pax_global_header00006660000000000000000000000064151235771120014516gustar00rootroot0000000000000052 comment=fe8740aa0679b67e13d2f1744bce5b61567d584e pgx-5.8.0/000077500000000000000000000000001512357711200123265ustar00rootroot00000000000000pgx-5.8.0/.github/000077500000000000000000000000001512357711200136665ustar00rootroot00000000000000pgx-5.8.0/.github/FUNDING.yml000066400000000000000000000000161512357711200155000ustar00rootroot00000000000000github: jackc pgx-5.8.0/.github/ISSUE_TEMPLATE/000077500000000000000000000000001512357711200160515ustar00rootroot00000000000000pgx-5.8.0/.github/ISSUE_TEMPLATE/bug_report.md000066400000000000000000000023551512357711200205500ustar00rootroot00000000000000--- name: Bug report about: Create a report to help us improve title: '' labels: bug assignees: '' --- **Describe the bug** A clear and concise description of what the bug is. **To Reproduce** Steps to reproduce the behavior: If possible, please provide runnable example such as: ```go package main import ( "context" "log" "os" "github.com/jackc/pgx/v5" ) func main() { conn, err := pgx.Connect(context.Background(), os.Getenv("DATABASE_URL")) if err != nil { log.Fatal(err) } defer conn.Close(context.Background()) // Your code here... } ``` Please run your example with the race detector enabled. For example, `go run -race main.go` or `go test -race`. **Expected behavior** A clear and concise description of what you expected to happen. **Actual behavior** A clear and concise description of what actually happened. **Version** - Go: `$ go version` -> [e.g. go version go1.18.3 darwin/amd64] - PostgreSQL: `$ psql --no-psqlrc --tuples-only -c 'select version()'` -> [e.g. PostgreSQL 14.4 on x86_64-apple-darwin21.5.0, compiled by Apple clang version 13.1.6 (clang-1316.0.21.2.5), 64-bit] - pgx: `$ grep 'github.com/jackc/pgx/v[0-9]' go.mod` -> [e.g. v4.16.1] **Additional context** Add any other context about the problem here. pgx-5.8.0/.github/ISSUE_TEMPLATE/feature_request.md000066400000000000000000000011231512357711200215730ustar00rootroot00000000000000--- name: Feature request about: Suggest an idea for this project title: '' labels: '' assignees: '' --- **Is your feature request related to a problem? Please describe.** A clear and concise description of what the problem is. Ex. I'm always frustrated when [...] **Describe the solution you'd like** A clear and concise description of what you want to happen. **Describe alternatives you've considered** A clear and concise description of any alternative solutions or features you've considered. **Additional context** Add any other context or screenshots about the feature request here. pgx-5.8.0/.github/ISSUE_TEMPLATE/other-issues.md000066400000000000000000000003501512357711200210230ustar00rootroot00000000000000--- name: Other issues about: Any issue that is not a bug or a feature request title: '' labels: '' assignees: '' --- Please describe the issue in detail. If this is a question about how to use pgx please use discussions instead. pgx-5.8.0/.github/workflows/000077500000000000000000000000001512357711200157235ustar00rootroot00000000000000pgx-5.8.0/.github/workflows/ci.yml000066400000000000000000000222461512357711200170470ustar00rootroot00000000000000name: CI on: push: branches: [master] pull_request: branches: [master] jobs: test: name: Test runs-on: ubuntu-22.04 strategy: matrix: go-version: ["1.24", "1.25"] pg-version: [14, 15, 16, 17, 18, cockroachdb] include: - pg-version: 14 pgx-test-database: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-unix-socket-conn-string: "host=/var/run/postgresql dbname=pgx_test" pgx-test-tcp-conn-string: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-scram-password-conn-string: "host=127.0.0.1 user=pgx_scram password=secret dbname=pgx_test" pgx-test-md5-password-conn-string: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-plain-password-conn-string: "host=127.0.0.1 user=pgx_pw password=secret dbname=pgx_test" pgx-test-tls-conn-string: "host=localhost user=pgx_ssl password=secret sslmode=verify-full sslrootcert=/tmp/ca.pem dbname=pgx_test" pgx-ssl-password: certpw pgx-test-tls-client-conn-string: "host=localhost user=pgx_sslcert sslmode=verify-full sslrootcert=/tmp/ca.pem sslcert=/tmp/pgx_sslcert.crt sslkey=/tmp/pgx_sslcert.key dbname=pgx_test" - pg-version: 15 pgx-test-database: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-unix-socket-conn-string: "host=/var/run/postgresql dbname=pgx_test" pgx-test-tcp-conn-string: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-scram-password-conn-string: "host=127.0.0.1 user=pgx_scram password=secret dbname=pgx_test" pgx-test-md5-password-conn-string: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-plain-password-conn-string: "host=127.0.0.1 user=pgx_pw password=secret dbname=pgx_test" pgx-test-tls-conn-string: "host=localhost user=pgx_ssl password=secret sslmode=verify-full sslrootcert=/tmp/ca.pem dbname=pgx_test" pgx-ssl-password: certpw pgx-test-tls-client-conn-string: "host=localhost user=pgx_sslcert sslmode=verify-full sslrootcert=/tmp/ca.pem sslcert=/tmp/pgx_sslcert.crt sslkey=/tmp/pgx_sslcert.key dbname=pgx_test" - pg-version: 16 pgx-test-database: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-unix-socket-conn-string: "host=/var/run/postgresql dbname=pgx_test" pgx-test-tcp-conn-string: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-scram-password-conn-string: "host=127.0.0.1 user=pgx_scram password=secret dbname=pgx_test" pgx-test-md5-password-conn-string: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-plain-password-conn-string: "host=127.0.0.1 user=pgx_pw password=secret dbname=pgx_test" pgx-test-tls-conn-string: "host=localhost user=pgx_ssl password=secret sslmode=verify-full sslrootcert=/tmp/ca.pem dbname=pgx_test" pgx-ssl-password: certpw pgx-test-tls-client-conn-string: "host=localhost user=pgx_sslcert sslmode=verify-full sslrootcert=/tmp/ca.pem sslcert=/tmp/pgx_sslcert.crt sslkey=/tmp/pgx_sslcert.key dbname=pgx_test" - pg-version: 17 pgx-test-database: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-unix-socket-conn-string: "host=/var/run/postgresql dbname=pgx_test" pgx-test-tcp-conn-string: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-scram-password-conn-string: "host=127.0.0.1 user=pgx_scram password=secret dbname=pgx_test" pgx-test-md5-password-conn-string: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-plain-password-conn-string: "host=127.0.0.1 user=pgx_pw password=secret dbname=pgx_test" pgx-test-tls-conn-string: "host=localhost user=pgx_ssl password=secret sslmode=verify-full sslrootcert=/tmp/ca.pem dbname=pgx_test" pgx-ssl-password: certpw pgx-test-tls-client-conn-string: "host=localhost user=pgx_sslcert sslmode=verify-full sslrootcert=/tmp/ca.pem sslcert=/tmp/pgx_sslcert.crt sslkey=/tmp/pgx_sslcert.key dbname=pgx_test" - pg-version: 18 pgx-test-database: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-unix-socket-conn-string: "host=/var/run/postgresql dbname=pgx_test" pgx-test-tcp-conn-string: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-scram-password-conn-string: "host=127.0.0.1 user=pgx_scram password=secret dbname=pgx_test" pgx-test-md5-password-conn-string: "host=127.0.0.1 user=pgx_md5 password=secret dbname=pgx_test" pgx-test-plain-password-conn-string: "host=127.0.0.1 user=pgx_pw password=secret dbname=pgx_test" pgx-test-tls-conn-string: "host=localhost user=pgx_ssl password=secret sslmode=verify-full sslrootcert=/tmp/ca.pem dbname=pgx_test" pgx-ssl-password: certpw pgx-test-tls-client-conn-string: "host=localhost user=pgx_sslcert sslmode=verify-full sslrootcert=/tmp/ca.pem sslcert=/tmp/pgx_sslcert.crt sslkey=/tmp/pgx_sslcert.key dbname=pgx_test" - pg-version: cockroachdb pgx-test-database: "postgresql://root@127.0.0.1:26257/pgx_test?sslmode=disable&experimental_enable_temp_tables=on" steps: - name: Check out code into the Go module directory uses: actions/checkout@v5 - name: Set up Go ${{ matrix.go-version }} uses: actions/setup-go@v6 with: go-version: ${{ matrix.go-version }} - name: Setup database server for testing run: ci/setup_test.bash env: PGVERSION: ${{ matrix.pg-version }} # - name: Setup upterm session # uses: lhotari/action-upterm@v1 # with: # ## limits ssh access and adds the ssh public key for the user which triggered the workflow # limit-access-to-actor: true # env: # PGX_TEST_DATABASE: ${{ matrix.pgx-test-database }} # PGX_TEST_UNIX_SOCKET_CONN_STRING: ${{ matrix.pgx-test-unix-socket-conn-string }} # PGX_TEST_TCP_CONN_STRING: ${{ matrix.pgx-test-tcp-conn-string }} # PGX_TEST_SCRAM_PASSWORD_CONN_STRING: ${{ matrix.pgx-test-scram-password-conn-string }} # PGX_TEST_MD5_PASSWORD_CONN_STRING: ${{ matrix.pgx-test-md5-password-conn-string }} # PGX_TEST_PLAIN_PASSWORD_CONN_STRING: ${{ matrix.pgx-test-plain-password-conn-string }} # PGX_TEST_TLS_CONN_STRING: ${{ matrix.pgx-test-tls-conn-string }} # PGX_SSL_PASSWORD: ${{ matrix.pgx-ssl-password }} # PGX_TEST_TLS_CLIENT_CONN_STRING: ${{ matrix.pgx-test-tls-client-conn-string }} - name: Check formatting run: | gofmt -l -s -w . git status git diff --exit-code - name: Test # parallel testing is disabled because somehow parallel testing causes Github Actions to kill the runner. run: go test -parallel=1 -race ./... env: PGX_TEST_DATABASE: ${{ matrix.pgx-test-database }} PGX_TEST_UNIX_SOCKET_CONN_STRING: ${{ matrix.pgx-test-unix-socket-conn-string }} PGX_TEST_TCP_CONN_STRING: ${{ matrix.pgx-test-tcp-conn-string }} PGX_TEST_SCRAM_PASSWORD_CONN_STRING: ${{ matrix.pgx-test-scram-password-conn-string }} PGX_TEST_MD5_PASSWORD_CONN_STRING: ${{ matrix.pgx-test-md5-password-conn-string }} PGX_TEST_PLAIN_PASSWORD_CONN_STRING: ${{ matrix.pgx-test-plain-password-conn-string }} # TestConnectTLS fails. However, it succeeds if I connect to the CI server with upterm and run it. Give up on that test for now. # PGX_TEST_TLS_CONN_STRING: ${{ matrix.pgx-test-tls-conn-string }} PGX_SSL_PASSWORD: ${{ matrix.pgx-ssl-password }} PGX_TEST_TLS_CLIENT_CONN_STRING: ${{ matrix.pgx-test-tls-client-conn-string }} test-windows: name: Test Windows runs-on: windows-latest strategy: matrix: go-version: ["1.24", "1.25"] steps: - name: Setup PostgreSQL id: postgres uses: ikalnytskyi/action-setup-postgres@v4 with: database: pgx_test - name: Check out code into the Go module directory uses: actions/checkout@v5 - name: Set up Go ${{ matrix.go-version }} uses: actions/setup-go@v6 with: go-version: ${{ matrix.go-version }} - name: Initialize test database run: | psql -f testsetup/postgresql_setup.sql pgx_test env: PGSERVICE: ${{ steps.postgres.outputs.service-name }} shell: bash - name: Test # Parallel testing is disabled because somehow parallel testing causes Github Actions to kill the runner. # Disabling CGO because that is not working on the Windows runner. Apparently, we could install MingW and set up # CGO to work, but disabling CGO takes less CI time. Without CGO, we also must not use the race detector. run: go test -parallel=1 ./... env: CGO_ENABLED: 0 PGX_TEST_DATABASE: ${{ steps.postgres.outputs.connection-uri }} pgx-5.8.0/.gitignore000066400000000000000000000004301512357711200143130ustar00rootroot00000000000000# Compiled Object files, Static and Dynamic libs (Shared Objects) *.o *.a *.so # Folders _obj _test # Architecture specific extensions/prefixes *.[568vq] [568vq].out *.cgo1.go *.cgo2.c _cgo_defun.c _cgo_gotypes.go _cgo_export.* _testmain.go *.exe .envrc /.testdb .DS_Store pgx-5.8.0/.golangci.yml000066400000000000000000000011641512357711200147140ustar00rootroot00000000000000# See for configurations: https://golangci-lint.run/usage/configuration/ version: 2 # See: https://golangci-lint.run/usage/formatters/ formatters: default: none enable: - gofmt # https://pkg.go.dev/cmd/gofmt - gofumpt # https://github.com/mvdan/gofumpt settings: gofmt: simplify: true # Simplify code: gofmt with `-s` option. gofumpt: # Module path which contains the source code being formatted. # Default: "" module-path: github.com/jackc/pgx/v5 # Should match with module in go.mod # Choose whether to use the extra rules. # Default: false extra-rules: true pgx-5.8.0/CHANGELOG.md000066400000000000000000000627761512357711200141610ustar00rootroot00000000000000# 5.8.0 (December 26, 2025) * Require Go 1.24+ * Remove golang.org/x/crypto dependency * Add OptionShouldPing to control ResetSession ping behavior (ilyam8) * Fix: Avoid overflow when MaxConns is set to MaxInt32 * Fix: Close batch pipeline after a query error (Anthonin Bonnefoy) * Faster shutdown of pgxpool.Pool background goroutines (Blake Gentry) * Add pgxpool ping timeout (Amirsalar Safaei) * Fix: Rows.FieldDescriptions for empty query * Scan unknown types into *any as string or []byte based on format code * Optimize pgtype.Numeric (Philip Dubé) * Add AfterNetConnect hook to pgconn.Config * Fix: Handle for preparing statements that fail during the Describe phase * Fix overflow in numeric scanning (Ilia Demianenko) * Fix: json/jsonb sql.Scanner source type is []byte * Migrate from math/rand to math/rand/v2 (Mathias Bogaert) * Optimize internal iobufpool (Mathias Bogaert) * Optimize stmtcache invalidation (Mathias Bogaert) * Fix: missing error case in interval parsing (Maxime Soulé) * Fix: invalidate statement/description cache in Exec (James Hartig) * ColumnTypeLength method return the type length for varbit type (DengChan) * Array and Composite codecs handle typed nils # 5.7.6 (September 8, 2025) * Use ParseConfigError in pgx.ParseConfig and pgxpool.ParseConfig (Yurasov Ilia) * Add PrepareConn hook to pgxpool (Jonathan Hall) * Reduce allocations in QueryContext (Dominique Lefevre) * Add MarshalJSON and UnmarshalJSON for pgtype.Uint32 (Panos Koutsovasilis) * Configure ping behavior on pgxpool with ShouldPing (Christian Kiely) * zeronull int types implement Int64Valuer and Int64Scanner (Li Zeghong) * Fix panic when receiving terminate connection message during CopyFrom (Michal Drausowski) * Fix statement cache not being invalidated on error during batch (Muhammadali Nazarov) # 5.7.5 (May 17, 2025) * Support sslnegotiation connection option (divyam234) * Update golang.org/x/crypto to v0.37.0. This placates security scanners that were unable to see that pgx did not use the behavior affected by https://pkg.go.dev/vuln/GO-2025-3487. * TraceLog now logs Acquire and Release at the debug level (dave sinclair) * Add support for PGTZ environment variable * Add support for PGOPTIONS environment variable * Unpin memory used by Rows quicker * Remove PlanScan memoization. This resolves a rare issue where scanning could be broken for one type by first scanning another. The problem was in the memoization system and benchmarking revealed that memoization was not providing any meaningful benefit. # 5.7.4 (March 24, 2025) * Fix / revert change to scanning JSON `null` (Felix Röhrich) # 5.7.3 (March 21, 2025) * Expose EmptyAcquireWaitTime in pgxpool.Stat (vamshiaruru32) * Improve SQL sanitizer performance (ninedraft) * Fix Scan confusion with json(b), sql.Scanner, and automatic dereferencing (moukoublen, felix-roehrich) * Fix Values() for xml type always returning nil instead of []byte * Add ability to send Flush message in pipeline mode (zenkovev) * Fix pgtype.Timestamp's JSON behavior to match PostgreSQL (pconstantinou) * Better error messages when scanning structs (logicbomb) * Fix handling of error on batch write (bonnefoa) * Match libpq's connection fallback behavior more closely (felix-roehrich) * Add MinIdleConns to pgxpool (djahandarie) # 5.7.2 (December 21, 2024) * Fix prepared statement already exists on batch prepare failure * Add commit query to tx options (Lucas Hild) * Fix pgtype.Timestamp json unmarshal (Shean de Montigny-Desautels) * Add message body size limits in frontend and backend (zene) * Add xid8 type * Ensure planning encodes and scans cannot infinitely recurse * Implement pgtype.UUID.String() (Konstantin Grachev) * Switch from ExecParams to Exec in ValidateConnectTargetSessionAttrs functions (Alexander Rumyantsev) * Update golang.org/x/crypto * Fix json(b) columns prefer sql.Scanner interface like database/sql (Ludovico Russo) # 5.7.1 (September 10, 2024) * Fix data race in tracelog.TraceLog * Update puddle to v2.2.2. This removes the import of nanotime via linkname. * Update golang.org/x/crypto and golang.org/x/text # 5.7.0 (September 7, 2024) * Add support for sslrootcert=system (Yann Soubeyrand) * Add LoadTypes to load multiple types in a single SQL query (Nick Farrell) * Add XMLCodec supports encoding + scanning XML column type like json (nickcruess-soda) * Add MultiTrace (Stepan Rabotkin) * Add TraceLogConfig with customizable TimeKey (stringintech) * pgx.ErrNoRows wraps sql.ErrNoRows to aid in database/sql compatibility with native pgx functions (merlin) * Support scanning binary formatted uint32 into string / TextScanner (jennifersp) * Fix interval encoding to allow 0s and avoid extra spaces (Carlos Pérez-Aradros Herce) * Update pgservicefile - fixes panic when parsing invalid file * Better error message when reading past end of batch * Don't print url when url.Parse returns an error (Kevin Biju) * Fix snake case name normalization collision in RowToStructByName with db tag (nolandseigler) * Fix: Scan and encode types with underlying types of arrays # 5.6.0 (May 25, 2024) * Add StrictNamedArgs (Tomas Zahradnicek) * Add support for macaddr8 type (Carlos Pérez-Aradros Herce) * Add SeverityUnlocalized field to PgError / Notice * Performance optimization of RowToStructByPos/Name (Zach Olstein) * Allow customizing context canceled behavior for pgconn * Add ScanLocation to pgtype.Timestamp[tz]Codec * Add custom data to pgconn.PgConn * Fix ResultReader.Read() to handle nil values * Do not encode interval microseconds when they are 0 (Carlos Pérez-Aradros Herce) * pgconn.SafeToRetry checks for wrapped errors (tjasko) * Failed connection attempts include all errors * Optimize LargeObject.Read (Mitar) * Add tracing for connection acquire and release from pool (ngavinsir) * Fix encode driver.Valuer not called when nil * Add support for custom JSON marshal and unmarshal (Mitar) * Use Go default keepalive for TCP connections (Hans-Joachim Kliemeck) # 5.5.5 (March 9, 2024) Use spaces instead of parentheses for SQL sanitization. This still solves the problem of negative numbers creating a line comment, but this avoids breaking edge cases such as `set foo to $1` where the substitution is taking place in a location where an arbitrary expression is not allowed. # 5.5.4 (March 4, 2024) Fix CVE-2024-27304 SQL injection can occur if an attacker can cause a single query or bind message to exceed 4 GB in size. An integer overflow in the calculated message size can cause the one large message to be sent as multiple messages under the attacker's control. Thanks to Paul Gerste for reporting this issue. * Fix behavior of CollectRows to return empty slice if Rows are empty (Felix) * Fix simple protocol encoding of json.RawMessage * Fix *Pipeline.getResults should close pipeline on error * Fix panic in TryFindUnderlyingTypeScanPlan (David Kurman) * Fix deallocation of invalidated cached statements in a transaction * Handle invalid sslkey file * Fix scan float4 into sql.Scanner * Fix pgtype.Bits not making copy of data from read buffer. This would cause the data to be corrupted by future reads. # 5.5.3 (February 3, 2024) * Fix: prepared statement already exists * Improve CopyFrom auto-conversion of text-ish values * Add ltree type support (Florent Viel) * Make some properties of Batch and QueuedQuery public (Pavlo Golub) * Add AppendRows function (Edoardo Spadolini) * Optimize convert UUID [16]byte to string (Kirill Malikov) * Fix: LargeObject Read and Write of more than ~1GB at a time (Mitar) # 5.5.2 (January 13, 2024) * Allow NamedArgs to start with underscore * pgproto3: Maximum message body length support (jeremy.spriet) * Upgrade golang.org/x/crypto to v0.17.0 * Add snake_case support to RowToStructByName (Tikhon Fedulov) * Fix: update description cache after exec prepare (James Hartig) * Fix: pipeline checks if it is closed (James Hartig and Ryan Fowler) * Fix: normalize timeout / context errors during TLS startup (Samuel Stauffer) * Add OnPgError for easier centralized error handling (James Hartig) # 5.5.1 (December 9, 2023) * Add CopyFromFunc helper function. (robford) * Add PgConn.Deallocate method that uses PostgreSQL protocol Close message. * pgx uses new PgConn.Deallocate method. This allows deallocating statements to work in a failed transaction. This fixes a case where the prepared statement map could become invalid. * Fix: Prefer driver.Valuer over json.Marshaler for json fields. (Jacopo) * Fix: simple protocol SQL sanitizer previously panicked if an invalid $0 placeholder was used. This now returns an error instead. (maksymnevajdev) * Add pgtype.Numeric.ScanScientific (Eshton Robateau) # 5.5.0 (November 4, 2023) * Add CollectExactlyOneRow. (Julien GOTTELAND) * Add OpenDBFromPool to create *database/sql.DB from *pgxpool.Pool. (Lev Zakharov) * Prepare can automatically choose statement name based on sql. This makes it easier to explicitly manage prepared statements. * Statement cache now uses deterministic, stable statement names. * database/sql prepared statement names are deterministically generated. * Fix: SendBatch wasn't respecting context cancellation. * Fix: Timeout error from pipeline is now normalized. * Fix: database/sql encoding json.RawMessage to []byte. * CancelRequest: Wait for the cancel request to be acknowledged by the server. This should improve PgBouncer compatibility. (Anton Levakin) * stdlib: Use Ping instead of CheckConn in ResetSession * Add json.Marshaler and json.Unmarshaler for Float4, Float8 (Kirill Mironov) # 5.4.3 (August 5, 2023) * Fix: QCharArrayOID was defined with the wrong OID (Christoph Engelbert) * Fix: connect_timeout for sslmode=allow|prefer (smaher-edb) * Fix: pgxpool: background health check cannot overflow pool * Fix: Check for nil in defer when sending batch (recover properly from panic) * Fix: json scan of non-string pointer to pointer * Fix: zeronull.Timestamptz should use pgtype.Timestamptz * Fix: NewConnsCount was not correctly counting connections created by Acquire directly. (James Hartig) * RowTo(AddrOf)StructByPos ignores fields with "-" db tag * Optimization: improve text format numeric parsing (horpto) # 5.4.2 (July 11, 2023) * Fix: RowScanner errors are fatal to Rows * Fix: Enable failover efforts when pg_hba.conf disallows non-ssl connections (Brandon Kauffman) * Hstore text codec internal improvements (Evan Jones) * Fix: Stop timers for background reader when not in use. Fixes memory leak when closing connections (Adrian-Stefan Mares) * Fix: Stop background reader as soon as possible. * Add PgConn.SyncConn(). This combined with the above fix makes it safe to directly use the underlying net.Conn. # 5.4.1 (June 18, 2023) * Fix: concurrency bug with pgtypeDefaultMap and simple protocol (Lev Zakharov) * Add TxOptions.BeginQuery to allow overriding the default BEGIN query # 5.4.0 (June 14, 2023) * Replace platform specific syscalls for non-blocking IO with more traditional goroutines and deadlines. This returns to the v4 approach with some additional improvements and fixes. This restores the ability to use a pgx.Conn over an ssh.Conn as well as other non-TCP or Unix socket connections. In addition, it is a significantly simpler implementation that is less likely to have cross platform issues. * Optimization: The default type registrations are now shared among all connections. This saves about 100KB of memory per connection. `pgtype.Type` and `pgtype.Codec` values are now required to be immutable after registration. This was already necessary in most cases but wasn't documented until now. (Lev Zakharov) * Fix: Ensure pgxpool.Pool.QueryRow.Scan releases connection on panic * CancelRequest: don't try to read the reply (Nicola Murino) * Fix: correctly handle bool type aliases (Wichert Akkerman) * Fix: pgconn.CancelRequest: Fix unix sockets: don't use RemoteAddr() * Fix: pgx.Conn memory leak with prepared statement caching (Evan Jones) * Add BeforeClose to pgxpool.Pool (Evan Cordell) * Fix: various hstore fixes and optimizations (Evan Jones) * Fix: RowToStructByPos with embedded unexported struct * Support different bool string representations (Lev Zakharov) * Fix: error when using BatchResults.Exec on a select that returns an error after some rows. * Fix: pipelineBatchResults.Exec() not returning error from ResultReader * Fix: pipeline batch results not closing pipeline when error occurs while reading directly from results instead of using a callback. * Fix: scanning a table type into a struct * Fix: scan array of record to pointer to slice of struct * Fix: handle null for json (Cemre Mengu) * Batch Query callback is called even when there is an error * Add RowTo(AddrOf)StructByNameLax (Audi P. Risa P) # 5.3.1 (February 27, 2023) * Fix: Support v4 and v5 stdlib in same program (Tomáš Procházka) * Fix: sql.Scanner not being used in certain cases * Add text format jsonpath support * Fix: fake non-blocking read adaptive wait time # 5.3.0 (February 11, 2023) * Fix: json values work with sql.Scanner * Fixed / improved error messages (Mark Chambers and Yevgeny Pats) * Fix: support scan into single dimensional arrays * Fix: MaxConnLifetimeJitter setting actually jitter (Ben Weintraub) * Fix: driver.Value representation of bytea should be []byte not string * Fix: better handling of unregistered OIDs * CopyFrom can use query cache to avoid extra round trip to get OIDs (Alejandro Do Nascimento Mora) * Fix: encode to json ignoring driver.Valuer * Support sql.Scanner on renamed base type * Fix: pgtype.Numeric text encoding of negative numbers (Mark Chambers) * Fix: connect with multiple hostnames when one can't be resolved * Upgrade puddle to remove dependency on uber/atomic and fix alignment issue on 32-bit platform * Fix: scanning json column into **string * Multiple reductions in memory allocations * Fake non-blocking read adapts its max wait time * Improve CopyFrom performance and reduce memory usage * Fix: encode []any to array * Fix: LoadType for composite with dropped attributes (Felix Röhrich) * Support v4 and v5 stdlib in same program * Fix: text format array decoding with string of "NULL" * Prefer binary format for arrays # 5.2.0 (December 5, 2022) * `tracelog.TraceLog` implements the pgx.PrepareTracer interface. (Vitalii Solodilov) * Optimize creating begin transaction SQL string (Petr Evdokimov and ksco) * `Conn.LoadType` supports range and multirange types (Vitalii Solodilov) * Fix scan `uint` and `uint64` `ScanNumeric`. This resolves a PostgreSQL `numeric` being incorrectly scanned into `uint` and `uint64`. # 5.1.1 (November 17, 2022) * Fix simple query sanitizer where query text contains a Unicode replacement character. * Remove erroneous `name` argument from `DeallocateAll()`. Technically, this is a breaking change, but given that method was only added 5 days ago this change was accepted. (Bodo Kaiser) # 5.1.0 (November 12, 2022) * Update puddle to v2.1.2. This resolves a race condition and a deadlock in pgxpool. * `QueryRewriter.RewriteQuery` now returns an error. Technically, this is a breaking change for any external implementers, but given the minimal likelihood that there are actually any external implementers this change was accepted. * Expose `GetSSLPassword` support to pgx. * Fix encode `ErrorResponse` unknown field handling. This would only affect pgproto3 being used directly as a proxy with a non-PostgreSQL server that included additional error fields. * Fix date text format encoding with 5 digit years. * Fix date values passed to a `sql.Scanner` as `string` instead of `time.Time`. * DateCodec.DecodeValue can return `pgtype.InfinityModifier` instead of `string` for infinite values. This now matches the behavior of the timestamp types. * Add domain type support to `Conn.LoadType()`. * Add `RowToStructByName` and `RowToAddrOfStructByName`. (Pavlo Golub) * Add `Conn.DeallocateAll()` to clear all prepared statements including the statement cache. (Bodo Kaiser) # 5.0.4 (October 24, 2022) * Fix: CollectOneRow prefers PostgreSQL error over pgx.ErrorNoRows * Fix: some reflect Kind checks to first check for nil * Bump golang.org/x/text dependency to placate snyk * Fix: RowToStructByPos on structs with multiple anonymous sub-structs (Baptiste Fontaine) * Fix: Exec checks if tx is closed # 5.0.3 (October 14, 2022) * Fix `driver.Valuer` handling edge cases that could cause infinite loop or crash # v5.0.2 (October 8, 2022) * Fix date encoding in text format to always use 2 digits for month and day * Prefer driver.Valuer over wrap plans when encoding * Fix scan to pointer to pointer to renamed type * Allow scanning NULL even if PG and Go types are incompatible # v5.0.1 (September 24, 2022) * Fix 32-bit atomic usage * Add MarshalJSON for Float8 (yogipristiawan) * Add `[` and `]` to text encoding of `Lseg` * Fix sqlScannerWrapper NULL handling # v5.0.0 (September 17, 2022) ## Merged Packages `github.com/jackc/pgtype`, `github.com/jackc/pgconn`, and `github.com/jackc/pgproto3` are now included in the main `github.com/jackc/pgx` repository. Previously there was confusion as to where issues should be reported, additional release work due to releasing multiple packages, and less clear changelogs. ## pgconn `CommandTag` is now an opaque type instead of directly exposing an underlying `[]byte`. The return value `ResultReader.Values()` is no longer safe to retain a reference to after a subsequent call to `NextRow()` or `Close()`. `Trace()` method adds low level message tracing similar to the `PQtrace` function in `libpq`. pgconn now uses non-blocking IO. This is a significant internal restructuring, but it should not cause any visible changes on its own. However, it is important in implementing other new features. `CheckConn()` checks a connection's liveness by doing a non-blocking read. This can be used to detect database restarts or network interruptions without executing a query or a ping. pgconn now supports pipeline mode. `*PgConn.ReceiveResults` removed. Use pipeline mode instead. `Timeout()` no longer considers `context.Canceled` as a timeout error. `context.DeadlineExceeded` still is considered a timeout error. ## pgxpool `Connect` and `ConnectConfig` have been renamed to `New` and `NewWithConfig` respectively. The `LazyConnect` option has been removed. Pools always lazily connect. ## pgtype The `pgtype` package has been significantly changed. ### NULL Representation Previously, types had a `Status` field that could be `Undefined`, `Null`, or `Present`. This has been changed to a `Valid` `bool` field to harmonize with how `database/sql` represents `NULL` and to make the zero value useable. Previously, a type that implemented `driver.Valuer` would have the `Value` method called even on a nil pointer. All nils whether typed or untyped now represent `NULL`. ### Codec and Value Split Previously, the type system combined decoding and encoding values with the value types. e.g. Type `Int8` both handled encoding and decoding the PostgreSQL representation and acted as a value object. This caused some difficulties when there was not an exact 1 to 1 relationship between the Go types and the PostgreSQL types For example, scanning a PostgreSQL binary `numeric` into a Go `float64` was awkward (see https://github.com/jackc/pgtype/issues/147). This concepts have been separated. A `Codec` only has responsibility for encoding and decoding values. Value types are generally defined by implementing an interface that a particular `Codec` understands (e.g. `PointScanner` and `PointValuer` for the PostgreSQL `point` type). ### Array Types All array types are now handled by `ArrayCodec` instead of using code generation for each new array type. This also means that less common array types such as `point[]` are now supported. `Array[T]` supports PostgreSQL multi-dimensional arrays. ### Composite Types Composite types must be registered before use. `CompositeFields` may still be used to construct and destruct composite values, but any type may now implement `CompositeIndexGetter` and `CompositeIndexScanner` to be used as a composite. ### Range Types Range types are now handled with types `RangeCodec` and `Range[T]`. This allows additional user defined range types to easily be handled. Multirange types are handled similarly with `MultirangeCodec` and `Multirange[T]`. ### pgxtype `LoadDataType` moved to `*Conn` as `LoadType`. ### Bytea The `Bytea` and `GenericBinary` types have been replaced. Use the following instead: * `[]byte` - For normal usage directly use `[]byte`. * `DriverBytes` - Uses driver memory only available until next database method call. Avoids a copy and an allocation. * `PreallocBytes` - Uses preallocated byte slice to avoid an allocation. * `UndecodedBytes` - Avoids any decoding. Allows working with raw bytes. ### Dropped lib/pq Support `pgtype` previously supported and was tested against [lib/pq](https://github.com/lib/pq). While it will continue to work in most cases this is no longer supported. ### database/sql Scan Previously, most `Scan` implementations would convert `[]byte` to `string` automatically to decode a text value. Now only `string` is handled. This is to allow the possibility of future binary support in `database/sql` mode by considering `[]byte` to be binary format and `string` text format. This change should have no effect for any use with `pgx`. The previous behavior was only necessary for `lib/pq` compatibility. Added `*Map.SQLScanner` to create a `sql.Scanner` for types such as `[]int32` and `Range[T]` that do not implement `sql.Scanner` directly. ### Number Type Fields Include Bit size `Int2`, `Int4`, `Int8`, `Float4`, `Float8`, and `Uint32` fields now include bit size. e.g. `Int` is renamed to `Int64`. This matches the convention set by `database/sql`. In addition, for comparable types like `pgtype.Int8` and `sql.NullInt64` the structures are identical. This means they can be directly converted one to another. ### 3rd Party Type Integrations * Extracted integrations with https://github.com/shopspring/decimal and https://github.com/gofrs/uuid to https://github.com/jackc/pgx-shopspring-decimal and https://github.com/jackc/pgx-gofrs-uuid respectively. This trims the pgx dependency tree. ### Other Changes * `Bit` and `Varbit` are both replaced by the `Bits` type. * `CID`, `OID`, `OIDValue`, and `XID` are replaced by the `Uint32` type. * `Hstore` is now defined as `map[string]*string`. * `JSON` and `JSONB` types removed. Use `[]byte` or `string` directly. * `QChar` type removed. Use `rune` or `byte` directly. * `Inet` and `Cidr` types removed. Use `netip.Addr` and `netip.Prefix` directly. These types are more memory efficient than the previous `net.IPNet`. * `Macaddr` type removed. Use `net.HardwareAddr` directly. * Renamed `pgtype.ConnInfo` to `pgtype.Map`. * Renamed `pgtype.DataType` to `pgtype.Type`. * Renamed `pgtype.None` to `pgtype.Finite`. * `RegisterType` now accepts a `*Type` instead of `Type`. * Assorted array helper methods and types made private. ## stdlib * Removed `AcquireConn` and `ReleaseConn` as that functionality has been built in since Go 1.13. ## Reduced Memory Usage by Reusing Read Buffers Previously, the connection read buffer would allocate large chunks of memory and never reuse them. This allowed transferring ownership to anything such as scanned values without incurring an additional allocation and memory copy. However, this came at the cost of overall increased memory allocation size. But worse it was also possible to pin large chunks of memory by retaining a reference to a small value that originally came directly from the read buffer. Now ownership remains with the read buffer and anything needing to retain a value must make a copy. ## Query Execution Modes Control over automatic prepared statement caching and simple protocol use are now combined into query execution mode. See documentation for `QueryExecMode`. ## QueryRewriter Interface and NamedArgs pgx now supports named arguments with the `NamedArgs` type. This is implemented via the new `QueryRewriter` interface which allows arbitrary rewriting of query SQL and arguments. ## RowScanner Interface The `RowScanner` interface allows a single argument to Rows.Scan to scan the entire row. ## Rows Result Helpers * `CollectRows` and `RowTo*` functions simplify collecting results into a slice. * `CollectOneRow` collects one row using `RowTo*` functions. * `ForEachRow` simplifies scanning each row and executing code using the scanned values. `ForEachRow` replaces `QueryFunc`. ## Tx Helpers Rather than every type that implemented `Begin` or `BeginTx` methods also needing to implement `BeginFunc` and `BeginTxFunc` these methods have been converted to functions that take a db that implements `Begin` or `BeginTx`. ## Improved Batch Query Ergonomics Previously, the code for building a batch went in one place before the call to `SendBatch`, and the code for reading the results went in one place after the call to `SendBatch`. This could make it difficult to match up the query and the code to handle the results. Now `Queue` returns a `QueuedQuery` which has methods `Query`, `QueryRow`, and `Exec` which can be used to register a callback function that will handle the result. Callback functions are called automatically when `BatchResults.Close` is called. ## SendBatch Uses Pipeline Mode When Appropriate Previously, a batch with 10 unique parameterized statements executed 100 times would entail 11 network round trips. 1 for each prepare / describe and 1 for executing them all. Now pipeline mode is used to prepare / describe all statements in a single network round trip. So it would only take 2 round trips. ## Tracing and Logging Internal logging support has been replaced with tracing hooks. This allows custom tracing integration with tools like OpenTelemetry. Package tracelog provides an adapter for pgx v4 loggers to act as a tracer. All integrations with 3rd party loggers have been extracted to separate repositories. This trims the pgx dependency tree. pgx-5.8.0/CONTRIBUTING.md000066400000000000000000000112751512357711200145650ustar00rootroot00000000000000# Contributing ## Discuss Significant Changes Before you invest a significant amount of time on a change, please create a discussion or issue describing your proposal. This will help to ensure your proposed change has a reasonable chance of being merged. ## Avoid Dependencies Adding a dependency is a big deal. While on occasion a new dependency may be accepted, the default answer to any change that adds a dependency is no. ## Development Environment Setup pgx tests naturally require a PostgreSQL database. It will connect to the database specified in the `PGX_TEST_DATABASE` environment variable. The `PGX_TEST_DATABASE` environment variable can either be a URL or key-value pairs. In addition, the standard `PG*` environment variables will be respected. Consider using [direnv](https://github.com/direnv/direnv) to simplify environment variable handling. ### Using an Existing PostgreSQL Cluster If you already have a PostgreSQL development server this is the quickest way to start and run the majority of the pgx test suite. Some tests will be skipped that require server configuration changes (e.g. those testing different authentication methods). Create and setup a test database: ``` export PGDATABASE=pgx_test createdb psql -c 'create extension hstore;' psql -c 'create extension ltree;' psql -c 'create domain uint64 as numeric(20,0);' ``` Ensure a `postgres` user exists. This happens by default in normal PostgreSQL installs, but some installation methods such as Homebrew do not. ``` createuser -s postgres ``` Ensure your `PGX_TEST_DATABASE` environment variable points to the database you just created and run the tests. ``` export PGX_TEST_DATABASE="host=/private/tmp database=pgx_test" go test ./... ``` This will run the vast majority of the tests, but some tests will be skipped (e.g. those testing different connection methods). ### Creating a New PostgreSQL Cluster Exclusively for Testing The following environment variables need to be set both for initial setup and whenever the tests are run. (direnv is highly recommended). Depending on your platform, you may need to change the host for `PGX_TEST_UNIX_SOCKET_CONN_STRING`. ``` export PGPORT=5015 export PGUSER=postgres export PGDATABASE=pgx_test export POSTGRESQL_DATA_DIR=postgresql export PGX_TEST_DATABASE="host=127.0.0.1 database=pgx_test user=pgx_md5 password=secret" export PGX_TEST_UNIX_SOCKET_CONN_STRING="host=/private/tmp database=pgx_test" export PGX_TEST_TCP_CONN_STRING="host=127.0.0.1 database=pgx_test user=pgx_md5 password=secret" export PGX_TEST_SCRAM_PASSWORD_CONN_STRING="host=127.0.0.1 user=pgx_scram password=secret database=pgx_test" export PGX_TEST_MD5_PASSWORD_CONN_STRING="host=127.0.0.1 database=pgx_test user=pgx_md5 password=secret" export PGX_TEST_PLAIN_PASSWORD_CONN_STRING="host=127.0.0.1 user=pgx_pw password=secret" export PGX_TEST_TLS_CONN_STRING="host=localhost user=pgx_ssl password=secret sslmode=verify-full sslrootcert=`pwd`/.testdb/ca.pem" export PGX_SSL_PASSWORD=certpw export PGX_TEST_TLS_CLIENT_CONN_STRING="host=localhost user=pgx_sslcert sslmode=verify-full sslrootcert=`pwd`/.testdb/ca.pem database=pgx_test sslcert=`pwd`/.testdb/pgx_sslcert.crt sslkey=`pwd`/.testdb/pgx_sslcert.key" ``` Create a new database cluster. ``` initdb --locale=en_US -E UTF-8 --username=postgres .testdb/$POSTGRESQL_DATA_DIR echo "listen_addresses = '127.0.0.1'" >> .testdb/$POSTGRESQL_DATA_DIR/postgresql.conf echo "port = $PGPORT" >> .testdb/$POSTGRESQL_DATA_DIR/postgresql.conf cat testsetup/postgresql_ssl.conf >> .testdb/$POSTGRESQL_DATA_DIR/postgresql.conf cp testsetup/pg_hba.conf .testdb/$POSTGRESQL_DATA_DIR/pg_hba.conf cd .testdb # Generate CA, server, and encrypted client certificates. go run ../testsetup/generate_certs.go # Copy certificates to server directory and set permissions. cp ca.pem $POSTGRESQL_DATA_DIR/root.crt cp localhost.key $POSTGRESQL_DATA_DIR/server.key chmod 600 $POSTGRESQL_DATA_DIR/server.key cp localhost.crt $POSTGRESQL_DATA_DIR/server.crt cd .. ``` Start the new cluster. This will be necessary whenever you are running pgx tests. ``` postgres -D .testdb/$POSTGRESQL_DATA_DIR ``` Setup the test database in the new cluster. ``` createdb psql --no-psqlrc -f testsetup/postgresql_setup.sql ``` ### PgBouncer There are tests specific for PgBouncer that will be executed if `PGX_TEST_PGBOUNCER_CONN_STRING` is set. ### Optional Tests pgx supports multiple connection types and means of authentication. These tests are optional. They will only run if the appropriate environment variables are set. In addition, there may be tests specific to particular PostgreSQL versions, non-PostgreSQL servers (e.g. CockroachDB), or connection poolers (e.g. PgBouncer). `go test ./... -v | grep SKIP` to see if any tests are being skipped. pgx-5.8.0/LICENSE000066400000000000000000000020661512357711200133370ustar00rootroot00000000000000Copyright (c) 2013-2021 Jack Christensen MIT License Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. pgx-5.8.0/README.md000066400000000000000000000175611512357711200136170ustar00rootroot00000000000000[![Go Reference](https://pkg.go.dev/badge/github.com/jackc/pgx/v5.svg)](https://pkg.go.dev/github.com/jackc/pgx/v5) [![Build Status](https://github.com/jackc/pgx/actions/workflows/ci.yml/badge.svg)](https://github.com/jackc/pgx/actions/workflows/ci.yml) # pgx - PostgreSQL Driver and Toolkit pgx is a pure Go driver and toolkit for PostgreSQL. The pgx driver is a low-level, high performance interface that exposes PostgreSQL-specific features such as `LISTEN` / `NOTIFY` and `COPY`. It also includes an adapter for the standard `database/sql` interface. The toolkit component is a related set of packages that implement PostgreSQL functionality such as parsing the wire protocol and type mapping between PostgreSQL and Go. These underlying packages can be used to implement alternative drivers, proxies, load balancers, logical replication clients, etc. ## Example Usage ```go package main import ( "context" "fmt" "os" "github.com/jackc/pgx/v5" ) func main() { // urlExample := "postgres://username:password@localhost:5432/database_name" conn, err := pgx.Connect(context.Background(), os.Getenv("DATABASE_URL")) if err != nil { fmt.Fprintf(os.Stderr, "Unable to connect to database: %v\n", err) os.Exit(1) } defer conn.Close(context.Background()) var name string var weight int64 err = conn.QueryRow(context.Background(), "select name, weight from widgets where id=$1", 42).Scan(&name, &weight) if err != nil { fmt.Fprintf(os.Stderr, "QueryRow failed: %v\n", err) os.Exit(1) } fmt.Println(name, weight) } ``` See the [getting started guide](https://github.com/jackc/pgx/wiki/Getting-started-with-pgx) for more information. ## Features * Support for approximately 70 different PostgreSQL types * Automatic statement preparation and caching * Batch queries * Single-round trip query mode * Full TLS connection control * Binary format support for custom types (allows for much quicker encoding/decoding) * `COPY` protocol support for faster bulk data loads * Tracing and logging support * Connection pool with after-connect hook for arbitrary connection setup * `LISTEN` / `NOTIFY` * Conversion of PostgreSQL arrays to Go slice mappings for integers, floats, and strings * `hstore` support * `json` and `jsonb` support * Maps `inet` and `cidr` PostgreSQL types to `netip.Addr` and `netip.Prefix` * Large object support * NULL mapping to pointer to pointer * Supports `database/sql.Scanner` and `database/sql/driver.Valuer` interfaces for custom types * Notice response handling * Simulated nested transactions with savepoints ## Choosing Between the pgx and database/sql Interfaces The pgx interface is faster. Many PostgreSQL specific features such as `LISTEN` / `NOTIFY` and `COPY` are not available through the `database/sql` interface. The pgx interface is recommended when: 1. The application only targets PostgreSQL. 2. No other libraries that require `database/sql` are in use. It is also possible to use the `database/sql` interface and convert a connection to the lower-level pgx interface as needed. ## Testing See [CONTRIBUTING.md](./CONTRIBUTING.md) for setup instructions. ## Architecture See the presentation at Golang Estonia, [PGX Top to Bottom](https://www.youtube.com/watch?v=sXMSWhcHCf8) for a description of pgx architecture. ## Supported Go and PostgreSQL Versions pgx supports the same versions of Go and PostgreSQL that are supported by their respective teams. For [Go](https://golang.org/doc/devel/release.html#policy) that is the two most recent major releases and for [PostgreSQL](https://www.postgresql.org/support/versioning/) the major releases in the last 5 years. This means pgx supports Go 1.24 and higher and PostgreSQL 13 and higher. pgx also is tested against the latest version of [CockroachDB](https://www.cockroachlabs.com/product/). ## Version Policy pgx follows semantic versioning for the documented public API on stable releases. `v5` is the latest stable major version. ## PGX Family Libraries ### [github.com/jackc/pglogrepl](https://github.com/jackc/pglogrepl) pglogrepl provides functionality to act as a client for PostgreSQL logical replication. ### [github.com/jackc/pgmock](https://github.com/jackc/pgmock) pgmock offers the ability to create a server that mocks the PostgreSQL wire protocol. This is used internally to test pgx by purposely inducing unusual errors. pgproto3 and pgmock together provide most of the foundational tooling required to implement a PostgreSQL proxy or MitM (such as for a custom connection pooler). ### [github.com/jackc/tern](https://github.com/jackc/tern) tern is a stand-alone SQL migration system. ### [github.com/jackc/pgerrcode](https://github.com/jackc/pgerrcode) pgerrcode contains constants for the PostgreSQL error codes. ## Adapters for 3rd Party Types * [github.com/jackc/pgx-gofrs-uuid](https://github.com/jackc/pgx-gofrs-uuid) * [github.com/jackc/pgx-shopspring-decimal](https://github.com/jackc/pgx-shopspring-decimal) * [github.com/twpayne/pgx-geos](https://github.com/twpayne/pgx-geos) ([PostGIS](https://postgis.net/) and [GEOS](https://libgeos.org/) via [go-geos](https://github.com/twpayne/go-geos)) * [github.com/vgarvardt/pgx-google-uuid](https://github.com/vgarvardt/pgx-google-uuid) ## Adapters for 3rd Party Tracers * [github.com/jackhopner/pgx-xray-tracer](https://github.com/jackhopner/pgx-xray-tracer) * [github.com/exaring/otelpgx](https://github.com/exaring/otelpgx) ## Adapters for 3rd Party Loggers These adapters can be used with the tracelog package. * [github.com/jackc/pgx-go-kit-log](https://github.com/jackc/pgx-go-kit-log) * [github.com/jackc/pgx-log15](https://github.com/jackc/pgx-log15) * [github.com/jackc/pgx-logrus](https://github.com/jackc/pgx-logrus) * [github.com/jackc/pgx-zap](https://github.com/jackc/pgx-zap) * [github.com/jackc/pgx-zerolog](https://github.com/jackc/pgx-zerolog) * [github.com/mcosta74/pgx-slog](https://github.com/mcosta74/pgx-slog) * [github.com/kataras/pgx-golog](https://github.com/kataras/pgx-golog) ## 3rd Party Libraries with PGX Support ### [github.com/pashagolub/pgxmock](https://github.com/pashagolub/pgxmock) pgxmock is a mock library implementing pgx interfaces. pgxmock has one and only purpose - to simulate pgx behavior in tests, without needing a real database connection. ### [github.com/georgysavva/scany](https://github.com/georgysavva/scany) Library for scanning data from a database into Go structs and more. ### [github.com/vingarcia/ksql](https://github.com/vingarcia/ksql) A carefully designed SQL client for making using SQL easier, more productive, and less error-prone on Golang. ### [github.com/otan/gopgkrb5](https://github.com/otan/gopgkrb5) Adds GSSAPI / Kerberos authentication support. ### [github.com/wcamarao/pmx](https://github.com/wcamarao/pmx) Explicit data mapping and scanning library for Go structs and slices. ### [github.com/stephenafamo/scan](https://github.com/stephenafamo/scan) Type safe and flexible package for scanning database data into Go types. Supports, structs, maps, slices and custom mapping functions. ### [github.com/z0ne-dev/mgx](https://github.com/z0ne-dev/mgx) Code first migration library for native pgx (no database/sql abstraction). ### [github.com/amirsalarsafaei/sqlc-pgx-monitoring](https://github.com/amirsalarsafaei/sqlc-pgx-monitoring) A database monitoring/metrics library for pgx and sqlc. Trace, log and monitor your sqlc query performance using OpenTelemetry. ### [https://github.com/nikolayk812/pgx-outbox](https://github.com/nikolayk812/pgx-outbox) Simple Golang implementation for transactional outbox pattern for PostgreSQL using jackc/pgx driver. ### [https://github.com/Arlandaren/pgxWrappy](https://github.com/Arlandaren/pgxWrappy) Simplifies working with the pgx library, providing convenient scanning of nested structures. ### [https://github.com/KoNekoD/pgx-colon-query-rewriter](https://github.com/KoNekoD/pgx-colon-query-rewriter) Implementation of the pgx query rewriter to use ':' instead of '@' in named query parameters. pgx-5.8.0/Rakefile000066400000000000000000000007171512357711200140000ustar00rootroot00000000000000require "erb" rule '.go' => '.go.erb' do |task| erb = ERB.new(File.read(task.source)) File.write(task.name, "// Code generated from #{task.source}. DO NOT EDIT.\n\n" + erb.result(binding)) sh "goimports", "-w", task.name end generated_code_files = [ "pgtype/int.go", "pgtype/int_test.go", "pgtype/integration_benchmark_test.go", "pgtype/zeronull/int.go", "pgtype/zeronull/int_test.go" ] desc "Generate code" task generate: generated_code_files pgx-5.8.0/batch.go000066400000000000000000000331241512357711200137410ustar00rootroot00000000000000package pgx import ( "context" "errors" "fmt" "github.com/jackc/pgx/v5/pgconn" ) // QueuedQuery is a query that has been queued for execution via a Batch. type QueuedQuery struct { SQL string Arguments []any Fn batchItemFunc sd *pgconn.StatementDescription } type batchItemFunc func(br BatchResults) error // Query sets fn to be called when the response to qq is received. func (qq *QueuedQuery) Query(fn func(rows Rows) error) { qq.Fn = func(br BatchResults) error { rows, _ := br.Query() defer rows.Close() err := fn(rows) if err != nil { return err } rows.Close() return rows.Err() } } // Query sets fn to be called when the response to qq is received. func (qq *QueuedQuery) QueryRow(fn func(row Row) error) { qq.Fn = func(br BatchResults) error { row := br.QueryRow() return fn(row) } } // Exec sets fn to be called when the response to qq is received. // // Note: for simple batch insert uses where it is not required to handle // each potential error individually, it's sufficient to not set any callbacks, // and just handle the return value of BatchResults.Close. func (qq *QueuedQuery) Exec(fn func(ct pgconn.CommandTag) error) { qq.Fn = func(br BatchResults) error { ct, err := br.Exec() if err != nil { return err } return fn(ct) } } // Batch queries are a way of bundling multiple queries together to avoid // unnecessary network round trips. A Batch must only be sent once. type Batch struct { QueuedQueries []*QueuedQuery } // Queue queues a query to batch b. query can be an SQL query or the name of a prepared statement. The only pgx option // argument that is supported is QueryRewriter. Queries are executed using the connection's DefaultQueryExecMode. // // While query can contain multiple statements if the connection's DefaultQueryExecMode is QueryModeSimple, this should // be avoided. QueuedQuery.Fn must not be set as it will only be called for the first query. That is, QueuedQuery.Query, // QueuedQuery.QueryRow, and QueuedQuery.Exec must not be called. In addition, any error messages or tracing that // include the current query may reference the wrong query. func (b *Batch) Queue(query string, arguments ...any) *QueuedQuery { qq := &QueuedQuery{ SQL: query, Arguments: arguments, } b.QueuedQueries = append(b.QueuedQueries, qq) return qq } // Len returns number of queries that have been queued so far. func (b *Batch) Len() int { return len(b.QueuedQueries) } type BatchResults interface { // Exec reads the results from the next query in the batch as if the query has been sent with Conn.Exec. Prefer // calling Exec on the QueuedQuery, or just calling Close. Exec() (pgconn.CommandTag, error) // Query reads the results from the next query in the batch as if the query has been sent with Conn.Query. Prefer // calling Query on the QueuedQuery. Query() (Rows, error) // QueryRow reads the results from the next query in the batch as if the query has been sent with Conn.QueryRow. // Prefer calling QueryRow on the QueuedQuery. QueryRow() Row // Close closes the batch operation. All unread results are read and any callback functions registered with // QueuedQuery.Query, QueuedQuery.QueryRow, or QueuedQuery.Exec will be called. If a callback function returns an // error or the batch encounters an error subsequent callback functions will not be called. // // For simple batch inserts inside a transaction or similar queries, it's sufficient to not set any callbacks, // and just handle the return value of Close. // // Close must be called before the underlying connection can be used again. Any error that occurred during a batch // operation may have made it impossible to resyncronize the connection with the server. In this case the underlying // connection will have been closed. // // Close is safe to call multiple times. If it returns an error subsequent calls will return the same error. Callback // functions will not be rerun. Close() error } type batchResults struct { ctx context.Context conn *Conn mrr *pgconn.MultiResultReader err error b *Batch qqIdx int closed bool endTraced bool } // Exec reads the results from the next query in the batch as if the query has been sent with Exec. func (br *batchResults) Exec() (pgconn.CommandTag, error) { if br.err != nil { return pgconn.CommandTag{}, br.err } if br.closed { return pgconn.CommandTag{}, fmt.Errorf("batch already closed") } query, arguments, _ := br.nextQueryAndArgs() if !br.mrr.NextResult() { err := br.mrr.Close() if err == nil { err = errors.New("no more results in batch") } if br.conn.batchTracer != nil { br.conn.batchTracer.TraceBatchQuery(br.ctx, br.conn, TraceBatchQueryData{ SQL: query, Args: arguments, Err: err, }) } return pgconn.CommandTag{}, err } commandTag, err := br.mrr.ResultReader().Close() if err != nil { br.err = err br.mrr.Close() } if br.conn.batchTracer != nil { br.conn.batchTracer.TraceBatchQuery(br.ctx, br.conn, TraceBatchQueryData{ SQL: query, Args: arguments, CommandTag: commandTag, Err: br.err, }) } return commandTag, br.err } // Query reads the results from the next query in the batch as if the query has been sent with Query. func (br *batchResults) Query() (Rows, error) { query, arguments, ok := br.nextQueryAndArgs() if !ok { query = "batch query" } if br.err != nil { return &baseRows{err: br.err, closed: true}, br.err } if br.closed { alreadyClosedErr := fmt.Errorf("batch already closed") return &baseRows{err: alreadyClosedErr, closed: true}, alreadyClosedErr } rows := br.conn.getRows(br.ctx, query, arguments) rows.batchTracer = br.conn.batchTracer if !br.mrr.NextResult() { rows.err = br.mrr.Close() if rows.err == nil { rows.err = errors.New("no more results in batch") } rows.closed = true if br.conn.batchTracer != nil { br.conn.batchTracer.TraceBatchQuery(br.ctx, br.conn, TraceBatchQueryData{ SQL: query, Args: arguments, Err: rows.err, }) } return rows, rows.err } rows.resultReader = br.mrr.ResultReader() return rows, nil } // QueryRow reads the results from the next query in the batch as if the query has been sent with QueryRow. func (br *batchResults) QueryRow() Row { rows, _ := br.Query() return (*connRow)(rows.(*baseRows)) } // Close closes the batch operation. Any error that occurred during a batch operation may have made it impossible to // resyncronize the connection with the server. In this case the underlying connection will have been closed. func (br *batchResults) Close() error { defer func() { if !br.endTraced { if br.conn != nil && br.conn.batchTracer != nil { br.conn.batchTracer.TraceBatchEnd(br.ctx, br.conn, TraceBatchEndData{Err: br.err}) } br.endTraced = true } invalidateCachesOnBatchResultsError(br.conn, br.b, br.err) }() if br.err != nil { return br.err } if br.closed { return nil } // Read and run fn for all remaining items for br.err == nil && !br.closed && br.b != nil && br.qqIdx < len(br.b.QueuedQueries) { if br.b.QueuedQueries[br.qqIdx].Fn != nil { err := br.b.QueuedQueries[br.qqIdx].Fn(br) if err != nil { br.err = err } } else { br.Exec() } } br.closed = true err := br.mrr.Close() if br.err == nil { br.err = err } return br.err } func (br *batchResults) earlyError() error { return br.err } func (br *batchResults) nextQueryAndArgs() (query string, args []any, ok bool) { if br.b != nil && br.qqIdx < len(br.b.QueuedQueries) { bi := br.b.QueuedQueries[br.qqIdx] query = bi.SQL args = bi.Arguments ok = true br.qqIdx++ } return } type pipelineBatchResults struct { ctx context.Context conn *Conn pipeline *pgconn.Pipeline lastRows *baseRows err error b *Batch qqIdx int closed bool endTraced bool } // Exec reads the results from the next query in the batch as if the query has been sent with Exec. func (br *pipelineBatchResults) Exec() (pgconn.CommandTag, error) { if br.err != nil { return pgconn.CommandTag{}, br.err } if br.closed { return pgconn.CommandTag{}, fmt.Errorf("batch already closed") } if br.lastRows != nil && br.lastRows.err != nil { return pgconn.CommandTag{}, br.err } query, arguments, err := br.nextQueryAndArgs() if err != nil { return pgconn.CommandTag{}, err } results, err := br.pipeline.GetResults() if err != nil { br.err = err return pgconn.CommandTag{}, br.err } var commandTag pgconn.CommandTag switch results := results.(type) { case *pgconn.ResultReader: commandTag, br.err = results.Close() default: return pgconn.CommandTag{}, fmt.Errorf("unexpected pipeline result: %T", results) } if br.conn.batchTracer != nil { br.conn.batchTracer.TraceBatchQuery(br.ctx, br.conn, TraceBatchQueryData{ SQL: query, Args: arguments, CommandTag: commandTag, Err: br.err, }) } return commandTag, br.err } // Query reads the results from the next query in the batch as if the query has been sent with Query. func (br *pipelineBatchResults) Query() (Rows, error) { if br.err != nil { return &baseRows{err: br.err, closed: true}, br.err } if br.closed { alreadyClosedErr := fmt.Errorf("batch already closed") return &baseRows{err: alreadyClosedErr, closed: true}, alreadyClosedErr } if br.lastRows != nil && br.lastRows.err != nil { br.err = br.lastRows.err return &baseRows{err: br.err, closed: true}, br.err } query, arguments, err := br.nextQueryAndArgs() if err != nil { return &baseRows{err: err, closed: true}, err } rows := br.conn.getRows(br.ctx, query, arguments) rows.batchTracer = br.conn.batchTracer br.lastRows = rows results, err := br.pipeline.GetResults() if err != nil { br.err = err rows.err = err rows.closed = true if br.conn.batchTracer != nil { br.conn.batchTracer.TraceBatchQuery(br.ctx, br.conn, TraceBatchQueryData{ SQL: query, Args: arguments, Err: err, }) } } else { switch results := results.(type) { case *pgconn.ResultReader: rows.resultReader = results default: err = fmt.Errorf("unexpected pipeline result: %T", results) br.err = err rows.err = err rows.closed = true } } return rows, rows.err } // QueryRow reads the results from the next query in the batch as if the query has been sent with QueryRow. func (br *pipelineBatchResults) QueryRow() Row { rows, _ := br.Query() return (*connRow)(rows.(*baseRows)) } // Close closes the batch operation. Any error that occurred during a batch operation may have made it impossible to // resyncronize the connection with the server. In this case the underlying connection will have been closed. func (br *pipelineBatchResults) Close() error { defer func() { if !br.endTraced { if br.conn.batchTracer != nil { br.conn.batchTracer.TraceBatchEnd(br.ctx, br.conn, TraceBatchEndData{Err: br.err}) } br.endTraced = true } invalidateCachesOnBatchResultsError(br.conn, br.b, br.err) }() if br.err == nil && br.lastRows != nil && br.lastRows.err != nil { br.err = br.lastRows.err } if br.closed { return br.err } // Read and run fn for all remaining items for br.err == nil && !br.closed && br.b != nil && br.qqIdx < len(br.b.QueuedQueries) { if br.b.QueuedQueries[br.qqIdx].Fn != nil { err := br.b.QueuedQueries[br.qqIdx].Fn(br) if err != nil { br.err = err } } else { br.Exec() } } br.closed = true err := br.pipeline.Close() if br.err == nil { br.err = err } return br.err } func (br *pipelineBatchResults) earlyError() error { return br.err } func (br *pipelineBatchResults) nextQueryAndArgs() (query string, args []any, err error) { if br.b == nil { return "", nil, errors.New("no reference to batch") } if br.qqIdx >= len(br.b.QueuedQueries) { return "", nil, errors.New("no more results in batch") } bi := br.b.QueuedQueries[br.qqIdx] br.qqIdx++ return bi.SQL, bi.Arguments, nil } type emptyBatchResults struct { conn *Conn closed bool } // Exec reads the results from the next query in the batch as if the query has been sent with Exec. func (br *emptyBatchResults) Exec() (pgconn.CommandTag, error) { if br.closed { return pgconn.CommandTag{}, fmt.Errorf("batch already closed") } return pgconn.CommandTag{}, errors.New("no more results in batch") } // Query reads the results from the next query in the batch as if the query has been sent with Query. func (br *emptyBatchResults) Query() (Rows, error) { if br.closed { alreadyClosedErr := fmt.Errorf("batch already closed") return &baseRows{err: alreadyClosedErr, closed: true}, alreadyClosedErr } rows := br.conn.getRows(context.Background(), "", nil) rows.err = errors.New("no more results in batch") rows.closed = true return rows, rows.err } // QueryRow reads the results from the next query in the batch as if the query has been sent with QueryRow. func (br *emptyBatchResults) QueryRow() Row { rows, _ := br.Query() return (*connRow)(rows.(*baseRows)) } // Close closes the batch operation. Any error that occurred during a batch operation may have made it impossible to // resyncronize the connection with the server. In this case the underlying connection will have been closed. func (br *emptyBatchResults) Close() error { br.closed = true return nil } // invalidates statement and description caches on batch results error func invalidateCachesOnBatchResultsError(conn *Conn, b *Batch, err error) { if err != nil && conn != nil && b != nil { if sc := conn.statementCache; sc != nil { for _, bi := range b.QueuedQueries { sc.Invalidate(bi.SQL) } } if sc := conn.descriptionCache; sc != nil { for _, bi := range b.QueuedQueries { sc.Invalidate(bi.SQL) } } } } pgx-5.8.0/batch_test.go000066400000000000000000000734331512357711200150070ustar00rootroot00000000000000package pgx_test import ( "context" "errors" "fmt" "io" "net" "os" "testing" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/internal/faultyconn" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgproto3" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func TestConnSendBatch(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server serial type is incompatible with test") sql := `create temporary table ledger( id serial primary key, description varchar not null, amount int not null );` mustExec(t, conn, sql) batch := &pgx.Batch{} batch.Queue("insert into ledger(description, amount) values($1, $2)", "q1", 1) batch.Queue("insert into ledger(description, amount) values($1, $2)", "q2", 2) batch.Queue("insert into ledger(description, amount) values($1, $2)", "q3", 3) batch.Queue("select id, description, amount from ledger order by id") batch.Queue("select id, description, amount from ledger order by id") batch.Queue("select * from ledger where false") batch.Queue("select sum(amount) from ledger") br := conn.SendBatch(ctx, batch) ct, err := br.Exec() if err != nil { t.Error(err) } if ct.RowsAffected() != 1 { t.Errorf("ct.RowsAffected() => %v, want %v", ct.RowsAffected(), 1) } ct, err = br.Exec() if err != nil { t.Error(err) } if ct.RowsAffected() != 1 { t.Errorf("ct.RowsAffected() => %v, want %v", ct.RowsAffected(), 1) } ct, err = br.Exec() if err != nil { t.Error(err) } if ct.RowsAffected() != 1 { t.Errorf("ct.RowsAffected() => %v, want %v", ct.RowsAffected(), 1) } selectFromLedgerExpectedRows := []struct { id int32 description string amount int32 }{ {1, "q1", 1}, {2, "q2", 2}, {3, "q3", 3}, } rows, err := br.Query() if err != nil { t.Error(err) } var id int32 var description string var amount int32 rowCount := 0 for rows.Next() { if rowCount >= len(selectFromLedgerExpectedRows) { t.Fatalf("got too many rows: %d", rowCount) } if err := rows.Scan(&id, &description, &amount); err != nil { t.Fatalf("row %d: %v", rowCount, err) } if id != selectFromLedgerExpectedRows[rowCount].id { t.Errorf("id => %v, want %v", id, selectFromLedgerExpectedRows[rowCount].id) } if description != selectFromLedgerExpectedRows[rowCount].description { t.Errorf("description => %v, want %v", description, selectFromLedgerExpectedRows[rowCount].description) } if amount != selectFromLedgerExpectedRows[rowCount].amount { t.Errorf("amount => %v, want %v", amount, selectFromLedgerExpectedRows[rowCount].amount) } rowCount++ } if rows.Err() != nil { t.Fatal(rows.Err()) } rowCount = 0 rows, _ = br.Query() _, err = pgx.ForEachRow(rows, []any{&id, &description, &amount}, func() error { if id != selectFromLedgerExpectedRows[rowCount].id { t.Errorf("id => %v, want %v", id, selectFromLedgerExpectedRows[rowCount].id) } if description != selectFromLedgerExpectedRows[rowCount].description { t.Errorf("description => %v, want %v", description, selectFromLedgerExpectedRows[rowCount].description) } if amount != selectFromLedgerExpectedRows[rowCount].amount { t.Errorf("amount => %v, want %v", amount, selectFromLedgerExpectedRows[rowCount].amount) } rowCount++ return nil }) if err != nil { t.Error(err) } err = br.QueryRow().Scan(&id, &description, &amount) if !errors.Is(err, pgx.ErrNoRows) { t.Errorf("expected pgx.ErrNoRows but got: %v", err) } err = br.QueryRow().Scan(&amount) if err != nil { t.Error(err) } if amount != 6 { t.Errorf("amount => %v, want %v", amount, 6) } err = br.Close() if err != nil { t.Fatal(err) } }) } func TestConnSendBatchQueuedQuery(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server serial type is incompatible with test") sql := `create temporary table ledger( id serial primary key, description varchar not null, amount int not null );` mustExec(t, conn, sql) batch := &pgx.Batch{} batch.Queue("insert into ledger(description, amount) values($1, $2)", "q1", 1).Exec(func(ct pgconn.CommandTag) error { assert.EqualValues(t, 1, ct.RowsAffected()) return nil }) batch.Queue("insert into ledger(description, amount) values($1, $2)", "q2", 2).Exec(func(ct pgconn.CommandTag) error { assert.EqualValues(t, 1, ct.RowsAffected()) return nil }) batch.Queue("insert into ledger(description, amount) values($1, $2)", "q3", 3).Exec(func(ct pgconn.CommandTag) error { assert.EqualValues(t, 1, ct.RowsAffected()) return nil }) selectFromLedgerExpectedRows := []struct { id int32 description string amount int32 }{ {1, "q1", 1}, {2, "q2", 2}, {3, "q3", 3}, } batch.Queue("select id, description, amount from ledger order by id").Query(func(rows pgx.Rows) error { rowCount := 0 var id int32 var description string var amount int32 _, err := pgx.ForEachRow(rows, []any{&id, &description, &amount}, func() error { assert.Equal(t, selectFromLedgerExpectedRows[rowCount].id, id) assert.Equal(t, selectFromLedgerExpectedRows[rowCount].description, description) assert.Equal(t, selectFromLedgerExpectedRows[rowCount].amount, amount) rowCount++ return nil }) assert.NoError(t, err) return nil }) batch.Queue("select id, description, amount from ledger order by id").Query(func(rows pgx.Rows) error { rowCount := 0 var id int32 var description string var amount int32 _, err := pgx.ForEachRow(rows, []any{&id, &description, &amount}, func() error { assert.Equal(t, selectFromLedgerExpectedRows[rowCount].id, id) assert.Equal(t, selectFromLedgerExpectedRows[rowCount].description, description) assert.Equal(t, selectFromLedgerExpectedRows[rowCount].amount, amount) rowCount++ return nil }) assert.NoError(t, err) return nil }) batch.Queue("select * from ledger where false").QueryRow(func(row pgx.Row) error { err := row.Scan(nil, nil, nil) assert.ErrorIs(t, err, pgx.ErrNoRows) return nil }) batch.Queue("select sum(amount) from ledger").QueryRow(func(row pgx.Row) error { var sumAmount int32 err := row.Scan(&sumAmount) assert.NoError(t, err) assert.EqualValues(t, 6, sumAmount) return nil }) err := conn.SendBatch(ctx, batch).Close() assert.NoError(t, err) }) } func TestConnSendBatchMany(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { sql := `create temporary table ledger( id serial primary key, description varchar not null, amount int not null );` mustExec(t, conn, sql) batch := &pgx.Batch{} numInserts := 1000 for range numInserts { batch.Queue("insert into ledger(description, amount) values($1, $2)", "q1", 1) } batch.Queue("select count(*) from ledger") br := conn.SendBatch(ctx, batch) for range numInserts { ct, err := br.Exec() assert.NoError(t, err) assert.EqualValues(t, 1, ct.RowsAffected()) } var actualInserts int err := br.QueryRow().Scan(&actualInserts) assert.NoError(t, err) assert.EqualValues(t, numInserts, actualInserts) err = br.Close() require.NoError(t, err) }) } // https://github.com/jackc/pgx/issues/1801#issuecomment-2203784178 func TestConnSendBatchReadResultsWhenNothingQueued(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { batch := &pgx.Batch{} br := conn.SendBatch(ctx, batch) commandTag, err := br.Exec() require.Equal(t, "", commandTag.String()) require.EqualError(t, err, "no more results in batch") err = br.Close() require.NoError(t, err) }) } func TestConnSendBatchReadMoreResultsThanQueriesSent(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { batch := &pgx.Batch{} batch.Queue("select 1") br := conn.SendBatch(ctx, batch) commandTag, err := br.Exec() require.Equal(t, "SELECT 1", commandTag.String()) require.NoError(t, err) commandTag, err = br.Exec() require.Equal(t, "", commandTag.String()) require.EqualError(t, err, "no more results in batch") err = br.Close() require.NoError(t, err) }) } func TestConnSendBatchWithPreparedStatement(t *testing.T) { t.Parallel() modes := []pgx.QueryExecMode{ pgx.QueryExecModeCacheStatement, pgx.QueryExecModeCacheDescribe, pgx.QueryExecModeDescribeExec, pgx.QueryExecModeExec, // Don't test simple mode with prepared statements. } ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, modes, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server issues incorrect ParameterDescription (https://github.com/cockroachdb/cockroach/issues/60907)") _, err := conn.Prepare(ctx, "ps1", "select n from generate_series(0,$1::int) n") if err != nil { t.Fatal(err) } batch := &pgx.Batch{} queryCount := 3 for range queryCount { batch.Queue("ps1", 5) } br := conn.SendBatch(ctx, batch) for range queryCount { rows, err := br.Query() if err != nil { t.Fatal(err) } for k := 0; rows.Next(); k++ { var n int if err := rows.Scan(&n); err != nil { t.Fatal(err) } if n != k { t.Fatalf("n => %v, want %v", n, k) } } if rows.Err() != nil { t.Fatal(rows.Err()) } } err = br.Close() if err != nil { t.Fatal(err) } }) } func TestConnSendBatchWithQueryRewriter(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { batch := &pgx.Batch{} batch.Queue("something to be replaced", &testQueryRewriter{sql: "select $1::int", args: []any{1}}) batch.Queue("something else to be replaced", &testQueryRewriter{sql: "select $1::text", args: []any{"hello"}}) batch.Queue("more to be replaced", &testQueryRewriter{sql: "select $1::int", args: []any{3}}) br := conn.SendBatch(ctx, batch) var n int32 err := br.QueryRow().Scan(&n) require.NoError(t, err) require.EqualValues(t, 1, n) var s string err = br.QueryRow().Scan(&s) require.NoError(t, err) require.Equal(t, "hello", s) err = br.QueryRow().Scan(&n) require.NoError(t, err) require.EqualValues(t, 3, n) err = br.Close() require.NoError(t, err) }) } // https://github.com/jackc/pgx/issues/856 func TestConnSendBatchWithPreparedStatementAndStatementCacheDisabled(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgx.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.DefaultQueryExecMode = pgx.QueryExecModeDescribeExec config.StatementCacheCapacity = 0 config.DescriptionCacheCapacity = 0 conn := mustConnect(t, config) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server issues incorrect ParameterDescription (https://github.com/cockroachdb/cockroach/issues/60907)") _, err = conn.Prepare(ctx, "ps1", "select n from generate_series(0,$1::int) n") if err != nil { t.Fatal(err) } batch := &pgx.Batch{} queryCount := 3 for range queryCount { batch.Queue("ps1", 5) } br := conn.SendBatch(ctx, batch) for range queryCount { rows, err := br.Query() if err != nil { t.Fatal(err) } for k := 0; rows.Next(); k++ { var n int if err := rows.Scan(&n); err != nil { t.Fatal(err) } if n != k { t.Fatalf("n => %v, want %v", n, k) } } if rows.Err() != nil { t.Fatal(rows.Err()) } } err = br.Close() if err != nil { t.Fatal(err) } ensureConnValid(t, conn) } func TestConnSendBatchCloseRowsPartiallyRead(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { batch := &pgx.Batch{} batch.Queue("select n from generate_series(0,5) n") batch.Queue("select n from generate_series(0,5) n") br := conn.SendBatch(ctx, batch) rows, err := br.Query() if err != nil { t.Error(err) } for i := range 3 { if !rows.Next() { t.Error("expected a row to be available") } var n int if err := rows.Scan(&n); err != nil { t.Error(err) } if n != i { t.Errorf("n => %v, want %v", n, i) } } rows.Close() rows, err = br.Query() if err != nil { t.Error(err) } for i := 0; rows.Next(); i++ { var n int if err := rows.Scan(&n); err != nil { t.Error(err) } if n != i { t.Errorf("n => %v, want %v", n, i) } } if rows.Err() != nil { t.Error(rows.Err()) } err = br.Close() if err != nil { t.Fatal(err) } }) } func TestConnSendBatchQueryError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { batch := &pgx.Batch{} batch.Queue("select n from generate_series(0,5) n where 100/(5-n) > 0") batch.Queue("select n from generate_series(0,5) n") br := conn.SendBatch(ctx, batch) rows, err := br.Query() if err != nil { t.Error(err) } for i := 0; rows.Next(); i++ { var n int if err := rows.Scan(&n); err != nil { t.Error(err) } if n != i { t.Errorf("n => %v, want %v", n, i) } } if pgErr, ok := rows.Err().(*pgconn.PgError); !(ok && pgErr.Code == "22012") { t.Errorf("rows.Err() => %v, want error code %v", rows.Err(), 22012) } err = br.Close() if pgErr, ok := err.(*pgconn.PgError); !(ok && pgErr.Code == "22012") { t.Errorf("br.Close() => %v, want error code %v", err, 22012) } }) } func TestConnSendBatchQuerySyntaxError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { batch := &pgx.Batch{} batch.Queue("select 1 1") br := conn.SendBatch(ctx, batch) var n int32 err := br.QueryRow().Scan(&n) if pgErr, ok := err.(*pgconn.PgError); !(ok && pgErr.Code == "42601") { t.Errorf("rows.Err() => %v, want error code %v", err, 42601) } err = br.Close() if err == nil { t.Error("Expected error") } }) } func TestConnSendBatchQueryRowInsert(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { sql := `create temporary table ledger( id serial primary key, description varchar not null, amount int not null );` mustExec(t, conn, sql) batch := &pgx.Batch{} batch.Queue("select 1") batch.Queue("insert into ledger(description, amount) values($1, $2),($1, $2)", "q1", 1) br := conn.SendBatch(ctx, batch) var value int err := br.QueryRow().Scan(&value) if err != nil { t.Error(err) } ct, err := br.Exec() if err != nil { t.Error(err) } if ct.RowsAffected() != 2 { t.Errorf("ct.RowsAffected() => %v, want %v", ct.RowsAffected(), 2) } br.Close() }) } func TestConnSendBatchQueryPartialReadInsert(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { sql := `create temporary table ledger( id serial primary key, description varchar not null, amount int not null );` mustExec(t, conn, sql) batch := &pgx.Batch{} batch.Queue("select 1 union all select 2 union all select 3") batch.Queue("insert into ledger(description, amount) values($1, $2),($1, $2)", "q1", 1) br := conn.SendBatch(ctx, batch) rows, err := br.Query() if err != nil { t.Error(err) } rows.Close() ct, err := br.Exec() if err != nil { t.Error(err) } if ct.RowsAffected() != 2 { t.Errorf("ct.RowsAffected() => %v, want %v", ct.RowsAffected(), 2) } br.Close() }) } func TestTxSendBatch(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { sql := `create temporary table ledger1( id serial primary key, description varchar not null );` mustExec(t, conn, sql) sql = `create temporary table ledger2( id int primary key, amount int not null );` mustExec(t, conn, sql) tx, _ := conn.Begin(ctx) batch := &pgx.Batch{} batch.Queue("insert into ledger1(description) values($1) returning id", "q1") br := tx.SendBatch(context.Background(), batch) var id int err := br.QueryRow().Scan(&id) if err != nil { t.Error(err) } br.Close() batch = &pgx.Batch{} batch.Queue("insert into ledger2(id,amount) values($1, $2)", id, 2) batch.Queue("select amount from ledger2 where id = $1", id) br = tx.SendBatch(ctx, batch) ct, err := br.Exec() if err != nil { t.Error(err) } if ct.RowsAffected() != 1 { t.Errorf("ct.RowsAffected() => %v, want %v", ct.RowsAffected(), 1) } var amount int err = br.QueryRow().Scan(&amount) if err != nil { t.Error(err) } br.Close() tx.Commit(ctx) var count int conn.QueryRow(ctx, "select count(1) from ledger1 where id = $1", id).Scan(&count) if count != 1 { t.Errorf("count => %v, want %v", count, 1) } err = br.Close() if err != nil { t.Fatal(err) } }) } func TestTxSendBatchRollback(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { sql := `create temporary table ledger1( id serial primary key, description varchar not null );` mustExec(t, conn, sql) tx, _ := conn.Begin(ctx) batch := &pgx.Batch{} batch.Queue("insert into ledger1(description) values($1) returning id", "q1") br := tx.SendBatch(ctx, batch) var id int err := br.QueryRow().Scan(&id) if err != nil { t.Error(err) } br.Close() tx.Rollback(ctx) row := conn.QueryRow(ctx, "select count(1) from ledger1 where id = $1", id) var count int row.Scan(&count) if count != 0 { t.Errorf("count => %v, want %v", count, 0) } }) } // https://github.com/jackc/pgx/issues/1578 func TestSendBatchErrorWhileReadingResultsWithoutCallback(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { batch := &pgx.Batch{} batch.Queue("select 4 / $1::int", 0) batchResult := conn.SendBatch(ctx, batch) _, execErr := batchResult.Exec() require.Error(t, execErr) closeErr := batchResult.Close() require.Equal(t, execErr, closeErr) // Try to use the connection. _, err := conn.Exec(ctx, "select 1") require.NoError(t, err) }) } func TestSendBatchErrorWhileReadingResultsWithExecWhereSomeRowsAreReturned(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { batch := &pgx.Batch{} batch.Queue("select 4 / n from generate_series(-2, 2) n") batchResult := conn.SendBatch(ctx, batch) _, execErr := batchResult.Exec() require.Error(t, execErr) closeErr := batchResult.Close() require.Equal(t, execErr, closeErr) // Try to use the connection. _, err := conn.Exec(ctx, "select 1") require.NoError(t, err) }) } func TestConnBeginBatchDeferredError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server does not support deferred constraint (https://github.com/cockroachdb/cockroach/issues/31632)") mustExec(t, conn, `create temporary table t ( id text primary key, n int not null, unique (n) deferrable initially deferred ); insert into t (id, n) values ('a', 1), ('b', 2), ('c', 3);`) batch := &pgx.Batch{} batch.Queue(`update t set n=n+1 where id='b' returning *`) br := conn.SendBatch(ctx, batch) rows, err := br.Query() if err != nil { t.Error(err) } for rows.Next() { var id string var n int32 err = rows.Scan(&id, &n) if err != nil { t.Fatal(err) } } err = br.Close() if err == nil { t.Fatal("expected error 23505 but got none") } if err, ok := err.(*pgconn.PgError); !ok || err.Code != "23505" { t.Fatalf("expected error 23505, got %v", err) } }) } func TestConnSendBatchNoStatementCache(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config := mustParseConfig(t, os.Getenv("PGX_TEST_DATABASE")) config.DefaultQueryExecMode = pgx.QueryExecModeDescribeExec config.StatementCacheCapacity = 0 config.DescriptionCacheCapacity = 0 conn := mustConnect(t, config) defer closeConn(t, conn) testConnSendBatch(t, ctx, conn, 3) } func TestConnSendBatchPrepareStatementCache(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config := mustParseConfig(t, os.Getenv("PGX_TEST_DATABASE")) config.DefaultQueryExecMode = pgx.QueryExecModeCacheStatement config.StatementCacheCapacity = 32 conn := mustConnect(t, config) defer closeConn(t, conn) testConnSendBatch(t, ctx, conn, 3) } func TestConnSendBatchDescribeStatementCache(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config := mustParseConfig(t, os.Getenv("PGX_TEST_DATABASE")) config.DefaultQueryExecMode = pgx.QueryExecModeCacheDescribe config.DescriptionCacheCapacity = 32 conn := mustConnect(t, config) defer closeConn(t, conn) testConnSendBatch(t, ctx, conn, 3) } func testConnSendBatch(t *testing.T, ctx context.Context, conn *pgx.Conn, queryCount int) { batch := &pgx.Batch{} for range queryCount { batch.Queue("select n from generate_series(0,5) n") } br := conn.SendBatch(ctx, batch) for range queryCount { rows, err := br.Query() require.NoError(t, err) for k := 0; rows.Next(); k++ { var n int err := rows.Scan(&n) require.NoError(t, err) require.Equal(t, k, n) } require.NoError(t, rows.Err()) } err := br.Close() require.NoError(t, err) } func TestSendBatchSimpleProtocol(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config := mustParseConfig(t, os.Getenv("PGX_TEST_DATABASE")) config.DefaultQueryExecMode = pgx.QueryExecModeSimpleProtocol conn := mustConnect(t, config) defer closeConn(t, conn) var batch pgx.Batch batch.Queue("SELECT 1::int") batch.Queue("SELECT 2::int; SELECT $1::int", 3) results := conn.SendBatch(ctx, &batch) rows, err := results.Query() assert.NoError(t, err) assert.True(t, rows.Next()) values, err := rows.Values() assert.NoError(t, err) assert.EqualValues(t, 1, values[0]) assert.False(t, rows.Next()) rows, err = results.Query() assert.NoError(t, err) assert.True(t, rows.Next()) values, err = rows.Values() assert.NoError(t, err) assert.EqualValues(t, 2, values[0]) assert.False(t, rows.Next()) rows, err = results.Query() assert.NoError(t, err) assert.True(t, rows.Next()) values, err = rows.Values() assert.NoError(t, err) assert.EqualValues(t, 3, values[0]) assert.False(t, rows.Next()) } // https://github.com/jackc/pgx/issues/1847#issuecomment-2347858887 func TestConnSendBatchErrorDoesNotLeaveOrphanedPreparedStatement(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server serial type is incompatible with test") mustExec(t, conn, `create temporary table foo(col1 text primary key);`) batch := &pgx.Batch{} batch.Queue("select col1 from foo") batch.Queue("select col1 from baz") err := conn.SendBatch(ctx, batch).Close() require.EqualError(t, err, `ERROR: relation "baz" does not exist (SQLSTATE 42P01)`) mustExec(t, conn, `create temporary table baz(col1 text primary key);`) // Since table baz now exists, the batch should succeed. batch = &pgx.Batch{} batch.Queue("select col1 from foo") batch.Queue("select col1 from baz") err = conn.SendBatch(ctx, batch).Close() require.NoError(t, err) }) } func TestSendBatchStatementTimeout(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { batch := &pgx.Batch{} batch.Queue("SET statement_timeout='1ms'") batch.Queue("SELECT pg_sleep(10)") br := conn.SendBatch(context.Background(), batch) // set statement_timeout _, err := br.Exec() assert.NoError(t, err) // get pg_sleep results rows, err := br.Query() assert.NoError(t, err) // Consume rows and check error for rows.Next() { } err = rows.Err() assert.ErrorContains(t, err, "(SQLSTATE 57014)") rows.Close() // The last error should be repeated when closing the batch err = br.Close() assert.ErrorContains(t, err, "(SQLSTATE 57014)") // Connection should be usable after the statement timeout in pipeline _, err = conn.Exec(context.Background(), "Select 1") assert.NoError(t, err) }) } func TestSendBatchHandlesTimeoutBetweenParseAndDescribe(t *testing.T) { // Not parallel because it is a timing sensitive test. ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() var faultyConn *faultyconn.Conn faultyConnTestRunner := pgxtest.DefaultConnTestRunner() faultyConnTestRunner.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config, err := pgx.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.AfterNetConnect = func(ctx context.Context, config *pgconn.Config, conn net.Conn) (net.Conn, error) { faultyConn = faultyconn.New(conn) return faultyConn, nil } return config } // Only need to test modes that use Parse/Describe. extendedQueryModes := []pgx.QueryExecMode{ pgx.QueryExecModeCacheStatement, pgx.QueryExecModeCacheDescribe, pgx.QueryExecModeDescribeExec, pgx.QueryExecModeExec, } pgxtest.RunWithQueryExecModes(ctx, t, faultyConnTestRunner, extendedQueryModes, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Induced error does not occur on CockroachDB") _, err := conn.Exec(ctx, "set statement_timeout = '100ms'") require.NoError(t, err) batch := &pgx.Batch{} batch.Queue("select 1") batch.Queue("select 2") faultyConn.HandleFrontendMessage = func(backendWriter io.Writer, msg pgproto3.FrontendMessage) error { if _, ok := msg.(*pgproto3.Describe); ok { time.Sleep(200 * time.Millisecond) } buf, err := msg.Encode(nil) if err != nil { return err } _, err = backendWriter.Write(buf) return err } err = conn.SendBatch(ctx, batch).Close() require.Error(t, err) var pgErr *pgconn.PgError require.True(t, errors.As(err, &pgErr)) require.Equal(t, "57014", pgErr.Code) faultyConn.HandleFrontendMessage = nil _, err = conn.Exec(ctx, "set statement_timeout = default") require.NoError(t, err) batch = &pgx.Batch{} batch.Queue("select 1") batch.Queue("select 2") err = conn.SendBatch(ctx, batch).Close() require.NoError(t, err) }) } func ExampleConn_SendBatch() { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn, err := pgx.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) if err != nil { fmt.Printf("Unable to establish connection: %v", err) return } batch := &pgx.Batch{} batch.Queue("select 1 + 1").QueryRow(func(row pgx.Row) error { var n int32 err := row.Scan(&n) if err != nil { return err } fmt.Println(n) return err }) batch.Queue("select 1 + 2").QueryRow(func(row pgx.Row) error { var n int32 err := row.Scan(&n) if err != nil { return err } fmt.Println(n) return err }) batch.Queue("select 2 + 3").QueryRow(func(row pgx.Row) error { var n int32 err := row.Scan(&n) if err != nil { return err } fmt.Println(n) return err }) err = conn.SendBatch(ctx, batch).Close() if err != nil { fmt.Printf("SendBatch error: %v", err) return } // Output: // 2 // 3 // 5 } pgx-5.8.0/bench_test.go000066400000000000000000001034111512357711200147730ustar00rootroot00000000000000package pgx_test import ( "bytes" "context" "fmt" "io" "net" "os" "strconv" "strings" "testing" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgtype" "github.com/stretchr/testify/require" ) func BenchmarkConnectClose(b *testing.B) { for b.Loop() { conn, err := pgx.Connect(context.Background(), os.Getenv("PGX_TEST_DATABASE")) if err != nil { b.Fatal(err) } err = conn.Close(context.Background()) if err != nil { b.Fatal(err) } } } func BenchmarkMinimalUnpreparedSelectWithoutStatementCache(b *testing.B) { config := mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE")) config.DefaultQueryExecMode = pgx.QueryExecModeDescribeExec config.StatementCacheCapacity = 0 config.DescriptionCacheCapacity = 0 conn := mustConnect(b, config) defer closeConn(b, conn) var n int64 for i := 0; b.Loop(); i++ { err := conn.QueryRow(context.Background(), "select $1::int8", i).Scan(&n) if err != nil { b.Fatal(err) } if n != int64(i) { b.Fatalf("expected %d, got %d", i, n) } } } func BenchmarkMinimalUnpreparedSelectWithStatementCacheModeDescribe(b *testing.B) { config := mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE")) config.DefaultQueryExecMode = pgx.QueryExecModeCacheDescribe config.StatementCacheCapacity = 0 config.DescriptionCacheCapacity = 32 conn := mustConnect(b, config) defer closeConn(b, conn) var n int64 for i := 0; b.Loop(); i++ { err := conn.QueryRow(context.Background(), "select $1::int8", i).Scan(&n) if err != nil { b.Fatal(err) } if n != int64(i) { b.Fatalf("expected %d, got %d", i, n) } } } func BenchmarkMinimalUnpreparedSelectWithStatementCacheModePrepare(b *testing.B) { config := mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE")) config.DefaultQueryExecMode = pgx.QueryExecModeCacheStatement config.StatementCacheCapacity = 32 config.DescriptionCacheCapacity = 0 conn := mustConnect(b, config) defer closeConn(b, conn) var n int64 for i := 0; b.Loop(); i++ { err := conn.QueryRow(context.Background(), "select $1::int8", i).Scan(&n) if err != nil { b.Fatal(err) } if n != int64(i) { b.Fatalf("expected %d, got %d", i, n) } } } func BenchmarkMinimalPreparedSelect(b *testing.B) { conn := mustConnect(b, mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE"))) defer closeConn(b, conn) _, err := conn.Prepare(context.Background(), "ps1", "select $1::int8") if err != nil { b.Fatal(err) } var n int64 for i := 0; b.Loop(); i++ { err = conn.QueryRow(context.Background(), "ps1", i).Scan(&n) if err != nil { b.Fatal(err) } if n != int64(i) { b.Fatalf("expected %d, got %d", i, n) } } } func BenchmarkMinimalPgConnPreparedSelect(b *testing.B) { conn := mustConnect(b, mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE"))) defer closeConn(b, conn) pgConn := conn.PgConn() _, err := pgConn.Prepare(context.Background(), "ps1", "select $1::int8", nil) if err != nil { b.Fatal(err) } encodedBytes := make([]byte, 8) for b.Loop() { rr := pgConn.ExecPrepared(context.Background(), "ps1", [][]byte{encodedBytes}, []int16{1}, []int16{1}) if err != nil { b.Fatal(err) } for rr.NextRow() { for i := range rr.Values() { if !bytes.Equal(rr.Values()[0], encodedBytes) { b.Fatalf("unexpected values: %s %s", rr.Values()[i], encodedBytes) } } } _, err = rr.Close() if err != nil { b.Fatal(err) } } } func BenchmarkPointerPointerWithNullValues(b *testing.B) { conn := mustConnect(b, mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE"))) defer closeConn(b, conn) _, err := conn.Prepare(context.Background(), "selectNulls", "select 1::int4, 'johnsmith', null::text, null::text, null::text, null::date, null::timestamptz") if err != nil { b.Fatal(err) } for b.Loop() { var record struct { id int32 userName string email *string name *string sex *string birthDate *time.Time lastLoginTime *time.Time } err = conn.QueryRow(context.Background(), "selectNulls").Scan( &record.id, &record.userName, &record.email, &record.name, &record.sex, &record.birthDate, &record.lastLoginTime, ) if err != nil { b.Fatal(err) } // These checks both ensure that the correct data was returned // and provide a benchmark of accessing the returned values. if record.id != 1 { b.Fatalf("bad value for id: %v", record.id) } if record.userName != "johnsmith" { b.Fatalf("bad value for userName: %v", record.userName) } if record.email != nil { b.Fatalf("bad value for email: %v", record.email) } if record.name != nil { b.Fatalf("bad value for name: %v", record.name) } if record.sex != nil { b.Fatalf("bad value for sex: %v", record.sex) } if record.birthDate != nil { b.Fatalf("bad value for birthDate: %v", record.birthDate) } if record.lastLoginTime != nil { b.Fatalf("bad value for lastLoginTime: %v", record.lastLoginTime) } } } func BenchmarkPointerPointerWithPresentValues(b *testing.B) { conn := mustConnect(b, mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE"))) defer closeConn(b, conn) _, err := conn.Prepare(context.Background(), "selectNulls", "select 1::int4, 'johnsmith', 'johnsmith@example.com', 'John Smith', 'male', '1970-01-01'::date, '2015-01-01 00:00:00'::timestamptz") if err != nil { b.Fatal(err) } for b.Loop() { var record struct { id int32 userName string email *string name *string sex *string birthDate *time.Time lastLoginTime *time.Time } err = conn.QueryRow(context.Background(), "selectNulls").Scan( &record.id, &record.userName, &record.email, &record.name, &record.sex, &record.birthDate, &record.lastLoginTime, ) if err != nil { b.Fatal(err) } // These checks both ensure that the correct data was returned // and provide a benchmark of accessing the returned values. if record.id != 1 { b.Fatalf("bad value for id: %v", record.id) } if record.userName != "johnsmith" { b.Fatalf("bad value for userName: %v", record.userName) } if record.email == nil || *record.email != "johnsmith@example.com" { b.Fatalf("bad value for email: %v", record.email) } if record.name == nil || *record.name != "John Smith" { b.Fatalf("bad value for name: %v", record.name) } if record.sex == nil || *record.sex != "male" { b.Fatalf("bad value for sex: %v", record.sex) } if record.birthDate == nil || *record.birthDate != time.Date(1970, 1, 1, 0, 0, 0, 0, time.UTC) { b.Fatalf("bad value for birthDate: %v", record.birthDate) } if record.lastLoginTime == nil || *record.lastLoginTime != time.Date(2015, 1, 1, 0, 0, 0, 0, time.Local) { b.Fatalf("bad value for lastLoginTime: %v", record.lastLoginTime) } } } const benchmarkWriteTableCreateSQL = `drop table if exists t; create table t( varchar_1 varchar not null, varchar_2 varchar not null, varchar_null_1 varchar, date_1 date not null, date_null_1 date, int4_1 int4 not null, int4_2 int4 not null, int4_null_1 int4, tstz_1 timestamptz not null, tstz_2 timestamptz, bool_1 bool not null, bool_2 bool not null, bool_3 bool not null ); ` const benchmarkWriteTableInsertSQL = `insert into t( varchar_1, varchar_2, varchar_null_1, date_1, date_null_1, int4_1, int4_2, int4_null_1, tstz_1, tstz_2, bool_1, bool_2, bool_3 ) values ( $1::varchar, $2::varchar, $3::varchar, $4::date, $5::date, $6::int4, $7::int4, $8::int4, $9::timestamptz, $10::timestamptz, $11::bool, $12::bool, $13::bool )` type benchmarkWriteTableCopyFromSrc struct { count int idx int row []any } func (s *benchmarkWriteTableCopyFromSrc) Next() bool { next := s.idx < s.count s.idx++ return next } func (s *benchmarkWriteTableCopyFromSrc) Values() ([]any, error) { return s.row, nil } func (s *benchmarkWriteTableCopyFromSrc) Err() error { return nil } func newBenchmarkWriteTableCopyFromSrc(count int) pgx.CopyFromSource { return &benchmarkWriteTableCopyFromSrc{ count: count, row: []any{ "varchar_1", "varchar_2", &pgtype.Text{}, time.Date(2000, 1, 1, 0, 0, 0, 0, time.Local), &pgtype.Date{}, 1, 2, &pgtype.Int4{}, time.Date(2001, 1, 1, 0, 0, 0, 0, time.Local), time.Date(2002, 1, 1, 0, 0, 0, 0, time.Local), true, false, true, }, } } func benchmarkWriteNRowsViaInsert(b *testing.B, n int) { conn := mustConnect(b, mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE"))) defer closeConn(b, conn) mustExec(b, conn, benchmarkWriteTableCreateSQL) _, err := conn.Prepare(context.Background(), "insert_t", benchmarkWriteTableInsertSQL) if err != nil { b.Fatal(err) } for b.Loop() { src := newBenchmarkWriteTableCopyFromSrc(n) tx, err := conn.Begin(context.Background()) if err != nil { b.Fatal(err) } for src.Next() { values, _ := src.Values() if _, err = tx.Exec(context.Background(), "insert_t", values...); err != nil { b.Fatalf("Exec unexpectedly failed with: %v", err) } } err = tx.Commit(context.Background()) if err != nil { b.Fatal(err) } } } func benchmarkWriteNRowsViaBatchInsert(b *testing.B, n int) { conn := mustConnect(b, mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE"))) defer closeConn(b, conn) mustExec(b, conn, benchmarkWriteTableCreateSQL) _, err := conn.Prepare(context.Background(), "insert_t", benchmarkWriteTableInsertSQL) if err != nil { b.Fatal(err) } for b.Loop() { src := newBenchmarkWriteTableCopyFromSrc(n) batch := &pgx.Batch{} for src.Next() { values, _ := src.Values() batch.Queue("insert_t", values...) } err = conn.SendBatch(context.Background(), batch).Close() if err != nil { b.Fatal(err) } } } type queryArgs []any func (qa *queryArgs) Append(v any) string { *qa = append(*qa, v) return "$" + strconv.Itoa(len(*qa)) } // note this function is only used for benchmarks -- it doesn't escape tableName // or columnNames func multiInsert(conn *pgx.Conn, tableName string, columnNames []string, rowSrc pgx.CopyFromSource) (int, error) { maxRowsPerInsert := 65535 / len(columnNames) rowsThisInsert := 0 rowCount := 0 sqlBuf := &bytes.Buffer{} args := make(queryArgs, 0) resetQuery := func() { sqlBuf.Reset() fmt.Fprintf(sqlBuf, "insert into %s(%s) values", tableName, strings.Join(columnNames, ", ")) args = args[0:0] rowsThisInsert = 0 } resetQuery() tx, err := conn.Begin(context.Background()) if err != nil { return 0, err } defer tx.Rollback(context.Background()) for rowSrc.Next() { if rowsThisInsert > 0 { sqlBuf.WriteByte(',') } sqlBuf.WriteByte('(') values, err := rowSrc.Values() if err != nil { return 0, err } for i, val := range values { if i > 0 { sqlBuf.WriteByte(',') } sqlBuf.WriteString(args.Append(val)) } sqlBuf.WriteByte(')') rowsThisInsert++ if rowsThisInsert == maxRowsPerInsert { _, err := tx.Exec(context.Background(), sqlBuf.String(), args...) if err != nil { return 0, err } rowCount += rowsThisInsert resetQuery() } } if rowsThisInsert > 0 { _, err := tx.Exec(context.Background(), sqlBuf.String(), args...) if err != nil { return 0, err } rowCount += rowsThisInsert } if err := tx.Commit(context.Background()); err != nil { return 0, err } return rowCount, nil } func benchmarkWriteNRowsViaMultiInsert(b *testing.B, n int) { conn := mustConnect(b, mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE"))) defer closeConn(b, conn) mustExec(b, conn, benchmarkWriteTableCreateSQL) _, err := conn.Prepare(context.Background(), "insert_t", benchmarkWriteTableInsertSQL) if err != nil { b.Fatal(err) } for b.Loop() { src := newBenchmarkWriteTableCopyFromSrc(n) _, err := multiInsert(conn, "t", []string{ "varchar_1", "varchar_2", "varchar_null_1", "date_1", "date_null_1", "int4_1", "int4_2", "int4_null_1", "tstz_1", "tstz_2", "bool_1", "bool_2", "bool_3", }, src) if err != nil { b.Fatal(err) } } } func benchmarkWriteNRowsViaCopy(b *testing.B, n int) { conn := mustConnect(b, mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE"))) defer closeConn(b, conn) mustExec(b, conn, benchmarkWriteTableCreateSQL) for b.Loop() { src := newBenchmarkWriteTableCopyFromSrc(n) _, err := conn.CopyFrom(context.Background(), pgx.Identifier{"t"}, []string{ "varchar_1", "varchar_2", "varchar_null_1", "date_1", "date_null_1", "int4_1", "int4_2", "int4_null_1", "tstz_1", "tstz_2", "bool_1", "bool_2", "bool_3", }, src) if err != nil { b.Fatal(err) } } } func BenchmarkWrite2RowsViaInsert(b *testing.B) { benchmarkWriteNRowsViaInsert(b, 2) } func BenchmarkWrite2RowsViaMultiInsert(b *testing.B) { benchmarkWriteNRowsViaMultiInsert(b, 2) } func BenchmarkWrite2RowsViaBatchInsert(b *testing.B) { benchmarkWriteNRowsViaBatchInsert(b, 2) } func BenchmarkWrite2RowsViaCopy(b *testing.B) { benchmarkWriteNRowsViaCopy(b, 2) } func BenchmarkWrite5RowsViaInsert(b *testing.B) { benchmarkWriteNRowsViaInsert(b, 5) } func BenchmarkWrite5RowsViaMultiInsert(b *testing.B) { benchmarkWriteNRowsViaMultiInsert(b, 5) } func BenchmarkWrite5RowsViaBatchInsert(b *testing.B) { benchmarkWriteNRowsViaBatchInsert(b, 5) } func BenchmarkWrite5RowsViaCopy(b *testing.B) { benchmarkWriteNRowsViaCopy(b, 5) } func BenchmarkWrite10RowsViaInsert(b *testing.B) { benchmarkWriteNRowsViaInsert(b, 10) } func BenchmarkWrite10RowsViaMultiInsert(b *testing.B) { benchmarkWriteNRowsViaMultiInsert(b, 10) } func BenchmarkWrite10RowsViaBatchInsert(b *testing.B) { benchmarkWriteNRowsViaBatchInsert(b, 10) } func BenchmarkWrite10RowsViaCopy(b *testing.B) { benchmarkWriteNRowsViaCopy(b, 10) } func BenchmarkWrite100RowsViaInsert(b *testing.B) { benchmarkWriteNRowsViaInsert(b, 100) } func BenchmarkWrite100RowsViaMultiInsert(b *testing.B) { benchmarkWriteNRowsViaMultiInsert(b, 100) } func BenchmarkWrite100RowsViaBatchInsert(b *testing.B) { benchmarkWriteNRowsViaBatchInsert(b, 100) } func BenchmarkWrite100RowsViaCopy(b *testing.B) { benchmarkWriteNRowsViaCopy(b, 100) } func BenchmarkWrite1000RowsViaInsert(b *testing.B) { benchmarkWriteNRowsViaInsert(b, 1_000) } func BenchmarkWrite1000RowsViaMultiInsert(b *testing.B) { benchmarkWriteNRowsViaMultiInsert(b, 1_000) } func BenchmarkWrite1000RowsViaBatchInsert(b *testing.B) { benchmarkWriteNRowsViaBatchInsert(b, 1_000) } func BenchmarkWrite1000RowsViaCopy(b *testing.B) { benchmarkWriteNRowsViaCopy(b, 1_000) } func BenchmarkWrite10000RowsViaInsert(b *testing.B) { benchmarkWriteNRowsViaInsert(b, 10_000) } func BenchmarkWrite10000RowsViaMultiInsert(b *testing.B) { benchmarkWriteNRowsViaMultiInsert(b, 10_000) } func BenchmarkWrite10000RowsViaBatchInsert(b *testing.B) { benchmarkWriteNRowsViaBatchInsert(b, 10_000) } func BenchmarkWrite10000RowsViaCopy(b *testing.B) { benchmarkWriteNRowsViaCopy(b, 10_000) } func BenchmarkMultipleQueriesNonBatchNoStatementCache(b *testing.B) { config := mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE")) config.DefaultQueryExecMode = pgx.QueryExecModeDescribeExec config.StatementCacheCapacity = 0 config.DescriptionCacheCapacity = 0 conn := mustConnect(b, config) defer closeConn(b, conn) benchmarkMultipleQueriesNonBatch(b, conn, 3) } func BenchmarkMultipleQueriesNonBatchPrepareStatementCache(b *testing.B) { config := mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE")) config.DefaultQueryExecMode = pgx.QueryExecModeCacheStatement config.StatementCacheCapacity = 32 config.DescriptionCacheCapacity = 0 conn := mustConnect(b, config) defer closeConn(b, conn) benchmarkMultipleQueriesNonBatch(b, conn, 3) } func BenchmarkMultipleQueriesNonBatchDescribeStatementCache(b *testing.B) { config := mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE")) config.DefaultQueryExecMode = pgx.QueryExecModeCacheDescribe config.StatementCacheCapacity = 0 config.DescriptionCacheCapacity = 32 conn := mustConnect(b, config) defer closeConn(b, conn) benchmarkMultipleQueriesNonBatch(b, conn, 3) } func benchmarkMultipleQueriesNonBatch(b *testing.B, conn *pgx.Conn, queryCount int) { for b.Loop() { for range queryCount { rows, err := conn.Query(context.Background(), "select n from generate_series(0, 5) n") if err != nil { b.Fatal(err) } for k := 0; rows.Next(); k++ { var n int if err := rows.Scan(&n); err != nil { b.Fatal(err) } if n != k { b.Fatalf("n => %v, want %v", n, k) } } if rows.Err() != nil { b.Fatal(rows.Err()) } } } } func BenchmarkMultipleQueriesBatchNoStatementCache(b *testing.B) { config := mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE")) config.DefaultQueryExecMode = pgx.QueryExecModeDescribeExec config.StatementCacheCapacity = 0 config.DescriptionCacheCapacity = 0 conn := mustConnect(b, config) defer closeConn(b, conn) benchmarkMultipleQueriesBatch(b, conn, 3) } func BenchmarkMultipleQueriesBatchPrepareStatementCache(b *testing.B) { config := mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE")) config.DefaultQueryExecMode = pgx.QueryExecModeCacheStatement config.StatementCacheCapacity = 32 config.DescriptionCacheCapacity = 0 conn := mustConnect(b, config) defer closeConn(b, conn) benchmarkMultipleQueriesBatch(b, conn, 3) } func BenchmarkMultipleQueriesBatchDescribeStatementCache(b *testing.B) { config := mustParseConfig(b, os.Getenv("PGX_TEST_DATABASE")) config.DefaultQueryExecMode = pgx.QueryExecModeCacheDescribe config.StatementCacheCapacity = 0 config.DescriptionCacheCapacity = 32 conn := mustConnect(b, config) defer closeConn(b, conn) benchmarkMultipleQueriesBatch(b, conn, 3) } func benchmarkMultipleQueriesBatch(b *testing.B, conn *pgx.Conn, queryCount int) { for b.Loop() { batch := &pgx.Batch{} for range queryCount { batch.Queue("select n from generate_series(0,5) n") } br := conn.SendBatch(context.Background(), batch) for range queryCount { rows, err := br.Query() if err != nil { b.Fatal(err) } for k := 0; rows.Next(); k++ { var n int if err := rows.Scan(&n); err != nil { b.Fatal(err) } if n != k { b.Fatalf("n => %v, want %v", n, k) } } if rows.Err() != nil { b.Fatal(rows.Err()) } } err := br.Close() if err != nil { b.Fatal(err) } } } func BenchmarkSelectManyUnknownEnum(b *testing.B) { conn := mustConnectString(b, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(b, conn) ctx := context.Background() tx, err := conn.Begin(ctx) require.NoError(b, err) defer tx.Rollback(ctx) _, err = tx.Exec(context.Background(), "drop type if exists color;") require.NoError(b, err) _, err = tx.Exec(ctx, `create type color as enum ('blue', 'green', 'orange')`) require.NoError(b, err) var x, y, z string for b.Loop() { rows, err := conn.Query(ctx, "select 'blue'::color, 'green'::color, 'orange'::color from generate_series(1,10)") if err != nil { b.Fatal(err) } for rows.Next() { err = rows.Scan(&x, &y, &z) if err != nil { b.Fatal(err) } if x != "blue" { b.Fatal("unexpected result") } if y != "green" { b.Fatal("unexpected result") } if z != "orange" { b.Fatal("unexpected result") } } if rows.Err() != nil { b.Fatal(rows.Err()) } } } func BenchmarkSelectManyRegisteredEnum(b *testing.B) { conn := mustConnectString(b, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(b, conn) ctx := context.Background() tx, err := conn.Begin(ctx) require.NoError(b, err) defer tx.Rollback(ctx) _, err = tx.Exec(context.Background(), "drop type if exists color;") require.NoError(b, err) _, err = tx.Exec(ctx, `create type color as enum ('blue', 'green', 'orange')`) require.NoError(b, err) var oid uint32 err = conn.QueryRow(context.Background(), "select oid from pg_type where typname=$1;", "color").Scan(&oid) require.NoError(b, err) conn.TypeMap().RegisterType(&pgtype.Type{Name: "color", OID: oid, Codec: &pgtype.EnumCodec{}}) var x, y, z string for b.Loop() { rows, err := conn.Query(ctx, "select 'blue'::color, 'green'::color, 'orange'::color from generate_series(1,10)") if err != nil { b.Fatal(err) } for rows.Next() { err = rows.Scan(&x, &y, &z) if err != nil { b.Fatal(err) } if x != "blue" { b.Fatal("unexpected result") } if y != "green" { b.Fatal("unexpected result") } if z != "orange" { b.Fatal("unexpected result") } } if rows.Err() != nil { b.Fatal(rows.Err()) } } } func getSelectRowsCounts(b *testing.B) []int64 { var rowCounts []int64 { s := os.Getenv("PGX_BENCH_SELECT_ROWS_COUNTS") if s != "" { for p := range strings.SplitSeq(s, " ") { n, err := strconv.ParseInt(p, 10, 64) if err != nil { b.Fatalf("Bad PGX_BENCH_SELECT_ROWS_COUNTS value: %v", err) } rowCounts = append(rowCounts, n) } } } if len(rowCounts) == 0 { rowCounts = []int64{1, 10, 100, 1000} } return rowCounts } type BenchRowSimple struct { ID int32 FirstName string LastName string Sex string BirthDate time.Time Weight int32 Height int32 Tags []string UpdateTime time.Time } func BenchmarkSelectRowsScanSimple(b *testing.B) { conn := mustConnectString(b, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(b, conn) rowCounts := getSelectRowsCounts(b) for _, rowCount := range rowCounts { b.Run(fmt.Sprintf("%d rows", rowCount), func(b *testing.B) { br := &BenchRowSimple{} for b.Loop() { rows, err := conn.Query(context.Background(), "select n, 'Adam', 'Smith ' || n, 'male', '1952-06-16'::date, 258, 72, '{foo,bar,baz}'::text[], '2001-01-28 01:02:03-05'::timestamptz from generate_series(100001, 100000 + $1) n", rowCount) if err != nil { b.Fatal(err) } for rows.Next() { rows.Scan(&br.ID, &br.FirstName, &br.LastName, &br.Sex, &br.BirthDate, &br.Weight, &br.Height, &br.Tags, &br.UpdateTime) } if rows.Err() != nil { b.Fatal(rows.Err()) } } }) } } type BenchRowStringBytes struct { ID int32 FirstName []byte LastName []byte Sex []byte BirthDate time.Time Weight int32 Height int32 Tags []string UpdateTime time.Time } func BenchmarkSelectRowsScanStringBytes(b *testing.B) { conn := mustConnectString(b, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(b, conn) rowCounts := getSelectRowsCounts(b) for _, rowCount := range rowCounts { b.Run(fmt.Sprintf("%d rows", rowCount), func(b *testing.B) { br := &BenchRowStringBytes{} for b.Loop() { rows, err := conn.Query(context.Background(), "select n, 'Adam', 'Smith ' || n, 'male', '1952-06-16'::date, 258, 72, '{foo,bar,baz}'::text[], '2001-01-28 01:02:03-05'::timestamptz from generate_series(100001, 100000 + $1) n", rowCount) if err != nil { b.Fatal(err) } for rows.Next() { rows.Scan(&br.ID, &br.FirstName, &br.LastName, &br.Sex, &br.BirthDate, &br.Weight, &br.Height, &br.Tags, &br.UpdateTime) } if rows.Err() != nil { b.Fatal(rows.Err()) } } }) } } type BenchRowDecoder struct { ID pgtype.Int4 FirstName pgtype.Text LastName pgtype.Text Sex pgtype.Text BirthDate pgtype.Date Weight pgtype.Int4 Height pgtype.Int4 Tags pgtype.FlatArray[string] UpdateTime pgtype.Timestamptz } func BenchmarkSelectRowsScanDecoder(b *testing.B) { conn := mustConnectString(b, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(b, conn) rowCounts := getSelectRowsCounts(b) for _, rowCount := range rowCounts { b.Run(fmt.Sprintf("%d rows", rowCount), func(b *testing.B) { formats := []struct { name string code int16 }{ {"text", pgx.TextFormatCode}, {"binary", pgx.BinaryFormatCode}, } for _, format := range formats { b.Run(format.name, func(b *testing.B) { br := &BenchRowDecoder{} for b.Loop() { rows, err := conn.Query( context.Background(), "select n, 'Adam', 'Smith ' || n, 'male', '1952-06-16'::date, 258, 72, '{foo,bar,baz}'::text[], '2001-01-28 01:02:03-05'::timestamptz from generate_series(100001, 100000 + $1) n", pgx.QueryResultFormats{format.code}, rowCount, ) if err != nil { b.Fatal(err) } for rows.Next() { rows.Scan(&br.ID, &br.FirstName, &br.LastName, &br.Sex, &br.BirthDate, &br.Weight, &br.Height, &br.Tags, &br.UpdateTime) } if rows.Err() != nil { b.Fatal(rows.Err()) } } }) } }) } } func BenchmarkSelectRowsPgConnExecText(b *testing.B) { conn := mustConnectString(b, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(b, conn) rowCounts := getSelectRowsCounts(b) for _, rowCount := range rowCounts { b.Run(fmt.Sprintf("%d rows", rowCount), func(b *testing.B) { for b.Loop() { mrr := conn.PgConn().Exec(context.Background(), fmt.Sprintf("select n, 'Adam', 'Smith ' || n, 'male', '1952-06-16'::date, 258, 72, '{foo,bar,baz}'::text[], '2001-01-28 01:02:03-05'::timestamptz from generate_series(100001, 100000 + %d) n", rowCount)) for mrr.NextResult() { rr := mrr.ResultReader() for rr.NextRow() { rr.Values() } } err := mrr.Close() if err != nil { b.Fatal(err) } } }) } } func BenchmarkSelectRowsPgConnExecParams(b *testing.B) { conn := mustConnectString(b, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(b, conn) rowCounts := getSelectRowsCounts(b) for _, rowCount := range rowCounts { b.Run(fmt.Sprintf("%d rows", rowCount), func(b *testing.B) { formats := []struct { name string code int16 }{ {"text", pgx.TextFormatCode}, {"binary - mostly", pgx.BinaryFormatCode}, } for _, format := range formats { b.Run(format.name, func(b *testing.B) { for b.Loop() { rr := conn.PgConn().ExecParams( context.Background(), "select n, 'Adam', 'Smith ' || n, 'male', '1952-06-16'::date, 258, 72, '{foo,bar,baz}'::text[], '2001-01-28 01:02:03-05'::timestamptz from generate_series(100001, 100000 + $1) n", [][]byte{[]byte(strconv.FormatInt(rowCount, 10))}, nil, nil, []int16{format.code, pgx.TextFormatCode, pgx.TextFormatCode, pgx.TextFormatCode, format.code, format.code, format.code, format.code, format.code}, ) for rr.NextRow() { rr.Values() } _, err := rr.Close() if err != nil { b.Fatal(err) } } }) } }) } } func BenchmarkSelectRowsSimpleCollectRowsRowToStructByPos(b *testing.B) { conn := mustConnectString(b, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(b, conn) rowCounts := getSelectRowsCounts(b) for _, rowCount := range rowCounts { b.Run(fmt.Sprintf("%d rows", rowCount), func(b *testing.B) { for b.Loop() { rows, _ := conn.Query(context.Background(), "select n, 'Adam', 'Smith ' || n, 'male', '1952-06-16'::date, 258, 72, '{foo,bar,baz}'::text[], '2001-01-28 01:02:03-05'::timestamptz from generate_series(100001, 100000 + $1) n", rowCount) benchRows, err := pgx.CollectRows(rows, pgx.RowToStructByPos[BenchRowSimple]) if err != nil { b.Fatal(err) } if len(benchRows) != int(rowCount) { b.Fatalf("Expected %d rows, got %d", rowCount, len(benchRows)) } } }) } } func BenchmarkSelectRowsSimpleAppendRowsRowToStructByPos(b *testing.B) { conn := mustConnectString(b, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(b, conn) rowCounts := getSelectRowsCounts(b) for _, rowCount := range rowCounts { b.Run(fmt.Sprintf("%d rows", rowCount), func(b *testing.B) { benchRows := make([]BenchRowSimple, 0, rowCount) for b.Loop() { benchRows = benchRows[:0] rows, _ := conn.Query(context.Background(), "select n, 'Adam', 'Smith ' || n, 'male', '1952-06-16'::date, 258, 72, '{foo,bar,baz}'::text[], '2001-01-28 01:02:03-05'::timestamptz from generate_series(100001, 100000 + $1) n", rowCount) var err error benchRows, err = pgx.AppendRows(benchRows, rows, pgx.RowToStructByPos[BenchRowSimple]) if err != nil { b.Fatal(err) } if len(benchRows) != int(rowCount) { b.Fatalf("Expected %d rows, got %d", rowCount, len(benchRows)) } } }) } } func BenchmarkSelectRowsSimpleCollectRowsRowToStructByName(b *testing.B) { conn := mustConnectString(b, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(b, conn) rowCounts := getSelectRowsCounts(b) for _, rowCount := range rowCounts { b.Run(fmt.Sprintf("%d rows", rowCount), func(b *testing.B) { for b.Loop() { rows, _ := conn.Query(context.Background(), "select n as id, 'Adam' as first_name, 'Smith ' || n as last_name, 'male' as sex, '1952-06-16'::date as birth_date, 258 as weight, 72 as height, '{foo,bar,baz}'::text[] as tags, '2001-01-28 01:02:03-05'::timestamptz as update_time from generate_series(100001, 100000 + $1) n", rowCount) benchRows, err := pgx.CollectRows(rows, pgx.RowToStructByName[BenchRowSimple]) if err != nil { b.Fatal(err) } if len(benchRows) != int(rowCount) { b.Fatalf("Expected %d rows, got %d", rowCount, len(benchRows)) } } }) } } func BenchmarkSelectRowsSimpleAppendRowsRowToStructByName(b *testing.B) { conn := mustConnectString(b, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(b, conn) rowCounts := getSelectRowsCounts(b) for _, rowCount := range rowCounts { b.Run(fmt.Sprintf("%d rows", rowCount), func(b *testing.B) { benchRows := make([]BenchRowSimple, 0, rowCount) for b.Loop() { benchRows = benchRows[:0] rows, _ := conn.Query(context.Background(), "select n, 'Adam', 'Smith ' || n, 'male', '1952-06-16'::date, 258, 72, '{foo,bar,baz}'::text[], '2001-01-28 01:02:03-05'::timestamptz from generate_series(100001, 100000 + $1) n", rowCount) var err error benchRows, err = pgx.AppendRows(benchRows, rows, pgx.RowToStructByPos[BenchRowSimple]) if err != nil { b.Fatal(err) } if len(benchRows) != int(rowCount) { b.Fatalf("Expected %d rows, got %d", rowCount, len(benchRows)) } } }) } } func BenchmarkSelectRowsPgConnExecPrepared(b *testing.B) { conn := mustConnectString(b, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(b, conn) rowCounts := getSelectRowsCounts(b) _, err := conn.PgConn().Prepare(context.Background(), "ps1", "select n, 'Adam', 'Smith ' || n, 'male', '1952-06-16'::date, 258, 72, '{foo,bar,baz}'::text[], '2001-01-28 01:02:03-05'::timestamptz from generate_series(100001, 100000 + $1) n", nil) if err != nil { b.Fatal(err) } for _, rowCount := range rowCounts { b.Run(fmt.Sprintf("%d rows", rowCount), func(b *testing.B) { formats := []struct { name string code int16 }{ {"text", pgx.TextFormatCode}, {"binary - mostly", pgx.BinaryFormatCode}, } for _, format := range formats { b.Run(format.name, func(b *testing.B) { for b.Loop() { rr := conn.PgConn().ExecPrepared( context.Background(), "ps1", [][]byte{[]byte(strconv.FormatInt(rowCount, 10))}, nil, []int16{format.code, pgx.TextFormatCode, pgx.TextFormatCode, pgx.TextFormatCode, format.code, format.code, format.code, format.code, format.code}, ) for rr.NextRow() { rr.Values() } _, err := rr.Close() if err != nil { b.Fatal(err) } } }) } }) } } type queryRecorder struct { conn net.Conn writeBuf []byte readCount int } func (qr *queryRecorder) Read(b []byte) (n int, err error) { n, err = qr.conn.Read(b) qr.readCount += n return n, err } func (qr *queryRecorder) Write(b []byte) (n int, err error) { qr.writeBuf = append(qr.writeBuf, b...) return qr.conn.Write(b) } func (qr *queryRecorder) Close() error { return qr.conn.Close() } func (qr *queryRecorder) LocalAddr() net.Addr { return qr.conn.LocalAddr() } func (qr *queryRecorder) RemoteAddr() net.Addr { return qr.conn.RemoteAddr() } func (qr *queryRecorder) SetDeadline(t time.Time) error { return qr.conn.SetDeadline(t) } func (qr *queryRecorder) SetReadDeadline(t time.Time) error { return qr.conn.SetReadDeadline(t) } func (qr *queryRecorder) SetWriteDeadline(t time.Time) error { return qr.conn.SetWriteDeadline(t) } // BenchmarkSelectRowsRawPrepared hijacks a pgconn connection and inserts a queryRecorder. It then executes the query // once. The benchmark is simply sending the exact query bytes over the wire to the server and reading the expected // number of bytes back. It does nothing else. This should be the theoretical maximum performance a Go application // could achieve. func BenchmarkSelectRowsRawPrepared(b *testing.B) { rowCounts := getSelectRowsCounts(b) for _, rowCount := range rowCounts { b.Run(fmt.Sprintf("%d rows", rowCount), func(b *testing.B) { formats := []struct { name string code int16 }{ {"text", pgx.TextFormatCode}, {"binary - mostly", pgx.BinaryFormatCode}, } for _, format := range formats { b.Run(format.name, func(b *testing.B) { conn := mustConnectString(b, os.Getenv("PGX_TEST_DATABASE")).PgConn() defer conn.Close(context.Background()) _, err := conn.Prepare(context.Background(), "ps1", "select n, 'Adam', 'Smith ' || n, 'male', '1952-06-16'::date, 258, 72, '{foo,bar,baz}'::text[], '2001-01-28 01:02:03-05'::timestamptz from generate_series(100001, 100000 + $1) n", nil) if err != nil { b.Fatal(err) } hijackedConn, err := conn.Hijack() require.NoError(b, err) qr := &queryRecorder{ conn: hijackedConn.Conn, } hijackedConn.Conn = qr hijackedConn.Frontend = hijackedConn.Config.BuildFrontend(qr, qr) conn, err = pgconn.Construct(hijackedConn) require.NoError(b, err) { rr := conn.ExecPrepared( context.Background(), "ps1", [][]byte{[]byte(strconv.FormatInt(rowCount, 10))}, nil, []int16{format.code, pgx.TextFormatCode, pgx.TextFormatCode, pgx.TextFormatCode, format.code, format.code, format.code, format.code, format.code}, ) _, err := rr.Close() require.NoError(b, err) } buf := make([]byte, qr.readCount) b.ResetTimer() for b.Loop() { _, err := qr.conn.Write(qr.writeBuf) if err != nil { b.Fatal(err) } _, err = io.ReadFull(qr.conn, buf) if err != nil { b.Fatal(err) } } }) } }) } } pgx-5.8.0/ci/000077500000000000000000000000001512357711200127215ustar00rootroot00000000000000pgx-5.8.0/ci/setup_test.bash000077500000000000000000000045261512357711200157710ustar00rootroot00000000000000#!/usr/bin/env bash set -eux if [[ "${PGVERSION-}" =~ ^[0-9.]+$ ]] then sudo apt-get remove -y --purge postgresql libpq-dev libpq5 postgresql-client-common postgresql-common sudo rm -rf /var/lib/postgresql wget --quiet -O - https://www.postgresql.org/media/keys/ACCC4CF8.asc | sudo apt-key add - sudo sh -c "echo deb http://apt.postgresql.org/pub/repos/apt/ $(lsb_release -cs)-pgdg main $PGVERSION >> /etc/apt/sources.list.d/postgresql.list" sudo apt-get update -qq sudo apt-get -y -o Dpkg::Options::=--force-confdef -o Dpkg::Options::="--force-confnew" install postgresql-$PGVERSION postgresql-server-dev-$PGVERSION postgresql-contrib-$PGVERSION sudo cp testsetup/pg_hba.conf /etc/postgresql/$PGVERSION/main/pg_hba.conf sudo sh -c "echo \"listen_addresses = '127.0.0.1'\" >> /etc/postgresql/$PGVERSION/main/postgresql.conf" sudo sh -c "cat testsetup/postgresql_ssl.conf >> /etc/postgresql/$PGVERSION/main/postgresql.conf" cd testsetup # Generate CA, server, and encrypted client certificates. go run generate_certs.go # Copy certificates to server directory and set permissions. sudo cp ca.pem /var/lib/postgresql/$PGVERSION/main/root.crt sudo chown postgres:postgres /var/lib/postgresql/$PGVERSION/main/root.crt sudo cp localhost.key /var/lib/postgresql/$PGVERSION/main/server.key sudo chown postgres:postgres /var/lib/postgresql/$PGVERSION/main/server.key sudo chmod 600 /var/lib/postgresql/$PGVERSION/main/server.key sudo cp localhost.crt /var/lib/postgresql/$PGVERSION/main/server.crt sudo chown postgres:postgres /var/lib/postgresql/$PGVERSION/main/server.crt cp ca.pem /tmp cp pgx_sslcert.key /tmp cp pgx_sslcert.crt /tmp cd .. sudo /etc/init.d/postgresql restart createdb -U postgres pgx_test psql -U postgres -f testsetup/postgresql_setup.sql pgx_test fi if [[ "${PGVERSION-}" =~ ^cockroach ]] then wget -qO- https://binaries.cockroachdb.com/cockroach-v24.3.3.linux-amd64.tgz | tar xvz sudo mv cockroach-v24.3.3.linux-amd64/cockroach /usr/local/bin/ cockroach start-single-node --insecure --background --listen-addr=localhost cockroach sql --insecure -e 'create database pgx_test' fi if [ "${CRATEVERSION-}" != "" ] then docker run \ -p "6543:5432" \ -d \ crate:"$CRATEVERSION" \ crate \ -Cnetwork.host=0.0.0.0 \ -Ctransport.host=localhost \ -Clicense.enterprise=false fi pgx-5.8.0/conn.go000066400000000000000000001347251512357711200136260ustar00rootroot00000000000000package pgx import ( "context" "crypto/sha256" "database/sql" "encoding/hex" "errors" "fmt" "strconv" "strings" "time" "github.com/jackc/pgx/v5/internal/sanitize" "github.com/jackc/pgx/v5/internal/stmtcache" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgtype" ) // ConnConfig contains all the options used to establish a connection. It must be created by ParseConfig and // then it can be modified. A manually initialized ConnConfig will cause ConnectConfig to panic. type ConnConfig struct { pgconn.Config Tracer QueryTracer // Original connection string that was parsed into config. connString string // StatementCacheCapacity is maximum size of the statement cache used when executing a query with "cache_statement" // query exec mode. StatementCacheCapacity int // DescriptionCacheCapacity is the maximum size of the description cache used when executing a query with // "cache_describe" query exec mode. DescriptionCacheCapacity int // DefaultQueryExecMode controls the default mode for executing queries. By default pgx uses the extended protocol // and automatically prepares and caches prepared statements. However, this may be incompatible with proxies such as // PGBouncer. In this case it may be preferable to use QueryExecModeExec or QueryExecModeSimpleProtocol. The same // functionality can be controlled on a per query basis by passing a QueryExecMode as the first query argument. DefaultQueryExecMode QueryExecMode createdByParseConfig bool // Used to enforce created by ParseConfig rule. } // ParseConfigOptions contains options that control how a config is built such as getsslpassword. type ParseConfigOptions struct { pgconn.ParseConfigOptions } // Copy returns a deep copy of the config that is safe to use and modify. // The only exception is the tls.Config: // according to the tls.Config docs it must not be modified after creation. func (cc *ConnConfig) Copy() *ConnConfig { newConfig := new(ConnConfig) *newConfig = *cc newConfig.Config = *newConfig.Config.Copy() return newConfig } // ConnString returns the connection string as parsed by pgx.ParseConfig into pgx.ConnConfig. func (cc *ConnConfig) ConnString() string { return cc.connString } // Conn is a PostgreSQL connection handle. It is not safe for concurrent usage. Use a connection pool to manage access // to multiple database connections from multiple goroutines. type Conn struct { pgConn *pgconn.PgConn config *ConnConfig // config used when establishing this connection preparedStatements map[string]*pgconn.StatementDescription failedDescribeStatement string statementCache stmtcache.Cache descriptionCache stmtcache.Cache queryTracer QueryTracer batchTracer BatchTracer copyFromTracer CopyFromTracer prepareTracer PrepareTracer notifications []*pgconn.Notification doneChan chan struct{} closedChan chan error typeMap *pgtype.Map wbuf []byte eqb ExtendedQueryBuilder } // Identifier a PostgreSQL identifier or name. Identifiers can be composed of // multiple parts such as ["schema", "table"] or ["table", "column"]. type Identifier []string // Sanitize returns a sanitized string safe for SQL interpolation. func (ident Identifier) Sanitize() string { parts := make([]string, len(ident)) for i := range ident { s := strings.ReplaceAll(ident[i], string([]byte{0}), "") parts[i] = `"` + strings.ReplaceAll(s, `"`, `""`) + `"` } return strings.Join(parts, ".") } var ( // ErrNoRows occurs when rows are expected but none are returned. ErrNoRows = newProxyErr(sql.ErrNoRows, "no rows in result set") // ErrTooManyRows occurs when more rows than expected are returned. ErrTooManyRows = errors.New("too many rows in result set") ) func newProxyErr(background error, msg string) error { return &proxyError{ msg: msg, background: background, } } type proxyError struct { msg string background error } func (err *proxyError) Error() string { return err.msg } func (err *proxyError) Unwrap() error { return err.background } var ( errDisabledStatementCache = fmt.Errorf("cannot use QueryExecModeCacheStatement with disabled statement cache") errDisabledDescriptionCache = fmt.Errorf("cannot use QueryExecModeCacheDescribe with disabled description cache") ) // Connect establishes a connection with a PostgreSQL server with a connection string. See // pgconn.Connect for details. func Connect(ctx context.Context, connString string) (*Conn, error) { connConfig, err := ParseConfig(connString) if err != nil { return nil, err } return connect(ctx, connConfig) } // ConnectWithOptions behaves exactly like Connect with the addition of options. At the present options is only used to // provide a GetSSLPassword function. func ConnectWithOptions(ctx context.Context, connString string, options ParseConfigOptions) (*Conn, error) { connConfig, err := ParseConfigWithOptions(connString, options) if err != nil { return nil, err } return connect(ctx, connConfig) } // ConnectConfig establishes a connection with a PostgreSQL server with a configuration struct. // connConfig must have been created by ParseConfig. func ConnectConfig(ctx context.Context, connConfig *ConnConfig) (*Conn, error) { // In general this improves safety. In particular avoid the config.Config.OnNotification mutation from affecting other // connections with the same config. See https://github.com/jackc/pgx/issues/618. connConfig = connConfig.Copy() return connect(ctx, connConfig) } // ParseConfigWithOptions behaves exactly as ParseConfig does with the addition of options. At the present options is // only used to provide a GetSSLPassword function. func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*ConnConfig, error) { config, err := pgconn.ParseConfigWithOptions(connString, options.ParseConfigOptions) if err != nil { return nil, err } statementCacheCapacity := 512 if s, ok := config.RuntimeParams["statement_cache_capacity"]; ok { delete(config.RuntimeParams, "statement_cache_capacity") n, err := strconv.ParseInt(s, 10, 32) if err != nil { return nil, pgconn.NewParseConfigError(connString, "cannot parse statement_cache_capacity", err) } statementCacheCapacity = int(n) } descriptionCacheCapacity := 512 if s, ok := config.RuntimeParams["description_cache_capacity"]; ok { delete(config.RuntimeParams, "description_cache_capacity") n, err := strconv.ParseInt(s, 10, 32) if err != nil { return nil, pgconn.NewParseConfigError(connString, "cannot parse description_cache_capacity", err) } descriptionCacheCapacity = int(n) } defaultQueryExecMode := QueryExecModeCacheStatement if s, ok := config.RuntimeParams["default_query_exec_mode"]; ok { delete(config.RuntimeParams, "default_query_exec_mode") switch s { case "cache_statement": defaultQueryExecMode = QueryExecModeCacheStatement case "cache_describe": defaultQueryExecMode = QueryExecModeCacheDescribe case "describe_exec": defaultQueryExecMode = QueryExecModeDescribeExec case "exec": defaultQueryExecMode = QueryExecModeExec case "simple_protocol": defaultQueryExecMode = QueryExecModeSimpleProtocol default: return nil, pgconn.NewParseConfigError(connString, "invalid default_query_exec_mode", err) } } connConfig := &ConnConfig{ Config: *config, createdByParseConfig: true, StatementCacheCapacity: statementCacheCapacity, DescriptionCacheCapacity: descriptionCacheCapacity, DefaultQueryExecMode: defaultQueryExecMode, connString: connString, } return connConfig, nil } // ParseConfig creates a ConnConfig from a connection string. ParseConfig handles all options that [pgconn.ParseConfig] // does. In addition, it accepts the following options: // // - default_query_exec_mode. // Possible values: "cache_statement", "cache_describe", "describe_exec", "exec", and "simple_protocol". See // QueryExecMode constant documentation for the meaning of these values. Default: "cache_statement". // // - statement_cache_capacity. // The maximum size of the statement cache used when executing a query with "cache_statement" query exec mode. // Default: 512. // // - description_cache_capacity. // The maximum size of the description cache used when executing a query with "cache_describe" query exec mode. // Default: 512. func ParseConfig(connString string) (*ConnConfig, error) { return ParseConfigWithOptions(connString, ParseConfigOptions{}) } // connect connects to a database. connect takes ownership of config. The caller must not use or access it again. func connect(ctx context.Context, config *ConnConfig) (c *Conn, err error) { if connectTracer, ok := config.Tracer.(ConnectTracer); ok { ctx = connectTracer.TraceConnectStart(ctx, TraceConnectStartData{ConnConfig: config}) defer func() { connectTracer.TraceConnectEnd(ctx, TraceConnectEndData{Conn: c, Err: err}) }() } // Default values are set in ParseConfig. Enforce initial creation by ParseConfig rather than setting defaults from // zero values. if !config.createdByParseConfig { panic("config must be created by ParseConfig") } c = &Conn{ config: config, typeMap: pgtype.NewMap(), queryTracer: config.Tracer, } if t, ok := c.queryTracer.(BatchTracer); ok { c.batchTracer = t } if t, ok := c.queryTracer.(CopyFromTracer); ok { c.copyFromTracer = t } if t, ok := c.queryTracer.(PrepareTracer); ok { c.prepareTracer = t } // Only install pgx notification system if no other callback handler is present. if config.Config.OnNotification == nil { config.Config.OnNotification = c.bufferNotifications } c.pgConn, err = pgconn.ConnectConfig(ctx, &config.Config) if err != nil { return nil, err } c.preparedStatements = make(map[string]*pgconn.StatementDescription) c.doneChan = make(chan struct{}) c.closedChan = make(chan error) c.wbuf = make([]byte, 0, 1024) if c.config.StatementCacheCapacity > 0 { c.statementCache = stmtcache.NewLRUCache(c.config.StatementCacheCapacity) } if c.config.DescriptionCacheCapacity > 0 { c.descriptionCache = stmtcache.NewLRUCache(c.config.DescriptionCacheCapacity) } return c, nil } // Close closes a connection. It is safe to call Close on an already closed // connection. func (c *Conn) Close(ctx context.Context) error { if c.IsClosed() { return nil } err := c.pgConn.Close(ctx) return err } // Prepare creates a prepared statement with name and sql. sql can contain placeholders for bound parameters. These // placeholders are referenced positionally as $1, $2, etc. name can be used instead of sql with Query, QueryRow, and // Exec to execute the statement. It can also be used with Batch.Queue. // // The underlying PostgreSQL identifier for the prepared statement will be name if name != sql or a digest of sql if // name == sql. // // Prepare is idempotent; i.e. it is safe to call Prepare multiple times with the same name and sql arguments. This // allows a code path to Prepare and Query/Exec without concern for if the statement has already been prepared. func (c *Conn) Prepare(ctx context.Context, name, sql string) (sd *pgconn.StatementDescription, err error) { if c.failedDescribeStatement != "" { err = c.Deallocate(ctx, c.failedDescribeStatement) if err != nil { return nil, fmt.Errorf("failed to deallocate previously failed statement %q: %w", c.failedDescribeStatement, err) } c.failedDescribeStatement = "" } if c.prepareTracer != nil { ctx = c.prepareTracer.TracePrepareStart(ctx, c, TracePrepareStartData{Name: name, SQL: sql}) } if name != "" { var ok bool if sd, ok = c.preparedStatements[name]; ok && sd.SQL == sql { if c.prepareTracer != nil { c.prepareTracer.TracePrepareEnd(ctx, c, TracePrepareEndData{AlreadyPrepared: true}) } return sd, nil } } if c.prepareTracer != nil { defer func() { c.prepareTracer.TracePrepareEnd(ctx, c, TracePrepareEndData{Err: err}) }() } var psName, psKey string if name == sql { digest := sha256.Sum256([]byte(sql)) psName = "stmt_" + hex.EncodeToString(digest[0:24]) psKey = sql } else { psName = name psKey = name } sd, err = c.pgConn.Prepare(ctx, psName, sql, nil) if err != nil { var pErr *pgconn.PrepareError if errors.As(err, &pErr) { c.failedDescribeStatement = psKey } return nil, err } if psKey != "" { c.preparedStatements[psKey] = sd } return sd, nil } // Deallocate releases a prepared statement. Calling Deallocate on a non-existent prepared statement will succeed. func (c *Conn) Deallocate(ctx context.Context, name string) error { var psName string sd := c.preparedStatements[name] if sd != nil { psName = sd.Name } else { psName = name } err := c.pgConn.Deallocate(ctx, psName) if err != nil { return err } if sd != nil { delete(c.preparedStatements, name) } return nil } // DeallocateAll releases all previously prepared statements from the server and client, where it also resets the statement and description cache. func (c *Conn) DeallocateAll(ctx context.Context) error { c.preparedStatements = map[string]*pgconn.StatementDescription{} if c.config.StatementCacheCapacity > 0 { c.statementCache = stmtcache.NewLRUCache(c.config.StatementCacheCapacity) } if c.config.DescriptionCacheCapacity > 0 { c.descriptionCache = stmtcache.NewLRUCache(c.config.DescriptionCacheCapacity) } _, err := c.pgConn.Exec(ctx, "deallocate all").ReadAll() return err } func (c *Conn) bufferNotifications(_ *pgconn.PgConn, n *pgconn.Notification) { c.notifications = append(c.notifications, n) } // WaitForNotification waits for a PostgreSQL notification. It wraps the underlying pgconn notification system in a // slightly more convenient form. func (c *Conn) WaitForNotification(ctx context.Context) (*pgconn.Notification, error) { var n *pgconn.Notification // Return already received notification immediately if len(c.notifications) > 0 { n = c.notifications[0] c.notifications = c.notifications[1:] return n, nil } err := c.pgConn.WaitForNotification(ctx) if len(c.notifications) > 0 { n = c.notifications[0] c.notifications = c.notifications[1:] } return n, err } // IsClosed reports if the connection has been closed. func (c *Conn) IsClosed() bool { return c.pgConn.IsClosed() } func (c *Conn) die() { if c.IsClosed() { return } ctx, cancel := context.WithCancel(context.Background()) cancel() // force immediate hard cancel c.pgConn.Close(ctx) } func quoteIdentifier(s string) string { return `"` + strings.ReplaceAll(s, `"`, `""`) + `"` } // Ping delegates to the underlying *pgconn.PgConn.Ping. func (c *Conn) Ping(ctx context.Context) error { return c.pgConn.Ping(ctx) } // PgConn returns the underlying *pgconn.PgConn. This is an escape hatch method that allows lower level access to the // PostgreSQL connection than pgx exposes. // // It is strongly recommended that the connection be idle (no in-progress queries) before the underlying *pgconn.PgConn // is used and the connection must be returned to the same state before any *pgx.Conn methods are again used. func (c *Conn) PgConn() *pgconn.PgConn { return c.pgConn } // TypeMap returns the connection info used for this connection. func (c *Conn) TypeMap() *pgtype.Map { return c.typeMap } // Config returns a copy of config that was used to establish this connection. func (c *Conn) Config() *ConnConfig { return c.config.Copy() } // Exec executes sql. sql can be either a prepared statement name or an SQL string. arguments should be referenced // positionally from the sql string as $1, $2, etc. func (c *Conn) Exec(ctx context.Context, sql string, arguments ...any) (pgconn.CommandTag, error) { if c.queryTracer != nil { ctx = c.queryTracer.TraceQueryStart(ctx, c, TraceQueryStartData{SQL: sql, Args: arguments}) } if err := c.deallocateInvalidatedCachedStatements(ctx); err != nil { return pgconn.CommandTag{}, err } commandTag, err := c.exec(ctx, sql, arguments...) if c.queryTracer != nil { c.queryTracer.TraceQueryEnd(ctx, c, TraceQueryEndData{CommandTag: commandTag, Err: err}) } return commandTag, err } func (c *Conn) exec(ctx context.Context, sql string, arguments ...any) (commandTag pgconn.CommandTag, err error) { mode := c.config.DefaultQueryExecMode var queryRewriter QueryRewriter optionLoop: for len(arguments) > 0 { switch arg := arguments[0].(type) { case QueryExecMode: mode = arg arguments = arguments[1:] case QueryRewriter: queryRewriter = arg arguments = arguments[1:] default: break optionLoop } } if queryRewriter != nil { sql, arguments, err = queryRewriter.RewriteQuery(ctx, c, sql, arguments) if err != nil { return pgconn.CommandTag{}, fmt.Errorf("rewrite query failed: %w", err) } } // Always use simple protocol when there are no arguments. if len(arguments) == 0 { mode = QueryExecModeSimpleProtocol } defer func() { if err != nil { if sc := c.statementCache; sc != nil { sc.Invalidate(sql) } if sc := c.descriptionCache; sc != nil { sc.Invalidate(sql) } } }() if sd, ok := c.preparedStatements[sql]; ok { return c.execPrepared(ctx, sd, arguments) } switch mode { case QueryExecModeCacheStatement: if c.statementCache == nil { return pgconn.CommandTag{}, errDisabledStatementCache } sd := c.statementCache.Get(sql) if sd == nil { sd, err = c.Prepare(ctx, stmtcache.StatementName(sql), sql) if err != nil { return pgconn.CommandTag{}, err } c.statementCache.Put(sd) } return c.execPrepared(ctx, sd, arguments) case QueryExecModeCacheDescribe: if c.descriptionCache == nil { return pgconn.CommandTag{}, errDisabledDescriptionCache } sd := c.descriptionCache.Get(sql) if sd == nil { sd, err = c.Prepare(ctx, "", sql) if err != nil { return pgconn.CommandTag{}, err } c.descriptionCache.Put(sd) } return c.execParams(ctx, sd, arguments) case QueryExecModeDescribeExec: sd, err := c.Prepare(ctx, "", sql) if err != nil { return pgconn.CommandTag{}, err } return c.execPrepared(ctx, sd, arguments) case QueryExecModeExec: return c.execSQLParams(ctx, sql, arguments) case QueryExecModeSimpleProtocol: return c.execSimpleProtocol(ctx, sql, arguments) default: return pgconn.CommandTag{}, fmt.Errorf("unknown QueryExecMode: %v", mode) } } func (c *Conn) execSimpleProtocol(ctx context.Context, sql string, arguments []any) (commandTag pgconn.CommandTag, err error) { if len(arguments) > 0 { sql, err = c.sanitizeForSimpleQuery(sql, arguments...) if err != nil { return pgconn.CommandTag{}, err } } mrr := c.pgConn.Exec(ctx, sql) for mrr.NextResult() { commandTag, _ = mrr.ResultReader().Close() } err = mrr.Close() return commandTag, err } func (c *Conn) execParams(ctx context.Context, sd *pgconn.StatementDescription, arguments []any) (pgconn.CommandTag, error) { err := c.eqb.Build(c.typeMap, sd, arguments) if err != nil { return pgconn.CommandTag{}, err } result := c.pgConn.ExecParams(ctx, sd.SQL, c.eqb.ParamValues, sd.ParamOIDs, c.eqb.ParamFormats, c.eqb.ResultFormats).Read() c.eqb.reset() // Allow c.eqb internal memory to be GC'ed as soon as possible. return result.CommandTag, result.Err } func (c *Conn) execPrepared(ctx context.Context, sd *pgconn.StatementDescription, arguments []any) (pgconn.CommandTag, error) { err := c.eqb.Build(c.typeMap, sd, arguments) if err != nil { return pgconn.CommandTag{}, err } result := c.pgConn.ExecPrepared(ctx, sd.Name, c.eqb.ParamValues, c.eqb.ParamFormats, c.eqb.ResultFormats).Read() c.eqb.reset() // Allow c.eqb internal memory to be GC'ed as soon as possible. return result.CommandTag, result.Err } func (c *Conn) execSQLParams(ctx context.Context, sql string, args []any) (pgconn.CommandTag, error) { err := c.eqb.Build(c.typeMap, nil, args) if err != nil { return pgconn.CommandTag{}, err } result := c.pgConn.ExecParams(ctx, sql, c.eqb.ParamValues, nil, c.eqb.ParamFormats, c.eqb.ResultFormats).Read() c.eqb.reset() // Allow c.eqb internal memory to be GC'ed as soon as possible. return result.CommandTag, result.Err } func (c *Conn) getRows(ctx context.Context, sql string, args []any) *baseRows { r := &baseRows{} r.ctx = ctx r.queryTracer = c.queryTracer r.typeMap = c.typeMap r.startTime = time.Now() r.sql = sql r.args = args r.conn = c return r } type QueryExecMode int32 const ( _ QueryExecMode = iota // Automatically prepare and cache statements. This uses the extended protocol. Queries are executed in a single round // trip after the statement is cached. This is the default. If the database schema is modified or the search_path is // changed after a statement is cached then the first execution of a previously cached query may fail. e.g. If the // number of columns returned by a "SELECT *" changes or the type of a column is changed. QueryExecModeCacheStatement // Cache statement descriptions (i.e. argument and result types) and assume they do not change. This uses the extended // protocol. Queries are executed in a single round trip after the description is cached. If the database schema is // modified or the search_path is changed after a statement is cached then the first execution of a previously cached // query may fail. e.g. If the number of columns returned by a "SELECT *" changes or the type of a column is changed. QueryExecModeCacheDescribe // Get the statement description on every execution. This uses the extended protocol. Queries require two round trips // to execute. It does not use named prepared statements. But it does use the unnamed prepared statement to get the // statement description on the first round trip and then uses it to execute the query on the second round trip. This // may cause problems with connection poolers that switch the underlying connection between round trips. It is safe // even when the database schema is modified concurrently. QueryExecModeDescribeExec // Assume the PostgreSQL query parameter types based on the Go type of the arguments. This uses the extended protocol // with text formatted parameters and results. Queries are executed in a single round trip. Type mappings can be // registered with pgtype.Map.RegisterDefaultPgType. Queries will be rejected that have arguments that are // unregistered or ambiguous. e.g. A map[string]string may have the PostgreSQL type json or hstore. Modes that know // the PostgreSQL type can use a map[string]string directly as an argument. This mode cannot. // // On rare occasions user defined types may behave differently when encoded in the text format instead of the binary // format. For example, this could happen if a "type RomanNumeral int32" implements fmt.Stringer to format integers as // Roman numerals (e.g. 7 is VII). The binary format would properly encode the integer 7 as the binary value for 7. // But the text format would encode the integer 7 as the string "VII". As QueryExecModeExec uses the text format, it // is possible that changing query mode from another mode to QueryExecModeExec could change the behavior of the query. // This should not occur with types pgx supports directly and can be avoided by registering the types with // pgtype.Map.RegisterDefaultPgType and implementing the appropriate type interfaces. In the cas of RomanNumeral, it // should implement pgtype.Int64Valuer. QueryExecModeExec // Use the simple protocol. Assume the PostgreSQL query parameter types based on the Go type of the arguments. This is // especially significant for []byte values. []byte values are encoded as PostgreSQL bytea. string must be used // instead for text type values including json and jsonb. Type mappings can be registered with // pgtype.Map.RegisterDefaultPgType. Queries will be rejected that have arguments that are unregistered or ambiguous. // e.g. A map[string]string may have the PostgreSQL type json or hstore. Modes that know the PostgreSQL type can use a // map[string]string directly as an argument. This mode cannot. Queries are executed in a single round trip. // // QueryExecModeSimpleProtocol should have the user application visible behavior as QueryExecModeExec. This includes // the warning regarding differences in text format and binary format encoding with user defined types. There may be // other minor exceptions such as behavior when multiple result returning queries are erroneously sent in a single // string. // // QueryExecModeSimpleProtocol uses client side parameter interpolation. All values are quoted and escaped. Prefer // QueryExecModeExec over QueryExecModeSimpleProtocol whenever possible. In general QueryExecModeSimpleProtocol should // only be used if connecting to a proxy server, connection pool server, or non-PostgreSQL server that does not // support the extended protocol. QueryExecModeSimpleProtocol ) func (m QueryExecMode) String() string { switch m { case QueryExecModeCacheStatement: return "cache statement" case QueryExecModeCacheDescribe: return "cache describe" case QueryExecModeDescribeExec: return "describe exec" case QueryExecModeExec: return "exec" case QueryExecModeSimpleProtocol: return "simple protocol" default: return "invalid" } } // QueryResultFormats controls the result format (text=0, binary=1) of a query by result column position. type QueryResultFormats []int16 // QueryResultFormatsByOID controls the result format (text=0, binary=1) of a query by the result column OID. type QueryResultFormatsByOID map[uint32]int16 // QueryRewriter rewrites a query when used as the first arguments to a query method. type QueryRewriter interface { RewriteQuery(ctx context.Context, conn *Conn, sql string, args []any) (newSQL string, newArgs []any, err error) } // Query sends a query to the server and returns a Rows to read the results. Only errors encountered sending the query // and initializing Rows will be returned. Err() on the returned Rows must be checked after the Rows is closed to // determine if the query executed successfully. // // The returned Rows must be closed before the connection can be used again. It is safe to attempt to read from the // returned Rows even if an error is returned. The error will be the available in rows.Err() after rows are closed. It // is allowed to ignore the error returned from Query and handle it in Rows. // // It is possible for a call of FieldDescriptions on the returned Rows to return nil even if the Query call did not // return an error. // // It is possible for a query to return one or more rows before encountering an error. In most cases the rows should be // collected before processing rather than processed while receiving each row. This avoids the possibility of the // application processing rows from a query that the server rejected. The CollectRows function is useful here. // // An implementor of QueryRewriter may be passed as the first element of args. It can rewrite the sql and change or // replace args. For example, NamedArgs is QueryRewriter that implements named arguments. // // For extra control over how the query is executed, the types QueryExecMode, QueryResultFormats, and // QueryResultFormatsByOID may be used as the first args to control exactly how the query is executed. This is rarely // needed. See the documentation for those types for details. func (c *Conn) Query(ctx context.Context, sql string, args ...any) (Rows, error) { if c.queryTracer != nil { ctx = c.queryTracer.TraceQueryStart(ctx, c, TraceQueryStartData{SQL: sql, Args: args}) } if err := c.deallocateInvalidatedCachedStatements(ctx); err != nil { if c.queryTracer != nil { c.queryTracer.TraceQueryEnd(ctx, c, TraceQueryEndData{Err: err}) } return &baseRows{err: err, closed: true}, err } var resultFormats QueryResultFormats var resultFormatsByOID QueryResultFormatsByOID mode := c.config.DefaultQueryExecMode var queryRewriter QueryRewriter optionLoop: for len(args) > 0 { switch arg := args[0].(type) { case QueryResultFormats: resultFormats = arg args = args[1:] case QueryResultFormatsByOID: resultFormatsByOID = arg args = args[1:] case QueryExecMode: mode = arg args = args[1:] case QueryRewriter: queryRewriter = arg args = args[1:] default: break optionLoop } } if queryRewriter != nil { var err error originalSQL := sql originalArgs := args sql, args, err = queryRewriter.RewriteQuery(ctx, c, sql, args) if err != nil { rows := c.getRows(ctx, originalSQL, originalArgs) err = fmt.Errorf("rewrite query failed: %w", err) rows.fatal(err) return rows, err } } // Bypass any statement caching. if sql == "" { mode = QueryExecModeSimpleProtocol } c.eqb.reset() rows := c.getRows(ctx, sql, args) var err error sd, explicitPreparedStatement := c.preparedStatements[sql] if sd != nil || mode == QueryExecModeCacheStatement || mode == QueryExecModeCacheDescribe || mode == QueryExecModeDescribeExec { if sd == nil { sd, err = c.getStatementDescription(ctx, mode, sql) if err != nil { rows.fatal(err) return rows, err } } if len(sd.ParamOIDs) != len(args) { rows.fatal(fmt.Errorf("expected %d arguments, got %d", len(sd.ParamOIDs), len(args))) return rows, rows.err } rows.sql = sd.SQL err = c.eqb.Build(c.typeMap, sd, args) if err != nil { rows.fatal(err) return rows, rows.err } if resultFormatsByOID != nil { resultFormats = make([]int16, len(sd.Fields)) for i := range resultFormats { resultFormats[i] = resultFormatsByOID[uint32(sd.Fields[i].DataTypeOID)] } } if resultFormats == nil { resultFormats = c.eqb.ResultFormats } if !explicitPreparedStatement && mode == QueryExecModeCacheDescribe { rows.resultReader = c.pgConn.ExecParams(ctx, sql, c.eqb.ParamValues, sd.ParamOIDs, c.eqb.ParamFormats, resultFormats) } else { rows.resultReader = c.pgConn.ExecPrepared(ctx, sd.Name, c.eqb.ParamValues, c.eqb.ParamFormats, resultFormats) } } else if mode == QueryExecModeExec { err := c.eqb.Build(c.typeMap, nil, args) if err != nil { rows.fatal(err) return rows, rows.err } rows.resultReader = c.pgConn.ExecParams(ctx, sql, c.eqb.ParamValues, nil, c.eqb.ParamFormats, c.eqb.ResultFormats) } else if mode == QueryExecModeSimpleProtocol { sql, err = c.sanitizeForSimpleQuery(sql, args...) if err != nil { rows.fatal(err) return rows, err } mrr := c.pgConn.Exec(ctx, sql) if mrr.NextResult() { rows.resultReader = mrr.ResultReader() rows.multiResultReader = mrr } else { err = mrr.Close() rows.fatal(err) return rows, err } return rows, nil } else { err = fmt.Errorf("unknown QueryExecMode: %v", mode) rows.fatal(err) return rows, rows.err } c.eqb.reset() // Allow c.eqb internal memory to be GC'ed as soon as possible. return rows, rows.err } // getStatementDescription returns the statement description of the sql query // according to the given mode. // // If the mode is one that doesn't require to know the param and result OIDs // then nil is returned without error. func (c *Conn) getStatementDescription( ctx context.Context, mode QueryExecMode, sql string, ) (sd *pgconn.StatementDescription, err error) { switch mode { case QueryExecModeCacheStatement: if c.statementCache == nil { return nil, errDisabledStatementCache } sd = c.statementCache.Get(sql) if sd == nil { sd, err = c.Prepare(ctx, stmtcache.StatementName(sql), sql) if err != nil { return nil, err } c.statementCache.Put(sd) } case QueryExecModeCacheDescribe: if c.descriptionCache == nil { return nil, errDisabledDescriptionCache } sd = c.descriptionCache.Get(sql) if sd == nil { sd, err = c.Prepare(ctx, "", sql) if err != nil { return nil, err } c.descriptionCache.Put(sd) } case QueryExecModeDescribeExec: return c.Prepare(ctx, "", sql) } return sd, err } // QueryRow is a convenience wrapper over Query. Any error that occurs while // querying is deferred until calling Scan on the returned Row. That Row will // error with ErrNoRows if no rows are returned. func (c *Conn) QueryRow(ctx context.Context, sql string, args ...any) Row { rows, _ := c.Query(ctx, sql, args...) return (*connRow)(rows.(*baseRows)) } // SendBatch sends all queued queries to the server at once. All queries are run in an implicit transaction unless // explicit transaction control statements are executed. The returned BatchResults must be closed before the connection // is used again. // // Depending on the QueryExecMode, all queries may be prepared before any are executed. This means that creating a table // and using it in a subsequent query in the same batch can fail. func (c *Conn) SendBatch(ctx context.Context, b *Batch) (br BatchResults) { if len(b.QueuedQueries) == 0 { return &emptyBatchResults{conn: c} } if c.batchTracer != nil { ctx = c.batchTracer.TraceBatchStart(ctx, c, TraceBatchStartData{Batch: b}) defer func() { err := br.(interface{ earlyError() error }).earlyError() if err != nil { c.batchTracer.TraceBatchEnd(ctx, c, TraceBatchEndData{Err: err}) } }() } if err := c.deallocateInvalidatedCachedStatements(ctx); err != nil { return &batchResults{ctx: ctx, conn: c, err: err} } for _, bi := range b.QueuedQueries { var queryRewriter QueryRewriter sql := bi.SQL arguments := bi.Arguments optionLoop: for len(arguments) > 0 { // Update Batch.Queue function comment when additional options are implemented switch arg := arguments[0].(type) { case QueryRewriter: queryRewriter = arg arguments = arguments[1:] default: break optionLoop } } if queryRewriter != nil { var err error sql, arguments, err = queryRewriter.RewriteQuery(ctx, c, sql, arguments) if err != nil { return &batchResults{ctx: ctx, conn: c, err: fmt.Errorf("rewrite query failed: %w", err)} } } bi.SQL = sql bi.Arguments = arguments } // TODO: changing mode per batch? Update Batch.Queue function comment when implemented mode := c.config.DefaultQueryExecMode if mode == QueryExecModeSimpleProtocol { return c.sendBatchQueryExecModeSimpleProtocol(ctx, b) } // All other modes use extended protocol and thus can use prepared statements. for _, bi := range b.QueuedQueries { if sd, ok := c.preparedStatements[bi.SQL]; ok { bi.sd = sd } } switch mode { case QueryExecModeExec: return c.sendBatchQueryExecModeExec(ctx, b) case QueryExecModeCacheStatement: return c.sendBatchQueryExecModeCacheStatement(ctx, b) case QueryExecModeCacheDescribe: return c.sendBatchQueryExecModeCacheDescribe(ctx, b) case QueryExecModeDescribeExec: return c.sendBatchQueryExecModeDescribeExec(ctx, b) default: panic("unknown QueryExecMode") } } func (c *Conn) sendBatchQueryExecModeSimpleProtocol(ctx context.Context, b *Batch) *batchResults { var sb strings.Builder for i, bi := range b.QueuedQueries { if i > 0 { sb.WriteByte(';') } sql, err := c.sanitizeForSimpleQuery(bi.SQL, bi.Arguments...) if err != nil { return &batchResults{ctx: ctx, conn: c, err: err} } sb.WriteString(sql) } mrr := c.pgConn.Exec(ctx, sb.String()) return &batchResults{ ctx: ctx, conn: c, mrr: mrr, b: b, qqIdx: 0, } } func (c *Conn) sendBatchQueryExecModeExec(ctx context.Context, b *Batch) *batchResults { batch := &pgconn.Batch{} for _, bi := range b.QueuedQueries { sd := bi.sd if sd != nil { err := c.eqb.Build(c.typeMap, sd, bi.Arguments) if err != nil { return &batchResults{ctx: ctx, conn: c, err: err} } batch.ExecPrepared(sd.Name, c.eqb.ParamValues, c.eqb.ParamFormats, c.eqb.ResultFormats) } else { err := c.eqb.Build(c.typeMap, nil, bi.Arguments) if err != nil { return &batchResults{ctx: ctx, conn: c, err: err} } batch.ExecParams(bi.SQL, c.eqb.ParamValues, nil, c.eqb.ParamFormats, c.eqb.ResultFormats) } } c.eqb.reset() // Allow c.eqb internal memory to be GC'ed as soon as possible. mrr := c.pgConn.ExecBatch(ctx, batch) return &batchResults{ ctx: ctx, conn: c, mrr: mrr, b: b, qqIdx: 0, } } func (c *Conn) sendBatchQueryExecModeCacheStatement(ctx context.Context, b *Batch) (pbr *pipelineBatchResults) { if c.statementCache == nil { return &pipelineBatchResults{ctx: ctx, conn: c, err: errDisabledStatementCache, closed: true} } distinctNewQueries := []*pgconn.StatementDescription{} distinctNewQueriesIdxMap := make(map[string]int) for _, bi := range b.QueuedQueries { if bi.sd == nil { sd := c.statementCache.Get(bi.SQL) if sd != nil { bi.sd = sd } else { if idx, present := distinctNewQueriesIdxMap[bi.SQL]; present { bi.sd = distinctNewQueries[idx] } else { sd = &pgconn.StatementDescription{ Name: stmtcache.StatementName(bi.SQL), SQL: bi.SQL, } distinctNewQueriesIdxMap[sd.SQL] = len(distinctNewQueries) distinctNewQueries = append(distinctNewQueries, sd) bi.sd = sd } } } } return c.sendBatchExtendedWithDescription(ctx, b, distinctNewQueries, c.statementCache) } func (c *Conn) sendBatchQueryExecModeCacheDescribe(ctx context.Context, b *Batch) (pbr *pipelineBatchResults) { if c.descriptionCache == nil { return &pipelineBatchResults{ctx: ctx, conn: c, err: errDisabledDescriptionCache, closed: true} } distinctNewQueries := []*pgconn.StatementDescription{} distinctNewQueriesIdxMap := make(map[string]int) for _, bi := range b.QueuedQueries { if bi.sd == nil { sd := c.descriptionCache.Get(bi.SQL) if sd != nil { bi.sd = sd } else { if idx, present := distinctNewQueriesIdxMap[bi.SQL]; present { bi.sd = distinctNewQueries[idx] } else { sd = &pgconn.StatementDescription{ SQL: bi.SQL, } distinctNewQueriesIdxMap[sd.SQL] = len(distinctNewQueries) distinctNewQueries = append(distinctNewQueries, sd) bi.sd = sd } } } } return c.sendBatchExtendedWithDescription(ctx, b, distinctNewQueries, c.descriptionCache) } func (c *Conn) sendBatchQueryExecModeDescribeExec(ctx context.Context, b *Batch) (pbr *pipelineBatchResults) { distinctNewQueries := []*pgconn.StatementDescription{} distinctNewQueriesIdxMap := make(map[string]int) for _, bi := range b.QueuedQueries { if bi.sd == nil { if idx, present := distinctNewQueriesIdxMap[bi.SQL]; present { bi.sd = distinctNewQueries[idx] } else { sd := &pgconn.StatementDescription{ SQL: bi.SQL, } distinctNewQueriesIdxMap[sd.SQL] = len(distinctNewQueries) distinctNewQueries = append(distinctNewQueries, sd) bi.sd = sd } } } return c.sendBatchExtendedWithDescription(ctx, b, distinctNewQueries, nil) } func (c *Conn) sendBatchExtendedWithDescription(ctx context.Context, b *Batch, distinctNewQueries []*pgconn.StatementDescription, sdCache stmtcache.Cache) (pbr *pipelineBatchResults) { pipeline := c.pgConn.StartPipeline(ctx) defer func() { if pbr != nil && pbr.err != nil { pipeline.Close() } }() // Prepare any needed queries if len(distinctNewQueries) > 0 { err := func() (err error) { for _, sd := range distinctNewQueries { pipeline.SendPrepare(sd.Name, sd.SQL, nil) } // Store all statements we are preparing into the cache. It's fine if it overflows because HandleInvalidated will // clean them up later. if sdCache != nil { for _, sd := range distinctNewQueries { sdCache.Put(sd) } } // If something goes wrong preparing the statements, we need to invalidate the cache entries we just added. defer func() { if err != nil && sdCache != nil { for _, sd := range distinctNewQueries { sdCache.Invalidate(sd.SQL) } } }() err = pipeline.Sync() if err != nil { return err } for _, sd := range distinctNewQueries { results, err := pipeline.GetResults() if err != nil { return err } resultSD, ok := results.(*pgconn.StatementDescription) if !ok { return fmt.Errorf("expected statement description, got %T", results) } // Fill in the previously empty / pending statement descriptions. sd.ParamOIDs = resultSD.ParamOIDs sd.Fields = resultSD.Fields } results, err := pipeline.GetResults() if err != nil { return err } _, ok := results.(*pgconn.PipelineSync) if !ok { return fmt.Errorf("expected sync, got %T", results) } return nil }() if err != nil { return &pipelineBatchResults{ctx: ctx, conn: c, err: err, closed: true} } } // Queue the queries. for _, bi := range b.QueuedQueries { err := c.eqb.Build(c.typeMap, bi.sd, bi.Arguments) if err != nil { // we wrap the error so we the user can understand which query failed inside the batch err = fmt.Errorf("error building query %s: %w", bi.SQL, err) return &pipelineBatchResults{ctx: ctx, conn: c, err: err, closed: true} } if bi.sd.Name == "" { pipeline.SendQueryParams(bi.sd.SQL, c.eqb.ParamValues, bi.sd.ParamOIDs, c.eqb.ParamFormats, c.eqb.ResultFormats) } else { pipeline.SendQueryPrepared(bi.sd.Name, c.eqb.ParamValues, c.eqb.ParamFormats, c.eqb.ResultFormats) } } err := pipeline.Sync() if err != nil { return &pipelineBatchResults{ctx: ctx, conn: c, err: err, closed: true} } return &pipelineBatchResults{ ctx: ctx, conn: c, pipeline: pipeline, b: b, } } func (c *Conn) sanitizeForSimpleQuery(sql string, args ...any) (string, error) { if c.pgConn.ParameterStatus("standard_conforming_strings") != "on" { return "", errors.New("simple protocol queries must be run with standard_conforming_strings=on") } if c.pgConn.ParameterStatus("client_encoding") != "UTF8" { return "", errors.New("simple protocol queries must be run with client_encoding=UTF8") } var err error valueArgs := make([]any, len(args)) for i, a := range args { valueArgs[i], err = convertSimpleArgument(c.typeMap, a) if err != nil { return "", err } } return sanitize.SanitizeSQL(sql, valueArgs...) } // LoadType inspects the database for typeName and produces a pgtype.Type suitable for registration. typeName must be // the name of a type where the underlying type(s) is already understood by pgx. It is for derived types. In particular, // typeName must be one of the following: // - An array type name of a type that is already registered. e.g. "_foo" when "foo" is registered. // - A composite type name where all field types are already registered. // - A domain type name where the base type is already registered. // - An enum type name. // - A range type name where the element type is already registered. // - A multirange type name where the element type is already registered. func (c *Conn) LoadType(ctx context.Context, typeName string) (*pgtype.Type, error) { var oid uint32 err := c.QueryRow(ctx, "select $1::text::regtype::oid;", typeName).Scan(&oid) if err != nil { return nil, err } var typtype string var typbasetype uint32 err = c.QueryRow(ctx, "select typtype::text, typbasetype from pg_type where oid=$1", oid).Scan(&typtype, &typbasetype) if err != nil { return nil, err } switch typtype { case "b": // array elementOID, err := c.getArrayElementOID(ctx, oid) if err != nil { return nil, err } dt, ok := c.TypeMap().TypeForOID(elementOID) if !ok { return nil, errors.New("array element OID not registered") } return &pgtype.Type{Name: typeName, OID: oid, Codec: &pgtype.ArrayCodec{ElementType: dt}}, nil case "c": // composite fields, err := c.getCompositeFields(ctx, oid) if err != nil { return nil, err } return &pgtype.Type{Name: typeName, OID: oid, Codec: &pgtype.CompositeCodec{Fields: fields}}, nil case "d": // domain dt, ok := c.TypeMap().TypeForOID(typbasetype) if !ok { return nil, errors.New("domain base type OID not registered") } return &pgtype.Type{Name: typeName, OID: oid, Codec: dt.Codec}, nil case "e": // enum return &pgtype.Type{Name: typeName, OID: oid, Codec: &pgtype.EnumCodec{}}, nil case "r": // range elementOID, err := c.getRangeElementOID(ctx, oid) if err != nil { return nil, err } dt, ok := c.TypeMap().TypeForOID(elementOID) if !ok { return nil, errors.New("range element OID not registered") } return &pgtype.Type{Name: typeName, OID: oid, Codec: &pgtype.RangeCodec{ElementType: dt}}, nil case "m": // multirange elementOID, err := c.getMultiRangeElementOID(ctx, oid) if err != nil { return nil, err } dt, ok := c.TypeMap().TypeForOID(elementOID) if !ok { return nil, errors.New("multirange element OID not registered") } return &pgtype.Type{Name: typeName, OID: oid, Codec: &pgtype.MultirangeCodec{ElementType: dt}}, nil default: return &pgtype.Type{}, errors.New("unknown typtype") } } func (c *Conn) getArrayElementOID(ctx context.Context, oid uint32) (uint32, error) { var typelem uint32 err := c.QueryRow(ctx, "select typelem from pg_type where oid=$1", oid).Scan(&typelem) if err != nil { return 0, err } return typelem, nil } func (c *Conn) getRangeElementOID(ctx context.Context, oid uint32) (uint32, error) { var typelem uint32 err := c.QueryRow(ctx, "select rngsubtype from pg_range where rngtypid=$1", oid).Scan(&typelem) if err != nil { return 0, err } return typelem, nil } func (c *Conn) getMultiRangeElementOID(ctx context.Context, oid uint32) (uint32, error) { var typelem uint32 err := c.QueryRow(ctx, "select rngtypid from pg_range where rngmultitypid=$1", oid).Scan(&typelem) if err != nil { return 0, err } return typelem, nil } func (c *Conn) getCompositeFields(ctx context.Context, oid uint32) ([]pgtype.CompositeCodecField, error) { var typrelid uint32 err := c.QueryRow(ctx, "select typrelid from pg_type where oid=$1", oid).Scan(&typrelid) if err != nil { return nil, err } var fields []pgtype.CompositeCodecField var fieldName string var fieldOID uint32 rows, _ := c.Query(ctx, `select attname, atttypid from pg_attribute where attrelid=$1 and not attisdropped and attnum > 0 order by attnum`, typrelid, ) _, err = ForEachRow(rows, []any{&fieldName, &fieldOID}, func() error { dt, ok := c.TypeMap().TypeForOID(fieldOID) if !ok { return fmt.Errorf("unknown composite type field OID: %v", fieldOID) } fields = append(fields, pgtype.CompositeCodecField{Name: fieldName, Type: dt}) return nil }) if err != nil { return nil, err } return fields, nil } func (c *Conn) deallocateInvalidatedCachedStatements(ctx context.Context) error { if txStatus := c.pgConn.TxStatus(); txStatus != 'I' && txStatus != 'T' { return nil } if c.descriptionCache != nil { c.descriptionCache.RemoveInvalidated() } var invalidatedStatements []*pgconn.StatementDescription if c.statementCache != nil { invalidatedStatements = c.statementCache.GetInvalidated() } if len(invalidatedStatements) == 0 { return nil } pipeline := c.pgConn.StartPipeline(ctx) defer pipeline.Close() for _, sd := range invalidatedStatements { pipeline.SendDeallocate(sd.Name) } err := pipeline.Sync() if err != nil { return fmt.Errorf("failed to deallocate cached statement(s): %w", err) } err = pipeline.Close() if err != nil { return fmt.Errorf("failed to deallocate cached statement(s): %w", err) } c.statementCache.RemoveInvalidated() for _, sd := range invalidatedStatements { delete(c.preparedStatements, sd.Name) } return nil } pgx-5.8.0/conn_internal_test.go000066400000000000000000000027671512357711200165610ustar00rootroot00000000000000package pgx import ( "context" "fmt" "os" "testing" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func mustParseConfig(t testing.TB, connString string) *ConnConfig { config, err := ParseConfig(connString) require.Nil(t, err) return config } func mustConnect(t testing.TB, config *ConnConfig) *Conn { conn, err := ConnectConfig(context.Background(), config) if err != nil { t.Fatalf("Unable to establish connection: %v", err) } return conn } // Ensures the connection limits the size of its cached objects. // This test examines the internals of *Conn so must be in the same package. func TestStmtCacheSizeLimit(t *testing.T) { const cacheLimit = 16 connConfig := mustParseConfig(t, os.Getenv("PGX_TEST_DATABASE")) connConfig.StatementCacheCapacity = cacheLimit conn := mustConnect(t, connConfig) defer func() { err := conn.Close(context.Background()) if err != nil { t.Fatal(err) } }() // run a set of unique queries that should overflow the cache ctx := context.Background() for i := range cacheLimit * 2 { uniqueString := fmt.Sprintf("unique %d", i) uniqueSQL := fmt.Sprintf("select '%s'", uniqueString) var output string err := conn.QueryRow(ctx, uniqueSQL).Scan(&output) require.NoError(t, err) require.Equal(t, uniqueString, output) } // preparedStatements contains cacheLimit+1 because deallocation happens before the query assert.Len(t, conn.preparedStatements, cacheLimit+1) assert.Equal(t, cacheLimit, conn.statementCache.Len()) } pgx-5.8.0/conn_test.go000066400000000000000000001461351512357711200146630ustar00rootroot00000000000000package pgx_test import ( "bytes" "context" "database/sql" "io" "net" "os" "strings" "sync" "testing" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/internal/faultyconn" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgproto3" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func TestCrateDBConnect(t *testing.T) { t.Parallel() connString := os.Getenv("PGX_TEST_CRATEDB_CONN_STRING") if connString == "" { t.Skipf("Skipping due to missing environment variable %v", "PGX_TEST_CRATEDB_CONN_STRING") } conn, err := pgx.Connect(context.Background(), connString) require.Nil(t, err) defer closeConn(t, conn) assert.Equal(t, connString, conn.Config().ConnString()) var result int err = conn.QueryRow(context.Background(), "select 1 +1").Scan(&result) if err != nil { t.Fatalf("QueryRow Scan unexpectedly failed: %v", err) } if result != 2 { t.Errorf("bad result: %d", result) } } func TestConnect(t *testing.T) { t.Parallel() connString := os.Getenv("PGX_TEST_DATABASE") config := mustParseConfig(t, connString) conn, err := pgx.ConnectConfig(context.Background(), config) if err != nil { t.Fatalf("Unable to establish connection: %v", err) } assertConfigsEqual(t, config, conn.Config(), "Conn.Config() returns original config") var currentDB string err = conn.QueryRow(context.Background(), "select current_database()").Scan(¤tDB) if err != nil { t.Fatalf("QueryRow Scan unexpectedly failed: %v", err) } if currentDB != config.Config.Database { t.Errorf("Did not connect to specified database (%v)", config.Config.Database) } var user string err = conn.QueryRow(context.Background(), "select current_user").Scan(&user) if err != nil { t.Fatalf("QueryRow Scan unexpectedly failed: %v", err) } if user != config.Config.User { t.Errorf("Did not connect as specified user (%v)", config.Config.User) } err = conn.Close(context.Background()) if err != nil { t.Fatal("Unable to close connection") } } func TestConnectWithPreferSimpleProtocol(t *testing.T) { t.Parallel() connConfig := mustParseConfig(t, os.Getenv("PGX_TEST_DATABASE")) connConfig.DefaultQueryExecMode = pgx.QueryExecModeSimpleProtocol conn := mustConnect(t, connConfig) defer closeConn(t, conn) // If simple protocol is used we should be able to correctly scan the result // into a pgtype.Text as the integer will have been encoded in text. var s pgtype.Text err := conn.QueryRow(context.Background(), "select $1::int4", 42).Scan(&s) require.NoError(t, err) require.Equal(t, pgtype.Text{String: "42", Valid: true}, s) ensureConnValid(t, conn) } func TestConnectConfigRequiresConnConfigFromParseConfig(t *testing.T) { config := &pgx.ConnConfig{} require.PanicsWithValue(t, "config must be created by ParseConfig", func() { pgx.ConnectConfig(context.Background(), config) }) } func TestConfigContainsConnStr(t *testing.T) { connStr := os.Getenv("PGX_TEST_DATABASE") config, err := pgx.ParseConfig(connStr) require.NoError(t, err) assert.Equal(t, connStr, config.ConnString()) } func TestConfigCopyReturnsEqualConfig(t *testing.T) { connString := "postgres://jack:secret@localhost:5432/mydb?application_name=pgxtest&search_path=myschema&connect_timeout=5" original, err := pgx.ParseConfig(connString) require.NoError(t, err) copied := original.Copy() assertConfigsEqual(t, original, copied, t.Name()) } func TestConfigCopyCanBeUsedToConnect(t *testing.T) { connString := os.Getenv("PGX_TEST_DATABASE") original, err := pgx.ParseConfig(connString) require.NoError(t, err) copied := original.Copy() assert.NotPanics(t, func() { _, err = pgx.ConnectConfig(context.Background(), copied) }) assert.NoError(t, err) } func TestParseConfigExtractsStatementCacheOptions(t *testing.T) { t.Parallel() config, err := pgx.ParseConfig("statement_cache_capacity=0") require.NoError(t, err) require.EqualValues(t, 0, config.StatementCacheCapacity) config, err = pgx.ParseConfig("statement_cache_capacity=42") require.NoError(t, err) require.EqualValues(t, 42, config.StatementCacheCapacity) config, err = pgx.ParseConfig("description_cache_capacity=0") require.NoError(t, err) require.EqualValues(t, 0, config.DescriptionCacheCapacity) config, err = pgx.ParseConfig("description_cache_capacity=42") require.NoError(t, err) require.EqualValues(t, 42, config.DescriptionCacheCapacity) // default_query_exec_mode // Possible values: "cache_statement", "cache_describe", "describe_exec", "exec", and "simple_protocol". See config, err = pgx.ParseConfig("default_query_exec_mode=cache_statement") require.NoError(t, err) require.Equal(t, pgx.QueryExecModeCacheStatement, config.DefaultQueryExecMode) config, err = pgx.ParseConfig("default_query_exec_mode=cache_describe") require.NoError(t, err) require.Equal(t, pgx.QueryExecModeCacheDescribe, config.DefaultQueryExecMode) config, err = pgx.ParseConfig("default_query_exec_mode=describe_exec") require.NoError(t, err) require.Equal(t, pgx.QueryExecModeDescribeExec, config.DefaultQueryExecMode) config, err = pgx.ParseConfig("default_query_exec_mode=exec") require.NoError(t, err) require.Equal(t, pgx.QueryExecModeExec, config.DefaultQueryExecMode) config, err = pgx.ParseConfig("default_query_exec_mode=simple_protocol") require.NoError(t, err) require.Equal(t, pgx.QueryExecModeSimpleProtocol, config.DefaultQueryExecMode) } func TestParseConfigExtractsDefaultQueryExecMode(t *testing.T) { t.Parallel() for _, tt := range []struct { connString string defaultQueryExecMode pgx.QueryExecMode }{ {"", pgx.QueryExecModeCacheStatement}, {"default_query_exec_mode=cache_statement", pgx.QueryExecModeCacheStatement}, {"default_query_exec_mode=cache_describe", pgx.QueryExecModeCacheDescribe}, {"default_query_exec_mode=describe_exec", pgx.QueryExecModeDescribeExec}, {"default_query_exec_mode=exec", pgx.QueryExecModeExec}, {"default_query_exec_mode=simple_protocol", pgx.QueryExecModeSimpleProtocol}, } { config, err := pgx.ParseConfig(tt.connString) require.NoError(t, err) require.Equalf(t, tt.defaultQueryExecMode, config.DefaultQueryExecMode, "connString: `%s`", tt.connString) require.Empty(t, config.RuntimeParams["default_query_exec_mode"]) } } func TestParseConfigErrors(t *testing.T) { t.Parallel() for _, tt := range []struct { connString string expectedErrSubstring string }{ {"default_query_exec_mode=does_not_exist", "does_not_exist"}, } { config, err := pgx.ParseConfig(tt.connString) require.Nil(t, config) require.ErrorContains(t, err, tt.expectedErrSubstring) } } func TestExec(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { if results := mustExec(t, conn, "create temporary table foo(id integer primary key);"); results.String() != "CREATE TABLE" { t.Error("Unexpected results from Exec") } // Accept parameters if results := mustExec(t, conn, "insert into foo(id) values($1)", 1); results.String() != "INSERT 0 1" { t.Errorf("Unexpected results from Exec: %v", results) } if results := mustExec(t, conn, "drop table foo;"); results.String() != "DROP TABLE" { t.Error("Unexpected results from Exec") } // Multiple statements can be executed -- last command tag is returned if results := mustExec(t, conn, "create temporary table foo(id serial primary key); drop table foo;"); results.String() != "DROP TABLE" { t.Error("Unexpected results from Exec") } // Can execute longer SQL strings than sharedBufferSize if results := mustExec(t, conn, strings.Repeat("select 42; ", 1000)); results.String() != "SELECT 1" { t.Errorf("Unexpected results from Exec: %v", results) } // Exec no-op which does not return a command tag if results := mustExec(t, conn, "--;"); results.String() != "" { t.Errorf("Unexpected results from Exec: %v", results) } }) } type testQueryRewriter struct { sql string args []any } func (qr *testQueryRewriter) RewriteQuery(ctx context.Context, conn *pgx.Conn, sql string, args []any) (newSQL string, newArgs []any, err error) { return qr.sql, qr.args, nil } func TestExecWithQueryRewriter(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { qr := testQueryRewriter{sql: "select $1::int", args: []any{42}} _, err := conn.Exec(ctx, "should be replaced", &qr) require.NoError(t, err) }) } func TestExecFailure(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { if _, err := conn.Exec(context.Background(), "selct;"); err == nil { t.Fatal("Expected SQL syntax error") } rows, _ := conn.Query(context.Background(), "select 1") rows.Close() if rows.Err() != nil { t.Fatalf("Exec failure appears to have broken connection: %v", rows.Err()) } }) } func TestExecFailureWithArguments(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Exec(context.Background(), "selct $1;", 1) if err == nil { t.Fatal("Expected SQL syntax error") } assert.False(t, pgconn.SafeToRetry(err)) _, err = conn.Exec(context.Background(), "select $1::varchar(1);", "1", "2") require.Error(t, err) }) } func TestExecContextWithoutCancelation(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { ctx, cancelFunc := context.WithCancel(ctx) defer cancelFunc() commandTag, err := conn.Exec(ctx, "create temporary table foo(id integer primary key);") if err != nil { t.Fatal(err) } if commandTag.String() != "CREATE TABLE" { t.Fatalf("Unexpected results from Exec: %v", commandTag) } assert.False(t, pgconn.SafeToRetry(err)) }) } func TestExecContextFailureWithoutCancelation(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { ctx, cancelFunc := context.WithCancel(ctx) defer cancelFunc() _, err := conn.Exec(ctx, "selct;") if err == nil { t.Fatal("Expected SQL syntax error") } assert.False(t, pgconn.SafeToRetry(err)) rows, _ := conn.Query(context.Background(), "select 1") rows.Close() if rows.Err() != nil { t.Fatalf("ExecEx failure appears to have broken connection: %v", rows.Err()) } assert.False(t, pgconn.SafeToRetry(err)) }) } func TestExecContextFailureWithoutCancelationWithArguments(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { ctx, cancelFunc := context.WithCancel(ctx) defer cancelFunc() _, err := conn.Exec(ctx, "selct $1;", 1) if err == nil { t.Fatal("Expected SQL syntax error") } assert.False(t, pgconn.SafeToRetry(err)) }) } func TestExecFailureCloseBefore(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) closeConn(t, conn) _, err := conn.Exec(context.Background(), "select 1") require.Error(t, err) assert.True(t, pgconn.SafeToRetry(err)) } func TestExecPerQuerySimpleProtocol(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) ctx := t.Context() commandTag, err := conn.Exec(ctx, "create temporary table foo(name varchar primary key);") if err != nil { t.Fatal(err) } if commandTag.String() != "CREATE TABLE" { t.Fatalf("Unexpected results from Exec: %v", commandTag) } commandTag, err = conn.Exec(ctx, "insert into foo(name) values($1);", pgx.QueryExecModeSimpleProtocol, "bar'; drop table foo;--", ) if err != nil { t.Fatal(err) } if commandTag.String() != "INSERT 0 1" { t.Fatalf("Unexpected results from Exec: %v", commandTag) } } func TestPrepare(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) _, err := conn.Prepare(context.Background(), "test", "select $1::varchar") if err != nil { t.Errorf("Unable to prepare statement: %v", err) return } var s string err = conn.QueryRow(context.Background(), "test", "hello").Scan(&s) if err != nil { t.Errorf("Executing prepared statement failed: %v", err) } if s != "hello" { t.Errorf("Prepared statement did not return expected value: %v", s) } err = conn.Deallocate(context.Background(), "test") if err != nil { t.Errorf("conn.Deallocate failed: %v", err) } // Create another prepared statement to ensure Deallocate left the connection // in a working state and that we can reuse the prepared statement name. _, err = conn.Prepare(context.Background(), "test", "select $1::integer") if err != nil { t.Errorf("Unable to prepare statement: %v", err) return } var n int32 err = conn.QueryRow(context.Background(), "test", int32(1)).Scan(&n) if err != nil { t.Errorf("Executing prepared statement failed: %v", err) } if n != 1 { t.Errorf("Prepared statement did not return expected value: %v", s) } err = conn.DeallocateAll(context.Background()) if err != nil { t.Errorf("conn.Deallocate failed: %v", err) } } // https://github.com/jackc/pgx/issues/2223 func TestPrepareHandlesTimeoutBetweenParseAndDescribe(t *testing.T) { // Not parallel because it is a timing sensitive test. config, err := pgx.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) var faultyConn *faultyconn.Conn config.AfterNetConnect = func(ctx context.Context, config *pgconn.Config, conn net.Conn) (net.Conn, error) { faultyConn = faultyconn.New(conn) return faultyConn, nil } ctx := context.Background() conn, err := pgx.ConnectConfig(ctx, config) require.NoError(t, err) defer closeConn(t, conn) require.NotNil(t, faultyConn) pgxtest.SkipCockroachDB(t, conn, "Induced error does not occur on CockroachDB") _, err = conn.Exec(ctx, "set statement_timeout = '100ms'") require.NoError(t, err) faultyConn.HandleFrontendMessage = func(backendWriter io.Writer, msg pgproto3.FrontendMessage) error { if _, ok := msg.(*pgproto3.Describe); ok { time.Sleep(200 * time.Millisecond) } buf, err := msg.Encode(nil) if err != nil { return err } _, err = backendWriter.Write(buf) return err } psd, err := conn.Prepare(ctx, "test", "select $1::varchar") var pgErr *pgconn.PgError require.ErrorAs(t, err, &pgErr) require.Equal(t, "57014", pgErr.Code) require.Nil(t, psd) faultyConn.HandleFrontendMessage = nil _, err = conn.Exec(ctx, "set statement_timeout = default") require.NoError(t, err) var existsOnServer bool err = conn.QueryRow( ctx, "select exists(select 1 from pg_prepared_statements where name = 'test')", // Avoid using the prepared statement cache or it will clear the broken statement before we can check for its // existence. pgx.QueryExecModeExec, ).Scan(&existsOnServer) require.NoError(t, err) require.True(t, existsOnServer) psd, err = conn.Prepare(ctx, "test", "select $1::varchar") require.NoError(t, err) require.NotNil(t, psd) } func TestPrepareBadSQLFailure(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) if _, err := conn.Prepare(context.Background(), "badSQL", "select foo"); err == nil { t.Fatal("Prepare should have failed with syntax error") } ensureConnValid(t, conn) } func TestPrepareIdempotency(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { for i := range 2 { _, err := conn.Prepare(context.Background(), "test", "select 42::integer") if err != nil { t.Fatalf("%d. Unable to prepare statement: %v", i, err) } var n int32 err = conn.QueryRow(context.Background(), "test").Scan(&n) if err != nil { t.Errorf("%d. Executing prepared statement failed: %v", i, err) } if n != int32(42) { t.Errorf("%d. Prepared statement did not return expected value: %v", i, n) } } _, err := conn.Prepare(context.Background(), "test", "select 'fail'::varchar") if err == nil { t.Fatalf("Prepare statement with same name but different SQL should have failed but it didn't") return } }) } func TestPrepareStatementCacheModes(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Prepare(context.Background(), "test", "select $1::text") require.NoError(t, err) var s string err = conn.QueryRow(context.Background(), "test", "hello").Scan(&s) require.NoError(t, err) require.Equal(t, "hello", s) }) } func TestPrepareWithDigestedName(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { sql := "select $1::text" sd, err := conn.Prepare(ctx, sql, sql) require.NoError(t, err) require.Equal(t, "stmt_2510cc7db17de3f42758a2a29c8b9ef8305d007b997ebdd6", sd.Name) var s string err = conn.QueryRow(ctx, sql, "hello").Scan(&s) require.NoError(t, err) require.Equal(t, "hello", s) err = conn.Deallocate(ctx, sql) require.NoError(t, err) }) } // https://github.com/jackc/pgx/pull/1795 func TestDeallocateInAbortedTransaction(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { tx, err := conn.Begin(ctx) require.NoError(t, err) sql := "select $1::text" sd, err := tx.Prepare(ctx, sql, sql) require.NoError(t, err) require.Equal(t, "stmt_2510cc7db17de3f42758a2a29c8b9ef8305d007b997ebdd6", sd.Name) var s string err = tx.QueryRow(ctx, sql, "hello").Scan(&s) require.NoError(t, err) require.Equal(t, "hello", s) _, err = tx.Exec(ctx, "select 1/0") // abort transaction with divide by zero error require.Error(t, err) err = conn.Deallocate(ctx, sql) require.NoError(t, err) err = tx.Rollback(ctx) require.NoError(t, err) sd, err = conn.Prepare(ctx, sql, sql) require.NoError(t, err) require.Equal(t, "stmt_2510cc7db17de3f42758a2a29c8b9ef8305d007b997ebdd6", sd.Name) }) } func TestDeallocateMissingPreparedStatementStillClearsFromPreparedStatementMap(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Prepare(ctx, "ps", "select $1::text") require.NoError(t, err) _, err = conn.Exec(ctx, "deallocate ps") require.NoError(t, err) err = conn.Deallocate(ctx, "ps") require.NoError(t, err) _, err = conn.Prepare(ctx, "ps", "select $1::text, $2::text") require.NoError(t, err) var s1, s2 string err = conn.QueryRow(ctx, "ps", "hello", "world").Scan(&s1, &s2) require.NoError(t, err) require.Equal(t, "hello", s1) require.Equal(t, "world", s2) }) } func TestListenNotify(t *testing.T) { t.Parallel() listener := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, listener) if listener.PgConn().ParameterStatus("crdb_version") != "" { t.Skip("Server does not support LISTEN / NOTIFY (https://github.com/cockroachdb/cockroach/issues/41522)") } mustExec(t, listener, "listen chat") notifier := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, notifier) mustExec(t, notifier, "notify chat") // when notification is waiting on the socket to be read notification, err := listener.WaitForNotification(context.Background()) require.NoError(t, err) assert.Equal(t, "chat", notification.Channel) // when notification has already been read during previous query mustExec(t, notifier, "notify chat") rows, _ := listener.Query(context.Background(), "select 1") rows.Close() require.NoError(t, rows.Err()) ctx, cancelFn := context.WithCancel(context.Background()) cancelFn() notification, err = listener.WaitForNotification(ctx) require.NoError(t, err) assert.Equal(t, "chat", notification.Channel) // when timeout occurs ctx, cancel := context.WithTimeout(context.Background(), time.Millisecond) defer cancel() notification, err = listener.WaitForNotification(ctx) assert.True(t, pgconn.Timeout(err)) assert.Nil(t, notification) // listener can listen again after a timeout mustExec(t, notifier, "notify chat") notification, err = listener.WaitForNotification(context.Background()) require.NoError(t, err) assert.Equal(t, "chat", notification.Channel) } func TestListenNotifyWhileBusyIsSafe(t *testing.T) { t.Parallel() func() { conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server does not support LISTEN / NOTIFY (https://github.com/cockroachdb/cockroach/issues/41522)") }() listenerDone := make(chan bool) notifierDone := make(chan bool) listening := make(chan bool) go func() { conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) defer func() { listenerDone <- true }() mustExec(t, conn, "listen busysafe") listening <- true for range 5000 { var sum int32 var rowCount int32 rows, err := conn.Query(context.Background(), "select generate_series(1,$1)", 100) if err != nil { t.Errorf("conn.Query failed: %v", err) return } for rows.Next() { var n int32 if err := rows.Scan(&n); err != nil { t.Errorf("Row scan failed: %v", err) return } sum += n rowCount++ } if rows.Err() != nil { t.Errorf("conn.Query failed: %v", rows.Err()) return } if sum != 5050 { t.Errorf("Wrong rows sum: %v", sum) return } if rowCount != 100 { t.Errorf("Wrong number of rows: %v", rowCount) return } } }() go func() { conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) defer func() { notifierDone <- true }() <-listening for range 100_000 { mustExec(t, conn, "notify busysafe, 'hello'") } }() <-listenerDone <-notifierDone } func TestListenNotifySelfNotification(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server does not support LISTEN / NOTIFY (https://github.com/cockroachdb/cockroach/issues/41522)") mustExec(t, conn, "listen self") // Notify self and WaitForNotification immediately mustExec(t, conn, "notify self") ctx, cancel := context.WithTimeout(context.Background(), time.Second) defer cancel() notification, err := conn.WaitForNotification(ctx) require.NoError(t, err) assert.Equal(t, "self", notification.Channel) // Notify self and do something else before WaitForNotification mustExec(t, conn, "notify self") rows, _ := conn.Query(context.Background(), "select 1") rows.Close() if rows.Err() != nil { t.Fatalf("Unexpected error on Query: %v", rows.Err()) } ctx, cncl := context.WithTimeout(context.Background(), time.Second) defer cncl() notification, err = conn.WaitForNotification(ctx) require.NoError(t, err) assert.Equal(t, "self", notification.Channel) } func TestFatalRxError(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server does not support pg_terminate_backend() (https://github.com/cockroachdb/cockroach/issues/35897)") var wg sync.WaitGroup wg.Add(1) go func() { defer wg.Done() var n int32 var s string err := conn.QueryRow(context.Background(), "select 1::int4, pg_sleep(10)::varchar").Scan(&n, &s) if pgErr, ok := err.(*pgconn.PgError); ok && pgErr.Severity == "FATAL" { } else { t.Errorf("Expected QueryRow Scan to return fatal PgError, but instead received %v", err) return } }() otherConn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer otherConn.Close(context.Background()) if _, err := otherConn.Exec(context.Background(), "select pg_terminate_backend($1)", conn.PgConn().PID()); err != nil { t.Fatalf("Unable to kill backend PostgreSQL process: %v", err) } wg.Wait() if !conn.IsClosed() { t.Fatal("Connection should be closed") } } func TestFatalTxError(t *testing.T) { t.Parallel() // Run timing sensitive test many times for range 50 { func() { conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server does not support pg_terminate_backend() (https://github.com/cockroachdb/cockroach/issues/35897)") otherConn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer otherConn.Close(context.Background()) _, err := otherConn.Exec(context.Background(), "select pg_terminate_backend($1)", conn.PgConn().PID()) if err != nil { t.Fatalf("Unable to kill backend PostgreSQL process: %v", err) } err = conn.QueryRow(context.Background(), "select 1").Scan(nil) if err == nil { t.Fatal("Expected error but none occurred") } if !conn.IsClosed() { t.Fatalf("Connection should be closed but isn't. Previous Query err: %v", err) } }() } } func TestInsertBoolArray(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { if results := mustExec(t, conn, "create temporary table foo(spice bool[]);"); results.String() != "CREATE TABLE" { t.Error("Unexpected results from Exec") } // Accept parameters if results := mustExec(t, conn, "insert into foo(spice) values($1)", []bool{true, false, true}); results.String() != "INSERT 0 1" { t.Errorf("Unexpected results from Exec: %v", results) } }) } func TestInsertTimestampArray(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { if results := mustExec(t, conn, "create temporary table foo(spice timestamp[]);"); results.String() != "CREATE TABLE" { t.Error("Unexpected results from Exec") } // Accept parameters if results := mustExec(t, conn, "insert into foo(spice) values($1)", []time.Time{time.Unix(1419143667, 0), time.Unix(1419143672, 0)}); results.String() != "INSERT 0 1" { t.Errorf("Unexpected results from Exec: %v", results) } }) } func TestIdentifierSanitize(t *testing.T) { t.Parallel() tests := []struct { ident pgx.Identifier expected string }{ { ident: pgx.Identifier{`foo`}, expected: `"foo"`, }, { ident: pgx.Identifier{`select`}, expected: `"select"`, }, { ident: pgx.Identifier{`foo`, `bar`}, expected: `"foo"."bar"`, }, { ident: pgx.Identifier{`you should " not do this`}, expected: `"you should "" not do this"`, }, { ident: pgx.Identifier{`you should " not do this`, `please don't`}, expected: `"you should "" not do this"."please don't"`, }, { ident: pgx.Identifier{`you should ` + string([]byte{0}) + `not do this`}, expected: `"you should not do this"`, }, } for i, tt := range tests { qval := tt.ident.Sanitize() if qval != tt.expected { t.Errorf("%d. Expected Sanitize %v to return %v but it was %v", i, tt.ident, tt.expected, qval) } } } func TestConnInitTypeMap(t *testing.T) { conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) // spot check that the standard postgres type names aren't qualified nameOIDs := map[string]uint32{ "_int8": pgtype.Int8ArrayOID, "int8": pgtype.Int8OID, "json": pgtype.JSONOID, "text": pgtype.TextOID, } for name, oid := range nameOIDs { dtByName, ok := conn.TypeMap().TypeForName(name) if !ok { t.Fatalf("Expected type named %v to be present", name) } dtByOID, ok := conn.TypeMap().TypeForOID(oid) if !ok { t.Fatalf("Expected type OID %v to be present", oid) } if dtByName != dtByOID { t.Fatalf("Expected type named %v to be the same as type OID %v", name, oid) } } ensureConnValid(t, conn) } func TestUnregisteredTypeUsableAsStringArgumentAndBaseResult(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server does support domain types (https://github.com/cockroachdb/cockroach/issues/27796)") var n uint64 err := conn.QueryRow(context.Background(), "select $1::uint64", "42").Scan(&n) if err != nil { t.Fatal(err) } if n != 42 { t.Fatalf("Expected n to be 42, but was %v", n) } }) } func TestDomainType(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server does support domain types (https://github.com/cockroachdb/cockroach/issues/27796)") // Domain type uint64 is a PostgreSQL domain of underlying type numeric. // In the extended protocol preparing "select $1::uint64" appears to create a statement that expects a param OID of // uint64 but a result OID of the underlying numeric. var s string err := conn.QueryRow(ctx, "select $1::uint64", "24").Scan(&s) require.NoError(t, err) require.Equal(t, "24", s) // Register type uint64Type, err := conn.LoadType(ctx, "uint64") require.NoError(t, err) conn.TypeMap().RegisterType(uint64Type) var n uint64 err = conn.QueryRow(ctx, "select $1::uint64", uint64(24)).Scan(&n) require.NoError(t, err) // String is still an acceptable argument after registration err = conn.QueryRow(ctx, "select $1::uint64", "7").Scan(&n) if err != nil { t.Fatal(err) } if n != 7 { t.Fatalf("Expected n to be 7, but was %v", n) } }) } func TestLoadTypeSameNameInDifferentSchemas(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server does support composite types (https://github.com/cockroachdb/cockroach/issues/27792)") tx, err := conn.Begin(ctx) require.NoError(t, err) defer tx.Rollback(ctx) _, err = tx.Exec(ctx, `create schema pgx_a; create type pgx_a.point as (a text, b text); create schema pgx_b; create type pgx_b.point as (c text); `) require.NoError(t, err) // Register types for _, typename := range []string{"pgx_a.point", "pgx_b.point"} { // Obviously using conn while a tx is in use and registering a type after the connection has been established are // really bad practices, but for the sake of convenience we do it in the test here. dt, err := conn.LoadType(ctx, typename) require.NoError(t, err) conn.TypeMap().RegisterType(dt) } type aPoint struct { A string B string } type bPoint struct { C string } var a aPoint var b bPoint err = tx.QueryRow(ctx, `select '(foo,bar)'::pgx_a.point, '(baz)'::pgx_b.point`).Scan(&a, &b) require.NoError(t, err) require.Equal(t, aPoint{"foo", "bar"}, a) require.Equal(t, bPoint{"baz"}, b) }) } func TestLoadCompositeType(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server does support composite types (https://github.com/cockroachdb/cockroach/issues/27792)") tx, err := conn.Begin(ctx) require.NoError(t, err) defer tx.Rollback(ctx) _, err = tx.Exec(ctx, "create type compositetype as (attr1 int, attr2 int)") require.NoError(t, err) _, err = tx.Exec(ctx, "alter type compositetype drop attribute attr1") require.NoError(t, err) _, err = conn.LoadType(ctx, "compositetype") require.NoError(t, err) }) } func TestLoadRangeType(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server does support range types") tx, err := conn.Begin(ctx) require.NoError(t, err) defer tx.Rollback(ctx) _, err = tx.Exec(ctx, "create type examplefloatrange as range (subtype=float8, subtype_diff=float8mi)") require.NoError(t, err) // Register types newRangeType, err := conn.LoadType(ctx, "examplefloatrange") require.NoError(t, err) conn.TypeMap().RegisterType(newRangeType) conn.TypeMap().RegisterDefaultPgType(pgtype.Range[float64]{}, "examplefloatrange") inputRangeType := pgtype.Range[float64]{ Lower: 1.0, Upper: 2.0, LowerType: pgtype.Inclusive, UpperType: pgtype.Inclusive, Valid: true, } var outputRangeType pgtype.Range[float64] err = tx.QueryRow(ctx, "SELECT $1::examplefloatrange", inputRangeType).Scan(&outputRangeType) require.NoError(t, err) require.Equal(t, inputRangeType, outputRangeType) }) } func TestLoadMultiRangeType(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server does support range types") pgxtest.SkipPostgreSQLVersionLessThan(t, conn, 14) // multirange data type was added in 14 postgresql tx, err := conn.Begin(ctx) require.NoError(t, err) defer tx.Rollback(ctx) _, err = tx.Exec(ctx, "create type examplefloatrange as range (subtype=float8, subtype_diff=float8mi, multirange_type_name=examplefloatmultirange)") require.NoError(t, err) // Register types newRangeType, err := conn.LoadType(ctx, "examplefloatrange") require.NoError(t, err) conn.TypeMap().RegisterType(newRangeType) conn.TypeMap().RegisterDefaultPgType(pgtype.Range[float64]{}, "examplefloatrange") newMultiRangeType, err := conn.LoadType(ctx, "examplefloatmultirange") require.NoError(t, err) conn.TypeMap().RegisterType(newMultiRangeType) conn.TypeMap().RegisterDefaultPgType(pgtype.Multirange[pgtype.Range[float64]]{}, "examplefloatmultirange") inputMultiRangeType := pgtype.Multirange[pgtype.Range[float64]]{ { Lower: 1.0, Upper: 2.0, LowerType: pgtype.Inclusive, UpperType: pgtype.Inclusive, Valid: true, }, { Lower: 3.0, Upper: 4.0, LowerType: pgtype.Exclusive, UpperType: pgtype.Exclusive, Valid: true, }, } var outputMultiRangeType pgtype.Multirange[pgtype.Range[float64]] err = tx.QueryRow(ctx, "SELECT $1::examplefloatmultirange", inputMultiRangeType).Scan(&outputMultiRangeType) require.NoError(t, err) require.Equal(t, inputMultiRangeType, outputMultiRangeType) }) } func TestStmtCacheInvalidationConn(t *testing.T) { ctx := context.Background() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) // create a table and fill it with some data _, err := conn.Exec(ctx, ` DROP TABLE IF EXISTS drop_cols; CREATE TABLE drop_cols ( id SERIAL PRIMARY KEY NOT NULL, f1 int NOT NULL, f2 int NOT NULL ); `) require.NoError(t, err) _, err = conn.Exec(ctx, "INSERT INTO drop_cols (f1, f2) VALUES (1, 2)") require.NoError(t, err) getSQL := "SELECT * FROM drop_cols WHERE id = $1" // This query will populate the statement cache. We don't care about the result. rows, err := conn.Query(ctx, getSQL, 1) require.NoError(t, err) rows.Close() require.NoError(t, rows.Err()) // Now, change the schema of the table out from under the statement, making it invalid. _, err = conn.Exec(ctx, "ALTER TABLE drop_cols DROP COLUMN f1") require.NoError(t, err) // We must get an error the first time we try to re-execute a bad statement. // It is up to the application to determine if it wants to try again. We punt to // the application because there is no clear recovery path in the case of failed transactions // or batch operations and because automatic retry is tricky and we don't want to get // it wrong at such an importaint layer of the stack. rows, err = conn.Query(ctx, getSQL, 1) require.NoError(t, err) rows.Next() nextErr := rows.Err() rows.Close() for _, err := range []error{nextErr, rows.Err()} { if err == nil { t.Fatal(`expected "cached plan must not change result type": no error`) } if !strings.Contains(err.Error(), "cached plan must not change result type") { t.Fatalf(`expected "cached plan must not change result type", got: "%s"`, err.Error()) } } // On retry, the statement should have been flushed from the cache. rows, err = conn.Query(ctx, getSQL, 1) require.NoError(t, err) rows.Next() err = rows.Err() require.NoError(t, err) rows.Close() require.NoError(t, rows.Err()) ensureConnValid(t, conn) } func TestStmtCacheInvalidationTx(t *testing.T) { ctx := context.Background() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) if conn.PgConn().ParameterStatus("crdb_version") != "" { t.Skip("Server has non-standard prepare in errored transaction behavior (https://github.com/cockroachdb/cockroach/issues/84140)") } // create a table and fill it with some data _, err := conn.Exec(ctx, ` DROP TABLE IF EXISTS drop_cols; CREATE TABLE drop_cols ( id SERIAL PRIMARY KEY NOT NULL, f1 int NOT NULL, f2 int NOT NULL ); `) require.NoError(t, err) _, err = conn.Exec(ctx, "INSERT INTO drop_cols (f1, f2) VALUES (1, 2)") require.NoError(t, err) tx, err := conn.Begin(ctx) require.NoError(t, err) getSQL := "SELECT * FROM drop_cols WHERE id = $1" // This query will populate the statement cache. We don't care about the result. rows, err := tx.Query(ctx, getSQL, 1) require.NoError(t, err) rows.Close() require.NoError(t, rows.Err()) // Now, change the schema of the table out from under the statement, making it invalid. _, err = tx.Exec(ctx, "ALTER TABLE drop_cols DROP COLUMN f1") require.NoError(t, err) // We must get an error the first time we try to re-execute a bad statement. // It is up to the application to determine if it wants to try again. We punt to // the application because there is no clear recovery path in the case of failed transactions // or batch operations and because automatic retry is tricky and we don't want to get // it wrong at such an importaint layer of the stack. rows, err = tx.Query(ctx, getSQL, 1) require.NoError(t, err) rows.Next() nextErr := rows.Err() rows.Close() for _, err := range []error{nextErr, rows.Err()} { if err == nil { t.Fatal(`expected "cached plan must not change result type": no error`) } if !strings.Contains(err.Error(), "cached plan must not change result type") { t.Fatalf(`expected "cached plan must not change result type", got: "%s"`, err.Error()) } } rows, _ = tx.Query(ctx, getSQL, 1) rows.Close() err = rows.Err() // Retries within the same transaction are errors (really anything except a rollback // will be an error in this transaction). require.Error(t, err) rows.Close() err = tx.Rollback(ctx) require.NoError(t, err) // once we've rolled back, retries will work rows, err = conn.Query(ctx, getSQL, 1) require.NoError(t, err) rows.Next() err = rows.Err() require.NoError(t, err) rows.Close() ensureConnValid(t, conn) } func TestStmtCacheInvalidationConnWithBatch(t *testing.T) { ctx := context.Background() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) if conn.PgConn().ParameterStatus("crdb_version") != "" { t.Skip("Test fails due to different CRDB behavior") } // create a table and fill it with some data _, err := conn.Exec(ctx, ` DROP TABLE IF EXISTS drop_cols; CREATE TABLE drop_cols ( id SERIAL PRIMARY KEY NOT NULL, f1 int NOT NULL, f2 int NOT NULL ); `) require.NoError(t, err) _, err = conn.Exec(ctx, "INSERT INTO drop_cols (f1, f2) VALUES (1, 2)") require.NoError(t, err) getSQL := "SELECT * FROM drop_cols WHERE id = $1" // This query will populate the statement cache. We don't care about the result. rows, err := conn.Query(ctx, getSQL, 1) require.NoError(t, err) rows.Close() require.NoError(t, rows.Err()) // Now, change the schema of the table out from under the statement, making it invalid. _, err = conn.Exec(ctx, "ALTER TABLE drop_cols DROP COLUMN f1") require.NoError(t, err) // We must get an error the first time we try to re-execute a bad statement. // It is up to the application to determine if it wants to try again. We punt to // the application because there is no clear recovery path in the case of failed transactions // or batch operations and because automatic retry is tricky and we don't want to get // it wrong at such an importaint layer of the stack. batch := &pgx.Batch{} batch.Queue(getSQL, 1) br := conn.SendBatch(ctx, batch) rows, err = br.Query() require.Error(t, err) rows.Next() nextErr := rows.Err() rows.Close() err = br.Close() require.Error(t, err) for _, err := range []error{nextErr, rows.Err()} { if err == nil { t.Fatal(`expected "cached plan must not change result type": no error`) } if !strings.Contains(err.Error(), "cached plan must not change result type") { t.Fatalf(`expected "cached plan must not change result type", got: "%s"`, err.Error()) } } // On retry, the statement should have been flushed from the cache. batch = &pgx.Batch{} batch.Queue(getSQL, 1) br = conn.SendBatch(ctx, batch) rows, err = br.Query() require.NoError(t, err) rows.Next() err = rows.Err() require.NoError(t, err) rows.Close() require.NoError(t, rows.Err()) err = br.Close() require.NoError(t, err) ensureConnValid(t, conn) } func TestStmtCacheInvalidationTxWithBatch(t *testing.T) { ctx := context.Background() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) if conn.PgConn().ParameterStatus("crdb_version") != "" { t.Skip("Server has non-standard prepare in errored transaction behavior (https://github.com/cockroachdb/cockroach/issues/84140)") } // create a table and fill it with some data _, err := conn.Exec(ctx, ` DROP TABLE IF EXISTS drop_cols; CREATE TABLE drop_cols ( id SERIAL PRIMARY KEY NOT NULL, f1 int NOT NULL, f2 int NOT NULL ); `) require.NoError(t, err) _, err = conn.Exec(ctx, "INSERT INTO drop_cols (f1, f2) VALUES (1, 2)") require.NoError(t, err) tx, err := conn.Begin(ctx) require.NoError(t, err) getSQL := "SELECT * FROM drop_cols WHERE id = $1" // This query will populate the statement cache. We don't care about the result. rows, err := tx.Query(ctx, getSQL, 1) require.NoError(t, err) rows.Close() require.NoError(t, rows.Err()) // Now, change the schema of the table out from under the statement, making it invalid. _, err = tx.Exec(ctx, "ALTER TABLE drop_cols DROP COLUMN f1") require.NoError(t, err) // We must get an error the first time we try to re-execute a bad statement. // It is up to the application to determine if it wants to try again. We punt to // the application because there is no clear recovery path in the case of failed transactions // or batch operations and because automatic retry is tricky and we don't want to get // it wrong at such an importaint layer of the stack. batch := &pgx.Batch{} batch.Queue(getSQL, 1) br := tx.SendBatch(ctx, batch) rows, err = br.Query() require.Error(t, err) rows.Next() nextErr := rows.Err() rows.Close() err = br.Close() require.Error(t, err) for _, err := range []error{nextErr, rows.Err()} { if err == nil { t.Fatal(`expected "cached plan must not change result type": no error`) } if !strings.Contains(err.Error(), "cached plan must not change result type") { t.Fatalf(`expected "cached plan must not change result type", got: "%s"`, err.Error()) } } batch = &pgx.Batch{} batch.Queue(getSQL, 1) br = tx.SendBatch(ctx, batch) rows, err = br.Query() require.Error(t, err) rows.Close() err = rows.Err() // Retries within the same transaction are errors (really anything except a rollback // will be an error in this transaction). require.Error(t, err) rows.Close() err = br.Close() require.Error(t, err) err = tx.Rollback(ctx) require.NoError(t, err) // once we've rolled back, retries will work batch = &pgx.Batch{} batch.Queue(getSQL, 1) br = conn.SendBatch(ctx, batch) rows, err = br.Query() require.NoError(t, err) rows.Next() err = rows.Err() require.NoError(t, err) rows.Close() err = br.Close() require.NoError(t, err) ensureConnValid(t, conn) } // https://github.com/jackc/pgx/issues/2442 func TestStmtCacheInvalidationExec(t *testing.T) { ctx := context.Background() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) if conn.PgConn().ParameterStatus("crdb_version") != "" { t.Skip("CockroachDB does not support column column type from int to bool") } // create a table and fill it with some data _, err := conn.Exec(ctx, ` DROP TABLE IF EXISTS drop_cols; CREATE TABLE drop_cols ( id SERIAL PRIMARY KEY NOT NULL, f1 int NOT NULL, f2 int NOT NULL ); `) require.NoError(t, err) insertSQL := "INSERT INTO drop_cols (f1, f2) VALUES ($1, $2)" // This query will populate the statement cache. _, err = conn.Exec(ctx, insertSQL, 1, 2) require.NoError(t, err) // Now, change the schema of the table out from under the statement, making it invalid. _, err = conn.Exec(ctx, "ALTER TABLE drop_cols ALTER COLUMN f1 TYPE boolean USING f1::boolean") require.NoError(t, err) // We must get an error the first time we try to re-execute a bad statement. // It is up to the application to determine if it wants to try again. We punt to // the application because there is no clear recovery path in the case of failed transactions // or batch operations and because automatic retry is tricky and we don't want to get // it wrong at such an importaint layer of the stack. _, err = conn.Exec(ctx, insertSQL, true, 2) require.ErrorContains(t, err, "failed to encode args[0]") // On retry, the statement should have been flushed from the cache. _, err = conn.Exec(ctx, insertSQL, true, 2) require.NoError(t, err) ensureConnValid(t, conn) } func TestInsertDurationInterval(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Exec(context.Background(), "create temporary table t(duration INTERVAL(0) NOT NULL)") require.NoError(t, err) result, err := conn.Exec(context.Background(), "insert into t(duration) values($1)", time.Minute) require.NoError(t, err) n := result.RowsAffected() require.EqualValues(t, 1, n) }) } func TestRawValuesUnderlyingMemoryReused(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var buf []byte rows, err := conn.Query(ctx, `select 1::int`) require.NoError(t, err) for rows.Next() { buf = rows.RawValues()[0] } require.NoError(t, rows.Err()) original := make([]byte, len(buf)) copy(original, buf) for i := range 1_000_000 { rows, err := conn.Query(ctx, `select $1::int`, i) require.NoError(t, err) rows.Close() require.NoError(t, rows.Err()) if !bytes.Equal(original, buf) { return } } t.Fatal("expected buffer from RawValues to be overwritten by subsequent queries but it was not") }) } // https://github.com/jackc/pgx/issues/1847 func TestConnDeallocateInvalidatedCachedStatementsWhenCanceled(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "CockroachDB returns decimal instead of integer for integer division") var n int32 err := conn.QueryRow(ctx, "select 1 / $1::int", 1).Scan(&n) require.NoError(t, err) require.EqualValues(t, 1, n) // Divide by zero causes an error. baseRows.Close() calls Invalidate on the statement cache whenever an error was // encountered by the query. Use this to purposely invalidate the query. If we had access to private fields of conn // we could call conn.statementCache.InvalidateAll() instead. err = conn.QueryRow(ctx, "select 1 / $1::int", 0).Scan(&n) require.Error(t, err) ctx2, cancel2 := context.WithCancel(ctx) cancel2() err = conn.QueryRow(ctx2, "select 1 / $1::int", 1).Scan(&n) require.Error(t, err) require.ErrorIs(t, err, context.Canceled) err = conn.QueryRow(ctx, "select 1 / $1::int", 1).Scan(&n) require.NoError(t, err) require.EqualValues(t, 1, n) }) } // https://github.com/jackc/pgx/issues/1847 func TestConnDeallocateInvalidatedCachedStatementsInTransactionWithBatch(t *testing.T) { t.Parallel() ctx := context.Background() connString := os.Getenv("PGX_TEST_DATABASE") config := mustParseConfig(t, connString) config.DefaultQueryExecMode = pgx.QueryExecModeCacheStatement config.StatementCacheCapacity = 2 conn, err := pgx.ConnectConfig(ctx, config) require.NoError(t, err) tx, err := conn.Begin(ctx) require.NoError(t, err) defer tx.Rollback(ctx) _, err = tx.Exec(ctx, "select $1::int + 1", 1) require.NoError(t, err) _, err = tx.Exec(ctx, "select $1::int + 2", 1) require.NoError(t, err) // This should invalidate the first cached statement. _, err = tx.Exec(ctx, "select $1::int + 3", 1) require.NoError(t, err) batch := &pgx.Batch{} batch.Queue("select $1::int + 1", 1) err = tx.SendBatch(ctx, batch).Close() require.NoError(t, err) err = tx.Rollback(ctx) require.NoError(t, err) ensureConnValid(t, conn) } func TestErrNoRows(t *testing.T) { t.Parallel() // ensure we preserve old error message require.Equal(t, "no rows in result set", pgx.ErrNoRows.Error()) require.ErrorIs(t, pgx.ErrNoRows, sql.ErrNoRows, "pgx.ErrNowRows must match sql.ErrNoRows") } pgx-5.8.0/copy_from.go000066400000000000000000000161431512357711200146570ustar00rootroot00000000000000package pgx import ( "bytes" "context" "fmt" "io" "github.com/jackc/pgx/v5/internal/pgio" "github.com/jackc/pgx/v5/pgconn" ) // CopyFromRows returns a CopyFromSource interface over the provided rows slice // making it usable by *Conn.CopyFrom. func CopyFromRows(rows [][]any) CopyFromSource { return ©FromRows{rows: rows, idx: -1} } type copyFromRows struct { rows [][]any idx int } func (ctr *copyFromRows) Next() bool { ctr.idx++ return ctr.idx < len(ctr.rows) } func (ctr *copyFromRows) Values() ([]any, error) { return ctr.rows[ctr.idx], nil } func (ctr *copyFromRows) Err() error { return nil } // CopyFromSlice returns a CopyFromSource interface over a dynamic func // making it usable by *Conn.CopyFrom. func CopyFromSlice(length int, next func(int) ([]any, error)) CopyFromSource { return ©FromSlice{next: next, idx: -1, len: length} } type copyFromSlice struct { next func(int) ([]any, error) idx int len int err error } func (cts *copyFromSlice) Next() bool { cts.idx++ return cts.idx < cts.len } func (cts *copyFromSlice) Values() ([]any, error) { values, err := cts.next(cts.idx) if err != nil { cts.err = err } return values, err } func (cts *copyFromSlice) Err() error { return cts.err } // CopyFromFunc returns a CopyFromSource interface that relies on nxtf for values. // nxtf returns rows until it either signals an 'end of data' by returning row=nil and err=nil, // or it returns an error. If nxtf returns an error, the copy is aborted. func CopyFromFunc(nxtf func() (row []any, err error)) CopyFromSource { return ©FromFunc{next: nxtf} } type copyFromFunc struct { next func() ([]any, error) valueRow []any err error } func (g *copyFromFunc) Next() bool { g.valueRow, g.err = g.next() // only return true if valueRow exists and no error return g.valueRow != nil && g.err == nil } func (g *copyFromFunc) Values() ([]any, error) { return g.valueRow, g.err } func (g *copyFromFunc) Err() error { return g.err } // CopyFromSource is the interface used by *Conn.CopyFrom as the source for copy data. type CopyFromSource interface { // Next returns true if there is another row and makes the next row data // available to Values(). When there are no more rows available or an error // has occurred it returns false. Next() bool // Values returns the values for the current row. Values() ([]any, error) // Err returns any error that has been encountered by the CopyFromSource. If // this is not nil *Conn.CopyFrom will abort the copy. Err() error } type copyFrom struct { conn *Conn tableName Identifier columnNames []string rowSrc CopyFromSource readerErrChan chan error mode QueryExecMode } func (ct *copyFrom) run(ctx context.Context) (int64, error) { if ct.conn.copyFromTracer != nil { ctx = ct.conn.copyFromTracer.TraceCopyFromStart(ctx, ct.conn, TraceCopyFromStartData{ TableName: ct.tableName, ColumnNames: ct.columnNames, }) } quotedTableName := ct.tableName.Sanitize() cbuf := &bytes.Buffer{} for i, cn := range ct.columnNames { if i != 0 { cbuf.WriteString(", ") } cbuf.WriteString(quoteIdentifier(cn)) } quotedColumnNames := cbuf.String() var sd *pgconn.StatementDescription switch ct.mode { case QueryExecModeExec, QueryExecModeSimpleProtocol: // These modes don't support the binary format. Before the inclusion of the // QueryExecModes, Conn.Prepare was called on every COPY operation to get // the OIDs. These prepared statements were not cached. // // Since that's the same behavior provided by QueryExecModeDescribeExec, // we'll default to that mode. ct.mode = QueryExecModeDescribeExec fallthrough case QueryExecModeCacheStatement, QueryExecModeCacheDescribe, QueryExecModeDescribeExec: var err error sd, err = ct.conn.getStatementDescription( ctx, ct.mode, fmt.Sprintf("select %s from %s", quotedColumnNames, quotedTableName), ) if err != nil { return 0, fmt.Errorf("statement description failed: %w", err) } default: return 0, fmt.Errorf("unknown QueryExecMode: %v", ct.mode) } r, w := io.Pipe() doneChan := make(chan struct{}) go func() { defer close(doneChan) // Purposely NOT using defer w.Close(). See https://github.com/golang/go/issues/24283. buf := ct.conn.wbuf buf = append(buf, "PGCOPY\n\377\r\n\000"...) buf = pgio.AppendInt32(buf, 0) buf = pgio.AppendInt32(buf, 0) moreRows := true for moreRows { var err error moreRows, buf, err = ct.buildCopyBuf(buf, sd) if err != nil { w.CloseWithError(err) return } if ct.rowSrc.Err() != nil { w.CloseWithError(ct.rowSrc.Err()) return } if len(buf) > 0 { _, err = w.Write(buf) if err != nil { w.Close() return } } buf = buf[:0] } w.Close() }() commandTag, err := ct.conn.pgConn.CopyFrom(ctx, r, fmt.Sprintf("copy %s ( %s ) from stdin binary;", quotedTableName, quotedColumnNames)) r.Close() <-doneChan if ct.conn.copyFromTracer != nil { ct.conn.copyFromTracer.TraceCopyFromEnd(ctx, ct.conn, TraceCopyFromEndData{ CommandTag: commandTag, Err: err, }) } return commandTag.RowsAffected(), err } func (ct *copyFrom) buildCopyBuf(buf []byte, sd *pgconn.StatementDescription) (bool, []byte, error) { const sendBufSize = 65536 - 5 // The packet has a 5-byte header lastBufLen := 0 largestRowLen := 0 for ct.rowSrc.Next() { lastBufLen = len(buf) values, err := ct.rowSrc.Values() if err != nil { return false, nil, err } if len(values) != len(ct.columnNames) { return false, nil, fmt.Errorf("expected %d values, got %d values", len(ct.columnNames), len(values)) } buf = pgio.AppendInt16(buf, int16(len(ct.columnNames))) for i, val := range values { buf, err = encodeCopyValue(ct.conn.typeMap, buf, sd.Fields[i].DataTypeOID, val) if err != nil { return false, nil, err } } rowLen := len(buf) - lastBufLen if rowLen > largestRowLen { largestRowLen = rowLen } // Try not to overflow size of the buffer PgConn.CopyFrom will be reading into. If that happens then the nature of // io.Pipe means that the next Read will be short. This can lead to pathological send sizes such as 65531, 13, 65531 // 13, 65531, 13, 65531, 13. if len(buf) > sendBufSize-largestRowLen { return true, buf, nil } } return false, buf, nil } // CopyFrom uses the PostgreSQL copy protocol to perform bulk data insertion. It returns the number of rows copied and // an error. // // CopyFrom requires all values use the binary format. A pgtype.Type that supports the binary format must be registered // for the type of each column. Almost all types implemented by pgx support the binary format. // // Even though enum types appear to be strings they still must be registered to use with CopyFrom. This can be done with // Conn.LoadType and pgtype.Map.RegisterType. func (c *Conn) CopyFrom(ctx context.Context, tableName Identifier, columnNames []string, rowSrc CopyFromSource) (int64, error) { ct := ©From{ conn: c, tableName: tableName, columnNames: columnNames, rowSrc: rowSrc, readerErrChan: make(chan error), mode: c.config.DefaultQueryExecMode, } return ct.run(ctx) } pgx-5.8.0/copy_from_test.go000066400000000000000000000535641512357711200157260ustar00rootroot00000000000000package pgx_test import ( "context" "fmt" "os" "reflect" "testing" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/require" ) func TestConnCopyWithAllQueryExecModes(t *testing.T) { for _, mode := range pgxtest.AllQueryExecModes { t.Run(mode.String(), func(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() cfg := mustParseConfig(t, os.Getenv("PGX_TEST_DATABASE")) cfg.DefaultQueryExecMode = mode conn := mustConnect(t, cfg) defer closeConn(t, conn) mustExec(t, conn, `create temporary table foo( a int2, b int4, c int8, d text, e timestamptz )`) tzedTime := time.Date(2010, 2, 3, 4, 5, 6, 0, time.Local) inputRows := [][]any{ {int16(0), int32(1), int64(2), "abc", tzedTime}, {nil, nil, nil, nil, nil}, } copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a", "b", "c", "d", "e"}, pgx.CopyFromRows(inputRows)) if err != nil { t.Errorf("Unexpected error for CopyFrom: %v", err) } if int(copyCount) != len(inputRows) { t.Errorf("Expected CopyFrom to return %d copied rows, but got %d", len(inputRows), copyCount) } rows, err := conn.Query(ctx, "select * from foo") if err != nil { t.Errorf("Unexpected error for Query: %v", err) } var outputRows [][]any for rows.Next() { row, err := rows.Values() if err != nil { t.Errorf("Unexpected error for rows.Values(): %v", err) } outputRows = append(outputRows, row) } if rows.Err() != nil { t.Errorf("Unexpected error for rows.Err(): %v", rows.Err()) } if !reflect.DeepEqual(inputRows, outputRows) { t.Errorf("Input rows and output rows do not equal: %v -> %v", inputRows, outputRows) } ensureConnValid(t, conn) }) } } func TestConnCopyWithKnownOIDQueryExecModes(t *testing.T) { for _, mode := range pgxtest.KnownOIDQueryExecModes { t.Run(mode.String(), func(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() cfg := mustParseConfig(t, os.Getenv("PGX_TEST_DATABASE")) cfg.DefaultQueryExecMode = mode conn := mustConnect(t, cfg) defer closeConn(t, conn) mustExec(t, conn, `create temporary table foo( a int2, b int4, c int8, d varchar, e text, f date, g timestamptz )`) tzedTime := time.Date(2010, 2, 3, 4, 5, 6, 0, time.Local) inputRows := [][]any{ {int16(0), int32(1), int64(2), "abc", "efg", time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC), tzedTime}, {nil, nil, nil, nil, nil, nil, nil}, } copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a", "b", "c", "d", "e", "f", "g"}, pgx.CopyFromRows(inputRows)) if err != nil { t.Errorf("Unexpected error for CopyFrom: %v", err) } if int(copyCount) != len(inputRows) { t.Errorf("Expected CopyFrom to return %d copied rows, but got %d", len(inputRows), copyCount) } rows, err := conn.Query(ctx, "select * from foo") if err != nil { t.Errorf("Unexpected error for Query: %v", err) } var outputRows [][]any for rows.Next() { row, err := rows.Values() if err != nil { t.Errorf("Unexpected error for rows.Values(): %v", err) } outputRows = append(outputRows, row) } if rows.Err() != nil { t.Errorf("Unexpected error for rows.Err(): %v", rows.Err()) } if !reflect.DeepEqual(inputRows, outputRows) { t.Errorf("Input rows and output rows do not equal: %v -> %v", inputRows, outputRows) } ensureConnValid(t, conn) }) } } func TestConnCopyFromSmall(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) mustExec(t, conn, `create temporary table foo( a int2, b int4, c int8, d varchar, e text, f date, g timestamptz )`) tzedTime := time.Date(2010, 2, 3, 4, 5, 6, 0, time.Local) inputRows := [][]any{ {int16(0), int32(1), int64(2), "abc", "efg", time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC), tzedTime}, {nil, nil, nil, nil, nil, nil, nil}, } copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a", "b", "c", "d", "e", "f", "g"}, pgx.CopyFromRows(inputRows)) if err != nil { t.Errorf("Unexpected error for CopyFrom: %v", err) } if int(copyCount) != len(inputRows) { t.Errorf("Expected CopyFrom to return %d copied rows, but got %d", len(inputRows), copyCount) } rows, err := conn.Query(ctx, "select * from foo") if err != nil { t.Errorf("Unexpected error for Query: %v", err) } var outputRows [][]any for rows.Next() { row, err := rows.Values() if err != nil { t.Errorf("Unexpected error for rows.Values(): %v", err) } outputRows = append(outputRows, row) } if rows.Err() != nil { t.Errorf("Unexpected error for rows.Err(): %v", rows.Err()) } if !reflect.DeepEqual(inputRows, outputRows) { t.Errorf("Input rows and output rows do not equal: %v -> %v", inputRows, outputRows) } ensureConnValid(t, conn) } func TestConnCopyFromSliceSmall(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) mustExec(t, conn, `create temporary table foo( a int2, b int4, c int8, d varchar, e text, f date, g timestamptz )`) tzedTime := time.Date(2010, 2, 3, 4, 5, 6, 0, time.Local) inputRows := [][]any{ {int16(0), int32(1), int64(2), "abc", "efg", time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC), tzedTime}, {nil, nil, nil, nil, nil, nil, nil}, } copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a", "b", "c", "d", "e", "f", "g"}, pgx.CopyFromSlice(len(inputRows), func(i int) ([]any, error) { return inputRows[i], nil })) if err != nil { t.Errorf("Unexpected error for CopyFrom: %v", err) } if int(copyCount) != len(inputRows) { t.Errorf("Expected CopyFrom to return %d copied rows, but got %d", len(inputRows), copyCount) } rows, err := conn.Query(ctx, "select * from foo") if err != nil { t.Errorf("Unexpected error for Query: %v", err) } var outputRows [][]any for rows.Next() { row, err := rows.Values() if err != nil { t.Errorf("Unexpected error for rows.Values(): %v", err) } outputRows = append(outputRows, row) } if rows.Err() != nil { t.Errorf("Unexpected error for rows.Err(): %v", rows.Err()) } if !reflect.DeepEqual(inputRows, outputRows) { t.Errorf("Input rows and output rows do not equal: %v -> %v", inputRows, outputRows) } ensureConnValid(t, conn) } func TestConnCopyFromLarge(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) mustExec(t, conn, `create temporary table foo( a int2, b int4, c int8, d varchar, e text, f date, g timestamptz, h bytea )`) tzedTime := time.Date(2010, 2, 3, 4, 5, 6, 0, time.Local) inputRows := [][]any{} for range 10_000 { inputRows = append(inputRows, []any{int16(0), int32(1), int64(2), "abc", "efg", time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC), tzedTime, []byte{111, 111, 111, 111}}) } copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a", "b", "c", "d", "e", "f", "g", "h"}, pgx.CopyFromRows(inputRows)) if err != nil { t.Errorf("Unexpected error for CopyFrom: %v", err) } if int(copyCount) != len(inputRows) { t.Errorf("Expected CopyFrom to return %d copied rows, but got %d", len(inputRows), copyCount) } rows, err := conn.Query(ctx, "select * from foo") if err != nil { t.Errorf("Unexpected error for Query: %v", err) } var outputRows [][]any for rows.Next() { row, err := rows.Values() if err != nil { t.Errorf("Unexpected error for rows.Values(): %v", err) } outputRows = append(outputRows, row) } if rows.Err() != nil { t.Errorf("Unexpected error for rows.Err(): %v", rows.Err()) } if !reflect.DeepEqual(inputRows, outputRows) { t.Errorf("Input rows and output rows do not equal") } ensureConnValid(t, conn) } func TestConnCopyFromEnum(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) tx, err := conn.Begin(ctx) require.NoError(t, err) defer tx.Rollback(ctx) _, err = tx.Exec(ctx, `drop type if exists color`) require.NoError(t, err) _, err = tx.Exec(ctx, `drop type if exists fruit`) require.NoError(t, err) _, err = tx.Exec(ctx, `create type color as enum ('blue', 'green', 'orange')`) require.NoError(t, err) _, err = tx.Exec(ctx, `create type fruit as enum ('apple', 'orange', 'grape')`) require.NoError(t, err) // Obviously using conn while a tx is in use and registering a type after the connection has been established are // really bad practices, but for the sake of convenience we do it in the test here. for _, name := range []string{"fruit", "color"} { typ, err := conn.LoadType(ctx, name) require.NoError(t, err) conn.TypeMap().RegisterType(typ) } _, err = tx.Exec(ctx, `create temporary table foo( a text, b color, c fruit, d color, e fruit, f text )`) require.NoError(t, err) inputRows := [][]any{ {"abc", "blue", "grape", "orange", "orange", "def"}, {nil, nil, nil, nil, nil, nil}, } copyCount, err := tx.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a", "b", "c", "d", "e", "f"}, pgx.CopyFromRows(inputRows)) require.NoError(t, err) require.EqualValues(t, len(inputRows), copyCount) rows, err := tx.Query(ctx, "select * from foo") require.NoError(t, err) var outputRows [][]any for rows.Next() { row, err := rows.Values() require.NoError(t, err) outputRows = append(outputRows, row) } require.NoError(t, rows.Err()) if !reflect.DeepEqual(inputRows, outputRows) { t.Errorf("Input rows and output rows do not equal: %v -> %v", inputRows, outputRows) } err = tx.Rollback(ctx) require.NoError(t, err) ensureConnValid(t, conn) } func TestConnCopyFromJSON(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) for _, typeName := range []string{"json", "jsonb"} { if _, ok := conn.TypeMap().TypeForName(typeName); !ok { return // No JSON/JSONB type -- must be running against old PostgreSQL } } mustExec(t, conn, `create temporary table foo( a json, b jsonb )`) inputRows := [][]any{ {map[string]any{"foo": "bar"}, map[string]any{"bar": "quz"}}, {nil, nil}, } copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a", "b"}, pgx.CopyFromRows(inputRows)) if err != nil { t.Errorf("Unexpected error for CopyFrom: %v", err) } if int(copyCount) != len(inputRows) { t.Errorf("Expected CopyFrom to return %d copied rows, but got %d", len(inputRows), copyCount) } rows, err := conn.Query(ctx, "select * from foo") if err != nil { t.Errorf("Unexpected error for Query: %v", err) } var outputRows [][]any for rows.Next() { row, err := rows.Values() if err != nil { t.Errorf("Unexpected error for rows.Values(): %v", err) } outputRows = append(outputRows, row) } if rows.Err() != nil { t.Errorf("Unexpected error for rows.Err(): %v", rows.Err()) } if !reflect.DeepEqual(inputRows, outputRows) { t.Errorf("Input rows and output rows do not equal: %v -> %v", inputRows, outputRows) } ensureConnValid(t, conn) } type clientFailSource struct { count int err error } func (cfs *clientFailSource) Next() bool { cfs.count++ return cfs.count < 100 } func (cfs *clientFailSource) Values() ([]any, error) { if cfs.count == 3 { cfs.err = fmt.Errorf("client error") return nil, cfs.err } return []any{make([]byte, 100_000)}, nil } func (cfs *clientFailSource) Err() error { return cfs.err } func TestConnCopyFromFailServerSideMidway(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) mustExec(t, conn, `create temporary table foo( a int4, b varchar not null )`) inputRows := [][]any{ {int32(1), "abc"}, {int32(2), nil}, // this row should trigger a failure {int32(3), "def"}, } copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a", "b"}, pgx.CopyFromRows(inputRows)) if err == nil { t.Errorf("Expected CopyFrom return error, but it did not") } if _, ok := err.(*pgconn.PgError); !ok { t.Errorf("Expected CopyFrom return pgx.PgError, but instead it returned: %v", err) } if copyCount != 0 { t.Errorf("Expected CopyFrom to return 0 copied rows, but got %d", copyCount) } rows, err := conn.Query(ctx, "select * from foo") if err != nil { t.Errorf("Unexpected error for Query: %v", err) } var outputRows [][]any for rows.Next() { row, err := rows.Values() if err != nil { t.Errorf("Unexpected error for rows.Values(): %v", err) } outputRows = append(outputRows, row) } if rows.Err() != nil { t.Errorf("Unexpected error for rows.Err(): %v", rows.Err()) } if len(outputRows) != 0 { t.Errorf("Expected 0 rows, but got %v", outputRows) } mustExec(t, conn, "truncate foo") ensureConnValid(t, conn) } type failSource struct { count int } func (fs *failSource) Next() bool { time.Sleep(time.Millisecond * 100) fs.count++ return fs.count < 100 } func (fs *failSource) Values() ([]any, error) { if fs.count == 3 { return []any{nil}, nil } return []any{make([]byte, 100_000)}, nil } func (fs *failSource) Err() error { return nil } func TestConnCopyFromFailServerSideMidwayAbortsWithoutWaiting(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server copy error does not fail fast") mustExec(t, conn, `create temporary table foo( a bytea not null )`) startTime := time.Now() copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a"}, &failSource{}) if err == nil { t.Errorf("Expected CopyFrom return error, but it did not") } if _, ok := err.(*pgconn.PgError); !ok { t.Errorf("Expected CopyFrom return pgx.PgError, but instead it returned: %v", err) } if copyCount != 0 { t.Errorf("Expected CopyFrom to return 0 copied rows, but got %d", copyCount) } endTime := time.Now() copyTime := endTime.Sub(startTime) if copyTime > time.Second { t.Errorf("Failing CopyFrom shouldn't have taken so long: %v", copyTime) } rows, err := conn.Query(ctx, "select * from foo") if err != nil { t.Errorf("Unexpected error for Query: %v", err) } var outputRows [][]any for rows.Next() { row, err := rows.Values() if err != nil { t.Errorf("Unexpected error for rows.Values(): %v", err) } outputRows = append(outputRows, row) } if rows.Err() != nil { t.Errorf("Unexpected error for rows.Err(): %v", rows.Err()) } if len(outputRows) != 0 { t.Errorf("Expected 0 rows, but got %v", outputRows) } ensureConnValid(t, conn) } type slowFailRaceSource struct { count int } func (fs *slowFailRaceSource) Next() bool { time.Sleep(time.Millisecond) fs.count++ return fs.count < 1000 } func (fs *slowFailRaceSource) Values() ([]any, error) { if fs.count == 500 { return []any{nil, nil}, nil } return []any{1, make([]byte, 1000)}, nil } func (fs *slowFailRaceSource) Err() error { return nil } func TestConnCopyFromSlowFailRace(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) mustExec(t, conn, `create temporary table foo( a int not null, b bytea not null )`) copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a", "b"}, &slowFailRaceSource{}) if err == nil { t.Errorf("Expected CopyFrom return error, but it did not") } if _, ok := err.(*pgconn.PgError); !ok { t.Errorf("Expected CopyFrom return pgx.PgError, but instead it returned: %v", err) } if copyCount != 0 { t.Errorf("Expected CopyFrom to return 0 copied rows, but got %d", copyCount) } ensureConnValid(t, conn) } func TestConnCopyFromCopyFromSourceErrorMidway(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) mustExec(t, conn, `create temporary table foo( a bytea not null )`) copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a"}, &clientFailSource{}) if err == nil { t.Errorf("Expected CopyFrom return error, but it did not") } if copyCount != 0 { t.Errorf("Expected CopyFrom to return 0 copied rows, but got %d", copyCount) } rows, err := conn.Query(ctx, "select * from foo") if err != nil { t.Errorf("Unexpected error for Query: %v", err) } var outputRows [][]any for rows.Next() { row, err := rows.Values() if err != nil { t.Errorf("Unexpected error for rows.Values(): %v", err) } outputRows = append(outputRows, row) } if rows.Err() != nil { t.Errorf("Unexpected error for rows.Err(): %v", rows.Err()) } if len(outputRows) != 0 { t.Errorf("Expected 0 rows, but got %v", len(outputRows)) } ensureConnValid(t, conn) } type clientFinalErrSource struct { count int } func (cfs *clientFinalErrSource) Next() bool { cfs.count++ return cfs.count < 5 } func (cfs *clientFinalErrSource) Values() ([]any, error) { return []any{make([]byte, 100_000)}, nil } func (cfs *clientFinalErrSource) Err() error { return fmt.Errorf("final error") } func TestConnCopyFromCopyFromSourceErrorEnd(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) mustExec(t, conn, `create temporary table foo( a bytea not null )`) copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a"}, &clientFinalErrSource{}) if err == nil { t.Errorf("Expected CopyFrom return error, but it did not") } if copyCount != 0 { t.Errorf("Expected CopyFrom to return 0 copied rows, but got %d", copyCount) } rows, err := conn.Query(ctx, "select * from foo") if err != nil { t.Errorf("Unexpected error for Query: %v", err) } var outputRows [][]any for rows.Next() { row, err := rows.Values() if err != nil { t.Errorf("Unexpected error for rows.Values(): %v", err) } outputRows = append(outputRows, row) } if rows.Err() != nil { t.Errorf("Unexpected error for rows.Err(): %v", rows.Err()) } if len(outputRows) != 0 { t.Errorf("Expected 0 rows, but got %v", outputRows) } ensureConnValid(t, conn) } func TestConnCopyFromAutomaticStringConversion(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) mustExec(t, conn, `create temporary table foo( a int8 )`) inputRows := [][]any{ {"42"}, {"7"}, {8}, } copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a"}, pgx.CopyFromRows(inputRows)) require.NoError(t, err) require.EqualValues(t, len(inputRows), copyCount) rows, _ := conn.Query(ctx, "select * from foo") nums, err := pgx.CollectRows(rows, pgx.RowTo[int64]) require.NoError(t, err) require.Equal(t, []int64{42, 7, 8}, nums) ensureConnValid(t, conn) } // https://github.com/jackc/pgx/discussions/1891 func TestConnCopyFromAutomaticStringConversionArray(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) mustExec(t, conn, `create temporary table foo( a numeric[] )`) inputRows := [][]any{ {[]string{"42"}}, {[]string{"7"}}, {[]string{"8", "9"}}, {[][]string{{"10", "11"}, {"12", "13"}}}, } copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a"}, pgx.CopyFromRows(inputRows)) require.NoError(t, err) require.EqualValues(t, len(inputRows), copyCount) // Test reads as int64 and flattened array for simplicity. rows, _ := conn.Query(ctx, "select * from foo") nums, err := pgx.CollectRows(rows, pgx.RowTo[[]int64]) require.NoError(t, err) require.Equal(t, [][]int64{{42}, {7}, {8, 9}, {10, 11, 12, 13}}, nums) ensureConnValid(t, conn) } func TestCopyFromFunc(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) mustExec(t, conn, `create temporary table foo( a int )`) dataCh := make(chan int, 1) const channelItems = 10 go func() { for i := range channelItems { dataCh <- i } close(dataCh) }() copyCount, err := conn.CopyFrom(context.Background(), pgx.Identifier{"foo"}, []string{"a"}, pgx.CopyFromFunc(func() ([]any, error) { v, ok := <-dataCh if !ok { return nil, nil } return []any{v}, nil })) require.ErrorIs(t, err, nil) require.EqualValues(t, channelItems, copyCount) rows, err := conn.Query(context.Background(), "select * from foo order by a") require.NoError(t, err) nums, err := pgx.CollectRows(rows, pgx.RowTo[int64]) require.NoError(t, err) require.Equal(t, []int64{0, 1, 2, 3, 4, 5, 6, 7, 8, 9}, nums) // simulate a failure copyCount, err = conn.CopyFrom(context.Background(), pgx.Identifier{"foo"}, []string{"a"}, pgx.CopyFromFunc(func() func() ([]any, error) { x := 9 return func() ([]any, error) { x++ if x > 100 { return nil, fmt.Errorf("simulated error") } return []any{x}, nil } }())) require.NotErrorIs(t, err, nil) require.EqualValues(t, 0, copyCount) // no change, due to error ensureConnValid(t, conn) } pgx-5.8.0/derived_types.go000066400000000000000000000230041512357711200155220ustar00rootroot00000000000000package pgx import ( "context" "fmt" "regexp" "strconv" "strings" "github.com/jackc/pgx/v5/pgtype" ) /* buildLoadDerivedTypesSQL generates the correct query for retrieving type information. pgVersion: the major version of the PostgreSQL server typeNames: the names of the types to load. If nil, load all types. */ func buildLoadDerivedTypesSQL(pgVersion int64, typeNames []string) string { supportsMultirange := (pgVersion >= 14) var typeNamesClause string if typeNames == nil { // This should not occur; this will not return any types typeNamesClause = "= ''" } else { typeNamesClause = "= ANY($1)" } parts := make([]string, 0, 10) // Each of the type names provided might be found in pg_class or pg_type. // Additionally, it may or may not include a schema portion. parts = append(parts, ` WITH RECURSIVE -- find the OIDs in pg_class which match one of the provided type names selected_classes(oid,reltype) AS ( -- this query uses the namespace search path, so will match type names without a schema prefix SELECT pg_class.oid, pg_class.reltype FROM pg_catalog.pg_class LEFT JOIN pg_catalog.pg_namespace n ON n.oid = pg_class.relnamespace WHERE pg_catalog.pg_table_is_visible(pg_class.oid) AND relname `, typeNamesClause, ` UNION ALL -- this query will only match type names which include the schema prefix SELECT pg_class.oid, pg_class.reltype FROM pg_class INNER JOIN pg_namespace ON (pg_class.relnamespace = pg_namespace.oid) WHERE nspname || '.' || relname `, typeNamesClause, ` ), selected_types(oid) AS ( -- collect the OIDs from pg_types which correspond to the selected classes SELECT reltype AS oid FROM selected_classes UNION ALL -- as well as any other type names which match our criteria SELECT pg_type.oid FROM pg_type LEFT OUTER JOIN pg_namespace ON (pg_type.typnamespace = pg_namespace.oid) WHERE typname `, typeNamesClause, ` OR nspname || '.' || typname `, typeNamesClause, ` ), -- this builds a parent/child mapping of objects, allowing us to know -- all the child (ie: dependent) types that a parent (type) requires -- As can be seen, there are 3 ways this can occur (the last of which -- is due to being a composite class, where the composite fields are children) pc(parent, child) AS ( SELECT parent.oid, parent.typelem FROM pg_type parent WHERE parent.typtype = 'b' AND parent.typelem != 0 UNION ALL SELECT parent.oid, parent.typbasetype FROM pg_type parent WHERE parent.typtypmod = -1 AND parent.typbasetype != 0 UNION ALL SELECT pg_type.oid, atttypid FROM pg_attribute INNER JOIN pg_class ON (pg_class.oid = pg_attribute.attrelid) INNER JOIN pg_type ON (pg_type.oid = pg_class.reltype) WHERE NOT attisdropped AND attnum > 0 ), -- Now construct a recursive query which includes a 'depth' element. -- This is used to ensure that the "youngest" children are registered before -- their parents. relationships(parent, child, depth) AS ( SELECT DISTINCT 0::OID, selected_types.oid, 0 FROM selected_types UNION ALL SELECT pg_type.oid AS parent, pg_attribute.atttypid AS child, 1 FROM selected_classes c inner join pg_type ON (c.reltype = pg_type.oid) inner join pg_attribute on (c.oid = pg_attribute.attrelid) UNION ALL SELECT pc.parent, pc.child, relationships.depth + 1 FROM pc INNER JOIN relationships ON (pc.parent = relationships.child) ), -- composite fields need to be encapsulated as a couple of arrays to provide the required information for registration composite AS ( SELECT pg_type.oid, ARRAY_AGG(attname ORDER BY attnum) AS attnames, ARRAY_AGG(atttypid ORDER BY ATTNUM) AS atttypids FROM pg_attribute INNER JOIN pg_class ON (pg_class.oid = pg_attribute.attrelid) INNER JOIN pg_type ON (pg_type.oid = pg_class.reltype) WHERE NOT attisdropped AND attnum > 0 GROUP BY pg_type.oid ) -- Bring together this information, showing all the information which might possibly be required -- to complete the registration, applying filters to only show the items which relate to the selected -- types/classes. SELECT typname, pg_namespace.nspname, typtype, typbasetype, typelem, pg_type.oid,`) if supportsMultirange { parts = append(parts, ` COALESCE(multirange.rngtypid, 0) AS rngtypid,`) } else { parts = append(parts, ` 0 AS rngtypid,`) } parts = append(parts, ` COALESCE(pg_range.rngsubtype, 0) AS rngsubtype, attnames, atttypids FROM relationships INNER JOIN pg_type ON (pg_type.oid = relationships.child) LEFT OUTER JOIN pg_range ON (pg_type.oid = pg_range.rngtypid)`) if supportsMultirange { parts = append(parts, ` LEFT OUTER JOIN pg_range multirange ON (pg_type.oid = multirange.rngmultitypid)`) } parts = append(parts, ` LEFT OUTER JOIN composite USING (oid) LEFT OUTER JOIN pg_namespace ON (pg_type.typnamespace = pg_namespace.oid) WHERE NOT (typtype = 'b' AND typelem = 0)`) parts = append(parts, ` GROUP BY typname, pg_namespace.nspname, typtype, typbasetype, typelem, pg_type.oid, pg_range.rngsubtype,`) if supportsMultirange { parts = append(parts, ` multirange.rngtypid,`) } parts = append(parts, ` attnames, atttypids ORDER BY MAX(depth) desc, typname;`) return strings.Join(parts, "") } type derivedTypeInfo struct { Oid, Typbasetype, Typelem, Rngsubtype, Rngtypid uint32 TypeName, Typtype, NspName string Attnames []string Atttypids []uint32 } // LoadTypes performs a single (complex) query, returning all the required // information to register the named types, as well as any other types directly // or indirectly required to complete the registration. // The result of this call can be passed into RegisterTypes to complete the process. func (c *Conn) LoadTypes(ctx context.Context, typeNames []string) ([]*pgtype.Type, error) { m := c.TypeMap() if len(typeNames) == 0 { return nil, fmt.Errorf("No type names were supplied.") } // Disregard server version errors. This will result in // the SQL not support recent structures such as multirange serverVersion, _ := serverVersion(c) sql := buildLoadDerivedTypesSQL(serverVersion, typeNames) rows, err := c.Query(ctx, sql, QueryExecModeSimpleProtocol, typeNames) if err != nil { return nil, fmt.Errorf("While generating load types query: %w", err) } defer rows.Close() result := make([]*pgtype.Type, 0, 100) for rows.Next() { ti := derivedTypeInfo{} err = rows.Scan(&ti.TypeName, &ti.NspName, &ti.Typtype, &ti.Typbasetype, &ti.Typelem, &ti.Oid, &ti.Rngtypid, &ti.Rngsubtype, &ti.Attnames, &ti.Atttypids) if err != nil { return nil, fmt.Errorf("While scanning type information: %w", err) } var type_ *pgtype.Type switch ti.Typtype { case "b": // array dt, ok := m.TypeForOID(ti.Typelem) if !ok { return nil, fmt.Errorf("Array element OID %v not registered while loading pgtype %q", ti.Typelem, ti.TypeName) } type_ = &pgtype.Type{Name: ti.TypeName, OID: ti.Oid, Codec: &pgtype.ArrayCodec{ElementType: dt}} case "c": // composite var fields []pgtype.CompositeCodecField for i, fieldName := range ti.Attnames { dt, ok := m.TypeForOID(ti.Atttypids[i]) if !ok { return nil, fmt.Errorf("Unknown field for composite type %q: field %q (OID %v) is not already registered.", ti.TypeName, fieldName, ti.Atttypids[i]) } fields = append(fields, pgtype.CompositeCodecField{Name: fieldName, Type: dt}) } type_ = &pgtype.Type{Name: ti.TypeName, OID: ti.Oid, Codec: &pgtype.CompositeCodec{Fields: fields}} case "d": // domain dt, ok := m.TypeForOID(ti.Typbasetype) if !ok { return nil, fmt.Errorf("Domain base type OID %v was not already registered, needed for %q", ti.Typbasetype, ti.TypeName) } type_ = &pgtype.Type{Name: ti.TypeName, OID: ti.Oid, Codec: dt.Codec} case "e": // enum type_ = &pgtype.Type{Name: ti.TypeName, OID: ti.Oid, Codec: &pgtype.EnumCodec{}} case "r": // range dt, ok := m.TypeForOID(ti.Rngsubtype) if !ok { return nil, fmt.Errorf("Range element OID %v was not already registered, needed for %q", ti.Rngsubtype, ti.TypeName) } type_ = &pgtype.Type{Name: ti.TypeName, OID: ti.Oid, Codec: &pgtype.RangeCodec{ElementType: dt}} case "m": // multirange dt, ok := m.TypeForOID(ti.Rngtypid) if !ok { return nil, fmt.Errorf("Multirange element OID %v was not already registered, needed for %q", ti.Rngtypid, ti.TypeName) } type_ = &pgtype.Type{Name: ti.TypeName, OID: ti.Oid, Codec: &pgtype.MultirangeCodec{ElementType: dt}} default: return nil, fmt.Errorf("Unknown typtype %q was found while registering %q", ti.Typtype, ti.TypeName) } // the type_ is imposible to be null m.RegisterType(type_) if ti.NspName != "" { nspType := &pgtype.Type{Name: ti.NspName + "." + type_.Name, OID: type_.OID, Codec: type_.Codec} m.RegisterType(nspType) result = append(result, nspType) } result = append(result, type_) } return result, nil } // serverVersion returns the postgresql server version. func serverVersion(c *Conn) (int64, error) { serverVersionStr := c.PgConn().ParameterStatus("server_version") serverVersionStr = regexp.MustCompile(`^[0-9]+`).FindString(serverVersionStr) // if not PostgreSQL do nothing if serverVersionStr == "" { return 0, fmt.Errorf("Cannot identify server version in %q", serverVersionStr) } version, err := strconv.ParseInt(serverVersionStr, 10, 64) if err != nil { return 0, fmt.Errorf("postgres version parsing failed: %w", err) } return version, nil } pgx-5.8.0/derived_types_test.go000066400000000000000000000023101512357711200165560ustar00rootroot00000000000000package pgx_test import ( "context" "testing" "github.com/jackc/pgx/v5" "github.com/stretchr/testify/require" ) func TestCompositeCodecTranscodeWithLoadTypes(t *testing.T) { skipCockroachDB(t, "Server does not support composite types (see https://github.com/cockroachdb/cockroach/issues/27792)") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Exec(ctx, ` drop type if exists dtype_test; drop domain if exists anotheruint64; create domain anotheruint64 as numeric(20,0); create type dtype_test as ( a text, b int4, c anotheruint64, d anotheruint64[] );`) require.NoError(t, err) defer conn.Exec(ctx, "drop type dtype_test") defer conn.Exec(ctx, "drop domain anotheruint64") types, err := conn.LoadTypes(ctx, []string{"dtype_test"}) require.NoError(t, err) require.Len(t, types, 6) require.Equal(t, types[0].Name, "public.anotheruint64") require.Equal(t, types[1].Name, "anotheruint64") require.Equal(t, types[2].Name, "public._anotheruint64") require.Equal(t, types[3].Name, "_anotheruint64") require.Equal(t, types[4].Name, "public.dtype_test") require.Equal(t, types[5].Name, "dtype_test") }) } pgx-5.8.0/doc.go000066400000000000000000000160131512357711200134230ustar00rootroot00000000000000// Package pgx is a PostgreSQL database driver. /* pgx provides a native PostgreSQL driver and can act as a database/sql driver. The native PostgreSQL interface is similar to the database/sql interface while providing better speed and access to PostgreSQL specific features. Use github.com/jackc/pgx/v5/stdlib to use pgx as a database/sql compatible driver. See that package's documentation for details. Establishing a Connection The primary way of establishing a connection is with [pgx.Connect]: conn, err := pgx.Connect(context.Background(), os.Getenv("DATABASE_URL")) The database connection string can be in URL or key/value format. Both PostgreSQL settings and pgx settings can be specified here. In addition, a config struct can be created by [ParseConfig] and modified before establishing the connection with [ConnectConfig] to configure settings such as tracing that cannot be configured with a connection string. Connection Pool [*pgx.Conn] represents a single connection to the database and is not concurrency safe. Use package github.com/jackc/pgx/v5/pgxpool for a concurrency safe connection pool. Query Interface pgx implements Query in the familiar database/sql style. However, pgx provides generic functions such as CollectRows and ForEachRow that are a simpler and safer way of processing rows than manually calling defer rows.Close(), rows.Next(), rows.Scan, and rows.Err(). CollectRows can be used collect all returned rows into a slice. rows, _ := conn.Query(context.Background(), "select generate_series(1,$1)", 5) numbers, err := pgx.CollectRows(rows, pgx.RowTo[int32]) if err != nil { return err } // numbers => [1 2 3 4 5] ForEachRow can be used to execute a callback function for every row. This is often easier than iterating over rows directly. var sum, n int32 rows, _ := conn.Query(context.Background(), "select generate_series(1,$1)", 10) _, err := pgx.ForEachRow(rows, []any{&n}, func() error { sum += n return nil }) if err != nil { return err } pgx also implements QueryRow in the same style as database/sql. var name string var weight int64 err := conn.QueryRow(context.Background(), "select name, weight from widgets where id=$1", 42).Scan(&name, &weight) if err != nil { return err } Use Exec to execute a query that does not return a result set. commandTag, err := conn.Exec(context.Background(), "delete from widgets where id=$1", 42) if err != nil { return err } if commandTag.RowsAffected() != 1 { return errors.New("No row found to delete") } PostgreSQL Data Types pgx uses the pgtype package to converting Go values to and from PostgreSQL values. It supports many PostgreSQL types directly and is customizable and extendable. User defined data types such as enums, domains, and composite types may require type registration. See that package's documentation for details. Transactions Transactions are started by calling Begin. tx, err := conn.Begin(context.Background()) if err != nil { return err } // Rollback is safe to call even if the tx is already closed, so if // the tx commits successfully, this is a no-op defer tx.Rollback(context.Background()) _, err = tx.Exec(context.Background(), "insert into foo(id) values (1)") if err != nil { return err } err = tx.Commit(context.Background()) if err != nil { return err } The Tx returned from Begin also implements the Begin method. This can be used to implement pseudo nested transactions. These are internally implemented with savepoints. Use BeginTx to control the transaction mode. BeginTx also can be used to ensure a new transaction is created instead of a pseudo nested transaction. BeginFunc and BeginTxFunc are functions that begin a transaction, execute a function, and commit or rollback the transaction depending on the return value of the function. These can be simpler and less error prone to use. err = pgx.BeginFunc(context.Background(), conn, func(tx pgx.Tx) error { _, err := tx.Exec(context.Background(), "insert into foo(id) values (1)") return err }) if err != nil { return err } Prepared Statements Prepared statements can be manually created with the Prepare method. However, this is rarely necessary because pgx includes an automatic statement cache by default. Queries run through the normal Query, QueryRow, and Exec functions are automatically prepared on first execution and the prepared statement is reused on subsequent executions. See ParseConfig for information on how to customize or disable the statement cache. Copy Protocol Use CopyFrom to efficiently insert multiple rows at a time using the PostgreSQL copy protocol. CopyFrom accepts a CopyFromSource interface. If the data is already in a [][]any use CopyFromRows to wrap it in a CopyFromSource interface. Or implement CopyFromSource to avoid buffering the entire data set in memory. rows := [][]any{ {"John", "Smith", int32(36)}, {"Jane", "Doe", int32(29)}, } copyCount, err := conn.CopyFrom( context.Background(), pgx.Identifier{"people"}, []string{"first_name", "last_name", "age"}, pgx.CopyFromRows(rows), ) When you already have a typed array using CopyFromSlice can be more convenient. rows := []User{ {"John", "Smith", 36}, {"Jane", "Doe", 29}, } copyCount, err := conn.CopyFrom( context.Background(), pgx.Identifier{"people"}, []string{"first_name", "last_name", "age"}, pgx.CopyFromSlice(len(rows), func(i int) ([]any, error) { return []any{rows[i].FirstName, rows[i].LastName, rows[i].Age}, nil }), ) CopyFrom can be faster than an insert with as few as 5 rows. Listen and Notify pgx can listen to the PostgreSQL notification system with the `Conn.WaitForNotification` method. It blocks until a notification is received or the context is canceled. _, err := conn.Exec(context.Background(), "listen channelname") if err != nil { return err } notification, err := conn.WaitForNotification(context.Background()) if err != nil { return err } // do something with notification Tracing and Logging pgx supports tracing by setting ConnConfig.Tracer. To combine several tracers you can use the multitracer.Tracer. In addition, the tracelog package provides the TraceLog type which lets a traditional logger act as a Tracer. For debug tracing of the actual PostgreSQL wire protocol messages see github.com/jackc/pgx/v5/pgproto3. Lower Level PostgreSQL Functionality github.com/jackc/pgx/v5/pgconn contains a lower level PostgreSQL driver roughly at the level of libpq. pgx.Conn is implemented on top of pgconn. The Conn.PgConn() method can be used to access this lower layer. PgBouncer By default pgx automatically uses prepared statements. Prepared statements are incompatible with PgBouncer. This can be disabled by setting a different QueryExecMode in ConnConfig.DefaultQueryExecMode. */ package pgx pgx-5.8.0/examples/000077500000000000000000000000001512357711200141445ustar00rootroot00000000000000pgx-5.8.0/examples/README.md000066400000000000000000000005721512357711200154270ustar00rootroot00000000000000# Examples * chat is a command line chat program using listen/notify. * todo is a command line todo list that demonstrates basic CRUD actions. * url_shortener contains a simple example of using pgx in a web context. * [Tern](https://github.com/jackc/tern) is a migration tool that uses pgx. * [The Pithy Reader](https://github.com/jackc/tpr) is a RSS aggregator that uses pgx. pgx-5.8.0/examples/chat/000077500000000000000000000000001512357711200150635ustar00rootroot00000000000000pgx-5.8.0/examples/chat/README.md000066400000000000000000000010471512357711200163440ustar00rootroot00000000000000# Description This is a sample chat program implemented using PostgreSQL's listen/notify functionality with pgx. Start multiple instances of this program connected to the same database to chat between them. ## Connection configuration The database connection is configured via DATABASE_URL and standard PostgreSQL environment variables (PGHOST, PGUSER, etc.) You can either export them then run chat: export PGHOST=/private/tmp ./chat Or you can prefix the chat execution with the environment variables: PGHOST=/private/tmp ./chat pgx-5.8.0/examples/chat/main.go000066400000000000000000000030321512357711200163340ustar00rootroot00000000000000package main import ( "bufio" "context" "fmt" "os" "github.com/jackc/pgx/v5/pgxpool" ) var pool *pgxpool.Pool func main() { var err error pool, err = pgxpool.New(context.Background(), os.Getenv("DATABASE_URL")) if err != nil { fmt.Fprintln(os.Stderr, "Unable to connect to database:", err) os.Exit(1) } go listen() fmt.Println(`Type a message and press enter. This message should appear in any other chat instances connected to the same database. Type "exit" to quit.`) scanner := bufio.NewScanner(os.Stdin) for scanner.Scan() { msg := scanner.Text() if msg == "exit" { os.Exit(0) } _, err = pool.Exec(context.Background(), "select pg_notify('chat', $1)", msg) if err != nil { fmt.Fprintln(os.Stderr, "Error sending notification:", err) os.Exit(1) } } if err := scanner.Err(); err != nil { fmt.Fprintln(os.Stderr, "Error scanning from stdin:", err) os.Exit(1) } } func listen() { conn, err := pool.Acquire(context.Background()) if err != nil { fmt.Fprintln(os.Stderr, "Error acquiring connection:", err) os.Exit(1) } defer conn.Release() _, err = conn.Exec(context.Background(), "listen chat") if err != nil { fmt.Fprintln(os.Stderr, "Error listening to chat channel:", err) os.Exit(1) } for { notification, err := conn.Conn().WaitForNotification(context.Background()) if err != nil { fmt.Fprintln(os.Stderr, "Error waiting for notification:", err) os.Exit(1) } fmt.Println("PID:", notification.PID, "Channel:", notification.Channel, "Payload:", notification.Payload) } } pgx-5.8.0/examples/todo/000077500000000000000000000000001512357711200151115ustar00rootroot00000000000000pgx-5.8.0/examples/todo/README.md000066400000000000000000000035141512357711200163730ustar00rootroot00000000000000# Description This is a sample todo list implemented using pgx as the connector to a PostgreSQL data store. # Usage Create a PostgreSQL database and run structure.sql into it to create the necessary data schema. Example: createdb todo psql todo < structure.sql Build todo: go build ## Connection configuration The database connection is configured via DATABASE_URL and standard PostgreSQL environment variables (PGHOST, PGUSER, etc.) You can either export them then run todo: export PGDATABASE=todo ./todo list Or you can prefix the todo execution with the environment variables: PGDATABASE=todo ./todo list ## Add a todo item ./todo add 'Learn go' ## List tasks ./todo list ## Update a task ./todo update 1 'Learn more go' ## Delete a task ./todo remove 1 # Example Setup and Execution jack@hk-47~/dev/go/src/github.com/jackc/pgx/examples/todo$ createdb todo jack@hk-47~/dev/go/src/github.com/jackc/pgx/examples/todo$ psql todo < structure.sql Expanded display is used automatically. Timing is on. CREATE TABLE Time: 6.363 ms jack@hk-47~/dev/go/src/github.com/jackc/pgx/examples/todo$ go build jack@hk-47~/dev/go/src/github.com/jackc/pgx/examples/todo$ export PGDATABASE=todo jack@hk-47~/dev/go/src/github.com/jackc/pgx/examples/todo$ ./todo list jack@hk-47~/dev/go/src/github.com/jackc/pgx/examples/todo$ ./todo add 'Learn Go' jack@hk-47~/dev/go/src/github.com/jackc/pgx/examples/todo$ ./todo list 1. Learn Go jack@hk-47~/dev/go/src/github.com/jackc/pgx/examples/todo$ ./todo update 1 'Learn more Go' jack@hk-47~/dev/go/src/github.com/jackc/pgx/examples/todo$ ./todo list 1. Learn more Go jack@hk-47~/dev/go/src/github.com/jackc/pgx/examples/todo$ ./todo remove 1 jack@hk-47~/dev/go/src/github.com/jackc/pgx/examples/todo$ ./todo list pgx-5.8.0/examples/todo/main.go000066400000000000000000000044331512357711200163700ustar00rootroot00000000000000package main import ( "context" "fmt" "os" "strconv" "github.com/jackc/pgx/v5" ) var conn *pgx.Conn func main() { var err error conn, err = pgx.Connect(context.Background(), os.Getenv("DATABASE_URL")) if err != nil { fmt.Fprintf(os.Stderr, "Unable to connection to database: %v\n", err) os.Exit(1) } if len(os.Args) == 1 { printHelp() os.Exit(0) } switch os.Args[1] { case "list": err = listTasks() if err != nil { fmt.Fprintf(os.Stderr, "Unable to list tasks: %v\n", err) os.Exit(1) } case "add": err = addTask(os.Args[2]) if err != nil { fmt.Fprintf(os.Stderr, "Unable to add task: %v\n", err) os.Exit(1) } case "update": n, err := strconv.ParseInt(os.Args[2], 10, 32) if err != nil { fmt.Fprintf(os.Stderr, "Unable convert task_num into int32: %v\n", err) os.Exit(1) } err = updateTask(int32(n), os.Args[3]) if err != nil { fmt.Fprintf(os.Stderr, "Unable to update task: %v\n", err) os.Exit(1) } case "remove": n, err := strconv.ParseInt(os.Args[2], 10, 32) if err != nil { fmt.Fprintf(os.Stderr, "Unable convert task_num into int32: %v\n", err) os.Exit(1) } err = removeTask(int32(n)) if err != nil { fmt.Fprintf(os.Stderr, "Unable to remove task: %v\n", err) os.Exit(1) } default: fmt.Fprintln(os.Stderr, "Invalid command") printHelp() os.Exit(1) } } func listTasks() error { rows, _ := conn.Query(context.Background(), "select * from tasks") for rows.Next() { var id int32 var description string err := rows.Scan(&id, &description) if err != nil { return err } fmt.Printf("%d. %s\n", id, description) } return rows.Err() } func addTask(description string) error { _, err := conn.Exec(context.Background(), "insert into tasks(description) values($1)", description) return err } func updateTask(itemNum int32, description string) error { _, err := conn.Exec(context.Background(), "update tasks set description=$1 where id=$2", description, itemNum) return err } func removeTask(itemNum int32) error { _, err := conn.Exec(context.Background(), "delete from tasks where id=$1", itemNum) return err } func printHelp() { fmt.Print(`Todo pgx demo Usage: todo list todo add task todo update task_num item todo remove task_num Example: todo add 'Learn Go' todo list `) } pgx-5.8.0/examples/todo/structure.sql000066400000000000000000000001151512357711200176670ustar00rootroot00000000000000create table tasks ( id serial primary key, description text not null ); pgx-5.8.0/examples/url_shortener/000077500000000000000000000000001512357711200170375ustar00rootroot00000000000000pgx-5.8.0/examples/url_shortener/README.md000066400000000000000000000012021512357711200203110ustar00rootroot00000000000000# Description This is a sample REST URL shortener service implemented using pgx as the connector to a PostgreSQL data store. # Usage Create a PostgreSQL database and run structure.sql into it to create the necessary data schema. Configure the database connection with `DATABASE_URL` or standard PostgreSQL (`PG*`) environment variables or Run main.go: ``` go run main.go ``` ## Create or Update a Shortened URL ``` curl -X PUT -d 'http://www.google.com' http://localhost:8080/google ``` ## Get a Shortened URL ``` curl http://localhost:8080/google ``` ## Delete a Shortened URL ``` curl -X DELETE http://localhost:8080/google ``` pgx-5.8.0/examples/url_shortener/main.go000066400000000000000000000042711512357711200203160ustar00rootroot00000000000000package main import ( "context" "io" "log" "net/http" "os" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgxpool" ) var db *pgxpool.Pool func getUrlHandler(w http.ResponseWriter, req *http.Request) { var url string err := db.QueryRow(context.Background(), "select url from shortened_urls where id=$1", req.URL.Path).Scan(&url) switch err { case nil: http.Redirect(w, req, url, http.StatusSeeOther) case pgx.ErrNoRows: http.NotFound(w, req) default: http.Error(w, "Internal server error", http.StatusInternalServerError) } } func putUrlHandler(w http.ResponseWriter, req *http.Request) { id := req.URL.Path var url string if body, err := io.ReadAll(req.Body); err == nil { url = string(body) } else { http.Error(w, "Internal server error", http.StatusInternalServerError) return } if _, err := db.Exec(context.Background(), `insert into shortened_urls(id, url) values ($1, $2) on conflict (id) do update set url=excluded.url`, id, url); err == nil { w.WriteHeader(http.StatusOK) } else { http.Error(w, "Internal server error", http.StatusInternalServerError) } } func deleteUrlHandler(w http.ResponseWriter, req *http.Request) { if _, err := db.Exec(context.Background(), "delete from shortened_urls where id=$1", req.URL.Path); err == nil { w.WriteHeader(http.StatusOK) } else { http.Error(w, "Internal server error", http.StatusInternalServerError) } } func urlHandler(w http.ResponseWriter, req *http.Request) { switch req.Method { case "GET": getUrlHandler(w, req) case "PUT": putUrlHandler(w, req) case "DELETE": deleteUrlHandler(w, req) default: w.Header().Add("Allow", "GET, PUT, DELETE") w.WriteHeader(http.StatusMethodNotAllowed) } } func main() { poolConfig, err := pgxpool.ParseConfig(os.Getenv("DATABASE_URL")) if err != nil { log.Fatalln("Unable to parse DATABASE_URL:", err) } db, err = pgxpool.NewWithConfig(context.Background(), poolConfig) if err != nil { log.Fatalln("Unable to create connection pool:", err) } http.HandleFunc("/", urlHandler) log.Println("Starting URL shortener on localhost:8080") err = http.ListenAndServe("localhost:8080", nil) if err != nil { log.Fatalln("Unable to start web server:", err) } } pgx-5.8.0/examples/url_shortener/structure.sql000066400000000000000000000001131512357711200216130ustar00rootroot00000000000000create table shortened_urls ( id text primary key, url text not null );pgx-5.8.0/extended_query_builder.go000066400000000000000000000074671512357711200174260ustar00rootroot00000000000000package pgx import ( "fmt" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgtype" ) // ExtendedQueryBuilder is used to choose the parameter formats, to format the parameters and to choose the result // formats for an extended query. type ExtendedQueryBuilder struct { ParamValues [][]byte paramValueBytes []byte ParamFormats []int16 ResultFormats []int16 } // Build sets ParamValues, ParamFormats, and ResultFormats for use with *PgConn.ExecParams or *PgConn.ExecPrepared. If // sd is nil then QueryExecModeExec behavior will be used. func (eqb *ExtendedQueryBuilder) Build(m *pgtype.Map, sd *pgconn.StatementDescription, args []any) error { eqb.reset() if sd == nil { for i := range args { err := eqb.appendParam(m, 0, pgtype.TextFormatCode, args[i]) if err != nil { err = fmt.Errorf("failed to encode args[%d]: %w", i, err) return err } } return nil } if len(sd.ParamOIDs) != len(args) { return fmt.Errorf("mismatched param and argument count") } for i := range args { err := eqb.appendParam(m, sd.ParamOIDs[i], -1, args[i]) if err != nil { err = fmt.Errorf("failed to encode args[%d]: %w", i, err) return err } } for i := range sd.Fields { eqb.appendResultFormat(m.FormatCodeForOID(sd.Fields[i].DataTypeOID)) } return nil } // appendParam appends a parameter to the query. format may be -1 to automatically choose the format. If arg is nil it // must be an untyped nil. func (eqb *ExtendedQueryBuilder) appendParam(m *pgtype.Map, oid uint32, format int16, arg any) error { if format == -1 { preferredFormat := eqb.chooseParameterFormatCode(m, oid, arg) preferredErr := eqb.appendParam(m, oid, preferredFormat, arg) if preferredErr == nil { return nil } var otherFormat int16 if preferredFormat == TextFormatCode { otherFormat = BinaryFormatCode } else { otherFormat = TextFormatCode } otherErr := eqb.appendParam(m, oid, otherFormat, arg) if otherErr == nil { return nil } return preferredErr // return the error from the preferred format } v, err := eqb.encodeExtendedParamValue(m, oid, format, arg) if err != nil { return err } eqb.ParamFormats = append(eqb.ParamFormats, format) eqb.ParamValues = append(eqb.ParamValues, v) return nil } // appendResultFormat appends a result format to the query. func (eqb *ExtendedQueryBuilder) appendResultFormat(format int16) { eqb.ResultFormats = append(eqb.ResultFormats, format) } // reset readies eqb to build another query. func (eqb *ExtendedQueryBuilder) reset() { eqb.ParamValues = eqb.ParamValues[0:0] eqb.paramValueBytes = eqb.paramValueBytes[0:0] eqb.ParamFormats = eqb.ParamFormats[0:0] eqb.ResultFormats = eqb.ResultFormats[0:0] if cap(eqb.ParamValues) > 64 { eqb.ParamValues = make([][]byte, 0, 64) } if cap(eqb.paramValueBytes) > 256 { eqb.paramValueBytes = make([]byte, 0, 256) } if cap(eqb.ParamFormats) > 64 { eqb.ParamFormats = make([]int16, 0, 64) } if cap(eqb.ResultFormats) > 64 { eqb.ResultFormats = make([]int16, 0, 64) } } func (eqb *ExtendedQueryBuilder) encodeExtendedParamValue(m *pgtype.Map, oid uint32, formatCode int16, arg any) ([]byte, error) { if eqb.paramValueBytes == nil { eqb.paramValueBytes = make([]byte, 0, 128) } pos := len(eqb.paramValueBytes) buf, err := m.Encode(oid, formatCode, arg, eqb.paramValueBytes) if err != nil { return nil, err } if buf == nil { return nil, nil } eqb.paramValueBytes = buf return eqb.paramValueBytes[pos:], nil } // chooseParameterFormatCode determines the correct format code for an // argument to a prepared statement. It defaults to TextFormatCode if no // determination can be made. func (eqb *ExtendedQueryBuilder) chooseParameterFormatCode(m *pgtype.Map, oid uint32, arg any) int16 { switch arg.(type) { case string, *string: return TextFormatCode } return m.FormatCodeForOID(oid) } pgx-5.8.0/go.mod000066400000000000000000000010321512357711200134300ustar00rootroot00000000000000module github.com/jackc/pgx/v5 go 1.24.0 require ( github.com/jackc/pgpassfile v1.0.0 github.com/jackc/pgservicefile v0.0.0-20240606120523-5a60cdf6a761 github.com/jackc/puddle/v2 v2.2.2 github.com/stretchr/testify v1.11.1 golang.org/x/sync v0.17.0 golang.org/x/text v0.29.0 ) require ( github.com/davecgh/go-spew v1.1.1 // indirect github.com/kr/pretty v0.3.0 // indirect github.com/pmezard/go-difflib v1.0.0 // indirect gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c // indirect gopkg.in/yaml.v3 v3.0.1 // indirect ) pgx-5.8.0/go.sum000066400000000000000000000065551512357711200134740ustar00rootroot00000000000000github.com/creack/pty v1.1.9/go.mod h1:oKZEueFk5CKHvIhNR5MUki03XCEU+Q6VDXinZuGJ33E= github.com/davecgh/go-spew v1.1.0/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/davecgh/go-spew v1.1.1 h1:vj9j/u1bqnvCEfJOwUhtlOARqs3+rkHYY13jYWTU97c= github.com/davecgh/go-spew v1.1.1/go.mod h1:J7Y8YcW2NihsgmVo/mv3lAwl/skON4iLHjSsI+c5H38= github.com/jackc/pgpassfile v1.0.0 h1:/6Hmqy13Ss2zCq62VdNG8tM1wchn8zjSGOBJ6icpsIM= github.com/jackc/pgpassfile v1.0.0/go.mod h1:CEx0iS5ambNFdcRtxPj5JhEz+xB6uRky5eyVu/W2HEg= github.com/jackc/pgservicefile v0.0.0-20240606120523-5a60cdf6a761 h1:iCEnooe7UlwOQYpKFhBabPMi4aNAfoODPEFNiAnClxo= github.com/jackc/pgservicefile v0.0.0-20240606120523-5a60cdf6a761/go.mod h1:5TJZWKEWniPve33vlWYSoGYefn3gLQRzjfDlhSJ9ZKM= github.com/jackc/puddle/v2 v2.2.2 h1:PR8nw+E/1w0GLuRFSmiioY6UooMp6KJv0/61nB7icHo= github.com/jackc/puddle/v2 v2.2.2/go.mod h1:vriiEXHvEE654aYKXXjOvZM39qJ0q+azkZFrfEOc3H4= github.com/kr/pretty v0.1.0/go.mod h1:dAy3ld7l9f0ibDNOQOHHMYYIIbhfbHSm3C4ZsoJORNo= github.com/kr/pretty v0.2.1/go.mod h1:ipq/a2n7PKx3OHsz4KJII5eveXtPO4qwEXGdVfWzfnI= github.com/kr/pretty v0.3.0 h1:WgNl7dwNpEZ6jJ9k1snq4pZsg7DOEN8hP9Xw0Tsjwk0= github.com/kr/pretty v0.3.0/go.mod h1:640gp4NfQd8pI5XOwp5fnNeVWj67G7CFk/SaSQn7NBk= github.com/kr/pty v1.1.1/go.mod h1:pFQYn66WHrOpPYNljwOMqo10TkYh1fy3cYio2l3bCsQ= github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI= github.com/kr/text v0.2.0 h1:5Nx0Ya0ZqY2ygV366QzturHI13Jq95ApcVaJBhpS+AY= github.com/kr/text v0.2.0/go.mod h1:eLer722TekiGuMkidMxC/pM04lWEeraHUUmBw8l2grE= github.com/pmezard/go-difflib v1.0.0 h1:4DBwDE0NGyQoBHbLQYPwSUPoCMWR5BEzIk/f1lZbAQM= github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= github.com/rogpeppe/go-internal v1.6.1 h1:/FiVV8dS/e+YqF2JvO3yXRFbBLTIuSDkuC7aBOAvL+k= github.com/rogpeppe/go-internal v1.6.1/go.mod h1:xXDCJY+GAPziupqXw64V24skbSoqbTEfhy4qGm1nDQc= github.com/stretchr/objx v0.1.0/go.mod h1:HFkY916IF+rwdDfMAkV7OtwuqBVzrE8GR6GFx+wExME= github.com/stretchr/testify v1.3.0/go.mod h1:M5WIy9Dh21IEIfnGCwXGc5bZfKNJtfHm1UVUgZn+9EI= github.com/stretchr/testify v1.7.0/go.mod h1:6Fq8oRcR53rry900zMqJjRRixrwX3KX962/h/Wwjteg= github.com/stretchr/testify v1.11.1 h1:7s2iGBzp5EwR7/aIZr8ao5+dra3wiQyKjjFuvgVKu7U= github.com/stretchr/testify v1.11.1/go.mod h1:wZwfW3scLgRK+23gO65QZefKpKQRnfz6sD981Nm4B6U= golang.org/x/sync v0.17.0 h1:l60nONMj9l5drqw6jlhIELNv9I0A4OFgRsG9k2oT9Ug= golang.org/x/sync v0.17.0/go.mod h1:9KTHXmSnoGruLpwFjVSX0lNNA75CykiMECbovNTZqGI= golang.org/x/text v0.29.0 h1:1neNs90w9YzJ9BocxfsQNHKuAT4pkghyXc4nhZ6sJvk= golang.org/x/text v0.29.0/go.mod h1:7MhJOA9CD2qZyOKYazxdYMF85OwPdEr9jTtBpO7ydH4= gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c h1:Hei/4ADfdWqJk1ZMxUNpqntNwaWcugrBjAiHlqqRiVk= gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c/go.mod h1:JHkPIbrfpd72SG/EVd6muEfDQjcINNoR0C8j2r3qZ4Q= gopkg.in/errgo.v2 v2.1.0/go.mod h1:hNsd1EY+bozCKY1Ytp96fpM3vjJbqLJn88ws8XvfDNI= gopkg.in/yaml.v3 v3.0.0-20200313102051-9f266ea9e77c/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= gopkg.in/yaml.v3 v3.0.1 h1:fxVm/GzAzEWqLHuvctI91KS9hhNmmWOoWu0XTYJS7CA= gopkg.in/yaml.v3 v3.0.1/go.mod h1:K4uyk7z7BCEPqu6E+C64Yfv1cQ7kz7rIZviUmN+EgEM= pgx-5.8.0/helper_test.go000066400000000000000000000117741512357711200152050ustar00rootroot00000000000000package pgx_test import ( "context" "os" "testing" "github.com/stretchr/testify/assert" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/require" ) var defaultConnTestRunner pgxtest.ConnTestRunner func init() { defaultConnTestRunner = pgxtest.DefaultConnTestRunner() defaultConnTestRunner.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config, err := pgx.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) return config } } func mustConnectString(t testing.TB, connString string) *pgx.Conn { conn, err := pgx.Connect(context.Background(), connString) if err != nil { t.Fatalf("Unable to establish connection: %v", err) } return conn } func mustParseConfig(t testing.TB, connString string) *pgx.ConnConfig { config, err := pgx.ParseConfig(connString) require.Nil(t, err) return config } func mustConnect(t testing.TB, config *pgx.ConnConfig) *pgx.Conn { conn, err := pgx.ConnectConfig(context.Background(), config) if err != nil { t.Fatalf("Unable to establish connection: %v", err) } return conn } func closeConn(t testing.TB, conn *pgx.Conn) { err := conn.Close(context.Background()) if err != nil { t.Fatalf("conn.Close unexpectedly failed: %v", err) } } func mustExec(t testing.TB, conn *pgx.Conn, sql string, arguments ...any) (commandTag pgconn.CommandTag) { var err error if commandTag, err = conn.Exec(context.Background(), sql, arguments...); err != nil { t.Fatalf("Exec unexpectedly failed with %v: %v", sql, err) } return } // Do a simple query to ensure the connection is still usable func ensureConnValid(t testing.TB, conn *pgx.Conn) { var sum, rowCount int32 rows, err := conn.Query(context.Background(), "select generate_series(1,$1)", 10) if err != nil { t.Fatalf("conn.Query failed: %v", err) } defer rows.Close() for rows.Next() { var n int32 rows.Scan(&n) sum += n rowCount++ } if rows.Err() != nil { t.Fatalf("conn.Query failed: %v", rows.Err()) } if rowCount != 10 { t.Error("Select called onDataRow wrong number of times") } if sum != 55 { t.Error("Wrong values returned") } } func assertConfigsEqual(t *testing.T, expected, actual *pgx.ConnConfig, testName string) { if !assert.NotNil(t, expected) { return } if !assert.NotNil(t, actual) { return } assert.Equalf(t, expected.Tracer, actual.Tracer, "%s - Tracer", testName) assert.Equalf(t, expected.ConnString(), actual.ConnString(), "%s - ConnString", testName) assert.Equalf(t, expected.StatementCacheCapacity, actual.StatementCacheCapacity, "%s - StatementCacheCapacity", testName) assert.Equalf(t, expected.DescriptionCacheCapacity, actual.DescriptionCacheCapacity, "%s - DescriptionCacheCapacity", testName) assert.Equalf(t, expected.DefaultQueryExecMode, actual.DefaultQueryExecMode, "%s - DefaultQueryExecMode", testName) assert.Equalf(t, expected.Host, actual.Host, "%s - Host", testName) assert.Equalf(t, expected.Database, actual.Database, "%s - Database", testName) assert.Equalf(t, expected.Port, actual.Port, "%s - Port", testName) assert.Equalf(t, expected.User, actual.User, "%s - User", testName) assert.Equalf(t, expected.Password, actual.Password, "%s - Password", testName) assert.Equalf(t, expected.ConnectTimeout, actual.ConnectTimeout, "%s - ConnectTimeout", testName) assert.Equalf(t, expected.RuntimeParams, actual.RuntimeParams, "%s - RuntimeParams", testName) // Can't test function equality, so just test that they are set or not. assert.Equalf(t, expected.ValidateConnect == nil, actual.ValidateConnect == nil, "%s - ValidateConnect", testName) assert.Equalf(t, expected.AfterConnect == nil, actual.AfterConnect == nil, "%s - AfterConnect", testName) if assert.Equalf(t, expected.TLSConfig == nil, actual.TLSConfig == nil, "%s - TLSConfig", testName) { if expected.TLSConfig != nil { assert.Equalf(t, expected.TLSConfig.InsecureSkipVerify, actual.TLSConfig.InsecureSkipVerify, "%s - TLSConfig InsecureSkipVerify", testName) assert.Equalf(t, expected.TLSConfig.ServerName, actual.TLSConfig.ServerName, "%s - TLSConfig ServerName", testName) } } if assert.Equalf(t, len(expected.Fallbacks), len(actual.Fallbacks), "%s - Fallbacks", testName) { for i := range expected.Fallbacks { assert.Equalf(t, expected.Fallbacks[i].Host, actual.Fallbacks[i].Host, "%s - Fallback %d - Host", testName, i) assert.Equalf(t, expected.Fallbacks[i].Port, actual.Fallbacks[i].Port, "%s - Fallback %d - Port", testName, i) if assert.Equalf(t, expected.Fallbacks[i].TLSConfig == nil, actual.Fallbacks[i].TLSConfig == nil, "%s - Fallback %d - TLSConfig", testName, i) { if expected.Fallbacks[i].TLSConfig != nil { assert.Equalf(t, expected.Fallbacks[i].TLSConfig.InsecureSkipVerify, actual.Fallbacks[i].TLSConfig.InsecureSkipVerify, "%s - Fallback %d - TLSConfig InsecureSkipVerify", testName) assert.Equalf(t, expected.Fallbacks[i].TLSConfig.ServerName, actual.Fallbacks[i].TLSConfig.ServerName, "%s - Fallback %d - TLSConfig ServerName", testName) } } } } } pgx-5.8.0/internal/000077500000000000000000000000001512357711200141425ustar00rootroot00000000000000pgx-5.8.0/internal/faultyconn/000077500000000000000000000000001512357711200163245ustar00rootroot00000000000000pgx-5.8.0/internal/faultyconn/faultyconn.go000066400000000000000000000051021512357711200210330ustar00rootroot00000000000000package faultyconn import ( "bytes" "io" "net" "time" "github.com/jackc/pgx/v5/pgproto3" ) // Conn is a wrapper for a net.Conn that allows inspection and modification of messages between a PostgreSQL client and // server. It is designed to be used in tests that use a *pgx.Conn or *pgconn.PgConn connected to a real PostgreSQL // server. Instead of mocking an entire server connection, this is used to specify and modify only the particular // aspects of a connection that are necessary. This can be easier to setup and is more true to real world conditions. // // It currently only supports handling frontend messages. type Conn struct { // HandleFrontendMessage is called for each frontend message received. It should use backendWriter to write to the // backend. HandleFrontendMessage func(backendWriter io.Writer, msg pgproto3.FrontendMessage) error // TODO: Implement this if we need to handle backend messages. // HandleBackendMessage func(w io.Writer, msg pgproto3.BackendMessage) error conn net.Conn fromFrontendBuf *bytes.Buffer fromBackendBuf *bytes.Buffer backend *pgproto3.Backend frontend *pgproto3.Frontend } // NewConn creates a new Conn that proxies the messages sent to and from the given net.Conn. New can be used with // pgconn.Config.AfterNetConnect to wrap a net.Conn for testing purposes. func New(c net.Conn) *Conn { fromFrontendBuf := &bytes.Buffer{} fromBackendBuf := &bytes.Buffer{} return &Conn{ conn: c, fromFrontendBuf: fromFrontendBuf, fromBackendBuf: fromBackendBuf, backend: pgproto3.NewBackend(fromFrontendBuf, c), frontend: pgproto3.NewFrontend(fromBackendBuf, c), } } func (c *Conn) Read(b []byte) (n int, err error) { return c.conn.Read(b) } func (c *Conn) Write(b []byte) (n int, err error) { if c.HandleFrontendMessage == nil { return c.conn.Write(b) } c.fromFrontendBuf.Write(b) for { msg, err := c.backend.Receive() if err != nil { if err == io.ErrUnexpectedEOF { break } return len(b), err } err = c.HandleFrontendMessage(c.conn, msg) if err != nil { return len(b), err } } return len(b), nil } func (c *Conn) Close() error { return c.conn.Close() } func (c *Conn) LocalAddr() net.Addr { return c.conn.LocalAddr() } func (c *Conn) RemoteAddr() net.Addr { return c.conn.RemoteAddr() } func (c *Conn) SetDeadline(t time.Time) error { return c.conn.SetDeadline(t) } func (c *Conn) SetReadDeadline(t time.Time) error { return c.conn.SetReadDeadline(t) } func (c *Conn) SetWriteDeadline(t time.Time) error { return c.conn.SetWriteDeadline(t) } pgx-5.8.0/internal/iobufpool/000077500000000000000000000000001512357711200161405ustar00rootroot00000000000000pgx-5.8.0/internal/iobufpool/iobufpool.go000066400000000000000000000026251512357711200204720ustar00rootroot00000000000000// Package iobufpool implements a global segregated-fit pool of buffers for IO. // // It uses *[]byte instead of []byte to avoid the sync.Pool allocation with Put. Unfortunately, using a pointer to avoid // an allocation is purposely not documented. https://github.com/golang/go/issues/16323 package iobufpool import ( "math/bits" "sync" ) const minPoolExpOf2 = 8 var pools [18]*sync.Pool func init() { for i := range pools { bufLen := 1 << (minPoolExpOf2 + i) pools[i] = &sync.Pool{ New: func() any { buf := make([]byte, bufLen) return &buf }, } } } // Get gets a []byte of len size with cap <= size*2. func Get(size int) *[]byte { i := getPoolIdx(size) if i >= len(pools) { buf := make([]byte, size) return &buf } ptrBuf := (pools[i].Get().(*[]byte)) *ptrBuf = (*ptrBuf)[:size] return ptrBuf } func getPoolIdx(size int) int { if size < 2 { return 0 } idx := bits.Len(uint(size-1)) - minPoolExpOf2 if idx < 0 { return 0 } return idx } // Put returns buf to the pool. func Put(buf *[]byte) { i := putPoolIdx(cap(*buf)) if i < 0 { return } pools[i].Put(buf) } func putPoolIdx(size int) int { // Only exact power-of-2 sizes match pool buckets if size&(size-1) != 0 { return -1 } // Calculate log2(size) using trailing zeros count exp := bits.TrailingZeros(uint(size)) idx := exp - minPoolExpOf2 if idx < 0 || idx >= len(pools) { return -1 } return idx } pgx-5.8.0/internal/iobufpool/iobufpool_internal_test.go000066400000000000000000000014211512357711200234160ustar00rootroot00000000000000package iobufpool import ( "testing" "github.com/stretchr/testify/assert" ) func TestPoolIdx(t *testing.T) { tests := []struct { size int expected int }{ {size: 0, expected: 0}, {size: 1, expected: 0}, {size: 255, expected: 0}, {size: 256, expected: 0}, {size: 257, expected: 1}, {size: 511, expected: 1}, {size: 512, expected: 1}, {size: 513, expected: 2}, {size: 1023, expected: 2}, {size: 1024, expected: 2}, {size: 1025, expected: 3}, {size: 2047, expected: 3}, {size: 2048, expected: 3}, {size: 2049, expected: 4}, {size: 8388607, expected: 15}, {size: 8388608, expected: 15}, {size: 8388609, expected: 16}, } for _, tt := range tests { idx := getPoolIdx(tt.size) assert.Equalf(t, tt.expected, idx, "size: %d", tt.size) } } pgx-5.8.0/internal/iobufpool/iobufpool_test.go000066400000000000000000000053321512357711200215270ustar00rootroot00000000000000package iobufpool_test import ( "testing" "github.com/jackc/pgx/v5/internal/iobufpool" "github.com/stretchr/testify/assert" ) func TestGetCap(t *testing.T) { tests := []struct { requestedLen int expectedCap int }{ {requestedLen: 0, expectedCap: 256}, {requestedLen: 128, expectedCap: 256}, {requestedLen: 255, expectedCap: 256}, {requestedLen: 256, expectedCap: 256}, {requestedLen: 257, expectedCap: 512}, {requestedLen: 511, expectedCap: 512}, {requestedLen: 512, expectedCap: 512}, {requestedLen: 513, expectedCap: 1024}, {requestedLen: 1023, expectedCap: 1024}, {requestedLen: 1024, expectedCap: 1024}, {requestedLen: 33554431, expectedCap: 33554432}, {requestedLen: 33554432, expectedCap: 33554432}, // Above 32 MiB skip the pool and allocate exactly the requested size. {requestedLen: 33554433, expectedCap: 33554433}, } for _, tt := range tests { buf := iobufpool.Get(tt.requestedLen) assert.Equalf(t, tt.requestedLen, len(*buf), "bad len for requestedLen: %d", len(*buf), tt.requestedLen) assert.Equalf(t, tt.expectedCap, cap(*buf), "bad cap for requestedLen: %d", tt.requestedLen) } } func TestPutHandlesWrongSizedBuffers(t *testing.T) { for putBufSize := range []int{0, 1, 128, 250, 256, 257, 1023, 1024, 1025, 1 << 28} { putBuf := make([]byte, putBufSize) iobufpool.Put(&putBuf) tests := []struct { requestedLen int expectedCap int }{ {requestedLen: 0, expectedCap: 256}, {requestedLen: 128, expectedCap: 256}, {requestedLen: 255, expectedCap: 256}, {requestedLen: 256, expectedCap: 256}, {requestedLen: 257, expectedCap: 512}, {requestedLen: 511, expectedCap: 512}, {requestedLen: 512, expectedCap: 512}, {requestedLen: 513, expectedCap: 1024}, {requestedLen: 1023, expectedCap: 1024}, {requestedLen: 1024, expectedCap: 1024}, {requestedLen: 33554431, expectedCap: 33554432}, {requestedLen: 33554432, expectedCap: 33554432}, // Above 32 MiB skip the pool and allocate exactly the requested size. {requestedLen: 33554433, expectedCap: 33554433}, } for _, tt := range tests { getBuf := iobufpool.Get(tt.requestedLen) assert.Equalf(t, tt.requestedLen, len(*getBuf), "len(putBuf): %d, requestedLen: %d", len(putBuf), tt.requestedLen) assert.Equalf(t, tt.expectedCap, cap(*getBuf), "cap(putBuf): %d, requestedLen: %d", cap(putBuf), tt.requestedLen) } } } func TestPutGetBufferReuse(t *testing.T) { // There is no way to guarantee a buffer will be reused. It should be, but a GC between the Put and the Get will cause // it not to be. So try many times. for range 100_000 { buf := iobufpool.Get(4) (*buf)[0] = 1 iobufpool.Put(buf) buf = iobufpool.Get(4) if (*buf)[0] == 1 { return } } t.Error("buffer was never reused") } pgx-5.8.0/internal/pgio/000077500000000000000000000000001512357711200151005ustar00rootroot00000000000000pgx-5.8.0/internal/pgio/README.md000066400000000000000000000002761512357711200163640ustar00rootroot00000000000000# pgio Package pgio is a low-level toolkit building messages in the PostgreSQL wire protocol. pgio provides functions for appending integers to a []byte while doing byte order conversion. pgx-5.8.0/internal/pgio/doc.go000066400000000000000000000003131512357711200161710ustar00rootroot00000000000000// Package pgio is a low-level toolkit building messages in the PostgreSQL wire protocol. /* pgio provides functions for appending integers to a []byte while doing byte order conversion. */ package pgio pgx-5.8.0/internal/pgio/write.go000066400000000000000000000015161512357711200165640ustar00rootroot00000000000000package pgio import "encoding/binary" func AppendUint16(buf []byte, n uint16) []byte { wp := len(buf) buf = append(buf, 0, 0) binary.BigEndian.PutUint16(buf[wp:], n) return buf } func AppendUint32(buf []byte, n uint32) []byte { wp := len(buf) buf = append(buf, 0, 0, 0, 0) binary.BigEndian.PutUint32(buf[wp:], n) return buf } func AppendUint64(buf []byte, n uint64) []byte { wp := len(buf) buf = append(buf, 0, 0, 0, 0, 0, 0, 0, 0) binary.BigEndian.PutUint64(buf[wp:], n) return buf } func AppendInt16(buf []byte, n int16) []byte { return AppendUint16(buf, uint16(n)) } func AppendInt32(buf []byte, n int32) []byte { return AppendUint32(buf, uint32(n)) } func AppendInt64(buf []byte, n int64) []byte { return AppendUint64(buf, uint64(n)) } func SetInt32(buf []byte, n int32) { binary.BigEndian.PutUint32(buf, uint32(n)) } pgx-5.8.0/internal/pgio/write_test.go000066400000000000000000000041511512357711200176210ustar00rootroot00000000000000package pgio import ( "reflect" "testing" ) func TestAppendUint16NilBuf(t *testing.T) { buf := AppendUint16(nil, 1) if !reflect.DeepEqual(buf, []byte{0, 1}) { t.Errorf("AppendUint16(nil, 1) => %v, want %v", buf, []byte{0, 1}) } } func TestAppendUint16EmptyBuf(t *testing.T) { buf := []byte{} buf = AppendUint16(buf, 1) if !reflect.DeepEqual(buf, []byte{0, 1}) { t.Errorf("AppendUint16(nil, 1) => %v, want %v", buf, []byte{0, 1}) } } func TestAppendUint16BufWithCapacityDoesNotAllocate(t *testing.T) { buf := make([]byte, 0, 4) AppendUint16(buf, 1) buf = buf[0:2] if !reflect.DeepEqual(buf, []byte{0, 1}) { t.Errorf("AppendUint16(nil, 1) => %v, want %v", buf, []byte{0, 1}) } } func TestAppendUint32NilBuf(t *testing.T) { buf := AppendUint32(nil, 1) if !reflect.DeepEqual(buf, []byte{0, 0, 0, 1}) { t.Errorf("AppendUint32(nil, 1) => %v, want %v", buf, []byte{0, 0, 0, 1}) } } func TestAppendUint32EmptyBuf(t *testing.T) { buf := []byte{} buf = AppendUint32(buf, 1) if !reflect.DeepEqual(buf, []byte{0, 0, 0, 1}) { t.Errorf("AppendUint32(nil, 1) => %v, want %v", buf, []byte{0, 0, 0, 1}) } } func TestAppendUint32BufWithCapacityDoesNotAllocate(t *testing.T) { buf := make([]byte, 0, 4) AppendUint32(buf, 1) buf = buf[0:4] if !reflect.DeepEqual(buf, []byte{0, 0, 0, 1}) { t.Errorf("AppendUint32(nil, 1) => %v, want %v", buf, []byte{0, 0, 0, 1}) } } func TestAppendUint64NilBuf(t *testing.T) { buf := AppendUint64(nil, 1) if !reflect.DeepEqual(buf, []byte{0, 0, 0, 0, 0, 0, 0, 1}) { t.Errorf("AppendUint64(nil, 1) => %v, want %v", buf, []byte{0, 0, 0, 0, 0, 0, 0, 1}) } } func TestAppendUint64EmptyBuf(t *testing.T) { buf := []byte{} buf = AppendUint64(buf, 1) if !reflect.DeepEqual(buf, []byte{0, 0, 0, 0, 0, 0, 0, 1}) { t.Errorf("AppendUint64(nil, 1) => %v, want %v", buf, []byte{0, 0, 0, 0, 0, 0, 0, 1}) } } func TestAppendUint64BufWithCapacityDoesNotAllocate(t *testing.T) { buf := make([]byte, 0, 8) AppendUint64(buf, 1) buf = buf[0:8] if !reflect.DeepEqual(buf, []byte{0, 0, 0, 0, 0, 0, 0, 1}) { t.Errorf("AppendUint64(nil, 1) => %v, want %v", buf, []byte{0, 0, 0, 0, 0, 0, 0, 1}) } } pgx-5.8.0/internal/pgmock/000077500000000000000000000000001512357711200154225ustar00rootroot00000000000000pgx-5.8.0/internal/pgmock/pgmock.go000066400000000000000000000052511512357711200172340ustar00rootroot00000000000000// Package pgmock provides the ability to mock a PostgreSQL server. package pgmock import ( "fmt" "io" "reflect" "github.com/jackc/pgx/v5/pgproto3" ) type Step interface { Step(*pgproto3.Backend) error } type Script struct { Steps []Step } func (s *Script) Run(backend *pgproto3.Backend) error { for _, step := range s.Steps { err := step.Step(backend) if err != nil { return err } } return nil } func (s *Script) Step(backend *pgproto3.Backend) error { return s.Run(backend) } type expectMessageStep struct { want pgproto3.FrontendMessage any bool } func (e *expectMessageStep) Step(backend *pgproto3.Backend) error { msg, err := backend.Receive() if err != nil { return err } if e.any && reflect.TypeOf(msg) == reflect.TypeOf(e.want) { return nil } if !reflect.DeepEqual(msg, e.want) { return fmt.Errorf("msg => %#v, e.want => %#v", msg, e.want) } return nil } type expectStartupMessageStep struct { want *pgproto3.StartupMessage any bool } func (e *expectStartupMessageStep) Step(backend *pgproto3.Backend) error { msg, err := backend.ReceiveStartupMessage() if err != nil { return err } if e.any { return nil } if !reflect.DeepEqual(msg, e.want) { return fmt.Errorf("msg => %#v, e.want => %#v", msg, e.want) } return nil } func ExpectMessage(want pgproto3.FrontendMessage) Step { return expectMessage(want, false) } func ExpectAnyMessage(want pgproto3.FrontendMessage) Step { return expectMessage(want, true) } func expectMessage(want pgproto3.FrontendMessage, any bool) Step { if want, ok := want.(*pgproto3.StartupMessage); ok { return &expectStartupMessageStep{want: want, any: any} } return &expectMessageStep{want: want, any: any} } type sendMessageStep struct { msg pgproto3.BackendMessage } func (e *sendMessageStep) Step(backend *pgproto3.Backend) error { backend.Send(e.msg) return backend.Flush() } func SendMessage(msg pgproto3.BackendMessage) Step { return &sendMessageStep{msg: msg} } type waitForCloseMessageStep struct{} func (e *waitForCloseMessageStep) Step(backend *pgproto3.Backend) error { for { msg, err := backend.Receive() if err == io.EOF { return nil } else if err != nil { return err } if _, ok := msg.(*pgproto3.Terminate); ok { return nil } } } func WaitForClose() Step { return &waitForCloseMessageStep{} } func AcceptUnauthenticatedConnRequestSteps() []Step { return []Step{ ExpectAnyMessage(&pgproto3.StartupMessage{ProtocolVersion: pgproto3.ProtocolVersionNumber, Parameters: map[string]string{}}), SendMessage(&pgproto3.AuthenticationOk{}), SendMessage(&pgproto3.BackendKeyData{ProcessID: 0, SecretKey: 0}), SendMessage(&pgproto3.ReadyForQuery{TxStatus: 'I'}), } } pgx-5.8.0/internal/pgmock/pgmock_test.go000066400000000000000000000045421512357711200202750ustar00rootroot00000000000000package pgmock_test import ( "context" "fmt" "net" "strings" "testing" "time" "github.com/jackc/pgx/v5/internal/pgmock" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgproto3" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func TestScript(t *testing.T) { script := &pgmock.Script{ Steps: pgmock.AcceptUnauthenticatedConnRequestSteps(), } script.Steps = append(script.Steps, pgmock.ExpectMessage(&pgproto3.Query{String: "select 42"})) script.Steps = append(script.Steps, pgmock.SendMessage(&pgproto3.RowDescription{ Fields: []pgproto3.FieldDescription{ { Name: []byte("?column?"), TableOID: 0, TableAttributeNumber: 0, DataTypeOID: 23, DataTypeSize: 4, TypeModifier: -1, Format: 0, }, }, })) script.Steps = append(script.Steps, pgmock.SendMessage(&pgproto3.DataRow{ Values: [][]byte{[]byte("42")}, })) script.Steps = append(script.Steps, pgmock.SendMessage(&pgproto3.CommandComplete{CommandTag: []byte("SELECT 1")})) script.Steps = append(script.Steps, pgmock.SendMessage(&pgproto3.ReadyForQuery{TxStatus: 'I'})) script.Steps = append(script.Steps, pgmock.ExpectMessage(&pgproto3.Terminate{})) ln, err := net.Listen("tcp", "127.0.0.1:") require.NoError(t, err) defer ln.Close() serverErrChan := make(chan error, 1) go func() { defer close(serverErrChan) conn, err := ln.Accept() if err != nil { serverErrChan <- err return } defer conn.Close() err = conn.SetDeadline(time.Now().Add(time.Second)) if err != nil { serverErrChan <- err return } err = script.Run(pgproto3.NewBackend(conn, conn)) if err != nil { serverErrChan <- err return } }() host, port, _ := strings.Cut(ln.Addr().String(), ":") connStr := fmt.Sprintf("sslmode=disable host=%s port=%s", host, port) ctx, cancel := context.WithTimeout(context.Background(), time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, connStr) require.NoError(t, err) results, err := pgConn.Exec(ctx, "select 42").ReadAll() assert.NoError(t, err) assert.Len(t, results, 1) assert.Nil(t, results[0].Err) assert.Equal(t, "SELECT 1", results[0].CommandTag.String()) assert.Len(t, results[0].Rows, 1) assert.Equal(t, "42", string(results[0].Rows[0][0])) pgConn.Close(ctx) assert.NoError(t, <-serverErrChan) } pgx-5.8.0/internal/sanitize/000077500000000000000000000000001512357711200157705ustar00rootroot00000000000000pgx-5.8.0/internal/sanitize/benchmmark.sh000066400000000000000000000027431512357711200204410ustar00rootroot00000000000000#!/usr/bin/env bash current_branch=$(git rev-parse --abbrev-ref HEAD) if [ "$current_branch" == "HEAD" ]; then current_branch=$(git rev-parse HEAD) fi restore_branch() { echo "Restoring original branch/commit: $current_branch" git checkout "$current_branch" } trap restore_branch EXIT # Check if there are uncommitted changes if ! git diff --quiet || ! git diff --cached --quiet; then echo "There are uncommitted changes. Please commit or stash them before running this script." exit 1 fi # Ensure that at least one commit argument is passed if [ "$#" -lt 1 ]; then echo "Usage: $0 ... " exit 1 fi commits=("$@") benchmarks_dir=benchmarks if ! mkdir -p "${benchmarks_dir}"; then echo "Unable to create dir for benchmarks data" exit 1 fi # Benchmark results bench_files=() # Run benchmark for each listed commit for i in "${!commits[@]}"; do commit="${commits[i]}" git checkout "$commit" || { echo "Failed to checkout $commit" exit 1 } # Sanitized commmit message commit_message=$(git log -1 --pretty=format:"%s" | tr -c '[:alnum:]-_' '_') # Benchmark data will go there bench_file="${benchmarks_dir}/${i}_${commit_message}.bench" if ! go test -bench=. -count=10 >"$bench_file"; then echo "Benchmarking failed for commit $commit" exit 1 fi bench_files+=("$bench_file") done # go install golang.org/x/perf/cmd/benchstat[@latest] benchstat "${bench_files[@]}" pgx-5.8.0/internal/sanitize/sanitize.go000066400000000000000000000224021512357711200201450ustar00rootroot00000000000000package sanitize import ( "bytes" "encoding/hex" "fmt" "slices" "strconv" "strings" "sync" "time" "unicode/utf8" ) // Part is either a string or an int. A string is raw SQL. An int is a // argument placeholder. type Part any type Query struct { Parts []Part } // utf.DecodeRune returns the utf8.RuneError for errors. But that is actually rune U+FFFD -- the unicode replacement // character. utf8.RuneError is not an error if it is also width 3. // // https://github.com/jackc/pgx/issues/1380 const replacementcharacterwidth = 3 const maxBufSize = 16384 // 16 Ki var bufPool = &pool[*bytes.Buffer]{ new: func() *bytes.Buffer { return &bytes.Buffer{} }, reset: func(b *bytes.Buffer) bool { n := b.Len() b.Reset() return n < maxBufSize }, } var null = []byte("null") func (q *Query) Sanitize(args ...any) (string, error) { argUse := make([]bool, len(args)) buf := bufPool.get() defer bufPool.put(buf) for _, part := range q.Parts { switch part := part.(type) { case string: buf.WriteString(part) case int: argIdx := part - 1 var p []byte if argIdx < 0 { return "", fmt.Errorf("first sql argument must be > 0") } if argIdx >= len(args) { return "", fmt.Errorf("insufficient arguments") } // Prevent SQL injection via Line Comment Creation // https://github.com/jackc/pgx/security/advisories/GHSA-m7wr-2xf7-cm9p buf.WriteByte(' ') arg := args[argIdx] switch arg := arg.(type) { case nil: p = null case int64: p = strconv.AppendInt(buf.AvailableBuffer(), arg, 10) case float64: p = strconv.AppendFloat(buf.AvailableBuffer(), arg, 'f', -1, 64) case bool: p = strconv.AppendBool(buf.AvailableBuffer(), arg) case []byte: p = QuoteBytes(buf.AvailableBuffer(), arg) case string: p = QuoteString(buf.AvailableBuffer(), arg) case time.Time: p = arg.Truncate(time.Microsecond). AppendFormat(buf.AvailableBuffer(), "'2006-01-02 15:04:05.999999999Z07:00:00'") default: return "", fmt.Errorf("invalid arg type: %T", arg) } argUse[argIdx] = true buf.Write(p) // Prevent SQL injection via Line Comment Creation // https://github.com/jackc/pgx/security/advisories/GHSA-m7wr-2xf7-cm9p buf.WriteByte(' ') default: return "", fmt.Errorf("invalid Part type: %T", part) } } for i, used := range argUse { if !used { return "", fmt.Errorf("unused argument: %d", i) } } return buf.String(), nil } func NewQuery(sql string) (*Query, error) { query := &Query{} query.init(sql) return query, nil } var sqlLexerPool = &pool[*sqlLexer]{ new: func() *sqlLexer { return &sqlLexer{} }, reset: func(sl *sqlLexer) bool { *sl = sqlLexer{} return true }, } func (q *Query) init(sql string) { parts := q.Parts[:0] if parts == nil { // dirty, but fast heuristic to preallocate for ~90% usecases n := strings.Count(sql, "$") + strings.Count(sql, "--") + 1 parts = make([]Part, 0, n) } l := sqlLexerPool.get() defer sqlLexerPool.put(l) l.src = sql l.stateFn = rawState l.parts = parts for l.stateFn != nil { l.stateFn = l.stateFn(l) } q.Parts = l.parts } func QuoteString(dst []byte, str string) []byte { const quote = '\'' // Preallocate space for the worst case scenario dst = slices.Grow(dst, len(str)*2+2) // Add opening quote dst = append(dst, quote) // Iterate through the string without allocating for i := 0; i < len(str); i++ { if str[i] == quote { dst = append(dst, quote, quote) } else { dst = append(dst, str[i]) } } // Add closing quote dst = append(dst, quote) return dst } func QuoteBytes(dst, buf []byte) []byte { if len(buf) == 0 { return append(dst, `'\x'`...) } // Calculate required length requiredLen := 3 + hex.EncodedLen(len(buf)) + 1 // Ensure dst has enough capacity if cap(dst)-len(dst) < requiredLen { newDst := make([]byte, len(dst), len(dst)+requiredLen) copy(newDst, dst) dst = newDst } // Record original length and extend slice origLen := len(dst) dst = dst[:origLen+requiredLen] // Add prefix dst[origLen] = '\'' dst[origLen+1] = '\\' dst[origLen+2] = 'x' // Encode bytes directly into dst hex.Encode(dst[origLen+3:len(dst)-1], buf) // Add suffix dst[len(dst)-1] = '\'' return dst } type sqlLexer struct { src string start int pos int nested int // multiline comment nesting level. stateFn stateFn parts []Part } type stateFn func(*sqlLexer) stateFn func rawState(l *sqlLexer) stateFn { for { r, width := utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width switch r { case 'e', 'E': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune == '\'' { l.pos += width return escapeStringState } case '\'': return singleQuoteState case '"': return doubleQuoteState case '$': nextRune, _ := utf8.DecodeRuneInString(l.src[l.pos:]) if '0' <= nextRune && nextRune <= '9' { if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos-width]) } l.start = l.pos return placeholderState } case '-': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune == '-' { l.pos += width return oneLineCommentState } case '/': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune == '*' { l.pos += width return multilineCommentState } case utf8.RuneError: if width != replacementcharacterwidth { if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos]) l.start = l.pos } return nil } } } } func singleQuoteState(l *sqlLexer) stateFn { for { r, width := utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width switch r { case '\'': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune != '\'' { return rawState } l.pos += width case utf8.RuneError: if width != replacementcharacterwidth { if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos]) l.start = l.pos } return nil } } } } func doubleQuoteState(l *sqlLexer) stateFn { for { r, width := utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width switch r { case '"': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune != '"' { return rawState } l.pos += width case utf8.RuneError: if width != replacementcharacterwidth { if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos]) l.start = l.pos } return nil } } } } // placeholderState consumes a placeholder value. The $ must have already has // already been consumed. The first rune must be a digit. func placeholderState(l *sqlLexer) stateFn { num := 0 for { r, width := utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width if '0' <= r && r <= '9' { num *= 10 num += int(r - '0') } else { l.parts = append(l.parts, num) l.pos -= width l.start = l.pos return rawState } } } func escapeStringState(l *sqlLexer) stateFn { for { r, width := utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width switch r { case '\\': _, width = utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width case '\'': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune != '\'' { return rawState } l.pos += width case utf8.RuneError: if width != replacementcharacterwidth { if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos]) l.start = l.pos } return nil } } } } func oneLineCommentState(l *sqlLexer) stateFn { for { r, width := utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width switch r { case '\\': _, width = utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width case '\n', '\r': return rawState case utf8.RuneError: if width != replacementcharacterwidth { if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos]) l.start = l.pos } return nil } } } } func multilineCommentState(l *sqlLexer) stateFn { for { r, width := utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width switch r { case '/': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune == '*' { l.pos += width l.nested++ } case '*': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune != '/' { continue } l.pos += width if l.nested == 0 { return rawState } l.nested-- case utf8.RuneError: if width != replacementcharacterwidth { if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos]) l.start = l.pos } return nil } } } } var queryPool = &pool[*Query]{ new: func() *Query { return &Query{} }, reset: func(q *Query) bool { n := len(q.Parts) q.Parts = q.Parts[:0] return n < 64 // drop too large queries }, } // SanitizeSQL replaces placeholder values with args. It quotes and escapes args // as necessary. This function is only safe when standard_conforming_strings is // on. func SanitizeSQL(sql string, args ...any) (string, error) { query := queryPool.get() query.init(sql) defer queryPool.put(query) return query.Sanitize(args...) } type pool[E any] struct { p sync.Pool new func() E reset func(E) bool } func (pool *pool[E]) get() E { v, ok := pool.p.Get().(E) if !ok { v = pool.new() } return v } func (p *pool[E]) put(v E) { if p.reset(v) { p.p.Put(v) } } pgx-5.8.0/internal/sanitize/sanitize_bench_test.go000066400000000000000000000024351512357711200223470ustar00rootroot00000000000000// sanitize_benchmark_test.go package sanitize_test import ( "testing" "time" "github.com/jackc/pgx/v5/internal/sanitize" ) var benchmarkSanitizeResult string const benchmarkQuery = "" + `SELECT * FROM "water_containers" WHERE NOT "id" = $1 -- int64 AND "tags" NOT IN $2 -- nil AND "volume" > $3 -- float64 AND "transportable" = $4 -- bool AND position($5 IN "sign") -- bytes AND "label" LIKE $6 -- string AND "created_at" > $7; -- time.Time` var benchmarkArgs = []any{ int64(12345), nil, float64(500), true, []byte("8BADF00D"), "kombucha's han'dy awokowa", time.Date(2015, 10, 1, 0, 0, 0, 0, time.UTC), } func BenchmarkSanitize(b *testing.B) { query, err := sanitize.NewQuery(benchmarkQuery) if err != nil { b.Fatalf("failed to create query: %v", err) } b.ReportAllocs() for b.Loop() { benchmarkSanitizeResult, err = query.Sanitize(benchmarkArgs...) if err != nil { b.Fatalf("failed to sanitize query: %v", err) } } } var benchmarkNewSQLResult string func BenchmarkSanitizeSQL(b *testing.B) { b.ReportAllocs() var err error for b.Loop() { benchmarkNewSQLResult, err = sanitize.SanitizeSQL(benchmarkQuery, benchmarkArgs...) if err != nil { b.Fatalf("failed to sanitize SQL: %v", err) } } } pgx-5.8.0/internal/sanitize/sanitize_fuzz_test.go000066400000000000000000000021541512357711200222640ustar00rootroot00000000000000package sanitize_test import ( "strings" "testing" "github.com/jackc/pgx/v5/internal/sanitize" ) func FuzzQuoteString(f *testing.F) { const prefix = "prefix" f.Add("new\nline") f.Add("sample text") f.Add("sample q'u'o't'e's") f.Add("select 'quoted $42', $1") f.Fuzz(func(t *testing.T, input string) { got := string(sanitize.QuoteString([]byte(prefix), input)) want := oldQuoteString(input) quoted, ok := strings.CutPrefix(got, prefix) if !ok { t.Fatalf("result has no prefix") } if want != quoted { t.Errorf("got %q", got) t.Fatalf("want %q", want) } }) } func FuzzQuoteBytes(f *testing.F) { const prefix = "prefix" f.Add([]byte(nil)) f.Add([]byte("\n")) f.Add([]byte("sample text")) f.Add([]byte("sample q'u'o't'e's")) f.Add([]byte("select 'quoted $42', $1")) f.Fuzz(func(t *testing.T, input []byte) { got := string(sanitize.QuoteBytes([]byte(prefix), input)) want := oldQuoteBytes(input) quoted, ok := strings.CutPrefix(got, prefix) if !ok { t.Fatalf("result has no prefix") } if want != quoted { t.Errorf("got %q", got) t.Fatalf("want %q", want) } }) } pgx-5.8.0/internal/sanitize/sanitize_test.go000066400000000000000000000175271512357711200212200ustar00rootroot00000000000000package sanitize_test import ( "encoding/hex" "strings" "testing" "time" "github.com/jackc/pgx/v5/internal/sanitize" ) func TestNewQuery(t *testing.T) { successTests := []struct { sql string expected sanitize.Query }{ { sql: "select 42", expected: sanitize.Query{Parts: []sanitize.Part{"select 42"}}, }, { sql: "select $1", expected: sanitize.Query{Parts: []sanitize.Part{"select ", 1}}, }, { sql: "select 'quoted $42', $1", expected: sanitize.Query{Parts: []sanitize.Part{"select 'quoted $42', ", 1}}, }, { sql: `select "doubled quoted $42", $1`, expected: sanitize.Query{Parts: []sanitize.Part{`select "doubled quoted $42", `, 1}}, }, { sql: "select 'foo''bar', $1", expected: sanitize.Query{Parts: []sanitize.Part{"select 'foo''bar', ", 1}}, }, { sql: `select "foo""bar", $1`, expected: sanitize.Query{Parts: []sanitize.Part{`select "foo""bar", `, 1}}, }, { sql: "select '''', $1", expected: sanitize.Query{Parts: []sanitize.Part{"select '''', ", 1}}, }, { sql: `select """", $1`, expected: sanitize.Query{Parts: []sanitize.Part{`select """", `, 1}}, }, { sql: "select $1, $2, $3, $4, $5, $6, $7, $8, $9, $10, $11", expected: sanitize.Query{Parts: []sanitize.Part{"select ", 1, ", ", 2, ", ", 3, ", ", 4, ", ", 5, ", ", 6, ", ", 7, ", ", 8, ", ", 9, ", ", 10, ", ", 11}}, }, { sql: `select "adsf""$1""adsf", $1, 'foo''$$12bar', $2, '$3'`, expected: sanitize.Query{Parts: []sanitize.Part{`select "adsf""$1""adsf", `, 1, `, 'foo''$$12bar', `, 2, `, '$3'`}}, }, { sql: `select E'escape string\' $42', $1`, expected: sanitize.Query{Parts: []sanitize.Part{`select E'escape string\' $42', `, 1}}, }, { sql: `select e'escape string\' $42', $1`, expected: sanitize.Query{Parts: []sanitize.Part{`select e'escape string\' $42', `, 1}}, }, { sql: `select /* a baby's toy */ 'barbie', $1`, expected: sanitize.Query{Parts: []sanitize.Part{`select /* a baby's toy */ 'barbie', `, 1}}, }, { sql: `select /* *_* */ $1`, expected: sanitize.Query{Parts: []sanitize.Part{`select /* *_* */ `, 1}}, }, { sql: `select 42 /* /* /* 42 */ */ */, $1`, expected: sanitize.Query{Parts: []sanitize.Part{`select 42 /* /* /* 42 */ */ */, `, 1}}, }, { sql: "select -- a baby's toy\n'barbie', $1", expected: sanitize.Query{Parts: []sanitize.Part{"select -- a baby's toy\n'barbie', ", 1}}, }, { sql: "select 42 -- is a Deep Thought's favorite number", expected: sanitize.Query{Parts: []sanitize.Part{"select 42 -- is a Deep Thought's favorite number"}}, }, { sql: "select 42, -- \\nis a Deep Thought's favorite number\n$1", expected: sanitize.Query{Parts: []sanitize.Part{"select 42, -- \\nis a Deep Thought's favorite number\n", 1}}, }, { sql: "select 42, -- \\nis a Deep Thought's favorite number\r$1", expected: sanitize.Query{Parts: []sanitize.Part{"select 42, -- \\nis a Deep Thought's favorite number\r", 1}}, }, { // https://github.com/jackc/pgx/issues/1380 sql: "select 'hello w�rld'", expected: sanitize.Query{Parts: []sanitize.Part{"select 'hello w�rld'"}}, }, { // Unterminated quoted string sql: "select 'hello world", expected: sanitize.Query{Parts: []sanitize.Part{"select 'hello world"}}, }, } for i, tt := range successTests { query, err := sanitize.NewQuery(tt.sql) if err != nil { t.Errorf("%d. %v", i, err) } if len(query.Parts) == len(tt.expected.Parts) { for j := range query.Parts { if query.Parts[j] != tt.expected.Parts[j] { t.Errorf("%d. expected part %d to be %v but it was %v", i, j, tt.expected.Parts[j], query.Parts[j]) } } } else { t.Errorf("%d. expected query parts to be %v but it was %v", i, tt.expected.Parts, query.Parts) } } } func TestQuerySanitize(t *testing.T) { successfulTests := []struct { query sanitize.Query args []any expected string }{ { query: sanitize.Query{Parts: []sanitize.Part{"select 42"}}, args: []any{}, expected: `select 42`, }, { query: sanitize.Query{Parts: []sanitize.Part{"select ", 1}}, args: []any{int64(42)}, expected: `select 42 `, }, { query: sanitize.Query{Parts: []sanitize.Part{"select ", 1}}, args: []any{float64(1.23)}, expected: `select 1.23 `, }, { query: sanitize.Query{Parts: []sanitize.Part{"select ", 1}}, args: []any{true}, expected: `select true `, }, { query: sanitize.Query{Parts: []sanitize.Part{"select ", 1}}, args: []any{[]byte{0, 1, 2, 3, 255}}, expected: `select '\x00010203ff' `, }, { query: sanitize.Query{Parts: []sanitize.Part{"select ", 1}}, args: []any{nil}, expected: `select null `, }, { query: sanitize.Query{Parts: []sanitize.Part{"select ", 1}}, args: []any{"foobar"}, expected: `select 'foobar' `, }, { query: sanitize.Query{Parts: []sanitize.Part{"select ", 1}}, args: []any{"foo'bar"}, expected: `select 'foo''bar' `, }, { query: sanitize.Query{Parts: []sanitize.Part{"select ", 1}}, args: []any{`foo\'bar`}, expected: `select 'foo\''bar' `, }, { query: sanitize.Query{Parts: []sanitize.Part{"insert ", 1}}, args: []any{time.Date(2020, time.March, 1, 23, 59, 59, 999999999, time.UTC)}, expected: `insert '2020-03-01 23:59:59.999999Z' `, }, { query: sanitize.Query{Parts: []sanitize.Part{"select 1-", 1}}, args: []any{int64(-1)}, expected: `select 1- -1 `, }, { query: sanitize.Query{Parts: []sanitize.Part{"select 1-", 1}}, args: []any{float64(-1)}, expected: `select 1- -1 `, }, } for i, tt := range successfulTests { actual, err := tt.query.Sanitize(tt.args...) if err != nil { t.Errorf("%d. %v", i, err) continue } if tt.expected != actual { t.Errorf("%d. expected %s, but got %s", i, tt.expected, actual) } } errorTests := []struct { query sanitize.Query args []any expected string }{ { query: sanitize.Query{Parts: []sanitize.Part{"select ", 1, ", ", 2}}, args: []any{int64(42)}, expected: `insufficient arguments`, }, { query: sanitize.Query{Parts: []sanitize.Part{"select 'foo'"}}, args: []any{int64(42)}, expected: `unused argument: 0`, }, { query: sanitize.Query{Parts: []sanitize.Part{"select ", 1}}, args: []any{42}, expected: `invalid arg type: int`, }, } for i, tt := range errorTests { _, err := tt.query.Sanitize(tt.args...) if err == nil || err.Error() != tt.expected { t.Errorf("%d. expected error %v, got %v", i, tt.expected, err) } } } func TestQuoteString(t *testing.T) { tc := func(name, input string) { t.Run(name, func(t *testing.T) { t.Parallel() got := string(sanitize.QuoteString(nil, input)) want := oldQuoteString(input) if got != want { t.Errorf("got: %s", got) t.Fatalf("want: %s", want) } }) } tc("empty", "") tc("text", "abcd") tc("with quotes", `one's hat is always a cat`) } // This function was used before optimizations. // You should keep for testing purposes - we want to ensure there are no breaking changes. func oldQuoteString(str string) string { return "'" + strings.ReplaceAll(str, "'", "''") + "'" } func TestQuoteBytes(t *testing.T) { tc := func(name string, input []byte) { t.Run(name, func(t *testing.T) { t.Parallel() got := string(sanitize.QuoteBytes(nil, input)) want := oldQuoteBytes(input) if got != want { t.Errorf("got: %s", got) t.Fatalf("want: %s", want) } }) } tc("nil", nil) tc("empty", []byte{}) tc("text", []byte("abcd")) } // This function was used before optimizations. // You should keep for testing purposes - we want to ensure there are no breaking changes. func oldQuoteBytes(buf []byte) string { return `'\x` + hex.EncodeToString(buf) + "'" } pgx-5.8.0/internal/stmtcache/000077500000000000000000000000001512357711200161155ustar00rootroot00000000000000pgx-5.8.0/internal/stmtcache/lru_cache.go000066400000000000000000000063211512357711200203730ustar00rootroot00000000000000package stmtcache import ( "container/list" "github.com/jackc/pgx/v5/pgconn" ) // LRUCache implements Cache with a Least Recently Used (LRU) cache. type LRUCache struct { cap int m map[string]*list.Element l *list.List invalidStmts []*pgconn.StatementDescription invalidSet map[string]struct{} } // NewLRUCache creates a new LRUCache. cap is the maximum size of the cache. func NewLRUCache(cap int) *LRUCache { return &LRUCache{ cap: cap, m: make(map[string]*list.Element), l: list.New(), invalidSet: make(map[string]struct{}), } } // Get returns the statement description for sql. Returns nil if not found. func (c *LRUCache) Get(key string) *pgconn.StatementDescription { if el, ok := c.m[key]; ok { c.l.MoveToFront(el) return el.Value.(*pgconn.StatementDescription) } return nil } // Put stores sd in the cache. Put panics if sd.SQL is "". Put does nothing if sd.SQL already exists in the cache or // sd.SQL has been invalidated and HandleInvalidated has not been called yet. func (c *LRUCache) Put(sd *pgconn.StatementDescription) { if sd.SQL == "" { panic("cannot store statement description with empty SQL") } if _, present := c.m[sd.SQL]; present { return } // The statement may have been invalidated but not yet handled. Do not readd it to the cache. if _, invalidated := c.invalidSet[sd.SQL]; invalidated { return } if c.l.Len() == c.cap { c.invalidateOldest() } el := c.l.PushFront(sd) c.m[sd.SQL] = el } // Invalidate invalidates statement description identified by sql. Does nothing if not found. func (c *LRUCache) Invalidate(sql string) { if el, ok := c.m[sql]; ok { delete(c.m, sql) sd := el.Value.(*pgconn.StatementDescription) c.invalidStmts = append(c.invalidStmts, sd) c.invalidSet[sql] = struct{}{} c.l.Remove(el) } } // InvalidateAll invalidates all statement descriptions. func (c *LRUCache) InvalidateAll() { el := c.l.Front() for el != nil { sd := el.Value.(*pgconn.StatementDescription) c.invalidStmts = append(c.invalidStmts, sd) c.invalidSet[sd.SQL] = struct{}{} el = el.Next() } c.m = make(map[string]*list.Element) c.l = list.New() } // GetInvalidated returns a slice of all statement descriptions invalidated since the last call to RemoveInvalidated. func (c *LRUCache) GetInvalidated() []*pgconn.StatementDescription { return c.invalidStmts } // RemoveInvalidated removes all invalidated statement descriptions. No other calls to Cache must be made between a // call to GetInvalidated and RemoveInvalidated or RemoveInvalidated may remove statement descriptions that were // never seen by the call to GetInvalidated. func (c *LRUCache) RemoveInvalidated() { c.invalidStmts = nil c.invalidSet = make(map[string]struct{}) } // Len returns the number of cached prepared statement descriptions. func (c *LRUCache) Len() int { return c.l.Len() } // Cap returns the maximum number of cached prepared statement descriptions. func (c *LRUCache) Cap() int { return c.cap } func (c *LRUCache) invalidateOldest() { oldest := c.l.Back() sd := oldest.Value.(*pgconn.StatementDescription) c.invalidStmts = append(c.invalidStmts, sd) c.invalidSet[sd.SQL] = struct{}{} delete(c.m, sd.SQL) c.l.Remove(oldest) } pgx-5.8.0/internal/stmtcache/stmtcache.go000066400000000000000000000031001512357711200204110ustar00rootroot00000000000000// Package stmtcache is a cache for statement descriptions. package stmtcache import ( "crypto/sha256" "encoding/hex" "github.com/jackc/pgx/v5/pgconn" ) // StatementName returns a statement name that will be stable for sql across multiple connections and program // executions. func StatementName(sql string) string { digest := sha256.Sum256([]byte(sql)) return "stmtcache_" + hex.EncodeToString(digest[0:24]) } // Cache caches statement descriptions. type Cache interface { // Get returns the statement description for sql. Returns nil if not found. Get(sql string) *pgconn.StatementDescription // Put stores sd in the cache. Put panics if sd.SQL is "". Put does nothing if sd.SQL already exists in the cache. Put(sd *pgconn.StatementDescription) // Invalidate invalidates statement description identified by sql. Does nothing if not found. Invalidate(sql string) // InvalidateAll invalidates all statement descriptions. InvalidateAll() // GetInvalidated returns a slice of all statement descriptions invalidated since the last call to RemoveInvalidated. GetInvalidated() []*pgconn.StatementDescription // RemoveInvalidated removes all invalidated statement descriptions. No other calls to Cache must be made between a // call to GetInvalidated and RemoveInvalidated or RemoveInvalidated may remove statement descriptions that were // never seen by the call to GetInvalidated. RemoveInvalidated() // Len returns the number of cached prepared statement descriptions. Len() int // Cap returns the maximum number of cached prepared statement descriptions. Cap() int } pgx-5.8.0/large_objects.go000066400000000000000000000107751512357711200154720ustar00rootroot00000000000000package pgx import ( "context" "errors" "io" "github.com/jackc/pgx/v5/pgtype" ) // The PostgreSQL wire protocol has a limit of 1 GB - 1 per message. See definition of // PQ_LARGE_MESSAGE_LIMIT in the PostgreSQL source code. To allow for the other data // in the message,maxLargeObjectMessageLength should be no larger than 1 GB - 1 KB. var maxLargeObjectMessageLength = 1024*1024*1024 - 1024 // LargeObjects is a structure used to access the large objects API. It is only valid within the transaction where it // was created. // // For more details see: http://www.postgresql.org/docs/current/static/largeobjects.html type LargeObjects struct { tx Tx } type LargeObjectMode int32 const ( LargeObjectModeWrite LargeObjectMode = 0x20000 LargeObjectModeRead LargeObjectMode = 0x40000 ) // Create creates a new large object. If oid is zero, the server assigns an unused OID. func (o *LargeObjects) Create(ctx context.Context, oid uint32) (uint32, error) { err := o.tx.QueryRow(ctx, "select lo_create($1)", oid).Scan(&oid) return oid, err } // Open opens an existing large object with the given mode. ctx will also be used for all operations on the opened large // object. func (o *LargeObjects) Open(ctx context.Context, oid uint32, mode LargeObjectMode) (*LargeObject, error) { var fd int32 err := o.tx.QueryRow(ctx, "select lo_open($1, $2)", oid, mode).Scan(&fd) if err != nil { return nil, err } return &LargeObject{fd: fd, tx: o.tx, ctx: ctx}, nil } // Unlink removes a large object from the database. func (o *LargeObjects) Unlink(ctx context.Context, oid uint32) error { var result int32 err := o.tx.QueryRow(ctx, "select lo_unlink($1)", oid).Scan(&result) if err != nil { return err } if result != 1 { return errors.New("failed to remove large object") } return nil } // A LargeObject is a large object stored on the server. It is only valid within the transaction that it was initialized // in. It uses the context it was initialized with for all operations. It implements these interfaces: // // io.Writer // io.Reader // io.Seeker // io.Closer type LargeObject struct { ctx context.Context tx Tx fd int32 } // Write writes p to the large object and returns the number of bytes written and an error if not all of p was written. func (o *LargeObject) Write(p []byte) (int, error) { nTotal := 0 for { expected := len(p) - nTotal if expected == 0 { break } else if expected > maxLargeObjectMessageLength { expected = maxLargeObjectMessageLength } var n int err := o.tx.QueryRow(o.ctx, "select lowrite($1, $2)", o.fd, p[nTotal:nTotal+expected]).Scan(&n) if err != nil { return nTotal, err } if n < 0 { return nTotal, errors.New("failed to write to large object") } nTotal += n if n < expected { return nTotal, errors.New("short write to large object") } else if n > expected { return nTotal, errors.New("invalid write to large object") } } return nTotal, nil } // Read reads up to len(p) bytes into p returning the number of bytes read. func (o *LargeObject) Read(p []byte) (int, error) { nTotal := 0 for { expected := len(p) - nTotal if expected == 0 { break } else if expected > maxLargeObjectMessageLength { expected = maxLargeObjectMessageLength } res := pgtype.PreallocBytes(p[nTotal:]) err := o.tx.QueryRow(o.ctx, "select loread($1, $2)", o.fd, expected).Scan(&res) // We compute expected so that it always fits into p, so it should never happen // that PreallocBytes's ScanBytes had to allocate a new slice. nTotal += len(res) if err != nil { return nTotal, err } if len(res) < expected { return nTotal, io.EOF } else if len(res) > expected { return nTotal, errors.New("invalid read of large object") } } return nTotal, nil } // Seek moves the current location pointer to the new location specified by offset. func (o *LargeObject) Seek(offset int64, whence int) (n int64, err error) { err = o.tx.QueryRow(o.ctx, "select lo_lseek64($1, $2, $3)", o.fd, offset, whence).Scan(&n) return n, err } // Tell returns the current read or write location of the large object descriptor. func (o *LargeObject) Tell() (n int64, err error) { err = o.tx.QueryRow(o.ctx, "select lo_tell64($1)", o.fd).Scan(&n) return n, err } // Truncate the large object to size. func (o *LargeObject) Truncate(size int64) (err error) { _, err = o.tx.Exec(o.ctx, "select lo_truncate64($1, $2)", o.fd, size) return err } // Close the large object descriptor. func (o *LargeObject) Close() error { _, err := o.tx.Exec(o.ctx, "select lo_close($1)", o.fd) return err } pgx-5.8.0/large_objects_private_test.go000066400000000000000000000007111512357711200202500ustar00rootroot00000000000000package pgx import ( "testing" ) // SetMaxLargeObjectMessageLength sets internal maxLargeObjectMessageLength variable // to the given length for the duration of the test. // // Tests using this helper should not use t.Parallel(). func SetMaxLargeObjectMessageLength(t *testing.T, length int) { t.Helper() original := maxLargeObjectMessageLength t.Cleanup(func() { maxLargeObjectMessageLength = original }) maxLargeObjectMessageLength = length } pgx-5.8.0/large_objects_test.go000066400000000000000000000134131512357711200165210ustar00rootroot00000000000000package pgx_test import ( "context" "io" "os" "testing" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgxtest" ) func TestLargeObjects(t *testing.T) { // We use a very short limit to test chunking logic. pgx.SetMaxLargeObjectMessageLength(t, 2) ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn, err := pgx.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) if err != nil { t.Fatal(err) } pgxtest.SkipCockroachDB(t, conn, "Server does support large objects") tx, err := conn.Begin(ctx) if err != nil { t.Fatal(err) } testLargeObjects(t, ctx, tx) } func TestLargeObjectsSimpleProtocol(t *testing.T) { // We use a very short limit to test chunking logic. pgx.SetMaxLargeObjectMessageLength(t, 2) ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgx.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) if err != nil { t.Fatal(err) } config.DefaultQueryExecMode = pgx.QueryExecModeSimpleProtocol conn, err := pgx.ConnectConfig(ctx, config) if err != nil { t.Fatal(err) } pgxtest.SkipCockroachDB(t, conn, "Server does support large objects") tx, err := conn.Begin(ctx) if err != nil { t.Fatal(err) } testLargeObjects(t, ctx, tx) } func testLargeObjects(t *testing.T, ctx context.Context, tx pgx.Tx) { lo := tx.LargeObjects() id, err := lo.Create(ctx, 0) if err != nil { t.Fatal(err) } obj, err := lo.Open(ctx, id, pgx.LargeObjectModeRead|pgx.LargeObjectModeWrite) if err != nil { t.Fatal(err) } n, err := obj.Write([]byte("testing")) if err != nil { t.Fatal(err) } if n != 7 { t.Errorf("Expected n to be 7, got %d", n) } pos, err := obj.Seek(1, 0) if err != nil { t.Fatal(err) } if pos != 1 { t.Errorf("Expected pos to be 1, got %d", pos) } res := make([]byte, 6) n, err = obj.Read(res) if err != nil { t.Fatal(err) } if string(res) != "esting" { t.Errorf(`Expected res to be "esting", got %q`, res) } if n != 6 { t.Errorf("Expected n to be 6, got %d", n) } n, err = obj.Read(res) if err != io.EOF { t.Error("Expected io.EOF, go nil") } if n != 0 { t.Errorf("Expected n to be 0, got %d", n) } pos, err = obj.Tell() if err != nil { t.Fatal(err) } if pos != 7 { t.Errorf("Expected pos to be 7, got %d", pos) } err = obj.Truncate(1) if err != nil { t.Fatal(err) } pos, err = obj.Seek(-1, 2) if err != nil { t.Fatal(err) } if pos != 0 { t.Errorf("Expected pos to be 0, got %d", pos) } res = make([]byte, 2) n, err = obj.Read(res) if err != io.EOF { t.Errorf("Expected err to be io.EOF, got %v", err) } if n != 1 { t.Errorf("Expected n to be 1, got %d", n) } if res[0] != 't' { t.Errorf("Expected res[0] to be 't', got %v", res[0]) } err = obj.Close() if err != nil { t.Fatal(err) } err = lo.Unlink(ctx, id) if err != nil { t.Fatal(err) } _, err = lo.Open(ctx, id, pgx.LargeObjectModeRead) if e, ok := err.(*pgconn.PgError); !ok || e.Code != "42704" { t.Errorf("Expected undefined_object error (42704), got %#v", err) } } func TestLargeObjectsMultipleTransactions(t *testing.T) { // We use a very short limit to test chunking logic. pgx.SetMaxLargeObjectMessageLength(t, 2) ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn, err := pgx.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) if err != nil { t.Fatal(err) } pgxtest.SkipCockroachDB(t, conn, "Server does support large objects") tx, err := conn.Begin(ctx) if err != nil { t.Fatal(err) } lo := tx.LargeObjects() id, err := lo.Create(ctx, 0) if err != nil { t.Fatal(err) } obj, err := lo.Open(ctx, id, pgx.LargeObjectModeWrite) if err != nil { t.Fatal(err) } n, err := obj.Write([]byte("testing")) if err != nil { t.Fatal(err) } if n != 7 { t.Errorf("Expected n to be 7, got %d", n) } // Commit the first transaction err = tx.Commit(ctx) if err != nil { t.Fatal(err) } // IMPORTANT: Use the same connection for another query query := `select n from generate_series(1,10) n` rows, err := conn.Query(ctx, query) if err != nil { t.Fatal(err) } rows.Close() // Start a new transaction tx2, err := conn.Begin(ctx) if err != nil { t.Fatal(err) } lo2 := tx2.LargeObjects() // Reopen the large object in the new transaction obj2, err := lo2.Open(ctx, id, pgx.LargeObjectModeRead|pgx.LargeObjectModeWrite) if err != nil { t.Fatal(err) } pos, err := obj2.Seek(1, 0) if err != nil { t.Fatal(err) } if pos != 1 { t.Errorf("Expected pos to be 1, got %d", pos) } res := make([]byte, 6) n, err = obj2.Read(res) if err != nil { t.Fatal(err) } if string(res) != "esting" { t.Errorf(`Expected res to be "esting", got %q`, res) } if n != 6 { t.Errorf("Expected n to be 6, got %d", n) } n, err = obj2.Read(res) if err != io.EOF { t.Error("Expected io.EOF, go nil") } if n != 0 { t.Errorf("Expected n to be 0, got %d", n) } pos, err = obj2.Tell() if err != nil { t.Fatal(err) } if pos != 7 { t.Errorf("Expected pos to be 7, got %d", pos) } err = obj2.Truncate(1) if err != nil { t.Fatal(err) } pos, err = obj2.Seek(-1, 2) if err != nil { t.Fatal(err) } if pos != 0 { t.Errorf("Expected pos to be 0, got %d", pos) } res = make([]byte, 2) n, err = obj2.Read(res) if err != io.EOF { t.Errorf("Expected err to be io.EOF, got %v", err) } if n != 1 { t.Errorf("Expected n to be 1, got %d", n) } if res[0] != 't' { t.Errorf("Expected res[0] to be 't', got %v", res[0]) } err = obj2.Close() if err != nil { t.Fatal(err) } err = lo2.Unlink(ctx, id) if err != nil { t.Fatal(err) } _, err = lo2.Open(ctx, id, pgx.LargeObjectModeRead) if e, ok := err.(*pgconn.PgError); !ok || e.Code != "42704" { t.Errorf("Expected undefined_object error (42704), got %#v", err) } } pgx-5.8.0/log/000077500000000000000000000000001512357711200131075ustar00rootroot00000000000000pgx-5.8.0/log/testingadapter/000077500000000000000000000000001512357711200161255ustar00rootroot00000000000000pgx-5.8.0/log/testingadapter/adapter.go000066400000000000000000000013201512357711200200700ustar00rootroot00000000000000// Package testingadapter provides a logger that writes to a test or benchmark // log. package testingadapter import ( "context" "fmt" "github.com/jackc/pgx/v5/tracelog" ) // TestingLogger interface defines the subset of testing.TB methods used by this // adapter. type TestingLogger interface { Log(args ...any) } type Logger struct { l TestingLogger } func NewLogger(l TestingLogger) *Logger { return &Logger{l: l} } func (l *Logger) Log(ctx context.Context, level tracelog.LogLevel, msg string, data map[string]any) { logArgs := make([]any, 0, 2+len(data)) logArgs = append(logArgs, level, msg) for k, v := range data { logArgs = append(logArgs, fmt.Sprintf("%s=%v", k, v)) } l.l.Log(logArgs...) } pgx-5.8.0/multitracer/000077500000000000000000000000001512357711200146615ustar00rootroot00000000000000pgx-5.8.0/multitracer/tracer.go000066400000000000000000000106631512357711200164760ustar00rootroot00000000000000// Package multitracer provides a Tracer that can combine several tracers into one. package multitracer import ( "context" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgxpool" ) // Tracer can combine several tracers into one. // You can use New to automatically split tracers by interface. type Tracer struct { QueryTracers []pgx.QueryTracer BatchTracers []pgx.BatchTracer CopyFromTracers []pgx.CopyFromTracer PrepareTracers []pgx.PrepareTracer ConnectTracers []pgx.ConnectTracer PoolAcquireTracers []pgxpool.AcquireTracer PoolReleaseTracers []pgxpool.ReleaseTracer } // New returns new Tracer from tracers with automatically split tracers by interface. func New(tracers ...pgx.QueryTracer) *Tracer { var t Tracer for _, tracer := range tracers { t.QueryTracers = append(t.QueryTracers, tracer) if batchTracer, ok := tracer.(pgx.BatchTracer); ok { t.BatchTracers = append(t.BatchTracers, batchTracer) } if copyFromTracer, ok := tracer.(pgx.CopyFromTracer); ok { t.CopyFromTracers = append(t.CopyFromTracers, copyFromTracer) } if prepareTracer, ok := tracer.(pgx.PrepareTracer); ok { t.PrepareTracers = append(t.PrepareTracers, prepareTracer) } if connectTracer, ok := tracer.(pgx.ConnectTracer); ok { t.ConnectTracers = append(t.ConnectTracers, connectTracer) } if poolAcquireTracer, ok := tracer.(pgxpool.AcquireTracer); ok { t.PoolAcquireTracers = append(t.PoolAcquireTracers, poolAcquireTracer) } if poolReleaseTracer, ok := tracer.(pgxpool.ReleaseTracer); ok { t.PoolReleaseTracers = append(t.PoolReleaseTracers, poolReleaseTracer) } } return &t } func (t *Tracer) TraceQueryStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryStartData) context.Context { for _, tracer := range t.QueryTracers { ctx = tracer.TraceQueryStart(ctx, conn, data) } return ctx } func (t *Tracer) TraceQueryEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryEndData) { for _, tracer := range t.QueryTracers { tracer.TraceQueryEnd(ctx, conn, data) } } func (t *Tracer) TraceBatchStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchStartData) context.Context { for _, tracer := range t.BatchTracers { ctx = tracer.TraceBatchStart(ctx, conn, data) } return ctx } func (t *Tracer) TraceBatchQuery(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchQueryData) { for _, tracer := range t.BatchTracers { tracer.TraceBatchQuery(ctx, conn, data) } } func (t *Tracer) TraceBatchEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchEndData) { for _, tracer := range t.BatchTracers { tracer.TraceBatchEnd(ctx, conn, data) } } func (t *Tracer) TraceCopyFromStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceCopyFromStartData) context.Context { for _, tracer := range t.CopyFromTracers { ctx = tracer.TraceCopyFromStart(ctx, conn, data) } return ctx } func (t *Tracer) TraceCopyFromEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceCopyFromEndData) { for _, tracer := range t.CopyFromTracers { tracer.TraceCopyFromEnd(ctx, conn, data) } } func (t *Tracer) TracePrepareStart(ctx context.Context, conn *pgx.Conn, data pgx.TracePrepareStartData) context.Context { for _, tracer := range t.PrepareTracers { ctx = tracer.TracePrepareStart(ctx, conn, data) } return ctx } func (t *Tracer) TracePrepareEnd(ctx context.Context, conn *pgx.Conn, data pgx.TracePrepareEndData) { for _, tracer := range t.PrepareTracers { tracer.TracePrepareEnd(ctx, conn, data) } } func (t *Tracer) TraceConnectStart(ctx context.Context, data pgx.TraceConnectStartData) context.Context { for _, tracer := range t.ConnectTracers { ctx = tracer.TraceConnectStart(ctx, data) } return ctx } func (t *Tracer) TraceConnectEnd(ctx context.Context, data pgx.TraceConnectEndData) { for _, tracer := range t.ConnectTracers { tracer.TraceConnectEnd(ctx, data) } } func (t *Tracer) TraceAcquireStart(ctx context.Context, pool *pgxpool.Pool, data pgxpool.TraceAcquireStartData) context.Context { for _, tracer := range t.PoolAcquireTracers { ctx = tracer.TraceAcquireStart(ctx, pool, data) } return ctx } func (t *Tracer) TraceAcquireEnd(ctx context.Context, pool *pgxpool.Pool, data pgxpool.TraceAcquireEndData) { for _, tracer := range t.PoolAcquireTracers { tracer.TraceAcquireEnd(ctx, pool, data) } } func (t *Tracer) TraceRelease(pool *pgxpool.Pool, data pgxpool.TraceReleaseData) { for _, tracer := range t.PoolReleaseTracers { tracer.TraceRelease(pool, data) } } pgx-5.8.0/multitracer/tracer_test.go000066400000000000000000000062141512357711200175320ustar00rootroot00000000000000package multitracer_test import ( "context" "testing" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/multitracer" "github.com/jackc/pgx/v5/pgxpool" "github.com/stretchr/testify/require" ) type testFullTracer struct{} func (tt *testFullTracer) TraceQueryStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryStartData) context.Context { return ctx } func (tt *testFullTracer) TraceQueryEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryEndData) { } func (tt *testFullTracer) TraceBatchStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchStartData) context.Context { return ctx } func (tt *testFullTracer) TraceBatchQuery(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchQueryData) { } func (tt *testFullTracer) TraceBatchEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchEndData) { } func (tt *testFullTracer) TraceCopyFromStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceCopyFromStartData) context.Context { return ctx } func (tt *testFullTracer) TraceCopyFromEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceCopyFromEndData) { } func (tt *testFullTracer) TracePrepareStart(ctx context.Context, conn *pgx.Conn, data pgx.TracePrepareStartData) context.Context { return ctx } func (tt *testFullTracer) TracePrepareEnd(ctx context.Context, conn *pgx.Conn, data pgx.TracePrepareEndData) { } func (tt *testFullTracer) TraceConnectStart(ctx context.Context, data pgx.TraceConnectStartData) context.Context { return ctx } func (tt *testFullTracer) TraceConnectEnd(ctx context.Context, data pgx.TraceConnectEndData) { } func (tt *testFullTracer) TraceAcquireStart(ctx context.Context, pool *pgxpool.Pool, data pgxpool.TraceAcquireStartData) context.Context { return ctx } func (tt *testFullTracer) TraceAcquireEnd(ctx context.Context, pool *pgxpool.Pool, data pgxpool.TraceAcquireEndData) { } func (tt *testFullTracer) TraceRelease(pool *pgxpool.Pool, data pgxpool.TraceReleaseData) { } type testCopyTracer struct{} func (tt *testCopyTracer) TraceQueryStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryStartData) context.Context { return ctx } func (tt *testCopyTracer) TraceQueryEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryEndData) { } func (tt *testCopyTracer) TraceCopyFromStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceCopyFromStartData) context.Context { return ctx } func (tt *testCopyTracer) TraceCopyFromEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceCopyFromEndData) { } func TestNew(t *testing.T) { t.Parallel() fullTracer := &testFullTracer{} copyTracer := &testCopyTracer{} mt := multitracer.New(fullTracer, copyTracer) require.Equal( t, &multitracer.Tracer{ QueryTracers: []pgx.QueryTracer{ fullTracer, copyTracer, }, BatchTracers: []pgx.BatchTracer{ fullTracer, }, CopyFromTracers: []pgx.CopyFromTracer{ fullTracer, copyTracer, }, PrepareTracers: []pgx.PrepareTracer{ fullTracer, }, ConnectTracers: []pgx.ConnectTracer{ fullTracer, }, PoolAcquireTracers: []pgxpool.AcquireTracer{ fullTracer, }, PoolReleaseTracers: []pgxpool.ReleaseTracer{ fullTracer, }, }, mt, ) } pgx-5.8.0/named_args.go000066400000000000000000000154431512357711200147640ustar00rootroot00000000000000package pgx import ( "context" "fmt" "strconv" "strings" "unicode/utf8" ) // NamedArgs can be used as the first argument to a query method. It will replace every '@' named placeholder with a '$' // ordinal placeholder and construct the appropriate arguments. // // For example, the following two queries are equivalent: // // conn.Query(ctx, "select * from widgets where foo = @foo and bar = @bar", pgx.NamedArgs{"foo": 1, "bar": 2}) // conn.Query(ctx, "select * from widgets where foo = $1 and bar = $2", 1, 2) // // Named placeholders are case sensitive and must start with a letter or underscore. Subsequent characters can be // letters, numbers, or underscores. type NamedArgs map[string]any // RewriteQuery implements the QueryRewriter interface. func (na NamedArgs) RewriteQuery(ctx context.Context, conn *Conn, sql string, args []any) (newSQL string, newArgs []any, err error) { return rewriteQuery(na, sql, false) } // StrictNamedArgs can be used in the same way as NamedArgs, but provided arguments are also checked to include all // named arguments that the sql query uses, and no extra arguments. type StrictNamedArgs map[string]any // RewriteQuery implements the QueryRewriter interface. func (sna StrictNamedArgs) RewriteQuery(ctx context.Context, conn *Conn, sql string, args []any) (newSQL string, newArgs []any, err error) { return rewriteQuery(sna, sql, true) } type namedArg string type sqlLexer struct { src string start int pos int nested int // multiline comment nesting level. stateFn stateFn parts []any nameToOrdinal map[namedArg]int } type stateFn func(*sqlLexer) stateFn func rewriteQuery(na map[string]any, sql string, isStrict bool) (newSQL string, newArgs []any, err error) { l := &sqlLexer{ src: sql, stateFn: rawState, nameToOrdinal: make(map[namedArg]int, len(na)), } for l.stateFn != nil { l.stateFn = l.stateFn(l) } sb := strings.Builder{} for _, p := range l.parts { switch p := p.(type) { case string: sb.WriteString(p) case namedArg: sb.WriteRune('$') sb.WriteString(strconv.Itoa(l.nameToOrdinal[p])) } } newArgs = make([]any, len(l.nameToOrdinal)) for name, ordinal := range l.nameToOrdinal { var found bool newArgs[ordinal-1], found = na[string(name)] if isStrict && !found { return "", nil, fmt.Errorf("argument %s found in sql query but not present in StrictNamedArgs", name) } } if isStrict { for name := range na { if _, found := l.nameToOrdinal[namedArg(name)]; !found { return "", nil, fmt.Errorf("argument %s of StrictNamedArgs not found in sql query", name) } } } return sb.String(), newArgs, nil } func rawState(l *sqlLexer) stateFn { for { r, width := utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width switch r { case 'e', 'E': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune == '\'' { l.pos += width return escapeStringState } case '\'': return singleQuoteState case '"': return doubleQuoteState case '@': nextRune, _ := utf8.DecodeRuneInString(l.src[l.pos:]) if isLetter(nextRune) || nextRune == '_' { if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos-width]) } l.start = l.pos return namedArgState } case '-': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune == '-' { l.pos += width return oneLineCommentState } case '/': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune == '*' { l.pos += width return multilineCommentState } case utf8.RuneError: if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos]) l.start = l.pos } return nil } } } func isLetter(r rune) bool { return (r >= 'a' && r <= 'z') || (r >= 'A' && r <= 'Z') } func namedArgState(l *sqlLexer) stateFn { for { r, width := utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width if r == utf8.RuneError { if l.pos-l.start > 0 { na := namedArg(l.src[l.start:l.pos]) if _, found := l.nameToOrdinal[na]; !found { l.nameToOrdinal[na] = len(l.nameToOrdinal) + 1 } l.parts = append(l.parts, na) l.start = l.pos } return nil } else if !(isLetter(r) || (r >= '0' && r <= '9') || r == '_') { l.pos -= width na := namedArg(l.src[l.start:l.pos]) if _, found := l.nameToOrdinal[na]; !found { l.nameToOrdinal[na] = len(l.nameToOrdinal) + 1 } l.parts = append(l.parts, namedArg(na)) l.start = l.pos return rawState } } } func singleQuoteState(l *sqlLexer) stateFn { for { r, width := utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width switch r { case '\'': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune != '\'' { return rawState } l.pos += width case utf8.RuneError: if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos]) l.start = l.pos } return nil } } } func doubleQuoteState(l *sqlLexer) stateFn { for { r, width := utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width switch r { case '"': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune != '"' { return rawState } l.pos += width case utf8.RuneError: if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos]) l.start = l.pos } return nil } } } func escapeStringState(l *sqlLexer) stateFn { for { r, width := utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width switch r { case '\\': _, width = utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width case '\'': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune != '\'' { return rawState } l.pos += width case utf8.RuneError: if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos]) l.start = l.pos } return nil } } } func oneLineCommentState(l *sqlLexer) stateFn { for { r, width := utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width switch r { case '\\': _, width = utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width case '\n', '\r': return rawState case utf8.RuneError: if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos]) l.start = l.pos } return nil } } } func multilineCommentState(l *sqlLexer) stateFn { for { r, width := utf8.DecodeRuneInString(l.src[l.pos:]) l.pos += width switch r { case '/': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune == '*' { l.pos += width l.nested++ } case '*': nextRune, width := utf8.DecodeRuneInString(l.src[l.pos:]) if nextRune != '/' { continue } l.pos += width if l.nested == 0 { return rawState } l.nested-- case utf8.RuneError: if l.pos-l.start > 0 { l.parts = append(l.parts, l.src[l.start:l.pos]) l.start = l.pos } return nil } } } pgx-5.8.0/named_args_test.go000066400000000000000000000106651512357711200160240ustar00rootroot00000000000000package pgx_test import ( "context" "testing" "github.com/jackc/pgx/v5" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func TestNamedArgsRewriteQuery(t *testing.T) { t.Parallel() for i, tt := range []struct { sql string args []any namedArgs pgx.NamedArgs expectedSQL string expectedArgs []any }{ { sql: "select * from users where id = @id", namedArgs: pgx.NamedArgs{"id": int32(42)}, expectedSQL: "select * from users where id = $1", expectedArgs: []any{int32(42)}, }, { sql: "select * from t where foo < @abc and baz = @def and bar < @abc", namedArgs: pgx.NamedArgs{"abc": int32(42), "def": int32(1)}, expectedSQL: "select * from t where foo < $1 and baz = $2 and bar < $1", expectedArgs: []any{int32(42), int32(1)}, }, { sql: "select @a::int, @b::text", namedArgs: pgx.NamedArgs{"a": int32(42), "b": "foo"}, expectedSQL: "select $1::int, $2::text", expectedArgs: []any{int32(42), "foo"}, }, { sql: "select @Abc::int, @b_4::text, @_c::int", namedArgs: pgx.NamedArgs{"Abc": int32(42), "b_4": "foo", "_c": int32(1)}, expectedSQL: "select $1::int, $2::text, $3::int", expectedArgs: []any{int32(42), "foo", int32(1)}, }, { sql: "at end @", namedArgs: pgx.NamedArgs{"a": int32(42), "b": "foo"}, expectedSQL: "at end @", expectedArgs: []any{}, }, { sql: "ignores without valid character after @ foo bar", namedArgs: pgx.NamedArgs{"a": int32(42), "b": "foo"}, expectedSQL: "ignores without valid character after @ foo bar", expectedArgs: []any{}, }, { sql: "name cannot start with number @1 foo bar", namedArgs: pgx.NamedArgs{"a": int32(42), "b": "foo"}, expectedSQL: "name cannot start with number @1 foo bar", expectedArgs: []any{}, }, { sql: `select *, '@foo' as "@bar" from users where id = @id`, namedArgs: pgx.NamedArgs{"id": int32(42)}, expectedSQL: `select *, '@foo' as "@bar" from users where id = $1`, expectedArgs: []any{int32(42)}, }, { sql: `select * -- @foo from users -- @single line comments where id = @id;`, namedArgs: pgx.NamedArgs{"id": int32(42)}, expectedSQL: `select * -- @foo from users -- @single line comments where id = $1;`, expectedArgs: []any{int32(42)}, }, { sql: `select * /* @multi line @comment */ /* /* with @nesting */ */ from users where id = @id;`, namedArgs: pgx.NamedArgs{"id": int32(42)}, expectedSQL: `select * /* @multi line @comment */ /* /* with @nesting */ */ from users where id = $1;`, expectedArgs: []any{int32(42)}, }, { sql: "extra provided argument", namedArgs: pgx.NamedArgs{"extra": int32(1)}, expectedSQL: "extra provided argument", expectedArgs: []any{}, }, { sql: "@missing argument", namedArgs: pgx.NamedArgs{}, expectedSQL: "$1 argument", expectedArgs: []any{nil}, }, // test comments and quotes } { sql, args, err := tt.namedArgs.RewriteQuery(context.Background(), nil, tt.sql, tt.args) require.NoError(t, err) assert.Equalf(t, tt.expectedSQL, sql, "%d", i) assert.Equalf(t, tt.expectedArgs, args, "%d", i) } } func TestStrictNamedArgsRewriteQuery(t *testing.T) { t.Parallel() for i, tt := range []struct { sql string namedArgs pgx.StrictNamedArgs expectedSQL string expectedArgs []any isExpectedError bool }{ { sql: "no arguments", namedArgs: pgx.StrictNamedArgs{}, expectedSQL: "no arguments", expectedArgs: []any{}, isExpectedError: false, }, { sql: "@all @matches", namedArgs: pgx.StrictNamedArgs{"all": int32(1), "matches": int32(2)}, expectedSQL: "$1 $2", expectedArgs: []any{int32(1), int32(2)}, isExpectedError: false, }, { sql: "extra provided argument", namedArgs: pgx.StrictNamedArgs{"extra": int32(1)}, isExpectedError: true, }, { sql: "@missing argument", namedArgs: pgx.StrictNamedArgs{}, isExpectedError: true, }, } { sql, args, err := tt.namedArgs.RewriteQuery(context.Background(), nil, tt.sql, nil) if tt.isExpectedError { assert.Errorf(t, err, "%d", i) } else { require.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expectedSQL, sql, "%d", i) assert.Equalf(t, tt.expectedArgs, args, "%d", i) } } } pgx-5.8.0/pgbouncer_test.go000066400000000000000000000040371512357711200157040ustar00rootroot00000000000000package pgx_test import ( "context" "os" "testing" "github.com/jackc/pgx/v5" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func TestPgbouncerStatementCacheDescribe(t *testing.T) { connString := os.Getenv("PGX_TEST_PGBOUNCER_CONN_STRING") if connString == "" { t.Skipf("Skipping due to missing environment variable %v", "PGX_TEST_PGBOUNCER_CONN_STRING") } config := mustParseConfig(t, connString) config.DefaultQueryExecMode = pgx.QueryExecModeCacheDescribe config.DescriptionCacheCapacity = 1024 testPgbouncer(t, config, 10, 100) } func TestPgbouncerSimpleProtocol(t *testing.T) { connString := os.Getenv("PGX_TEST_PGBOUNCER_CONN_STRING") if connString == "" { t.Skipf("Skipping due to missing environment variable %v", "PGX_TEST_PGBOUNCER_CONN_STRING") } config := mustParseConfig(t, connString) config.DefaultQueryExecMode = pgx.QueryExecModeSimpleProtocol testPgbouncer(t, config, 10, 100) } func testPgbouncer(t *testing.T, config *pgx.ConnConfig, workers, iterations int) { doneChan := make(chan struct{}) for range workers { go func() { defer func() { doneChan <- struct{}{} }() conn, err := pgx.ConnectConfig(context.Background(), config) require.Nil(t, err) defer closeConn(t, conn) for range iterations { var i32 int32 var i64 int64 var f32 float32 var s string var s2 string err = conn.QueryRow(context.Background(), "select 1::int4, 2::int8, 3::float4, 'hi'::text").Scan(&i32, &i64, &f32, &s) require.NoError(t, err) assert.Equal(t, int32(1), i32) assert.Equal(t, int64(2), i64) assert.Equal(t, float32(3), f32) assert.Equal(t, "hi", s) err = conn.QueryRow(context.Background(), "select 1::int8, 2::float4, 'bye'::text, 4::int4, 'whatever'::text").Scan(&i64, &f32, &s, &i32, &s2) require.NoError(t, err) assert.Equal(t, int64(1), i64) assert.Equal(t, float32(2), f32) assert.Equal(t, "bye", s) assert.Equal(t, int32(4), i32) assert.Equal(t, "whatever", s2) } }() } for range workers { <-doneChan } } pgx-5.8.0/pgconn/000077500000000000000000000000001512357711200136125ustar00rootroot00000000000000pgx-5.8.0/pgconn/README.md000066400000000000000000000017311512357711200150730ustar00rootroot00000000000000# pgconn Package pgconn is a low-level PostgreSQL database driver. It operates at nearly the same level as the C library libpq. It is primarily intended to serve as the foundation for higher level libraries such as https://github.com/jackc/pgx. Applications should handle normal queries with a higher level library and only use pgconn directly when required for low-level access to PostgreSQL functionality. ## Example Usage ```go pgConn, err := pgconn.Connect(context.Background(), os.Getenv("DATABASE_URL")) if err != nil { log.Fatalln("pgconn failed to connect:", err) } defer pgConn.Close(context.Background()) result := pgConn.ExecParams(context.Background(), "SELECT email FROM users WHERE id=$1", [][]byte{[]byte("123")}, nil, nil, nil) for result.NextRow() { fmt.Println("User 123 has email:", string(result.Values()[0])) } _, err = result.Close() if err != nil { log.Fatalln("failed reading result:", err) } ``` ## Testing See CONTRIBUTING.md for setup instructions. pgx-5.8.0/pgconn/auth_scram.go000066400000000000000000000170711512357711200162750ustar00rootroot00000000000000// SCRAM-SHA-256 authentication // // Resources: // https://tools.ietf.org/html/rfc5802 // https://tools.ietf.org/html/rfc8265 // https://www.postgresql.org/docs/current/sasl-authentication.html // // Inspiration drawn from other implementations: // https://github.com/lib/pq/pull/608 // https://github.com/lib/pq/pull/788 // https://github.com/lib/pq/pull/833 package pgconn import ( "bytes" "crypto/hmac" "crypto/pbkdf2" "crypto/rand" "crypto/sha256" "encoding/base64" "errors" "fmt" "slices" "strconv" "github.com/jackc/pgx/v5/pgproto3" "golang.org/x/text/secure/precis" ) const clientNonceLen = 18 // Perform SCRAM authentication. func (c *PgConn) scramAuth(serverAuthMechanisms []string) error { sc, err := newScramClient(serverAuthMechanisms, c.config.Password) if err != nil { return err } // Send client-first-message in a SASLInitialResponse saslInitialResponse := &pgproto3.SASLInitialResponse{ AuthMechanism: "SCRAM-SHA-256", Data: sc.clientFirstMessage(), } c.frontend.Send(saslInitialResponse) err = c.flushWithPotentialWriteReadDeadlock() if err != nil { return err } // Receive server-first-message payload in an AuthenticationSASLContinue. saslContinue, err := c.rxSASLContinue() if err != nil { return err } err = sc.recvServerFirstMessage(saslContinue.Data) if err != nil { return err } // Send client-final-message in a SASLResponse saslResponse := &pgproto3.SASLResponse{ Data: []byte(sc.clientFinalMessage()), } c.frontend.Send(saslResponse) err = c.flushWithPotentialWriteReadDeadlock() if err != nil { return err } // Receive server-final-message payload in an AuthenticationSASLFinal. saslFinal, err := c.rxSASLFinal() if err != nil { return err } return sc.recvServerFinalMessage(saslFinal.Data) } func (c *PgConn) rxSASLContinue() (*pgproto3.AuthenticationSASLContinue, error) { msg, err := c.receiveMessage() if err != nil { return nil, err } switch m := msg.(type) { case *pgproto3.AuthenticationSASLContinue: return m, nil case *pgproto3.ErrorResponse: return nil, ErrorResponseToPgError(m) } return nil, fmt.Errorf("expected AuthenticationSASLContinue message but received unexpected message %T", msg) } func (c *PgConn) rxSASLFinal() (*pgproto3.AuthenticationSASLFinal, error) { msg, err := c.receiveMessage() if err != nil { return nil, err } switch m := msg.(type) { case *pgproto3.AuthenticationSASLFinal: return m, nil case *pgproto3.ErrorResponse: return nil, ErrorResponseToPgError(m) } return nil, fmt.Errorf("expected AuthenticationSASLFinal message but received unexpected message %T", msg) } type scramClient struct { serverAuthMechanisms []string password string clientNonce []byte clientFirstMessageBare []byte serverFirstMessage []byte clientAndServerNonce []byte salt []byte iterations int saltedPassword []byte authMessage []byte } func newScramClient(serverAuthMechanisms []string, password string) (*scramClient, error) { sc := &scramClient{ serverAuthMechanisms: serverAuthMechanisms, } // Ensure server supports SCRAM-SHA-256 hasScramSHA256 := slices.Contains(sc.serverAuthMechanisms, "SCRAM-SHA-256") if !hasScramSHA256 { return nil, errors.New("server does not support SCRAM-SHA-256") } // precis.OpaqueString is equivalent to SASLprep for password. var err error sc.password, err = precis.OpaqueString.String(password) if err != nil { // PostgreSQL allows passwords invalid according to SCRAM / SASLprep. sc.password = password } buf := make([]byte, clientNonceLen) _, err = rand.Read(buf) if err != nil { return nil, err } sc.clientNonce = make([]byte, base64.RawStdEncoding.EncodedLen(len(buf))) base64.RawStdEncoding.Encode(sc.clientNonce, buf) return sc, nil } func (sc *scramClient) clientFirstMessage() []byte { sc.clientFirstMessageBare = fmt.Appendf(nil, "n=,r=%s", sc.clientNonce) return fmt.Appendf(nil, "n,,%s", sc.clientFirstMessageBare) } func (sc *scramClient) recvServerFirstMessage(serverFirstMessage []byte) error { sc.serverFirstMessage = serverFirstMessage buf := serverFirstMessage if !bytes.HasPrefix(buf, []byte("r=")) { return errors.New("invalid SCRAM server-first-message received from server: did not include r=") } buf = buf[2:] idx := bytes.IndexByte(buf, ',') if idx == -1 { return errors.New("invalid SCRAM server-first-message received from server: did not include s=") } sc.clientAndServerNonce = buf[:idx] buf = buf[idx+1:] if !bytes.HasPrefix(buf, []byte("s=")) { return errors.New("invalid SCRAM server-first-message received from server: did not include s=") } buf = buf[2:] idx = bytes.IndexByte(buf, ',') if idx == -1 { return errors.New("invalid SCRAM server-first-message received from server: did not include i=") } saltStr := buf[:idx] buf = buf[idx+1:] if !bytes.HasPrefix(buf, []byte("i=")) { return errors.New("invalid SCRAM server-first-message received from server: did not include i=") } buf = buf[2:] iterationsStr := buf var err error sc.salt, err = base64.StdEncoding.DecodeString(string(saltStr)) if err != nil { return fmt.Errorf("invalid SCRAM salt received from server: %w", err) } sc.iterations, err = strconv.Atoi(string(iterationsStr)) if err != nil || sc.iterations <= 0 { return fmt.Errorf("invalid SCRAM iteration count received from server: %w", err) } if !bytes.HasPrefix(sc.clientAndServerNonce, sc.clientNonce) { return errors.New("invalid SCRAM nonce: did not start with client nonce") } if len(sc.clientAndServerNonce) <= len(sc.clientNonce) { return errors.New("invalid SCRAM nonce: did not include server nonce") } return nil } func (sc *scramClient) clientFinalMessage() string { clientFinalMessageWithoutProof := fmt.Appendf(nil, "c=biws,r=%s", sc.clientAndServerNonce) var err error sc.saltedPassword, err = pbkdf2.Key(sha256.New, sc.password, sc.salt, sc.iterations, 32) if err != nil { panic(err) // This should never happen. } sc.authMessage = bytes.Join([][]byte{sc.clientFirstMessageBare, sc.serverFirstMessage, clientFinalMessageWithoutProof}, []byte(",")) clientProof := computeClientProof(sc.saltedPassword, sc.authMessage) return fmt.Sprintf("%s,p=%s", clientFinalMessageWithoutProof, clientProof) } func (sc *scramClient) recvServerFinalMessage(serverFinalMessage []byte) error { if !bytes.HasPrefix(serverFinalMessage, []byte("v=")) { return errors.New("invalid SCRAM server-final-message received from server") } serverSignature := serverFinalMessage[2:] if !hmac.Equal(serverSignature, computeServerSignature(sc.saltedPassword, sc.authMessage)) { return errors.New("invalid SCRAM ServerSignature received from server") } return nil } func computeHMAC(key, msg []byte) []byte { mac := hmac.New(sha256.New, key) mac.Write(msg) return mac.Sum(nil) } func computeClientProof(saltedPassword, authMessage []byte) []byte { clientKey := computeHMAC(saltedPassword, []byte("Client Key")) storedKey := sha256.Sum256(clientKey) clientSignature := computeHMAC(storedKey[:], authMessage) clientProof := make([]byte, len(clientSignature)) for i := range clientSignature { clientProof[i] = clientKey[i] ^ clientSignature[i] } buf := make([]byte, base64.StdEncoding.EncodedLen(len(clientProof))) base64.StdEncoding.Encode(buf, clientProof) return buf } func computeServerSignature(saltedPassword, authMessage []byte) []byte { serverKey := computeHMAC(saltedPassword, []byte("Server Key")) serverSignature := computeHMAC(serverKey, authMessage) buf := make([]byte, base64.StdEncoding.EncodedLen(len(serverSignature))) base64.StdEncoding.Encode(buf, serverSignature) return buf } pgx-5.8.0/pgconn/benchmark_private_test.go000066400000000000000000000026141512357711200206670ustar00rootroot00000000000000package pgconn import ( "strings" "testing" ) func BenchmarkCommandTagRowsAffected(b *testing.B) { benchmarks := []struct { commandTag string rowsAffected int64 }{ {"UPDATE 1", 1}, {"UPDATE 123456789", 123456789}, {"INSERT 0 1", 1}, {"INSERT 0 123456789", 123456789}, } for _, bm := range benchmarks { ct := CommandTag{s: bm.commandTag} b.Run(bm.commandTag, func(b *testing.B) { var n int64 for b.Loop() { n = ct.RowsAffected() } if n != bm.rowsAffected { b.Errorf("expected %d got %d", bm.rowsAffected, n) } }) } } func BenchmarkCommandTagTypeFromString(b *testing.B) { ct := CommandTag{s: "UPDATE 1"} var update bool for b.Loop() { update = strings.HasPrefix(ct.String(), "UPDATE") } if !update { b.Error("expected update") } } func BenchmarkCommandTagInsert(b *testing.B) { benchmarks := []struct { commandTag string is bool }{ {"INSERT 1", true}, {"INSERT 1234567890", true}, {"UPDATE 1", false}, {"UPDATE 1234567890", false}, {"DELETE 1", false}, {"DELETE 1234567890", false}, {"SELECT 1", false}, {"SELECT 1234567890", false}, {"UNKNOWN 1234567890", false}, } for _, bm := range benchmarks { ct := CommandTag{s: bm.commandTag} b.Run(bm.commandTag, func(b *testing.B) { var is bool for b.Loop() { is = ct.Insert() } if is != bm.is { b.Errorf("expected %v got %v", bm.is, is) } }) } } pgx-5.8.0/pgconn/benchmark_test.go000066400000000000000000000133621512357711200171370ustar00rootroot00000000000000package pgconn_test import ( "bytes" "context" "os" "testing" "github.com/jackc/pgx/v5/pgconn" "github.com/stretchr/testify/require" ) func BenchmarkConnect(b *testing.B) { benchmarks := []struct { name string env string }{ {"Unix socket", "PGX_TEST_UNIX_SOCKET_CONN_STRING"}, {"TCP", "PGX_TEST_TCP_CONN_STRING"}, } for _, bm := range benchmarks { b.Run(bm.name, func(b *testing.B) { connString := os.Getenv(bm.env) if connString == "" { b.Skipf("Skipping due to missing environment variable %v", bm.env) } for b.Loop() { conn, err := pgconn.Connect(context.Background(), connString) require.Nil(b, err) err = conn.Close(context.Background()) require.Nil(b, err) } }) } } func BenchmarkExec(b *testing.B) { expectedValues := [][]byte{[]byte("hello"), []byte("42"), []byte("2019-01-01")} benchmarks := []struct { name string ctx context.Context }{ // Using an empty context other than context.Background() to compare // performance {"background context", context.Background()}, {"empty context", context.TODO()}, } for _, bm := range benchmarks { b.Run(bm.name, func(b *testing.B) { conn, err := pgconn.Connect(bm.ctx, os.Getenv("PGX_TEST_DATABASE")) require.Nil(b, err) defer closeConn(b, conn) b.ResetTimer() for b.Loop() { mrr := conn.Exec(bm.ctx, "select 'hello'::text as a, 42::int4 as b, '2019-01-01'::date") for mrr.NextResult() { rr := mrr.ResultReader() rowCount := 0 for rr.NextRow() { rowCount++ if len(rr.Values()) != len(expectedValues) { b.Fatalf("unexpected number of values: %d", len(rr.Values())) } for i := range rr.Values() { if !bytes.Equal(rr.Values()[i], expectedValues[i]) { b.Fatalf("unexpected values: %s %s", rr.Values()[i], expectedValues[i]) } } } _, err = rr.Close() if err != nil { b.Fatal(err) } if rowCount != 1 { b.Fatalf("unexpected rowCount: %d", rowCount) } } err := mrr.Close() if err != nil { b.Fatal(err) } } }) } } func BenchmarkExecPossibleToCancel(b *testing.B) { conn, err := pgconn.Connect(context.Background(), os.Getenv("PGX_TEST_DATABASE")) require.Nil(b, err) defer closeConn(b, conn) expectedValues := [][]byte{[]byte("hello"), []byte("42"), []byte("2019-01-01")} ctx := b.Context() for b.Loop() { mrr := conn.Exec(ctx, "select 'hello'::text as a, 42::int4 as b, '2019-01-01'::date") for mrr.NextResult() { rr := mrr.ResultReader() rowCount := 0 for rr.NextRow() { rowCount++ if len(rr.Values()) != len(expectedValues) { b.Fatalf("unexpected number of values: %d", len(rr.Values())) } for i := range rr.Values() { if !bytes.Equal(rr.Values()[i], expectedValues[i]) { b.Fatalf("unexpected values: %s %s", rr.Values()[i], expectedValues[i]) } } } _, err = rr.Close() if err != nil { b.Fatal(err) } if rowCount != 1 { b.Fatalf("unexpected rowCount: %d", rowCount) } } err := mrr.Close() if err != nil { b.Fatal(err) } } } func BenchmarkExecPrepared(b *testing.B) { expectedValues := [][]byte{[]byte("hello"), []byte("42"), []byte("2019-01-01")} benchmarks := []struct { name string ctx context.Context }{ // Using an empty context other than context.Background() to compare // performance {"background context", context.Background()}, {"empty context", context.TODO()}, } for _, bm := range benchmarks { b.Run(bm.name, func(b *testing.B) { conn, err := pgconn.Connect(bm.ctx, os.Getenv("PGX_TEST_DATABASE")) require.Nil(b, err) defer closeConn(b, conn) _, err = conn.Prepare(bm.ctx, "ps1", "select 'hello'::text as a, 42::int4 as b, '2019-01-01'::date", nil) require.Nil(b, err) b.ResetTimer() for b.Loop() { rr := conn.ExecPrepared(bm.ctx, "ps1", nil, nil, nil) rowCount := 0 for rr.NextRow() { rowCount++ if len(rr.Values()) != len(expectedValues) { b.Fatalf("unexpected number of values: %d", len(rr.Values())) } for i := range rr.Values() { if !bytes.Equal(rr.Values()[i], expectedValues[i]) { b.Fatalf("unexpected values: %s %s", rr.Values()[i], expectedValues[i]) } } } _, err = rr.Close() if err != nil { b.Fatal(err) } if rowCount != 1 { b.Fatalf("unexpected rowCount: %d", rowCount) } } }) } } func BenchmarkExecPreparedPossibleToCancel(b *testing.B) { conn, err := pgconn.Connect(context.Background(), os.Getenv("PGX_TEST_DATABASE")) require.Nil(b, err) defer closeConn(b, conn) ctx := b.Context() _, err = conn.Prepare(ctx, "ps1", "select 'hello'::text as a, 42::int4 as b, '2019-01-01'::date", nil) require.Nil(b, err) expectedValues := [][]byte{[]byte("hello"), []byte("42"), []byte("2019-01-01")} for b.Loop() { rr := conn.ExecPrepared(ctx, "ps1", nil, nil, nil) rowCount := 0 for rr.NextRow() { rowCount += 1 if len(rr.Values()) != len(expectedValues) { b.Fatalf("unexpected number of values: %d", len(rr.Values())) } for i := range rr.Values() { if !bytes.Equal(rr.Values()[i], expectedValues[i]) { b.Fatalf("unexpected values: %s %s", rr.Values()[i], expectedValues[i]) } } } _, err = rr.Close() if err != nil { b.Fatal(err) } if rowCount != 1 { b.Fatalf("unexpected rowCount: %d", rowCount) } } } // func BenchmarkChanToSetDeadlinePossibleToCancel(b *testing.B) { // conn, err := pgconn.Connect(context.Background(), os.Getenv("PGX_TEST_DATABASE")) // require.Nil(b, err) // defer closeConn(b, conn) // ctx, cancel := context.WithCancel(context.Background()) // defer cancel() // b.ResetTimer() // for i := 0; i < b.N; i++ { // conn.ChanToSetDeadline().Watch(ctx) // conn.ChanToSetDeadline().Ignore() // } // } pgx-5.8.0/pgconn/config.go000066400000000000000000000733371512357711200154230ustar00rootroot00000000000000package pgconn import ( "context" "crypto/tls" "crypto/x509" "encoding/pem" "errors" "fmt" "io" "maps" "math" "net" "net/url" "os" "path/filepath" "strconv" "strings" "time" "github.com/jackc/pgpassfile" "github.com/jackc/pgservicefile" "github.com/jackc/pgx/v5/pgconn/ctxwatch" "github.com/jackc/pgx/v5/pgproto3" ) type ( AfterConnectFunc func(ctx context.Context, pgconn *PgConn) error ValidateConnectFunc func(ctx context.Context, pgconn *PgConn) error GetSSLPasswordFunc func(ctx context.Context) string ) // Config is the settings used to establish a connection to a PostgreSQL server. It must be created by [ParseConfig]. A // manually initialized Config will cause ConnectConfig to panic. type Config struct { Host string // host (e.g. localhost) or absolute path to unix domain socket directory (e.g. /private/tmp) Port uint16 Database string User string Password string TLSConfig *tls.Config // nil disables TLS ConnectTimeout time.Duration DialFunc DialFunc // e.g. net.Dialer.DialContext LookupFunc LookupFunc // e.g. net.Resolver.LookupHost BuildFrontend BuildFrontendFunc // BuildContextWatcherHandler is called to create a ContextWatcherHandler for a connection. The handler is called // when a context passed to a PgConn method is canceled. BuildContextWatcherHandler func(*PgConn) ctxwatch.Handler RuntimeParams map[string]string // Run-time parameters to set on connection as session default values (e.g. search_path or application_name) KerberosSrvName string KerberosSpn string Fallbacks []*FallbackConfig SSLNegotiation string // sslnegotiation=postgres or sslnegotiation=direct // AfterNetConnect is called after the network connection, including TLS if applicable, is established but before any // PostgreSQL protocol communication. It takes the established net.Conn and returns a net.Conn that will be used in // its place. It can be used to wrap the net.Conn (e.g. for logging, diagnostics, or testing). Its functionality has // some overlap with DialFunc. However, DialFunc takes place before TLS is established and cannot be used to control // the final net.Conn used for PostgreSQL protocol communication while AfterNetConnect can. AfterNetConnect func(ctx context.Context, config *Config, conn net.Conn) (net.Conn, error) // ValidateConnect is called during a connection attempt after a successful authentication with the PostgreSQL server. // It can be used to validate that the server is acceptable. If this returns an error the connection is closed and the next // fallback config is tried. This allows implementing high availability behavior such as libpq does with target_session_attrs. ValidateConnect ValidateConnectFunc // AfterConnect is called after ValidateConnect. It can be used to set up the connection (e.g. Set session variables // or prepare statements). If this returns an error the connection attempt fails. AfterConnect AfterConnectFunc // OnNotice is a callback function called when a notice response is received. OnNotice NoticeHandler // OnNotification is a callback function called when a notification from the LISTEN/NOTIFY system is received. OnNotification NotificationHandler // OnPgError is a callback function called when a Postgres error is received by the server. The default handler will close // the connection on any FATAL errors. If you override this handler you should call the previously set handler or ensure // that you close on FATAL errors by returning false. OnPgError PgErrorHandler createdByParseConfig bool // Used to enforce created by ParseConfig rule. } // ParseConfigOptions contains options that control how a config is built such as GetSSLPassword. type ParseConfigOptions struct { // GetSSLPassword gets the password to decrypt a SSL client certificate. This is analogous to the libpq function // PQsetSSLKeyPassHook_OpenSSL. GetSSLPassword GetSSLPasswordFunc } // Copy returns a deep copy of the config that is safe to use and modify. // The only exception is the TLSConfig field: // according to the tls.Config docs it must not be modified after creation. func (c *Config) Copy() *Config { newConf := new(Config) *newConf = *c if newConf.TLSConfig != nil { newConf.TLSConfig = c.TLSConfig.Clone() } if newConf.RuntimeParams != nil { newConf.RuntimeParams = make(map[string]string, len(c.RuntimeParams)) maps.Copy(newConf.RuntimeParams, c.RuntimeParams) } if newConf.Fallbacks != nil { newConf.Fallbacks = make([]*FallbackConfig, len(c.Fallbacks)) for i, fallback := range c.Fallbacks { newFallback := new(FallbackConfig) *newFallback = *fallback if newFallback.TLSConfig != nil { newFallback.TLSConfig = fallback.TLSConfig.Clone() } newConf.Fallbacks[i] = newFallback } } return newConf } // FallbackConfig is additional settings to attempt a connection with when the primary Config fails to establish a // network connection. It is used for TLS fallback such as sslmode=prefer and high availability (HA) connections. type FallbackConfig struct { Host string // host (e.g. localhost) or path to unix domain socket directory (e.g. /private/tmp) Port uint16 TLSConfig *tls.Config // nil disables TLS } // connectOneConfig is the configuration for a single attempt to connect to a single host. type connectOneConfig struct { network string address string originalHostname string // original hostname before resolving tlsConfig *tls.Config // nil disables TLS } // isAbsolutePath checks if the provided value is an absolute path either // beginning with a forward slash (as on Linux-based systems) or with a capital // letter A-Z followed by a colon and a backslash, e.g., "C:\", (as on Windows). func isAbsolutePath(path string) bool { isWindowsPath := func(p string) bool { if len(p) < 3 { return false } drive := p[0] colon := p[1] backslash := p[2] if drive >= 'A' && drive <= 'Z' && colon == ':' && backslash == '\\' { return true } return false } return strings.HasPrefix(path, "/") || isWindowsPath(path) } // NetworkAddress converts a PostgreSQL host and port into network and address suitable for use with // net.Dial. func NetworkAddress(host string, port uint16) (network, address string) { if isAbsolutePath(host) { network = "unix" address = filepath.Join(host, ".s.PGSQL.") + strconv.FormatInt(int64(port), 10) } else { network = "tcp" address = net.JoinHostPort(host, strconv.Itoa(int(port))) } return network, address } // ParseConfig builds a *Config from connString with similar behavior to the PostgreSQL standard C library libpq. It // uses the same defaults as libpq (e.g. port=5432) and understands most PG* environment variables. ParseConfig closely // matches the parsing behavior of libpq. connString may either be in URL format or keyword = value format. See // https://www.postgresql.org/docs/current/libpq-connect.html#LIBPQ-CONNSTRING for details. connString also may be empty // to only read from the environment. If a password is not supplied it will attempt to read the .pgpass file. // // # Example Keyword/Value // user=jack password=secret host=pg.example.com port=5432 dbname=mydb sslmode=verify-ca // // # Example URL // postgres://jack:secret@pg.example.com:5432/mydb?sslmode=verify-ca // // The returned *Config may be modified. However, it is strongly recommended that any configuration that can be done // through the connection string be done there. In particular the fields Host, Port, TLSConfig, and Fallbacks can be // interdependent (e.g. TLSConfig needs knowledge of the host to validate the server certificate). These fields should // not be modified individually. They should all be modified or all left unchanged. // // ParseConfig supports specifying multiple hosts in similar manner to libpq. Host and port may include comma separated // values that will be tried in order. This can be used as part of a high availability system. See // https://www.postgresql.org/docs/current/libpq-connect.html#LIBPQ-MULTIPLE-HOSTS for more information. // // # Example URL // postgres://jack:secret@foo.example.com:5432,bar.example.com:5432/mydb // // ParseConfig currently recognizes the following environment variable and their parameter key word equivalents passed // via database URL or keyword/value: // // PGHOST // PGPORT // PGDATABASE // PGUSER // PGPASSWORD // PGPASSFILE // PGSERVICE // PGSERVICEFILE // PGSSLMODE // PGSSLCERT // PGSSLKEY // PGSSLROOTCERT // PGSSLPASSWORD // PGOPTIONS // PGAPPNAME // PGCONNECT_TIMEOUT // PGTARGETSESSIONATTRS // PGTZ // // See http://www.postgresql.org/docs/current/static/libpq-envars.html for details on the meaning of environment variables. // // See https://www.postgresql.org/docs/current/libpq-connect.html#LIBPQ-PARAMKEYWORDS for parameter key word names. They are // usually but not always the environment variable name downcased and without the "PG" prefix. // // Important Security Notes: // // ParseConfig tries to match libpq behavior with regard to PGSSLMODE. This includes defaulting to "prefer" behavior if // not set. // // See http://www.postgresql.org/docs/current/static/libpq-ssl.html#LIBPQ-SSL-PROTECTION for details on what level of // security each sslmode provides. // // The sslmode "prefer" (the default), sslmode "allow", and multiple hosts are implemented via the Fallbacks field of // the Config struct. If TLSConfig is manually changed it will not affect the fallbacks. For example, in the case of // sslmode "prefer" this means it will first try the main Config settings which use TLS, then it will try the fallback // which does not use TLS. This can lead to an unexpected unencrypted connection if the main TLS config is manually // changed later but the unencrypted fallback is present. Ensure there are no stale fallbacks when manually setting // TLSConfig. // // Other known differences with libpq: // // When multiple hosts are specified, libpq allows them to have different passwords set via the .pgpass file. pgconn // does not. // // In addition, ParseConfig accepts the following options: // // - servicefile. // libpq only reads servicefile from the PGSERVICEFILE environment variable. ParseConfig accepts servicefile as a // part of the connection string. func ParseConfig(connString string) (*Config, error) { var parseConfigOptions ParseConfigOptions return ParseConfigWithOptions(connString, parseConfigOptions) } // ParseConfigWithOptions builds a *Config from connString and options with similar behavior to the PostgreSQL standard // C library libpq. options contains settings that cannot be specified in a connString such as providing a function to // get the SSL password. func ParseConfigWithOptions(connString string, options ParseConfigOptions) (*Config, error) { defaultSettings := defaultSettings() envSettings := parseEnvSettings() connStringSettings := make(map[string]string) if connString != "" { var err error // connString may be a database URL or in PostgreSQL keyword/value format if strings.HasPrefix(connString, "postgres://") || strings.HasPrefix(connString, "postgresql://") { connStringSettings, err = parseURLSettings(connString) if err != nil { return nil, &ParseConfigError{ConnString: connString, msg: "failed to parse as URL", err: err} } } else { connStringSettings, err = parseKeywordValueSettings(connString) if err != nil { return nil, &ParseConfigError{ConnString: connString, msg: "failed to parse as keyword/value", err: err} } } } settings := mergeSettings(defaultSettings, envSettings, connStringSettings) if service, present := settings["service"]; present { serviceSettings, err := parseServiceSettings(settings["servicefile"], service) if err != nil { return nil, &ParseConfigError{ConnString: connString, msg: "failed to read service", err: err} } settings = mergeSettings(defaultSettings, envSettings, serviceSettings, connStringSettings) } config := &Config{ createdByParseConfig: true, Database: settings["database"], User: settings["user"], Password: settings["password"], RuntimeParams: make(map[string]string), BuildFrontend: func(r io.Reader, w io.Writer) *pgproto3.Frontend { return pgproto3.NewFrontend(r, w) }, BuildContextWatcherHandler: func(pgConn *PgConn) ctxwatch.Handler { return &DeadlineContextWatcherHandler{Conn: pgConn.conn} }, OnPgError: func(_ *PgConn, pgErr *PgError) bool { // we want to automatically close any fatal errors if strings.EqualFold(pgErr.Severity, "FATAL") { return false } return true }, } if connectTimeoutSetting, present := settings["connect_timeout"]; present { connectTimeout, err := parseConnectTimeoutSetting(connectTimeoutSetting) if err != nil { return nil, &ParseConfigError{ConnString: connString, msg: "invalid connect_timeout", err: err} } config.ConnectTimeout = connectTimeout config.DialFunc = makeConnectTimeoutDialFunc(connectTimeout) } else { defaultDialer := makeDefaultDialer() config.DialFunc = defaultDialer.DialContext } config.LookupFunc = makeDefaultResolver().LookupHost notRuntimeParams := map[string]struct{}{ "host": {}, "port": {}, "database": {}, "user": {}, "password": {}, "passfile": {}, "connect_timeout": {}, "sslmode": {}, "sslkey": {}, "sslcert": {}, "sslrootcert": {}, "sslnegotiation": {}, "sslpassword": {}, "sslsni": {}, "krbspn": {}, "krbsrvname": {}, "target_session_attrs": {}, "service": {}, "servicefile": {}, } // Adding kerberos configuration if _, present := settings["krbsrvname"]; present { config.KerberosSrvName = settings["krbsrvname"] } if _, present := settings["krbspn"]; present { config.KerberosSpn = settings["krbspn"] } for k, v := range settings { if _, present := notRuntimeParams[k]; present { continue } config.RuntimeParams[k] = v } fallbacks := []*FallbackConfig{} hosts := strings.Split(settings["host"], ",") ports := strings.Split(settings["port"], ",") for i, host := range hosts { var portStr string if i < len(ports) { portStr = ports[i] } else { portStr = ports[0] } port, err := parsePort(portStr) if err != nil { return nil, &ParseConfigError{ConnString: connString, msg: "invalid port", err: err} } var tlsConfigs []*tls.Config // Ignore TLS settings if Unix domain socket like libpq if network, _ := NetworkAddress(host, port); network == "unix" { tlsConfigs = append(tlsConfigs, nil) } else { var err error tlsConfigs, err = configTLS(settings, host, options) if err != nil { return nil, &ParseConfigError{ConnString: connString, msg: "failed to configure TLS", err: err} } } for _, tlsConfig := range tlsConfigs { fallbacks = append(fallbacks, &FallbackConfig{ Host: host, Port: port, TLSConfig: tlsConfig, }) } } config.Host = fallbacks[0].Host config.Port = fallbacks[0].Port config.TLSConfig = fallbacks[0].TLSConfig config.Fallbacks = fallbacks[1:] config.SSLNegotiation = settings["sslnegotiation"] passfile, err := pgpassfile.ReadPassfile(settings["passfile"]) if err == nil { if config.Password == "" { host := config.Host if network, _ := NetworkAddress(config.Host, config.Port); network == "unix" { host = "localhost" } config.Password = passfile.FindPassword(host, strconv.Itoa(int(config.Port)), config.Database, config.User) } } switch tsa := settings["target_session_attrs"]; tsa { case "read-write": config.ValidateConnect = ValidateConnectTargetSessionAttrsReadWrite case "read-only": config.ValidateConnect = ValidateConnectTargetSessionAttrsReadOnly case "primary": config.ValidateConnect = ValidateConnectTargetSessionAttrsPrimary case "standby": config.ValidateConnect = ValidateConnectTargetSessionAttrsStandby case "prefer-standby": config.ValidateConnect = ValidateConnectTargetSessionAttrsPreferStandby case "any": // do nothing default: return nil, &ParseConfigError{ConnString: connString, msg: fmt.Sprintf("unknown target_session_attrs value: %v", tsa)} } return config, nil } func mergeSettings(settingSets ...map[string]string) map[string]string { settings := make(map[string]string) for _, s2 := range settingSets { maps.Copy(settings, s2) } return settings } func parseEnvSettings() map[string]string { settings := make(map[string]string) nameMap := map[string]string{ "PGHOST": "host", "PGPORT": "port", "PGDATABASE": "database", "PGUSER": "user", "PGPASSWORD": "password", "PGPASSFILE": "passfile", "PGAPPNAME": "application_name", "PGCONNECT_TIMEOUT": "connect_timeout", "PGSSLMODE": "sslmode", "PGSSLKEY": "sslkey", "PGSSLCERT": "sslcert", "PGSSLSNI": "sslsni", "PGSSLROOTCERT": "sslrootcert", "PGSSLPASSWORD": "sslpassword", "PGSSLNEGOTIATION": "sslnegotiation", "PGTARGETSESSIONATTRS": "target_session_attrs", "PGSERVICE": "service", "PGSERVICEFILE": "servicefile", "PGTZ": "timezone", "PGOPTIONS": "options", } for envname, realname := range nameMap { value := os.Getenv(envname) if value != "" { settings[realname] = value } } return settings } func parseURLSettings(connString string) (map[string]string, error) { settings := make(map[string]string) parsedURL, err := url.Parse(connString) if err != nil { if urlErr := new(url.Error); errors.As(err, &urlErr) { return nil, urlErr.Err } return nil, err } if parsedURL.User != nil { settings["user"] = parsedURL.User.Username() if password, present := parsedURL.User.Password(); present { settings["password"] = password } } // Handle multiple host:port's in url.Host by splitting them into host,host,host and port,port,port. var hosts []string var ports []string for host := range strings.SplitSeq(parsedURL.Host, ",") { if host == "" { continue } if isIPOnly(host) { hosts = append(hosts, strings.Trim(host, "[]")) continue } h, p, err := net.SplitHostPort(host) if err != nil { return nil, fmt.Errorf("failed to split host:port in '%s', err: %w", host, err) } if h != "" { hosts = append(hosts, h) } if p != "" { ports = append(ports, p) } } if len(hosts) > 0 { settings["host"] = strings.Join(hosts, ",") } if len(ports) > 0 { settings["port"] = strings.Join(ports, ",") } database := strings.TrimLeft(parsedURL.Path, "/") if database != "" { settings["database"] = database } nameMap := map[string]string{ "dbname": "database", } for k, v := range parsedURL.Query() { if k2, present := nameMap[k]; present { k = k2 } settings[k] = v[0] } return settings, nil } func isIPOnly(host string) bool { return net.ParseIP(strings.Trim(host, "[]")) != nil || !strings.Contains(host, ":") } var asciiSpace = [256]uint8{'\t': 1, '\n': 1, '\v': 1, '\f': 1, '\r': 1, ' ': 1} func parseKeywordValueSettings(s string) (map[string]string, error) { settings := make(map[string]string) nameMap := map[string]string{ "dbname": "database", } for len(s) > 0 { var key, val string eqIdx := strings.IndexRune(s, '=') if eqIdx < 0 { return nil, errors.New("invalid keyword/value") } key = strings.Trim(s[:eqIdx], " \t\n\r\v\f") s = strings.TrimLeft(s[eqIdx+1:], " \t\n\r\v\f") if len(s) == 0 { } else if s[0] != '\'' { end := 0 for ; end < len(s); end++ { if asciiSpace[s[end]] == 1 { break } if s[end] == '\\' { end++ if end == len(s) { return nil, errors.New("invalid backslash") } } } val = strings.Replace(strings.Replace(s[:end], "\\\\", "\\", -1), "\\'", "'", -1) if end == len(s) { s = "" } else { s = s[end+1:] } } else { // quoted string s = s[1:] end := 0 for ; end < len(s); end++ { if s[end] == '\'' { break } if s[end] == '\\' { end++ } } if end == len(s) { return nil, errors.New("unterminated quoted string in connection info string") } val = strings.Replace(strings.Replace(s[:end], "\\\\", "\\", -1), "\\'", "'", -1) if end == len(s) { s = "" } else { s = s[end+1:] } } if k, ok := nameMap[key]; ok { key = k } if key == "" { return nil, errors.New("invalid keyword/value") } settings[key] = val } return settings, nil } func parseServiceSettings(servicefilePath, serviceName string) (map[string]string, error) { servicefile, err := pgservicefile.ReadServicefile(servicefilePath) if err != nil { return nil, fmt.Errorf("failed to read service file: %v", servicefilePath) } service, err := servicefile.GetService(serviceName) if err != nil { return nil, fmt.Errorf("unable to find service: %v", serviceName) } nameMap := map[string]string{ "dbname": "database", } settings := make(map[string]string, len(service.Settings)) for k, v := range service.Settings { if k2, present := nameMap[k]; present { k = k2 } settings[k] = v } return settings, nil } // configTLS uses libpq's TLS parameters to construct []*tls.Config. It is // necessary to allow returning multiple TLS configs as sslmode "allow" and // "prefer" allow fallback. func configTLS(settings map[string]string, thisHost string, parseConfigOptions ParseConfigOptions) ([]*tls.Config, error) { host := thisHost sslmode := settings["sslmode"] sslrootcert := settings["sslrootcert"] sslcert := settings["sslcert"] sslkey := settings["sslkey"] sslpassword := settings["sslpassword"] sslsni := settings["sslsni"] sslnegotiation := settings["sslnegotiation"] // Match libpq default behavior if sslmode == "" { sslmode = "prefer" } if sslsni == "" { sslsni = "1" } tlsConfig := &tls.Config{} if sslnegotiation == "direct" { tlsConfig.NextProtos = []string{"postgresql"} if sslmode == "prefer" { sslmode = "require" } } if sslrootcert != "" { var caCertPool *x509.CertPool if sslrootcert == "system" { var err error caCertPool, err = x509.SystemCertPool() if err != nil { return nil, fmt.Errorf("unable to load system certificate pool: %w", err) } sslmode = "verify-full" } else { caCertPool = x509.NewCertPool() caPath := sslrootcert caCert, err := os.ReadFile(caPath) if err != nil { return nil, fmt.Errorf("unable to read CA file: %w", err) } if !caCertPool.AppendCertsFromPEM(caCert) { return nil, errors.New("unable to add CA to cert pool") } } tlsConfig.RootCAs = caCertPool tlsConfig.ClientCAs = caCertPool } switch sslmode { case "disable": return []*tls.Config{nil}, nil case "allow", "prefer": tlsConfig.InsecureSkipVerify = true case "require": // According to PostgreSQL documentation, if a root CA file exists, // the behavior of sslmode=require should be the same as that of verify-ca // // See https://www.postgresql.org/docs/current/libpq-ssl.html if sslrootcert != "" { goto nextCase } tlsConfig.InsecureSkipVerify = true break nextCase: fallthrough case "verify-ca": // Don't perform the default certificate verification because it // will verify the hostname. Instead, verify the server's // certificate chain ourselves in VerifyPeerCertificate and // ignore the server name. This emulates libpq's verify-ca // behavior. // // See https://github.com/golang/go/issues/21971#issuecomment-332693931 // and https://pkg.go.dev/crypto/tls?tab=doc#example-Config-VerifyPeerCertificate // for more info. tlsConfig.InsecureSkipVerify = true tlsConfig.VerifyPeerCertificate = func(certificates [][]byte, _ [][]*x509.Certificate) error { certs := make([]*x509.Certificate, len(certificates)) for i, asn1Data := range certificates { cert, err := x509.ParseCertificate(asn1Data) if err != nil { return errors.New("failed to parse certificate from server: " + err.Error()) } certs[i] = cert } // Leave DNSName empty to skip hostname verification. opts := x509.VerifyOptions{ Roots: tlsConfig.RootCAs, Intermediates: x509.NewCertPool(), } // Skip the first cert because it's the leaf. All others // are intermediates. for _, cert := range certs[1:] { opts.Intermediates.AddCert(cert) } _, err := certs[0].Verify(opts) return err } case "verify-full": tlsConfig.ServerName = host default: return nil, errors.New("sslmode is invalid") } if (sslcert != "" && sslkey == "") || (sslcert == "" && sslkey != "") { return nil, errors.New(`both "sslcert" and "sslkey" are required`) } if sslcert != "" && sslkey != "" { buf, err := os.ReadFile(sslkey) if err != nil { return nil, fmt.Errorf("unable to read sslkey: %w", err) } block, _ := pem.Decode(buf) if block == nil { return nil, errors.New("failed to decode sslkey") } var pemKey []byte var decryptedKey []byte var decryptedError error // If PEM is encrypted, attempt to decrypt using pass phrase if x509.IsEncryptedPEMBlock(block) { // Attempt decryption with pass phrase // NOTE: only supports RSA (PKCS#1) if sslpassword != "" { decryptedKey, decryptedError = x509.DecryptPEMBlock(block, []byte(sslpassword)) } // if sslpassword not provided or has decryption error when use it // try to find sslpassword with callback function if sslpassword == "" || decryptedError != nil { if parseConfigOptions.GetSSLPassword != nil { sslpassword = parseConfigOptions.GetSSLPassword(context.Background()) } if sslpassword == "" { return nil, fmt.Errorf("unable to find sslpassword") } } decryptedKey, decryptedError = x509.DecryptPEMBlock(block, []byte(sslpassword)) // Should we also provide warning for PKCS#1 needed? if decryptedError != nil { return nil, fmt.Errorf("unable to decrypt key: %w", err) } pemBytes := pem.Block{ Type: "RSA PRIVATE KEY", Bytes: decryptedKey, } pemKey = pem.EncodeToMemory(&pemBytes) } else { pemKey = pem.EncodeToMemory(block) } certfile, err := os.ReadFile(sslcert) if err != nil { return nil, fmt.Errorf("unable to read cert: %w", err) } cert, err := tls.X509KeyPair(certfile, pemKey) if err != nil { return nil, fmt.Errorf("unable to load cert: %w", err) } tlsConfig.Certificates = []tls.Certificate{cert} } // Set Server Name Indication (SNI), if enabled by connection parameters. // Per RFC 6066, do not set it if the host is a literal IP address (IPv4 // or IPv6). if sslsni == "1" && net.ParseIP(host) == nil { tlsConfig.ServerName = host } switch sslmode { case "allow": return []*tls.Config{nil, tlsConfig}, nil case "prefer": return []*tls.Config{tlsConfig, nil}, nil case "require", "verify-ca", "verify-full": return []*tls.Config{tlsConfig}, nil default: panic("BUG: bad sslmode should already have been caught") } } func parsePort(s string) (uint16, error) { port, err := strconv.ParseUint(s, 10, 16) if err != nil { return 0, err } if port < 1 || port > math.MaxUint16 { return 0, errors.New("outside range") } return uint16(port), nil } func makeDefaultDialer() *net.Dialer { // rely on GOLANG KeepAlive settings return &net.Dialer{} } func makeDefaultResolver() *net.Resolver { return net.DefaultResolver } func parseConnectTimeoutSetting(s string) (time.Duration, error) { timeout, err := strconv.ParseInt(s, 10, 64) if err != nil { return 0, err } if timeout < 0 { return 0, errors.New("negative timeout") } return time.Duration(timeout) * time.Second, nil } func makeConnectTimeoutDialFunc(timeout time.Duration) DialFunc { d := makeDefaultDialer() d.Timeout = timeout return d.DialContext } // ValidateConnectTargetSessionAttrsReadWrite is a ValidateConnectFunc that implements libpq compatible // target_session_attrs=read-write. func ValidateConnectTargetSessionAttrsReadWrite(ctx context.Context, pgConn *PgConn) error { result, err := pgConn.Exec(ctx, "show transaction_read_only").ReadAll() if err != nil { return err } if string(result[0].Rows[0][0]) == "on" { return errors.New("read only connection") } return nil } // ValidateConnectTargetSessionAttrsReadOnly is a ValidateConnectFunc that implements libpq compatible // target_session_attrs=read-only. func ValidateConnectTargetSessionAttrsReadOnly(ctx context.Context, pgConn *PgConn) error { result, err := pgConn.Exec(ctx, "show transaction_read_only").ReadAll() if err != nil { return err } if string(result[0].Rows[0][0]) != "on" { return errors.New("connection is not read only") } return nil } // ValidateConnectTargetSessionAttrsStandby is a ValidateConnectFunc that implements libpq compatible // target_session_attrs=standby. func ValidateConnectTargetSessionAttrsStandby(ctx context.Context, pgConn *PgConn) error { result, err := pgConn.Exec(ctx, "select pg_is_in_recovery()").ReadAll() if err != nil { return err } if string(result[0].Rows[0][0]) != "t" { return errors.New("server is not in hot standby mode") } return nil } // ValidateConnectTargetSessionAttrsPrimary is a ValidateConnectFunc that implements libpq compatible // target_session_attrs=primary. func ValidateConnectTargetSessionAttrsPrimary(ctx context.Context, pgConn *PgConn) error { result, err := pgConn.Exec(ctx, "select pg_is_in_recovery()").ReadAll() if err != nil { return err } if string(result[0].Rows[0][0]) == "t" { return errors.New("server is in standby mode") } return nil } // ValidateConnectTargetSessionAttrsPreferStandby is a ValidateConnectFunc that implements libpq compatible // target_session_attrs=prefer-standby. func ValidateConnectTargetSessionAttrsPreferStandby(ctx context.Context, pgConn *PgConn) error { result, err := pgConn.Exec(ctx, "select pg_is_in_recovery()").ReadAll() if err != nil { return err } if string(result[0].Rows[0][0]) != "t" { return &NotPreferredError{err: errors.New("server is not in hot standby mode")} } return nil } pgx-5.8.0/pgconn/config_test.go000066400000000000000000000764541512357711200164650ustar00rootroot00000000000000package pgconn_test import ( "context" "crypto/tls" "fmt" "os" "os/user" "path/filepath" "runtime" "strconv" "strings" "testing" "time" "github.com/jackc/pgx/v5/pgconn" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func skipOnWindows(t *testing.T) { if runtime.GOOS == "windows" { t.Skip("FIXME: skipping on Windows, investigate why this test fails in CI environment") } } func getDefaultPort(t *testing.T) uint16 { if envPGPORT := os.Getenv("PGPORT"); envPGPORT != "" { p, err := strconv.ParseUint(envPGPORT, 10, 16) require.NoError(t, err) return uint16(p) } return 5432 } func getDefaultUser(t *testing.T) string { if pguser := os.Getenv("PGUSER"); pguser != "" { return pguser } var osUserName string osUser, err := user.Current() if err == nil { // Windows gives us the username here as `DOMAIN\user` or `LOCALPCNAME\user`, // but the libpq default is just the `user` portion, so we strip off the first part. if runtime.GOOS == "windows" && strings.Contains(osUser.Username, "\\") { osUserName = osUser.Username[strings.LastIndex(osUser.Username, "\\")+1:] } else { osUserName = osUser.Username } } return osUserName } func TestParseConfig(t *testing.T) { skipOnWindows(t) t.Parallel() config, err := pgconn.ParseConfig("") require.NoError(t, err) defaultHost := config.Host defaultUser := getDefaultUser(t) defaultPort := getDefaultPort(t) tests := []struct { name string connString string config *pgconn.Config }{ // Test all sslmodes { name: "sslmode not set (prefer)", connString: "postgres://jack:secret@localhost:5432/mydb", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: &tls.Config{ InsecureSkipVerify: true, ServerName: "localhost", }, RuntimeParams: map[string]string{}, Fallbacks: []*pgconn.FallbackConfig{ { Host: "localhost", Port: 5432, TLSConfig: nil, }, }, }, }, { name: "sslmode disable", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=disable", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "sslmode allow", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=allow", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, Fallbacks: []*pgconn.FallbackConfig{ { Host: "localhost", Port: 5432, TLSConfig: &tls.Config{ InsecureSkipVerify: true, ServerName: "localhost", }, }, }, }, }, { name: "sslmode prefer", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=prefer", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: &tls.Config{ InsecureSkipVerify: true, ServerName: "localhost", }, RuntimeParams: map[string]string{}, Fallbacks: []*pgconn.FallbackConfig{ { Host: "localhost", Port: 5432, TLSConfig: nil, }, }, }, }, { name: "sslmode require", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=require", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: &tls.Config{ InsecureSkipVerify: true, ServerName: "localhost", }, RuntimeParams: map[string]string{}, }, }, { name: "sslmode verify-ca", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=verify-ca", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: &tls.Config{ InsecureSkipVerify: true, ServerName: "localhost", }, RuntimeParams: map[string]string{}, }, }, { name: "sslmode verify-full", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=verify-full", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: &tls.Config{ServerName: "localhost"}, RuntimeParams: map[string]string{}, }, }, { name: "database url everything", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=disable&application_name=pgxtest&search_path=myschema&connect_timeout=5", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, ConnectTimeout: 5 * time.Second, RuntimeParams: map[string]string{ "application_name": "pgxtest", "search_path": "myschema", }, }, }, { name: "database url missing password", connString: "postgres://jack@localhost:5432/mydb?sslmode=disable", config: &pgconn.Config{ User: "jack", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "database url missing user and password", connString: "postgres://localhost:5432/mydb?sslmode=disable", config: &pgconn.Config{ User: defaultUser, Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "database url missing port", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=disable", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "database url unix domain socket host", connString: "postgres:///foo?host=/tmp", config: &pgconn.Config{ User: defaultUser, Host: "/tmp", Port: defaultPort, Database: "foo", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "database url unix domain socket host on windows", connString: "postgres:///foo?host=C:\\tmp", config: &pgconn.Config{ User: defaultUser, Host: "C:\\tmp", Port: defaultPort, Database: "foo", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "database url dbname", connString: "postgres://localhost/?dbname=foo&sslmode=disable", config: &pgconn.Config{ User: defaultUser, Host: "localhost", Port: defaultPort, Database: "foo", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "database url postgresql protocol", connString: "postgresql://jack@localhost:5432/mydb?sslmode=disable", config: &pgconn.Config{ User: "jack", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "database url IPv4 with port", connString: "postgresql://jack@127.0.0.1:5433/mydb?sslmode=disable", config: &pgconn.Config{ User: "jack", Host: "127.0.0.1", Port: 5433, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "database url IPv6 with port", connString: "postgresql://jack@[2001:db8::1]:5433/mydb?sslmode=disable", config: &pgconn.Config{ User: "jack", Host: "2001:db8::1", Port: 5433, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "database url IPv6 no port", connString: "postgresql://jack@[2001:db8::1]/mydb?sslmode=disable", config: &pgconn.Config{ User: "jack", Host: "2001:db8::1", Port: defaultPort, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "Key/value everything", connString: "user=jack password=secret host=localhost port=5432 dbname=mydb sslmode=disable application_name=pgxtest search_path=myschema connect_timeout=5", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, ConnectTimeout: 5 * time.Second, RuntimeParams: map[string]string{ "application_name": "pgxtest", "search_path": "myschema", }, }, }, { name: "Key/value with escaped single quote", connString: "user=jack\\'s password=secret host=localhost port=5432 dbname=mydb sslmode=disable", config: &pgconn.Config{ User: "jack's", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "Key/value with escaped backslash", connString: "user=jack password=sooper\\\\secret host=localhost port=5432 dbname=mydb sslmode=disable", config: &pgconn.Config{ User: "jack", Password: "sooper\\secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "Key/value with single quoted values", connString: "user='jack' host='localhost' dbname='mydb' sslmode='disable'", config: &pgconn.Config{ User: "jack", Host: "localhost", Port: defaultPort, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "Key/value with single quoted value with escaped single quote", connString: "user='jack\\'s' host='localhost' dbname='mydb' sslmode='disable'", config: &pgconn.Config{ User: "jack's", Host: "localhost", Port: defaultPort, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "Key/value with empty single quoted value", connString: "user='jack' password='' host='localhost' dbname='mydb' sslmode='disable'", config: &pgconn.Config{ User: "jack", Host: "localhost", Port: defaultPort, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "Key/value with space between key and value", connString: "user = 'jack' password = '' host = 'localhost' dbname = 'mydb' sslmode='disable'", config: &pgconn.Config{ User: "jack", Host: "localhost", Port: defaultPort, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "URL multiple hosts", connString: "postgres://jack:secret@foo,bar,baz/mydb?sslmode=disable", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "foo", Port: defaultPort, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, Fallbacks: []*pgconn.FallbackConfig{ { Host: "bar", Port: defaultPort, TLSConfig: nil, }, { Host: "baz", Port: defaultPort, TLSConfig: nil, }, }, }, }, { name: "URL multiple hosts and ports", connString: "postgres://jack:secret@foo:1,bar:2,baz:3/mydb?sslmode=disable", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "foo", Port: 1, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, Fallbacks: []*pgconn.FallbackConfig{ { Host: "bar", Port: 2, TLSConfig: nil, }, { Host: "baz", Port: 3, TLSConfig: nil, }, }, }, }, // https://github.com/jackc/pgconn/issues/72 { name: "URL without host but with port still uses default host", connString: "postgres://jack:secret@:1/mydb?sslmode=disable", config: &pgconn.Config{ User: "jack", Password: "secret", Host: defaultHost, Port: 1, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "Key/value multiple hosts one port", connString: "user=jack password=secret host=foo,bar,baz port=5432 dbname=mydb sslmode=disable", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "foo", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, Fallbacks: []*pgconn.FallbackConfig{ { Host: "bar", Port: 5432, TLSConfig: nil, }, { Host: "baz", Port: 5432, TLSConfig: nil, }, }, }, }, { name: "Key/value multiple hosts multiple ports", connString: "user=jack password=secret host=foo,bar,baz port=1,2,3 dbname=mydb sslmode=disable", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "foo", Port: 1, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, Fallbacks: []*pgconn.FallbackConfig{ { Host: "bar", Port: 2, TLSConfig: nil, }, { Host: "baz", Port: 3, TLSConfig: nil, }, }, }, }, { name: "multiple hosts and fallback tls", connString: "user=jack password=secret host=foo,bar,baz dbname=mydb sslmode=prefer", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "foo", Port: defaultPort, Database: "mydb", TLSConfig: &tls.Config{ InsecureSkipVerify: true, ServerName: "foo", }, RuntimeParams: map[string]string{}, Fallbacks: []*pgconn.FallbackConfig{ { Host: "foo", Port: defaultPort, TLSConfig: nil, }, { Host: "bar", Port: defaultPort, TLSConfig: &tls.Config{ InsecureSkipVerify: true, ServerName: "bar", }, }, { Host: "bar", Port: defaultPort, TLSConfig: nil, }, { Host: "baz", Port: defaultPort, TLSConfig: &tls.Config{ InsecureSkipVerify: true, ServerName: "baz", }, }, { Host: "baz", Port: defaultPort, TLSConfig: nil, }, }, }, }, { name: "target_session_attrs read-write", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=disable&target_session_attrs=read-write", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, ValidateConnect: pgconn.ValidateConnectTargetSessionAttrsReadWrite, }, }, { name: "target_session_attrs read-only", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=disable&target_session_attrs=read-only", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, ValidateConnect: pgconn.ValidateConnectTargetSessionAttrsReadOnly, }, }, { name: "target_session_attrs primary", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=disable&target_session_attrs=primary", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, ValidateConnect: pgconn.ValidateConnectTargetSessionAttrsPrimary, }, }, { name: "target_session_attrs standby", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=disable&target_session_attrs=standby", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, ValidateConnect: pgconn.ValidateConnectTargetSessionAttrsStandby, }, }, { name: "target_session_attrs prefer-standby", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=disable&target_session_attrs=prefer-standby", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, ValidateConnect: pgconn.ValidateConnectTargetSessionAttrsPreferStandby, }, }, { name: "target_session_attrs any", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=disable&target_session_attrs=any", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "target_session_attrs not set (any)", connString: "postgres://jack:secret@localhost:5432/mydb?sslmode=disable", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "localhost", Port: 5432, Database: "mydb", TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, { name: "SNI is set by default", connString: "postgres://jack:secret@sni.test:5432/mydb?sslmode=require", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "sni.test", Port: 5432, Database: "mydb", TLSConfig: &tls.Config{ InsecureSkipVerify: true, ServerName: "sni.test", }, RuntimeParams: map[string]string{}, }, }, { name: "SNI is not set for IPv4", connString: "postgres://jack:secret@1.1.1.1:5432/mydb?sslmode=require", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "1.1.1.1", Port: 5432, Database: "mydb", TLSConfig: &tls.Config{ InsecureSkipVerify: true, }, RuntimeParams: map[string]string{}, }, }, { name: "SNI is not set for IPv6", connString: "postgres://jack:secret@[::1]:5432/mydb?sslmode=require", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "::1", Port: 5432, Database: "mydb", TLSConfig: &tls.Config{ InsecureSkipVerify: true, }, RuntimeParams: map[string]string{}, }, }, { name: "SNI is not set when disabled (URL-style)", connString: "postgres://jack:secret@sni.test:5432/mydb?sslmode=require&sslsni=0", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "sni.test", Port: 5432, Database: "mydb", TLSConfig: &tls.Config{ InsecureSkipVerify: true, }, RuntimeParams: map[string]string{}, }, }, { name: "SNI is not set when disabled (key/value style)", connString: "user=jack password=secret host=sni.test dbname=mydb sslmode=require sslsni=0", config: &pgconn.Config{ User: "jack", Password: "secret", Host: "sni.test", Port: defaultPort, Database: "mydb", TLSConfig: &tls.Config{ InsecureSkipVerify: true, }, RuntimeParams: map[string]string{}, }, }, } for i, tt := range tests { config, err := pgconn.ParseConfig(tt.connString) if !assert.Nilf(t, err, "Test %d (%s)", i, tt.name) { continue } assertConfigsEqual(t, tt.config, config, fmt.Sprintf("Test %d (%s)", i, tt.name)) } } // https://github.com/jackc/pgconn/issues/47 func TestParseConfigKVWithTrailingEmptyEqualDoesNotPanic(t *testing.T) { _, err := pgconn.ParseConfig("host= user= password= port= database=") require.NoError(t, err) } func TestParseConfigKVLeadingEqual(t *testing.T) { _, err := pgconn.ParseConfig("= user=jack") require.Error(t, err) } // https://github.com/jackc/pgconn/issues/49 func TestParseConfigKVTrailingBackslash(t *testing.T) { _, err := pgconn.ParseConfig(`x=x\`) require.Error(t, err) assert.Contains(t, err.Error(), "invalid backslash") } func TestConfigCopyReturnsEqualConfig(t *testing.T) { connString := "postgres://jack:secret@localhost:5432/mydb?application_name=pgxtest&search_path=myschema&connect_timeout=5" original, err := pgconn.ParseConfig(connString) require.NoError(t, err) copied := original.Copy() assertConfigsEqual(t, original, copied, "Test Config.Copy() returns equal config") } func TestConfigCopyOriginalConfigDidNotChange(t *testing.T) { connString := "postgres://jack:secret@localhost:5432/mydb?application_name=pgxtest&search_path=myschema&connect_timeout=5&sslmode=prefer" original, err := pgconn.ParseConfig(connString) require.NoError(t, err) copied := original.Copy() assertConfigsEqual(t, original, copied, "Test Config.Copy() returns equal config") copied.Port = uint16(5433) copied.RuntimeParams["foo"] = "bar" copied.Fallbacks[0].Port = uint16(5433) assert.Equal(t, uint16(5432), original.Port) assert.Equal(t, "", original.RuntimeParams["foo"]) assert.Equal(t, uint16(5432), original.Fallbacks[0].Port) } func TestConfigCopyCanBeUsedToConnect(t *testing.T) { connString := os.Getenv("PGX_TEST_DATABASE") original, err := pgconn.ParseConfig(connString) require.NoError(t, err) copied := original.Copy() assert.NotPanics(t, func() { _, err = pgconn.ConnectConfig(context.Background(), copied) }) assert.NoError(t, err) } func TestNetworkAddress(t *testing.T) { tests := []struct { name string host string wantNet string }{ { name: "Default Unix socket address", host: "/var/run/postgresql", wantNet: "unix", }, { name: "Windows Unix socket address (standard drive name)", host: "C:\\tmp", wantNet: "unix", }, { name: "Windows Unix socket address (first drive name)", host: "A:\\tmp", wantNet: "unix", }, { name: "Windows Unix socket address (last drive name)", host: "Z:\\tmp", wantNet: "unix", }, { name: "Assume TCP for unknown formats", host: "a/tmp", wantNet: "tcp", }, { name: "loopback interface", host: "localhost", wantNet: "tcp", }, { name: "IP address", host: "127.0.0.1", wantNet: "tcp", }, } for i, tt := range tests { gotNet, _ := pgconn.NetworkAddress(tt.host, 5432) assert.Equalf(t, tt.wantNet, gotNet, "Test %d (%s)", i, tt.name) } } func assertConfigsEqual(t *testing.T, expected, actual *pgconn.Config, testName string) { if !assert.NotNil(t, expected) { return } if !assert.NotNil(t, actual) { return } assert.Equalf(t, expected.Host, actual.Host, "%s - Host", testName) assert.Equalf(t, expected.Database, actual.Database, "%s - Database", testName) assert.Equalf(t, expected.Port, actual.Port, "%s - Port", testName) assert.Equalf(t, expected.User, actual.User, "%s - User", testName) assert.Equalf(t, expected.Password, actual.Password, "%s - Password", testName) assert.Equalf(t, expected.ConnectTimeout, actual.ConnectTimeout, "%s - ConnectTimeout", testName) assert.Equalf(t, expected.RuntimeParams, actual.RuntimeParams, "%s - RuntimeParams", testName) // Can't test function equality, so just test that they are set or not. assert.Equalf(t, expected.ValidateConnect == nil, actual.ValidateConnect == nil, "%s - ValidateConnect", testName) assert.Equalf(t, expected.AfterConnect == nil, actual.AfterConnect == nil, "%s - AfterConnect", testName) if assert.Equalf(t, expected.TLSConfig == nil, actual.TLSConfig == nil, "%s - TLSConfig", testName) { if expected.TLSConfig != nil { assert.Equalf(t, expected.TLSConfig.InsecureSkipVerify, actual.TLSConfig.InsecureSkipVerify, "%s - TLSConfig InsecureSkipVerify", testName) assert.Equalf(t, expected.TLSConfig.ServerName, actual.TLSConfig.ServerName, "%s - TLSConfig ServerName", testName) } } if assert.Equalf(t, len(expected.Fallbacks), len(actual.Fallbacks), "%s - Fallbacks", testName) { for i := range expected.Fallbacks { assert.Equalf(t, expected.Fallbacks[i].Host, actual.Fallbacks[i].Host, "%s - Fallback %d - Host", testName, i) assert.Equalf(t, expected.Fallbacks[i].Port, actual.Fallbacks[i].Port, "%s - Fallback %d - Port", testName, i) if assert.Equalf(t, expected.Fallbacks[i].TLSConfig == nil, actual.Fallbacks[i].TLSConfig == nil, "%s - Fallback %d - TLSConfig", testName, i) { if expected.Fallbacks[i].TLSConfig != nil { assert.Equalf(t, expected.Fallbacks[i].TLSConfig.InsecureSkipVerify, actual.Fallbacks[i].TLSConfig.InsecureSkipVerify, "%s - Fallback %d - TLSConfig InsecureSkipVerify", testName) assert.Equalf(t, expected.Fallbacks[i].TLSConfig.ServerName, actual.Fallbacks[i].TLSConfig.ServerName, "%s - Fallback %d - TLSConfig ServerName", testName) } } } } } func TestParseConfigEnvLibpq(t *testing.T) { var osUserName string osUser, err := user.Current() if err == nil { // Windows gives us the username here as `DOMAIN\user` or `LOCALPCNAME\user`, // but the libpq default is just the `user` portion, so we strip off the first part. if runtime.GOOS == "windows" && strings.Contains(osUser.Username, "\\") { osUserName = osUser.Username[strings.LastIndex(osUser.Username, "\\")+1:] } else { osUserName = osUser.Username } } pgEnvvars := []string{"PGHOST", "PGPORT", "PGDATABASE", "PGUSER", "PGPASSWORD", "PGAPPNAME", "PGSSLMODE", "PGCONNECT_TIMEOUT", "PGSSLSNI", "PGTZ", "PGOPTIONS"} tests := []struct { name string envvars map[string]string config *pgconn.Config }{ { // not testing no environment at all as that would use default host and that can vary. name: "PGHOST only", envvars: map[string]string{"PGHOST": "123.123.123.123"}, config: &pgconn.Config{ User: osUserName, Host: "123.123.123.123", Port: 5432, TLSConfig: &tls.Config{ InsecureSkipVerify: true, }, RuntimeParams: map[string]string{}, Fallbacks: []*pgconn.FallbackConfig{ { Host: "123.123.123.123", Port: 5432, TLSConfig: nil, }, }, }, }, { name: "All non-TLS environment", envvars: map[string]string{ "PGHOST": "123.123.123.123", "PGPORT": "7777", "PGDATABASE": "foo", "PGUSER": "bar", "PGPASSWORD": "baz", "PGCONNECT_TIMEOUT": "10", "PGSSLMODE": "disable", "PGAPPNAME": "pgxtest", "PGTZ": "America/New_York", "PGOPTIONS": "-c search_path=myschema", }, config: &pgconn.Config{ Host: "123.123.123.123", Port: 7777, Database: "foo", User: "bar", Password: "baz", ConnectTimeout: 10 * time.Second, TLSConfig: nil, RuntimeParams: map[string]string{"application_name": "pgxtest", "timezone": "America/New_York", "options": "-c search_path=myschema"}, }, }, { name: "SNI can be disabled via environment variable", envvars: map[string]string{ "PGHOST": "test.foo", "PGSSLMODE": "require", "PGSSLSNI": "0", }, config: &pgconn.Config{ User: osUserName, Host: "test.foo", Port: 5432, TLSConfig: &tls.Config{ InsecureSkipVerify: true, }, RuntimeParams: map[string]string{}, }, }, } for i, tt := range tests { for _, env := range pgEnvvars { t.Setenv(env, tt.envvars[env]) } config, err := pgconn.ParseConfig("") if !assert.Nilf(t, err, "Test %d (%s)", i, tt.name) { continue } assertConfigsEqual(t, tt.config, config, fmt.Sprintf("Test %d (%s)", i, tt.name)) } } func TestParseConfigReadsPgPassfile(t *testing.T) { skipOnWindows(t) t.Parallel() tfName := filepath.Join(t.TempDir(), "config") err := os.WriteFile(tfName, []byte("test1:5432:curlydb:curly:nyuknyuknyuk"), 0o600) require.NoError(t, err) connString := fmt.Sprintf("postgres://curly@test1:5432/curlydb?sslmode=disable&passfile=%s", tfName) expected := &pgconn.Config{ User: "curly", Password: "nyuknyuknyuk", Host: "test1", Port: 5432, Database: "curlydb", TLSConfig: nil, RuntimeParams: map[string]string{}, } actual, err := pgconn.ParseConfig(connString) assert.NoError(t, err) assertConfigsEqual(t, expected, actual, "passfile") } func TestParseConfigReadsPgServiceFile(t *testing.T) { skipOnWindows(t) t.Parallel() tfName := filepath.Join(t.TempDir(), "config") err := os.WriteFile(tfName, []byte(` [abc] host=abc.example.com port=9999 dbname=abcdb user=abcuser [def] host = def.example.com dbname = defdb user = defuser application_name = spaced string `), 0o600) require.NoError(t, err) defaultPort := getDefaultPort(t) tests := []struct { name string connString string config *pgconn.Config }{ { name: "abc", connString: fmt.Sprintf("postgres:///?servicefile=%s&service=%s", tfName, "abc"), config: &pgconn.Config{ Host: "abc.example.com", Database: "abcdb", User: "abcuser", Port: 9999, TLSConfig: &tls.Config{ InsecureSkipVerify: true, ServerName: "abc.example.com", }, RuntimeParams: map[string]string{}, Fallbacks: []*pgconn.FallbackConfig{ { Host: "abc.example.com", Port: 9999, TLSConfig: nil, }, }, }, }, { name: "def", connString: fmt.Sprintf("postgres:///?servicefile=%s&service=%s", tfName, "def"), config: &pgconn.Config{ Host: "def.example.com", Port: defaultPort, Database: "defdb", User: "defuser", TLSConfig: &tls.Config{ InsecureSkipVerify: true, ServerName: "def.example.com", }, RuntimeParams: map[string]string{"application_name": "spaced string"}, Fallbacks: []*pgconn.FallbackConfig{ { Host: "def.example.com", Port: defaultPort, TLSConfig: nil, }, }, }, }, { name: "conn string has precedence", connString: fmt.Sprintf("postgres://other.example.com:7777/?servicefile=%s&service=%s&sslmode=disable", tfName, "abc"), config: &pgconn.Config{ Host: "other.example.com", Database: "abcdb", User: "abcuser", Port: 7777, TLSConfig: nil, RuntimeParams: map[string]string{}, }, }, } for i, tt := range tests { config, err := pgconn.ParseConfig(tt.connString) if !assert.NoErrorf(t, err, "Test %d (%s)", i, tt.name) { continue } assertConfigsEqual(t, tt.config, config, fmt.Sprintf("Test %d (%s)", i, tt.name)) } } pgx-5.8.0/pgconn/ctxwatch/000077500000000000000000000000001512357711200154375ustar00rootroot00000000000000pgx-5.8.0/pgconn/ctxwatch/context_watcher.go000066400000000000000000000040651512357711200211740ustar00rootroot00000000000000package ctxwatch import ( "context" "sync" ) // ContextWatcher watches a context and performs an action when the context is canceled. It can watch one context at a // time. type ContextWatcher struct { handler Handler unwatchChan chan struct{} lock sync.Mutex watchInProgress bool onCancelWasCalled bool } // NewContextWatcher returns a ContextWatcher. onCancel will be called when a watched context is canceled. // OnUnwatchAfterCancel will be called when Unwatch is called and the watched context had already been canceled and // onCancel called. func NewContextWatcher(handler Handler) *ContextWatcher { cw := &ContextWatcher{ handler: handler, unwatchChan: make(chan struct{}), } return cw } // Watch starts watching ctx. If ctx is canceled then the onCancel function passed to NewContextWatcher will be called. func (cw *ContextWatcher) Watch(ctx context.Context) { cw.lock.Lock() defer cw.lock.Unlock() if cw.watchInProgress { panic("Watch already in progress") } cw.onCancelWasCalled = false if ctx.Done() != nil { cw.watchInProgress = true go func() { select { case <-ctx.Done(): cw.handler.HandleCancel(ctx) cw.onCancelWasCalled = true <-cw.unwatchChan case <-cw.unwatchChan: } }() } else { cw.watchInProgress = false } } // Unwatch stops watching the previously watched context. If the onCancel function passed to NewContextWatcher was // called then onUnwatchAfterCancel will also be called. func (cw *ContextWatcher) Unwatch() { cw.lock.Lock() defer cw.lock.Unlock() if cw.watchInProgress { cw.unwatchChan <- struct{}{} if cw.onCancelWasCalled { cw.handler.HandleUnwatchAfterCancel() } cw.watchInProgress = false } } type Handler interface { // HandleCancel is called when the context that a ContextWatcher is currently watching is canceled. canceledCtx is the // context that was canceled. HandleCancel(canceledCtx context.Context) // HandleUnwatchAfterCancel is called when a ContextWatcher that called HandleCancel on this Handler is unwatched. HandleUnwatchAfterCancel() } pgx-5.8.0/pgconn/ctxwatch/context_watcher_test.go000066400000000000000000000114251512357711200222310ustar00rootroot00000000000000package ctxwatch_test import ( "context" "sync/atomic" "testing" "time" "github.com/jackc/pgx/v5/pgconn/ctxwatch" "github.com/stretchr/testify/require" ) type testHandler struct { handleCancel func(context.Context) handleUnwatchAfterCancel func() } func (h *testHandler) HandleCancel(ctx context.Context) { h.handleCancel(ctx) } func (h *testHandler) HandleUnwatchAfterCancel() { h.handleUnwatchAfterCancel() } func TestContextWatcherContextCancelled(t *testing.T) { canceledChan := make(chan struct{}) cleanupCalled := false cw := ctxwatch.NewContextWatcher(&testHandler{ handleCancel: func(context.Context) { canceledChan <- struct{}{} }, handleUnwatchAfterCancel: func() { cleanupCalled = true }, }) ctx, cancel := context.WithCancel(context.Background()) cw.Watch(ctx) cancel() select { case <-canceledChan: case <-time.NewTimer(time.Second).C: t.Fatal("Timed out waiting for cancel func to be called") } cw.Unwatch() require.True(t, cleanupCalled, "Cleanup func was not called") } func TestContextWatcherUnwatchedBeforeContextCancelled(t *testing.T) { cw := ctxwatch.NewContextWatcher(&testHandler{ handleCancel: func(context.Context) { t.Error("cancel func should not have been called") }, handleUnwatchAfterCancel: func() { t.Error("cleanup func should not have been called") }, }) ctx, cancel := context.WithCancel(context.Background()) cw.Watch(ctx) cw.Unwatch() cancel() } func TestContextWatcherMultipleWatchPanics(t *testing.T) { cw := ctxwatch.NewContextWatcher(&testHandler{handleCancel: func(context.Context) {}, handleUnwatchAfterCancel: func() {}}) ctx, cancel := context.WithCancel(t.Context()) defer cancel() cw.Watch(ctx) defer cw.Unwatch() ctx2, cancel2 := context.WithCancel(t.Context()) defer cancel2() require.Panics(t, func() { cw.Watch(ctx2) }, "Expected panic when Watch called multiple times") } func TestContextWatcherUnwatchWhenNotWatchingIsSafe(t *testing.T) { cw := ctxwatch.NewContextWatcher(&testHandler{handleCancel: func(context.Context) {}, handleUnwatchAfterCancel: func() {}}) cw.Unwatch() // unwatch when not / never watching ctx := t.Context() cw.Watch(ctx) cw.Unwatch() cw.Unwatch() // double unwatch } func TestContextWatcherUnwatchIsConcurrencySafe(t *testing.T) { cw := ctxwatch.NewContextWatcher(&testHandler{handleCancel: func(context.Context) {}, handleUnwatchAfterCancel: func() {}}) ctx, cancel := context.WithTimeout(context.Background(), 100*time.Millisecond) defer cancel() cw.Watch(ctx) go cw.Unwatch() go cw.Unwatch() <-ctx.Done() } func TestContextWatcherStress(t *testing.T) { var cancelFuncCalls int64 var cleanupFuncCalls int64 cw := ctxwatch.NewContextWatcher(&testHandler{ handleCancel: func(context.Context) { atomic.AddInt64(&cancelFuncCalls, 1) }, handleUnwatchAfterCancel: func() { atomic.AddInt64(&cleanupFuncCalls, 1) }, }) cycleCount := 100_000 for i := range cycleCount { ctx, cancel := context.WithCancel(context.Background()) cw.Watch(ctx) if i%2 == 0 { cancel() } // Without time.Sleep, cw.Unwatch will almost always run before the cancel func which means cancel will never happen. This gives us a better mix. if i%333 == 0 { // on Windows Sleep takes more time than expected so we try to get here less frequently to avoid // the CI takes a long time time.Sleep(time.Nanosecond) } cw.Unwatch() if i%2 == 1 { cancel() } } actualCancelFuncCalls := atomic.LoadInt64(&cancelFuncCalls) actualCleanupFuncCalls := atomic.LoadInt64(&cleanupFuncCalls) if actualCancelFuncCalls == 0 { t.Fatal("actualCancelFuncCalls == 0") } maxCancelFuncCalls := int64(cycleCount) / 2 if actualCancelFuncCalls > maxCancelFuncCalls { t.Errorf("cancel func calls should be no more than %d but was %d", actualCancelFuncCalls, maxCancelFuncCalls) } if actualCancelFuncCalls != actualCleanupFuncCalls { t.Errorf("cancel func calls (%d) should be equal to cleanup func calls (%d) but was not", actualCancelFuncCalls, actualCleanupFuncCalls) } } func BenchmarkContextWatcherUncancellable(b *testing.B) { cw := ctxwatch.NewContextWatcher(&testHandler{handleCancel: func(context.Context) {}, handleUnwatchAfterCancel: func() {}}) for b.Loop() { cw.Watch(context.Background()) cw.Unwatch() } } func BenchmarkContextWatcherCancelled(b *testing.B) { cw := ctxwatch.NewContextWatcher(&testHandler{handleCancel: func(context.Context) {}, handleUnwatchAfterCancel: func() {}}) for b.Loop() { ctx, cancel := context.WithCancel(context.Background()) cw.Watch(ctx) cancel() cw.Unwatch() } } func BenchmarkContextWatcherCancellable(b *testing.B) { cw := ctxwatch.NewContextWatcher(&testHandler{handleCancel: func(context.Context) {}, handleUnwatchAfterCancel: func() {}}) ctx := b.Context() for b.Loop() { cw.Watch(ctx) cw.Unwatch() } } pgx-5.8.0/pgconn/defaults.go000066400000000000000000000035531512357711200157560ustar00rootroot00000000000000//go:build !windows // +build !windows package pgconn import ( "os" "os/user" "path/filepath" ) func defaultSettings() map[string]string { settings := make(map[string]string) settings["host"] = defaultHost() settings["port"] = "5432" // Default to the OS user name. Purposely ignoring err getting user name from // OS. The client application will simply have to specify the user in that // case (which they typically will be doing anyway). user, err := user.Current() if err == nil { settings["user"] = user.Username settings["passfile"] = filepath.Join(user.HomeDir, ".pgpass") settings["servicefile"] = filepath.Join(user.HomeDir, ".pg_service.conf") sslcert := filepath.Join(user.HomeDir, ".postgresql", "postgresql.crt") sslkey := filepath.Join(user.HomeDir, ".postgresql", "postgresql.key") if _, err := os.Stat(sslcert); err == nil { if _, err := os.Stat(sslkey); err == nil { // Both the cert and key must be present to use them, or do not use either settings["sslcert"] = sslcert settings["sslkey"] = sslkey } } sslrootcert := filepath.Join(user.HomeDir, ".postgresql", "root.crt") if _, err := os.Stat(sslrootcert); err == nil { settings["sslrootcert"] = sslrootcert } } settings["target_session_attrs"] = "any" return settings } // defaultHost attempts to mimic libpq's default host. libpq uses the default unix socket location on *nix and localhost // on Windows. The default socket location is compiled into libpq. Since pgx does not have access to that default it // checks the existence of common locations. func defaultHost() string { candidatePaths := []string{ "/var/run/postgresql", // Debian "/private/tmp", // OSX - homebrew "/tmp", // standard PostgreSQL } for _, path := range candidatePaths { if _, err := os.Stat(path); err == nil { return path } } return "localhost" } pgx-5.8.0/pgconn/defaults_windows.go000066400000000000000000000036121512357711200175240ustar00rootroot00000000000000package pgconn import ( "os" "os/user" "path/filepath" "strings" ) func defaultSettings() map[string]string { settings := make(map[string]string) settings["host"] = defaultHost() settings["port"] = "5432" // Default to the OS user name. Purposely ignoring err getting user name from // OS. The client application will simply have to specify the user in that // case (which they typically will be doing anyway). user, err := user.Current() appData := os.Getenv("APPDATA") if err == nil { // Windows gives us the username here as `DOMAIN\user` or `LOCALPCNAME\user`, // but the libpq default is just the `user` portion, so we strip off the first part. username := user.Username if strings.Contains(username, "\\") { username = username[strings.LastIndex(username, "\\")+1:] } settings["user"] = username settings["passfile"] = filepath.Join(appData, "postgresql", "pgpass.conf") settings["servicefile"] = filepath.Join(user.HomeDir, ".pg_service.conf") sslcert := filepath.Join(appData, "postgresql", "postgresql.crt") sslkey := filepath.Join(appData, "postgresql", "postgresql.key") if _, err := os.Stat(sslcert); err == nil { if _, err := os.Stat(sslkey); err == nil { // Both the cert and key must be present to use them, or do not use either settings["sslcert"] = sslcert settings["sslkey"] = sslkey } } sslrootcert := filepath.Join(appData, "postgresql", "root.crt") if _, err := os.Stat(sslrootcert); err == nil { settings["sslrootcert"] = sslrootcert } } settings["target_session_attrs"] = "any" return settings } // defaultHost attempts to mimic libpq's default host. libpq uses the default unix socket location on *nix and localhost // on Windows. The default socket location is compiled into libpq. Since pgx does not have access to that default it // checks the existence of common locations. func defaultHost() string { return "localhost" } pgx-5.8.0/pgconn/doc.go000066400000000000000000000034651512357711200147160ustar00rootroot00000000000000// Package pgconn is a low-level PostgreSQL database driver. /* pgconn provides lower level access to a PostgreSQL connection than a database/sql or pgx connection. It operates at nearly the same level is the C library libpq. Establishing a Connection Use Connect to establish a connection. It accepts a connection string in URL or keyword/value format and will read the environment for libpq style environment variables. Executing a Query ExecParams and ExecPrepared execute a single query. They return readers that iterate over each row. The Read method reads all rows into memory. Executing Multiple Queries in a Single Round Trip Exec and ExecBatch can execute multiple queries in a single round trip. They return readers that iterate over each query result. The ReadAll method reads all query results into memory. Pipeline Mode Pipeline mode allows sending queries without having read the results of previously sent queries. It allows control of exactly how many and when network round trips occur. Context Support All potentially blocking operations take a context.Context. The default behavior when a context is canceled is for the method to immediately return. In most circumstances, this will also close the underlying connection. This behavior can be customized by using BuildContextWatcherHandler on the Config to create a ctxwatch.Handler with different behavior. This can be especially useful when queries that are frequently canceled and the overhead of creating new connections is a problem. DeadlineContextWatcherHandler and CancelRequestContextWatcherHandler can be used to introduce a delay before interrupting the query in such a way as to close the connection. The CancelRequest method may be used to request the PostgreSQL server cancel an in-progress query without forcing the client to abort. */ package pgconn pgx-5.8.0/pgconn/errors.go000066400000000000000000000157321512357711200154650ustar00rootroot00000000000000package pgconn import ( "context" "errors" "fmt" "net" "net/url" "regexp" "strings" ) // SafeToRetry checks if the err is guaranteed to have occurred before sending any data to the server. func SafeToRetry(err error) bool { var retryableErr interface{ SafeToRetry() bool } if errors.As(err, &retryableErr) { return retryableErr.SafeToRetry() } return false } // Timeout checks if err was caused by a timeout. To be specific, it is true if err was caused within pgconn by a // context.DeadlineExceeded or an implementer of net.Error where Timeout() is true. func Timeout(err error) bool { var timeoutErr *errTimeout return errors.As(err, &timeoutErr) } // PgError represents an error reported by the PostgreSQL server. See // http://www.postgresql.org/docs/current/static/protocol-error-fields.html for // detailed field description. type PgError struct { Severity string SeverityUnlocalized string Code string Message string Detail string Hint string Position int32 InternalPosition int32 InternalQuery string Where string SchemaName string TableName string ColumnName string DataTypeName string ConstraintName string File string Line int32 Routine string } func (pe *PgError) Error() string { return pe.Severity + ": " + pe.Message + " (SQLSTATE " + pe.Code + ")" } // SQLState returns the SQLState of the error. func (pe *PgError) SQLState() string { return pe.Code } // ConnectError is the error returned when a connection attempt fails. type ConnectError struct { Config *Config // The configuration that was used in the connection attempt. err error } func (e *ConnectError) Error() string { prefix := fmt.Sprintf("failed to connect to `user=%s database=%s`:", e.Config.User, e.Config.Database) details := e.err.Error() if strings.Contains(details, "\n") { return prefix + "\n\t" + strings.ReplaceAll(details, "\n", "\n\t") } else { return prefix + " " + details } } func (e *ConnectError) Unwrap() error { return e.err } type perDialConnectError struct { address string originalHostname string err error } func (e *perDialConnectError) Error() string { return fmt.Sprintf("%s (%s): %s", e.address, e.originalHostname, e.err.Error()) } func (e *perDialConnectError) Unwrap() error { return e.err } type connLockError struct { status string } func (e *connLockError) SafeToRetry() bool { return true // a lock failure by definition happens before the connection is used. } func (e *connLockError) Error() string { return e.status } // ParseConfigError is the error returned when a connection string cannot be parsed. type ParseConfigError struct { ConnString string // The connection string that could not be parsed. msg string err error } func NewParseConfigError(conn, msg string, err error) error { return &ParseConfigError{ ConnString: conn, msg: msg, err: err, } } func (e *ParseConfigError) Error() string { // Now that ParseConfigError is public and ConnString is available to the developer, perhaps it would be better only // return a static string. That would ensure that the error message cannot leak a password. The ConnString field would // allow access to the original string if desired and Unwrap would allow access to the underlying error. connString := redactPW(e.ConnString) if e.err == nil { return fmt.Sprintf("cannot parse `%s`: %s", connString, e.msg) } return fmt.Sprintf("cannot parse `%s`: %s (%s)", connString, e.msg, e.err.Error()) } func (e *ParseConfigError) Unwrap() error { return e.err } func normalizeTimeoutError(ctx context.Context, err error) error { var netErr net.Error if errors.As(err, &netErr) && netErr.Timeout() { if ctx.Err() == context.Canceled { // Since the timeout was caused by a context cancellation, the actual error is context.Canceled not the timeout error. return context.Canceled } else if ctx.Err() == context.DeadlineExceeded { return &errTimeout{err: ctx.Err()} } else { return &errTimeout{err: netErr} } } return err } type pgconnError struct { msg string err error safeToRetry bool } func (e *pgconnError) Error() string { if e.msg == "" { return e.err.Error() } if e.err == nil { return e.msg } return fmt.Sprintf("%s: %s", e.msg, e.err.Error()) } func (e *pgconnError) SafeToRetry() bool { return e.safeToRetry } func (e *pgconnError) Unwrap() error { return e.err } // errTimeout occurs when an error was caused by a timeout. Specifically, it wraps an error which is // context.Canceled, context.DeadlineExceeded, or an implementer of net.Error where Timeout() is true. type errTimeout struct { err error } func (e *errTimeout) Error() string { return fmt.Sprintf("timeout: %s", e.err.Error()) } func (e *errTimeout) SafeToRetry() bool { return SafeToRetry(e.err) } func (e *errTimeout) Unwrap() error { return e.err } type contextAlreadyDoneError struct { err error } func (e *contextAlreadyDoneError) Error() string { return fmt.Sprintf("context already done: %s", e.err.Error()) } func (e *contextAlreadyDoneError) SafeToRetry() bool { return true } func (e *contextAlreadyDoneError) Unwrap() error { return e.err } // newContextAlreadyDoneError double-wraps a context error in `contextAlreadyDoneError` and `errTimeout`. func newContextAlreadyDoneError(ctx context.Context) (err error) { return &errTimeout{&contextAlreadyDoneError{err: ctx.Err()}} } func redactPW(connString string) string { if strings.HasPrefix(connString, "postgres://") || strings.HasPrefix(connString, "postgresql://") { if u, err := url.Parse(connString); err == nil { return redactURL(u) } } quotedKV := regexp.MustCompile(`password='[^']*'`) connString = quotedKV.ReplaceAllLiteralString(connString, "password=xxxxx") plainKV := regexp.MustCompile(`password=[^ ]*`) connString = plainKV.ReplaceAllLiteralString(connString, "password=xxxxx") brokenURL := regexp.MustCompile(`:[^:@]+?@`) connString = brokenURL.ReplaceAllLiteralString(connString, ":xxxxxx@") return connString } func redactURL(u *url.URL) string { if u == nil { return "" } if _, pwSet := u.User.Password(); pwSet { u.User = url.UserPassword(u.User.Username(), "xxxxx") } return u.String() } type NotPreferredError struct { err error safeToRetry bool } func (e *NotPreferredError) Error() string { return fmt.Sprintf("standby server not found: %s", e.err.Error()) } func (e *NotPreferredError) SafeToRetry() bool { return e.safeToRetry } func (e *NotPreferredError) Unwrap() error { return e.err } type PrepareError struct { err error ParseComplete bool // Indicates whether the error occurred after a ParseComplete message was received. } func (e *PrepareError) Error() string { if e.ParseComplete { return fmt.Sprintf("prepare failed after ParseComplete: %s", e.err.Error()) } return e.err.Error() } func (e *PrepareError) Unwrap() error { return e.err } pgx-5.8.0/pgconn/errors_test.go000066400000000000000000000032531512357711200165170ustar00rootroot00000000000000package pgconn_test import ( "testing" "github.com/jackc/pgx/v5/pgconn" "github.com/stretchr/testify/assert" ) func TestConfigError(t *testing.T) { tests := []struct { name string err error expectedMsg string }{ { name: "url with password", err: pgconn.NewParseConfigError("postgresql://foo:password@host", "msg", nil), expectedMsg: "cannot parse `postgresql://foo:xxxxx@host`: msg", }, { name: "keyword/value with password unquoted", err: pgconn.NewParseConfigError("host=host password=password user=user", "msg", nil), expectedMsg: "cannot parse `host=host password=xxxxx user=user`: msg", }, { name: "keyword/value with password quoted", err: pgconn.NewParseConfigError("host=host password='pass word' user=user", "msg", nil), expectedMsg: "cannot parse `host=host password=xxxxx user=user`: msg", }, { name: "weird url", err: pgconn.NewParseConfigError("postgresql://foo::password@host:1:", "msg", nil), expectedMsg: "cannot parse `postgresql://foo:xxxxx@host:1:`: msg", }, { name: "weird url with slash in password", err: pgconn.NewParseConfigError("postgres://user:pass/word@host:5432/db_name", "msg", nil), expectedMsg: "cannot parse `postgres://user:xxxxxx@host:5432/db_name`: msg", }, { name: "url without password", err: pgconn.NewParseConfigError("postgresql://other@host/db", "msg", nil), expectedMsg: "cannot parse `postgresql://other@host/db`: msg", }, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { t.Parallel() assert.EqualError(t, tt.err, tt.expectedMsg) }) } } pgx-5.8.0/pgconn/export_test.go000066400000000000000000000001151512357711200165160ustar00rootroot00000000000000// File export_test exports some methods for better testing. package pgconn pgx-5.8.0/pgconn/helper_test.go000066400000000000000000000020001512357711200164470ustar00rootroot00000000000000package pgconn_test import ( "context" "testing" "time" "github.com/jackc/pgx/v5/pgconn" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func closeConn(t testing.TB, conn *pgconn.PgConn) { ctx, cancel := context.WithTimeout(context.Background(), 30*time.Second) defer cancel() require.NoError(t, conn.Close(ctx)) select { case <-conn.CleanupDone(): case <-time.After(30 * time.Second): t.Fatal("Connection cleanup exceeded maximum time") } } // Do a simple query to ensure the connection is still usable func ensureConnValid(t *testing.T, pgConn *pgconn.PgConn) { ctx, cancel := context.WithTimeout(context.Background(), 30*time.Second) result := pgConn.ExecParams(ctx, "select generate_series(1,$1)", [][]byte{[]byte("3")}, nil, nil, nil).Read() cancel() require.Nil(t, result.Err) assert.Equal(t, 3, len(result.Rows)) assert.Equal(t, "1", string(result.Rows[0][0])) assert.Equal(t, "2", string(result.Rows[1][0])) assert.Equal(t, "3", string(result.Rows[2][0])) } pgx-5.8.0/pgconn/internal/000077500000000000000000000000001512357711200154265ustar00rootroot00000000000000pgx-5.8.0/pgconn/internal/bgreader/000077500000000000000000000000001512357711200172015ustar00rootroot00000000000000pgx-5.8.0/pgconn/internal/bgreader/bgreader.go000066400000000000000000000056061512357711200213120ustar00rootroot00000000000000// Package bgreader provides a io.Reader that can optionally buffer reads in the background. package bgreader import ( "io" "sync" "github.com/jackc/pgx/v5/internal/iobufpool" ) const ( StatusStopped = iota StatusRunning StatusStopping ) // BGReader is an io.Reader that can optionally buffer reads in the background. It is safe for concurrent use. type BGReader struct { r io.Reader cond *sync.Cond status int32 readResults []readResult } type readResult struct { buf *[]byte err error } // Start starts the backgrounder reader. If the background reader is already running this is a no-op. The background // reader will stop automatically when the underlying reader returns an error. func (r *BGReader) Start() { r.cond.L.Lock() defer r.cond.L.Unlock() switch r.status { case StatusStopped: r.status = StatusRunning go r.bgRead() case StatusRunning: // no-op case StatusStopping: r.status = StatusRunning } } // Stop tells the background reader to stop after the in progress Read returns. It is safe to call Stop when the // background reader is not running. func (r *BGReader) Stop() { r.cond.L.Lock() defer r.cond.L.Unlock() switch r.status { case StatusStopped: // no-op case StatusRunning: r.status = StatusStopping case StatusStopping: // no-op } } // Status returns the current status of the background reader. func (r *BGReader) Status() int32 { r.cond.L.Lock() defer r.cond.L.Unlock() return r.status } func (r *BGReader) bgRead() { keepReading := true for keepReading { buf := iobufpool.Get(8192) n, err := r.r.Read(*buf) *buf = (*buf)[:n] r.cond.L.Lock() r.readResults = append(r.readResults, readResult{buf: buf, err: err}) if r.status == StatusStopping || err != nil { r.status = StatusStopped keepReading = false } r.cond.L.Unlock() r.cond.Broadcast() } } // Read implements the io.Reader interface. func (r *BGReader) Read(p []byte) (int, error) { r.cond.L.Lock() defer r.cond.L.Unlock() if len(r.readResults) > 0 { return r.readFromReadResults(p) } // There are no unread background read results and the background reader is stopped. if r.status == StatusStopped { return r.r.Read(p) } // Wait for results from the background reader for len(r.readResults) == 0 { r.cond.Wait() } return r.readFromReadResults(p) } // readBackgroundResults reads a result previously read by the background reader. r.cond.L must be held. func (r *BGReader) readFromReadResults(p []byte) (int, error) { buf := r.readResults[0].buf var err error n := copy(p, *buf) if n == len(*buf) { err = r.readResults[0].err iobufpool.Put(buf) if len(r.readResults) == 1 { r.readResults = nil } else { r.readResults = r.readResults[1:] } } else { *buf = (*buf)[n:] r.readResults[0].buf = buf } return n, err } func New(r io.Reader) *BGReader { return &BGReader{ r: r, cond: &sync.Cond{ L: &sync.Mutex{}, }, } } pgx-5.8.0/pgconn/internal/bgreader/bgreader_test.go000066400000000000000000000064211512357711200223450ustar00rootroot00000000000000package bgreader_test import ( "bytes" "errors" "io" "math/rand/v2" "testing" "time" "github.com/jackc/pgx/v5/pgconn/internal/bgreader" "github.com/stretchr/testify/require" ) func TestBGReaderReadWhenStopped(t *testing.T) { r := bytes.NewReader([]byte("foo bar baz")) bgr := bgreader.New(r) buf, err := io.ReadAll(bgr) require.NoError(t, err) require.Equal(t, []byte("foo bar baz"), buf) } func TestBGReaderReadWhenStarted(t *testing.T) { r := bytes.NewReader([]byte("foo bar baz")) bgr := bgreader.New(r) bgr.Start() buf, err := io.ReadAll(bgr) require.NoError(t, err) require.Equal(t, []byte("foo bar baz"), buf) } type mockReadFunc func(p []byte) (int, error) type mockReader struct { readFuncs []mockReadFunc } func (r *mockReader) Read(p []byte) (int, error) { if len(r.readFuncs) == 0 { return 0, io.EOF } fn := r.readFuncs[0] r.readFuncs = r.readFuncs[1:] return fn(p) } func TestBGReaderReadWaitsForBackgroundRead(t *testing.T) { rr := &mockReader{ readFuncs: []mockReadFunc{ func(p []byte) (int, error) { time.Sleep(1 * time.Second); return copy(p, []byte("foo")), nil }, func(p []byte) (int, error) { return copy(p, []byte("bar")), nil }, func(p []byte) (int, error) { return copy(p, []byte("baz")), nil }, }, } bgr := bgreader.New(rr) bgr.Start() buf := make([]byte, 3) n, err := bgr.Read(buf) require.NoError(t, err) require.EqualValues(t, 3, n) require.Equal(t, []byte("foo"), buf) } func TestBGReaderErrorWhenStarted(t *testing.T) { rr := &mockReader{ readFuncs: []mockReadFunc{ func(p []byte) (int, error) { return copy(p, []byte("foo")), nil }, func(p []byte) (int, error) { return copy(p, []byte("bar")), nil }, func(p []byte) (int, error) { return copy(p, []byte("baz")), errors.New("oops") }, }, } bgr := bgreader.New(rr) bgr.Start() buf, err := io.ReadAll(bgr) require.Equal(t, []byte("foobarbaz"), buf) require.EqualError(t, err, "oops") } func TestBGReaderErrorWhenStopped(t *testing.T) { rr := &mockReader{ readFuncs: []mockReadFunc{ func(p []byte) (int, error) { return copy(p, []byte("foo")), nil }, func(p []byte) (int, error) { return copy(p, []byte("bar")), nil }, func(p []byte) (int, error) { return copy(p, []byte("baz")), errors.New("oops") }, }, } bgr := bgreader.New(rr) buf, err := io.ReadAll(bgr) require.Equal(t, []byte("foobarbaz"), buf) require.EqualError(t, err, "oops") } type numberReader struct { v uint8 rng *rand.Rand } func (nr *numberReader) Read(p []byte) (int, error) { n := nr.rng.IntN(len(p)) for i := range n { p[i] = nr.v nr.v++ } return n, nil } // TestBGReaderStress stress tests BGReader by reading a lot of bytes in random sizes while randomly starting and // stopping the background worker from other goroutines. func TestBGReaderStress(t *testing.T) { nr := &numberReader{rng: rand.New(rand.NewPCG(0, 0))} bgr := bgreader.New(nr) bytesRead := 0 var expected uint8 buf := make([]byte, 10_000) rng := rand.New(rand.NewPCG(0, 0)) for bytesRead < 1_000_000 { randomNumber := rng.IntN(100) switch { case randomNumber < 10: go bgr.Start() case randomNumber < 20: go bgr.Stop() default: n, err := bgr.Read(buf) require.NoError(t, err) for i := range n { require.Equal(t, expected, buf[i]) expected++ } bytesRead += n } } } pgx-5.8.0/pgconn/krb5.go000066400000000000000000000044461512357711200150140ustar00rootroot00000000000000package pgconn import ( "errors" "fmt" "github.com/jackc/pgx/v5/pgproto3" ) // NewGSSFunc creates a GSS authentication provider, for use with // RegisterGSSProvider. type NewGSSFunc func() (GSS, error) var newGSS NewGSSFunc // RegisterGSSProvider registers a GSS authentication provider. For example, if // you need to use Kerberos to authenticate with your server, add this to your // main package: // // import "github.com/otan/gopgkrb5" // // func init() { // pgconn.RegisterGSSProvider(func() (pgconn.GSS, error) { return gopgkrb5.NewGSS() }) // } func RegisterGSSProvider(newGSSArg NewGSSFunc) { newGSS = newGSSArg } // GSS provides GSSAPI authentication (e.g., Kerberos). type GSS interface { GetInitToken(host, service string) ([]byte, error) GetInitTokenFromSPN(spn string) ([]byte, error) Continue(inToken []byte) (done bool, outToken []byte, err error) } func (c *PgConn) gssAuth() error { if newGSS == nil { return errors.New("kerberos error: no GSSAPI provider registered, see https://github.com/otan/gopgkrb5") } cli, err := newGSS() if err != nil { return err } var nextData []byte if c.config.KerberosSpn != "" { // Use the supplied SPN if provided. nextData, err = cli.GetInitTokenFromSPN(c.config.KerberosSpn) } else { // Allow the kerberos service name to be overridden service := "postgres" if c.config.KerberosSrvName != "" { service = c.config.KerberosSrvName } nextData, err = cli.GetInitToken(c.config.Host, service) } if err != nil { return err } for { gssResponse := &pgproto3.GSSResponse{ Data: nextData, } c.frontend.Send(gssResponse) err = c.flushWithPotentialWriteReadDeadlock() if err != nil { return err } resp, err := c.rxGSSContinue() if err != nil { return err } var done bool done, nextData, err = cli.Continue(resp.Data) if err != nil { return err } if done { break } } return nil } func (c *PgConn) rxGSSContinue() (*pgproto3.AuthenticationGSSContinue, error) { msg, err := c.receiveMessage() if err != nil { return nil, err } switch m := msg.(type) { case *pgproto3.AuthenticationGSSContinue: return m, nil case *pgproto3.ErrorResponse: return nil, ErrorResponseToPgError(m) } return nil, fmt.Errorf("expected AuthenticationGSSContinue message but received unexpected message %T", msg) } pgx-5.8.0/pgconn/pgconn.go000066400000000000000000002351641512357711200154400ustar00rootroot00000000000000package pgconn import ( "container/list" "context" "crypto/md5" "crypto/tls" "encoding/binary" "encoding/hex" "errors" "fmt" "io" "maps" "math" "net" "strconv" "strings" "sync" "time" "github.com/jackc/pgx/v5/internal/iobufpool" "github.com/jackc/pgx/v5/internal/pgio" "github.com/jackc/pgx/v5/pgconn/ctxwatch" "github.com/jackc/pgx/v5/pgconn/internal/bgreader" "github.com/jackc/pgx/v5/pgproto3" ) const ( connStatusUninitialized = iota connStatusConnecting connStatusClosed connStatusIdle connStatusBusy ) // Notice represents a notice response message reported by the PostgreSQL server. Be aware that this is distinct from // LISTEN/NOTIFY notification. type Notice PgError // Notification is a message received from the PostgreSQL LISTEN/NOTIFY system type Notification struct { PID uint32 // backend pid that sent the notification Channel string // channel from which notification was received Payload string } // DialFunc is a function that can be used to connect to a PostgreSQL server. type DialFunc func(ctx context.Context, network, addr string) (net.Conn, error) // LookupFunc is a function that can be used to lookup IPs addrs from host. Optionally an ip:port combination can be // returned in order to override the connection string's port. type LookupFunc func(ctx context.Context, host string) (addrs []string, err error) // BuildFrontendFunc is a function that can be used to create Frontend implementation for connection. type BuildFrontendFunc func(r io.Reader, w io.Writer) *pgproto3.Frontend // PgErrorHandler is a function that handles errors returned from Postgres. This function must return true to keep // the connection open. Returning false will cause the connection to be closed immediately. You should return // false on any FATAL-severity errors. This will not receive network errors. The *PgConn is provided so the handler is // aware of the origin of the error, but it must not invoke any query method. type PgErrorHandler func(*PgConn, *PgError) bool // NoticeHandler is a function that can handle notices received from the PostgreSQL server. Notices can be received at // any time, usually during handling of a query response. The *PgConn is provided so the handler is aware of the origin // of the notice, but it must not invoke any query method. Be aware that this is distinct from LISTEN/NOTIFY // notification. type NoticeHandler func(*PgConn, *Notice) // NotificationHandler is a function that can handle notifications received from the PostgreSQL server. Notifications // can be received at any time, usually during handling of a query response. The *PgConn is provided so the handler is // aware of the origin of the notice, but it must not invoke any query method. Be aware that this is distinct from a // notice event. type NotificationHandler func(*PgConn, *Notification) // PgConn is a low-level PostgreSQL connection handle. It is not safe for concurrent usage. type PgConn struct { conn net.Conn pid uint32 // backend pid secretKey uint32 // key to use to send a cancel query message to the server parameterStatuses map[string]string // parameters that have been reported by the server txStatus byte frontend *pgproto3.Frontend bgReader *bgreader.BGReader slowWriteTimer *time.Timer bgReaderStarted chan struct{} customData map[string]any config *Config status byte // One of connStatus* constants bufferingReceive bool bufferingReceiveMux sync.Mutex bufferingReceiveMsg pgproto3.BackendMessage bufferingReceiveErr error peekedMsg pgproto3.BackendMessage // Reusable / preallocated resources resultReader ResultReader multiResultReader MultiResultReader pipeline Pipeline contextWatcher *ctxwatch.ContextWatcher fieldDescriptions [16]FieldDescription cleanupDone chan struct{} } // Connect establishes a connection to a PostgreSQL server using the environment and connString (in URL or keyword/value // format) to provide configuration. See documentation for [ParseConfig] for details. ctx can be used to cancel a // connect attempt. func Connect(ctx context.Context, connString string) (*PgConn, error) { config, err := ParseConfig(connString) if err != nil { return nil, err } return ConnectConfig(ctx, config) } // Connect establishes a connection to a PostgreSQL server using the environment and connString (in URL or keyword/value // format) and ParseConfigOptions to provide additional configuration. See documentation for [ParseConfig] for details. // ctx can be used to cancel a connect attempt. func ConnectWithOptions(ctx context.Context, connString string, parseConfigOptions ParseConfigOptions) (*PgConn, error) { config, err := ParseConfigWithOptions(connString, parseConfigOptions) if err != nil { return nil, err } return ConnectConfig(ctx, config) } // Connect establishes a connection to a PostgreSQL server using config. config must have been constructed with // [ParseConfig]. ctx can be used to cancel a connect attempt. // // If config.Fallbacks are present they will sequentially be tried in case of error establishing network connection. An // authentication error will terminate the chain of attempts (like libpq: // https://www.postgresql.org/docs/current/libpq-connect.html#LIBPQ-MULTIPLE-HOSTS) and be returned as the error. func ConnectConfig(ctx context.Context, config *Config) (*PgConn, error) { // Default values are set in ParseConfig. Enforce initial creation by ParseConfig rather than setting defaults from // zero values. if !config.createdByParseConfig { panic("config must be created by ParseConfig") } var allErrors []error connectConfigs, errs := buildConnectOneConfigs(ctx, config) if len(errs) > 0 { allErrors = append(allErrors, errs...) } if len(connectConfigs) == 0 { return nil, &ConnectError{Config: config, err: fmt.Errorf("hostname resolving error: %w", errors.Join(allErrors...))} } pgConn, errs := connectPreferred(ctx, config, connectConfigs) if len(errs) > 0 { allErrors = append(allErrors, errs...) return nil, &ConnectError{Config: config, err: errors.Join(allErrors...)} } if config.AfterConnect != nil { err := config.AfterConnect(ctx, pgConn) if err != nil { pgConn.conn.Close() return nil, &ConnectError{Config: config, err: fmt.Errorf("AfterConnect error: %w", err)} } } return pgConn, nil } // buildConnectOneConfigs resolves hostnames and builds a list of connectOneConfigs to try connecting to. It returns a // slice of successfully resolved connectOneConfigs and a slice of errors. It is possible for both slices to contain // values if some hosts were successfully resolved and others were not. func buildConnectOneConfigs(ctx context.Context, config *Config) ([]*connectOneConfig, []error) { // Simplify usage by treating primary config and fallbacks the same. fallbackConfigs := []*FallbackConfig{ { Host: config.Host, Port: config.Port, TLSConfig: config.TLSConfig, }, } fallbackConfigs = append(fallbackConfigs, config.Fallbacks...) var configs []*connectOneConfig var allErrors []error for _, fb := range fallbackConfigs { // skip resolve for unix sockets if isAbsolutePath(fb.Host) { network, address := NetworkAddress(fb.Host, fb.Port) configs = append(configs, &connectOneConfig{ network: network, address: address, originalHostname: fb.Host, tlsConfig: fb.TLSConfig, }) continue } ips, err := config.LookupFunc(ctx, fb.Host) if err != nil { allErrors = append(allErrors, err) continue } for _, ip := range ips { splitIP, splitPort, err := net.SplitHostPort(ip) if err == nil { port, err := strconv.ParseUint(splitPort, 10, 16) if err != nil { return nil, []error{fmt.Errorf("error parsing port (%s) from lookup: %w", splitPort, err)} } network, address := NetworkAddress(splitIP, uint16(port)) configs = append(configs, &connectOneConfig{ network: network, address: address, originalHostname: fb.Host, tlsConfig: fb.TLSConfig, }) } else { network, address := NetworkAddress(ip, fb.Port) configs = append(configs, &connectOneConfig{ network: network, address: address, originalHostname: fb.Host, tlsConfig: fb.TLSConfig, }) } } } return configs, allErrors } // connectPreferred attempts to connect to the preferred host from connectOneConfigs. The connections are attempted in // order. If a connection is successful it is returned. If no connection is successful then all errors are returned. If // a connection attempt returns a [NotPreferredError], then that host will be used if no other hosts are successful. func connectPreferred(ctx context.Context, config *Config, connectOneConfigs []*connectOneConfig) (*PgConn, []error) { octx := ctx var allErrors []error var fallbackConnectOneConfig *connectOneConfig for i, c := range connectOneConfigs { // ConnectTimeout restricts the whole connection process. if config.ConnectTimeout != 0 { // create new context first time or when previous host was different if i == 0 || (connectOneConfigs[i].address != connectOneConfigs[i-1].address) { var cancel context.CancelFunc ctx, cancel = context.WithTimeout(octx, config.ConnectTimeout) defer cancel() } } else { ctx = octx } pgConn, err := connectOne(ctx, config, c, false) if pgConn != nil { return pgConn, nil } allErrors = append(allErrors, err) var pgErr *PgError if errors.As(err, &pgErr) { // pgx will try next host even if libpq does not in certain cases (see #2246) // consider change for the next major version const ERRCODE_INVALID_PASSWORD = "28P01" const ERRCODE_INVALID_CATALOG_NAME = "3D000" // db does not exist const ERRCODE_INSUFFICIENT_PRIVILEGE = "42501" // missing connect privilege // auth failed due to invalid password, db does not exist or user has no permission if pgErr.Code == ERRCODE_INVALID_PASSWORD || pgErr.Code == ERRCODE_INVALID_CATALOG_NAME || pgErr.Code == ERRCODE_INSUFFICIENT_PRIVILEGE { return nil, allErrors } } var npErr *NotPreferredError if errors.As(err, &npErr) { fallbackConnectOneConfig = c } } if fallbackConnectOneConfig != nil { pgConn, err := connectOne(ctx, config, fallbackConnectOneConfig, true) if err == nil { return pgConn, nil } allErrors = append(allErrors, err) } return nil, allErrors } // connectOne makes one connection attempt to a single host. func connectOne(ctx context.Context, config *Config, connectConfig *connectOneConfig, ignoreNotPreferredErr bool, ) (*PgConn, error) { pgConn := new(PgConn) pgConn.config = config pgConn.cleanupDone = make(chan struct{}) pgConn.customData = make(map[string]any) var err error newPerDialConnectError := func(msg string, err error) *perDialConnectError { err = normalizeTimeoutError(ctx, err) e := &perDialConnectError{address: connectConfig.address, originalHostname: connectConfig.originalHostname, err: fmt.Errorf("%s: %w", msg, err)} return e } pgConn.conn, err = config.DialFunc(ctx, connectConfig.network, connectConfig.address) if err != nil { return nil, newPerDialConnectError("dial error", err) } if connectConfig.tlsConfig != nil { pgConn.contextWatcher = ctxwatch.NewContextWatcher(&DeadlineContextWatcherHandler{Conn: pgConn.conn}) pgConn.contextWatcher.Watch(ctx) var ( tlsConn net.Conn err error ) if config.SSLNegotiation == "direct" { tlsConn = tls.Client(pgConn.conn, connectConfig.tlsConfig) } else { tlsConn, err = startTLS(pgConn.conn, connectConfig.tlsConfig) } pgConn.contextWatcher.Unwatch() // Always unwatch `netConn` after TLS. if err != nil { pgConn.conn.Close() return nil, newPerDialConnectError("tls error", err) } pgConn.conn = tlsConn } if config.AfterNetConnect != nil { pgConn.conn, err = config.AfterNetConnect(ctx, config, pgConn.conn) if err != nil { pgConn.conn.Close() return nil, newPerDialConnectError("AfterNetConnect failed", err) } } pgConn.contextWatcher = ctxwatch.NewContextWatcher(config.BuildContextWatcherHandler(pgConn)) pgConn.contextWatcher.Watch(ctx) defer pgConn.contextWatcher.Unwatch() pgConn.parameterStatuses = make(map[string]string) pgConn.status = connStatusConnecting pgConn.bgReader = bgreader.New(pgConn.conn) pgConn.slowWriteTimer = time.AfterFunc(time.Duration(math.MaxInt64), func() { pgConn.bgReader.Start() pgConn.bgReaderStarted <- struct{}{} }, ) pgConn.slowWriteTimer.Stop() pgConn.bgReaderStarted = make(chan struct{}) pgConn.frontend = config.BuildFrontend(pgConn.bgReader, pgConn.conn) startupMsg := pgproto3.StartupMessage{ ProtocolVersion: pgproto3.ProtocolVersionNumber, Parameters: make(map[string]string), } // Copy default run-time params maps.Copy(startupMsg.Parameters, config.RuntimeParams) startupMsg.Parameters["user"] = config.User if config.Database != "" { startupMsg.Parameters["database"] = config.Database } pgConn.frontend.Send(&startupMsg) if err := pgConn.flushWithPotentialWriteReadDeadlock(); err != nil { pgConn.conn.Close() return nil, newPerDialConnectError("failed to write startup message", err) } for { msg, err := pgConn.receiveMessage() if err != nil { pgConn.conn.Close() if err, ok := err.(*PgError); ok { return nil, newPerDialConnectError("server error", err) } return nil, newPerDialConnectError("failed to receive message", err) } switch msg := msg.(type) { case *pgproto3.BackendKeyData: pgConn.pid = msg.ProcessID pgConn.secretKey = msg.SecretKey case *pgproto3.AuthenticationOk: case *pgproto3.AuthenticationCleartextPassword: err = pgConn.txPasswordMessage(pgConn.config.Password) if err != nil { pgConn.conn.Close() return nil, newPerDialConnectError("failed to write password message", err) } case *pgproto3.AuthenticationMD5Password: digestedPassword := "md5" + hexMD5(hexMD5(pgConn.config.Password+pgConn.config.User)+string(msg.Salt[:])) err = pgConn.txPasswordMessage(digestedPassword) if err != nil { pgConn.conn.Close() return nil, newPerDialConnectError("failed to write password message", err) } case *pgproto3.AuthenticationSASL: err = pgConn.scramAuth(msg.AuthMechanisms) if err != nil { pgConn.conn.Close() return nil, newPerDialConnectError("failed SASL auth", err) } case *pgproto3.AuthenticationGSS: err = pgConn.gssAuth() if err != nil { pgConn.conn.Close() return nil, newPerDialConnectError("failed GSS auth", err) } case *pgproto3.ReadyForQuery: pgConn.status = connStatusIdle if config.ValidateConnect != nil { // ValidateConnect may execute commands that cause the context to be watched again. Unwatch first to avoid // the watch already in progress panic. This is that last thing done by this method so there is no need to // restart the watch after ValidateConnect returns. // // See https://github.com/jackc/pgconn/issues/40. pgConn.contextWatcher.Unwatch() err := config.ValidateConnect(ctx, pgConn) if err != nil { if _, ok := err.(*NotPreferredError); ignoreNotPreferredErr && ok { return pgConn, nil } pgConn.conn.Close() return nil, newPerDialConnectError("ValidateConnect failed", err) } } return pgConn, nil case *pgproto3.ParameterStatus, *pgproto3.NoticeResponse: // handled by ReceiveMessage case *pgproto3.ErrorResponse: pgConn.conn.Close() return nil, newPerDialConnectError("server error", ErrorResponseToPgError(msg)) default: pgConn.conn.Close() return nil, newPerDialConnectError("received unexpected message", err) } } } func startTLS(conn net.Conn, tlsConfig *tls.Config) (net.Conn, error) { err := binary.Write(conn, binary.BigEndian, []int32{8, 80877103}) if err != nil { return nil, err } response := make([]byte, 1) if _, err = io.ReadFull(conn, response); err != nil { return nil, err } if response[0] != 'S' { return nil, errors.New("server refused TLS connection") } return tls.Client(conn, tlsConfig), nil } func (pgConn *PgConn) txPasswordMessage(password string) (err error) { pgConn.frontend.Send(&pgproto3.PasswordMessage{Password: password}) return pgConn.flushWithPotentialWriteReadDeadlock() } func hexMD5(s string) string { hash := md5.New() io.WriteString(hash, s) return hex.EncodeToString(hash.Sum(nil)) } func (pgConn *PgConn) signalMessage() chan struct{} { if pgConn.bufferingReceive { panic("BUG: signalMessage when already in progress") } pgConn.bufferingReceive = true pgConn.bufferingReceiveMux.Lock() ch := make(chan struct{}) go func() { pgConn.bufferingReceiveMsg, pgConn.bufferingReceiveErr = pgConn.frontend.Receive() pgConn.bufferingReceiveMux.Unlock() close(ch) }() return ch } // ReceiveMessage receives one wire protocol message from the PostgreSQL server. It must only be used when the // connection is not busy. e.g. It is an error to call ReceiveMessage while reading the result of a query. The messages // are still handled by the core pgconn message handling system so receiving a NotificationResponse will still trigger // the OnNotification callback. // // This is a very low level method that requires deep understanding of the PostgreSQL wire protocol to use correctly. // See https://www.postgresql.org/docs/current/protocol.html. func (pgConn *PgConn) ReceiveMessage(ctx context.Context) (pgproto3.BackendMessage, error) { if err := pgConn.lock(); err != nil { return nil, err } defer pgConn.unlock() if ctx != context.Background() { select { case <-ctx.Done(): return nil, newContextAlreadyDoneError(ctx) default: } pgConn.contextWatcher.Watch(ctx) defer pgConn.contextWatcher.Unwatch() } msg, err := pgConn.receiveMessage() if err != nil { err = &pgconnError{ msg: "receive message failed", err: normalizeTimeoutError(ctx, err), safeToRetry: true, } } return msg, err } // peekMessage peeks at the next message without setting up context cancellation. func (pgConn *PgConn) peekMessage() (pgproto3.BackendMessage, error) { if pgConn.peekedMsg != nil { return pgConn.peekedMsg, nil } var msg pgproto3.BackendMessage var err error if pgConn.bufferingReceive { pgConn.bufferingReceiveMux.Lock() msg = pgConn.bufferingReceiveMsg err = pgConn.bufferingReceiveErr pgConn.bufferingReceiveMux.Unlock() pgConn.bufferingReceive = false // If a timeout error happened in the background try the read again. var netErr net.Error if errors.As(err, &netErr) && netErr.Timeout() { msg, err = pgConn.frontend.Receive() } } else { msg, err = pgConn.frontend.Receive() } if err != nil { // Close on anything other than timeout error - everything else is fatal var netErr net.Error isNetErr := errors.As(err, &netErr) if !(isNetErr && netErr.Timeout()) { pgConn.asyncClose() } return nil, err } pgConn.peekedMsg = msg return msg, nil } // receiveMessage receives a message without setting up context cancellation func (pgConn *PgConn) receiveMessage() (pgproto3.BackendMessage, error) { msg, err := pgConn.peekMessage() if err != nil { return nil, err } pgConn.peekedMsg = nil switch msg := msg.(type) { case *pgproto3.ReadyForQuery: pgConn.txStatus = msg.TxStatus case *pgproto3.ParameterStatus: pgConn.parameterStatuses[msg.Name] = msg.Value case *pgproto3.ErrorResponse: err := ErrorResponseToPgError(msg) if pgConn.config.OnPgError != nil && !pgConn.config.OnPgError(pgConn, err) { pgConn.status = connStatusClosed pgConn.conn.Close() // Ignore error as the connection is already broken and there is already an error to return. close(pgConn.cleanupDone) return nil, err } case *pgproto3.NoticeResponse: if pgConn.config.OnNotice != nil { pgConn.config.OnNotice(pgConn, noticeResponseToNotice(msg)) } case *pgproto3.NotificationResponse: if pgConn.config.OnNotification != nil { pgConn.config.OnNotification(pgConn, &Notification{PID: msg.PID, Channel: msg.Channel, Payload: msg.Payload}) } } return msg, nil } // Conn returns the underlying net.Conn. This rarely necessary. If the connection will be directly used for reading or // writing then SyncConn should usually be called before Conn. func (pgConn *PgConn) Conn() net.Conn { return pgConn.conn } // PID returns the backend PID. func (pgConn *PgConn) PID() uint32 { return pgConn.pid } // TxStatus returns the current TxStatus as reported by the server in the ReadyForQuery message. // // Possible return values: // // 'I' - idle / not in transaction // 'T' - in a transaction // 'E' - in a failed transaction // // See https://www.postgresql.org/docs/current/protocol-message-formats.html. func (pgConn *PgConn) TxStatus() byte { return pgConn.txStatus } // SecretKey returns the backend secret key used to send a cancel query message to the server. func (pgConn *PgConn) SecretKey() uint32 { return pgConn.secretKey } // Frontend returns the underlying *pgproto3.Frontend. This rarely necessary. func (pgConn *PgConn) Frontend() *pgproto3.Frontend { return pgConn.frontend } // Close closes a connection. It is safe to call Close on an already closed connection. Close attempts a clean close by // sending the exit message to PostgreSQL. However, this could block so ctx is available to limit the time to wait. The // underlying net.Conn.Close() will always be called regardless of any other errors. func (pgConn *PgConn) Close(ctx context.Context) error { if pgConn.status == connStatusClosed { return nil } pgConn.status = connStatusClosed defer close(pgConn.cleanupDone) defer pgConn.conn.Close() if ctx != context.Background() { // Close may be called while a cancellable query is in progress. This will most often be triggered by panic when // a defer closes the connection (possibly indirectly via a transaction or a connection pool). Unwatch to end any // previous watch. It is safe to Unwatch regardless of whether a watch is already is progress. // // See https://github.com/jackc/pgconn/issues/29 pgConn.contextWatcher.Unwatch() pgConn.contextWatcher.Watch(ctx) defer pgConn.contextWatcher.Unwatch() } // Ignore any errors sending Terminate message and waiting for server to close connection. // This mimics the behavior of libpq PQfinish. It calls closePGconn which calls sendTerminateConn which purposefully // ignores errors. // // See https://github.com/jackc/pgx/issues/637 pgConn.frontend.Send(&pgproto3.Terminate{}) pgConn.flushWithPotentialWriteReadDeadlock() return pgConn.conn.Close() } // asyncClose marks the connection as closed and asynchronously sends a cancel query message and closes the underlying // connection. func (pgConn *PgConn) asyncClose() { if pgConn.status == connStatusClosed { return } pgConn.status = connStatusClosed go func() { defer close(pgConn.cleanupDone) defer pgConn.conn.Close() deadline := time.Now().Add(time.Second * 15) ctx, cancel := context.WithDeadline(context.Background(), deadline) defer cancel() pgConn.CancelRequest(ctx) pgConn.conn.SetDeadline(deadline) pgConn.frontend.Send(&pgproto3.Terminate{}) pgConn.flushWithPotentialWriteReadDeadlock() }() } // CleanupDone returns a channel that will be closed after all underlying resources have been cleaned up. A closed // connection is no longer usable, but underlying resources, in particular the net.Conn, may not have finished closing // yet. This is because certain errors such as a context cancellation require that the interrupted function call return // immediately, but the error may also cause the connection to be closed. In these cases the underlying resources are // closed asynchronously. // // This is only likely to be useful to connection pools. It gives them a way avoid establishing a new connection while // an old connection is still being cleaned up and thereby exceeding the maximum pool size. func (pgConn *PgConn) CleanupDone() chan (struct{}) { return pgConn.cleanupDone } // IsClosed reports if the connection has been closed. // // CleanupDone() can be used to determine if all cleanup has been completed. func (pgConn *PgConn) IsClosed() bool { return pgConn.status < connStatusIdle } // IsBusy reports if the connection is busy. func (pgConn *PgConn) IsBusy() bool { return pgConn.status == connStatusBusy } // lock locks the connection. func (pgConn *PgConn) lock() error { switch pgConn.status { case connStatusBusy: return &connLockError{status: "conn busy"} // This only should be possible in case of an application bug. case connStatusClosed: return &connLockError{status: "conn closed"} case connStatusUninitialized: return &connLockError{status: "conn uninitialized"} } pgConn.status = connStatusBusy return nil } func (pgConn *PgConn) unlock() { switch pgConn.status { case connStatusBusy: pgConn.status = connStatusIdle case connStatusClosed: default: panic("BUG: cannot unlock unlocked connection") // This should only be possible if there is a bug in this package. } } // ParameterStatus returns the value of a parameter reported by the server (e.g. // server_version). Returns an empty string for unknown parameters. func (pgConn *PgConn) ParameterStatus(key string) string { return pgConn.parameterStatuses[key] } // CommandTag is the status text returned by PostgreSQL for a query. type CommandTag struct { s string } // NewCommandTag makes a CommandTag from s. func NewCommandTag(s string) CommandTag { return CommandTag{s: s} } // RowsAffected returns the number of rows affected. If the CommandTag was not // for a row affecting command (e.g. "CREATE TABLE") then it returns 0. func (ct CommandTag) RowsAffected() int64 { // Find last non-digit idx := -1 for i := len(ct.s) - 1; i >= 0; i-- { if ct.s[i] >= '0' && ct.s[i] <= '9' { idx = i } else { break } } if idx == -1 { return 0 } var n int64 for _, b := range ct.s[idx:] { n = n*10 + int64(b-'0') } return n } func (ct CommandTag) String() string { return ct.s } // Insert is true if the command tag starts with "INSERT". func (ct CommandTag) Insert() bool { return strings.HasPrefix(ct.s, "INSERT") } // Update is true if the command tag starts with "UPDATE". func (ct CommandTag) Update() bool { return strings.HasPrefix(ct.s, "UPDATE") } // Delete is true if the command tag starts with "DELETE". func (ct CommandTag) Delete() bool { return strings.HasPrefix(ct.s, "DELETE") } // Select is true if the command tag starts with "SELECT". func (ct CommandTag) Select() bool { return strings.HasPrefix(ct.s, "SELECT") } type FieldDescription struct { Name string TableOID uint32 TableAttributeNumber uint16 DataTypeOID uint32 DataTypeSize int16 TypeModifier int32 Format int16 } func (pgConn *PgConn) convertRowDescription(dst []FieldDescription, rd *pgproto3.RowDescription) []FieldDescription { if cap(dst) >= len(rd.Fields) { dst = dst[:len(rd.Fields):len(rd.Fields)] } else { dst = make([]FieldDescription, len(rd.Fields)) } for i := range rd.Fields { dst[i].Name = string(rd.Fields[i].Name) dst[i].TableOID = rd.Fields[i].TableOID dst[i].TableAttributeNumber = rd.Fields[i].TableAttributeNumber dst[i].DataTypeOID = rd.Fields[i].DataTypeOID dst[i].DataTypeSize = rd.Fields[i].DataTypeSize dst[i].TypeModifier = rd.Fields[i].TypeModifier dst[i].Format = rd.Fields[i].Format } return dst } type StatementDescription struct { Name string SQL string ParamOIDs []uint32 Fields []FieldDescription } // Prepare creates a prepared statement. If the name is empty, the anonymous prepared statement will be used. This // allows Prepare to also to describe statements without creating a server-side prepared statement. // // Prepare does not send a PREPARE statement to the server. It uses the PostgreSQL Parse and Describe protocol messages // directly. // // In extremely rare cases, Prepare may fail after the Parse is successful, but before the Describe is complete. In this // case, the returned error will be an error where errors.As with a *PrepareError succeeds and the *PrepareError has // ParseComplete set to true. func (pgConn *PgConn) Prepare(ctx context.Context, name, sql string, paramOIDs []uint32) (*StatementDescription, error) { if err := pgConn.lock(); err != nil { return nil, err } defer pgConn.unlock() if ctx != context.Background() { select { case <-ctx.Done(): return nil, newContextAlreadyDoneError(ctx) default: } pgConn.contextWatcher.Watch(ctx) defer pgConn.contextWatcher.Unwatch() } pgConn.frontend.SendParse(&pgproto3.Parse{Name: name, Query: sql, ParameterOIDs: paramOIDs}) pgConn.frontend.SendDescribe(&pgproto3.Describe{ObjectType: 'S', Name: name}) pgConn.frontend.SendSync(&pgproto3.Sync{}) err := pgConn.flushWithPotentialWriteReadDeadlock() if err != nil { pgConn.asyncClose() return nil, err } psd := &StatementDescription{Name: name, SQL: sql} var ParseComplete bool var pgErr *PgError readloop: for { msg, err := pgConn.receiveMessage() if err != nil { pgConn.asyncClose() return nil, normalizeTimeoutError(ctx, err) } switch msg := msg.(type) { case *pgproto3.ParseComplete: ParseComplete = true case *pgproto3.ParameterDescription: psd.ParamOIDs = make([]uint32, len(msg.ParameterOIDs)) copy(psd.ParamOIDs, msg.ParameterOIDs) case *pgproto3.RowDescription: psd.Fields = pgConn.convertRowDescription(nil, msg) case *pgproto3.ErrorResponse: pgErr = ErrorResponseToPgError(msg) case *pgproto3.ReadyForQuery: break readloop } } if pgErr != nil { return nil, &PrepareError{err: pgErr, ParseComplete: ParseComplete} } return psd, nil } // Deallocate deallocates a prepared statement. // // Deallocate does not send a DEALLOCATE statement to the server. It uses the PostgreSQL Close protocol message // directly. This has slightly different behavior than executing DEALLOCATE statement. // - Deallocate can succeed in an aborted transaction. // - Deallocating a non-existent prepared statement is not an error. func (pgConn *PgConn) Deallocate(ctx context.Context, name string) error { if err := pgConn.lock(); err != nil { return err } defer pgConn.unlock() if ctx != context.Background() { select { case <-ctx.Done(): return newContextAlreadyDoneError(ctx) default: } pgConn.contextWatcher.Watch(ctx) defer pgConn.contextWatcher.Unwatch() } pgConn.frontend.SendClose(&pgproto3.Close{ObjectType: 'S', Name: name}) pgConn.frontend.SendSync(&pgproto3.Sync{}) err := pgConn.flushWithPotentialWriteReadDeadlock() if err != nil { pgConn.asyncClose() return err } for { msg, err := pgConn.receiveMessage() if err != nil { pgConn.asyncClose() return normalizeTimeoutError(ctx, err) } switch msg := msg.(type) { case *pgproto3.ErrorResponse: return ErrorResponseToPgError(msg) case *pgproto3.ReadyForQuery: return nil } } } // ErrorResponseToPgError converts a wire protocol error message to a *PgError. func ErrorResponseToPgError(msg *pgproto3.ErrorResponse) *PgError { return &PgError{ Severity: msg.Severity, SeverityUnlocalized: msg.SeverityUnlocalized, Code: string(msg.Code), Message: string(msg.Message), Detail: string(msg.Detail), Hint: msg.Hint, Position: msg.Position, InternalPosition: msg.InternalPosition, InternalQuery: string(msg.InternalQuery), Where: string(msg.Where), SchemaName: string(msg.SchemaName), TableName: string(msg.TableName), ColumnName: string(msg.ColumnName), DataTypeName: string(msg.DataTypeName), ConstraintName: msg.ConstraintName, File: string(msg.File), Line: msg.Line, Routine: string(msg.Routine), } } func noticeResponseToNotice(msg *pgproto3.NoticeResponse) *Notice { pgerr := ErrorResponseToPgError((*pgproto3.ErrorResponse)(msg)) return (*Notice)(pgerr) } // CancelRequest sends a cancel request to the PostgreSQL server. It returns an error if unable to deliver the cancel // request, but lack of an error does not ensure that the query was canceled. As specified in the documentation, there // is no way to be sure a query was canceled. // See https://www.postgresql.org/docs/current/protocol-flow.html#PROTOCOL-FLOW-CANCELING-REQUESTS func (pgConn *PgConn) CancelRequest(ctx context.Context) error { // Open a cancellation request to the same server. The address is taken from the net.Conn directly instead of reusing // the connection config. This is important in high availability configurations where fallback connections may be // specified or DNS may be used to load balance. serverAddr := pgConn.conn.RemoteAddr() var serverNetwork string var serverAddress string if serverAddr.Network() == "unix" { // for unix sockets, RemoteAddr() calls getpeername() which returns the name the // server passed to bind(). For Postgres, this is always a relative path "./.s.PGSQL.5432" // so connecting to it will fail. Fall back to the config's value serverNetwork, serverAddress = NetworkAddress(pgConn.config.Host, pgConn.config.Port) } else { serverNetwork, serverAddress = serverAddr.Network(), serverAddr.String() } cancelConn, err := pgConn.config.DialFunc(ctx, serverNetwork, serverAddress) if err != nil { // In case of unix sockets, RemoteAddr() returns only the file part of the path. If the // first connect failed, try the config. if serverAddr.Network() != "unix" { return err } serverNetwork, serverAddr := NetworkAddress(pgConn.config.Host, pgConn.config.Port) cancelConn, err = pgConn.config.DialFunc(ctx, serverNetwork, serverAddr) if err != nil { return err } } defer cancelConn.Close() if ctx != context.Background() { contextWatcher := ctxwatch.NewContextWatcher(&DeadlineContextWatcherHandler{Conn: cancelConn}) contextWatcher.Watch(ctx) defer contextWatcher.Unwatch() } buf := make([]byte, 16) binary.BigEndian.PutUint32(buf[0:4], 16) binary.BigEndian.PutUint32(buf[4:8], 80877102) binary.BigEndian.PutUint32(buf[8:12], pgConn.pid) binary.BigEndian.PutUint32(buf[12:16], pgConn.secretKey) if _, err := cancelConn.Write(buf); err != nil { return fmt.Errorf("write to connection for cancellation: %w", err) } // Wait for the cancel request to be acknowledged by the server. // It copies the behavior of the libpq: https://github.com/postgres/postgres/blob/REL_16_0/src/interfaces/libpq/fe-connect.c#L4946-L4960 _, _ = cancelConn.Read(buf) return nil } // WaitForNotification waits for a LISTEN/NOTIFY message to be received. It returns an error if a notification was not // received. func (pgConn *PgConn) WaitForNotification(ctx context.Context) error { if err := pgConn.lock(); err != nil { return err } defer pgConn.unlock() if ctx != context.Background() { select { case <-ctx.Done(): return newContextAlreadyDoneError(ctx) default: } pgConn.contextWatcher.Watch(ctx) defer pgConn.contextWatcher.Unwatch() } for { msg, err := pgConn.receiveMessage() if err != nil { return normalizeTimeoutError(ctx, err) } switch msg.(type) { case *pgproto3.NotificationResponse: return nil } } } // Exec executes SQL via the PostgreSQL simple query protocol. SQL may contain multiple queries. Execution is // implicitly wrapped in a transaction unless a transaction is already in progress or SQL contains transaction control // statements. // // Prefer ExecParams unless executing arbitrary SQL that may contain multiple queries. func (pgConn *PgConn) Exec(ctx context.Context, sql string) *MultiResultReader { if err := pgConn.lock(); err != nil { return &MultiResultReader{ closed: true, err: err, } } pgConn.multiResultReader = MultiResultReader{ pgConn: pgConn, ctx: ctx, } multiResult := &pgConn.multiResultReader if ctx != context.Background() { select { case <-ctx.Done(): multiResult.closed = true multiResult.err = newContextAlreadyDoneError(ctx) pgConn.unlock() return multiResult default: } pgConn.contextWatcher.Watch(ctx) } pgConn.frontend.SendQuery(&pgproto3.Query{String: sql}) err := pgConn.flushWithPotentialWriteReadDeadlock() if err != nil { pgConn.asyncClose() pgConn.contextWatcher.Unwatch() multiResult.closed = true multiResult.err = err pgConn.unlock() return multiResult } return multiResult } // ExecParams executes a command via the PostgreSQL extended query protocol. // // sql is a SQL command string. It may only contain one query. Parameter substitution is positional using $1, $2, $3, // etc. // // paramValues are the parameter values. It must be encoded in the format given by paramFormats. // // paramOIDs is a slice of data type OIDs for paramValues. If paramOIDs is nil, the server will infer the data type for // all parameters. Any paramOID element that is 0 that will cause the server to infer the data type for that parameter. // ExecParams will panic if len(paramOIDs) is not 0, 1, or len(paramValues). // // paramFormats is a slice of format codes determining for each paramValue column whether it is encoded in text or // binary format. If paramFormats is nil all params are text format. ExecParams will panic if // len(paramFormats) is not 0, 1, or len(paramValues). // // resultFormats is a slice of format codes determining for each result column whether it is encoded in text or // binary format. If resultFormats is nil all results will be in text format. // // ResultReader must be closed before PgConn can be used again. func (pgConn *PgConn) ExecParams(ctx context.Context, sql string, paramValues [][]byte, paramOIDs []uint32, paramFormats, resultFormats []int16) *ResultReader { result := pgConn.execExtendedPrefix(ctx, paramValues) if result.closed { return result } pgConn.frontend.SendParse(&pgproto3.Parse{Query: sql, ParameterOIDs: paramOIDs}) pgConn.frontend.SendBind(&pgproto3.Bind{ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats}) pgConn.execExtendedSuffix(result) return result } // ExecPrepared enqueues the execution of a prepared statement via the PostgreSQL extended query protocol. // // paramValues are the parameter values. It must be encoded in the format given by paramFormats. // // paramFormats is a slice of format codes determining for each paramValue column whether it is encoded in text or // binary format. If paramFormats is nil all params are text format. ExecPrepared will panic if // len(paramFormats) is not 0, 1, or len(paramValues). // // resultFormats is a slice of format codes determining for each result column whether it is encoded in text or // binary format. If resultFormats is nil all results will be in text format. // // ResultReader must be closed before PgConn can be used again. func (pgConn *PgConn) ExecPrepared(ctx context.Context, stmtName string, paramValues [][]byte, paramFormats, resultFormats []int16) *ResultReader { result := pgConn.execExtendedPrefix(ctx, paramValues) if result.closed { return result } pgConn.frontend.SendBind(&pgproto3.Bind{PreparedStatement: stmtName, ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats}) pgConn.execExtendedSuffix(result) return result } func (pgConn *PgConn) execExtendedPrefix(ctx context.Context, paramValues [][]byte) *ResultReader { pgConn.resultReader = ResultReader{ pgConn: pgConn, ctx: ctx, } result := &pgConn.resultReader if err := pgConn.lock(); err != nil { result.concludeCommand(CommandTag{}, err) result.closed = true return result } if len(paramValues) > math.MaxUint16 { result.concludeCommand(CommandTag{}, fmt.Errorf("extended protocol limited to %v parameters", math.MaxUint16)) result.closed = true pgConn.unlock() return result } if ctx != context.Background() { select { case <-ctx.Done(): result.concludeCommand(CommandTag{}, newContextAlreadyDoneError(ctx)) result.closed = true pgConn.unlock() return result default: } pgConn.contextWatcher.Watch(ctx) } return result } func (pgConn *PgConn) execExtendedSuffix(result *ResultReader) { pgConn.frontend.SendDescribe(&pgproto3.Describe{ObjectType: 'P'}) pgConn.frontend.SendExecute(&pgproto3.Execute{}) pgConn.frontend.SendSync(&pgproto3.Sync{}) err := pgConn.flushWithPotentialWriteReadDeadlock() if err != nil { pgConn.asyncClose() result.concludeCommand(CommandTag{}, err) pgConn.contextWatcher.Unwatch() result.closed = true pgConn.unlock() return } result.readUntilRowDescription() } // CopyTo executes the copy command sql and copies the results to w. func (pgConn *PgConn) CopyTo(ctx context.Context, w io.Writer, sql string) (CommandTag, error) { if err := pgConn.lock(); err != nil { return CommandTag{}, err } if ctx != context.Background() { select { case <-ctx.Done(): pgConn.unlock() return CommandTag{}, newContextAlreadyDoneError(ctx) default: } pgConn.contextWatcher.Watch(ctx) defer pgConn.contextWatcher.Unwatch() } // Send copy to command pgConn.frontend.SendQuery(&pgproto3.Query{String: sql}) err := pgConn.flushWithPotentialWriteReadDeadlock() if err != nil { pgConn.asyncClose() pgConn.unlock() return CommandTag{}, err } // Read results var commandTag CommandTag var pgErr error for { msg, err := pgConn.receiveMessage() if err != nil { pgConn.asyncClose() return CommandTag{}, normalizeTimeoutError(ctx, err) } switch msg := msg.(type) { case *pgproto3.CopyDone: case *pgproto3.CopyData: _, err := w.Write(msg.Data) if err != nil { pgConn.asyncClose() return CommandTag{}, err } case *pgproto3.ReadyForQuery: pgConn.unlock() return commandTag, pgErr case *pgproto3.CommandComplete: commandTag = pgConn.makeCommandTag(msg.CommandTag) case *pgproto3.ErrorResponse: pgErr = ErrorResponseToPgError(msg) } } } // CopyFrom executes the copy command sql and copies all of r to the PostgreSQL server. // // Note: context cancellation will only interrupt operations on the underlying PostgreSQL network connection. Reads on r // could still block. func (pgConn *PgConn) CopyFrom(ctx context.Context, r io.Reader, sql string) (CommandTag, error) { if err := pgConn.lock(); err != nil { return CommandTag{}, err } defer pgConn.unlock() if ctx != context.Background() { select { case <-ctx.Done(): return CommandTag{}, newContextAlreadyDoneError(ctx) default: } pgConn.contextWatcher.Watch(ctx) defer pgConn.contextWatcher.Unwatch() } // Send copy from query pgConn.frontend.SendQuery(&pgproto3.Query{String: sql}) err := pgConn.flushWithPotentialWriteReadDeadlock() if err != nil { pgConn.asyncClose() return CommandTag{}, err } // Send copy data abortCopyChan := make(chan struct{}) copyErrChan := make(chan error, 1) signalMessageChan := pgConn.signalMessage() var wg sync.WaitGroup wg.Add(1) go func() { defer wg.Done() buf := iobufpool.Get(65536) defer iobufpool.Put(buf) (*buf)[0] = 'd' for { n, readErr := r.Read((*buf)[5:cap(*buf)]) if n > 0 { *buf = (*buf)[0 : n+5] pgio.SetInt32((*buf)[1:], int32(n+4)) writeErr := pgConn.frontend.SendUnbufferedEncodedCopyData(*buf) if writeErr != nil { // Write errors are always fatal, but we can't use asyncClose because we are in a different goroutine. Not // setting pgConn.status or closing pgConn.cleanupDone for the same reason. pgConn.conn.Close() copyErrChan <- writeErr return } } if readErr != nil { copyErrChan <- readErr return } select { case <-abortCopyChan: return default: } } }() var pgErr error var copyErr error for copyErr == nil && pgErr == nil { select { case copyErr = <-copyErrChan: case <-signalMessageChan: // If pgConn.receiveMessage encounters an error it will call pgConn.asyncClose. But that is a race condition with // the goroutine. So instead check pgConn.bufferingReceiveErr which will have been set by the signalMessage. If an // error is found then forcibly close the connection without sending the Terminate message. if err := pgConn.bufferingReceiveErr; err != nil { pgConn.status = connStatusClosed pgConn.conn.Close() close(pgConn.cleanupDone) return CommandTag{}, normalizeTimeoutError(ctx, err) } // peekMessage never returns err in the bufferingReceive mode - it only forwards the bufferingReceive variables. // Therefore, the only case for receiveMessage to return err is during handling of the ErrorResponse message type // and using pgOnError handler to determine the connection is no longer valid (and thus closing the conn). msg, serverError := pgConn.receiveMessage() if serverError != nil { close(abortCopyChan) return CommandTag{}, serverError } switch msg := msg.(type) { case *pgproto3.ErrorResponse: pgErr = ErrorResponseToPgError(msg) default: signalMessageChan = pgConn.signalMessage() } } } close(abortCopyChan) // Make sure io goroutine finishes before writing. wg.Wait() if copyErr == io.EOF || pgErr != nil { pgConn.frontend.Send(&pgproto3.CopyDone{}) } else { pgConn.frontend.Send(&pgproto3.CopyFail{Message: copyErr.Error()}) } err = pgConn.flushWithPotentialWriteReadDeadlock() if err != nil { pgConn.asyncClose() return CommandTag{}, err } // Read results var commandTag CommandTag for { msg, err := pgConn.receiveMessage() if err != nil { pgConn.asyncClose() return CommandTag{}, normalizeTimeoutError(ctx, err) } switch msg := msg.(type) { case *pgproto3.ReadyForQuery: return commandTag, pgErr case *pgproto3.CommandComplete: commandTag = pgConn.makeCommandTag(msg.CommandTag) case *pgproto3.ErrorResponse: pgErr = ErrorResponseToPgError(msg) } } } // MultiResultReader is a reader for a command that could return multiple results such as Exec or ExecBatch. type MultiResultReader struct { pgConn *PgConn ctx context.Context rr *ResultReader closed bool err error } // ReadAll reads all available results. Calling ReadAll is mutually exclusive with all other MultiResultReader methods. func (mrr *MultiResultReader) ReadAll() ([]*Result, error) { var results []*Result for mrr.NextResult() { results = append(results, mrr.ResultReader().Read()) } err := mrr.Close() return results, err } func (mrr *MultiResultReader) receiveMessage() (pgproto3.BackendMessage, error) { msg, err := mrr.pgConn.receiveMessage() if err != nil { mrr.pgConn.contextWatcher.Unwatch() mrr.err = normalizeTimeoutError(mrr.ctx, err) mrr.closed = true mrr.pgConn.asyncClose() return nil, mrr.err } switch msg := msg.(type) { case *pgproto3.ReadyForQuery: mrr.closed = true mrr.pgConn.contextWatcher.Unwatch() mrr.pgConn.unlock() case *pgproto3.ErrorResponse: mrr.err = ErrorResponseToPgError(msg) } return msg, nil } // NextResult returns advances the MultiResultReader to the next result and returns true if a result is available. func (mrr *MultiResultReader) NextResult() bool { for !mrr.closed && mrr.err == nil { msg, err := mrr.receiveMessage() if err != nil { return false } switch msg := msg.(type) { case *pgproto3.RowDescription: mrr.pgConn.resultReader = ResultReader{ pgConn: mrr.pgConn, multiResultReader: mrr, ctx: mrr.ctx, fieldDescriptions: mrr.pgConn.convertRowDescription(mrr.pgConn.fieldDescriptions[:], msg), } mrr.rr = &mrr.pgConn.resultReader return true case *pgproto3.CommandComplete: mrr.pgConn.resultReader = ResultReader{ commandTag: mrr.pgConn.makeCommandTag(msg.CommandTag), commandConcluded: true, closed: true, } mrr.rr = &mrr.pgConn.resultReader return true case *pgproto3.EmptyQueryResponse: mrr.pgConn.resultReader = ResultReader{ commandConcluded: true, closed: true, } mrr.rr = &mrr.pgConn.resultReader return true } } return false } // ResultReader returns the current ResultReader. func (mrr *MultiResultReader) ResultReader() *ResultReader { return mrr.rr } // Close closes the MultiResultReader and returns the first error that occurred during the MultiResultReader's use. func (mrr *MultiResultReader) Close() error { for !mrr.closed { _, err := mrr.receiveMessage() if err != nil { return mrr.err } } return mrr.err } // ResultReader is a reader for the result of a single query. type ResultReader struct { pgConn *PgConn multiResultReader *MultiResultReader pipeline *Pipeline ctx context.Context fieldDescriptions []FieldDescription rowValues [][]byte commandTag CommandTag commandConcluded bool closed bool err error } // Result is the saved query response that is returned by calling Read on a ResultReader. type Result struct { FieldDescriptions []FieldDescription Rows [][][]byte CommandTag CommandTag Err error } // Read saves the query response to a Result. func (rr *ResultReader) Read() *Result { br := &Result{} for rr.NextRow() { if br.FieldDescriptions == nil { br.FieldDescriptions = make([]FieldDescription, len(rr.FieldDescriptions())) copy(br.FieldDescriptions, rr.FieldDescriptions()) } values := rr.Values() row := make([][]byte, len(values)) for i := range row { if values[i] != nil { row[i] = make([]byte, len(values[i])) copy(row[i], values[i]) } } br.Rows = append(br.Rows, row) } br.CommandTag, br.Err = rr.Close() return br } // NextRow advances the ResultReader to the next row and returns true if a row is available. func (rr *ResultReader) NextRow() bool { for !rr.commandConcluded { msg, err := rr.receiveMessage() if err != nil { return false } switch msg := msg.(type) { case *pgproto3.DataRow: rr.rowValues = msg.Values return true } } return false } // FieldDescriptions returns the field descriptions for the current result set. The returned slice is only valid until // the ResultReader is closed. It may return nil (for example, if the query did not return a result set or an error was // encountered.) func (rr *ResultReader) FieldDescriptions() []FieldDescription { return rr.fieldDescriptions } // Values returns the current row data. NextRow must have been previously been called. The returned [][]byte is only // valid until the next NextRow call or the ResultReader is closed. func (rr *ResultReader) Values() [][]byte { return rr.rowValues } // Close consumes any remaining result data and returns the command tag or // error. func (rr *ResultReader) Close() (CommandTag, error) { if rr.closed { return rr.commandTag, rr.err } rr.closed = true for !rr.commandConcluded { _, err := rr.receiveMessage() if err != nil { return CommandTag{}, rr.err } } if rr.multiResultReader == nil && rr.pipeline == nil { for { msg, err := rr.receiveMessage() if err != nil { return CommandTag{}, rr.err } switch msg := msg.(type) { // Detect a deferred constraint violation where the ErrorResponse is sent after CommandComplete. case *pgproto3.ErrorResponse: rr.err = ErrorResponseToPgError(msg) case *pgproto3.ReadyForQuery: rr.pgConn.contextWatcher.Unwatch() rr.pgConn.unlock() return rr.commandTag, rr.err } } } return rr.commandTag, rr.err } // readUntilRowDescription ensures the ResultReader's fieldDescriptions are loaded. It does not return an error as any // error will be stored in the ResultReader. func (rr *ResultReader) readUntilRowDescription() { for !rr.commandConcluded { // Peek before receive to avoid consuming a DataRow if the result set does not include a RowDescription method. // This should never happen under normal pgconn usage, but it is possible if SendBytes and ReceiveResults are // manually used to construct a query that does not issue a describe statement. msg, _ := rr.pgConn.peekMessage() if _, ok := msg.(*pgproto3.DataRow); ok { return } // Consume the message msg, _ = rr.receiveMessage() if _, ok := msg.(*pgproto3.RowDescription); ok { return } } } func (rr *ResultReader) receiveMessage() (msg pgproto3.BackendMessage, err error) { if rr.multiResultReader == nil { msg, err = rr.pgConn.receiveMessage() } else { msg, err = rr.multiResultReader.receiveMessage() } if err != nil { err = normalizeTimeoutError(rr.ctx, err) rr.concludeCommand(CommandTag{}, err) rr.pgConn.contextWatcher.Unwatch() rr.closed = true if rr.multiResultReader == nil { rr.pgConn.asyncClose() } return nil, rr.err } switch msg := msg.(type) { case *pgproto3.RowDescription: rr.fieldDescriptions = rr.pgConn.convertRowDescription(rr.pgConn.fieldDescriptions[:], msg) case *pgproto3.CommandComplete: rr.concludeCommand(rr.pgConn.makeCommandTag(msg.CommandTag), nil) case *pgproto3.EmptyQueryResponse: rr.concludeCommand(CommandTag{}, nil) case *pgproto3.ErrorResponse: pgErr := ErrorResponseToPgError(msg) if rr.pipeline != nil { rr.pipeline.state.HandleError(pgErr) } rr.concludeCommand(CommandTag{}, pgErr) } return msg, nil } func (rr *ResultReader) concludeCommand(commandTag CommandTag, err error) { // Keep the first error that is recorded. Store the error before checking if the command is already concluded to // allow for receiving an error after CommandComplete but before ReadyForQuery. if err != nil && rr.err == nil { rr.err = err } if rr.commandConcluded { return } rr.commandTag = commandTag rr.rowValues = nil rr.commandConcluded = true } // Batch is a collection of queries that can be sent to the PostgreSQL server in a single round-trip. type Batch struct { buf []byte err error } // ExecParams appends an ExecParams command to the batch. See PgConn.ExecParams for parameter descriptions. func (batch *Batch) ExecParams(sql string, paramValues [][]byte, paramOIDs []uint32, paramFormats, resultFormats []int16) { if batch.err != nil { return } batch.buf, batch.err = (&pgproto3.Parse{Query: sql, ParameterOIDs: paramOIDs}).Encode(batch.buf) if batch.err != nil { return } batch.ExecPrepared("", paramValues, paramFormats, resultFormats) } // ExecPrepared appends an ExecPrepared e command to the batch. See PgConn.ExecPrepared for parameter descriptions. func (batch *Batch) ExecPrepared(stmtName string, paramValues [][]byte, paramFormats, resultFormats []int16) { if batch.err != nil { return } batch.buf, batch.err = (&pgproto3.Bind{PreparedStatement: stmtName, ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats}).Encode(batch.buf) if batch.err != nil { return } batch.buf, batch.err = (&pgproto3.Describe{ObjectType: 'P'}).Encode(batch.buf) if batch.err != nil { return } batch.buf, batch.err = (&pgproto3.Execute{}).Encode(batch.buf) if batch.err != nil { return } } // ExecBatch executes all the queries in batch in a single round-trip. Execution is implicitly transactional unless a // transaction is already in progress or SQL contains transaction control statements. This is a simpler way of executing // multiple queries in a single round trip than using pipeline mode. func (pgConn *PgConn) ExecBatch(ctx context.Context, batch *Batch) *MultiResultReader { if batch.err != nil { return &MultiResultReader{ closed: true, err: batch.err, } } if err := pgConn.lock(); err != nil { return &MultiResultReader{ closed: true, err: err, } } pgConn.multiResultReader = MultiResultReader{ pgConn: pgConn, ctx: ctx, } multiResult := &pgConn.multiResultReader if ctx != context.Background() { select { case <-ctx.Done(): multiResult.closed = true multiResult.err = newContextAlreadyDoneError(ctx) pgConn.unlock() return multiResult default: } pgConn.contextWatcher.Watch(ctx) } batch.buf, batch.err = (&pgproto3.Sync{}).Encode(batch.buf) if batch.err != nil { pgConn.contextWatcher.Unwatch() multiResult.err = normalizeTimeoutError(multiResult.ctx, batch.err) multiResult.closed = true pgConn.asyncClose() return multiResult } pgConn.enterPotentialWriteReadDeadlock() defer pgConn.exitPotentialWriteReadDeadlock() _, err := pgConn.conn.Write(batch.buf) if err != nil { pgConn.contextWatcher.Unwatch() multiResult.err = normalizeTimeoutError(multiResult.ctx, err) multiResult.closed = true pgConn.asyncClose() return multiResult } return multiResult } // EscapeString escapes a string such that it can safely be interpolated into a SQL command string. It does not include // the surrounding single quotes. // // The current implementation requires that standard_conforming_strings=on and client_encoding="UTF8". If these // conditions are not met an error will be returned. It is possible these restrictions will be lifted in the future. func (pgConn *PgConn) EscapeString(s string) (string, error) { if pgConn.ParameterStatus("standard_conforming_strings") != "on" { return "", errors.New("EscapeString must be run with standard_conforming_strings=on") } if pgConn.ParameterStatus("client_encoding") != "UTF8" { return "", errors.New("EscapeString must be run with client_encoding=UTF8") } return strings.Replace(s, "'", "''", -1), nil } // CheckConn checks the underlying connection without writing any bytes. This is currently implemented by doing a read // with a very short deadline. This can be useful because a TCP connection can be broken such that a write will appear // to succeed even though it will never actually reach the server. Reading immediately before a write will detect this // condition. If this is done immediately before sending a query it reduces the chances a query will be sent that fails // without the client knowing whether the server received it or not. // // Deprecated: CheckConn is deprecated in favor of Ping. CheckConn cannot detect all types of broken connections where // the write would still appear to succeed. Prefer Ping unless on a high latency connection. func (pgConn *PgConn) CheckConn() error { ctx, cancel := context.WithTimeout(context.Background(), 1*time.Millisecond) defer cancel() _, err := pgConn.ReceiveMessage(ctx) if err != nil { if !Timeout(err) { return err } } return nil } // Ping pings the server. This can be useful because a TCP connection can be broken such that a write will appear to // succeed even though it will never actually reach the server. Pinging immediately before sending a query reduces the // chances a query will be sent that fails without the client knowing whether the server received it or not. func (pgConn *PgConn) Ping(ctx context.Context) error { return pgConn.Exec(ctx, "-- ping").Close() } // makeCommandTag makes a CommandTag. It does not retain a reference to buf or buf's underlying memory. func (pgConn *PgConn) makeCommandTag(buf []byte) CommandTag { return CommandTag{s: string(buf)} } // enterPotentialWriteReadDeadlock must be called before a write that could deadlock if the server is simultaneously // blocked writing to us. func (pgConn *PgConn) enterPotentialWriteReadDeadlock() { // The time to wait is somewhat arbitrary. A Write should only take as long as the syscall and memcpy to the OS // outbound network buffer unless the buffer is full (which potentially is a block). It needs to be long enough for // the normal case, but short enough not to kill performance if a block occurs. // // In addition, on Windows the default timer resolution is 15.6ms. So setting the timer to less than that is // ineffective. if pgConn.slowWriteTimer.Reset(15 * time.Millisecond) { panic("BUG: slow write timer already active") } } // exitPotentialWriteReadDeadlock must be called after a call to enterPotentialWriteReadDeadlock. func (pgConn *PgConn) exitPotentialWriteReadDeadlock() { if !pgConn.slowWriteTimer.Stop() { // The timer starts its function in a separate goroutine. It is necessary to ensure the background reader has // started before calling Stop. Otherwise, the background reader may not be stopped. That on its own is not a // serious problem. But what is a serious problem is that the background reader may start at an inopportune time in // a subsequent query. For example, if a subsequent query was canceled then a deadline may be set on the net.Conn to // interrupt an in-progress read. After the read is interrupted, but before the deadline is cleared, the background // reader could start and read a deadline error. Then the next query would receive the an unexpected deadline error. <-pgConn.bgReaderStarted pgConn.bgReader.Stop() } } func (pgConn *PgConn) flushWithPotentialWriteReadDeadlock() error { pgConn.enterPotentialWriteReadDeadlock() defer pgConn.exitPotentialWriteReadDeadlock() err := pgConn.frontend.Flush() return err } // SyncConn prepares the underlying net.Conn for direct use. PgConn may internally buffer reads or use goroutines for // background IO. This means that any direct use of the underlying net.Conn may be corrupted if a read is already // buffered or a read is in progress. SyncConn drains read buffers and stops background IO. In some cases this may // require sending a ping to the server. ctx can be used to cancel this operation. This should be called before any // operation that will use the underlying net.Conn directly. e.g. Before Conn() or Hijack(). // // This should not be confused with the PostgreSQL protocol Sync message. func (pgConn *PgConn) SyncConn(ctx context.Context) error { for range 10 { if pgConn.bgReader.Status() == bgreader.StatusStopped && pgConn.frontend.ReadBufferLen() == 0 { return nil } err := pgConn.Ping(ctx) if err != nil { return fmt.Errorf("SyncConn: Ping failed while syncing conn: %w", err) } } // This should never happen. Only way I can imagine this occurring is if the server is constantly sending data such as // LISTEN/NOTIFY or log notifications such that we never can get an empty buffer. return errors.New("SyncConn: conn never synchronized") } // CustomData returns a map that can be used to associate custom data with the connection. func (pgConn *PgConn) CustomData() map[string]any { return pgConn.customData } // HijackedConn is the result of hijacking a connection. // // Due to the necessary exposure of internal implementation details, it is not covered by the semantic versioning // compatibility. type HijackedConn struct { Conn net.Conn PID uint32 // backend pid SecretKey uint32 // key to use to send a cancel query message to the server ParameterStatuses map[string]string // parameters that have been reported by the server TxStatus byte Frontend *pgproto3.Frontend Config *Config CustomData map[string]any } // Hijack extracts the internal connection data. pgConn must be in an idle state. SyncConn should be called immediately // before Hijack. pgConn is unusable after hijacking. Hijacking is typically only useful when using pgconn to establish // a connection, but taking complete control of the raw connection after that (e.g. a load balancer or proxy). // // Due to the necessary exposure of internal implementation details, it is not covered by the semantic versioning // compatibility. func (pgConn *PgConn) Hijack() (*HijackedConn, error) { if err := pgConn.lock(); err != nil { return nil, err } pgConn.status = connStatusClosed return &HijackedConn{ Conn: pgConn.conn, PID: pgConn.pid, SecretKey: pgConn.secretKey, ParameterStatuses: pgConn.parameterStatuses, TxStatus: pgConn.txStatus, Frontend: pgConn.frontend, Config: pgConn.config, CustomData: pgConn.customData, }, nil } // Construct created a PgConn from an already established connection to a PostgreSQL server. This is the inverse of // PgConn.Hijack. The connection must be in an idle state. // // hc.Frontend is replaced by a new pgproto3.Frontend built by hc.Config.BuildFrontend. // // Due to the necessary exposure of internal implementation details, it is not covered by the semantic versioning // compatibility. func Construct(hc *HijackedConn) (*PgConn, error) { pgConn := &PgConn{ conn: hc.Conn, pid: hc.PID, secretKey: hc.SecretKey, parameterStatuses: hc.ParameterStatuses, txStatus: hc.TxStatus, frontend: hc.Frontend, config: hc.Config, customData: hc.CustomData, status: connStatusIdle, cleanupDone: make(chan struct{}), } pgConn.contextWatcher = ctxwatch.NewContextWatcher(hc.Config.BuildContextWatcherHandler(pgConn)) pgConn.bgReader = bgreader.New(pgConn.conn) pgConn.slowWriteTimer = time.AfterFunc(time.Duration(math.MaxInt64), func() { pgConn.bgReader.Start() pgConn.bgReaderStarted <- struct{}{} }, ) pgConn.slowWriteTimer.Stop() pgConn.bgReaderStarted = make(chan struct{}) pgConn.frontend = hc.Config.BuildFrontend(pgConn.bgReader, pgConn.conn) return pgConn, nil } // Pipeline represents a connection in pipeline mode. // // SendPrepare, SendQueryParams, and SendQueryPrepared queue requests to the server. These requests are not written until // pipeline is flushed by Flush or Sync. Sync must be called after the last request is queued. Requests between // synchronization points are implicitly transactional unless explicit transaction control statements have been issued. // // The context the pipeline was started with is in effect for the entire life of the Pipeline. // // For a deeper understanding of pipeline mode see the PostgreSQL documentation for the extended query protocol // (https://www.postgresql.org/docs/current/protocol-flow.html#PROTOCOL-FLOW-EXT-QUERY) and the libpq pipeline mode // (https://www.postgresql.org/docs/current/libpq-pipeline-mode.html). type Pipeline struct { conn *PgConn ctx context.Context state pipelineState err error closed bool } // PipelineSync is returned by GetResults when a ReadyForQuery message is received. type PipelineSync struct{} // CloseComplete is returned by GetResults when a CloseComplete message is received. type CloseComplete struct{} type pipelineRequestType int const ( pipelineNil pipelineRequestType = iota pipelinePrepare pipelineQueryParams pipelineQueryPrepared pipelineDeallocate pipelineSyncRequest pipelineFlushRequest ) type pipelineRequestEvent struct { RequestType pipelineRequestType WasSentToServer bool BeforeFlushOrSync bool } type pipelineState struct { requestEventQueue list.List lastRequestType pipelineRequestType pgErr *PgError expectedReadyForQueryCount int } func (s *pipelineState) Init() { s.requestEventQueue.Init() s.lastRequestType = pipelineNil } func (s *pipelineState) RegisterSendingToServer() { for elem := s.requestEventQueue.Back(); elem != nil; elem = elem.Prev() { val := elem.Value.(pipelineRequestEvent) if val.WasSentToServer { return } val.WasSentToServer = true elem.Value = val } } func (s *pipelineState) registerFlushingBufferOnServer() { for elem := s.requestEventQueue.Back(); elem != nil; elem = elem.Prev() { val := elem.Value.(pipelineRequestEvent) if val.BeforeFlushOrSync { return } val.BeforeFlushOrSync = true elem.Value = val } } func (s *pipelineState) PushBackRequestType(req pipelineRequestType) { if req == pipelineNil { return } if req != pipelineFlushRequest { s.requestEventQueue.PushBack(pipelineRequestEvent{RequestType: req}) } if req == pipelineFlushRequest || req == pipelineSyncRequest { s.registerFlushingBufferOnServer() } s.lastRequestType = req if req == pipelineSyncRequest { s.expectedReadyForQueryCount++ } } func (s *pipelineState) ExtractFrontRequestType() pipelineRequestType { for { elem := s.requestEventQueue.Front() if elem == nil { return pipelineNil } val := elem.Value.(pipelineRequestEvent) if !(val.WasSentToServer && val.BeforeFlushOrSync) { return pipelineNil } s.requestEventQueue.Remove(elem) if val.RequestType == pipelineSyncRequest { s.pgErr = nil } if s.pgErr == nil { return val.RequestType } } } func (s *pipelineState) HandleError(err *PgError) { s.pgErr = err } func (s *pipelineState) HandleReadyForQuery() { s.expectedReadyForQueryCount-- } func (s *pipelineState) PendingSync() bool { var notPendingSync bool if elem := s.requestEventQueue.Back(); elem != nil { val := elem.Value.(pipelineRequestEvent) notPendingSync = (val.RequestType == pipelineSyncRequest) && val.WasSentToServer } else { notPendingSync = (s.lastRequestType == pipelineSyncRequest) || (s.lastRequestType == pipelineNil) } return !notPendingSync } func (s *pipelineState) ExpectedReadyForQuery() int { return s.expectedReadyForQueryCount } // StartPipeline switches the connection to pipeline mode and returns a *Pipeline. In pipeline mode requests can be sent // to the server without waiting for a response. Close must be called on the returned *Pipeline to return the connection // to normal mode. While in pipeline mode, no methods that communicate with the server may be called except // CancelRequest and Close. ctx is in effect for entire life of the *Pipeline. // // Prefer ExecBatch when only sending one group of queries at once. func (pgConn *PgConn) StartPipeline(ctx context.Context) *Pipeline { if err := pgConn.lock(); err != nil { pipeline := &Pipeline{ closed: true, err: err, } pipeline.state.Init() return pipeline } pgConn.pipeline = Pipeline{ conn: pgConn, ctx: ctx, } pgConn.pipeline.state.Init() pipeline := &pgConn.pipeline if ctx != context.Background() { select { case <-ctx.Done(): pipeline.closed = true pipeline.err = newContextAlreadyDoneError(ctx) pgConn.unlock() return pipeline default: } pgConn.contextWatcher.Watch(ctx) } return pipeline } // SendPrepare is the pipeline version of *PgConn.Prepare. func (p *Pipeline) SendPrepare(name, sql string, paramOIDs []uint32) { if p.closed { return } p.conn.frontend.SendParse(&pgproto3.Parse{Name: name, Query: sql, ParameterOIDs: paramOIDs}) p.conn.frontend.SendDescribe(&pgproto3.Describe{ObjectType: 'S', Name: name}) p.state.PushBackRequestType(pipelinePrepare) } // SendDeallocate deallocates a prepared statement. func (p *Pipeline) SendDeallocate(name string) { if p.closed { return } p.conn.frontend.SendClose(&pgproto3.Close{ObjectType: 'S', Name: name}) p.state.PushBackRequestType(pipelineDeallocate) } // SendQueryParams is the pipeline version of *PgConn.QueryParams. func (p *Pipeline) SendQueryParams(sql string, paramValues [][]byte, paramOIDs []uint32, paramFormats, resultFormats []int16) { if p.closed { return } p.conn.frontend.SendParse(&pgproto3.Parse{Query: sql, ParameterOIDs: paramOIDs}) p.conn.frontend.SendBind(&pgproto3.Bind{ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats}) p.conn.frontend.SendDescribe(&pgproto3.Describe{ObjectType: 'P'}) p.conn.frontend.SendExecute(&pgproto3.Execute{}) p.state.PushBackRequestType(pipelineQueryParams) } // SendQueryPrepared is the pipeline version of *PgConn.QueryPrepared. func (p *Pipeline) SendQueryPrepared(stmtName string, paramValues [][]byte, paramFormats, resultFormats []int16) { if p.closed { return } p.conn.frontend.SendBind(&pgproto3.Bind{PreparedStatement: stmtName, ParameterFormatCodes: paramFormats, Parameters: paramValues, ResultFormatCodes: resultFormats}) p.conn.frontend.SendDescribe(&pgproto3.Describe{ObjectType: 'P'}) p.conn.frontend.SendExecute(&pgproto3.Execute{}) p.state.PushBackRequestType(pipelineQueryPrepared) } // SendFlushRequest sends a request for the server to flush its output buffer. // // The server flushes its output buffer automatically as a result of Sync being called, // or on any request when not in pipeline mode; this function is useful to cause the server // to flush its output buffer in pipeline mode without establishing a synchronization point. // Note that the request is not itself flushed to the server automatically; use Flush if // necessary. This copies the behavior of libpq PQsendFlushRequest. func (p *Pipeline) SendFlushRequest() { if p.closed { return } p.conn.frontend.Send(&pgproto3.Flush{}) p.state.PushBackRequestType(pipelineFlushRequest) } // SendPipelineSync marks a synchronization point in a pipeline by sending a sync message // without flushing the send buffer. This serves as the delimiter of an implicit // transaction and an error recovery point. // // Note that the request is not itself flushed to the server automatically; use Flush if // necessary. This copies the behavior of libpq PQsendPipelineSync. func (p *Pipeline) SendPipelineSync() { if p.closed { return } p.conn.frontend.SendSync(&pgproto3.Sync{}) p.state.PushBackRequestType(pipelineSyncRequest) } // Flush flushes the queued requests without establishing a synchronization point. func (p *Pipeline) Flush() error { if p.closed { if p.err != nil { return p.err } return errors.New("pipeline closed") } err := p.conn.flushWithPotentialWriteReadDeadlock() if err != nil { err = normalizeTimeoutError(p.ctx, err) p.conn.asyncClose() p.conn.contextWatcher.Unwatch() p.conn.unlock() p.closed = true p.err = err return err } p.state.RegisterSendingToServer() return nil } // Sync establishes a synchronization point and flushes the queued requests. func (p *Pipeline) Sync() error { p.SendPipelineSync() return p.Flush() } // GetResults gets the next results. If results are present, results may be a *ResultReader, *StatementDescription, or // *PipelineSync. If an ErrorResponse is received from the server, results will be nil and err will be a *PgError. If no // results are available, results and err will both be nil. func (p *Pipeline) GetResults() (results any, err error) { if p.closed { if p.err != nil { return nil, p.err } return nil, errors.New("pipeline closed") } if p.state.ExtractFrontRequestType() == pipelineNil { return nil, nil } return p.getResults() } func (p *Pipeline) getResults() (results any, err error) { for { msg, err := p.conn.receiveMessage() if err != nil { p.closed = true p.err = err p.conn.asyncClose() return nil, normalizeTimeoutError(p.ctx, err) } switch msg := msg.(type) { case *pgproto3.RowDescription: p.conn.resultReader = ResultReader{ pgConn: p.conn, pipeline: p, ctx: p.ctx, fieldDescriptions: p.conn.convertRowDescription(p.conn.fieldDescriptions[:], msg), } return &p.conn.resultReader, nil case *pgproto3.CommandComplete: p.conn.resultReader = ResultReader{ commandTag: p.conn.makeCommandTag(msg.CommandTag), commandConcluded: true, closed: true, } return &p.conn.resultReader, nil case *pgproto3.ParseComplete: peekedMsg, err := p.conn.peekMessage() if err != nil { p.conn.asyncClose() return nil, normalizeTimeoutError(p.ctx, err) } if _, ok := peekedMsg.(*pgproto3.ParameterDescription); ok { return p.getResultsPrepare() } case *pgproto3.CloseComplete: return &CloseComplete{}, nil case *pgproto3.ReadyForQuery: p.state.HandleReadyForQuery() return &PipelineSync{}, nil case *pgproto3.ErrorResponse: pgErr := ErrorResponseToPgError(msg) p.state.HandleError(pgErr) return nil, pgErr } } } func (p *Pipeline) getResultsPrepare() (*StatementDescription, error) { psd := &StatementDescription{} for { msg, err := p.conn.receiveMessage() if err != nil { p.conn.asyncClose() return nil, normalizeTimeoutError(p.ctx, err) } switch msg := msg.(type) { case *pgproto3.ParameterDescription: psd.ParamOIDs = make([]uint32, len(msg.ParameterOIDs)) copy(psd.ParamOIDs, msg.ParameterOIDs) case *pgproto3.RowDescription: psd.Fields = p.conn.convertRowDescription(nil, msg) return psd, nil // NoData is returned instead of RowDescription when there is no expected result. e.g. An INSERT without a RETURNING // clause. case *pgproto3.NoData: return psd, nil // These should never happen here. But don't take chances that could lead to a deadlock. case *pgproto3.ErrorResponse: pgErr := ErrorResponseToPgError(msg) p.state.HandleError(pgErr) return nil, pgErr case *pgproto3.CommandComplete: p.conn.asyncClose() return nil, errors.New("BUG: received CommandComplete while handling Describe") case *pgproto3.ReadyForQuery: p.conn.asyncClose() return nil, errors.New("BUG: received ReadyForQuery while handling Describe") } } } // Close closes the pipeline and returns the connection to normal mode. func (p *Pipeline) Close() error { if p.closed { return p.err } p.closed = true if p.state.PendingSync() { p.conn.asyncClose() p.err = errors.New("pipeline has unsynced requests") p.conn.contextWatcher.Unwatch() p.conn.unlock() return p.err } for p.state.ExpectedReadyForQuery() > 0 { _, err := p.getResults() if err != nil { p.err = err var pgErr *PgError if !errors.As(err, &pgErr) { p.conn.asyncClose() break } } } p.conn.contextWatcher.Unwatch() p.conn.unlock() return p.err } // DeadlineContextWatcherHandler handles canceled contexts by setting a deadline on a net.Conn. type DeadlineContextWatcherHandler struct { Conn net.Conn // DeadlineDelay is the delay to set on the deadline set on net.Conn when the context is canceled. DeadlineDelay time.Duration } func (h *DeadlineContextWatcherHandler) HandleCancel(ctx context.Context) { h.Conn.SetDeadline(time.Now().Add(h.DeadlineDelay)) } func (h *DeadlineContextWatcherHandler) HandleUnwatchAfterCancel() { h.Conn.SetDeadline(time.Time{}) } // CancelRequestContextWatcherHandler handles canceled contexts by sending a cancel request to the server. It also sets // a deadline on a net.Conn as a fallback. type CancelRequestContextWatcherHandler struct { Conn *PgConn // CancelRequestDelay is the delay before sending the cancel request to the server. CancelRequestDelay time.Duration // DeadlineDelay is the delay to set on the deadline set on net.Conn when the context is canceled. DeadlineDelay time.Duration cancelFinishedChan chan struct{} handleUnwatchAfterCancelCalled func() } func (h *CancelRequestContextWatcherHandler) HandleCancel(context.Context) { h.cancelFinishedChan = make(chan struct{}) var handleUnwatchedAfterCancelCalledCtx context.Context handleUnwatchedAfterCancelCalledCtx, h.handleUnwatchAfterCancelCalled = context.WithCancel(context.Background()) deadline := time.Now().Add(h.DeadlineDelay) h.Conn.conn.SetDeadline(deadline) go func() { defer close(h.cancelFinishedChan) select { case <-handleUnwatchedAfterCancelCalledCtx.Done(): return case <-time.After(h.CancelRequestDelay): } cancelRequestCtx, cancel := context.WithDeadline(handleUnwatchedAfterCancelCalledCtx, deadline) defer cancel() h.Conn.CancelRequest(cancelRequestCtx) // CancelRequest is inherently racy. Even though the cancel request has been received by the server at this point, // it hasn't necessarily been delivered to the other connection. If we immediately return and the connection is // immediately used then it is possible the CancelRequest will actually cancel our next query. The // TestCancelRequestContextWatcherHandler Stress test can produce this error without the sleep below. The sleep time // is arbitrary, but should be sufficient to prevent this error case. time.Sleep(100 * time.Millisecond) }() } func (h *CancelRequestContextWatcherHandler) HandleUnwatchAfterCancel() { h.handleUnwatchAfterCancelCalled() <-h.cancelFinishedChan h.Conn.conn.SetDeadline(time.Time{}) } pgx-5.8.0/pgconn/pgconn_private_test.go000066400000000000000000000030201512357711200202110ustar00rootroot00000000000000package pgconn import ( "testing" "github.com/stretchr/testify/assert" ) func TestCommandTag(t *testing.T) { t.Parallel() tests := []struct { commandTag CommandTag rowsAffected int64 isInsert bool isUpdate bool isDelete bool isSelect bool }{ {commandTag: CommandTag{s: "INSERT 0 5"}, rowsAffected: 5, isInsert: true}, {commandTag: CommandTag{s: "UPDATE 0"}, rowsAffected: 0, isUpdate: true}, {commandTag: CommandTag{s: "UPDATE 1"}, rowsAffected: 1, isUpdate: true}, {commandTag: CommandTag{s: "DELETE 0"}, rowsAffected: 0, isDelete: true}, {commandTag: CommandTag{s: "DELETE 1"}, rowsAffected: 1, isDelete: true}, {commandTag: CommandTag{s: "DELETE 1234567890"}, rowsAffected: 1234567890, isDelete: true}, {commandTag: CommandTag{s: "SELECT 1"}, rowsAffected: 1, isSelect: true}, {commandTag: CommandTag{s: "SELECT 99999999999"}, rowsAffected: 99999999999, isSelect: true}, {commandTag: CommandTag{s: "CREATE TABLE"}, rowsAffected: 0}, {commandTag: CommandTag{s: "ALTER TABLE"}, rowsAffected: 0}, {commandTag: CommandTag{s: "DROP TABLE"}, rowsAffected: 0}, } for i, tt := range tests { ct := tt.commandTag assert.Equalf(t, tt.rowsAffected, ct.RowsAffected(), "%d. %v", i, tt.commandTag) assert.Equalf(t, tt.isInsert, ct.Insert(), "%d. %v", i, tt.commandTag) assert.Equalf(t, tt.isUpdate, ct.Update(), "%d. %v", i, tt.commandTag) assert.Equalf(t, tt.isDelete, ct.Delete(), "%d. %v", i, tt.commandTag) assert.Equalf(t, tt.isSelect, ct.Select(), "%d. %v", i, tt.commandTag) } } pgx-5.8.0/pgconn/pgconn_stress_test.go000066400000000000000000000050121512357711200200650ustar00rootroot00000000000000package pgconn_test import ( "context" "math/rand/v2" "os" "runtime" "strconv" "testing" "github.com/jackc/pgx/v5/pgconn" "github.com/stretchr/testify/require" ) func TestConnStress(t *testing.T) { pgConn, err := pgconn.Connect(context.Background(), os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) actionCount := 10_000 if s := os.Getenv("PGX_TEST_STRESS_FACTOR"); s != "" { stressFactor, err := strconv.ParseInt(s, 10, 64) require.Nil(t, err, "Failed to parse PGX_TEST_STRESS_FACTOR") actionCount *= int(stressFactor) } setupStressDB(t, pgConn) actions := []struct { name string fn func(*pgconn.PgConn) error }{ {"Exec Select", stressExecSelect}, {"ExecParams Select", stressExecParamsSelect}, {"Batch", stressBatch}, } for i := 0; i < actionCount; i++ { action := actions[rand.IntN(len(actions))] err := action.fn(pgConn) require.Nilf(t, err, "%d: %s", i, action.name) } // Each call with a context starts a goroutine. Ensure they are cleaned up when context is not canceled. numGoroutine := runtime.NumGoroutine() require.Truef(t, numGoroutine < 1000, "goroutines appear to be orphaned: %d in process", numGoroutine) } func setupStressDB(t *testing.T, pgConn *pgconn.PgConn) { _, err := pgConn.Exec(context.Background(), ` create temporary table widgets( id serial primary key, name varchar not null, description text, creation_time timestamptz default now() ); insert into widgets(name, description) values ('Foo', 'bar'), ('baz', 'Something really long Something really long Something really long Something really long Something really long'), ('a', 'b')`).ReadAll() require.NoError(t, err) } func stressExecSelect(pgConn *pgconn.PgConn) error { ctx, cancel := context.WithCancel(context.Background()) defer cancel() _, err := pgConn.Exec(ctx, "select * from widgets").ReadAll() return err } func stressExecParamsSelect(pgConn *pgconn.PgConn) error { ctx, cancel := context.WithCancel(context.Background()) defer cancel() result := pgConn.ExecParams(ctx, "select * from widgets where id < $1", [][]byte{[]byte("10")}, nil, nil, nil).Read() return result.Err } func stressBatch(pgConn *pgconn.PgConn) error { ctx, cancel := context.WithCancel(context.Background()) defer cancel() batch := &pgconn.Batch{} batch.ExecParams("select * from widgets", nil, nil, nil, nil) batch.ExecParams("select * from widgets where id < $1", [][]byte{[]byte("10")}, nil, nil, nil) _, err := pgConn.ExecBatch(ctx, batch).ReadAll() return err } pgx-5.8.0/pgconn/pgconn_test.go000066400000000000000000003652121512357711200164750ustar00rootroot00000000000000package pgconn_test import ( "bytes" "compress/gzip" "context" "crypto/tls" "errors" "fmt" "io" "log" "math" "net" "os" "strconv" "strings" "sync/atomic" "testing" "time" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/internal/pgio" "github.com/jackc/pgx/v5/internal/pgmock" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgconn/ctxwatch" "github.com/jackc/pgx/v5/pgproto3" "github.com/jackc/pgx/v5/pgtype" ) const pgbouncerConnStringEnvVar = "PGX_TEST_PGBOUNCER_CONN_STRING" func TestConnect(t *testing.T) { tests := []struct { name string env string }{ {"Unix socket", "PGX_TEST_UNIX_SOCKET_CONN_STRING"}, {"TCP", "PGX_TEST_TCP_CONN_STRING"}, {"Plain password", "PGX_TEST_PLAIN_PASSWORD_CONN_STRING"}, {"MD5 password", "PGX_TEST_MD5_PASSWORD_CONN_STRING"}, {"SCRAM password", "PGX_TEST_SCRAM_PASSWORD_CONN_STRING"}, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() connString := os.Getenv(tt.env) if connString == "" { t.Skipf("Skipping due to missing environment variable %v", tt.env) } conn, err := pgconn.Connect(ctx, connString) require.NoError(t, err) closeConn(t, conn) }) } } func TestConnectWithOptions(t *testing.T) { tests := []struct { name string env string }{ {"Unix socket", "PGX_TEST_UNIX_SOCKET_CONN_STRING"}, {"TCP", "PGX_TEST_TCP_CONN_STRING"}, {"Plain password", "PGX_TEST_PLAIN_PASSWORD_CONN_STRING"}, {"MD5 password", "PGX_TEST_MD5_PASSWORD_CONN_STRING"}, {"SCRAM password", "PGX_TEST_SCRAM_PASSWORD_CONN_STRING"}, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() connString := os.Getenv(tt.env) if connString == "" { t.Skipf("Skipping due to missing environment variable %v", tt.env) } var sslOptions pgconn.ParseConfigOptions sslOptions.GetSSLPassword = GetSSLPassword conn, err := pgconn.ConnectWithOptions(ctx, connString, sslOptions) require.NoError(t, err) closeConn(t, conn) }) } } // TestConnectTLS is separate from other connect tests because it has an additional test to ensure it really is a secure // connection. func TestConnectTLS(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() connString := os.Getenv("PGX_TEST_TLS_CONN_STRING") if connString == "" { t.Skipf("Skipping due to missing environment variable %v", "PGX_TEST_TLS_CONN_STRING") } conn, err := pgconn.Connect(ctx, connString) require.NoError(t, err) result := conn.ExecParams(ctx, `select ssl from pg_stat_ssl where pg_backend_pid() = pid;`, nil, nil, nil, nil).Read() require.NoError(t, result.Err) require.Len(t, result.Rows, 1) require.Len(t, result.Rows[0], 1) require.Equalf(t, "t", string(result.Rows[0][0]), "not a TLS connection") closeConn(t, conn) } func TestConnectTLSPasswordProtectedClientCertWithSSLPassword(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() connString := os.Getenv("PGX_TEST_TLS_CLIENT_CONN_STRING") if connString == "" { t.Skipf("Skipping due to missing environment variable %v", "PGX_TEST_TLS_CLIENT_CONN_STRING") } if os.Getenv("PGX_SSL_PASSWORD") == "" { t.Skipf("Skipping due to missing environment variable %v", "PGX_SSL_PASSWORD") } connString += " sslpassword=" + os.Getenv("PGX_SSL_PASSWORD") conn, err := pgconn.Connect(ctx, connString) require.NoError(t, err) result := conn.ExecParams(ctx, `select ssl from pg_stat_ssl where pg_backend_pid() = pid;`, nil, nil, nil, nil).Read() require.NoError(t, result.Err) require.Len(t, result.Rows, 1) require.Len(t, result.Rows[0], 1) require.Equalf(t, "t", string(result.Rows[0][0]), "not a TLS connection") closeConn(t, conn) } func TestConnectTLSPasswordProtectedClientCertWithGetSSLPasswordConfigOption(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() connString := os.Getenv("PGX_TEST_TLS_CLIENT_CONN_STRING") if connString == "" { t.Skipf("Skipping due to missing environment variable %v", "PGX_TEST_TLS_CLIENT_CONN_STRING") } if os.Getenv("PGX_SSL_PASSWORD") == "" { t.Skipf("Skipping due to missing environment variable %v", "PGX_SSL_PASSWORD") } var sslOptions pgconn.ParseConfigOptions sslOptions.GetSSLPassword = GetSSLPassword config, err := pgconn.ParseConfigWithOptions(connString, sslOptions) require.Nil(t, err) conn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) result := conn.ExecParams(ctx, `select ssl from pg_stat_ssl where pg_backend_pid() = pid;`, nil, nil, nil, nil).Read() require.NoError(t, result.Err) require.Len(t, result.Rows, 1) require.Len(t, result.Rows[0], 1) require.Equalf(t, "t", string(result.Rows[0][0]), "not a TLS connection") closeConn(t, conn) } type pgmockWaitStep time.Duration func (s pgmockWaitStep) Step(*pgproto3.Backend) error { time.Sleep(time.Duration(s)) return nil } func TestConnectTimeout(t *testing.T) { t.Parallel() tests := []struct { name string connect func(connStr string) error }{ { name: "via context that times out", connect: func(connStr string) error { ctx, cancel := context.WithTimeout(context.Background(), time.Millisecond*50) defer cancel() _, err := pgconn.Connect(ctx, connStr) return err }, }, { name: "via config ConnectTimeout", connect: func(connStr string) error { conf, err := pgconn.ParseConfig(connStr) require.NoError(t, err) conf.ConnectTimeout = time.Microsecond * 50 _, err = pgconn.ConnectConfig(context.Background(), conf) return err }, }, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { t.Parallel() script := &pgmock.Script{ Steps: []pgmock.Step{ pgmock.ExpectAnyMessage(&pgproto3.StartupMessage{ProtocolVersion: pgproto3.ProtocolVersionNumber, Parameters: map[string]string{}}), pgmock.SendMessage(&pgproto3.AuthenticationOk{}), pgmockWaitStep(time.Millisecond * 500), pgmock.SendMessage(&pgproto3.BackendKeyData{ProcessID: 0, SecretKey: 0}), pgmock.SendMessage(&pgproto3.ReadyForQuery{TxStatus: 'I'}), }, } ln, err := net.Listen("tcp", "127.0.0.1:") require.NoError(t, err) defer ln.Close() serverErrChan := make(chan error, 1) go func() { defer close(serverErrChan) conn, err := ln.Accept() if err != nil { serverErrChan <- err return } defer conn.Close() err = conn.SetDeadline(time.Now().Add(time.Millisecond * 450)) if err != nil { serverErrChan <- err return } err = script.Run(pgproto3.NewBackend(conn, conn)) if err != nil { serverErrChan <- err return } }() host, port, _ := strings.Cut(ln.Addr().String(), ":") connStr := fmt.Sprintf("sslmode=disable host=%s port=%s", host, port) tooLate := time.Now().Add(time.Millisecond * 500) err = tt.connect(connStr) require.True(t, pgconn.Timeout(err), err) require.True(t, time.Now().Before(tooLate)) }) } } func TestConnectTimeoutStuckOnTLSHandshake(t *testing.T) { t.Parallel() tests := []struct { name string connect func(connStr string) error }{ { name: "via context that times out", connect: func(connStr string) error { ctx, cancel := context.WithTimeout(context.Background(), time.Millisecond*10) defer cancel() _, err := pgconn.Connect(ctx, connStr) return err }, }, { name: "via config ConnectTimeout", connect: func(connStr string) error { conf, err := pgconn.ParseConfig(connStr) require.NoError(t, err) conf.ConnectTimeout = time.Millisecond * 10 _, err = pgconn.ConnectConfig(context.Background(), conf) return err }, }, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { t.Parallel() ln, err := net.Listen("tcp", "127.0.0.1:") require.NoError(t, err) defer ln.Close() serverErrChan := make(chan error, 1) go func() { conn, err := ln.Accept() if err != nil { serverErrChan <- err return } defer conn.Close() var buf []byte _, err = conn.Read(buf) if err != nil { serverErrChan <- err return } // Sleeping to hang the TLS handshake. time.Sleep(time.Minute) }() host, port, _ := strings.Cut(ln.Addr().String(), ":") connStr := fmt.Sprintf("host=%s port=%s", host, port) errChan := make(chan error) go func() { err := tt.connect(connStr) errChan <- err }() select { case err = <-errChan: require.True(t, pgconn.Timeout(err), err) case err = <-serverErrChan: t.Fatalf("server failed with error: %s", err) case <-time.After(time.Millisecond * 500): t.Fatal("exceeded connection timeout without erroring out") } }) } } func TestConnectInvalidUser(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() connString := os.Getenv("PGX_TEST_TCP_CONN_STRING") if connString == "" { t.Skipf("Skipping due to missing environment variable %v", "PGX_TEST_TCP_CONN_STRING") } config, err := pgconn.ParseConfig(connString) require.NoError(t, err) config.User = "pgxinvalidusertest" _, err = pgconn.ConnectConfig(ctx, config) require.Error(t, err) var pgErr *pgconn.PgError require.ErrorAs(t, err, &pgErr) if pgErr.Code != "28000" && pgErr.Code != "28P01" { t.Fatalf("Expected to receive a PgError with code 28000 or 28P01, instead received: %v", pgErr) } } func TestConnectWithConnectionRefused(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() // Presumably nothing is listening on 127.0.0.1:1 conn, err := pgconn.Connect(ctx, "host=127.0.0.1 port=1") if err == nil { conn.Close(ctx) t.Fatal("Expected error establishing connection to bad port") } } func TestConnectCustomDialer(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) dialed := false config.DialFunc = func(ctx context.Context, network, address string) (net.Conn, error) { dialed = true return net.Dial(network, address) } conn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) require.True(t, dialed) closeConn(t, conn) } func TestConnectCustomLookup(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() connString := os.Getenv("PGX_TEST_TCP_CONN_STRING") if connString == "" { t.Skipf("Skipping due to missing environment variable %v", "PGX_TEST_TCP_CONN_STRING") } config, err := pgconn.ParseConfig(connString) require.NoError(t, err) looked := false config.LookupFunc = func(ctx context.Context, host string) (addrs []string, err error) { looked = true return net.LookupHost(host) } conn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) require.True(t, looked) closeConn(t, conn) } func TestConnectCustomLookupWithPort(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() connString := os.Getenv("PGX_TEST_TCP_CONN_STRING") if connString == "" { t.Skipf("Skipping due to missing environment variable %v", "PGX_TEST_TCP_CONN_STRING") } config, err := pgconn.ParseConfig(connString) require.NoError(t, err) origPort := config.Port // Change the config an invalid port so it will fail if used config.Port = 0 looked := false config.LookupFunc = func(ctx context.Context, host string) ([]string, error) { looked = true addrs, err := net.LookupHost(host) if err != nil { return nil, err } for i := range addrs { addrs[i] = net.JoinHostPort(addrs[i], strconv.FormatUint(uint64(origPort), 10)) } return addrs, nil } conn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) require.True(t, looked) closeConn(t, conn) } func TestConnectWithRuntimeParams(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.RuntimeParams = map[string]string{ "application_name": "pgxtest", "search_path": "myschema", } conn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) defer closeConn(t, conn) result := conn.ExecParams(ctx, "show application_name", nil, nil, nil, nil).Read() require.Nil(t, result.Err) assert.Equal(t, 1, len(result.Rows)) assert.Equal(t, "pgxtest", string(result.Rows[0][0])) result = conn.ExecParams(ctx, "show search_path", nil, nil, nil, nil).Read() require.Nil(t, result.Err) assert.Equal(t, 1, len(result.Rows)) assert.Equal(t, "myschema", string(result.Rows[0][0])) } func TestConnectWithFallback(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) // Prepend current primary config to fallbacks config.Fallbacks = append([]*pgconn.FallbackConfig{ { Host: config.Host, Port: config.Port, TLSConfig: config.TLSConfig, }, }, config.Fallbacks...) // Make primary config bad config.Host = "localhost" config.Port = 1 // presumably nothing listening here // Prepend bad first fallback config.Fallbacks = append([]*pgconn.FallbackConfig{ { Host: "localhost", Port: 1, TLSConfig: config.TLSConfig, }, }, config.Fallbacks...) conn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) closeConn(t, conn) } func TestConnectFailsWithResolveFailureAndFailedConnectionAttempts(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 10*time.Second) defer cancel() conn, err := pgconn.Connect(ctx, "host=localhost,127.0.0.1,foo.invalid port=1,2,3 sslmode=disable") require.Error(t, err) require.Nil(t, conn) require.ErrorContains(t, err, "lookup foo.invalid") // Not testing the entire string as depending on IPv4 or IPv6 support localhost may resolve to 127.0.0.1 or ::1. require.ErrorContains(t, err, ":1 (localhost): dial error:") require.ErrorContains(t, err, ":2 (127.0.0.1): dial error:") } type testConnWrapper struct { conn net.Conn } func (w *testConnWrapper) Read(b []byte) (n int, err error) { return w.conn.Read(b) } func (w *testConnWrapper) Write(b []byte) (n int, err error) { return w.conn.Write(b) } func (w *testConnWrapper) Close() error { return w.conn.Close() } func (w *testConnWrapper) LocalAddr() net.Addr { return w.conn.LocalAddr() } func (w *testConnWrapper) RemoteAddr() net.Addr { return w.conn.RemoteAddr() } func (w *testConnWrapper) SetDeadline(t time.Time) error { return w.conn.SetDeadline(t) } func (w *testConnWrapper) SetReadDeadline(t time.Time) error { return w.conn.SetReadDeadline(t) } func (w *testConnWrapper) SetWriteDeadline(t time.Time) error { return w.conn.SetWriteDeadline(t) } func TestConnectWithAfterNetConnect(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) var wrappedConn net.Conn config.AfterNetConnect = func(ctx context.Context, config *pgconn.Config, conn net.Conn) (net.Conn, error) { wrappedConn = &testConnWrapper{conn: conn} return wrappedConn, nil } conn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) require.Equal(t, wrappedConn, conn.Conn()) closeConn(t, conn) } func TestConnectWithValidateConnect(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) dialCount := 0 config.DialFunc = func(ctx context.Context, network, address string) (net.Conn, error) { dialCount++ return net.Dial(network, address) } acceptConnCount := 0 config.ValidateConnect = func(ctx context.Context, conn *pgconn.PgConn) error { acceptConnCount++ if acceptConnCount < 2 { return errors.New("reject first conn") } return nil } // Append current primary config to fallbacks config.Fallbacks = append(config.Fallbacks, &pgconn.FallbackConfig{ Host: config.Host, Port: config.Port, TLSConfig: config.TLSConfig, }) // Repeat fallbacks config.Fallbacks = append(config.Fallbacks, config.Fallbacks...) conn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) closeConn(t, conn) assert.True(t, dialCount > 1) assert.True(t, acceptConnCount > 1) } func TestConnectWithValidateConnectTargetSessionAttrsReadWrite(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.ValidateConnect = pgconn.ValidateConnectTargetSessionAttrsReadWrite config.RuntimeParams["default_transaction_read_only"] = "on" conn, err := pgconn.ConnectConfig(ctx, config) if !assert.NotNil(t, err) { conn.Close(ctx) } } func TestConnectWithAfterConnect(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.AfterConnect = func(ctx context.Context, conn *pgconn.PgConn) error { _, err := conn.Exec(ctx, "set search_path to foobar;").ReadAll() return err } conn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) results, err := conn.Exec(ctx, "show search_path;").ReadAll() require.NoError(t, err) defer closeConn(t, conn) assert.Equal(t, []byte("foobar"), results[0].Rows[0][0]) } func TestConnectConfigRequiresConfigFromParseConfig(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config := &pgconn.Config{} require.PanicsWithValue(t, "config must be created by ParseConfig", func() { pgconn.ConnectConfig(ctx, config) }) } func TestConnPrepareSyntaxError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) psd, err := pgConn.Prepare(ctx, "ps1", "SYNTAX ERROR", nil) require.Nil(t, psd) require.NotNil(t, err) ensureConnValid(t, pgConn) } func TestConnPrepareContextPrecanceled(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) cancel() psd, err := pgConn.Prepare(ctx, "ps1", "select 1", nil) assert.Nil(t, psd) assert.Error(t, err) assert.True(t, errors.Is(err, context.Canceled)) assert.True(t, pgconn.SafeToRetry(err)) ensureConnValid(t, pgConn) } func TestConnDeallocate(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) _, err = pgConn.Prepare(ctx, "ps1", "select 1", nil) require.NoError(t, err) _, err = pgConn.ExecPrepared(ctx, "ps1", nil, nil, nil).Close() require.NoError(t, err) err = pgConn.Deallocate(ctx, "ps1") require.NoError(t, err) _, err = pgConn.ExecPrepared(ctx, "ps1", nil, nil, nil).Close() require.Error(t, err) var pgErr *pgconn.PgError require.ErrorAs(t, err, &pgErr) require.Equal(t, "26000", pgErr.Code) ensureConnValid(t, pgConn) } func TestConnDeallocateSucceedsInAbortedTransaction(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) err = pgConn.Exec(ctx, "begin").Close() require.NoError(t, err) _, err = pgConn.Prepare(ctx, "ps1", "select 1", nil) require.NoError(t, err) _, err = pgConn.ExecPrepared(ctx, "ps1", nil, nil, nil).Close() require.NoError(t, err) err = pgConn.Exec(ctx, "select 1/0").Close() // break transaction with divide by 0 error require.Error(t, err) var pgErr *pgconn.PgError require.ErrorAs(t, err, &pgErr) require.Equal(t, "22012", pgErr.Code) err = pgConn.Deallocate(ctx, "ps1") require.NoError(t, err) err = pgConn.Exec(ctx, "rollback").Close() require.NoError(t, err) _, err = pgConn.ExecPrepared(ctx, "ps1", nil, nil, nil).Close() require.Error(t, err) require.ErrorAs(t, err, &pgErr) require.Equal(t, "26000", pgErr.Code) ensureConnValid(t, pgConn) } func TestConnDeallocateNonExistantStatementSucceeds(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) err = pgConn.Deallocate(ctx, "ps1") require.NoError(t, err) ensureConnValid(t, pgConn) } func TestConnExec(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) results, err := pgConn.Exec(ctx, "select 'Hello, world'").ReadAll() assert.NoError(t, err) assert.Len(t, results, 1) assert.Nil(t, results[0].Err) assert.Equal(t, "SELECT 1", results[0].CommandTag.String()) assert.Len(t, results[0].Rows, 1) assert.Equal(t, "Hello, world", string(results[0].Rows[0][0])) ensureConnValid(t, pgConn) } func TestConnExecEmpty(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) results, err := pgConn.Exec(ctx, ";").ReadAll() require.NoError(t, err) require.Len(t, results, 1) require.Nil(t, results[0].Err) require.Equal(t, "", results[0].CommandTag.String()) require.Nil(t, results[0].FieldDescriptions) ensureConnValid(t, pgConn) } func TestConnExecMultipleQueries(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) results, err := pgConn.Exec(ctx, "select 'Hello, world'; select 1").ReadAll() assert.NoError(t, err) assert.Len(t, results, 2) assert.Nil(t, results[0].Err) assert.Equal(t, "SELECT 1", results[0].CommandTag.String()) assert.Len(t, results[0].Rows, 1) assert.Equal(t, "Hello, world", string(results[0].Rows[0][0])) assert.Nil(t, results[1].Err) assert.Equal(t, "SELECT 1", results[1].CommandTag.String()) assert.Len(t, results[1].Rows, 1) assert.Equal(t, "1", string(results[1].Rows[0][0])) ensureConnValid(t, pgConn) } func TestConnExecMultipleQueriesEagerFieldDescriptions(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) mrr := pgConn.Exec(ctx, "select 'Hello, world' as msg; select 1 as num") require.True(t, mrr.NextResult()) require.Len(t, mrr.ResultReader().FieldDescriptions(), 1) assert.Equal(t, "msg", mrr.ResultReader().FieldDescriptions()[0].Name) _, err = mrr.ResultReader().Close() require.NoError(t, err) require.True(t, mrr.NextResult()) require.Len(t, mrr.ResultReader().FieldDescriptions(), 1) assert.Equal(t, "num", mrr.ResultReader().FieldDescriptions()[0].Name) _, err = mrr.ResultReader().Close() require.NoError(t, err) require.False(t, mrr.NextResult()) require.NoError(t, mrr.Close()) ensureConnValid(t, pgConn) } func TestConnExecMultipleQueriesError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) results, err := pgConn.Exec(ctx, "select 1; select 1/0; select 1").ReadAll() require.NotNil(t, err) if pgErr, ok := err.(*pgconn.PgError); ok { assert.Equal(t, "22012", pgErr.Code) } else { t.Errorf("unexpected error: %v", err) } if pgConn.ParameterStatus("crdb_version") != "" { // CockroachDB starts the second query result set and then sends the divide by zero error. require.Len(t, results, 2) assert.Len(t, results[0].Rows, 1) assert.Equal(t, "1", string(results[0].Rows[0][0])) assert.Len(t, results[1].Rows, 0) } else { // PostgreSQL sends the divide by zero and never sends the second query result set. require.Len(t, results, 1) assert.Len(t, results[0].Rows, 1) assert.Equal(t, "1", string(results[0].Rows[0][0])) } ensureConnValid(t, pgConn) } func TestConnExecDeferredError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Server does not support deferred constraint (https://github.com/cockroachdb/cockroach/issues/31632)") } setupSQL := `create temporary table t ( id text primary key, n int not null, unique (n) deferrable initially deferred ); insert into t (id, n) values ('a', 1), ('b', 2), ('c', 3);` _, err = pgConn.Exec(ctx, setupSQL).ReadAll() assert.NoError(t, err) _, err = pgConn.Exec(ctx, `update t set n=n+1 where id='b' returning *`).ReadAll() require.NotNil(t, err) var pgErr *pgconn.PgError require.True(t, errors.As(err, &pgErr)) require.Equal(t, "23505", pgErr.Code) ensureConnValid(t, pgConn) } func TestConnExecContextCanceled(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) cancel() ctx, cancel = context.WithTimeout(context.Background(), 100*time.Millisecond) defer cancel() multiResult := pgConn.Exec(ctx, "select 'Hello, world', pg_sleep(1)") for multiResult.NextResult() { } err = multiResult.Close() assert.True(t, pgconn.Timeout(err)) assert.ErrorIs(t, err, context.DeadlineExceeded) assert.True(t, pgConn.IsClosed()) select { case <-pgConn.CleanupDone(): case <-time.After(5 * time.Second): t.Fatal("Connection cleanup exceeded maximum time") } } func TestConnExecContextPrecanceled(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) cancel() _, err = pgConn.Exec(ctx, "select 'Hello, world'").ReadAll() assert.Error(t, err) assert.True(t, errors.Is(err, context.Canceled)) assert.True(t, pgconn.SafeToRetry(err)) ensureConnValid(t, pgConn) } func TestConnExecParams(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) result := pgConn.ExecParams(ctx, "select $1::text as msg", [][]byte{[]byte("Hello, world")}, nil, nil, nil) require.Len(t, result.FieldDescriptions(), 1) assert.Equal(t, "msg", result.FieldDescriptions()[0].Name) rowCount := 0 for result.NextRow() { rowCount += 1 assert.Equal(t, "Hello, world", string(result.Values()[0])) } assert.Equal(t, 1, rowCount) commandTag, err := result.Close() assert.Equal(t, "SELECT 1", commandTag.String()) assert.NoError(t, err) ensureConnValid(t, pgConn) } func TestConnExecParamsDeferredError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Server does not support deferred constraint (https://github.com/cockroachdb/cockroach/issues/31632)") } setupSQL := `create temporary table t ( id text primary key, n int not null, unique (n) deferrable initially deferred ); insert into t (id, n) values ('a', 1), ('b', 2), ('c', 3);` _, err = pgConn.Exec(ctx, setupSQL).ReadAll() assert.NoError(t, err) result := pgConn.ExecParams(ctx, `update t set n=n+1 where id='b' returning *`, nil, nil, nil, nil).Read() require.NotNil(t, result.Err) var pgErr *pgconn.PgError require.True(t, errors.As(result.Err, &pgErr)) require.Equal(t, "23505", pgErr.Code) ensureConnValid(t, pgConn) } func TestConnExecParamsMaxNumberOfParams(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) paramCount := math.MaxUint16 params := make([]string, 0, paramCount) args := make([][]byte, 0, paramCount) for i := range paramCount { params = append(params, fmt.Sprintf("($%d::text)", i+1)) args = append(args, []byte(strconv.Itoa(i))) } sql := "values" + strings.Join(params, ", ") result := pgConn.ExecParams(ctx, sql, args, nil, nil, nil).Read() require.NoError(t, result.Err) require.Len(t, result.Rows, paramCount) ensureConnValid(t, pgConn) } func TestConnExecParamsTooManyParams(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) paramCount := math.MaxUint16 + 1 params := make([]string, 0, paramCount) args := make([][]byte, 0, paramCount) for i := range paramCount { params = append(params, fmt.Sprintf("($%d::text)", i+1)) args = append(args, []byte(strconv.Itoa(i))) } sql := "values" + strings.Join(params, ", ") result := pgConn.ExecParams(ctx, sql, args, nil, nil, nil).Read() require.Error(t, result.Err) require.Equal(t, "extended protocol limited to 65535 parameters", result.Err.Error()) ensureConnValid(t, pgConn) } func TestConnExecParamsCanceled(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) ctx, cancel = context.WithTimeout(ctx, 100*time.Millisecond) defer cancel() result := pgConn.ExecParams(ctx, "select current_database(), pg_sleep(1)", nil, nil, nil, nil) rowCount := 0 for result.NextRow() { rowCount += 1 } assert.Equal(t, 0, rowCount) commandTag, err := result.Close() assert.Equal(t, pgconn.CommandTag{}, commandTag) assert.True(t, pgconn.Timeout(err)) assert.ErrorIs(t, err, context.DeadlineExceeded) assert.True(t, pgConn.IsClosed()) select { case <-pgConn.CleanupDone(): case <-time.After(5 * time.Second): t.Fatal("Connection cleanup exceeded maximum time") } } func TestConnExecParamsPrecanceled(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) cancel() result := pgConn.ExecParams(ctx, "select $1::text", [][]byte{[]byte("Hello, world")}, nil, nil, nil).Read() require.Error(t, result.Err) assert.True(t, errors.Is(result.Err, context.Canceled)) assert.True(t, pgconn.SafeToRetry(result.Err)) ensureConnValid(t, pgConn) } func TestConnExecParamsEmptySQL(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) result := pgConn.ExecParams(ctx, "", nil, nil, nil, nil).Read() assert.Equal(t, pgconn.CommandTag{}, result.CommandTag) assert.Len(t, result.Rows, 0) assert.NoError(t, result.Err) ensureConnValid(t, pgConn) } // https://github.com/jackc/pgx/issues/859 func TestResultReaderValuesHaveSameCapacityAsLength(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) result := pgConn.ExecParams(ctx, "select $1::text as msg", [][]byte{[]byte("Hello, world")}, nil, nil, nil) require.Len(t, result.FieldDescriptions(), 1) assert.Equal(t, "msg", result.FieldDescriptions()[0].Name) rowCount := 0 for result.NextRow() { rowCount += 1 assert.Equal(t, "Hello, world", string(result.Values()[0])) assert.Equal(t, len(result.Values()[0]), cap(result.Values()[0])) } assert.Equal(t, 1, rowCount) commandTag, err := result.Close() assert.Equal(t, "SELECT 1", commandTag.String()) assert.NoError(t, err) ensureConnValid(t, pgConn) } // https://github.com/jackc/pgx/issues/1987 func TestResultReaderReadNil(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) result := pgConn.ExecParams(ctx, "select null::text", nil, nil, nil, nil).Read() require.NoError(t, result.Err) require.Nil(t, result.Rows[0][0]) ensureConnValid(t, pgConn) } func TestConnExecPrepared(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) psd, err := pgConn.Prepare(ctx, "ps1", "select $1::text as msg", nil) require.NoError(t, err) require.NotNil(t, psd) assert.Len(t, psd.ParamOIDs, 1) assert.Len(t, psd.Fields, 1) result := pgConn.ExecPrepared(ctx, "ps1", [][]byte{[]byte("Hello, world")}, nil, nil) require.Len(t, result.FieldDescriptions(), 1) assert.Equal(t, "msg", result.FieldDescriptions()[0].Name) rowCount := 0 for result.NextRow() { rowCount += 1 assert.Equal(t, "Hello, world", string(result.Values()[0])) } assert.Equal(t, 1, rowCount) commandTag, err := result.Close() assert.Equal(t, "SELECT 1", commandTag.String()) assert.NoError(t, err) ensureConnValid(t, pgConn) } func TestConnExecPreparedMaxNumberOfParams(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) paramCount := math.MaxUint16 params := make([]string, 0, paramCount) args := make([][]byte, 0, paramCount) for i := range paramCount { params = append(params, fmt.Sprintf("($%d::text)", i+1)) args = append(args, []byte(strconv.Itoa(i))) } sql := "values" + strings.Join(params, ", ") psd, err := pgConn.Prepare(ctx, "ps1", sql, nil) require.NoError(t, err) require.NotNil(t, psd) assert.Len(t, psd.ParamOIDs, paramCount) assert.Len(t, psd.Fields, 1) result := pgConn.ExecPrepared(ctx, "ps1", args, nil, nil).Read() require.NoError(t, result.Err) require.Len(t, result.Rows, paramCount) ensureConnValid(t, pgConn) } func TestConnExecPreparedTooManyParams(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) paramCount := math.MaxUint16 + 1 params := make([]string, 0, paramCount) args := make([][]byte, 0, paramCount) for i := range paramCount { params = append(params, fmt.Sprintf("($%d::text)", i+1)) args = append(args, []byte(strconv.Itoa(i))) } sql := "values" + strings.Join(params, ", ") psd, err := pgConn.Prepare(ctx, "ps1", sql, nil) if pgConn.ParameterStatus("crdb_version") != "" { // CockroachDB rejects preparing a statement with more than 65535 parameters. require.EqualError(t, err, "ERROR: more than 65535 arguments to prepared statement: 65536 (SQLSTATE 08P01)") } else { // PostgreSQL accepts preparing a statement with more than 65535 parameters and only fails when executing it through the extended protocol. require.NoError(t, err) require.NotNil(t, psd) assert.Len(t, psd.ParamOIDs, paramCount) assert.Len(t, psd.Fields, 1) result := pgConn.ExecPrepared(ctx, "ps1", args, nil, nil).Read() require.EqualError(t, result.Err, "extended protocol limited to 65535 parameters") } ensureConnValid(t, pgConn) } func TestConnExecPreparedCanceled(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) _, err = pgConn.Prepare(ctx, "ps1", "select current_database(), pg_sleep(1)", nil) require.NoError(t, err) ctx, cancel = context.WithTimeout(ctx, 100*time.Millisecond) defer cancel() result := pgConn.ExecPrepared(ctx, "ps1", nil, nil, nil) rowCount := 0 for result.NextRow() { rowCount += 1 } assert.Equal(t, 0, rowCount) commandTag, err := result.Close() assert.Equal(t, pgconn.CommandTag{}, commandTag) assert.True(t, pgconn.Timeout(err)) assert.True(t, pgConn.IsClosed()) select { case <-pgConn.CleanupDone(): case <-time.After(5 * time.Second): t.Fatal("Connection cleanup exceeded maximum time") } } func TestConnExecPreparedPrecanceled(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) _, err = pgConn.Prepare(ctx, "ps1", "select current_database(), pg_sleep(1)", nil) require.NoError(t, err) cancel() result := pgConn.ExecPrepared(ctx, "ps1", nil, nil, nil).Read() require.Error(t, result.Err) assert.True(t, errors.Is(result.Err, context.Canceled)) assert.True(t, pgconn.SafeToRetry(result.Err)) ensureConnValid(t, pgConn) } func TestConnExecPreparedEmptySQL(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) _, err = pgConn.Prepare(ctx, "ps1", "", nil) require.NoError(t, err) result := pgConn.ExecPrepared(ctx, "ps1", nil, nil, nil).Read() assert.Equal(t, pgconn.CommandTag{}, result.CommandTag) assert.Len(t, result.Rows, 0) assert.NoError(t, result.Err) ensureConnValid(t, pgConn) } func TestConnExecBatch(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) _, err = pgConn.Prepare(ctx, "ps1", "select $1::text", nil) require.NoError(t, err) batch := &pgconn.Batch{} batch.ExecParams("select $1::text", [][]byte{[]byte("ExecParams 1")}, nil, nil, nil) batch.ExecPrepared("ps1", [][]byte{[]byte("ExecPrepared 1")}, nil, nil) batch.ExecParams("select $1::text", [][]byte{[]byte("ExecParams 2")}, nil, nil, nil) results, err := pgConn.ExecBatch(ctx, batch).ReadAll() require.NoError(t, err) require.Len(t, results, 3) require.Len(t, results[0].Rows, 1) require.Equal(t, "ExecParams 1", string(results[0].Rows[0][0])) assert.Equal(t, "SELECT 1", results[0].CommandTag.String()) require.Len(t, results[1].Rows, 1) require.Equal(t, "ExecPrepared 1", string(results[1].Rows[0][0])) assert.Equal(t, "SELECT 1", results[1].CommandTag.String()) require.Len(t, results[2].Rows, 1) require.Equal(t, "ExecParams 2", string(results[2].Rows[0][0])) assert.Equal(t, "SELECT 1", results[2].CommandTag.String()) } type mockConnection struct { net.Conn writeLatency *time.Duration } func (m mockConnection) Write(b []byte) (n int, err error) { time.Sleep(*m.writeLatency) return m.Conn.Write(b) } func TestConnExecBatchWriteError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) var mockConn mockConnection writeLatency := 0 * time.Second config.DialFunc = func(ctx context.Context, network, address string) (net.Conn, error) { conn, err := net.Dial(network, address) mockConn = mockConnection{conn, &writeLatency} return mockConn, err } pgConn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) defer closeConn(t, pgConn) batch := &pgconn.Batch{} pgConn.Conn() ctx2, cancel2 := context.WithTimeout(context.Background(), 1*time.Second) defer cancel2() batch.ExecParams("select $1::text", [][]byte{[]byte("ExecParams 1")}, nil, nil, nil) writeLatency = 2 * time.Second mrr := pgConn.ExecBatch(ctx2, batch) err = mrr.Close() require.Error(t, err) assert.ErrorIs(t, err, context.DeadlineExceeded) require.True(t, pgConn.IsClosed()) } func TestConnExecBatchDeferredError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Server does not support deferred constraint (https://github.com/cockroachdb/cockroach/issues/31632)") } setupSQL := `create temporary table t ( id text primary key, n int not null, unique (n) deferrable initially deferred ); insert into t (id, n) values ('a', 1), ('b', 2), ('c', 3);` _, err = pgConn.Exec(ctx, setupSQL).ReadAll() require.NoError(t, err) batch := &pgconn.Batch{} batch.ExecParams(`update t set n=n+1 where id='b' returning *`, nil, nil, nil, nil) _, err = pgConn.ExecBatch(ctx, batch).ReadAll() require.NotNil(t, err) var pgErr *pgconn.PgError require.True(t, errors.As(err, &pgErr)) require.Equal(t, "23505", pgErr.Code) ensureConnValid(t, pgConn) } func TestConnExecBatchPrecanceled(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) _, err = pgConn.Prepare(ctx, "ps1", "select $1::text", nil) require.NoError(t, err) batch := &pgconn.Batch{} batch.ExecParams("select $1::text", [][]byte{[]byte("ExecParams 1")}, nil, nil, nil) batch.ExecPrepared("ps1", [][]byte{[]byte("ExecPrepared 1")}, nil, nil) batch.ExecParams("select $1::text", [][]byte{[]byte("ExecParams 2")}, nil, nil, nil) cancel() _, err = pgConn.ExecBatch(ctx, batch).ReadAll() require.Error(t, err) assert.True(t, errors.Is(err, context.Canceled)) assert.True(t, pgconn.SafeToRetry(err)) ensureConnValid(t, pgConn) } // Without concurrent reading and writing large batches can deadlock. // // See https://github.com/jackc/pgx/issues/374. func TestConnExecBatchHuge(t *testing.T) { if testing.Short() { t.Skip("skipping test in short mode.") } t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) batch := &pgconn.Batch{} queryCount := 100_000 args := make([]string, queryCount) for i := range args { args[i] = strconv.Itoa(i) batch.ExecParams("select $1::text", [][]byte{[]byte(args[i])}, nil, nil, nil) } results, err := pgConn.ExecBatch(ctx, batch).ReadAll() require.NoError(t, err) require.Len(t, results, queryCount) for i := range args { require.Len(t, results[i].Rows, 1) require.Equal(t, args[i], string(results[i].Rows[0][0])) assert.Equal(t, "SELECT 1", results[i].CommandTag.String()) } } func TestConnExecBatchImplicitTransaction(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Skipping due to known server issue: (https://github.com/cockroachdb/cockroach/issues/44803)") } _, err = pgConn.Exec(ctx, "create temporary table t(id int)").ReadAll() require.NoError(t, err) batch := &pgconn.Batch{} batch.ExecParams("insert into t(id) values(1)", nil, nil, nil, nil) batch.ExecParams("insert into t(id) values(2)", nil, nil, nil, nil) batch.ExecParams("insert into t(id) values(3)", nil, nil, nil, nil) batch.ExecParams("select 1/0", nil, nil, nil, nil) _, err = pgConn.ExecBatch(ctx, batch).ReadAll() require.Error(t, err) result := pgConn.ExecParams(ctx, "select count(*) from t", nil, nil, nil, nil).Read() require.Equal(t, "0", string(result.Rows[0][0])) } func TestConnLocking(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) mrr := pgConn.Exec(ctx, "select 'Hello, world'") _, err = pgConn.Exec(ctx, "select 'Hello, world'").ReadAll() assert.Error(t, err) assert.Equal(t, "conn busy", err.Error()) assert.True(t, pgconn.SafeToRetry(err)) results, err := mrr.ReadAll() assert.NoError(t, err) assert.Len(t, results, 1) assert.Nil(t, results[0].Err) assert.Equal(t, "SELECT 1", results[0].CommandTag.String()) assert.Len(t, results[0].Rows, 1) assert.Equal(t, "Hello, world", string(results[0].Rows[0][0])) ensureConnValid(t, pgConn) } func TestConnOnNotice(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) var notice *pgconn.Notice config.OnNotice = func(c *pgconn.PgConn, n *pgconn.Notice) { notice = n } config.RuntimeParams["client_min_messages"] = "notice" // Ensure we only get the message we expect. pgConn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) defer closeConn(t, pgConn) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Server does not support PL/PGSQL (https://github.com/cockroachdb/cockroach/issues/17511)") } multiResult := pgConn.Exec(ctx, `do $$ begin raise notice 'hello, world'; end$$;`) err = multiResult.Close() require.NoError(t, err) assert.Equal(t, "NOTICE", notice.SeverityUnlocalized) assert.Equal(t, "hello, world", notice.Message) ensureConnValid(t, pgConn) } func TestConnOnNotification(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) var msg string config.OnNotification = func(c *pgconn.PgConn, n *pgconn.Notification) { msg = n.Payload } pgConn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) defer closeConn(t, pgConn) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Server does not support LISTEN / NOTIFY (https://github.com/cockroachdb/cockroach/issues/41522)") } _, err = pgConn.Exec(ctx, "listen foo").ReadAll() require.NoError(t, err) notifier, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) defer closeConn(t, notifier) _, err = notifier.Exec(ctx, "notify foo, 'bar'").ReadAll() require.NoError(t, err) _, err = pgConn.Exec(ctx, "select 1").ReadAll() require.NoError(t, err) assert.Equal(t, "bar", msg) ensureConnValid(t, pgConn) } func TestConnWaitForNotification(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) var msg string config.OnNotification = func(c *pgconn.PgConn, n *pgconn.Notification) { msg = n.Payload } pgConn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) defer closeConn(t, pgConn) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Server does not support LISTEN / NOTIFY (https://github.com/cockroachdb/cockroach/issues/41522)") } _, err = pgConn.Exec(ctx, "listen foo").ReadAll() require.NoError(t, err) notifier, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) defer closeConn(t, notifier) _, err = notifier.Exec(ctx, "notify foo, 'bar'").ReadAll() require.NoError(t, err) err = pgConn.WaitForNotification(ctx) require.NoError(t, err) assert.Equal(t, "bar", msg) ensureConnValid(t, pgConn) } func TestConnWaitForNotificationPrecanceled(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) pgConn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) defer closeConn(t, pgConn) cancel() err = pgConn.WaitForNotification(ctx) require.ErrorIs(t, err, context.Canceled) ensureConnValid(t, pgConn) } func TestConnWaitForNotificationTimeout(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) pgConn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) defer closeConn(t, pgConn) ctx, cancel = context.WithTimeout(ctx, 5*time.Millisecond) err = pgConn.WaitForNotification(ctx) cancel() assert.True(t, pgconn.Timeout(err)) assert.ErrorIs(t, err, context.DeadlineExceeded) ensureConnValid(t, pgConn) } func TestConnCopyToSmall(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Server does support COPY TO") } _, err = pgConn.Exec(ctx, `create temporary table foo( a int2, b int4, c int8, d varchar, e text, f date, g json )`).ReadAll() require.NoError(t, err) _, err = pgConn.Exec(ctx, `insert into foo values (0, 1, 2, 'abc', 'efg', '2000-01-01', '{"abc":"def","foo":"bar"}')`).ReadAll() require.NoError(t, err) _, err = pgConn.Exec(ctx, `insert into foo values (null, null, null, null, null, null, null)`).ReadAll() require.NoError(t, err) inputBytes := []byte("0\t1\t2\tabc\tefg\t2000-01-01\t{\"abc\":\"def\",\"foo\":\"bar\"}\n" + "\\N\t\\N\t\\N\t\\N\t\\N\t\\N\t\\N\n") outputWriter := bytes.NewBuffer(make([]byte, 0, len(inputBytes))) res, err := pgConn.CopyTo(ctx, outputWriter, "copy foo to stdout") require.NoError(t, err) assert.Equal(t, int64(2), res.RowsAffected()) assert.Equal(t, inputBytes, outputWriter.Bytes()) ensureConnValid(t, pgConn) } func TestConnCopyToLarge(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Server does support COPY TO") } _, err = pgConn.Exec(ctx, `create temporary table foo( a int2, b int4, c int8, d varchar, e text, f date, g json, h bytea )`).ReadAll() require.NoError(t, err) inputBytes := make([]byte, 0) for range 1000 { _, err = pgConn.Exec(ctx, `insert into foo values (0, 1, 2, 'abc', 'efg', '2000-01-01', '{"abc":"def","foo":"bar"}', 'oooo')`).ReadAll() require.NoError(t, err) inputBytes = append(inputBytes, "0\t1\t2\tabc\tefg\t2000-01-01\t{\"abc\":\"def\",\"foo\":\"bar\"}\t\\\\x6f6f6f6f\n"...) } outputWriter := bytes.NewBuffer(make([]byte, 0, len(inputBytes))) res, err := pgConn.CopyTo(ctx, outputWriter, "copy foo to stdout") require.NoError(t, err) assert.Equal(t, int64(1000), res.RowsAffected()) assert.Equal(t, inputBytes, outputWriter.Bytes()) ensureConnValid(t, pgConn) } func TestConnCopyToQueryError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) outputWriter := bytes.NewBuffer(make([]byte, 0)) res, err := pgConn.CopyTo(ctx, outputWriter, "cropy foo to stdout") require.Error(t, err) assert.IsType(t, &pgconn.PgError{}, err) assert.Equal(t, int64(0), res.RowsAffected()) ensureConnValid(t, pgConn) } func TestConnCopyToCanceled(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Server does not support query cancellation (https://github.com/cockroachdb/cockroach/issues/41335)") } outputWriter := &bytes.Buffer{} ctx, cancel = context.WithTimeout(ctx, 100*time.Millisecond) defer cancel() res, err := pgConn.CopyTo(ctx, outputWriter, "copy (select *, pg_sleep(0.01) from generate_series(1,1000)) to stdout") assert.Error(t, err) assert.Equal(t, pgconn.CommandTag{}, res) assert.True(t, pgConn.IsClosed()) select { case <-pgConn.CleanupDone(): case <-time.After(5 * time.Second): t.Fatal("Connection cleanup exceeded maximum time") } } func TestConnCopyToPrecanceled(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) outputWriter := &bytes.Buffer{} cancel() res, err := pgConn.CopyTo(ctx, outputWriter, "copy (select * from generate_series(1,1000)) to stdout") require.Error(t, err) assert.True(t, errors.Is(err, context.Canceled)) assert.True(t, pgconn.SafeToRetry(err)) assert.Equal(t, pgconn.CommandTag{}, res) ensureConnValid(t, pgConn) } func TestConnCopyFrom(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) _, err = pgConn.Exec(ctx, `create temporary table foo( a int4, b varchar )`).ReadAll() require.NoError(t, err) srcBuf := &bytes.Buffer{} inputRows := [][][]byte{} for i := range 1000 { a := strconv.Itoa(i) b := "foo " + a + " bar" inputRows = append(inputRows, [][]byte{[]byte(a), []byte(b)}) _, err = srcBuf.Write(fmt.Appendf(nil, "%s,\"%s\"\n", a, b)) require.NoError(t, err) } copySql := "COPY foo FROM STDIN WITH (FORMAT csv)" if pgConn.ParameterStatus("crdb_version") != "" { copySql = "COPY foo FROM STDIN WITH CSV" } ct, err := pgConn.CopyFrom(ctx, srcBuf, copySql) require.NoError(t, err) assert.Equal(t, int64(len(inputRows)), ct.RowsAffected()) result := pgConn.ExecParams(ctx, "select * from foo", nil, nil, nil, nil).Read() require.NoError(t, result.Err) assert.Equal(t, inputRows, result.Rows) ensureConnValid(t, pgConn) } func TestConnCopyFromBinary(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) _, err = pgConn.Exec(ctx, `create temporary table foo( a int4, b varchar )`).ReadAll() require.NoError(t, err) buf := []byte{} buf = append(buf, "PGCOPY\n\377\r\n\000"...) buf = pgio.AppendInt32(buf, 0) buf = pgio.AppendInt32(buf, 0) inputRows := [][][]byte{} for i := range 1000 { // Number of elements in the tuple buf = pgio.AppendInt16(buf, int16(2)) a := i // Length of element for column `a int4` buf = pgio.AppendInt32(buf, 4) buf, err = pgtype.NewMap().Encode(pgtype.Int4OID, pgx.BinaryFormatCode, a, buf) require.NoError(t, err) b := "foo " + strconv.Itoa(a) + " bar" lenB := int32(len([]byte(b))) // Length of element for column `b varchar` buf = pgio.AppendInt32(buf, lenB) buf, err = pgtype.NewMap().Encode(pgtype.VarcharOID, pgx.BinaryFormatCode, b, buf) require.NoError(t, err) inputRows = append(inputRows, [][]byte{[]byte(strconv.Itoa(a)), []byte(b)}) } srcBuf := &bytes.Buffer{} srcBuf.Write(buf) ct, err := pgConn.CopyFrom(ctx, srcBuf, "COPY foo (a, b) FROM STDIN BINARY;") require.NoError(t, err) assert.Equal(t, int64(len(inputRows)), ct.RowsAffected()) result := pgConn.ExecParams(ctx, "select * from foo", nil, nil, nil, nil).Read() require.NoError(t, result.Err) assert.Equal(t, inputRows, result.Rows) ensureConnValid(t, pgConn) } func TestConnCopyFromCanceled(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) _, err = pgConn.Exec(ctx, `create temporary table foo( a int4, b varchar )`).ReadAll() require.NoError(t, err) r, w := io.Pipe() go func() { for i := range 1_000_000 { a := strconv.Itoa(i) b := "foo " + a + " bar" _, err := w.Write(fmt.Appendf(nil, "%s,\"%s\"\n", a, b)) if err != nil { return } time.Sleep(time.Microsecond) } }() ctx, cancel = context.WithTimeout(ctx, 100*time.Millisecond) copySql := "COPY foo FROM STDIN WITH (FORMAT csv)" if pgConn.ParameterStatus("crdb_version") != "" { copySql = "COPY foo FROM STDIN WITH CSV" } ct, err := pgConn.CopyFrom(ctx, r, copySql) cancel() assert.Equal(t, int64(0), ct.RowsAffected()) assert.Error(t, err) assert.True(t, pgConn.IsClosed()) select { case <-pgConn.CleanupDone(): case <-time.After(5 * time.Second): t.Fatal("Connection cleanup exceeded maximum time") } } func TestConnCopyFromPrecanceled(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) _, err = pgConn.Exec(ctx, `create temporary table foo( a int4, b varchar )`).ReadAll() require.NoError(t, err) r, w := io.Pipe() go func() { for i := range 1_000_000 { a := strconv.Itoa(i) b := "foo " + a + " bar" _, err := w.Write(fmt.Appendf(nil, "%s,\"%s\"\n", a, b)) if err != nil { return } time.Sleep(time.Microsecond) } }() ctx, cancel = context.WithCancel(ctx) cancel() ct, err := pgConn.CopyFrom(ctx, r, "COPY foo FROM STDIN WITH (FORMAT csv)") require.Error(t, err) assert.True(t, errors.Is(err, context.Canceled)) assert.True(t, pgconn.SafeToRetry(err)) assert.Equal(t, pgconn.CommandTag{}, ct) ensureConnValid(t, pgConn) } // https://github.com/jackc/pgx/issues/2364 func TestConnCopyFromConnectionTerminated(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Server does not support pg_terminate_backend") } closerConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, closerConn) errChan := make(chan error, 1) time.AfterFunc(500*time.Millisecond, func() { err := closerConn.ExecParams(ctx, "select pg_terminate_backend($1)", [][]byte{fmt.Appendf(nil, "%d", pgConn.PID())}, nil, nil, nil).Read().Err errChan <- err }) _, err = pgConn.Exec(ctx, `create temporary table foo( a int4, b varchar )`).ReadAll() require.NoError(t, err) r, w := io.Pipe() go func() { for i := range 5_000 { a := strconv.Itoa(i) b := "foo " + a + " bar" _, err := w.Write(fmt.Appendf(nil, "%s,\"%s\"\n", a, b)) if err != nil { return } time.Sleep(time.Millisecond) } }() copySql := "COPY foo FROM STDIN WITH (FORMAT csv)" ct, err := pgConn.CopyFrom(ctx, r, copySql) assert.Equal(t, int64(0), ct.RowsAffected()) assert.Error(t, err) assert.True(t, pgConn.IsClosed()) select { case <-pgConn.CleanupDone(): case <-time.After(5 * time.Second): t.Fatal("Connection cleanup exceeded maximum time") } err = <-errChan require.NoError(t, err) } func TestConnCopyFromGzipReader(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Server does not fully support COPY FROM (https://www.cockroachlabs.com/docs/v20.2/copy-from.html)") } _, err = pgConn.Exec(ctx, `create temporary table foo( a int4, b varchar )`).ReadAll() require.NoError(t, err) f, err := os.CreateTemp(t.TempDir(), "*") require.NoError(t, err) defer f.Close() gw := gzip.NewWriter(f) inputRows := [][][]byte{} for i := range 1000 { a := strconv.Itoa(i) b := "foo " + a + " bar" inputRows = append(inputRows, [][]byte{[]byte(a), []byte(b)}) _, err = gw.Write(fmt.Appendf(nil, "%s,\"%s\"\n", a, b)) require.NoError(t, err) } err = gw.Close() require.NoError(t, err) _, err = f.Seek(0, 0) require.NoError(t, err) gr, err := gzip.NewReader(f) require.NoError(t, err) copySql := "COPY foo FROM STDIN WITH (FORMAT csv)" if pgConn.ParameterStatus("crdb_version") != "" { copySql = "COPY foo FROM STDIN WITH CSV" } ct, err := pgConn.CopyFrom(ctx, gr, copySql) require.NoError(t, err) assert.Equal(t, int64(len(inputRows)), ct.RowsAffected()) err = gr.Close() require.NoError(t, err) result := pgConn.ExecParams(ctx, "select * from foo", nil, nil, nil, nil).Read() require.NoError(t, result.Err) assert.Equal(t, inputRows, result.Rows) ensureConnValid(t, pgConn) } func TestConnCopyFromQuerySyntaxError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) _, err = pgConn.Exec(ctx, `create temporary table foo( a int4, b varchar )`).ReadAll() require.NoError(t, err) srcBuf := &bytes.Buffer{} // Send data even though the COPY FROM command will be rejected with a syntax error. This ensures that this does not // break the connection. See https://github.com/jackc/pgconn/pull/127 for context. inputRows := [][][]byte{} for i := range 1000 { a := strconv.Itoa(i) b := "foo " + a + " bar" inputRows = append(inputRows, [][]byte{[]byte(a), []byte(b)}) _, err = srcBuf.Write(fmt.Appendf(nil, "%s,\"%s\"\n", a, b)) require.NoError(t, err) } res, err := pgConn.CopyFrom(ctx, srcBuf, "cropy foo FROM STDIN WITH (FORMAT csv)") require.Error(t, err) assert.IsType(t, &pgconn.PgError{}, err) assert.Equal(t, int64(0), res.RowsAffected()) ensureConnValid(t, pgConn) } func TestConnCopyFromQueryNoTableError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) srcBuf := &bytes.Buffer{} res, err := pgConn.CopyFrom(ctx, srcBuf, "copy foo to stdout") require.Error(t, err) assert.IsType(t, &pgconn.PgError{}, err) assert.Equal(t, int64(0), res.RowsAffected()) ensureConnValid(t, pgConn) } // https://github.com/jackc/pgconn/issues/21 func TestConnCopyFromNoticeResponseReceivedMidStream(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Server does not support triggers (https://github.com/cockroachdb/cockroach/issues/28296)") } _, err = pgConn.Exec(ctx, `create temporary table sentences( t text, ts tsvector )`).ReadAll() require.NoError(t, err) _, err = pgConn.Exec(ctx, `create function pg_temp.sentences_trigger() returns trigger as $$ begin new.ts := to_tsvector(new.t); return new; end $$ language plpgsql;`).ReadAll() require.NoError(t, err) _, err = pgConn.Exec(ctx, `create trigger sentences_update before insert on sentences for each row execute procedure pg_temp.sentences_trigger();`).ReadAll() require.NoError(t, err) longString := make([]byte, 10001) for i := range longString { longString[i] = 'x' } buf := &bytes.Buffer{} for range 1000 { buf.Write(fmt.Appendf(nil, "%s\n", string(longString))) } _, err = pgConn.CopyFrom(ctx, buf, "COPY sentences(t) FROM STDIN WITH (FORMAT csv)") require.NoError(t, err) } type delayedReader struct { r io.Reader } func (d delayedReader) Read(p []byte) (int, error) { // W/o sleep test passes, with sleep it fails. time.Sleep(time.Millisecond) return d.r.Read(p) } // https://github.com/jackc/pgconn/issues/128 func TestConnCopyFromDataWriteAfterErrorAndReturn(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() connString := os.Getenv("PGX_TEST_DATABASE") if connString == "" { t.Skipf("Skipping due to missing environment variable %v", "PGX_TEST_DATABASE") } config, err := pgconn.ParseConfig(connString) require.NoError(t, err) pgConn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Server does not fully support COPY FROM") } setupSQL := `create temporary table t ( id text primary key, n int not null );` _, err = pgConn.Exec(ctx, setupSQL).ReadAll() assert.NoError(t, err) r1 := delayedReader{r: strings.NewReader(`id 0\n`)} // Generate an error with a bogus COPY command _, err = pgConn.CopyFrom(ctx, r1, "COPY nosuchtable FROM STDIN ") assert.Error(t, err) r2 := delayedReader{r: strings.NewReader(`id 0\n`)} _, err = pgConn.CopyFrom(ctx, r2, "COPY t FROM STDIN") assert.NoError(t, err) } func TestConnEscapeString(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) tests := []struct { in string out string }{ {in: "", out: ""}, {in: "42", out: "42"}, {in: "'", out: "''"}, {in: "hi'there", out: "hi''there"}, {in: "'hi there'", out: "''hi there''"}, } for i, tt := range tests { value, err := pgConn.EscapeString(tt.in) if assert.NoErrorf(t, err, "%d.", i) { assert.Equalf(t, tt.out, value, "%d.", i) } } ensureConnValid(t, pgConn) } func TestConnCancelRequest(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) if pgConn.ParameterStatus("crdb_version") != "" { t.Skip("Server does not support query cancellation (https://github.com/cockroachdb/cockroach/issues/41335)") } multiResult := pgConn.Exec(ctx, "select 'Hello, world', pg_sleep(25)") errChan := make(chan error) go func() { // The query is actually sent when multiResult.NextResult() is called. So wait to ensure it is sent. // Once Flush is available this could use that instead. time.Sleep(1 * time.Second) err := pgConn.CancelRequest(ctx) errChan <- err }() for multiResult.NextResult() { } err = multiResult.Close() require.IsType(t, &pgconn.PgError{}, err) require.Equal(t, "57014", err.(*pgconn.PgError).Code) err = <-errChan require.NoError(t, err) ensureConnValid(t, pgConn) } // https://github.com/jackc/pgx/issues/659 func TestConnContextCanceledCancelsRunningQueryOnServer(t *testing.T) { t.Parallel() t.Run("postgres", func(t *testing.T) { t.Parallel() testConnContextCanceledCancelsRunningQueryOnServer(t, os.Getenv("PGX_TEST_DATABASE"), "postgres") }) t.Run("pgbouncer", func(t *testing.T) { t.Parallel() connString := os.Getenv(pgbouncerConnStringEnvVar) if connString == "" { t.Skipf("Skipping due to missing environment variable %v", pgbouncerConnStringEnvVar) } testConnContextCanceledCancelsRunningQueryOnServer(t, connString, "pgbouncer") }) } func testConnContextCanceledCancelsRunningQueryOnServer(t *testing.T, connString, dbType string) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, connString) require.NoError(t, err) defer closeConn(t, pgConn) ctx, cancel = context.WithTimeout(ctx, 100*time.Millisecond) defer cancel() // Getting the actual PostgreSQL server process ID (PID) from a query executed through pgbouncer is not straightforward // because pgbouncer abstracts the underlying database connections, and it doesn't expose the PID of the PostgreSQL // server process to clients. However, we can check if the query is running by checking the generated query ID. queryID := fmt.Sprintf("%s testConnContextCanceled %d", dbType, time.Now().UnixNano()) multiResult := pgConn.Exec(ctx, fmt.Sprintf(` -- %v select 'Hello, world', pg_sleep(30) `, queryID)) for multiResult.NextResult() { } err = multiResult.Close() assert.True(t, pgconn.Timeout(err)) assert.True(t, pgConn.IsClosed()) select { case <-pgConn.CleanupDone(): case <-time.After(5 * time.Second): t.Fatal("Connection cleanup exceeded maximum time") } ctx, cancel = context.WithTimeout(context.Background(), 10*time.Second) defer cancel() otherConn, err := pgconn.Connect(ctx, connString) require.NoError(t, err) defer closeConn(t, otherConn) ctx, cancel = context.WithTimeout(ctx, time.Second*5) defer cancel() for { result := otherConn.ExecParams(ctx, `select 1 from pg_stat_activity where query like $1`, [][]byte{[]byte("%" + queryID + "%")}, nil, nil, nil, ).Read() require.NoError(t, result.Err) if len(result.Rows) == 0 { break } } } func TestHijackAndConstruct(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() origConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) err = origConn.SyncConn(ctx) require.NoError(t, err) hc, err := origConn.Hijack() require.NoError(t, err) _, err = origConn.Exec(ctx, "select 'Hello, world'").ReadAll() require.Error(t, err) newConn, err := pgconn.Construct(hc) require.NoError(t, err) defer closeConn(t, newConn) results, err := newConn.Exec(ctx, "select 'Hello, world'").ReadAll() assert.NoError(t, err) assert.Len(t, results, 1) assert.Nil(t, results[0].Err) assert.Equal(t, "SELECT 1", results[0].CommandTag.String()) assert.Len(t, results[0].Rows, 1) assert.Equal(t, "Hello, world", string(results[0].Rows[0][0])) ensureConnValid(t, newConn) } func TestConnCloseWhileCancellableQueryInProgress(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) pgConn.Exec(ctx, "select n from generate_series(1,10) n") closeCtx, _ := context.WithCancel(ctx) pgConn.Close(closeCtx) select { case <-pgConn.CleanupDone(): case <-time.After(5 * time.Second): t.Fatal("Connection cleanup exceeded maximum time") } } // https://github.com/jackc/pgx/issues/800 func TestFatalErrorReceivedAfterCommandComplete(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() steps := pgmock.AcceptUnauthenticatedConnRequestSteps() steps = append(steps, pgmock.ExpectAnyMessage(&pgproto3.Parse{})) steps = append(steps, pgmock.ExpectAnyMessage(&pgproto3.Bind{})) steps = append(steps, pgmock.ExpectAnyMessage(&pgproto3.Describe{})) steps = append(steps, pgmock.ExpectAnyMessage(&pgproto3.Execute{})) steps = append(steps, pgmock.ExpectAnyMessage(&pgproto3.Sync{})) steps = append(steps, pgmock.SendMessage(&pgproto3.RowDescription{Fields: []pgproto3.FieldDescription{ {Name: []byte("mock")}, }})) steps = append(steps, pgmock.SendMessage(&pgproto3.CommandComplete{CommandTag: []byte("SELECT 0")})) steps = append(steps, pgmock.SendMessage(&pgproto3.ErrorResponse{Severity: "FATAL", Code: "57P01"})) script := &pgmock.Script{Steps: steps} ln, err := net.Listen("tcp", "127.0.0.1:") require.NoError(t, err) defer ln.Close() serverErrChan := make(chan error, 1) go func() { defer close(serverErrChan) conn, err := ln.Accept() if err != nil { serverErrChan <- err return } defer conn.Close() err = conn.SetDeadline(time.Now().Add(5 * time.Second)) if err != nil { serverErrChan <- err return } err = script.Run(pgproto3.NewBackend(conn, conn)) if err != nil { serverErrChan <- err return } }() host, port, _ := strings.Cut(ln.Addr().String(), ":") connStr := fmt.Sprintf("sslmode=disable host=%s port=%s", host, port) ctx, cancel = context.WithTimeout(ctx, 5*time.Second) defer cancel() conn, err := pgconn.Connect(ctx, connStr) require.NoError(t, err) rr := conn.ExecParams(ctx, "mocked...", nil, nil, nil, nil) for rr.NextRow() { } _, err = rr.Close() require.Error(t, err) } // https://github.com/jackc/pgconn/issues/27 func TestConnLargeResponseWhileWritingDoesNotDeadlock(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) _, err = pgConn.Exec(ctx, "set client_min_messages = debug5").ReadAll() require.NoError(t, err) // The actual contents of this test aren't important. What's important is a large amount of data to be written and // because of client_min_messages = debug5 the server will return a large amount of data. paramCount := math.MaxUint16 params := make([]string, 0, paramCount) args := make([][]byte, 0, paramCount) for i := range paramCount { params = append(params, fmt.Sprintf("($%d::text)", i+1)) args = append(args, []byte(strconv.Itoa(i))) } sql := "values" + strings.Join(params, ", ") result := pgConn.ExecParams(ctx, sql, args, nil, nil, nil).Read() require.NoError(t, result.Err) require.Len(t, result.Rows, paramCount) ensureConnValid(t, pgConn) } func TestConnCheckConn(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() // Intentionally using TCP connection for more predictable close behavior. (Not sure if Unix domain sockets would behave subtly different.) connString := os.Getenv("PGX_TEST_TCP_CONN_STRING") if connString == "" { t.Skipf("Skipping due to missing environment variable %v", "PGX_TEST_TCP_CONN_STRING") } c1, err := pgconn.Connect(ctx, connString) require.NoError(t, err) defer c1.Close(ctx) if c1.ParameterStatus("crdb_version") != "" { t.Skip("Server does not support pg_terminate_backend() (https://github.com/cockroachdb/cockroach/issues/35897)") } err = c1.CheckConn() require.NoError(t, err) c2, err := pgconn.Connect(ctx, connString) require.NoError(t, err) defer c2.Close(ctx) _, err = c2.Exec(ctx, fmt.Sprintf("select pg_terminate_backend(%d)", c1.PID())).ReadAll() require.NoError(t, err) // It may take a while for the server to kill the backend. Retry until the error is detected or the test context is // canceled. for err == nil && ctx.Err() == nil { time.Sleep(50 * time.Millisecond) err = c1.CheckConn() } require.Error(t, err) } func TestConnPing(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() // Intentionally using TCP connection for more predictable close behavior. (Not sure if Unix domain sockets would behave subtly different.) connString := os.Getenv("PGX_TEST_TCP_CONN_STRING") if connString == "" { t.Skipf("Skipping due to missing environment variable %v", "PGX_TEST_TCP_CONN_STRING") } c1, err := pgconn.Connect(ctx, connString) require.NoError(t, err) defer c1.Close(ctx) if c1.ParameterStatus("crdb_version") != "" { t.Skip("Server does not support pg_terminate_backend() (https://github.com/cockroachdb/cockroach/issues/35897)") } err = c1.Exec(ctx, "set log_statement = 'all'").Close() require.NoError(t, err) err = c1.Ping(ctx) require.NoError(t, err) c2, err := pgconn.Connect(ctx, connString) require.NoError(t, err) defer c2.Close(ctx) _, err = c2.Exec(ctx, fmt.Sprintf("select pg_terminate_backend(%d)", c1.PID())).ReadAll() require.NoError(t, err) // Give a little time for the signal to actually kill the backend. time.Sleep(500 * time.Millisecond) err = c1.Ping(ctx) require.Error(t, err) } func TestPipelinePrepare(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) result := pgConn.ExecParams(ctx, `create temporary table t (id text primary key)`, nil, nil, nil, nil).Read() require.NoError(t, result.Err) pipeline := pgConn.StartPipeline(ctx) pipeline.SendPrepare("selectInt", "select $1::bigint as a", nil) pipeline.SendPrepare("selectText", "select $1::text as b", nil) pipeline.SendPrepare("selectNoParams", "select 42 as c", nil) pipeline.SendPrepare("insertNoResults", "insert into t (id) values ($1)", nil) pipeline.SendPrepare("insertNoParamsOrResults", "insert into t (id) values ('foo')", nil) err = pipeline.Sync() require.NoError(t, err) results, err := pipeline.GetResults() require.NoError(t, err) sd, ok := results.(*pgconn.StatementDescription) require.Truef(t, ok, "expected StatementDescription, got: %#v", results) require.Len(t, sd.Fields, 1) require.Equal(t, "a", string(sd.Fields[0].Name)) require.Equal(t, []uint32{pgtype.Int8OID}, sd.ParamOIDs) results, err = pipeline.GetResults() require.NoError(t, err) sd, ok = results.(*pgconn.StatementDescription) require.Truef(t, ok, "expected StatementDescription, got: %#v", results) require.Len(t, sd.Fields, 1) require.Equal(t, "b", string(sd.Fields[0].Name)) require.Equal(t, []uint32{pgtype.TextOID}, sd.ParamOIDs) results, err = pipeline.GetResults() require.NoError(t, err) sd, ok = results.(*pgconn.StatementDescription) require.Truef(t, ok, "expected StatementDescription, got: %#v", results) require.Len(t, sd.Fields, 1) require.Equal(t, "c", string(sd.Fields[0].Name)) require.Equal(t, []uint32{}, sd.ParamOIDs) results, err = pipeline.GetResults() require.NoError(t, err) sd, ok = results.(*pgconn.StatementDescription) require.Truef(t, ok, "expected StatementDescription, got: %#v", results) require.Len(t, sd.Fields, 0) require.Equal(t, []uint32{pgtype.TextOID}, sd.ParamOIDs) results, err = pipeline.GetResults() require.NoError(t, err) sd, ok = results.(*pgconn.StatementDescription) require.Truef(t, ok, "expected StatementDescription, got: %#v", results) require.Len(t, sd.Fields, 0) require.Len(t, sd.ParamOIDs, 0) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.Truef(t, ok, "expected PipelineSync, got: %#v", results) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) err = pipeline.Close() require.NoError(t, err) ensureConnValid(t, pgConn) } func TestPipelinePrepareError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) pipeline := pgConn.StartPipeline(ctx) pipeline.SendPrepare("selectInt", "select $1::bigint as a", nil) pipeline.SendPrepare("selectError", "bad", nil) pipeline.SendPrepare("selectText", "select $1::text as b", nil) err = pipeline.Sync() require.NoError(t, err) results, err := pipeline.GetResults() require.NoError(t, err) sd, ok := results.(*pgconn.StatementDescription) require.Truef(t, ok, "expected StatementDescription, got: %#v", results) require.Len(t, sd.Fields, 1) require.Equal(t, "a", string(sd.Fields[0].Name)) require.Equal(t, []uint32{pgtype.Int8OID}, sd.ParamOIDs) results, err = pipeline.GetResults() var pgErr *pgconn.PgError require.ErrorAs(t, err, &pgErr) require.Nil(t, results) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.Truef(t, ok, "expected PipelineSync, got: %#v", results) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) err = pipeline.Close() require.NoError(t, err) ensureConnValid(t, pgConn) } func TestPipelinePrepareAndDeallocate(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) pipeline := pgConn.StartPipeline(ctx) pipeline.SendPrepare("selectInt", "select $1::bigint as a", nil) pipeline.SendDeallocate("selectInt") err = pipeline.Sync() require.NoError(t, err) results, err := pipeline.GetResults() require.NoError(t, err) sd, ok := results.(*pgconn.StatementDescription) require.Truef(t, ok, "expected StatementDescription, got: %#v", results) require.Len(t, sd.Fields, 1) require.Equal(t, "a", string(sd.Fields[0].Name)) require.Equal(t, []uint32{pgtype.Int8OID}, sd.ParamOIDs) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.CloseComplete) require.Truef(t, ok, "expected CloseComplete, got: %#v", results) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.Truef(t, ok, "expected PipelineSync, got: %#v", results) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) err = pipeline.Close() require.NoError(t, err) ensureConnValid(t, pgConn) } func TestPipelineQuery(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) pipeline := pgConn.StartPipeline(ctx) pipeline.SendQueryParams(`select 1`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 2`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 3`, nil, nil, nil, nil) err = pipeline.Sync() require.NoError(t, err) pipeline.SendQueryParams(`select 4`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 5`, nil, nil, nil, nil) err = pipeline.Sync() require.NoError(t, err) results, err := pipeline.GetResults() require.NoError(t, err) rr, ok := results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult := rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "1", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "2", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "3", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.Truef(t, ok, "expected PipelineSync, got: %#v", results) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "4", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "5", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.Truef(t, ok, "expected PipelineSync, got: %#v", results) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) err = pipeline.Close() require.NoError(t, err) ensureConnValid(t, pgConn) } func TestPipelinePrepareQuery(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) pipeline := pgConn.StartPipeline(ctx) pipeline.SendPrepare("ps", "select $1::text as msg", nil) pipeline.SendQueryPrepared(`ps`, [][]byte{[]byte("hello")}, nil, nil) pipeline.SendQueryPrepared(`ps`, [][]byte{[]byte("goodbye")}, nil, nil) err = pipeline.Sync() require.NoError(t, err) results, err := pipeline.GetResults() require.NoError(t, err) sd, ok := results.(*pgconn.StatementDescription) require.Truef(t, ok, "expected StatementDescription, got: %#v", results) require.Len(t, sd.Fields, 1) require.Equal(t, "msg", string(sd.Fields[0].Name)) require.Equal(t, []uint32{pgtype.TextOID}, sd.ParamOIDs) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok := results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult := rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "hello", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "goodbye", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.Truef(t, ok, "expected PipelineSync, got: %#v", results) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) err = pipeline.Close() require.NoError(t, err) ensureConnValid(t, pgConn) } func TestPipelineQueryErrorBetweenSyncs(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) pipeline := pgConn.StartPipeline(ctx) pipeline.SendQueryParams(`select 1`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 2`, nil, nil, nil, nil) err = pipeline.Sync() require.NoError(t, err) pipeline.SendQueryParams(`select 3`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 1/(3-n) from generate_series(1,10) n`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 4`, nil, nil, nil, nil) err = pipeline.Sync() require.NoError(t, err) pipeline.SendQueryParams(`select 5`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 6`, nil, nil, nil, nil) err = pipeline.Sync() require.NoError(t, err) results, err := pipeline.GetResults() require.NoError(t, err) rr, ok := results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult := rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "1", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "2", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.Truef(t, ok, "expected PipelineSync, got: %#v", results) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "3", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() var pgErr *pgconn.PgError require.ErrorAs(t, readResult.Err, &pgErr) require.Equal(t, "22012", pgErr.Code) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.Truef(t, ok, "expected PipelineSync, got: %#v", results) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "5", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "6", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.Truef(t, ok, "expected PipelineSync, got: %#v", results) err = pipeline.Close() require.NoError(t, err) ensureConnValid(t, pgConn) } func TestPipelineFlushForSingleRequests(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) pipeline := pgConn.StartPipeline(ctx) pipeline.SendPrepare("ps", "select $1::text as msg", nil) pipeline.SendFlushRequest() err = pipeline.Flush() require.NoError(t, err) results, err := pipeline.GetResults() require.NoError(t, err) sd, ok := results.(*pgconn.StatementDescription) require.Truef(t, ok, "expected StatementDescription, got: %#v", results) require.Len(t, sd.Fields, 1) require.Equal(t, "msg", string(sd.Fields[0].Name)) require.Equal(t, []uint32{pgtype.TextOID}, sd.ParamOIDs) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) pipeline.SendQueryPrepared(`ps`, [][]byte{[]byte("hello")}, nil, nil) pipeline.SendFlushRequest() err = pipeline.Flush() require.NoError(t, err) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok := results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult := rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "hello", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) pipeline.SendDeallocate("ps") pipeline.SendFlushRequest() err = pipeline.Flush() require.NoError(t, err) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.CloseComplete) require.Truef(t, ok, "expected CloseComplete, got: %#v", results) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) pipeline.SendQueryParams(`select 1`, nil, nil, nil, nil) pipeline.SendFlushRequest() err = pipeline.Flush() require.NoError(t, err) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "1", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) err = pipeline.Sync() require.NoError(t, err) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.Truef(t, ok, "expected PipelineSync, got: %#v", results) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) err = pipeline.Close() require.NoError(t, err) ensureConnValid(t, pgConn) } func TestPipelineFlushForRequestSeries(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) pipeline := pgConn.StartPipeline(ctx) pipeline.SendPrepare("ps", "select $1::bigint as num", nil) err = pipeline.Sync() require.NoError(t, err) results, err := pipeline.GetResults() require.NoError(t, err) sd, ok := results.(*pgconn.StatementDescription) require.Truef(t, ok, "expected StatementDescription, got: %#v", results) require.Len(t, sd.Fields, 1) require.Equal(t, "num", string(sd.Fields[0].Name)) require.Equal(t, []uint32{pgtype.Int8OID}, sd.ParamOIDs) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.Truef(t, ok, "expected PipelineSync, got: %#v", results) pipeline.SendQueryPrepared(`ps`, [][]byte{[]byte("1")}, nil, nil) pipeline.SendQueryPrepared(`ps`, [][]byte{[]byte("2")}, nil, nil) pipeline.SendFlushRequest() err = pipeline.Flush() require.NoError(t, err) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok := results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult := rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "1", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "2", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) pipeline.SendQueryPrepared(`ps`, [][]byte{[]byte("3")}, nil, nil) err = pipeline.Flush() require.NoError(t, err) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) pipeline.SendQueryPrepared(`ps`, [][]byte{[]byte("4")}, nil, nil) pipeline.SendFlushRequest() err = pipeline.Flush() require.NoError(t, err) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "3", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "4", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) pipeline.SendQueryPrepared(`ps`, [][]byte{[]byte("5")}, nil, nil) pipeline.SendFlushRequest() results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) pipeline.SendQueryPrepared(`ps`, [][]byte{[]byte("6")}, nil, nil) pipeline.SendFlushRequest() err = pipeline.Flush() require.NoError(t, err) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "5", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "6", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) err = pipeline.Sync() require.NoError(t, err) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.Truef(t, ok, "expected PipelineSync, got: %#v", results) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) err = pipeline.Close() require.NoError(t, err) ensureConnValid(t, pgConn) } func TestPipelineFlushWithError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) pipeline := pgConn.StartPipeline(ctx) pipeline.SendQueryParams(`select 1`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 1/(3-n) from generate_series(1,10) n`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 2`, nil, nil, nil, nil) pipeline.SendFlushRequest() err = pipeline.Flush() require.NoError(t, err) results, err := pipeline.GetResults() require.NoError(t, err) rr, ok := results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult := rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "1", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() var pgErr *pgconn.PgError require.ErrorAs(t, readResult.Err, &pgErr) require.Equal(t, "22012", pgErr.Code) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) pipeline.SendQueryParams(`select 3`, nil, nil, nil, nil) pipeline.SendFlushRequest() err = pipeline.Flush() require.NoError(t, err) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) pipeline.SendQueryParams(`select 4`, nil, nil, nil, nil) pipeline.SendPipelineSync() pipeline.SendQueryParams(`select 5`, nil, nil, nil, nil) pipeline.SendFlushRequest() err = pipeline.Flush() require.NoError(t, err) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.Truef(t, ok, "expected PipelineSync, got: %#v", results) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult = rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "5", string(readResult.Rows[0][0])) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) err = pipeline.Sync() require.NoError(t, err) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.Truef(t, ok, "expected PipelineSync, got: %#v", results) err = pipeline.Close() require.NoError(t, err) ensureConnValid(t, pgConn) } func TestPipelineCloseReadsUnreadResults(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) pipeline := pgConn.StartPipeline(ctx) pipeline.SendQueryParams(`select 1`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 2`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 3`, nil, nil, nil, nil) err = pipeline.Sync() require.NoError(t, err) pipeline.SendQueryParams(`select 4`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 5`, nil, nil, nil, nil) err = pipeline.Sync() require.NoError(t, err) results, err := pipeline.GetResults() require.NoError(t, err) rr, ok := results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult := rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "1", string(readResult.Rows[0][0])) err = pipeline.Close() require.NoError(t, err) ensureConnValid(t, pgConn) } func TestPipelineCloseDetectsUnsyncedRequests(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) pipeline := pgConn.StartPipeline(ctx) pipeline.SendQueryParams(`select 1`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 2`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 3`, nil, nil, nil, nil) err = pipeline.Sync() require.NoError(t, err) pipeline.SendQueryParams(`select 4`, nil, nil, nil, nil) pipeline.SendQueryParams(`select 5`, nil, nil, nil, nil) results, err := pipeline.GetResults() require.NoError(t, err) rr, ok := results.(*pgconn.ResultReader) require.Truef(t, ok, "expected ResultReader, got: %#v", results) readResult := rr.Read() require.NoError(t, readResult.Err) require.Len(t, readResult.Rows, 1) require.Len(t, readResult.Rows[0], 1) require.Equal(t, "1", string(readResult.Rows[0][0])) err = pipeline.Close() require.EqualError(t, err, "pipeline has unsynced requests") } func TestConnOnPgError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.OnPgError = func(c *pgconn.PgConn, pgErr *pgconn.PgError) bool { require.NotNil(t, c) require.NotNil(t, pgErr) // close connection on undefined tables only if pgErr.Code == "42P01" { return false } return true } pgConn, err := pgconn.ConnectConfig(ctx, config) require.NoError(t, err) defer closeConn(t, pgConn) _, err = pgConn.Exec(ctx, "select 'Hello, world'").ReadAll() assert.NoError(t, err) assert.False(t, pgConn.IsClosed()) _, err = pgConn.Exec(ctx, "select 1/0").ReadAll() assert.Error(t, err) assert.False(t, pgConn.IsClosed()) _, err = pgConn.Exec(ctx, "select * from non_existant_table").ReadAll() assert.Error(t, err) assert.True(t, pgConn.IsClosed()) } func TestConnCustomData(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeConn(t, pgConn) pgConn.CustomData()["foo"] = "bar" assert.Equal(t, "bar", pgConn.CustomData()["foo"]) ensureConnValid(t, pgConn) } func Example() { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgConn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) if err != nil { log.Fatalln(err) } defer pgConn.Close(ctx) result := pgConn.ExecParams(ctx, "select generate_series(1,3)", nil, nil, nil, nil).Read() if result.Err != nil { log.Fatalln(result.Err) } for _, row := range result.Rows { fmt.Println(string(row[0])) } fmt.Println(result.CommandTag) // Output: // 1 // 2 // 3 // SELECT 3 } func GetSSLPassword(ctx context.Context) string { connString := os.Getenv("PGX_SSL_PASSWORD") return connString } var rsaCertPEM = `-----BEGIN CERTIFICATE----- MIIDCTCCAfGgAwIBAgIUQDlN1g1bzxIJ8KWkayNcQY5gzMEwDQYJKoZIhvcNAQEL BQAwFDESMBAGA1UEAwwJbG9jYWxob3N0MB4XDTIyMDgxNTIxNDgyNloXDTIzMDgx NTIxNDgyNlowFDESMBAGA1UEAwwJbG9jYWxob3N0MIIBIjANBgkqhkiG9w0BAQEF AAOCAQ8AMIIBCgKCAQEA0vOppiT8zE+076acRORzD5JVbRYKMK3XlWLVrHua4+ct Rm54WyP+3XsYU4JGGGKgb8E+u2UosGJYcSM+b+U1/5XPTcpuumS+pCiD9WP++A39 tsukYwR7m65cgpiI4dlLEZI3EWpAW+Bb3230KiYW4sAmQ0Ih4PrN+oPvzcs86F4d 9Y03CqVUxRKLBLaClZQAg8qz2Pawwj1FKKjDX7u2fRVR0wgOugpCMOBJMcCgz9pp 0HSa4x3KZDHEZY7Pah5XwWrCfAEfRWsSTGcNaoN8gSxGFM1JOEJa8SAuPGjFcYIv MmVWdw0FXCgYlSDL02fzLE0uyvXBDibzSqOk770JhQIDAQABo1MwUTAdBgNVHQ4E FgQUiJ8JLENJ+2k1Xl4o6y2Lc/qHTh0wHwYDVR0jBBgwFoAUiJ8JLENJ+2k1Xl4o 6y2Lc/qHTh0wDwYDVR0TAQH/BAUwAwEB/zANBgkqhkiG9w0BAQsFAAOCAQEAwjn2 gnNAhFvh58VqLIjU6ftvn6rhz5B9dg2+XyY8sskLhhkO1nL9339BVZsRt+eI3a7I 81GNIm9qHVM3MUAcQv3SZy+0UPVUT8DNH2LwHT3CHnYTBP8U+8n8TDNGSTMUhIBB Rx+6KwODpwLdI79VGT3IkbU9bZwuepB9I9nM5t/tt5kS4gHmJFlO0aLJFCTO4Scf hp/WLPv4XQUH+I3cPfaJRxz2j0Kc8iOzMhFmvl1XOGByjX6X33LnOzY/LVeTSGyS VgC32BGtnMwuy5XZYgFAeUx9HKy4tG4OH2Ux6uPF/WAhsug6PXSjV7BK6wYT5i27 MlascjupnaptKX/wMA== -----END CERTIFICATE----- ` var rsaKeyPEM = testingKey(`-----BEGIN TESTING KEY----- MIIEvwIBADANBgkqhkiG9w0BAQEFAASCBKkwggSlAgEAAoIBAQDS86mmJPzMT7Tv ppxE5HMPklVtFgowrdeVYtWse5rj5y1GbnhbI/7dexhTgkYYYqBvwT67ZSiwYlhx Iz5v5TX/lc9Nym66ZL6kKIP1Y/74Df22y6RjBHubrlyCmIjh2UsRkjcRakBb4Fvf bfQqJhbiwCZDQiHg+s36g+/NyzzoXh31jTcKpVTFEosEtoKVlACDyrPY9rDCPUUo qMNfu7Z9FVHTCA66CkIw4EkxwKDP2mnQdJrjHcpkMcRljs9qHlfBasJ8AR9FaxJM Zw1qg3yBLEYUzUk4QlrxIC48aMVxgi8yZVZ3DQVcKBiVIMvTZ/MsTS7K9cEOJvNK o6TvvQmFAgMBAAECggEAKzTK54Ol33bn2TnnwdiElIjlRE2CUswYXrl6iDRc2hbs WAOiVRB/T/+5UMla7/2rXJhY7+rdNZs/ABU24ZYxxCJ77jPrD/Q4c8j0lhsgCtBa ycjV543wf0dsHTd+ubtWu8eVzdRUUD0YtB+CJevdPh4a+CWgaMMV0xyYzi61T+Yv Z7Uc3awIAiT4Kw9JRmJiTnyMJg5vZqW3BBAX4ZIvS/54ipwEU+9sWLcuH7WmCR0B QCTqS6hfJDLm//dGC89Iyno57zfYuiT3PYCWH5crr/DH3LqnwlNaOGSBkhkXuIL+ QvOaUMe2i0pjqxDrkBx05V554vyy9jEvK7i330HL4QKBgQDUJmouEr0+o7EMBApC CPPu58K04qY5t9aGciG/pOurN42PF99yNZ1CnynH6DbcnzSl8rjc6Y65tzTlWods bjwVfcmcokG7sPcivJvVjrjKpSQhL8xdZwSAjcqjN4yoJ/+ghm9w+SRmZr6oCQZ3 1jREfJKT+PGiWTEjYcExPWUD2QKBgQD+jdgq4c3tFavU8Hjnlf75xbStr5qu+fp2 SGLRRbX+msQwVbl2ZM9AJLoX9MTCl7D9zaI3ONhheMmfJ77lDTa3VMFtr3NevGA6 MxbiCEfRtQpNkJnsqCixLckx3bskj5+IF9BWzw7y7nOzdhoWVFv/+TltTm3RB51G McdlmmVjjQKBgQDSFAw2/YV6vtu2O1XxGC591/Bd8MaMBziev+wde3GHhaZfGVPC I8dLTpMwCwowpFKdNeLLl1gnHX161I+f1vUWjw4TVjVjaBUBx+VEr2Tb/nXtiwiD QV0a883CnGJjreAblKRMKdpasMmBWhaWmn39h6Iad3zHuCzJjaaiXNpn2QKBgQCf k1Q8LanmQnuh1c41f7aD5gjKCRezMUpt9BrejhD1NxheJJ9LNQ8nat6uPedLBcUS lmJms+AR2qKqf0QQWyQ98YgAtshgTz8TvQtPT1mWgSOgVFHqJdC8obNK63FyDgc4 TZVxlgQNDqbBjfv0m5XA9f+mIlB9hYR2iKYzb4K30QKBgQC+LEJYZh00zsXttGHr 5wU1RzbgDIEsNuu+nZ4MxsaCik8ILNRHNXdeQbnADKuo6ATfhdmDIQMVZLG8Mivi UwnwLd1GhizvqvLHa3ULnFphRyMGFxaLGV48axTT2ADoMX67ILrIY/yjycLqRZ3T z3w+CgS20UrbLIR1YXfqUXge1g== -----END TESTING KEY----- `) func testingKey(s string) string { return strings.ReplaceAll(s, "TESTING KEY", "PRIVATE KEY") } func TestSNISupport(t *testing.T) { t.Parallel() tests := []struct { name string sni_param string sni_set bool }{ { name: "SNI is passed by default", sni_param: "", sni_set: true, }, { name: "SNI is passed when asked for", sni_param: "sslsni=1", sni_set: true, }, { name: "SNI is not passed when disabled", sni_param: "sslsni=0", sni_set: false, }, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() ln, err := net.Listen("tcp", "127.0.0.1:") require.NoError(t, err) defer ln.Close() serverErrChan := make(chan error, 1) serverSNINameChan := make(chan string, 1) defer close(serverErrChan) defer close(serverSNINameChan) go func() { var sniHost string conn, err := ln.Accept() if err != nil { serverErrChan <- err return } defer conn.Close() err = conn.SetDeadline(time.Now().Add(5 * time.Second)) if err != nil { serverErrChan <- err return } backend := pgproto3.NewBackend(conn, conn) startupMessage, err := backend.ReceiveStartupMessage() if err != nil { serverErrChan <- err return } switch startupMessage.(type) { case *pgproto3.SSLRequest: _, err = conn.Write([]byte("S")) if err != nil { serverErrChan <- err return } default: serverErrChan <- fmt.Errorf("unexpected startup message: %#v", startupMessage) return } cert, err := tls.X509KeyPair([]byte(rsaCertPEM), []byte(rsaKeyPEM)) if err != nil { serverErrChan <- err return } srv := tls.Server(conn, &tls.Config{ Certificates: []tls.Certificate{cert}, GetConfigForClient: func(argHello *tls.ClientHelloInfo) (*tls.Config, error) { sniHost = argHello.ServerName return nil, nil }, }) defer srv.Close() if err := srv.Handshake(); err != nil { serverErrChan <- fmt.Errorf("handshake: %w", err) return } srv.Write(mustEncode((&pgproto3.AuthenticationOk{}).Encode(nil))) srv.Write(mustEncode((&pgproto3.BackendKeyData{ProcessID: 0, SecretKey: 0}).Encode(nil))) srv.Write(mustEncode((&pgproto3.ReadyForQuery{TxStatus: 'I'}).Encode(nil))) serverSNINameChan <- sniHost }() _, port, _ := strings.Cut(ln.Addr().String(), ":") connStr := fmt.Sprintf("sslmode=require host=localhost port=%s %s", port, tt.sni_param) _, err = pgconn.Connect(ctx, connStr) select { case sniHost := <-serverSNINameChan: if tt.sni_set { require.Equal(t, "localhost", sniHost) } else { require.Equal(t, "", sniHost) } case err = <-serverErrChan: t.Fatalf("server failed with error: %+v", err) case <-time.After(time.Millisecond * 100): t.Fatal("exceeded connection timeout without erroring out") } }) } } func TestConnectWithDirectSSLNegotiation(t *testing.T) { t.Parallel() tests := []struct { name string connString string expectDirectNego bool }{ { name: "Default negotiation (postgres)", connString: "sslmode=require", expectDirectNego: false, }, { name: "Direct negotiation", connString: "sslmode=require sslnegotiation=direct", expectDirectNego: true, }, { name: "Explicit postgres negotiation", connString: "sslmode=require sslnegotiation=postgres", expectDirectNego: false, }, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { t.Parallel() script := &pgmock.Script{ Steps: pgmock.AcceptUnauthenticatedConnRequestSteps(), } ln, err := net.Listen("tcp", "127.0.0.1:") require.NoError(t, err) defer ln.Close() _, port, err := net.SplitHostPort(ln.Addr().String()) require.NoError(t, err) var directNegoObserved atomic.Bool serverErrCh := make(chan error, 1) go func() { defer close(serverErrCh) conn, err := ln.Accept() if err != nil { serverErrCh <- fmt.Errorf("accept error: %w", err) return } defer conn.Close() conn.SetDeadline(time.Now().Add(5 * time.Second)) firstByte := make([]byte, 1) _, err = conn.Read(firstByte) if err != nil { serverErrCh <- fmt.Errorf("read first byte error: %w", err) return } // Check if TLS Client Hello (direct) or PostgreSQL SSLRequest isDirect := firstByte[0] >= 20 && firstByte[0] <= 23 directNegoObserved.Store(isDirect) var tlsConn *tls.Conn if !isDirect { // Handle standard PostgreSQL SSL negotiation // Read the rest of the SSL request message sslRequestRemainder := make([]byte, 7) _, err = io.ReadFull(conn, sslRequestRemainder) if err != nil { serverErrCh <- fmt.Errorf("read ssl request remainder error: %w", err) return } // Send SSL acceptance response _, err = conn.Write([]byte("S")) if err != nil { serverErrCh <- fmt.Errorf("write ssl acceptance error: %w", err) return } // Setup TLS server without needing to reuse the first byte cert, err := tls.X509KeyPair([]byte(rsaCertPEM), []byte(rsaKeyPEM)) if err != nil { serverErrCh <- fmt.Errorf("cert error: %w", err) return } tlsConn = tls.Server(conn, &tls.Config{ Certificates: []tls.Certificate{cert}, }) } else { // Handle direct TLS negotiation // Setup TLS server with the first byte already read cert, err := tls.X509KeyPair([]byte(rsaCertPEM), []byte(rsaKeyPEM)) if err != nil { serverErrCh <- fmt.Errorf("cert error: %w", err) return } // Use a wrapper to inject the first byte back into the TLS handshake bufConn := &prefixConn{ Conn: conn, prefixData: firstByte, } tlsConn = tls.Server(bufConn, &tls.Config{ Certificates: []tls.Certificate{cert}, }) } // Complete TLS handshake if err := tlsConn.Handshake(); err != nil { serverErrCh <- fmt.Errorf("TLS handshake error: %w", err) return } defer tlsConn.Close() err = script.Run(pgproto3.NewBackend(tlsConn, tlsConn)) if err != nil { serverErrCh <- fmt.Errorf("pgmock run error: %w", err) return } }() connStr := fmt.Sprintf("%s host=localhost port=%s sslmode=require sslinsecure=1", tt.connString, port) ctx, cancel := context.WithTimeout(context.Background(), 3*time.Second) defer cancel() conn, err := pgconn.Connect(ctx, connStr) require.NoError(t, err) defer conn.Close(ctx) err = <-serverErrCh require.NoError(t, err) require.Equal(t, tt.expectDirectNego, directNegoObserved.Load()) }) } } // prefixConn implements a net.Conn that prepends some data to the first Read type prefixConn struct { net.Conn prefixData []byte prefixConsumed bool } func (c *prefixConn) Read(b []byte) (n int, err error) { if !c.prefixConsumed && len(c.prefixData) > 0 { n = copy(b, c.prefixData) c.prefixData = c.prefixData[n:] c.prefixConsumed = len(c.prefixData) == 0 return n, nil } return c.Conn.Read(b) } // https://github.com/jackc/pgx/issues/1920 func TestFatalErrorReceivedInPipelineMode(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() steps := pgmock.AcceptUnauthenticatedConnRequestSteps() steps = append(steps, pgmock.ExpectAnyMessage(&pgproto3.Parse{})) steps = append(steps, pgmock.ExpectAnyMessage(&pgproto3.Describe{})) steps = append(steps, pgmock.ExpectAnyMessage(&pgproto3.Parse{})) steps = append(steps, pgmock.ExpectAnyMessage(&pgproto3.Describe{})) steps = append(steps, pgmock.ExpectAnyMessage(&pgproto3.Parse{})) steps = append(steps, pgmock.ExpectAnyMessage(&pgproto3.Describe{})) steps = append(steps, pgmock.SendMessage(&pgproto3.RowDescription{Fields: []pgproto3.FieldDescription{ {Name: []byte("mock")}, }})) steps = append(steps, pgmock.SendMessage(&pgproto3.ErrorResponse{Severity: "FATAL", Code: "57P01"})) // We shouldn't get anything after the first fatal error. But the reported issue was with PgBouncer so maybe that // causes the issue. Anyway, a FATAL error after the connection had already been killed could cause a panic. steps = append(steps, pgmock.SendMessage(&pgproto3.ErrorResponse{Severity: "FATAL", Code: "57P01"})) script := &pgmock.Script{Steps: steps} ln, err := net.Listen("tcp", "127.0.0.1:") require.NoError(t, err) defer ln.Close() serverKeepAlive := make(chan struct{}) defer close(serverKeepAlive) serverErrChan := make(chan error, 1) go func() { defer close(serverErrChan) conn, err := ln.Accept() if err != nil { serverErrChan <- err return } defer conn.Close() err = conn.SetDeadline(time.Now().Add(59 * time.Second)) if err != nil { serverErrChan <- err return } err = script.Run(pgproto3.NewBackend(conn, conn)) if err != nil { serverErrChan <- err return } <-serverKeepAlive }() parts := strings.Split(ln.Addr().String(), ":") host := parts[0] port := parts[1] connStr := fmt.Sprintf("sslmode=disable host=%s port=%s", host, port) ctx, cancel = context.WithTimeout(ctx, 59*time.Second) defer cancel() conn, err := pgconn.Connect(ctx, connStr) require.NoError(t, err) pipeline := conn.StartPipeline(ctx) pipeline.SendPrepare("s1", "select 1", nil) pipeline.SendPrepare("s2", "select 2", nil) pipeline.SendPrepare("s3", "select 3", nil) err = pipeline.Sync() require.NoError(t, err) _, err = pipeline.GetResults() require.NoError(t, err) _, err = pipeline.GetResults() require.Error(t, err) err = pipeline.Close() require.Error(t, err) } func mustEncode(buf []byte, err error) []byte { if err != nil { panic(err) } return buf } func TestDeadlineContextWatcherHandler(t *testing.T) { t.Parallel() t.Run("DeadlineExceeded with zero DeadlineDelay", func(t *testing.T) { config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.BuildContextWatcherHandler = func(conn *pgconn.PgConn) ctxwatch.Handler { return &pgconn.DeadlineContextWatcherHandler{Conn: conn.Conn()} } config.ConnectTimeout = 5 * time.Second pgConn, err := pgconn.ConnectConfig(context.Background(), config) require.NoError(t, err) defer closeConn(t, pgConn) ctx, cancel := context.WithTimeout(context.Background(), 50*time.Millisecond) defer cancel() _, err = pgConn.Exec(ctx, "select 1, pg_sleep(1)").ReadAll() require.Error(t, err) require.ErrorIs(t, err, context.DeadlineExceeded) require.True(t, pgConn.IsClosed()) }) t.Run("DeadlineExceeded with DeadlineDelay", func(t *testing.T) { config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.BuildContextWatcherHandler = func(conn *pgconn.PgConn) ctxwatch.Handler { return &pgconn.DeadlineContextWatcherHandler{Conn: conn.Conn(), DeadlineDelay: 500 * time.Millisecond} } config.ConnectTimeout = 5 * time.Second pgConn, err := pgconn.ConnectConfig(context.Background(), config) require.NoError(t, err) defer closeConn(t, pgConn) ctx, cancel := context.WithTimeout(context.Background(), 100*time.Millisecond) defer cancel() _, err = pgConn.Exec(ctx, "select 1, pg_sleep(0.250)").ReadAll() require.NoError(t, err) ensureConnValid(t, pgConn) }) } func TestCancelRequestContextWatcherHandler(t *testing.T) { t.Parallel() t.Run("DeadlineExceeded cancels request after CancelRequestDelay", func(t *testing.T) { config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.BuildContextWatcherHandler = func(conn *pgconn.PgConn) ctxwatch.Handler { return &pgconn.CancelRequestContextWatcherHandler{ Conn: conn, CancelRequestDelay: 250 * time.Millisecond, DeadlineDelay: 5000 * time.Millisecond, } } config.ConnectTimeout = 5 * time.Second pgConn, err := pgconn.ConnectConfig(context.Background(), config) require.NoError(t, err) defer closeConn(t, pgConn) ctx, cancel := context.WithTimeout(context.Background(), 50*time.Millisecond) defer cancel() _, err = pgConn.Exec(ctx, "select 1, pg_sleep(3)").ReadAll() require.Error(t, err) var pgErr *pgconn.PgError require.ErrorAs(t, err, &pgErr) ensureConnValid(t, pgConn) }) t.Run("DeadlineExceeded - do not send cancel request when query finishes in grace period", func(t *testing.T) { config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.BuildContextWatcherHandler = func(conn *pgconn.PgConn) ctxwatch.Handler { return &pgconn.CancelRequestContextWatcherHandler{ Conn: conn, CancelRequestDelay: 1000 * time.Millisecond, DeadlineDelay: 5000 * time.Millisecond, } } config.ConnectTimeout = 5 * time.Second pgConn, err := pgconn.ConnectConfig(context.Background(), config) require.NoError(t, err) defer closeConn(t, pgConn) ctx, cancel := context.WithTimeout(context.Background(), 100*time.Millisecond) defer cancel() _, err = pgConn.Exec(ctx, "select 1, pg_sleep(0.250)").ReadAll() require.NoError(t, err) ensureConnValid(t, pgConn) }) t.Run("DeadlineExceeded sets conn deadline with DeadlineDelay", func(t *testing.T) { config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.BuildContextWatcherHandler = func(conn *pgconn.PgConn) ctxwatch.Handler { return &pgconn.CancelRequestContextWatcherHandler{ Conn: conn, CancelRequestDelay: 5000 * time.Millisecond, // purposely setting this higher than DeadlineDelay to ensure the cancel request never happens. DeadlineDelay: 250 * time.Millisecond, } } config.ConnectTimeout = 5 * time.Second pgConn, err := pgconn.ConnectConfig(context.Background(), config) require.NoError(t, err) defer closeConn(t, pgConn) ctx, cancel := context.WithTimeout(context.Background(), 50*time.Millisecond) defer cancel() _, err = pgConn.Exec(ctx, "select 1, pg_sleep(1)").ReadAll() require.Error(t, err) require.ErrorIs(t, err, context.DeadlineExceeded) require.True(t, pgConn.IsClosed()) }) for i := range 10 { t.Run(fmt.Sprintf("Stress %d", i), func(t *testing.T) { t.Parallel() config, err := pgconn.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.BuildContextWatcherHandler = func(conn *pgconn.PgConn) ctxwatch.Handler { return &pgconn.CancelRequestContextWatcherHandler{ Conn: conn, CancelRequestDelay: 5 * time.Millisecond, DeadlineDelay: 1000 * time.Millisecond, } } config.ConnectTimeout = 5 * time.Second pgConn, err := pgconn.ConnectConfig(context.Background(), config) require.NoError(t, err) defer closeConn(t, pgConn) for range 20 { func() { ctx, cancel := context.WithTimeout(context.Background(), 4*time.Millisecond) defer cancel() pgConn.Exec(ctx, "select 1, pg_sleep(0.010)").ReadAll() time.Sleep(100 * time.Millisecond) // ensure a cancel request that was a little late doesn't interrupt ensureConnValid. ensureConnValid(t, pgConn) }() } }) } } pgx-5.8.0/pgproto3/000077500000000000000000000000001512357711200141035ustar00rootroot00000000000000pgx-5.8.0/pgproto3/README.md000066400000000000000000000004321512357711200153610ustar00rootroot00000000000000# pgproto3 Package pgproto3 is an encoder and decoder of the PostgreSQL wire protocol version 3. pgproto3 can be used as a foundation for PostgreSQL drivers, proxies, mock servers, load balancers and more. See example/pgfortune for a playful example of a fake PostgreSQL server. pgx-5.8.0/pgproto3/authentication_cleartext_password.go000066400000000000000000000030201512357711200234410ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "encoding/json" "errors" "github.com/jackc/pgx/v5/internal/pgio" ) // AuthenticationCleartextPassword is a message sent from the backend indicating that a clear-text password is required. type AuthenticationCleartextPassword struct{} // Backend identifies this message as sendable by the PostgreSQL backend. func (*AuthenticationCleartextPassword) Backend() {} // Backend identifies this message as an authentication response. func (*AuthenticationCleartextPassword) AuthenticationResponse() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *AuthenticationCleartextPassword) Decode(src []byte) error { if len(src) != 4 { return errors.New("bad authentication message size") } authType := binary.BigEndian.Uint32(src) if authType != AuthTypeCleartextPassword { return errors.New("bad auth type") } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *AuthenticationCleartextPassword) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeCleartextPassword) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src AuthenticationCleartextPassword) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string }{ Type: "AuthenticationCleartextPassword", }) } pgx-5.8.0/pgproto3/authentication_gss.go000066400000000000000000000021411512357711200203230ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "encoding/json" "errors" "github.com/jackc/pgx/v5/internal/pgio" ) type AuthenticationGSS struct{} func (a *AuthenticationGSS) Backend() {} func (a *AuthenticationGSS) AuthenticationResponse() {} func (a *AuthenticationGSS) Decode(src []byte) error { if len(src) < 4 { return errors.New("authentication message too short") } authType := binary.BigEndian.Uint32(src) if authType != AuthTypeGSS { return errors.New("bad auth type") } return nil } func (a *AuthenticationGSS) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeGSS) return finishMessage(dst, sp) } func (a *AuthenticationGSS) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Data []byte }{ Type: "AuthenticationGSS", }) } func (a *AuthenticationGSS) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { Type string } if err := json.Unmarshal(data, &msg); err != nil { return err } return nil } pgx-5.8.0/pgproto3/authentication_gss_continue.go000066400000000000000000000024331512357711200222330ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "encoding/json" "errors" "github.com/jackc/pgx/v5/internal/pgio" ) type AuthenticationGSSContinue struct { Data []byte } func (a *AuthenticationGSSContinue) Backend() {} func (a *AuthenticationGSSContinue) AuthenticationResponse() {} func (a *AuthenticationGSSContinue) Decode(src []byte) error { if len(src) < 4 { return errors.New("authentication message too short") } authType := binary.BigEndian.Uint32(src) if authType != AuthTypeGSSCont { return errors.New("bad auth type") } a.Data = src[4:] return nil } func (a *AuthenticationGSSContinue) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeGSSCont) dst = append(dst, a.Data...) return finishMessage(dst, sp) } func (a *AuthenticationGSSContinue) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Data []byte }{ Type: "AuthenticationGSSContinue", Data: a.Data, }) } func (a *AuthenticationGSSContinue) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { Type string Data []byte } if err := json.Unmarshal(data, &msg); err != nil { return err } a.Data = msg.Data return nil } pgx-5.8.0/pgproto3/authentication_md5_password.go000066400000000000000000000037001512357711200221400ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "encoding/json" "errors" "github.com/jackc/pgx/v5/internal/pgio" ) // AuthenticationMD5Password is a message sent from the backend indicating that an MD5 hashed password is required. type AuthenticationMD5Password struct { Salt [4]byte } // Backend identifies this message as sendable by the PostgreSQL backend. func (*AuthenticationMD5Password) Backend() {} // Backend identifies this message as an authentication response. func (*AuthenticationMD5Password) AuthenticationResponse() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *AuthenticationMD5Password) Decode(src []byte) error { if len(src) != 8 { return errors.New("bad authentication message size") } authType := binary.BigEndian.Uint32(src) if authType != AuthTypeMD5Password { return errors.New("bad auth type") } copy(dst.Salt[:], src[4:8]) return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *AuthenticationMD5Password) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeMD5Password) dst = append(dst, src.Salt[:]...) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src AuthenticationMD5Password) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Salt [4]byte }{ Type: "AuthenticationMD5Password", Salt: src.Salt, }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *AuthenticationMD5Password) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { Type string Salt [4]byte } if err := json.Unmarshal(data, &msg); err != nil { return err } dst.Salt = msg.Salt return nil } pgx-5.8.0/pgproto3/authentication_ok.go000066400000000000000000000025661512357711200201530ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "encoding/json" "errors" "github.com/jackc/pgx/v5/internal/pgio" ) // AuthenticationOk is a message sent from the backend indicating that authentication was successful. type AuthenticationOk struct{} // Backend identifies this message as sendable by the PostgreSQL backend. func (*AuthenticationOk) Backend() {} // Backend identifies this message as an authentication response. func (*AuthenticationOk) AuthenticationResponse() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *AuthenticationOk) Decode(src []byte) error { if len(src) != 4 { return errors.New("bad authentication message size") } authType := binary.BigEndian.Uint32(src) if authType != AuthTypeOk { return errors.New("bad auth type") } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *AuthenticationOk) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeOk) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src AuthenticationOk) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string }{ Type: "AuthenticationOK", }) } pgx-5.8.0/pgproto3/authentication_sasl.go000066400000000000000000000037371512357711200205050ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/binary" "encoding/json" "errors" "github.com/jackc/pgx/v5/internal/pgio" ) // AuthenticationSASL is a message sent from the backend indicating that SASL authentication is required. type AuthenticationSASL struct { AuthMechanisms []string } // Backend identifies this message as sendable by the PostgreSQL backend. func (*AuthenticationSASL) Backend() {} // Backend identifies this message as an authentication response. func (*AuthenticationSASL) AuthenticationResponse() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *AuthenticationSASL) Decode(src []byte) error { if len(src) < 4 { return errors.New("authentication message too short") } authType := binary.BigEndian.Uint32(src) if authType != AuthTypeSASL { return errors.New("bad auth type") } authMechanisms := src[4:] for len(authMechanisms) > 1 { idx := bytes.IndexByte(authMechanisms, 0) if idx == -1 { return &invalidMessageFormatErr{messageType: "AuthenticationSASL", details: "unterminated string"} } dst.AuthMechanisms = append(dst.AuthMechanisms, string(authMechanisms[:idx])) authMechanisms = authMechanisms[idx+1:] } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *AuthenticationSASL) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeSASL) for _, s := range src.AuthMechanisms { dst = append(dst, []byte(s)...) dst = append(dst, 0) } dst = append(dst, 0) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src AuthenticationSASL) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string AuthMechanisms []string }{ Type: "AuthenticationSASL", AuthMechanisms: src.AuthMechanisms, }) } pgx-5.8.0/pgproto3/authentication_sasl_continue.go000066400000000000000000000036471512357711200224110ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "encoding/json" "errors" "github.com/jackc/pgx/v5/internal/pgio" ) // AuthenticationSASLContinue is a message sent from the backend containing a SASL challenge. type AuthenticationSASLContinue struct { Data []byte } // Backend identifies this message as sendable by the PostgreSQL backend. func (*AuthenticationSASLContinue) Backend() {} // Backend identifies this message as an authentication response. func (*AuthenticationSASLContinue) AuthenticationResponse() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *AuthenticationSASLContinue) Decode(src []byte) error { if len(src) < 4 { return errors.New("authentication message too short") } authType := binary.BigEndian.Uint32(src) if authType != AuthTypeSASLContinue { return errors.New("bad auth type") } dst.Data = src[4:] return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *AuthenticationSASLContinue) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeSASLContinue) dst = append(dst, src.Data...) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src AuthenticationSASLContinue) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Data string }{ Type: "AuthenticationSASLContinue", Data: string(src.Data), }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *AuthenticationSASLContinue) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { Data string } if err := json.Unmarshal(data, &msg); err != nil { return err } dst.Data = []byte(msg.Data) return nil } pgx-5.8.0/pgproto3/authentication_sasl_final.go000066400000000000000000000036331512357711200216510ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "encoding/json" "errors" "github.com/jackc/pgx/v5/internal/pgio" ) // AuthenticationSASLFinal is a message sent from the backend indicating a SASL authentication has completed. type AuthenticationSASLFinal struct { Data []byte } // Backend identifies this message as sendable by the PostgreSQL backend. func (*AuthenticationSASLFinal) Backend() {} // Backend identifies this message as an authentication response. func (*AuthenticationSASLFinal) AuthenticationResponse() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *AuthenticationSASLFinal) Decode(src []byte) error { if len(src) < 4 { return errors.New("authentication message too short") } authType := binary.BigEndian.Uint32(src) if authType != AuthTypeSASLFinal { return errors.New("bad auth type") } dst.Data = src[4:] return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *AuthenticationSASLFinal) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'R') dst = pgio.AppendUint32(dst, AuthTypeSASLFinal) dst = append(dst, src.Data...) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Unmarshaler. func (src AuthenticationSASLFinal) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Data string }{ Type: "AuthenticationSASLFinal", Data: string(src.Data), }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *AuthenticationSASLFinal) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { Data string } if err := json.Unmarshal(data, &msg); err != nil { return err } dst.Data = []byte(msg.Data) return nil } pgx-5.8.0/pgproto3/backend.go000066400000000000000000000165361512357711200160340ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/binary" "fmt" "io" ) // Backend acts as a server for the PostgreSQL wire protocol version 3. type Backend struct { cr *chunkReader w io.Writer // tracer is used to trace messages when Send or Receive is called. This means an outbound message is traced // before it is actually transmitted (i.e. before Flush). tracer *tracer wbuf []byte encodeError error // Frontend message flyweights bind Bind cancelRequest CancelRequest _close Close copyFail CopyFail copyData CopyData copyDone CopyDone describe Describe execute Execute flush Flush functionCall FunctionCall gssEncRequest GSSEncRequest parse Parse query Query sslRequest SSLRequest startupMessage StartupMessage sync Sync terminate Terminate bodyLen int maxBodyLen int // maxBodyLen is the maximum length of a message body in octets. If a message body exceeds this length, Receive will return an error. msgType byte partialMsg bool authType uint32 } const ( minStartupPacketLen = 4 // minStartupPacketLen is a single 32-bit int version or code. maxStartupPacketLen = 10_000 // maxStartupPacketLen is MAX_STARTUP_PACKET_LENGTH from PG source. ) // NewBackend creates a new Backend. func NewBackend(r io.Reader, w io.Writer) *Backend { cr := newChunkReader(r, 0) return &Backend{cr: cr, w: w} } // Send sends a message to the frontend (i.e. the client). The message is buffered until Flush is called. Any error // encountered will be returned from Flush. func (b *Backend) Send(msg BackendMessage) { if b.encodeError != nil { return } prevLen := len(b.wbuf) newBuf, err := msg.Encode(b.wbuf) if err != nil { b.encodeError = err return } b.wbuf = newBuf if b.tracer != nil { b.tracer.traceMessage('B', int32(len(b.wbuf)-prevLen), msg) } } // Flush writes any pending messages to the frontend (i.e. the client). func (b *Backend) Flush() error { if err := b.encodeError; err != nil { b.encodeError = nil b.wbuf = b.wbuf[:0] return &writeError{err: err, safeToRetry: true} } n, err := b.w.Write(b.wbuf) const maxLen = 1024 if len(b.wbuf) > maxLen { b.wbuf = make([]byte, 0, maxLen) } else { b.wbuf = b.wbuf[:0] } if err != nil { return &writeError{err: err, safeToRetry: n == 0} } return nil } // Trace starts tracing the message traffic to w. It writes in a similar format to that produced by the libpq function // PQtrace. func (b *Backend) Trace(w io.Writer, options TracerOptions) { b.tracer = &tracer{ w: w, buf: &bytes.Buffer{}, TracerOptions: options, } } // Untrace stops tracing. func (b *Backend) Untrace() { b.tracer = nil } // ReceiveStartupMessage receives the initial connection message. This method is used of the normal Receive method // because the initial connection message is "special" and does not include the message type as the first byte. This // will return either a StartupMessage, SSLRequest, GSSEncRequest, or CancelRequest. func (b *Backend) ReceiveStartupMessage() (FrontendMessage, error) { buf, err := b.cr.Next(4) if err != nil { return nil, err } msgSize := int(binary.BigEndian.Uint32(buf) - 4) if msgSize < minStartupPacketLen || msgSize > maxStartupPacketLen { return nil, fmt.Errorf("invalid length of startup packet: %d", msgSize) } buf, err = b.cr.Next(msgSize) if err != nil { return nil, translateEOFtoErrUnexpectedEOF(err) } code := binary.BigEndian.Uint32(buf) switch code { case ProtocolVersionNumber: err = b.startupMessage.Decode(buf) if err != nil { return nil, err } return &b.startupMessage, nil case sslRequestNumber: err = b.sslRequest.Decode(buf) if err != nil { return nil, err } return &b.sslRequest, nil case cancelRequestCode: err = b.cancelRequest.Decode(buf) if err != nil { return nil, err } return &b.cancelRequest, nil case gssEncReqNumber: err = b.gssEncRequest.Decode(buf) if err != nil { return nil, err } return &b.gssEncRequest, nil default: return nil, fmt.Errorf("unknown startup message code: %d", code) } } // Receive receives a message from the frontend. The returned message is only valid until the next call to Receive. func (b *Backend) Receive() (FrontendMessage, error) { if !b.partialMsg { header, err := b.cr.Next(5) if err != nil { return nil, translateEOFtoErrUnexpectedEOF(err) } b.msgType = header[0] msgLength := int(binary.BigEndian.Uint32(header[1:])) if msgLength < 4 { return nil, fmt.Errorf("invalid message length: %d", msgLength) } b.bodyLen = msgLength - 4 if b.maxBodyLen > 0 && b.bodyLen > b.maxBodyLen { return nil, &ExceededMaxBodyLenErr{b.maxBodyLen, b.bodyLen} } b.partialMsg = true } var msg FrontendMessage switch b.msgType { case 'B': msg = &b.bind case 'C': msg = &b._close case 'D': msg = &b.describe case 'E': msg = &b.execute case 'F': msg = &b.functionCall case 'f': msg = &b.copyFail case 'd': msg = &b.copyData case 'c': msg = &b.copyDone case 'H': msg = &b.flush case 'P': msg = &b.parse case 'p': switch b.authType { case AuthTypeSASL: msg = &SASLInitialResponse{} case AuthTypeSASLContinue: msg = &SASLResponse{} case AuthTypeSASLFinal: msg = &SASLResponse{} case AuthTypeGSS, AuthTypeGSSCont: msg = &GSSResponse{} case AuthTypeCleartextPassword, AuthTypeMD5Password: fallthrough default: // to maintain backwards compatibility msg = &PasswordMessage{} } case 'Q': msg = &b.query case 'S': msg = &b.sync case 'X': msg = &b.terminate default: return nil, fmt.Errorf("unknown message type: %c", b.msgType) } msgBody, err := b.cr.Next(b.bodyLen) if err != nil { return nil, translateEOFtoErrUnexpectedEOF(err) } b.partialMsg = false err = msg.Decode(msgBody) if err != nil { return nil, err } if b.tracer != nil { b.tracer.traceMessage('F', int32(5+len(msgBody)), msg) } return msg, nil } // SetAuthType sets the authentication type in the backend. // Since multiple message types can start with 'p', SetAuthType allows // contextual identification of FrontendMessages. For example, in the // PG message flow documentation for PasswordMessage: // // Byte1('p') // // Identifies the message as a password response. Note that this is also used for // GSSAPI, SSPI and SASL response messages. The exact message type can be deduced from // the context. // // Since the Frontend does not know about the state of a backend, it is important // to call SetAuthType() after an authentication request is received by the Frontend. func (b *Backend) SetAuthType(authType uint32) error { switch authType { case AuthTypeOk, AuthTypeCleartextPassword, AuthTypeMD5Password, AuthTypeSCMCreds, AuthTypeGSS, AuthTypeGSSCont, AuthTypeSSPI, AuthTypeSASL, AuthTypeSASLContinue, AuthTypeSASLFinal: b.authType = authType default: return fmt.Errorf("authType not recognized: %d", authType) } return nil } // SetMaxBodyLen sets the maximum length of a message body in octets. // If a message body exceeds this length, Receive will return an error. // This is useful for protecting against malicious clients that send // large messages with the intent of causing memory exhaustion. // The default value is 0. // If maxBodyLen is 0, then no maximum is enforced. func (b *Backend) SetMaxBodyLen(maxBodyLen int) { b.maxBodyLen = maxBodyLen } pgx-5.8.0/pgproto3/backend_key_data.go000066400000000000000000000025401512357711200176630ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "encoding/json" "github.com/jackc/pgx/v5/internal/pgio" ) type BackendKeyData struct { ProcessID uint32 SecretKey uint32 } // Backend identifies this message as sendable by the PostgreSQL backend. func (*BackendKeyData) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *BackendKeyData) Decode(src []byte) error { if len(src) != 8 { return &invalidMessageLenErr{messageType: "BackendKeyData", expectedLen: 8, actualLen: len(src)} } dst.ProcessID = binary.BigEndian.Uint32(src[:4]) dst.SecretKey = binary.BigEndian.Uint32(src[4:]) return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *BackendKeyData) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'K') dst = pgio.AppendUint32(dst, src.ProcessID) dst = pgio.AppendUint32(dst, src.SecretKey) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src BackendKeyData) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string ProcessID uint32 SecretKey uint32 }{ Type: "BackendKeyData", ProcessID: src.ProcessID, SecretKey: src.SecretKey, }) } pgx-5.8.0/pgproto3/backend_test.go000066400000000000000000000063361512357711200170700ustar00rootroot00000000000000package pgproto3_test import ( "io" "testing" "github.com/jackc/pgx/v5/internal/pgio" "github.com/jackc/pgx/v5/pgproto3" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func TestBackendReceiveInterrupted(t *testing.T) { t.Parallel() server := &interruptReader{} server.push([]byte{'Q', 0, 0, 0, 6}) backend := pgproto3.NewBackend(server, nil) msg, err := backend.Receive() if err == nil { t.Fatal("expected err") } if msg != nil { t.Fatalf("did not expect msg, but %v", msg) } server.push([]byte{'I', 0}) msg, err = backend.Receive() if err != nil { t.Fatal(err) } if msg, ok := msg.(*pgproto3.Query); !ok || msg.String != "I" { t.Fatalf("unexpected msg: %v", msg) } } func TestBackendReceiveUnexpectedEOF(t *testing.T) { t.Parallel() server := &interruptReader{} server.push([]byte{'Q', 0, 0, 0, 6}) backend := pgproto3.NewBackend(server, nil) // Receive regular msg msg, err := backend.Receive() assert.Nil(t, msg) assert.Equal(t, io.ErrUnexpectedEOF, err) // Receive StartupMessage msg dst := []byte{} dst = pgio.AppendUint32(dst, 1000) // tell the backend we expect 1000 bytes to be read dst = pgio.AppendUint32(dst, 1) // only send 1 byte server.push(dst) msg, err = backend.ReceiveStartupMessage() assert.Nil(t, msg) assert.Equal(t, io.ErrUnexpectedEOF, err) } func TestStartupMessage(t *testing.T) { t.Parallel() t.Run("valid StartupMessage", func(t *testing.T) { want := &pgproto3.StartupMessage{ ProtocolVersion: pgproto3.ProtocolVersionNumber, Parameters: map[string]string{ "username": "tester", }, } dst, err := want.Encode([]byte{}) require.NoError(t, err) server := &interruptReader{} server.push(dst) backend := pgproto3.NewBackend(server, nil) msg, err := backend.ReceiveStartupMessage() require.NoError(t, err) require.Equal(t, want, msg) }) t.Run("invalid packet length", func(t *testing.T) { wantErr := "invalid length of startup packet" tests := []struct { name string packetLen uint32 }{ { name: "large packet length", // Since the StartupMessage contains the "Length of message contents // in bytes, including self", the max startup packet length is actually // 10000+4. Therefore, let's go past the limit with 10005 packetLen: 10005, }, { name: "short packet length", packetLen: 3, }, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { server := &interruptReader{} dst := []byte{} dst = pgio.AppendUint32(dst, tt.packetLen) dst = pgio.AppendUint32(dst, pgproto3.ProtocolVersionNumber) server.push(dst) backend := pgproto3.NewBackend(server, nil) msg, err := backend.ReceiveStartupMessage() require.Error(t, err) require.Nil(t, msg) require.Contains(t, err.Error(), wantErr) }) } }) } func TestBackendReceiveExceededMaxBodyLen(t *testing.T) { t.Parallel() server := &interruptReader{} server.push([]byte{'Q', 0, 0, 10, 10}) backend := pgproto3.NewBackend(server, nil) // Set max body len to 5 backend.SetMaxBodyLen(5) // Receive regular msg msg, err := backend.Receive() assert.Nil(t, msg) var invalidBodyLenErr *pgproto3.ExceededMaxBodyLenErr assert.ErrorAs(t, err, &invalidBodyLenErr) } pgx-5.8.0/pgproto3/big_endian.go000066400000000000000000000012271512357711200165130ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" ) type BigEndianBuf [8]byte func (b BigEndianBuf) Int16(n int16) []byte { buf := b[0:2] binary.BigEndian.PutUint16(buf, uint16(n)) return buf } func (b BigEndianBuf) Uint16(n uint16) []byte { buf := b[0:2] binary.BigEndian.PutUint16(buf, n) return buf } func (b BigEndianBuf) Int32(n int32) []byte { buf := b[0:4] binary.BigEndian.PutUint32(buf, uint32(n)) return buf } func (b BigEndianBuf) Uint32(n uint32) []byte { buf := b[0:4] binary.BigEndian.PutUint32(buf, n) return buf } func (b BigEndianBuf) Int64(n int64) []byte { buf := b[0:8] binary.BigEndian.PutUint64(buf, uint64(n)) return buf } pgx-5.8.0/pgproto3/bind.go000066400000000000000000000133731512357711200153550ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/binary" "encoding/hex" "encoding/json" "errors" "fmt" "math" "github.com/jackc/pgx/v5/internal/pgio" ) type Bind struct { DestinationPortal string PreparedStatement string ParameterFormatCodes []int16 Parameters [][]byte ResultFormatCodes []int16 } // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*Bind) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *Bind) Decode(src []byte) error { *dst = Bind{} idx := bytes.IndexByte(src, 0) if idx < 0 { return &invalidMessageFormatErr{messageType: "Bind"} } dst.DestinationPortal = string(src[:idx]) rp := idx + 1 idx = bytes.IndexByte(src[rp:], 0) if idx < 0 { return &invalidMessageFormatErr{messageType: "Bind"} } dst.PreparedStatement = string(src[rp : rp+idx]) rp += idx + 1 if len(src[rp:]) < 2 { return &invalidMessageFormatErr{messageType: "Bind"} } parameterFormatCodeCount := int(binary.BigEndian.Uint16(src[rp:])) rp += 2 if parameterFormatCodeCount > 0 { dst.ParameterFormatCodes = make([]int16, parameterFormatCodeCount) if len(src[rp:]) < len(dst.ParameterFormatCodes)*2 { return &invalidMessageFormatErr{messageType: "Bind"} } for i := range parameterFormatCodeCount { dst.ParameterFormatCodes[i] = int16(binary.BigEndian.Uint16(src[rp:])) rp += 2 } } if len(src[rp:]) < 2 { return &invalidMessageFormatErr{messageType: "Bind"} } parameterCount := int(binary.BigEndian.Uint16(src[rp:])) rp += 2 if parameterCount > 0 { dst.Parameters = make([][]byte, parameterCount) for i := range parameterCount { if len(src[rp:]) < 4 { return &invalidMessageFormatErr{messageType: "Bind"} } msgSize := int(int32(binary.BigEndian.Uint32(src[rp:]))) rp += 4 // null if msgSize == -1 { continue } if len(src[rp:]) < msgSize { return &invalidMessageFormatErr{messageType: "Bind"} } dst.Parameters[i] = src[rp : rp+msgSize] rp += msgSize } } if len(src[rp:]) < 2 { return &invalidMessageFormatErr{messageType: "Bind"} } resultFormatCodeCount := int(binary.BigEndian.Uint16(src[rp:])) rp += 2 dst.ResultFormatCodes = make([]int16, resultFormatCodeCount) if len(src[rp:]) < len(dst.ResultFormatCodes)*2 { return &invalidMessageFormatErr{messageType: "Bind"} } for i := range resultFormatCodeCount { dst.ResultFormatCodes[i] = int16(binary.BigEndian.Uint16(src[rp:])) rp += 2 } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *Bind) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'B') dst = append(dst, src.DestinationPortal...) dst = append(dst, 0) dst = append(dst, src.PreparedStatement...) dst = append(dst, 0) if len(src.ParameterFormatCodes) > math.MaxUint16 { return nil, errors.New("too many parameter format codes") } dst = pgio.AppendUint16(dst, uint16(len(src.ParameterFormatCodes))) for _, fc := range src.ParameterFormatCodes { dst = pgio.AppendInt16(dst, fc) } if len(src.Parameters) > math.MaxUint16 { return nil, errors.New("too many parameters") } dst = pgio.AppendUint16(dst, uint16(len(src.Parameters))) for _, p := range src.Parameters { if p == nil { dst = pgio.AppendInt32(dst, -1) continue } dst = pgio.AppendInt32(dst, int32(len(p))) dst = append(dst, p...) } if len(src.ResultFormatCodes) > math.MaxUint16 { return nil, errors.New("too many result format codes") } dst = pgio.AppendUint16(dst, uint16(len(src.ResultFormatCodes))) for _, fc := range src.ResultFormatCodes { dst = pgio.AppendInt16(dst, fc) } return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src Bind) MarshalJSON() ([]byte, error) { formattedParameters := make([]map[string]string, len(src.Parameters)) for i, p := range src.Parameters { if p == nil { continue } textFormat := true if len(src.ParameterFormatCodes) == 1 { textFormat = src.ParameterFormatCodes[0] == 0 } else if len(src.ParameterFormatCodes) > 1 { textFormat = src.ParameterFormatCodes[i] == 0 } if textFormat { formattedParameters[i] = map[string]string{"text": string(p)} } else { formattedParameters[i] = map[string]string{"binary": hex.EncodeToString(p)} } } return json.Marshal(struct { Type string DestinationPortal string PreparedStatement string ParameterFormatCodes []int16 Parameters []map[string]string ResultFormatCodes []int16 }{ Type: "Bind", DestinationPortal: src.DestinationPortal, PreparedStatement: src.PreparedStatement, ParameterFormatCodes: src.ParameterFormatCodes, Parameters: formattedParameters, ResultFormatCodes: src.ResultFormatCodes, }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *Bind) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { DestinationPortal string PreparedStatement string ParameterFormatCodes []int16 Parameters []map[string]string ResultFormatCodes []int16 } err := json.Unmarshal(data, &msg) if err != nil { return err } dst.DestinationPortal = msg.DestinationPortal dst.PreparedStatement = msg.PreparedStatement dst.ParameterFormatCodes = msg.ParameterFormatCodes dst.Parameters = make([][]byte, len(msg.Parameters)) dst.ResultFormatCodes = msg.ResultFormatCodes for n, parameter := range msg.Parameters { dst.Parameters[n], err = getValueFromJSON(parameter) if err != nil { return fmt.Errorf("cannot get param %d: %w", n, err) } } return nil } pgx-5.8.0/pgproto3/bind_complete.go000066400000000000000000000016601512357711200172410ustar00rootroot00000000000000package pgproto3 import ( "encoding/json" ) type BindComplete struct{} // Backend identifies this message as sendable by the PostgreSQL backend. func (*BindComplete) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *BindComplete) Decode(src []byte) error { if len(src) != 0 { return &invalidMessageLenErr{messageType: "BindComplete", expectedLen: 0, actualLen: len(src)} } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *BindComplete) Encode(dst []byte) ([]byte, error) { return append(dst, '2', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. func (src BindComplete) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string }{ Type: "BindComplete", }) } pgx-5.8.0/pgproto3/bind_test.go000066400000000000000000000007671512357711200164170ustar00rootroot00000000000000package pgproto3_test import ( "testing" "github.com/jackc/pgx/v5/pgproto3" "github.com/stretchr/testify/require" ) func TestBindBiggerThanMaxMessageBodyLen(t *testing.T) { t.Parallel() // Maximum allowed size. _, err := (&pgproto3.Bind{Parameters: [][]byte{make([]byte, pgproto3.MaxMessageBodyLen-16)}}).Encode(nil) require.NoError(t, err) // 1 byte too big _, err = (&pgproto3.Bind{Parameters: [][]byte{make([]byte, pgproto3.MaxMessageBodyLen-15)}}).Encode(nil) require.Error(t, err) } pgx-5.8.0/pgproto3/cancel_request.go000066400000000000000000000024621512357711200174330ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "encoding/json" "errors" "github.com/jackc/pgx/v5/internal/pgio" ) const cancelRequestCode = 80877102 type CancelRequest struct { ProcessID uint32 SecretKey uint32 } // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*CancelRequest) Frontend() {} func (dst *CancelRequest) Decode(src []byte) error { if len(src) != 12 { return errors.New("bad cancel request size") } requestCode := binary.BigEndian.Uint32(src) if requestCode != cancelRequestCode { return errors.New("bad cancel request code") } dst.ProcessID = binary.BigEndian.Uint32(src[4:]) dst.SecretKey = binary.BigEndian.Uint32(src[8:]) return nil } // Encode encodes src into dst. dst will include the 4 byte message length. func (src *CancelRequest) Encode(dst []byte) ([]byte, error) { dst = pgio.AppendInt32(dst, 16) dst = pgio.AppendInt32(dst, cancelRequestCode) dst = pgio.AppendUint32(dst, src.ProcessID) dst = pgio.AppendUint32(dst, src.SecretKey) return dst, nil } // MarshalJSON implements encoding/json.Marshaler. func (src CancelRequest) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string ProcessID uint32 SecretKey uint32 }{ Type: "CancelRequest", ProcessID: src.ProcessID, SecretKey: src.SecretKey, }) } pgx-5.8.0/pgproto3/chunkreader.go000066400000000000000000000051621512357711200167310ustar00rootroot00000000000000package pgproto3 import ( "io" "github.com/jackc/pgx/v5/internal/iobufpool" ) // chunkReader is a io.Reader wrapper that minimizes IO reads and memory allocations. It allocates memory in chunks and // will read as much as will fit in the current buffer in a single call regardless of how large a read is actually // requested. The memory returned via Next is only valid until the next call to Next. // // This is roughly equivalent to a bufio.Reader that only uses Peek and Discard to never copy bytes. type chunkReader struct { r io.Reader buf *[]byte rp, wp int // buf read position and write position minBufSize int } // newChunkReader creates and returns a new chunkReader for r with default configuration. If minBufSize is <= 0 it uses // a default value. func newChunkReader(r io.Reader, minBufSize int) *chunkReader { if minBufSize <= 0 { // By historical reasons Postgres currently has 8KB send buffer inside, // so here we want to have at least the same size buffer. // @see https://github.com/postgres/postgres/blob/249d64999615802752940e017ee5166e726bc7cd/src/backend/libpq/pqcomm.c#L134 // @see https://www.postgresql.org/message-id/0cdc5485-cb3c-5e16-4a46-e3b2f7a41322%40ya.ru // // In addition, testing has found no benefit of any larger buffer. minBufSize = 8192 } return &chunkReader{ r: r, minBufSize: minBufSize, buf: iobufpool.Get(minBufSize), } } // Next returns buf filled with the next n bytes. buf is only valid until next call of Next. If an error occurs, buf // will be nil. func (r *chunkReader) Next(n int) (buf []byte, err error) { // Reset the buffer if it is empty if r.rp == r.wp { if len(*r.buf) != r.minBufSize { iobufpool.Put(r.buf) r.buf = iobufpool.Get(r.minBufSize) } r.rp = 0 r.wp = 0 } // n bytes already in buf if (r.wp - r.rp) >= n { buf = (*r.buf)[r.rp : r.rp+n : r.rp+n] r.rp += n return buf, err } // buf is smaller than requested number of bytes if len(*r.buf) < n { bigBuf := iobufpool.Get(n) r.wp = copy((*bigBuf), (*r.buf)[r.rp:r.wp]) r.rp = 0 iobufpool.Put(r.buf) r.buf = bigBuf } // buf is large enough, but need to shift filled area to start to make enough contiguous space minReadCount := n - (r.wp - r.rp) if (len(*r.buf) - r.wp) < minReadCount { r.wp = copy((*r.buf), (*r.buf)[r.rp:r.wp]) r.rp = 0 } // Read at least the required number of bytes from the underlying io.Reader readBytesCount, err := io.ReadAtLeast(r.r, (*r.buf)[r.wp:], minReadCount) r.wp += readBytesCount // fmt.Println("read", n) if err != nil { return nil, err } buf = (*r.buf)[r.rp : r.rp+n : r.rp+n] r.rp += n return buf, nil } pgx-5.8.0/pgproto3/chunkreader_test.go000066400000000000000000000031061512357711200177640ustar00rootroot00000000000000package pgproto3 import ( "bytes" "math/rand/v2" "testing" ) func TestChunkReaderNextDoesNotReadIfAlreadyBuffered(t *testing.T) { server := &bytes.Buffer{} r := newChunkReader(server, 4) src := []byte{1, 2, 3, 4} server.Write(src) n1, err := r.Next(2) if err != nil { t.Fatal(err) } if !bytes.Equal(n1, src[0:2]) { t.Fatalf("Expected read bytes to be %v, but they were %v", src[0:2], n1) } n2, err := r.Next(2) if err != nil { t.Fatal(err) } if !bytes.Equal(n2, src[2:4]) { t.Fatalf("Expected read bytes to be %v, but they were %v", src[2:4], n2) } if !bytes.Equal((*r.buf)[:len(src)], src) { t.Fatalf("Expected r.buf to be %v, but it was %v", src, r.buf) } _, err = r.Next(0) // Trigger the buffer reset. if err != nil { t.Fatal(err) } if r.rp != 0 { t.Fatalf("Expected r.rp to be %v, but it was %v", 0, r.rp) } if r.wp != 0 { t.Fatalf("Expected r.wp to be %v, but it was %v", 0, r.wp) } } type randomReader struct { rnd *rand.Rand } // Read reads a random number of random bytes. func (r *randomReader) Read(p []byte) (n int, err error) { n = r.rnd.IntN(len(p) + 1) for i := 0; i < n; i++ { p[i] = byte(r.rnd.Uint64()) } return n, nil } func TestChunkReaderNextFuzz(t *testing.T) { rr := &randomReader{rnd: rand.New(rand.NewPCG(1, 0))} r := newChunkReader(rr, 8192) randomSizes := rand.New(rand.NewPCG(0, 0)) for range 100_000 { size := randomSizes.IntN(16384) + 1 buf, err := r.Next(size) if err != nil { t.Fatal(err) } if len(buf) != size { t.Fatalf("Expected to get %v bytes but got %v bytes", size, len(buf)) } } } pgx-5.8.0/pgproto3/close.go000066400000000000000000000035461512357711200155470ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/json" "errors" ) type Close struct { ObjectType byte // 'S' = prepared statement, 'P' = portal Name string } // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*Close) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *Close) Decode(src []byte) error { if len(src) < 2 { return &invalidMessageFormatErr{messageType: "Close"} } dst.ObjectType = src[0] rp := 1 idx := bytes.IndexByte(src[rp:], 0) if idx != len(src[rp:])-1 { return &invalidMessageFormatErr{messageType: "Close"} } dst.Name = string(src[rp : len(src)-1]) return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *Close) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'C') dst = append(dst, src.ObjectType) dst = append(dst, src.Name...) dst = append(dst, 0) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src Close) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string ObjectType string Name string }{ Type: "Close", ObjectType: string(src.ObjectType), Name: src.Name, }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *Close) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { ObjectType string Name string } if err := json.Unmarshal(data, &msg); err != nil { return err } if len(msg.ObjectType) != 1 { return errors.New("invalid length for Close.ObjectType") } dst.ObjectType = byte(msg.ObjectType[0]) dst.Name = msg.Name return nil } pgx-5.8.0/pgproto3/close_complete.go000066400000000000000000000016671512357711200174410ustar00rootroot00000000000000package pgproto3 import ( "encoding/json" ) type CloseComplete struct{} // Backend identifies this message as sendable by the PostgreSQL backend. func (*CloseComplete) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *CloseComplete) Decode(src []byte) error { if len(src) != 0 { return &invalidMessageLenErr{messageType: "CloseComplete", expectedLen: 0, actualLen: len(src)} } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *CloseComplete) Encode(dst []byte) ([]byte, error) { return append(dst, '3', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. func (src CloseComplete) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string }{ Type: "CloseComplete", }) } pgx-5.8.0/pgproto3/command_complete.go000066400000000000000000000032631512357711200177440ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/json" ) type CommandComplete struct { CommandTag []byte } // Backend identifies this message as sendable by the PostgreSQL backend. func (*CommandComplete) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *CommandComplete) Decode(src []byte) error { idx := bytes.IndexByte(src, 0) if idx == -1 { return &invalidMessageFormatErr{messageType: "CommandComplete", details: "unterminated string"} } if idx != len(src)-1 { return &invalidMessageFormatErr{messageType: "CommandComplete", details: "string terminated too early"} } dst.CommandTag = src[:idx] return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *CommandComplete) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'C') dst = append(dst, src.CommandTag...) dst = append(dst, 0) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src CommandComplete) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string CommandTag string }{ Type: "CommandComplete", CommandTag: string(src.CommandTag), }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *CommandComplete) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { CommandTag string } if err := json.Unmarshal(data, &msg); err != nil { return err } dst.CommandTag = []byte(msg.CommandTag) return nil } pgx-5.8.0/pgproto3/copy_both_response.go000066400000000000000000000047541512357711200203500ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/binary" "encoding/json" "errors" "math" "github.com/jackc/pgx/v5/internal/pgio" ) type CopyBothResponse struct { OverallFormat byte ColumnFormatCodes []uint16 } // Backend identifies this message as sendable by the PostgreSQL backend. func (*CopyBothResponse) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *CopyBothResponse) Decode(src []byte) error { buf := bytes.NewBuffer(src) if buf.Len() < 3 { return &invalidMessageFormatErr{messageType: "CopyBothResponse"} } overallFormat := buf.Next(1)[0] columnCount := int(binary.BigEndian.Uint16(buf.Next(2))) if buf.Len() != columnCount*2 { return &invalidMessageFormatErr{messageType: "CopyBothResponse"} } columnFormatCodes := make([]uint16, columnCount) for i := range columnCount { columnFormatCodes[i] = binary.BigEndian.Uint16(buf.Next(2)) } *dst = CopyBothResponse{OverallFormat: overallFormat, ColumnFormatCodes: columnFormatCodes} return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *CopyBothResponse) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'W') dst = append(dst, src.OverallFormat) if len(src.ColumnFormatCodes) > math.MaxUint16 { return nil, errors.New("too many column format codes") } dst = pgio.AppendUint16(dst, uint16(len(src.ColumnFormatCodes))) for _, fc := range src.ColumnFormatCodes { dst = pgio.AppendUint16(dst, fc) } return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src CopyBothResponse) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string ColumnFormatCodes []uint16 }{ Type: "CopyBothResponse", ColumnFormatCodes: src.ColumnFormatCodes, }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *CopyBothResponse) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { OverallFormat string ColumnFormatCodes []uint16 } if err := json.Unmarshal(data, &msg); err != nil { return err } if len(msg.OverallFormat) != 1 { return errors.New("invalid length for CopyBothResponse.OverallFormat") } dst.OverallFormat = msg.OverallFormat[0] dst.ColumnFormatCodes = msg.ColumnFormatCodes return nil } pgx-5.8.0/pgproto3/copy_both_response_test.go000066400000000000000000000011121512357711200213700ustar00rootroot00000000000000package pgproto3_test import ( "testing" "github.com/jackc/pgx/v5/pgproto3" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func TestEncodeDecode(t *testing.T) { srcBytes := []byte{'W', 0x00, 0x00, 0x00, 0x0b, 0x01, 0x00, 0x02, 0x00, 0x00, 0x00, 0x01} dstResp := pgproto3.CopyBothResponse{} err := dstResp.Decode(srcBytes[5:]) assert.NoError(t, err, "No errors on decode") dstBytes := []byte{} dstBytes, err = dstResp.Encode(dstBytes) require.NoError(t, err) assert.EqualValues(t, srcBytes, dstBytes, "Expecting src & dest bytes to match") } pgx-5.8.0/pgproto3/copy_data.go000066400000000000000000000026051512357711200164000ustar00rootroot00000000000000package pgproto3 import ( "encoding/hex" "encoding/json" ) type CopyData struct { Data []byte } // Backend identifies this message as sendable by the PostgreSQL backend. func (*CopyData) Backend() {} // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*CopyData) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *CopyData) Decode(src []byte) error { dst.Data = src return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *CopyData) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'd') dst = append(dst, src.Data...) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src CopyData) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Data string }{ Type: "CopyData", Data: hex.EncodeToString(src.Data), }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *CopyData) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { Data string } if err := json.Unmarshal(data, &msg); err != nil { return err } dst.Data = []byte(msg.Data) return nil } pgx-5.8.0/pgproto3/copy_done.go000066400000000000000000000017761512357711200164240ustar00rootroot00000000000000package pgproto3 import ( "encoding/json" ) type CopyDone struct{} // Backend identifies this message as sendable by the PostgreSQL backend. func (*CopyDone) Backend() {} // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*CopyDone) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *CopyDone) Decode(src []byte) error { if len(src) != 0 { return &invalidMessageLenErr{messageType: "CopyDone", expectedLen: 0, actualLen: len(src)} } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *CopyDone) Encode(dst []byte) ([]byte, error) { return append(dst, 'c', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. func (src CopyDone) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string }{ Type: "CopyDone", }) } pgx-5.8.0/pgproto3/copy_fail.go000066400000000000000000000021241512357711200163760ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/json" ) type CopyFail struct { Message string } // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*CopyFail) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *CopyFail) Decode(src []byte) error { idx := bytes.IndexByte(src, 0) if idx != len(src)-1 { return &invalidMessageFormatErr{messageType: "CopyFail"} } dst.Message = string(src[:idx]) return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *CopyFail) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'f') dst = append(dst, src.Message...) dst = append(dst, 0) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src CopyFail) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Message string }{ Type: "CopyFail", Message: src.Message, }) } pgx-5.8.0/pgproto3/copy_in_response.go000066400000000000000000000047271512357711200200220ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/binary" "encoding/json" "errors" "math" "github.com/jackc/pgx/v5/internal/pgio" ) type CopyInResponse struct { OverallFormat byte ColumnFormatCodes []uint16 } // Backend identifies this message as sendable by the PostgreSQL backend. func (*CopyInResponse) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *CopyInResponse) Decode(src []byte) error { buf := bytes.NewBuffer(src) if buf.Len() < 3 { return &invalidMessageFormatErr{messageType: "CopyInResponse"} } overallFormat := buf.Next(1)[0] columnCount := int(binary.BigEndian.Uint16(buf.Next(2))) if buf.Len() != columnCount*2 { return &invalidMessageFormatErr{messageType: "CopyInResponse"} } columnFormatCodes := make([]uint16, columnCount) for i := range columnCount { columnFormatCodes[i] = binary.BigEndian.Uint16(buf.Next(2)) } *dst = CopyInResponse{OverallFormat: overallFormat, ColumnFormatCodes: columnFormatCodes} return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *CopyInResponse) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'G') dst = append(dst, src.OverallFormat) if len(src.ColumnFormatCodes) > math.MaxUint16 { return nil, errors.New("too many column format codes") } dst = pgio.AppendUint16(dst, uint16(len(src.ColumnFormatCodes))) for _, fc := range src.ColumnFormatCodes { dst = pgio.AppendUint16(dst, fc) } return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src CopyInResponse) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string ColumnFormatCodes []uint16 }{ Type: "CopyInResponse", ColumnFormatCodes: src.ColumnFormatCodes, }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *CopyInResponse) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { OverallFormat string ColumnFormatCodes []uint16 } if err := json.Unmarshal(data, &msg); err != nil { return err } if len(msg.OverallFormat) != 1 { return errors.New("invalid length for CopyInResponse.OverallFormat") } dst.OverallFormat = msg.OverallFormat[0] dst.ColumnFormatCodes = msg.ColumnFormatCodes return nil } pgx-5.8.0/pgproto3/copy_out_response.go000066400000000000000000000046311512357711200202150ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/binary" "encoding/json" "errors" "math" "github.com/jackc/pgx/v5/internal/pgio" ) type CopyOutResponse struct { OverallFormat byte ColumnFormatCodes []uint16 } func (*CopyOutResponse) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *CopyOutResponse) Decode(src []byte) error { buf := bytes.NewBuffer(src) if buf.Len() < 3 { return &invalidMessageFormatErr{messageType: "CopyOutResponse"} } overallFormat := buf.Next(1)[0] columnCount := int(binary.BigEndian.Uint16(buf.Next(2))) if buf.Len() != columnCount*2 { return &invalidMessageFormatErr{messageType: "CopyOutResponse"} } columnFormatCodes := make([]uint16, columnCount) for i := range columnCount { columnFormatCodes[i] = binary.BigEndian.Uint16(buf.Next(2)) } *dst = CopyOutResponse{OverallFormat: overallFormat, ColumnFormatCodes: columnFormatCodes} return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *CopyOutResponse) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'H') dst = append(dst, src.OverallFormat) if len(src.ColumnFormatCodes) > math.MaxUint16 { return nil, errors.New("too many column format codes") } dst = pgio.AppendUint16(dst, uint16(len(src.ColumnFormatCodes))) for _, fc := range src.ColumnFormatCodes { dst = pgio.AppendUint16(dst, fc) } return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src CopyOutResponse) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string ColumnFormatCodes []uint16 }{ Type: "CopyOutResponse", ColumnFormatCodes: src.ColumnFormatCodes, }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *CopyOutResponse) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { OverallFormat string ColumnFormatCodes []uint16 } if err := json.Unmarshal(data, &msg); err != nil { return err } if len(msg.OverallFormat) != 1 { return errors.New("invalid length for CopyOutResponse.OverallFormat") } dst.OverallFormat = msg.OverallFormat[0] dst.ColumnFormatCodes = msg.ColumnFormatCodes return nil } pgx-5.8.0/pgproto3/data_row.go000066400000000000000000000062561512357711200162430ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "encoding/hex" "encoding/json" "errors" "math" "github.com/jackc/pgx/v5/internal/pgio" ) type DataRow struct { Values [][]byte } // Backend identifies this message as sendable by the PostgreSQL backend. func (*DataRow) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *DataRow) Decode(src []byte) error { if len(src) < 2 { return &invalidMessageFormatErr{messageType: "DataRow"} } rp := 0 fieldCount := int(binary.BigEndian.Uint16(src[rp:])) rp += 2 // If the capacity of the values slice is too small OR substantially too // large reallocate. This is too avoid one row with many columns from // permanently allocating memory. if cap(dst.Values) < fieldCount || cap(dst.Values)-fieldCount > 32 { newCap := max(32, fieldCount) dst.Values = make([][]byte, fieldCount, newCap) } else { dst.Values = dst.Values[:fieldCount] } for i := range fieldCount { if len(src[rp:]) < 4 { return &invalidMessageFormatErr{messageType: "DataRow"} } valueLen := int(int32(binary.BigEndian.Uint32(src[rp:]))) rp += 4 // null if valueLen == -1 { dst.Values[i] = nil } else { if len(src[rp:]) < valueLen || valueLen < 0 { return &invalidMessageFormatErr{messageType: "DataRow"} } dst.Values[i] = src[rp : rp+valueLen : rp+valueLen] rp += valueLen } } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *DataRow) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'D') if len(src.Values) > math.MaxUint16 { return nil, errors.New("too many values") } dst = pgio.AppendUint16(dst, uint16(len(src.Values))) for _, v := range src.Values { if v == nil { dst = pgio.AppendInt32(dst, -1) continue } dst = pgio.AppendInt32(dst, int32(len(v))) dst = append(dst, v...) } return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src DataRow) MarshalJSON() ([]byte, error) { formattedValues := make([]map[string]string, len(src.Values)) for i, v := range src.Values { if v == nil { continue } var hasNonPrintable bool for _, b := range v { if b < 32 { hasNonPrintable = true break } } if hasNonPrintable { formattedValues[i] = map[string]string{"binary": hex.EncodeToString(v)} } else { formattedValues[i] = map[string]string{"text": string(v)} } } return json.Marshal(struct { Type string Values []map[string]string }{ Type: "DataRow", Values: formattedValues, }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *DataRow) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { Values []map[string]string } if err := json.Unmarshal(data, &msg); err != nil { return err } dst.Values = make([][]byte, len(msg.Values)) for n, parameter := range msg.Values { var err error dst.Values[n], err = getValueFromJSON(parameter) if err != nil { return err } } return nil } pgx-5.8.0/pgproto3/describe.go000066400000000000000000000036031512357711200162140ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/json" "errors" ) type Describe struct { ObjectType byte // 'S' = prepared statement, 'P' = portal Name string } // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*Describe) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *Describe) Decode(src []byte) error { if len(src) < 2 { return &invalidMessageFormatErr{messageType: "Describe"} } dst.ObjectType = src[0] rp := 1 idx := bytes.IndexByte(src[rp:], 0) if idx != len(src[rp:])-1 { return &invalidMessageFormatErr{messageType: "Describe"} } dst.Name = string(src[rp : len(src)-1]) return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *Describe) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'D') dst = append(dst, src.ObjectType) dst = append(dst, src.Name...) dst = append(dst, 0) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src Describe) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string ObjectType string Name string }{ Type: "Describe", ObjectType: string(src.ObjectType), Name: src.Name, }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *Describe) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { ObjectType string Name string } if err := json.Unmarshal(data, &msg); err != nil { return err } if len(msg.ObjectType) != 1 { return errors.New("invalid length for Describe.ObjectType") } dst.ObjectType = byte(msg.ObjectType[0]) dst.Name = msg.Name return nil } pgx-5.8.0/pgproto3/doc.go000066400000000000000000000012601512357711200151760ustar00rootroot00000000000000// Package pgproto3 is an encoder and decoder of the PostgreSQL wire protocol version 3. // // The primary interfaces are Frontend and Backend. They correspond to a client and server respectively. Messages are // sent with Send (or a specialized Send variant). Messages are automatically buffered to minimize small writes. Call // Flush to ensure a message has actually been sent. // // The Trace method of Frontend and Backend can be used to examine the wire-level message traffic. It outputs in a // similar format to the PQtrace function in libpq. // // See https://www.postgresql.org/docs/current/protocol-message-formats.html for meanings of the different messages. package pgproto3 pgx-5.8.0/pgproto3/empty_query_response.go000066400000000000000000000017321512357711200207360ustar00rootroot00000000000000package pgproto3 import ( "encoding/json" ) type EmptyQueryResponse struct{} // Backend identifies this message as sendable by the PostgreSQL backend. func (*EmptyQueryResponse) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *EmptyQueryResponse) Decode(src []byte) error { if len(src) != 0 { return &invalidMessageLenErr{messageType: "EmptyQueryResponse", expectedLen: 0, actualLen: len(src)} } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *EmptyQueryResponse) Encode(dst []byte) ([]byte, error) { return append(dst, 'I', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. func (src EmptyQueryResponse) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string }{ Type: "EmptyQueryResponse", }) } pgx-5.8.0/pgproto3/error_response.go000066400000000000000000000171741512357711200175130ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/json" "strconv" ) type ErrorResponse struct { Severity string SeverityUnlocalized string // only in 9.6 and greater Code string Message string Detail string Hint string Position int32 InternalPosition int32 InternalQuery string Where string SchemaName string TableName string ColumnName string DataTypeName string ConstraintName string File string Line int32 Routine string UnknownFields map[byte]string } // Backend identifies this message as sendable by the PostgreSQL backend. func (*ErrorResponse) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *ErrorResponse) Decode(src []byte) error { *dst = ErrorResponse{} buf := bytes.NewBuffer(src) for { k, err := buf.ReadByte() if err != nil { return err } if k == 0 { break } vb, err := buf.ReadBytes(0) if err != nil { return err } v := string(vb[:len(vb)-1]) switch k { case 'S': dst.Severity = v case 'V': dst.SeverityUnlocalized = v case 'C': dst.Code = v case 'M': dst.Message = v case 'D': dst.Detail = v case 'H': dst.Hint = v case 'P': s := v n, _ := strconv.ParseInt(s, 10, 32) dst.Position = int32(n) case 'p': s := v n, _ := strconv.ParseInt(s, 10, 32) dst.InternalPosition = int32(n) case 'q': dst.InternalQuery = v case 'W': dst.Where = v case 's': dst.SchemaName = v case 't': dst.TableName = v case 'c': dst.ColumnName = v case 'd': dst.DataTypeName = v case 'n': dst.ConstraintName = v case 'F': dst.File = v case 'L': s := v n, _ := strconv.ParseInt(s, 10, 32) dst.Line = int32(n) case 'R': dst.Routine = v default: if dst.UnknownFields == nil { dst.UnknownFields = make(map[byte]string) } dst.UnknownFields[k] = v } } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *ErrorResponse) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'E') dst = src.appendFields(dst) return finishMessage(dst, sp) } func (src *ErrorResponse) appendFields(dst []byte) []byte { if src.Severity != "" { dst = append(dst, 'S') dst = append(dst, src.Severity...) dst = append(dst, 0) } if src.SeverityUnlocalized != "" { dst = append(dst, 'V') dst = append(dst, src.SeverityUnlocalized...) dst = append(dst, 0) } if src.Code != "" { dst = append(dst, 'C') dst = append(dst, src.Code...) dst = append(dst, 0) } if src.Message != "" { dst = append(dst, 'M') dst = append(dst, src.Message...) dst = append(dst, 0) } if src.Detail != "" { dst = append(dst, 'D') dst = append(dst, src.Detail...) dst = append(dst, 0) } if src.Hint != "" { dst = append(dst, 'H') dst = append(dst, src.Hint...) dst = append(dst, 0) } if src.Position != 0 { dst = append(dst, 'P') dst = append(dst, strconv.Itoa(int(src.Position))...) dst = append(dst, 0) } if src.InternalPosition != 0 { dst = append(dst, 'p') dst = append(dst, strconv.Itoa(int(src.InternalPosition))...) dst = append(dst, 0) } if src.InternalQuery != "" { dst = append(dst, 'q') dst = append(dst, src.InternalQuery...) dst = append(dst, 0) } if src.Where != "" { dst = append(dst, 'W') dst = append(dst, src.Where...) dst = append(dst, 0) } if src.SchemaName != "" { dst = append(dst, 's') dst = append(dst, src.SchemaName...) dst = append(dst, 0) } if src.TableName != "" { dst = append(dst, 't') dst = append(dst, src.TableName...) dst = append(dst, 0) } if src.ColumnName != "" { dst = append(dst, 'c') dst = append(dst, src.ColumnName...) dst = append(dst, 0) } if src.DataTypeName != "" { dst = append(dst, 'd') dst = append(dst, src.DataTypeName...) dst = append(dst, 0) } if src.ConstraintName != "" { dst = append(dst, 'n') dst = append(dst, src.ConstraintName...) dst = append(dst, 0) } if src.File != "" { dst = append(dst, 'F') dst = append(dst, src.File...) dst = append(dst, 0) } if src.Line != 0 { dst = append(dst, 'L') dst = append(dst, strconv.Itoa(int(src.Line))...) dst = append(dst, 0) } if src.Routine != "" { dst = append(dst, 'R') dst = append(dst, src.Routine...) dst = append(dst, 0) } for k, v := range src.UnknownFields { dst = append(dst, k) dst = append(dst, v...) dst = append(dst, 0) } dst = append(dst, 0) return dst } // MarshalJSON implements encoding/json.Marshaler. func (src ErrorResponse) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Severity string SeverityUnlocalized string // only in 9.6 and greater Code string Message string Detail string Hint string Position int32 InternalPosition int32 InternalQuery string Where string SchemaName string TableName string ColumnName string DataTypeName string ConstraintName string File string Line int32 Routine string UnknownFields map[byte]string }{ Type: "ErrorResponse", Severity: src.Severity, SeverityUnlocalized: src.SeverityUnlocalized, Code: src.Code, Message: src.Message, Detail: src.Detail, Hint: src.Hint, Position: src.Position, InternalPosition: src.InternalPosition, InternalQuery: src.InternalQuery, Where: src.Where, SchemaName: src.SchemaName, TableName: src.TableName, ColumnName: src.ColumnName, DataTypeName: src.DataTypeName, ConstraintName: src.ConstraintName, File: src.File, Line: src.Line, Routine: src.Routine, UnknownFields: src.UnknownFields, }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *ErrorResponse) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { Type string Severity string SeverityUnlocalized string // only in 9.6 and greater Code string Message string Detail string Hint string Position int32 InternalPosition int32 InternalQuery string Where string SchemaName string TableName string ColumnName string DataTypeName string ConstraintName string File string Line int32 Routine string UnknownFields map[byte]string } if err := json.Unmarshal(data, &msg); err != nil { return err } dst.Severity = msg.Severity dst.SeverityUnlocalized = msg.SeverityUnlocalized dst.Code = msg.Code dst.Message = msg.Message dst.Detail = msg.Detail dst.Hint = msg.Hint dst.Position = msg.Position dst.InternalPosition = msg.InternalPosition dst.InternalQuery = msg.InternalQuery dst.Where = msg.Where dst.SchemaName = msg.SchemaName dst.TableName = msg.TableName dst.ColumnName = msg.ColumnName dst.DataTypeName = msg.DataTypeName dst.ConstraintName = msg.ConstraintName dst.File = msg.File dst.Line = msg.Line dst.Routine = msg.Routine dst.UnknownFields = msg.UnknownFields return nil } pgx-5.8.0/pgproto3/example/000077500000000000000000000000001512357711200155365ustar00rootroot00000000000000pgx-5.8.0/pgproto3/example/pgfortune/000077500000000000000000000000001512357711200175475ustar00rootroot00000000000000pgx-5.8.0/pgproto3/example/pgfortune/README.md000066400000000000000000000031231512357711200210250ustar00rootroot00000000000000# pgfortune pgfortune is a mock PostgreSQL server that responds to every query with a fortune. ## Installation Install `fortune` and `cowsay`. They should be available in any Unix package manager (apt, yum, brew, etc.) ``` go get -u github.com/jackc/pgproto3/example/pgfortune ``` ## Usage ``` $ pgfortune ``` By default pgfortune listens on 127.0.0.1:15432 and responds to queries with `fortune | cowsay -f elephant`. These are configurable with the `listen` and `response-command` arguments respectively. While `pgfortune` is running connect to it with `psql`. ``` $ psql -h 127.0.0.1 -p 15432 Timing is on. Null display is "∅". Line style is unicode. psql (11.5, server 0.0.0) Type "help" for help. jack@127.0.0.1:15432 jack=# select foo; fortune ───────────────────────────────────────────── _________________________________________ ↵ / Ships are safe in harbor, but they were \↵ \ never meant to stay there. /↵ ----------------------------------------- ↵ \ /\ ___ /\ ↵ \ // \/ \/ \\ ↵ (( O O )) ↵ \\ / \ // ↵ \/ | | \/ ↵ | | | | ↵ | | | | ↵ | o | ↵ | | | | ↵ |m| |m| ↵ (1 row) Time: 28.161 ms ``` pgx-5.8.0/pgproto3/example/pgfortune/main.go000066400000000000000000000020571512357711200210260ustar00rootroot00000000000000package main import ( "flag" "fmt" "log" "net" "os" "os/exec" ) var options struct { listenAddress string responseCommand string } func main() { flag.Usage = func() { fmt.Fprintf(os.Stderr, "usage: %s [options]\n", os.Args[0]) flag.PrintDefaults() } flag.StringVar(&options.listenAddress, "listen", "127.0.0.1:15432", "Listen address") flag.StringVar(&options.responseCommand, "response-command", "fortune | cowsay -f elephant", "Command to execute to generate query response") flag.Parse() ln, err := net.Listen("tcp", options.listenAddress) if err != nil { log.Fatal(err) } log.Println("Listening on", ln.Addr()) for { conn, err := ln.Accept() if err != nil { log.Fatal(err) } log.Println("Accepted connection from", conn.RemoteAddr()) b := NewPgFortuneBackend(conn, func() ([]byte, error) { return exec.Command("sh", "-c", options.responseCommand).CombinedOutput() }) go func() { err := b.Run() if err != nil { log.Println(err) } log.Println("Closed connection from", conn.RemoteAddr()) }() } } pgx-5.8.0/pgproto3/example/pgfortune/server.go000066400000000000000000000051611512357711200214070ustar00rootroot00000000000000package main import ( "fmt" "net" "github.com/jackc/pgx/v5/pgproto3" ) type PgFortuneBackend struct { backend *pgproto3.Backend conn net.Conn responder func() ([]byte, error) } func NewPgFortuneBackend(conn net.Conn, responder func() ([]byte, error)) *PgFortuneBackend { backend := pgproto3.NewBackend(conn, conn) connHandler := &PgFortuneBackend{ backend: backend, conn: conn, responder: responder, } return connHandler } func (p *PgFortuneBackend) Run() error { defer p.Close() err := p.handleStartup() if err != nil { return err } for { msg, err := p.backend.Receive() if err != nil { return fmt.Errorf("error receiving message: %w", err) } switch msg.(type) { case *pgproto3.Query: response, err := p.responder() if err != nil { return fmt.Errorf("error generating query response: %w", err) } buf := mustEncode((&pgproto3.RowDescription{Fields: []pgproto3.FieldDescription{ { Name: []byte("fortune"), TableOID: 0, TableAttributeNumber: 0, DataTypeOID: 25, DataTypeSize: -1, TypeModifier: -1, Format: 0, }, }}).Encode(nil)) buf = mustEncode((&pgproto3.DataRow{Values: [][]byte{response}}).Encode(buf)) buf = mustEncode((&pgproto3.CommandComplete{CommandTag: []byte("SELECT 1")}).Encode(buf)) buf = mustEncode((&pgproto3.ReadyForQuery{TxStatus: 'I'}).Encode(buf)) _, err = p.conn.Write(buf) if err != nil { return fmt.Errorf("error writing query response: %w", err) } case *pgproto3.Terminate: return nil default: return fmt.Errorf("received message other than Query from client: %#v", msg) } } } func (p *PgFortuneBackend) handleStartup() error { startupMessage, err := p.backend.ReceiveStartupMessage() if err != nil { return fmt.Errorf("error receiving startup message: %w", err) } switch startupMessage.(type) { case *pgproto3.StartupMessage: buf := mustEncode((&pgproto3.AuthenticationOk{}).Encode(nil)) buf = mustEncode((&pgproto3.ReadyForQuery{TxStatus: 'I'}).Encode(buf)) _, err = p.conn.Write(buf) if err != nil { return fmt.Errorf("error sending ready for query: %w", err) } case *pgproto3.SSLRequest: _, err = p.conn.Write([]byte("N")) if err != nil { return fmt.Errorf("error sending deny SSL request: %w", err) } return p.handleStartup() default: return fmt.Errorf("unknown startup message: %#v", startupMessage) } return nil } func (p *PgFortuneBackend) Close() error { return p.conn.Close() } func mustEncode(buf []byte, err error) []byte { if err != nil { panic(err) } return buf } pgx-5.8.0/pgproto3/execute.go000066400000000000000000000025311512357711200160750ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/binary" "encoding/json" "github.com/jackc/pgx/v5/internal/pgio" ) type Execute struct { Portal string MaxRows uint32 } // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*Execute) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *Execute) Decode(src []byte) error { buf := bytes.NewBuffer(src) b, err := buf.ReadBytes(0) if err != nil { return err } dst.Portal = string(b[:len(b)-1]) if buf.Len() < 4 { return &invalidMessageFormatErr{messageType: "Execute"} } dst.MaxRows = binary.BigEndian.Uint32(buf.Next(4)) return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *Execute) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'E') dst = append(dst, src.Portal...) dst = append(dst, 0) dst = pgio.AppendUint32(dst, src.MaxRows) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src Execute) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Portal string MaxRows uint32 }{ Type: "Execute", Portal: src.Portal, MaxRows: src.MaxRows, }) } pgx-5.8.0/pgproto3/flush.go000066400000000000000000000016001512357711200155500ustar00rootroot00000000000000package pgproto3 import ( "encoding/json" ) type Flush struct{} // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*Flush) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *Flush) Decode(src []byte) error { if len(src) != 0 { return &invalidMessageLenErr{messageType: "Flush", expectedLen: 0, actualLen: len(src)} } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *Flush) Encode(dst []byte) ([]byte, error) { return append(dst, 'H', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. func (src Flush) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string }{ Type: "Flush", }) } pgx-5.8.0/pgproto3/frontend.go000066400000000000000000000302511512357711200162520ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/binary" "errors" "fmt" "io" ) // Frontend acts as a client for the PostgreSQL wire protocol version 3. type Frontend struct { cr *chunkReader w io.Writer // tracer is used to trace messages when Send or Receive is called. This means an outbound message is traced // before it is actually transmitted (i.e. before Flush). It is safe to change this variable when the Frontend is // idle. Setting and unsetting tracer provides equivalent functionality to PQtrace and PQuntrace in libpq. tracer *tracer wbuf []byte encodeError error // Backend message flyweights authenticationOk AuthenticationOk authenticationCleartextPassword AuthenticationCleartextPassword authenticationMD5Password AuthenticationMD5Password authenticationGSS AuthenticationGSS authenticationGSSContinue AuthenticationGSSContinue authenticationSASL AuthenticationSASL authenticationSASLContinue AuthenticationSASLContinue authenticationSASLFinal AuthenticationSASLFinal backendKeyData BackendKeyData bindComplete BindComplete closeComplete CloseComplete commandComplete CommandComplete copyBothResponse CopyBothResponse copyData CopyData copyInResponse CopyInResponse copyOutResponse CopyOutResponse copyDone CopyDone dataRow DataRow emptyQueryResponse EmptyQueryResponse errorResponse ErrorResponse functionCallResponse FunctionCallResponse noData NoData noticeResponse NoticeResponse notificationResponse NotificationResponse parameterDescription ParameterDescription parameterStatus ParameterStatus parseComplete ParseComplete readyForQuery ReadyForQuery rowDescription RowDescription portalSuspended PortalSuspended bodyLen int maxBodyLen int // maxBodyLen is the maximum length of a message body in octets. If a message body exceeds this length, Receive will return an error. msgType byte partialMsg bool authType uint32 } // NewFrontend creates a new Frontend. func NewFrontend(r io.Reader, w io.Writer) *Frontend { cr := newChunkReader(r, 0) return &Frontend{cr: cr, w: w} } // Send sends a message to the backend (i.e. the server). The message is buffered until Flush is called. Any error // encountered will be returned from Flush. // // Send can work with any FrontendMessage. Some commonly used message types such as Bind have specialized send methods // such as SendBind. These methods should be preferred when the type of message is known up front (e.g. when building an // extended query protocol query) as they may be faster due to knowing the type of msg rather than it being hidden // behind an interface. func (f *Frontend) Send(msg FrontendMessage) { if f.encodeError != nil { return } prevLen := len(f.wbuf) newBuf, err := msg.Encode(f.wbuf) if err != nil { f.encodeError = err return } f.wbuf = newBuf if f.tracer != nil { f.tracer.traceMessage('F', int32(len(f.wbuf)-prevLen), msg) } } // Flush writes any pending messages to the backend (i.e. the server). func (f *Frontend) Flush() error { if err := f.encodeError; err != nil { f.encodeError = nil f.wbuf = f.wbuf[:0] return &writeError{err: err, safeToRetry: true} } if len(f.wbuf) == 0 { return nil } n, err := f.w.Write(f.wbuf) const maxLen = 1024 if len(f.wbuf) > maxLen { f.wbuf = make([]byte, 0, maxLen) } else { f.wbuf = f.wbuf[:0] } if err != nil { return &writeError{err: err, safeToRetry: n == 0} } return nil } // Trace starts tracing the message traffic to w. It writes in a similar format to that produced by the libpq function // PQtrace. func (f *Frontend) Trace(w io.Writer, options TracerOptions) { f.tracer = &tracer{ w: w, buf: &bytes.Buffer{}, TracerOptions: options, } } // Untrace stops tracing. func (f *Frontend) Untrace() { f.tracer = nil } // SendBind sends a Bind message to the backend (i.e. the server). The message is buffered until Flush is called. Any // error encountered will be returned from Flush. func (f *Frontend) SendBind(msg *Bind) { if f.encodeError != nil { return } prevLen := len(f.wbuf) newBuf, err := msg.Encode(f.wbuf) if err != nil { f.encodeError = err return } f.wbuf = newBuf if f.tracer != nil { f.tracer.traceBind('F', int32(len(f.wbuf)-prevLen), msg) } } // SendParse sends a Parse message to the backend (i.e. the server). The message is buffered until Flush is called. Any // error encountered will be returned from Flush. func (f *Frontend) SendParse(msg *Parse) { if f.encodeError != nil { return } prevLen := len(f.wbuf) newBuf, err := msg.Encode(f.wbuf) if err != nil { f.encodeError = err return } f.wbuf = newBuf if f.tracer != nil { f.tracer.traceParse('F', int32(len(f.wbuf)-prevLen), msg) } } // SendClose sends a Close message to the backend (i.e. the server). The message is buffered until Flush is called. Any // error encountered will be returned from Flush. func (f *Frontend) SendClose(msg *Close) { if f.encodeError != nil { return } prevLen := len(f.wbuf) newBuf, err := msg.Encode(f.wbuf) if err != nil { f.encodeError = err return } f.wbuf = newBuf if f.tracer != nil { f.tracer.traceClose('F', int32(len(f.wbuf)-prevLen), msg) } } // SendDescribe sends a Describe message to the backend (i.e. the server). The message is buffered until Flush is // called. Any error encountered will be returned from Flush. func (f *Frontend) SendDescribe(msg *Describe) { if f.encodeError != nil { return } prevLen := len(f.wbuf) newBuf, err := msg.Encode(f.wbuf) if err != nil { f.encodeError = err return } f.wbuf = newBuf if f.tracer != nil { f.tracer.traceDescribe('F', int32(len(f.wbuf)-prevLen), msg) } } // SendExecute sends an Execute message to the backend (i.e. the server). The message is buffered until Flush is called. // Any error encountered will be returned from Flush. func (f *Frontend) SendExecute(msg *Execute) { if f.encodeError != nil { return } prevLen := len(f.wbuf) newBuf, err := msg.Encode(f.wbuf) if err != nil { f.encodeError = err return } f.wbuf = newBuf if f.tracer != nil { f.tracer.TraceQueryute('F', int32(len(f.wbuf)-prevLen), msg) } } // SendSync sends a Sync message to the backend (i.e. the server). The message is buffered until Flush is called. Any // error encountered will be returned from Flush. func (f *Frontend) SendSync(msg *Sync) { if f.encodeError != nil { return } prevLen := len(f.wbuf) newBuf, err := msg.Encode(f.wbuf) if err != nil { f.encodeError = err return } f.wbuf = newBuf if f.tracer != nil { f.tracer.traceSync('F', int32(len(f.wbuf)-prevLen), msg) } } // SendQuery sends a Query message to the backend (i.e. the server). The message is buffered until Flush is called. Any // error encountered will be returned from Flush. func (f *Frontend) SendQuery(msg *Query) { if f.encodeError != nil { return } prevLen := len(f.wbuf) newBuf, err := msg.Encode(f.wbuf) if err != nil { f.encodeError = err return } f.wbuf = newBuf if f.tracer != nil { f.tracer.traceQuery('F', int32(len(f.wbuf)-prevLen), msg) } } // SendUnbufferedEncodedCopyData immediately sends an encoded CopyData message to the backend (i.e. the server). This method // is more efficient than sending a CopyData message with Send as the message data is not copied to the internal buffer // before being written out. The internal buffer is flushed before the message is sent. func (f *Frontend) SendUnbufferedEncodedCopyData(msg []byte) error { err := f.Flush() if err != nil { return err } n, err := f.w.Write(msg) if err != nil { return &writeError{err: err, safeToRetry: n == 0} } if f.tracer != nil { f.tracer.traceCopyData('F', int32(len(msg)-1), &CopyData{}) } return nil } func translateEOFtoErrUnexpectedEOF(err error) error { if err == io.EOF { return io.ErrUnexpectedEOF } return err } // Receive receives a message from the backend. The returned message is only valid until the next call to Receive. func (f *Frontend) Receive() (BackendMessage, error) { if !f.partialMsg { header, err := f.cr.Next(5) if err != nil { return nil, translateEOFtoErrUnexpectedEOF(err) } f.msgType = header[0] msgLength := int(binary.BigEndian.Uint32(header[1:])) if msgLength < 4 { return nil, fmt.Errorf("invalid message length: %d", msgLength) } f.bodyLen = msgLength - 4 if f.maxBodyLen > 0 && f.bodyLen > f.maxBodyLen { return nil, &ExceededMaxBodyLenErr{f.maxBodyLen, f.bodyLen} } f.partialMsg = true } msgBody, err := f.cr.Next(f.bodyLen) if err != nil { return nil, translateEOFtoErrUnexpectedEOF(err) } f.partialMsg = false var msg BackendMessage switch f.msgType { case '1': msg = &f.parseComplete case '2': msg = &f.bindComplete case '3': msg = &f.closeComplete case 'A': msg = &f.notificationResponse case 'c': msg = &f.copyDone case 'C': msg = &f.commandComplete case 'd': msg = &f.copyData case 'D': msg = &f.dataRow case 'E': msg = &f.errorResponse case 'G': msg = &f.copyInResponse case 'H': msg = &f.copyOutResponse case 'I': msg = &f.emptyQueryResponse case 'K': msg = &f.backendKeyData case 'n': msg = &f.noData case 'N': msg = &f.noticeResponse case 'R': var err error msg, err = f.findAuthenticationMessageType(msgBody) if err != nil { return nil, err } case 's': msg = &f.portalSuspended case 'S': msg = &f.parameterStatus case 't': msg = &f.parameterDescription case 'T': msg = &f.rowDescription case 'V': msg = &f.functionCallResponse case 'W': msg = &f.copyBothResponse case 'Z': msg = &f.readyForQuery default: return nil, fmt.Errorf("unknown message type: %c", f.msgType) } err = msg.Decode(msgBody) if err != nil { return nil, err } if f.tracer != nil { f.tracer.traceMessage('B', int32(5+len(msgBody)), msg) } return msg, nil } // Authentication message type constants. // See src/include/libpq/pqcomm.h for all // constants. const ( AuthTypeOk = 0 AuthTypeCleartextPassword = 3 AuthTypeMD5Password = 5 AuthTypeSCMCreds = 6 AuthTypeGSS = 7 AuthTypeGSSCont = 8 AuthTypeSSPI = 9 AuthTypeSASL = 10 AuthTypeSASLContinue = 11 AuthTypeSASLFinal = 12 ) func (f *Frontend) findAuthenticationMessageType(src []byte) (BackendMessage, error) { if len(src) < 4 { return nil, errors.New("authentication message too short") } f.authType = binary.BigEndian.Uint32(src[:4]) switch f.authType { case AuthTypeOk: return &f.authenticationOk, nil case AuthTypeCleartextPassword: return &f.authenticationCleartextPassword, nil case AuthTypeMD5Password: return &f.authenticationMD5Password, nil case AuthTypeSCMCreds: return nil, errors.New("AuthTypeSCMCreds is unimplemented") case AuthTypeGSS: return &f.authenticationGSS, nil case AuthTypeGSSCont: return &f.authenticationGSSContinue, nil case AuthTypeSSPI: return nil, errors.New("AuthTypeSSPI is unimplemented") case AuthTypeSASL: return &f.authenticationSASL, nil case AuthTypeSASLContinue: return &f.authenticationSASLContinue, nil case AuthTypeSASLFinal: return &f.authenticationSASLFinal, nil default: return nil, fmt.Errorf("unknown authentication type: %d", f.authType) } } // GetAuthType returns the authType used in the current state of the frontend. // See SetAuthType for more information. func (f *Frontend) GetAuthType() uint32 { return f.authType } func (f *Frontend) ReadBufferLen() int { return f.cr.wp - f.cr.rp } // SetMaxBodyLen sets the maximum length of a message body in octets. // If a message body exceeds this length, Receive will return an error. // This is useful for protecting against a corrupted server that sends // messages with incorrect length, which can cause memory exhaustion. // The default value is 0. // If maxBodyLen is 0, then no maximum is enforced. func (f *Frontend) SetMaxBodyLen(maxBodyLen int) { f.maxBodyLen = maxBodyLen } pgx-5.8.0/pgproto3/frontend_test.go000066400000000000000000000057771512357711200173300ustar00rootroot00000000000000package pgproto3_test import ( "io" "testing" "github.com/jackc/pgx/v5/pgproto3" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) type interruptReader struct { chunks [][]byte } func (ir *interruptReader) Read(p []byte) (n int, err error) { if len(ir.chunks) == 0 { return 0, io.EOF } n = copy(p, ir.chunks[0]) if n != len(ir.chunks[0]) { panic("this test reader doesn't support partial reads of chunks") } ir.chunks = ir.chunks[1:] return n, nil } func (ir *interruptReader) push(p []byte) { ir.chunks = append(ir.chunks, p) } func TestFrontendReceiveInterrupted(t *testing.T) { t.Parallel() server := &interruptReader{} server.push([]byte{'Z', 0, 0, 0, 5}) frontend := pgproto3.NewFrontend(server, nil) msg, err := frontend.Receive() if err == nil { t.Fatal("expected err") } if msg != nil { t.Fatalf("did not expect msg, but %v", msg) } server.push([]byte{'I'}) msg, err = frontend.Receive() if err != nil { t.Fatal(err) } if msg, ok := msg.(*pgproto3.ReadyForQuery); !ok || msg.TxStatus != 'I' { t.Fatalf("unexpected msg: %v", msg) } } func TestFrontendReceiveUnexpectedEOF(t *testing.T) { t.Parallel() server := &interruptReader{} server.push([]byte{'Z', 0, 0, 0, 5}) frontend := pgproto3.NewFrontend(server, nil) msg, err := frontend.Receive() if err == nil { t.Fatal("expected err") } if msg != nil { t.Fatalf("did not expect msg, but %v", msg) } msg, err = frontend.Receive() assert.Nil(t, msg) assert.Equal(t, io.ErrUnexpectedEOF, err) } func TestErrorResponse(t *testing.T) { t.Parallel() want := &pgproto3.ErrorResponse{ Severity: "ERROR", SeverityUnlocalized: "ERROR", Message: `column "foo" does not exist`, File: "parse_relation.c", Code: "42703", Position: 8, Line: 3513, Routine: "errorMissingColumn", } raw := []byte{ 'E', 0, 0, 0, 'f', 'S', 'E', 'R', 'R', 'O', 'R', 0, 'V', 'E', 'R', 'R', 'O', 'R', 0, 'C', '4', '2', '7', '0', '3', 0, 'M', 'c', 'o', 'l', 'u', 'm', 'n', 32, '"', 'f', 'o', 'o', '"', 32, 'd', 'o', 'e', 's', 32, 'n', 'o', 't', 32, 'e', 'x', 'i', 's', 't', 0, 'P', '8', 0, 'F', 'p', 'a', 'r', 's', 'e', '_', 'r', 'e', 'l', 'a', 't', 'i', 'o', 'n', '.', 'c', 0, 'L', '3', '5', '1', '3', 0, 'R', 'e', 'r', 'r', 'o', 'r', 'M', 'i', 's', 's', 'i', 'n', 'g', 'C', 'o', 'l', 'u', 'm', 'n', 0, 0, } server := &interruptReader{} server.push(raw) frontend := pgproto3.NewFrontend(server, nil) got, err := frontend.Receive() require.NoError(t, err) assert.Equal(t, want, got) } func TestFrontendReceiveExceededMaxBodyLen(t *testing.T) { t.Parallel() client := &interruptReader{} client.push([]byte{'D', 0, 0, 10, 10}) frontend := pgproto3.NewFrontend(client, nil) // Set max body len to 5 frontend.SetMaxBodyLen(5) // Receive regular msg msg, err := frontend.Receive() assert.Nil(t, msg) var invalidBodyLenErr *pgproto3.ExceededMaxBodyLenErr assert.ErrorAs(t, err, &invalidBodyLenErr) } pgx-5.8.0/pgproto3/function_call.go000066400000000000000000000067341512357711200172640ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "errors" "math" "github.com/jackc/pgx/v5/internal/pgio" ) type FunctionCall struct { Function uint32 ArgFormatCodes []uint16 Arguments [][]byte ResultFormatCode uint16 } // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*FunctionCall) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *FunctionCall) Decode(src []byte) error { *dst = FunctionCall{} rp := 0 // Specifies the object ID of the function to call. dst.Function = binary.BigEndian.Uint32(src[rp:]) rp += 4 // The number of argument format codes that follow (denoted C below). // This can be zero to indicate that there are no arguments or that the arguments all use the default format (text); // or one, in which case the specified format code is applied to all arguments; // or it can equal the actual number of arguments. nArgumentCodes := int(binary.BigEndian.Uint16(src[rp:])) rp += 2 argumentCodes := make([]uint16, nArgumentCodes) for i := range nArgumentCodes { // The argument format codes. Each must presently be zero (text) or one (binary). ac := binary.BigEndian.Uint16(src[rp:]) if ac != 0 && ac != 1 { return &invalidMessageFormatErr{messageType: "FunctionCall"} } argumentCodes[i] = ac rp += 2 } dst.ArgFormatCodes = argumentCodes // Specifies the number of arguments being supplied to the function. nArguments := int(binary.BigEndian.Uint16(src[rp:])) rp += 2 arguments := make([][]byte, nArguments) for i := range nArguments { // The length of the argument value, in bytes (this count does not include itself). Can be zero. // As a special case, -1 indicates a NULL argument value. No value bytes follow in the NULL case. argumentLength := int(binary.BigEndian.Uint32(src[rp:])) rp += 4 if argumentLength == -1 { arguments[i] = nil } else { // The value of the argument, in the format indicated by the associated format code. n is the above length. argumentValue := src[rp : rp+argumentLength] rp += argumentLength arguments[i] = argumentValue } } dst.Arguments = arguments // The format code for the function result. Must presently be zero (text) or one (binary). resultFormatCode := binary.BigEndian.Uint16(src[rp:]) if resultFormatCode != 0 && resultFormatCode != 1 { return &invalidMessageFormatErr{messageType: "FunctionCall"} } dst.ResultFormatCode = resultFormatCode return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *FunctionCall) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'F') dst = pgio.AppendUint32(dst, src.Function) if len(src.ArgFormatCodes) > math.MaxUint16 { return nil, errors.New("too many arg format codes") } dst = pgio.AppendUint16(dst, uint16(len(src.ArgFormatCodes))) for _, argFormatCode := range src.ArgFormatCodes { dst = pgio.AppendUint16(dst, argFormatCode) } if len(src.Arguments) > math.MaxUint16 { return nil, errors.New("too many arguments") } dst = pgio.AppendUint16(dst, uint16(len(src.Arguments))) for _, argument := range src.Arguments { if argument == nil { dst = pgio.AppendInt32(dst, -1) } else { dst = pgio.AppendInt32(dst, int32(len(argument))) dst = append(dst, argument...) } } dst = pgio.AppendUint16(dst, src.ResultFormatCode) return finishMessage(dst, sp) } pgx-5.8.0/pgproto3/function_call_response.go000066400000000000000000000043661512357711200212010ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "encoding/hex" "encoding/json" "github.com/jackc/pgx/v5/internal/pgio" ) type FunctionCallResponse struct { Result []byte } // Backend identifies this message as sendable by the PostgreSQL backend. func (*FunctionCallResponse) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *FunctionCallResponse) Decode(src []byte) error { if len(src) < 4 { return &invalidMessageFormatErr{messageType: "FunctionCallResponse"} } rp := 0 resultSize := int(binary.BigEndian.Uint32(src[rp:])) rp += 4 if resultSize == -1 { dst.Result = nil return nil } if len(src[rp:]) != resultSize { return &invalidMessageFormatErr{messageType: "FunctionCallResponse"} } dst.Result = src[rp:] return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *FunctionCallResponse) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'V') if src.Result == nil { dst = pgio.AppendInt32(dst, -1) } else { dst = pgio.AppendInt32(dst, int32(len(src.Result))) dst = append(dst, src.Result...) } return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src FunctionCallResponse) MarshalJSON() ([]byte, error) { var formattedValue map[string]string var hasNonPrintable bool for _, b := range src.Result { if b < 32 { hasNonPrintable = true break } } if hasNonPrintable { formattedValue = map[string]string{"binary": hex.EncodeToString(src.Result)} } else { formattedValue = map[string]string{"text": string(src.Result)} } return json.Marshal(struct { Type string Result map[string]string }{ Type: "FunctionCallResponse", Result: formattedValue, }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *FunctionCallResponse) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { Result map[string]string } err := json.Unmarshal(data, &msg) if err != nil { return err } dst.Result, err = getValueFromJSON(msg.Result) return err } pgx-5.8.0/pgproto3/function_call_test.go000066400000000000000000000036031512357711200203130ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "reflect" "testing" "github.com/stretchr/testify/require" ) func TestFunctionCall_EncodeDecode(t *testing.T) { type fields struct { Function uint32 ArgFormatCodes []uint16 Arguments [][]byte ResultFormatCode uint16 } tests := []struct { name string fields fields wantErr bool }{ {"valid", fields{uint32(123), []uint16{0, 1, 0, 1}, [][]byte{[]byte("foo"), []byte("bar"), []byte("baz")}, uint16(1)}, false}, {"invalid format code", fields{uint32(123), []uint16{2, 1, 0, 1}, [][]byte{[]byte("foo"), []byte("bar"), []byte("baz")}, uint16(0)}, true}, {"invalid result format code", fields{uint32(123), []uint16{1, 1, 0, 1}, [][]byte{[]byte("foo"), []byte("bar"), []byte("baz")}, uint16(2)}, true}, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { src := &FunctionCall{ Function: tt.fields.Function, ArgFormatCodes: tt.fields.ArgFormatCodes, Arguments: tt.fields.Arguments, ResultFormatCode: tt.fields.ResultFormatCode, } encoded, err := src.Encode([]byte{}) require.NoError(t, err) dst := &FunctionCall{} // Check the header msgTypeCode := encoded[0] if msgTypeCode != 'F' { t.Errorf("msgTypeCode %v should be 'F'", msgTypeCode) return } // Check length, does not include type code character l := binary.BigEndian.Uint32(encoded[1:5]) if int(l) != (len(encoded) - 1) { t.Errorf("Incorrect message length, got = %v, wanted = %v", l, len(encoded)) } // Check decoding works as expected err = dst.Decode(encoded[5:]) if err != nil { if !tt.wantErr { t.Errorf("FunctionCall.Decode() error = %v, wantErr %v", err, tt.wantErr) } return } if !reflect.DeepEqual(src, dst) { t.Error("difference after encode / decode cycle") t.Errorf("src = %v", src) t.Errorf("dst = %v", dst) } }) } } pgx-5.8.0/pgproto3/fuzz_test.go000066400000000000000000000022501512357711200164660ustar00rootroot00000000000000package pgproto3_test import ( "bytes" "testing" "github.com/jackc/pgx/v5/internal/pgio" "github.com/jackc/pgx/v5/pgproto3" "github.com/stretchr/testify/require" ) func FuzzFrontend(f *testing.F) { testcases := []struct { msgType byte msgLen uint32 msgBody []byte }{ { msgType: 'Z', msgLen: 2, msgBody: []byte{'I'}, }, { msgType: 'Z', msgLen: 5, msgBody: []byte{'I'}, }, } for _, tc := range testcases { f.Add(tc.msgType, tc.msgLen, tc.msgBody) } f.Fuzz(func(t *testing.T, msgType byte, msgLen uint32, msgBody []byte) { // Prune any msgLen > len(msgBody) because they would hang the test waiting for more input. if int(msgLen) > len(msgBody)+4 { return } // Prune any messages that are too long. if msgLen > 128 || len(msgBody) > 128 { return } r := &bytes.Buffer{} w := &bytes.Buffer{} fe := pgproto3.NewFrontend(r, w) var encodedMsg []byte encodedMsg = append(encodedMsg, msgType) encodedMsg = pgio.AppendUint32(encodedMsg, msgLen) encodedMsg = append(encodedMsg, msgBody...) _, err := r.Write(encodedMsg) require.NoError(t, err) // Not checking anything other than no panic. fe.Receive() }) } pgx-5.8.0/pgproto3/gss_enc_request.go000066400000000000000000000020611512357711200176220ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "encoding/json" "errors" "github.com/jackc/pgx/v5/internal/pgio" ) const gssEncReqNumber = 80877104 type GSSEncRequest struct{} // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*GSSEncRequest) Frontend() {} func (dst *GSSEncRequest) Decode(src []byte) error { if len(src) < 4 { return errors.New("gss encoding request too short") } requestCode := binary.BigEndian.Uint32(src) if requestCode != gssEncReqNumber { return errors.New("bad gss encoding request code") } return nil } // Encode encodes src into dst. dst will include the 4 byte message length. func (src *GSSEncRequest) Encode(dst []byte) ([]byte, error) { dst = pgio.AppendInt32(dst, 8) dst = pgio.AppendInt32(dst, gssEncReqNumber) return dst, nil } // MarshalJSON implements encoding/json.Marshaler. func (src GSSEncRequest) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string ProtocolVersion uint32 Parameters map[string]string }{ Type: "GSSEncRequest", }) } pgx-5.8.0/pgproto3/gss_response.go000066400000000000000000000016031512357711200171440ustar00rootroot00000000000000package pgproto3 import ( "encoding/json" ) type GSSResponse struct { Data []byte } // Frontend identifies this message as sendable by a PostgreSQL frontend. func (g *GSSResponse) Frontend() {} func (g *GSSResponse) Decode(data []byte) error { g.Data = data return nil } func (g *GSSResponse) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'p') dst = append(dst, g.Data...) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (g *GSSResponse) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Data []byte }{ Type: "GSSResponse", Data: g.Data, }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (g *GSSResponse) UnmarshalJSON(data []byte) error { var msg struct { Data []byte } if err := json.Unmarshal(data, &msg); err != nil { return err } g.Data = msg.Data return nil } pgx-5.8.0/pgproto3/json_test.go000066400000000000000000000420541512357711200164470ustar00rootroot00000000000000package pgproto3 import ( "encoding/hex" "encoding/json" "reflect" "testing" ) func TestJSONUnmarshalAuthenticationMD5Password(t *testing.T) { data := []byte(`{"Type":"AuthenticationMD5Password", "Salt":[97,98,99,100]}`) want := AuthenticationMD5Password{ Salt: [4]byte{'a', 'b', 'c', 'd'}, } var got AuthenticationMD5Password if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled AuthenticationMD5Password struct doesn't match expected value") } } func TestJSONUnmarshalAuthenticationSASL(t *testing.T) { data := []byte(`{"Type":"AuthenticationSASL","AuthMechanisms":["SCRAM-SHA-256"]}`) want := AuthenticationSASL{ []string{"SCRAM-SHA-256"}, } var got AuthenticationSASL if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled AuthenticationSASL struct doesn't match expected value") } } func TestJSONUnmarshalAuthenticationGSS(t *testing.T) { data := []byte(`{"Type":"AuthenticationGSS"}`) want := AuthenticationGSS{} var got AuthenticationGSS if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled AuthenticationGSS struct doesn't match expected value") } } func TestJSONUnmarshalAuthenticationGSSContinue(t *testing.T) { data := []byte(`{"Type":"AuthenticationGSSContinue","Data":[1,2,3,4]}`) want := AuthenticationGSSContinue{Data: []byte{1, 2, 3, 4}} var got AuthenticationGSSContinue if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled AuthenticationGSSContinue struct doesn't match expected value") } } func TestJSONUnmarshalAuthenticationSASLContinue(t *testing.T) { data := []byte(`{"Type":"AuthenticationSASLContinue", "Data":"1"}`) want := AuthenticationSASLContinue{ Data: []byte{'1'}, } var got AuthenticationSASLContinue if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled AuthenticationSASLContinue struct doesn't match expected value") } } func TestJSONUnmarshalAuthenticationSASLFinal(t *testing.T) { data := []byte(`{"Type":"AuthenticationSASLFinal", "Data":"1"}`) want := AuthenticationSASLFinal{ Data: []byte{'1'}, } var got AuthenticationSASLFinal if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled AuthenticationSASLFinal struct doesn't match expected value") } } func TestJSONUnmarshalBackendKeyData(t *testing.T) { data := []byte(`{"Type":"BackendKeyData","ProcessID":8864,"SecretKey":3641487067}`) want := BackendKeyData{ ProcessID: 8864, SecretKey: 3641487067, } var got BackendKeyData if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled BackendKeyData struct doesn't match expected value") } } func TestJSONUnmarshalCommandComplete(t *testing.T) { data := []byte(`{"Type":"CommandComplete","CommandTag":"SELECT 1"}`) want := CommandComplete{ CommandTag: []byte("SELECT 1"), } var got CommandComplete if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled CommandComplete struct doesn't match expected value") } } func TestJSONUnmarshalCopyBothResponse(t *testing.T) { data := []byte(`{"Type":"CopyBothResponse", "OverallFormat": "W"}`) want := CopyBothResponse{ OverallFormat: 'W', } var got CopyBothResponse if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled CopyBothResponse struct doesn't match expected value") } } func TestJSONUnmarshalCopyData(t *testing.T) { data := []byte(`{"Type":"CopyData"}`) want := CopyData{ Data: []byte{}, } var got CopyData if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled CopyData struct doesn't match expected value") } } func TestJSONUnmarshalCopyInResponse(t *testing.T) { data := []byte(`{"Type":"CopyBothResponse", "OverallFormat": "W"}`) want := CopyBothResponse{ OverallFormat: 'W', } var got CopyBothResponse if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled CopyBothResponse struct doesn't match expected value") } } func TestJSONUnmarshalCopyOutResponse(t *testing.T) { data := []byte(`{"Type":"CopyOutResponse", "OverallFormat": "W"}`) want := CopyOutResponse{ OverallFormat: 'W', } var got CopyOutResponse if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled CopyOutResponse struct doesn't match expected value") } } func TestJSONUnmarshalDataRow(t *testing.T) { data := []byte(`{"Type":"DataRow","Values":[{"text":"abc"},{"text":"this is a test"},{"binary":"000263d3114d2e34"}]}`) want := DataRow{ Values: [][]byte{ []byte("abc"), []byte("this is a test"), {0, 2, 99, 211, 17, 77, 46, 52}, }, } var got DataRow if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled DataRow struct doesn't match expected value") } } func TestJSONUnmarshalErrorResponse(t *testing.T) { data := []byte(`{"Type":"ErrorResponse", "UnknownFields": {"97": "foo"}}`) want := ErrorResponse{ UnknownFields: map[byte]string{ 'a': "foo", }, } var got ErrorResponse if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled ErrorResponse struct doesn't match expected value") } } func TestJSONUnmarshalFunctionCallResponse(t *testing.T) { data := []byte(`{"Type":"FunctionCallResponse"}`) want := FunctionCallResponse{} var got FunctionCallResponse if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled FunctionCallResponse struct doesn't match expected value") } } func TestJSONUnmarshalNoticeResponse(t *testing.T) { data := []byte(`{"Type":"NoticeResponse", "UnknownFields": {"97": "foo"}}`) want := NoticeResponse{ UnknownFields: map[byte]string{ 'a': "foo", }, } var got NoticeResponse if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled NoticeResponse struct doesn't match expected value") } } func TestJSONUnmarshalNotificationResponse(t *testing.T) { data := []byte(`{"Type":"NotificationResponse"}`) want := NotificationResponse{} var got NotificationResponse if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled NotificationResponse struct doesn't match expected value") } } func TestJSONUnmarshalParameterDescription(t *testing.T) { data := []byte(`{"Type":"ParameterDescription", "ParameterOIDs": [25]}`) want := ParameterDescription{ ParameterOIDs: []uint32{25}, } var got ParameterDescription if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled ParameterDescription struct doesn't match expected value") } } func TestJSONUnmarshalParameterStatus(t *testing.T) { data := []byte(`{"Type":"ParameterStatus","Name":"TimeZone","Value":"Europe/Amsterdam"}`) want := ParameterStatus{ Name: "TimeZone", Value: "Europe/Amsterdam", } var got ParameterStatus if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled ParameterDescription struct doesn't match expected value") } } func TestJSONUnmarshalReadyForQuery(t *testing.T) { data := []byte(`{"Type":"ReadyForQuery","TxStatus":"I"}`) want := ReadyForQuery{ TxStatus: 'I', } var got ReadyForQuery if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled ParameterDescription struct doesn't match expected value") } } func TestJSONUnmarshalRowDescription(t *testing.T) { data := []byte(`{"Type":"RowDescription","Fields":[{"Name":"generate_series","TableOID":0,"TableAttributeNumber":0,"DataTypeOID":23,"DataTypeSize":4,"TypeModifier":-1,"Format":0}]}`) want := RowDescription{ Fields: []FieldDescription{ { Name: []byte("generate_series"), DataTypeOID: 23, DataTypeSize: 4, TypeModifier: -1, }, }, } var got RowDescription if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled RowDescription struct doesn't match expected value") } } func TestJSONUnmarshalBind(t *testing.T) { testCases := []struct { desc string data []byte }{ { "textual", []byte(`{"Type":"Bind","DestinationPortal":"","PreparedStatement":"lrupsc_1_0","ParameterFormatCodes":[0],"Parameters":[{"text":"ABC-123"}],"ResultFormatCodes":[0,0,0,0,0,1,1]}`), }, { "binary", []byte(`{"Type":"Bind","DestinationPortal":"","PreparedStatement":"lrupsc_1_0","ParameterFormatCodes":[0],"Parameters":[{"binary":"` + hex.EncodeToString([]byte("ABC-123")) + `"}],"ResultFormatCodes":[0,0,0,0,0,1,1]}`), }, } for _, tc := range testCases { t.Run(tc.desc, func(t *testing.T) { want := Bind{ PreparedStatement: "lrupsc_1_0", ParameterFormatCodes: []int16{0}, Parameters: [][]byte{[]byte("ABC-123")}, ResultFormatCodes: []int16{0, 0, 0, 0, 0, 1, 1}, } var got Bind if err := json.Unmarshal(tc.data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled Bind struct doesn't match expected value") } }) } } func TestJSONUnmarshalCancelRequest(t *testing.T) { data := []byte(`{"Type":"CancelRequest","ProcessID":8864,"SecretKey":3641487067}`) want := CancelRequest{ ProcessID: 8864, SecretKey: 3641487067, } var got CancelRequest if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled CancelRequest struct doesn't match expected value") } } func TestJSONUnmarshalClose(t *testing.T) { data := []byte(`{"Type":"Close","ObjectType":"S","Name":"abc"}`) want := Close{ ObjectType: 'S', Name: "abc", } var got Close if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled Close struct doesn't match expected value") } } func TestJSONUnmarshalCopyFail(t *testing.T) { data := []byte(`{"Type":"CopyFail","Message":"abc"}`) want := CopyFail{ Message: "abc", } var got CopyFail if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled CopyFail struct doesn't match expected value") } } func TestJSONUnmarshalDescribe(t *testing.T) { data := []byte(`{"Type":"Describe","ObjectType":"S","Name":"abc"}`) want := Describe{ ObjectType: 'S', Name: "abc", } var got Describe if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled Describe struct doesn't match expected value") } } func TestJSONUnmarshalExecute(t *testing.T) { data := []byte(`{"Type":"Execute","Portal":"","MaxRows":0}`) want := Execute{} var got Execute if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled Execute struct doesn't match expected value") } } func TestJSONUnmarshalParse(t *testing.T) { data := []byte(`{"Type":"Parse","Name":"lrupsc_1_0","Query":"SELECT id, name FROM t WHERE id = $1","ParameterOIDs":null}`) want := Parse{ Name: "lrupsc_1_0", Query: "SELECT id, name FROM t WHERE id = $1", } var got Parse if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled Parse struct doesn't match expected value") } } func TestJSONUnmarshalPasswordMessage(t *testing.T) { data := []byte(`{"Type":"PasswordMessage","Password":"abcdef"}`) want := PasswordMessage{ Password: "abcdef", } var got PasswordMessage if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled PasswordMessage struct doesn't match expected value") } } func TestJSONUnmarshalQuery(t *testing.T) { data := []byte(`{"Type":"Query","String":"SELECT 1"}`) want := Query{ String: "SELECT 1", } var got Query if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled Query struct doesn't match expected value") } } func TestJSONUnmarshalSASLInitialResponse(t *testing.T) { data := []byte(`{"Type":"SASLInitialResponse", "AuthMechanism":"SCRAM-SHA-256", "Data": "6D"}`) want := SASLInitialResponse{ AuthMechanism: "SCRAM-SHA-256", Data: []byte{109}, } var got SASLInitialResponse if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled SASLInitialResponse struct doesn't match expected value") } } func TestJSONUnmarshalSASLResponse(t *testing.T) { data := []byte(`{"Type":"SASLResponse","Message":"abc"}`) want := SASLResponse{} var got SASLResponse if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled SASLResponse struct doesn't match expected value") } } func TestJSONUnmarshalStartupMessage(t *testing.T) { data := []byte(`{"Type":"StartupMessage","ProtocolVersion":196608,"Parameters":{"database":"testing","user":"postgres"}}`) want := StartupMessage{ ProtocolVersion: 196608, Parameters: map[string]string{ "database": "testing", "user": "postgres", }, } var got StartupMessage if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled StartupMessage struct doesn't match expected value") } } func TestAuthenticationOK(t *testing.T) { data := []byte(`{"Type":"AuthenticationOK"}`) want := AuthenticationOk{} var got AuthenticationOk if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled AuthenticationOK struct doesn't match expected value") } } func TestAuthenticationCleartextPassword(t *testing.T) { data := []byte(`{"Type":"AuthenticationCleartextPassword"}`) want := AuthenticationCleartextPassword{} var got AuthenticationCleartextPassword if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled AuthenticationCleartextPassword struct doesn't match expected value") } } func TestAuthenticationMD5Password(t *testing.T) { data := []byte(`{"Type":"AuthenticationMD5Password","Salt":[1,2,3,4]}`) want := AuthenticationMD5Password{ Salt: [4]byte{1, 2, 3, 4}, } var got AuthenticationMD5Password if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled AuthenticationMD5Password struct doesn't match expected value") } } func TestJSONUnmarshalGSSResponse(t *testing.T) { data := []byte(`{"Type":"GSSResponse","Data":[10,20,30,40]}`) want := GSSResponse{Data: []byte{10, 20, 30, 40}} var got GSSResponse if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled GSSResponse struct doesn't match expected value") } } func TestErrorResponse(t *testing.T) { data := []byte(`{"Type":"ErrorResponse","UnknownFields":{"112":"foo"},"Code": "Fail","Position":1,"Message":"this is an error"}`) want := ErrorResponse{ UnknownFields: map[byte]string{ 'p': "foo", }, Code: "Fail", Position: 1, Message: "this is an error", } var got ErrorResponse if err := json.Unmarshal(data, &got); err != nil { t.Errorf("cannot JSON unmarshal %v", err) } if !reflect.DeepEqual(got, want) { t.Error("unmarshaled ErrorResponse struct doesn't match expected value") } } pgx-5.8.0/pgproto3/no_data.go000066400000000000000000000016061512357711200160420ustar00rootroot00000000000000package pgproto3 import ( "encoding/json" ) type NoData struct{} // Backend identifies this message as sendable by the PostgreSQL backend. func (*NoData) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *NoData) Decode(src []byte) error { if len(src) != 0 { return &invalidMessageLenErr{messageType: "NoData", expectedLen: 0, actualLen: len(src)} } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *NoData) Encode(dst []byte) ([]byte, error) { return append(dst, 'n', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. func (src NoData) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string }{ Type: "NoData", }) } pgx-5.8.0/pgproto3/notice_response.go000066400000000000000000000013221512357711200176270ustar00rootroot00000000000000package pgproto3 type NoticeResponse ErrorResponse // Backend identifies this message as sendable by the PostgreSQL backend. func (*NoticeResponse) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *NoticeResponse) Decode(src []byte) error { return (*ErrorResponse)(dst).Decode(src) } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *NoticeResponse) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'N') dst = (*ErrorResponse)(src).appendFields(dst) return finishMessage(dst, sp) } pgx-5.8.0/pgproto3/notification_response.go000066400000000000000000000033261512357711200210420ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/binary" "encoding/json" "github.com/jackc/pgx/v5/internal/pgio" ) type NotificationResponse struct { PID uint32 Channel string Payload string } // Backend identifies this message as sendable by the PostgreSQL backend. func (*NotificationResponse) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *NotificationResponse) Decode(src []byte) error { buf := bytes.NewBuffer(src) if buf.Len() < 4 { return &invalidMessageFormatErr{messageType: "NotificationResponse", details: "too short"} } pid := binary.BigEndian.Uint32(buf.Next(4)) b, err := buf.ReadBytes(0) if err != nil { return err } channel := string(b[:len(b)-1]) b, err = buf.ReadBytes(0) if err != nil { return err } payload := string(b[:len(b)-1]) *dst = NotificationResponse{PID: pid, Channel: channel, Payload: payload} return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *NotificationResponse) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'A') dst = pgio.AppendUint32(dst, src.PID) dst = append(dst, src.Channel...) dst = append(dst, 0) dst = append(dst, src.Payload...) dst = append(dst, 0) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src NotificationResponse) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string PID uint32 Channel string Payload string }{ Type: "NotificationResponse", PID: src.PID, Channel: src.Channel, Payload: src.Payload, }) } pgx-5.8.0/pgproto3/parameter_description.go000066400000000000000000000034521512357711200210210ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/binary" "encoding/json" "errors" "math" "github.com/jackc/pgx/v5/internal/pgio" ) type ParameterDescription struct { ParameterOIDs []uint32 } // Backend identifies this message as sendable by the PostgreSQL backend. func (*ParameterDescription) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *ParameterDescription) Decode(src []byte) error { buf := bytes.NewBuffer(src) if buf.Len() < 2 { return &invalidMessageFormatErr{messageType: "ParameterDescription"} } // Reported parameter count will be incorrect when number of args is greater than uint16 buf.Next(2) // Instead infer parameter count by remaining size of message parameterCount := buf.Len() / 4 *dst = ParameterDescription{ParameterOIDs: make([]uint32, parameterCount)} for i := range parameterCount { dst.ParameterOIDs[i] = binary.BigEndian.Uint32(buf.Next(4)) } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *ParameterDescription) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 't') if len(src.ParameterOIDs) > math.MaxUint16 { return nil, errors.New("too many parameter oids") } dst = pgio.AppendUint16(dst, uint16(len(src.ParameterOIDs))) for _, oid := range src.ParameterOIDs { dst = pgio.AppendUint32(dst, oid) } return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src ParameterDescription) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string ParameterOIDs []uint32 }{ Type: "ParameterDescription", ParameterOIDs: src.ParameterOIDs, }) } pgx-5.8.0/pgproto3/parameter_status.go000066400000000000000000000025011512357711200200130ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/json" ) type ParameterStatus struct { Name string Value string } // Backend identifies this message as sendable by the PostgreSQL backend. func (*ParameterStatus) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *ParameterStatus) Decode(src []byte) error { buf := bytes.NewBuffer(src) b, err := buf.ReadBytes(0) if err != nil { return err } name := string(b[:len(b)-1]) b, err = buf.ReadBytes(0) if err != nil { return err } value := string(b[:len(b)-1]) *dst = ParameterStatus{Name: name, Value: value} return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *ParameterStatus) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'S') dst = append(dst, src.Name...) dst = append(dst, 0) dst = append(dst, src.Value...) dst = append(dst, 0) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (ps ParameterStatus) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Name string Value string }{ Type: "ParameterStatus", Name: ps.Name, Value: ps.Value, }) } pgx-5.8.0/pgproto3/parse.go000066400000000000000000000040431512357711200155450ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/binary" "encoding/json" "errors" "math" "github.com/jackc/pgx/v5/internal/pgio" ) type Parse struct { Name string Query string ParameterOIDs []uint32 } // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*Parse) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *Parse) Decode(src []byte) error { *dst = Parse{} buf := bytes.NewBuffer(src) b, err := buf.ReadBytes(0) if err != nil { return err } dst.Name = string(b[:len(b)-1]) b, err = buf.ReadBytes(0) if err != nil { return err } dst.Query = string(b[:len(b)-1]) if buf.Len() < 2 { return &invalidMessageFormatErr{messageType: "Parse"} } parameterOIDCount := int(binary.BigEndian.Uint16(buf.Next(2))) for range parameterOIDCount { if buf.Len() < 4 { return &invalidMessageFormatErr{messageType: "Parse"} } dst.ParameterOIDs = append(dst.ParameterOIDs, binary.BigEndian.Uint32(buf.Next(4))) } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *Parse) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'P') dst = append(dst, src.Name...) dst = append(dst, 0) dst = append(dst, src.Query...) dst = append(dst, 0) if len(src.ParameterOIDs) > math.MaxUint16 { return nil, errors.New("too many parameter oids") } dst = pgio.AppendUint16(dst, uint16(len(src.ParameterOIDs))) for _, oid := range src.ParameterOIDs { dst = pgio.AppendUint32(dst, oid) } return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src Parse) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Name string Query string ParameterOIDs []uint32 }{ Type: "Parse", Name: src.Name, Query: src.Query, ParameterOIDs: src.ParameterOIDs, }) } pgx-5.8.0/pgproto3/parse_complete.go000066400000000000000000000016671512357711200174460ustar00rootroot00000000000000package pgproto3 import ( "encoding/json" ) type ParseComplete struct{} // Backend identifies this message as sendable by the PostgreSQL backend. func (*ParseComplete) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *ParseComplete) Decode(src []byte) error { if len(src) != 0 { return &invalidMessageLenErr{messageType: "ParseComplete", expectedLen: 0, actualLen: len(src)} } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *ParseComplete) Encode(dst []byte) ([]byte, error) { return append(dst, '1', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. func (src ParseComplete) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string }{ Type: "ParseComplete", }) } pgx-5.8.0/pgproto3/password_message.go000066400000000000000000000023451512357711200200040ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/json" ) type PasswordMessage struct { Password string } // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*PasswordMessage) Frontend() {} // InitialResponse identifies this message as an authentication response. func (*PasswordMessage) InitialResponse() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *PasswordMessage) Decode(src []byte) error { buf := bytes.NewBuffer(src) b, err := buf.ReadBytes(0) if err != nil { return err } dst.Password = string(b[:len(b)-1]) return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *PasswordMessage) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'p') dst = append(dst, src.Password...) dst = append(dst, 0) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src PasswordMessage) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Password string }{ Type: "PasswordMessage", Password: src.Password, }) } pgx-5.8.0/pgproto3/pgproto3.go000066400000000000000000000066261512357711200162210ustar00rootroot00000000000000package pgproto3 import ( "encoding/hex" "errors" "fmt" "github.com/jackc/pgx/v5/internal/pgio" ) // maxMessageBodyLen is the maximum length of a message body in bytes. See PG_LARGE_MESSAGE_LIMIT in the PostgreSQL // source. It is defined as (MaxAllocSize - 1). MaxAllocSize is defined as 0x3fffffff. const maxMessageBodyLen = (0x3fffffff - 1) // Message is the interface implemented by an object that can decode and encode // a particular PostgreSQL message. type Message interface { // Decode is allowed and expected to retain a reference to data after // returning (unlike encoding.BinaryUnmarshaler). Decode(data []byte) error // Encode appends itself to dst and returns the new buffer. Encode(dst []byte) ([]byte, error) } // FrontendMessage is a message sent by the frontend (i.e. the client). type FrontendMessage interface { Message Frontend() // no-op method to distinguish frontend from backend methods } // BackendMessage is a message sent by the backend (i.e. the server). type BackendMessage interface { Message Backend() // no-op method to distinguish frontend from backend methods } type AuthenticationResponseMessage interface { BackendMessage AuthenticationResponse() // no-op method to distinguish authentication responses } type invalidMessageLenErr struct { messageType string expectedLen int actualLen int } func (e *invalidMessageLenErr) Error() string { return fmt.Sprintf("%s body must have length of %d, but it is %d", e.messageType, e.expectedLen, e.actualLen) } type invalidMessageFormatErr struct { messageType string details string } func (e *invalidMessageFormatErr) Error() string { return fmt.Sprintf("%s body is invalid %s", e.messageType, e.details) } type writeError struct { err error safeToRetry bool } func (e *writeError) Error() string { return fmt.Sprintf("write failed: %s", e.err.Error()) } func (e *writeError) SafeToRetry() bool { return e.safeToRetry } func (e *writeError) Unwrap() error { return e.err } type ExceededMaxBodyLenErr struct { MaxExpectedBodyLen int ActualBodyLen int } func (e *ExceededMaxBodyLenErr) Error() string { return fmt.Sprintf("invalid body length: expected at most %d, but got %d", e.MaxExpectedBodyLen, e.ActualBodyLen) } // getValueFromJSON gets the value from a protocol message representation in JSON. func getValueFromJSON(v map[string]string) ([]byte, error) { if v == nil { return nil, nil } if text, ok := v["text"]; ok { return []byte(text), nil } if binary, ok := v["binary"]; ok { return hex.DecodeString(binary) } return nil, errors.New("unknown protocol representation") } // beginMessage begins a new message of type t. It appends the message type and a placeholder for the message length to // dst. It returns the new buffer and the position of the message length placeholder. func beginMessage(dst []byte, t byte) ([]byte, int) { dst = append(dst, t) sp := len(dst) dst = pgio.AppendInt32(dst, -1) return dst, sp } // finishMessage finishes a message that was started with beginMessage. It computes the message length and writes it to // dst[sp]. If the message length is too large it returns an error. Otherwise it returns the final message buffer. func finishMessage(dst []byte, sp int) ([]byte, error) { messageBodyLen := len(dst[sp:]) if messageBodyLen > maxMessageBodyLen { return nil, errors.New("message body too large") } pgio.SetInt32(dst[sp:], int32(messageBodyLen)) return dst, nil } pgx-5.8.0/pgproto3/pgproto3_private_test.go000066400000000000000000000000761512357711200210030ustar00rootroot00000000000000package pgproto3 const MaxMessageBodyLen = maxMessageBodyLen pgx-5.8.0/pgproto3/portal_suspended.go000066400000000000000000000017051512357711200200100ustar00rootroot00000000000000package pgproto3 import ( "encoding/json" ) type PortalSuspended struct{} // Backend identifies this message as sendable by the PostgreSQL backend. func (*PortalSuspended) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *PortalSuspended) Decode(src []byte) error { if len(src) != 0 { return &invalidMessageLenErr{messageType: "PortalSuspended", expectedLen: 0, actualLen: len(src)} } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *PortalSuspended) Encode(dst []byte) ([]byte, error) { return append(dst, 's', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. func (src PortalSuspended) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string }{ Type: "PortalSuspended", }) } pgx-5.8.0/pgproto3/query.go000066400000000000000000000020611512357711200155760ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/json" ) type Query struct { String string } // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*Query) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *Query) Decode(src []byte) error { i := bytes.IndexByte(src, 0) if i != len(src)-1 { return &invalidMessageFormatErr{messageType: "Query"} } dst.String = string(src[:i]) return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *Query) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'Q') dst = append(dst, src.String...) dst = append(dst, 0) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src Query) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string String string }{ Type: "Query", String: src.String, }) } pgx-5.8.0/pgproto3/query_test.go000066400000000000000000000010411512357711200166320ustar00rootroot00000000000000package pgproto3_test import ( "testing" "github.com/jackc/pgx/v5/pgproto3" "github.com/stretchr/testify/require" ) func TestQueryBiggerThanMaxMessageBodyLen(t *testing.T) { t.Parallel() // Maximum allowed size. 4 bytes for size and 1 byte for 0 terminated string. _, err := (&pgproto3.Query{String: string(make([]byte, pgproto3.MaxMessageBodyLen-5))}).Encode(nil) require.NoError(t, err) // 1 byte too big _, err = (&pgproto3.Query{String: string(make([]byte, pgproto3.MaxMessageBodyLen-4))}).Encode(nil) require.Error(t, err) } pgx-5.8.0/pgproto3/ready_for_query.go000066400000000000000000000030011512357711200176230ustar00rootroot00000000000000package pgproto3 import ( "encoding/json" "errors" ) type ReadyForQuery struct { TxStatus byte } // Backend identifies this message as sendable by the PostgreSQL backend. func (*ReadyForQuery) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *ReadyForQuery) Decode(src []byte) error { if len(src) != 1 { return &invalidMessageLenErr{messageType: "ReadyForQuery", expectedLen: 1, actualLen: len(src)} } dst.TxStatus = src[0] return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *ReadyForQuery) Encode(dst []byte) ([]byte, error) { return append(dst, 'Z', 0, 0, 0, 5, src.TxStatus), nil } // MarshalJSON implements encoding/json.Marshaler. func (src ReadyForQuery) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string TxStatus string }{ Type: "ReadyForQuery", TxStatus: string(src.TxStatus), }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *ReadyForQuery) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { TxStatus string } if err := json.Unmarshal(data, &msg); err != nil { return err } if len(msg.TxStatus) != 1 { return errors.New("invalid length for ReadyForQuery.TxStatus") } dst.TxStatus = msg.TxStatus[0] return nil } pgx-5.8.0/pgproto3/row_description.go000066400000000000000000000105061512357711200176460ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/binary" "encoding/json" "errors" "math" "github.com/jackc/pgx/v5/internal/pgio" ) const ( TextFormat = 0 BinaryFormat = 1 ) type FieldDescription struct { Name []byte TableOID uint32 TableAttributeNumber uint16 DataTypeOID uint32 DataTypeSize int16 TypeModifier int32 Format int16 } // MarshalJSON implements encoding/json.Marshaler. func (fd FieldDescription) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Name string TableOID uint32 TableAttributeNumber uint16 DataTypeOID uint32 DataTypeSize int16 TypeModifier int32 Format int16 }{ Name: string(fd.Name), TableOID: fd.TableOID, TableAttributeNumber: fd.TableAttributeNumber, DataTypeOID: fd.DataTypeOID, DataTypeSize: fd.DataTypeSize, TypeModifier: fd.TypeModifier, Format: fd.Format, }) } type RowDescription struct { Fields []FieldDescription } // Backend identifies this message as sendable by the PostgreSQL backend. func (*RowDescription) Backend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *RowDescription) Decode(src []byte) error { if len(src) < 2 { return &invalidMessageFormatErr{messageType: "RowDescription"} } fieldCount := int(binary.BigEndian.Uint16(src)) rp := 2 dst.Fields = dst.Fields[0:0] for range fieldCount { var fd FieldDescription idx := bytes.IndexByte(src[rp:], 0) if idx < 0 { return &invalidMessageFormatErr{messageType: "RowDescription"} } fd.Name = src[rp : rp+idx] rp += idx + 1 // Since buf.Next() doesn't return an error if we hit the end of the buffer // check Len ahead of time if len(src[rp:]) < 18 { return &invalidMessageFormatErr{messageType: "RowDescription"} } fd.TableOID = binary.BigEndian.Uint32(src[rp:]) rp += 4 fd.TableAttributeNumber = binary.BigEndian.Uint16(src[rp:]) rp += 2 fd.DataTypeOID = binary.BigEndian.Uint32(src[rp:]) rp += 4 fd.DataTypeSize = int16(binary.BigEndian.Uint16(src[rp:])) rp += 2 fd.TypeModifier = int32(binary.BigEndian.Uint32(src[rp:])) rp += 4 fd.Format = int16(binary.BigEndian.Uint16(src[rp:])) rp += 2 dst.Fields = append(dst.Fields, fd) } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *RowDescription) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'T') if len(src.Fields) > math.MaxUint16 { return nil, errors.New("too many fields") } dst = pgio.AppendUint16(dst, uint16(len(src.Fields))) for _, fd := range src.Fields { dst = append(dst, fd.Name...) dst = append(dst, 0) dst = pgio.AppendUint32(dst, fd.TableOID) dst = pgio.AppendUint16(dst, fd.TableAttributeNumber) dst = pgio.AppendUint32(dst, fd.DataTypeOID) dst = pgio.AppendInt16(dst, fd.DataTypeSize) dst = pgio.AppendInt32(dst, fd.TypeModifier) dst = pgio.AppendInt16(dst, fd.Format) } return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src RowDescription) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Fields []FieldDescription }{ Type: "RowDescription", Fields: src.Fields, }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *RowDescription) UnmarshalJSON(data []byte) error { var msg struct { Fields []struct { Name string TableOID uint32 TableAttributeNumber uint16 DataTypeOID uint32 DataTypeSize int16 TypeModifier int32 Format int16 } } if err := json.Unmarshal(data, &msg); err != nil { return err } dst.Fields = make([]FieldDescription, len(msg.Fields)) for n, field := range msg.Fields { dst.Fields[n] = FieldDescription{ Name: []byte(field.Name), TableOID: field.TableOID, TableAttributeNumber: field.TableAttributeNumber, DataTypeOID: field.DataTypeOID, DataTypeSize: field.DataTypeSize, TypeModifier: field.TypeModifier, Format: field.Format, } } return nil } pgx-5.8.0/pgproto3/sasl_initial_response.go000066400000000000000000000041211512357711200210210ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/hex" "encoding/json" "errors" "github.com/jackc/pgx/v5/internal/pgio" ) type SASLInitialResponse struct { AuthMechanism string Data []byte } // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*SASLInitialResponse) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *SASLInitialResponse) Decode(src []byte) error { *dst = SASLInitialResponse{} rp := 0 idx := bytes.IndexByte(src, 0) if idx < 0 { return errors.New("invalid SASLInitialResponse") } dst.AuthMechanism = string(src[rp:idx]) rp = idx + 1 rp += 4 // The rest of the message is data so we can just skip the size dst.Data = src[rp:] return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *SASLInitialResponse) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'p') dst = append(dst, []byte(src.AuthMechanism)...) dst = append(dst, 0) dst = pgio.AppendInt32(dst, int32(len(src.Data))) dst = append(dst, src.Data...) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src SASLInitialResponse) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string AuthMechanism string Data string }{ Type: "SASLInitialResponse", AuthMechanism: src.AuthMechanism, Data: string(src.Data), }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *SASLInitialResponse) UnmarshalJSON(data []byte) error { // Ignore null, like in the main JSON package. if string(data) == "null" { return nil } var msg struct { AuthMechanism string Data string } if err := json.Unmarshal(data, &msg); err != nil { return err } dst.AuthMechanism = msg.AuthMechanism if msg.Data != "" { decoded, err := hex.DecodeString(msg.Data) if err != nil { return err } dst.Data = decoded } return nil } pgx-5.8.0/pgproto3/sasl_response.go000066400000000000000000000024761512357711200173230ustar00rootroot00000000000000package pgproto3 import ( "encoding/hex" "encoding/json" ) type SASLResponse struct { Data []byte } // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*SASLResponse) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *SASLResponse) Decode(src []byte) error { *dst = SASLResponse{Data: src} return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *SASLResponse) Encode(dst []byte) ([]byte, error) { dst, sp := beginMessage(dst, 'p') dst = append(dst, src.Data...) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src SASLResponse) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string Data string }{ Type: "SASLResponse", Data: string(src.Data), }) } // UnmarshalJSON implements encoding/json.Unmarshaler. func (dst *SASLResponse) UnmarshalJSON(data []byte) error { var msg struct { Data string } if err := json.Unmarshal(data, &msg); err != nil { return err } if msg.Data != "" { decoded, err := hex.DecodeString(msg.Data) if err != nil { return err } dst.Data = decoded } return nil } pgx-5.8.0/pgproto3/ssl_request.go000066400000000000000000000020201512357711200167750ustar00rootroot00000000000000package pgproto3 import ( "encoding/binary" "encoding/json" "errors" "github.com/jackc/pgx/v5/internal/pgio" ) const sslRequestNumber = 80877103 type SSLRequest struct{} // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*SSLRequest) Frontend() {} func (dst *SSLRequest) Decode(src []byte) error { if len(src) < 4 { return errors.New("ssl request too short") } requestCode := binary.BigEndian.Uint32(src) if requestCode != sslRequestNumber { return errors.New("bad ssl request code") } return nil } // Encode encodes src into dst. dst will include the 4 byte message length. func (src *SSLRequest) Encode(dst []byte) ([]byte, error) { dst = pgio.AppendInt32(dst, 8) dst = pgio.AppendInt32(dst, sslRequestNumber) return dst, nil } // MarshalJSON implements encoding/json.Marshaler. func (src SSLRequest) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string ProtocolVersion uint32 Parameters map[string]string }{ Type: "SSLRequest", }) } pgx-5.8.0/pgproto3/startup_message.go000066400000000000000000000044331512357711200176440ustar00rootroot00000000000000package pgproto3 import ( "bytes" "encoding/binary" "encoding/json" "errors" "fmt" "github.com/jackc/pgx/v5/internal/pgio" ) const ProtocolVersionNumber = 196608 // 3.0 type StartupMessage struct { ProtocolVersion uint32 Parameters map[string]string } // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*StartupMessage) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *StartupMessage) Decode(src []byte) error { if len(src) < 4 { return errors.New("startup message too short") } dst.ProtocolVersion = binary.BigEndian.Uint32(src) rp := 4 if dst.ProtocolVersion != ProtocolVersionNumber { return fmt.Errorf("Bad startup message version number. Expected %d, got %d", ProtocolVersionNumber, dst.ProtocolVersion) } dst.Parameters = make(map[string]string) for { idx := bytes.IndexByte(src[rp:], 0) if idx < 0 { return &invalidMessageFormatErr{messageType: "StartupMessage"} } key := string(src[rp : rp+idx]) rp += idx + 1 idx = bytes.IndexByte(src[rp:], 0) if idx < 0 { return &invalidMessageFormatErr{messageType: "StartupMessage"} } value := string(src[rp : rp+idx]) rp += idx + 1 dst.Parameters[key] = value if len(src[rp:]) == 1 { if src[rp] != 0 { return fmt.Errorf("Bad startup message last byte. Expected 0, got %d", src[rp]) } break } } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *StartupMessage) Encode(dst []byte) ([]byte, error) { sp := len(dst) dst = pgio.AppendInt32(dst, -1) dst = pgio.AppendUint32(dst, src.ProtocolVersion) for k, v := range src.Parameters { dst = append(dst, k...) dst = append(dst, 0) dst = append(dst, v...) dst = append(dst, 0) } dst = append(dst, 0) return finishMessage(dst, sp) } // MarshalJSON implements encoding/json.Marshaler. func (src StartupMessage) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string ProtocolVersion uint32 Parameters map[string]string }{ Type: "StartupMessage", ProtocolVersion: src.ProtocolVersion, Parameters: src.Parameters, }) } pgx-5.8.0/pgproto3/sync.go000066400000000000000000000015711512357711200154120ustar00rootroot00000000000000package pgproto3 import ( "encoding/json" ) type Sync struct{} // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*Sync) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *Sync) Decode(src []byte) error { if len(src) != 0 { return &invalidMessageLenErr{messageType: "Sync", expectedLen: 0, actualLen: len(src)} } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *Sync) Encode(dst []byte) ([]byte, error) { return append(dst, 'S', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. func (src Sync) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string }{ Type: "Sync", }) } pgx-5.8.0/pgproto3/terminate.go000066400000000000000000000016341512357711200164260ustar00rootroot00000000000000package pgproto3 import ( "encoding/json" ) type Terminate struct{} // Frontend identifies this message as sendable by a PostgreSQL frontend. func (*Terminate) Frontend() {} // Decode decodes src into dst. src must contain the complete message with the exception of the initial 1 byte message // type identifier and 4 byte message length. func (dst *Terminate) Decode(src []byte) error { if len(src) != 0 { return &invalidMessageLenErr{messageType: "Terminate", expectedLen: 0, actualLen: len(src)} } return nil } // Encode encodes src into dst. dst will include the 1 byte message type identifier and the 4 byte message length. func (src *Terminate) Encode(dst []byte) ([]byte, error) { return append(dst, 'X', 0, 0, 0, 4), nil } // MarshalJSON implements encoding/json.Marshaler. func (src Terminate) MarshalJSON() ([]byte, error) { return json.Marshal(struct { Type string }{ Type: "Terminate", }) } pgx-5.8.0/pgproto3/testdata/000077500000000000000000000000001512357711200157145ustar00rootroot00000000000000pgx-5.8.0/pgproto3/testdata/fuzz/000077500000000000000000000000001512357711200167125ustar00rootroot00000000000000pgx-5.8.0/pgproto3/testdata/fuzz/FuzzFrontend/000077500000000000000000000000001512357711200213505ustar00rootroot0000000000000039c5e864da4707fc15fea48f7062d6a07796fdc43b33e0ba9dbd7074a0211fa6000066400000000000000000000000601512357711200321500ustar00rootroot00000000000000pgx-5.8.0/pgproto3/testdata/fuzz/FuzzFrontendgo test fuzz v1 byte('A') uint32(5) []byte("0") 9b06792b1aaac8a907dbfa04d526ae14326c8573b7409032caac8461e83065f7000066400000000000000000000001041512357711200317130ustar00rootroot00000000000000pgx-5.8.0/pgproto3/testdata/fuzz/FuzzFrontendgo test fuzz v1 byte('D') uint32(21) []byte("00\xb300000000000000") a661fb98e802839f0a7361160fbc6e28794612a411d00bde104364ee281c4214000066400000000000000000000000601512357711200314100ustar00rootroot00000000000000pgx-5.8.0/pgproto3/testdata/fuzz/FuzzFrontendgo test fuzz v1 byte('C') uint32(4) []byte("0") fc98dcd487a5173b38763a5f7dd023933f3a86ab566e3f2b091eb36248107eb4000066400000000000000000000002371512357711200317530ustar00rootroot00000000000000pgx-5.8.0/pgproto3/testdata/fuzz/FuzzFrontendgo test fuzz v1 byte('R') uint32(13) []byte("\x00\x00\x00\n0\x12\xebG\x8dI']G\xdac\x95\xb7\x18\xb0\x02\xe8m\xc2\x00\xef\x03\x12\x1b\xbdj\x10\x9f\xf9\xeb\xb8") pgx-5.8.0/pgproto3/trace.go000066400000000000000000000336341512357711200155410ustar00rootroot00000000000000package pgproto3 import ( "bytes" "fmt" "io" "strconv" "strings" "sync" "time" ) // tracer traces the messages send to and from a Backend or Frontend. The format it produces roughly mimics the // format produced by the libpq C function PQtrace. type tracer struct { TracerOptions mux sync.Mutex w io.Writer buf *bytes.Buffer } // TracerOptions controls tracing behavior. It is roughly equivalent to the libpq function PQsetTraceFlags. type TracerOptions struct { // SuppressTimestamps prevents printing of timestamps. SuppressTimestamps bool // RegressMode redacts fields that may be vary between executions. RegressMode bool } func (t *tracer) traceMessage(sender byte, encodedLen int32, msg Message) { switch msg := msg.(type) { case *AuthenticationCleartextPassword: t.traceAuthenticationCleartextPassword(sender, encodedLen, msg) case *AuthenticationGSS: t.traceAuthenticationGSS(sender, encodedLen, msg) case *AuthenticationGSSContinue: t.traceAuthenticationGSSContinue(sender, encodedLen, msg) case *AuthenticationMD5Password: t.traceAuthenticationMD5Password(sender, encodedLen, msg) case *AuthenticationOk: t.traceAuthenticationOk(sender, encodedLen, msg) case *AuthenticationSASL: t.traceAuthenticationSASL(sender, encodedLen, msg) case *AuthenticationSASLContinue: t.traceAuthenticationSASLContinue(sender, encodedLen, msg) case *AuthenticationSASLFinal: t.traceAuthenticationSASLFinal(sender, encodedLen, msg) case *BackendKeyData: t.traceBackendKeyData(sender, encodedLen, msg) case *Bind: t.traceBind(sender, encodedLen, msg) case *BindComplete: t.traceBindComplete(sender, encodedLen, msg) case *CancelRequest: t.traceCancelRequest(sender, encodedLen, msg) case *Close: t.traceClose(sender, encodedLen, msg) case *CloseComplete: t.traceCloseComplete(sender, encodedLen, msg) case *CommandComplete: t.traceCommandComplete(sender, encodedLen, msg) case *CopyBothResponse: t.traceCopyBothResponse(sender, encodedLen, msg) case *CopyData: t.traceCopyData(sender, encodedLen, msg) case *CopyDone: t.traceCopyDone(sender, encodedLen, msg) case *CopyFail: t.traceCopyFail(sender, encodedLen, msg) case *CopyInResponse: t.traceCopyInResponse(sender, encodedLen, msg) case *CopyOutResponse: t.traceCopyOutResponse(sender, encodedLen, msg) case *DataRow: t.traceDataRow(sender, encodedLen, msg) case *Describe: t.traceDescribe(sender, encodedLen, msg) case *EmptyQueryResponse: t.traceEmptyQueryResponse(sender, encodedLen, msg) case *ErrorResponse: t.traceErrorResponse(sender, encodedLen, msg) case *Execute: t.TraceQueryute(sender, encodedLen, msg) case *Flush: t.traceFlush(sender, encodedLen, msg) case *FunctionCall: t.traceFunctionCall(sender, encodedLen, msg) case *FunctionCallResponse: t.traceFunctionCallResponse(sender, encodedLen, msg) case *GSSEncRequest: t.traceGSSEncRequest(sender, encodedLen, msg) case *NoData: t.traceNoData(sender, encodedLen, msg) case *NoticeResponse: t.traceNoticeResponse(sender, encodedLen, msg) case *NotificationResponse: t.traceNotificationResponse(sender, encodedLen, msg) case *ParameterDescription: t.traceParameterDescription(sender, encodedLen, msg) case *ParameterStatus: t.traceParameterStatus(sender, encodedLen, msg) case *Parse: t.traceParse(sender, encodedLen, msg) case *ParseComplete: t.traceParseComplete(sender, encodedLen, msg) case *PortalSuspended: t.tracePortalSuspended(sender, encodedLen, msg) case *Query: t.traceQuery(sender, encodedLen, msg) case *ReadyForQuery: t.traceReadyForQuery(sender, encodedLen, msg) case *RowDescription: t.traceRowDescription(sender, encodedLen, msg) case *SSLRequest: t.traceSSLRequest(sender, encodedLen, msg) case *StartupMessage: t.traceStartupMessage(sender, encodedLen, msg) case *Sync: t.traceSync(sender, encodedLen, msg) case *Terminate: t.traceTerminate(sender, encodedLen, msg) default: t.writeTrace(sender, encodedLen, "Unknown", nil) } } func (t *tracer) traceAuthenticationCleartextPassword(sender byte, encodedLen int32, msg *AuthenticationCleartextPassword) { t.writeTrace(sender, encodedLen, "AuthenticationCleartextPassword", nil) } func (t *tracer) traceAuthenticationGSS(sender byte, encodedLen int32, msg *AuthenticationGSS) { t.writeTrace(sender, encodedLen, "AuthenticationGSS", nil) } func (t *tracer) traceAuthenticationGSSContinue(sender byte, encodedLen int32, msg *AuthenticationGSSContinue) { t.writeTrace(sender, encodedLen, "AuthenticationGSSContinue", nil) } func (t *tracer) traceAuthenticationMD5Password(sender byte, encodedLen int32, msg *AuthenticationMD5Password) { t.writeTrace(sender, encodedLen, "AuthenticationMD5Password", nil) } func (t *tracer) traceAuthenticationOk(sender byte, encodedLen int32, msg *AuthenticationOk) { t.writeTrace(sender, encodedLen, "AuthenticationOk", nil) } func (t *tracer) traceAuthenticationSASL(sender byte, encodedLen int32, msg *AuthenticationSASL) { t.writeTrace(sender, encodedLen, "AuthenticationSASL", nil) } func (t *tracer) traceAuthenticationSASLContinue(sender byte, encodedLen int32, msg *AuthenticationSASLContinue) { t.writeTrace(sender, encodedLen, "AuthenticationSASLContinue", nil) } func (t *tracer) traceAuthenticationSASLFinal(sender byte, encodedLen int32, msg *AuthenticationSASLFinal) { t.writeTrace(sender, encodedLen, "AuthenticationSASLFinal", nil) } func (t *tracer) traceBackendKeyData(sender byte, encodedLen int32, msg *BackendKeyData) { t.writeTrace(sender, encodedLen, "BackendKeyData", func() { if t.RegressMode { t.buf.WriteString("\t NNNN NNNN") } else { fmt.Fprintf(t.buf, "\t %d %d", msg.ProcessID, msg.SecretKey) } }) } func (t *tracer) traceBind(sender byte, encodedLen int32, msg *Bind) { t.writeTrace(sender, encodedLen, "Bind", func() { fmt.Fprintf(t.buf, "\t %s %s %d", traceDoubleQuotedString([]byte(msg.DestinationPortal)), traceDoubleQuotedString([]byte(msg.PreparedStatement)), len(msg.ParameterFormatCodes)) for _, fc := range msg.ParameterFormatCodes { fmt.Fprintf(t.buf, " %d", fc) } fmt.Fprintf(t.buf, " %d", len(msg.Parameters)) for _, p := range msg.Parameters { fmt.Fprintf(t.buf, " %s", traceSingleQuotedString(p)) } fmt.Fprintf(t.buf, " %d", len(msg.ResultFormatCodes)) for _, fc := range msg.ResultFormatCodes { fmt.Fprintf(t.buf, " %d", fc) } }) } func (t *tracer) traceBindComplete(sender byte, encodedLen int32, msg *BindComplete) { t.writeTrace(sender, encodedLen, "BindComplete", nil) } func (t *tracer) traceCancelRequest(sender byte, encodedLen int32, msg *CancelRequest) { t.writeTrace(sender, encodedLen, "CancelRequest", nil) } func (t *tracer) traceClose(sender byte, encodedLen int32, msg *Close) { t.writeTrace(sender, encodedLen, "Close", nil) } func (t *tracer) traceCloseComplete(sender byte, encodedLen int32, msg *CloseComplete) { t.writeTrace(sender, encodedLen, "CloseComplete", nil) } func (t *tracer) traceCommandComplete(sender byte, encodedLen int32, msg *CommandComplete) { t.writeTrace(sender, encodedLen, "CommandComplete", func() { fmt.Fprintf(t.buf, "\t %s", traceDoubleQuotedString(msg.CommandTag)) }) } func (t *tracer) traceCopyBothResponse(sender byte, encodedLen int32, msg *CopyBothResponse) { t.writeTrace(sender, encodedLen, "CopyBothResponse", nil) } func (t *tracer) traceCopyData(sender byte, encodedLen int32, msg *CopyData) { t.writeTrace(sender, encodedLen, "CopyData", nil) } func (t *tracer) traceCopyDone(sender byte, encodedLen int32, msg *CopyDone) { t.writeTrace(sender, encodedLen, "CopyDone", nil) } func (t *tracer) traceCopyFail(sender byte, encodedLen int32, msg *CopyFail) { t.writeTrace(sender, encodedLen, "CopyFail", func() { fmt.Fprintf(t.buf, "\t %s", traceDoubleQuotedString([]byte(msg.Message))) }) } func (t *tracer) traceCopyInResponse(sender byte, encodedLen int32, msg *CopyInResponse) { t.writeTrace(sender, encodedLen, "CopyInResponse", nil) } func (t *tracer) traceCopyOutResponse(sender byte, encodedLen int32, msg *CopyOutResponse) { t.writeTrace(sender, encodedLen, "CopyOutResponse", nil) } func (t *tracer) traceDataRow(sender byte, encodedLen int32, msg *DataRow) { t.writeTrace(sender, encodedLen, "DataRow", func() { fmt.Fprintf(t.buf, "\t %d", len(msg.Values)) for _, v := range msg.Values { if v == nil { t.buf.WriteString(" -1") } else { fmt.Fprintf(t.buf, " %d %s", len(v), traceSingleQuotedString(v)) } } }) } func (t *tracer) traceDescribe(sender byte, encodedLen int32, msg *Describe) { t.writeTrace(sender, encodedLen, "Describe", func() { fmt.Fprintf(t.buf, "\t %c %s", msg.ObjectType, traceDoubleQuotedString([]byte(msg.Name))) }) } func (t *tracer) traceEmptyQueryResponse(sender byte, encodedLen int32, msg *EmptyQueryResponse) { t.writeTrace(sender, encodedLen, "EmptyQueryResponse", nil) } func (t *tracer) traceErrorResponse(sender byte, encodedLen int32, msg *ErrorResponse) { t.writeTrace(sender, encodedLen, "ErrorResponse", nil) } func (t *tracer) TraceQueryute(sender byte, encodedLen int32, msg *Execute) { t.writeTrace(sender, encodedLen, "Execute", func() { fmt.Fprintf(t.buf, "\t %s %d", traceDoubleQuotedString([]byte(msg.Portal)), msg.MaxRows) }) } func (t *tracer) traceFlush(sender byte, encodedLen int32, msg *Flush) { t.writeTrace(sender, encodedLen, "Flush", nil) } func (t *tracer) traceFunctionCall(sender byte, encodedLen int32, msg *FunctionCall) { t.writeTrace(sender, encodedLen, "FunctionCall", nil) } func (t *tracer) traceFunctionCallResponse(sender byte, encodedLen int32, msg *FunctionCallResponse) { t.writeTrace(sender, encodedLen, "FunctionCallResponse", nil) } func (t *tracer) traceGSSEncRequest(sender byte, encodedLen int32, msg *GSSEncRequest) { t.writeTrace(sender, encodedLen, "GSSEncRequest", nil) } func (t *tracer) traceNoData(sender byte, encodedLen int32, msg *NoData) { t.writeTrace(sender, encodedLen, "NoData", nil) } func (t *tracer) traceNoticeResponse(sender byte, encodedLen int32, msg *NoticeResponse) { t.writeTrace(sender, encodedLen, "NoticeResponse", nil) } func (t *tracer) traceNotificationResponse(sender byte, encodedLen int32, msg *NotificationResponse) { t.writeTrace(sender, encodedLen, "NotificationResponse", func() { fmt.Fprintf(t.buf, "\t %d %s %s", msg.PID, traceDoubleQuotedString([]byte(msg.Channel)), traceDoubleQuotedString([]byte(msg.Payload))) }) } func (t *tracer) traceParameterDescription(sender byte, encodedLen int32, msg *ParameterDescription) { t.writeTrace(sender, encodedLen, "ParameterDescription", nil) } func (t *tracer) traceParameterStatus(sender byte, encodedLen int32, msg *ParameterStatus) { t.writeTrace(sender, encodedLen, "ParameterStatus", func() { fmt.Fprintf(t.buf, "\t %s %s", traceDoubleQuotedString([]byte(msg.Name)), traceDoubleQuotedString([]byte(msg.Value))) }) } func (t *tracer) traceParse(sender byte, encodedLen int32, msg *Parse) { t.writeTrace(sender, encodedLen, "Parse", func() { fmt.Fprintf(t.buf, "\t %s %s %d", traceDoubleQuotedString([]byte(msg.Name)), traceDoubleQuotedString([]byte(msg.Query)), len(msg.ParameterOIDs)) for _, oid := range msg.ParameterOIDs { fmt.Fprintf(t.buf, " %d", oid) } }) } func (t *tracer) traceParseComplete(sender byte, encodedLen int32, msg *ParseComplete) { t.writeTrace(sender, encodedLen, "ParseComplete", nil) } func (t *tracer) tracePortalSuspended(sender byte, encodedLen int32, msg *PortalSuspended) { t.writeTrace(sender, encodedLen, "PortalSuspended", nil) } func (t *tracer) traceQuery(sender byte, encodedLen int32, msg *Query) { t.writeTrace(sender, encodedLen, "Query", func() { fmt.Fprintf(t.buf, "\t %s", traceDoubleQuotedString([]byte(msg.String))) }) } func (t *tracer) traceReadyForQuery(sender byte, encodedLen int32, msg *ReadyForQuery) { t.writeTrace(sender, encodedLen, "ReadyForQuery", func() { fmt.Fprintf(t.buf, "\t %c", msg.TxStatus) }) } func (t *tracer) traceRowDescription(sender byte, encodedLen int32, msg *RowDescription) { t.writeTrace(sender, encodedLen, "RowDescription", func() { fmt.Fprintf(t.buf, "\t %d", len(msg.Fields)) for _, fd := range msg.Fields { fmt.Fprintf(t.buf, ` %s %d %d %d %d %d %d`, traceDoubleQuotedString(fd.Name), fd.TableOID, fd.TableAttributeNumber, fd.DataTypeOID, fd.DataTypeSize, fd.TypeModifier, fd.Format) } }) } func (t *tracer) traceSSLRequest(sender byte, encodedLen int32, msg *SSLRequest) { t.writeTrace(sender, encodedLen, "SSLRequest", nil) } func (t *tracer) traceStartupMessage(sender byte, encodedLen int32, msg *StartupMessage) { t.writeTrace(sender, encodedLen, "StartupMessage", nil) } func (t *tracer) traceSync(sender byte, encodedLen int32, msg *Sync) { t.writeTrace(sender, encodedLen, "Sync", nil) } func (t *tracer) traceTerminate(sender byte, encodedLen int32, msg *Terminate) { t.writeTrace(sender, encodedLen, "Terminate", nil) } func (t *tracer) writeTrace(sender byte, encodedLen int32, msgType string, writeDetails func()) { t.mux.Lock() defer t.mux.Unlock() defer func() { if t.buf.Cap() > 1024 { t.buf = &bytes.Buffer{} } else { t.buf.Reset() } }() if !t.SuppressTimestamps { now := time.Now() t.buf.WriteString(now.Format("2006-01-02 15:04:05.000000")) t.buf.WriteByte('\t') } t.buf.WriteByte(sender) t.buf.WriteByte('\t') t.buf.WriteString(msgType) t.buf.WriteByte('\t') t.buf.WriteString(strconv.FormatInt(int64(encodedLen), 10)) if writeDetails != nil { writeDetails() } t.buf.WriteByte('\n') t.buf.WriteTo(t.w) } // traceDoubleQuotedString returns t.buf as a double-quoted string without any escaping. It is roughly equivalent to // pqTraceOutputString in libpq. func traceDoubleQuotedString(buf []byte) string { return `"` + string(buf) + `"` } // traceSingleQuotedString returns buf as a single-quoted string with non-printable characters hex-escaped. It is // roughly equivalent to pqTraceOutputNchar in libpq. func traceSingleQuotedString(buf []byte) string { sb := &strings.Builder{} sb.WriteByte('\'') for _, b := range buf { if b < 32 || b > 126 { fmt.Fprintf(sb, `\x%x`, b) } else { sb.WriteByte(b) } } sb.WriteByte('\'') return sb.String() } pgx-5.8.0/pgproto3/trace_test.go000066400000000000000000000024301512357711200165660ustar00rootroot00000000000000package pgproto3_test import ( "bytes" "context" "os" "testing" "time" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgproto3" "github.com/stretchr/testify/require" ) func TestTrace(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn, err := pgconn.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer conn.Close(ctx) if conn.ParameterStatus("crdb_version") != "" { t.Skip("Skipping message trace on CockroachDB as it varies slightly from PostgreSQL") } traceOutput := &bytes.Buffer{} conn.Frontend().Trace(traceOutput, pgproto3.TracerOptions{ SuppressTimestamps: true, RegressMode: true, }) result := conn.ExecParams(ctx, "select n from generate_series(1,5) n", nil, nil, nil, nil).Read() require.NoError(t, result.Err) expected := `F Parse 45 "" "select n from generate_series(1,5) n" 0 F Bind 13 "" "" 0 0 0 F Describe 7 P "" F Execute 10 "" 0 F Sync 5 B ParseComplete 5 B BindComplete 5 B RowDescription 27 1 "n" 0 0 23 4 -1 0 B DataRow 12 1 1 '1' B DataRow 12 1 1 '2' B DataRow 12 1 1 '3' B DataRow 12 1 1 '4' B DataRow 12 1 1 '5' B CommandComplete 14 "SELECT 5" B ReadyForQuery 6 I ` require.Equal(t, expected, traceOutput.String()) } pgx-5.8.0/pgtype/000077500000000000000000000000001512357711200136365ustar00rootroot00000000000000pgx-5.8.0/pgtype/array.go000066400000000000000000000227151512357711200153120ustar00rootroot00000000000000package pgtype import ( "bytes" "encoding/binary" "fmt" "io" "strconv" "strings" "unicode" "github.com/jackc/pgx/v5/internal/pgio" ) // Information on the internals of PostgreSQL arrays can be found in // src/include/utils/array.h and src/backend/utils/adt/arrayfuncs.c. Of // particular interest is the array_send function. type arrayHeader struct { ContainsNull bool ElementOID uint32 Dimensions []ArrayDimension } type ArrayDimension struct { Length int32 LowerBound int32 } // cardinality returns the number of elements in an array of dimensions size. func cardinality(dimensions []ArrayDimension) int { if len(dimensions) == 0 { return 0 } elementCount := int(dimensions[0].Length) for _, d := range dimensions[1:] { elementCount *= int(d.Length) } return elementCount } func (dst *arrayHeader) DecodeBinary(m *Map, src []byte) (int, error) { if len(src) < 12 { return 0, fmt.Errorf("array header too short: %d", len(src)) } rp := 0 numDims := int(binary.BigEndian.Uint32(src[rp:])) rp += 4 dst.ContainsNull = binary.BigEndian.Uint32(src[rp:]) == 1 rp += 4 dst.ElementOID = binary.BigEndian.Uint32(src[rp:]) rp += 4 dst.Dimensions = make([]ArrayDimension, numDims) if len(src) < 12+numDims*8 { return 0, fmt.Errorf("array header too short for %d dimensions: %d", numDims, len(src)) } for i := range dst.Dimensions { dst.Dimensions[i].Length = int32(binary.BigEndian.Uint32(src[rp:])) rp += 4 dst.Dimensions[i].LowerBound = int32(binary.BigEndian.Uint32(src[rp:])) rp += 4 } return rp, nil } func (src arrayHeader) EncodeBinary(buf []byte) []byte { buf = pgio.AppendInt32(buf, int32(len(src.Dimensions))) var containsNull int32 if src.ContainsNull { containsNull = 1 } buf = pgio.AppendInt32(buf, containsNull) buf = pgio.AppendUint32(buf, src.ElementOID) for i := range src.Dimensions { buf = pgio.AppendInt32(buf, src.Dimensions[i].Length) buf = pgio.AppendInt32(buf, src.Dimensions[i].LowerBound) } return buf } type untypedTextArray struct { Elements []string Quoted []bool Dimensions []ArrayDimension } func parseUntypedTextArray(src string) (*untypedTextArray, error) { dst := &untypedTextArray{ Elements: []string{}, Quoted: []bool{}, Dimensions: []ArrayDimension{}, } buf := bytes.NewBufferString(src) skipWhitespace(buf) r, _, err := buf.ReadRune() if err != nil { return nil, fmt.Errorf("invalid array: %w", err) } var explicitDimensions []ArrayDimension // Array has explicit dimensions if r == '[' { buf.UnreadRune() for { r, _, err = buf.ReadRune() if err != nil { return nil, fmt.Errorf("invalid array: %w", err) } if r == '=' { break } else if r != '[' { return nil, fmt.Errorf("invalid array, expected '[' or '=' got %v", r) } lower, err := arrayParseInteger(buf) if err != nil { return nil, fmt.Errorf("invalid array: %w", err) } r, _, err = buf.ReadRune() if err != nil { return nil, fmt.Errorf("invalid array: %w", err) } if r != ':' { return nil, fmt.Errorf("invalid array, expected ':' got %v", r) } upper, err := arrayParseInteger(buf) if err != nil { return nil, fmt.Errorf("invalid array: %w", err) } r, _, err = buf.ReadRune() if err != nil { return nil, fmt.Errorf("invalid array: %w", err) } if r != ']' { return nil, fmt.Errorf("invalid array, expected ']' got %v", r) } explicitDimensions = append(explicitDimensions, ArrayDimension{LowerBound: lower, Length: upper - lower + 1}) } r, _, err = buf.ReadRune() if err != nil { return nil, fmt.Errorf("invalid array: %w", err) } } if r != '{' { return nil, fmt.Errorf("invalid array, expected '{' got %v", r) } implicitDimensions := []ArrayDimension{{LowerBound: 1, Length: 0}} // Consume all initial opening brackets. This provides number of dimensions. for { r, _, err = buf.ReadRune() if err != nil { return nil, fmt.Errorf("invalid array: %w", err) } if r == '{' { implicitDimensions[len(implicitDimensions)-1].Length = 1 implicitDimensions = append(implicitDimensions, ArrayDimension{LowerBound: 1}) } else { buf.UnreadRune() break } } currentDim := len(implicitDimensions) - 1 counterDim := currentDim for { r, _, err = buf.ReadRune() if err != nil { return nil, fmt.Errorf("invalid array: %w", err) } switch r { case '{': if currentDim == counterDim { implicitDimensions[currentDim].Length++ } currentDim++ case ',': case '}': currentDim-- if currentDim < counterDim { counterDim = currentDim } default: buf.UnreadRune() value, quoted, err := arrayParseValue(buf) if err != nil { return nil, fmt.Errorf("invalid array value: %w", err) } if currentDim == counterDim { implicitDimensions[currentDim].Length++ } dst.Quoted = append(dst.Quoted, quoted) dst.Elements = append(dst.Elements, value) } if currentDim < 0 { break } } skipWhitespace(buf) if buf.Len() > 0 { return nil, fmt.Errorf("unexpected trailing data: %v", buf.String()) } if len(dst.Elements) == 0 { } else if len(explicitDimensions) > 0 { dst.Dimensions = explicitDimensions } else { dst.Dimensions = implicitDimensions } return dst, nil } func skipWhitespace(buf *bytes.Buffer) { var r rune var err error for r, _, _ = buf.ReadRune(); unicode.IsSpace(r); r, _, _ = buf.ReadRune() { } if err != io.EOF { buf.UnreadRune() } } func arrayParseValue(buf *bytes.Buffer) (string, bool, error) { r, _, err := buf.ReadRune() if err != nil { return "", false, err } if r == '"' { return arrayParseQuotedValue(buf) } buf.UnreadRune() s := &bytes.Buffer{} for { r, _, err := buf.ReadRune() if err != nil { return "", false, err } switch r { case ',', '}': buf.UnreadRune() return s.String(), false, nil } s.WriteRune(r) } } func arrayParseQuotedValue(buf *bytes.Buffer) (string, bool, error) { s := &bytes.Buffer{} for { r, _, err := buf.ReadRune() if err != nil { return "", false, err } switch r { case '\\': r, _, err = buf.ReadRune() if err != nil { return "", false, err } case '"': r, _, err = buf.ReadRune() if err != nil { return "", false, err } buf.UnreadRune() return s.String(), true, nil } s.WriteRune(r) } } func arrayParseInteger(buf *bytes.Buffer) (int32, error) { s := &bytes.Buffer{} for { r, _, err := buf.ReadRune() if err != nil { return 0, err } if ('0' <= r && r <= '9') || r == '-' { s.WriteRune(r) } else { buf.UnreadRune() n, err := strconv.ParseInt(s.String(), 10, 32) if err != nil { return 0, err } return int32(n), nil } } } func encodeTextArrayDimensions(buf []byte, dimensions []ArrayDimension) []byte { var customDimensions bool for _, dim := range dimensions { if dim.LowerBound != 1 { customDimensions = true } } if !customDimensions { return buf } for _, dim := range dimensions { buf = append(buf, '[') buf = append(buf, strconv.FormatInt(int64(dim.LowerBound), 10)...) buf = append(buf, ':') buf = append(buf, strconv.FormatInt(int64(dim.LowerBound+dim.Length-1), 10)...) buf = append(buf, ']') } return append(buf, '=') } var quoteArrayReplacer = strings.NewReplacer(`\`, `\\`, `"`, `\"`) func quoteArrayElement(src string) string { return `"` + quoteArrayReplacer.Replace(src) + `"` } func isSpace(ch byte) bool { // see array_isspace: // https://github.com/postgres/postgres/blob/master/src/backend/utils/adt/arrayfuncs.c return ch == ' ' || ch == '\t' || ch == '\n' || ch == '\r' || ch == '\v' || ch == '\f' } func quoteArrayElementIfNeeded(src string) string { if src == "" || (len(src) == 4 && strings.EqualFold(src, "null")) || isSpace(src[0]) || isSpace(src[len(src)-1]) || strings.ContainsAny(src, `{},"\`) { return quoteArrayElement(src) } return src } // Array represents a PostgreSQL array for T. It implements the [ArrayGetter] and [ArraySetter] interfaces. It preserves // PostgreSQL dimensions and custom lower bounds. Use [FlatArray] if these are not needed. type Array[T any] struct { Elements []T Dims []ArrayDimension Valid bool } func (a Array[T]) Dimensions() []ArrayDimension { return a.Dims } func (a Array[T]) Index(i int) any { return a.Elements[i] } func (a Array[T]) IndexType() any { var el T return el } func (a *Array[T]) SetDimensions(dimensions []ArrayDimension) error { if dimensions == nil { *a = Array[T]{} return nil } elementCount := cardinality(dimensions) *a = Array[T]{ Elements: make([]T, elementCount), Dims: dimensions, Valid: true, } return nil } func (a Array[T]) ScanIndex(i int) any { return &a.Elements[i] } func (a Array[T]) ScanIndexType() any { return new(T) } // FlatArray implements the [ArrayGetter] and [ArraySetter] interfaces for any slice of T. It ignores PostgreSQL dimensions // and custom lower bounds. Use [Array] to preserve these. type FlatArray[T any] []T func (a FlatArray[T]) Dimensions() []ArrayDimension { if a == nil { return nil } return []ArrayDimension{{Length: int32(len(a)), LowerBound: 1}} } func (a FlatArray[T]) Index(i int) any { return a[i] } func (a FlatArray[T]) IndexType() any { var el T return el } func (a *FlatArray[T]) SetDimensions(dimensions []ArrayDimension) error { if dimensions == nil { *a = nil return nil } elementCount := cardinality(dimensions) *a = make(FlatArray[T], elementCount) return nil } func (a FlatArray[T]) ScanIndex(i int) any { return &a[i] } func (a FlatArray[T]) ScanIndexType() any { return new(T) } pgx-5.8.0/pgtype/array_codec.go000066400000000000000000000236521512357711200164500ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "fmt" "reflect" "github.com/jackc/pgx/v5/internal/pgio" ) // ArrayGetter is a type that can be converted into a PostgreSQL array. type ArrayGetter interface { // Dimensions returns the array dimensions. If array is nil then nil is returned. Dimensions() []ArrayDimension // Index returns the element at i. Index(i int) any // IndexType returns a non-nil scan target of the type Index will return. This is used by ArrayCodec.PlanEncode. IndexType() any } // ArraySetter is a type can be set from a PostgreSQL array. type ArraySetter interface { // SetDimensions prepares the value such that ScanIndex can be called for each element. This will remove any existing // elements. dimensions may be nil to indicate a NULL array. If unable to exactly preserve dimensions SetDimensions // may return an error or silently flatten the array dimensions. SetDimensions(dimensions []ArrayDimension) error // ScanIndex returns a value usable as a scan target for i. SetDimensions must be called before ScanIndex. ScanIndex(i int) any // ScanIndexType returns a non-nil scan target of the type ScanIndex will return. This is used by // ArrayCodec.PlanScan. ScanIndexType() any } // ArrayCodec is a codec for any array type. type ArrayCodec struct { ElementType *Type } func (c *ArrayCodec) FormatSupported(format int16) bool { return c.ElementType.Codec.FormatSupported(format) } func (c *ArrayCodec) PreferredFormat() int16 { // The binary format should always be preferred for arrays if it is supported. Usually, this will happen automatically // because most types that support binary prefer it. However, text, json, and jsonb support binary but prefer the text // format. This is because it is simpler for jsonb and PostgreSQL can be significantly faster using the text format // for text-like data types than binary. However, arrays appear to always be faster in binary. // // https://www.postgresql.org/message-id/CAMovtNoHFod2jMAKQjjxv209PCTJx5Kc66anwWvX0mEiaXwgmA%40mail.gmail.com if c.ElementType.Codec.FormatSupported(BinaryFormatCode) { return BinaryFormatCode } return TextFormatCode } func (c *ArrayCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { arrayValuer, ok := value.(ArrayGetter) if !ok { return nil } elementType := arrayValuer.IndexType() elementEncodePlan := m.PlanEncode(c.ElementType.OID, format, elementType) if elementEncodePlan == nil { if reflect.TypeOf(elementType) != nil { return nil } } switch format { case BinaryFormatCode: return &encodePlanArrayCodecBinary{ac: c, m: m, oid: oid} case TextFormatCode: return &encodePlanArrayCodecText{ac: c, m: m, oid: oid} } return nil } type encodePlanArrayCodecText struct { ac *ArrayCodec m *Map oid uint32 } func (p *encodePlanArrayCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { array := value.(ArrayGetter) dimensions := array.Dimensions() if dimensions == nil { return nil, nil } elementCount := cardinality(dimensions) if elementCount == 0 { return append(buf, '{', '}'), nil } buf = encodeTextArrayDimensions(buf, dimensions) // dimElemCounts is the multiples of elements that each array lies on. For // example, a single dimension array of length 4 would have a dimElemCounts of // [4]. A multi-dimensional array of lengths [3,5,2] would have a // dimElemCounts of [30,10,2]. This is used to simplify when to render a '{' // or '}'. dimElemCounts := make([]int, len(dimensions)) dimElemCounts[len(dimensions)-1] = int(dimensions[len(dimensions)-1].Length) for i := len(dimensions) - 2; i > -1; i-- { dimElemCounts[i] = int(dimensions[i].Length) * dimElemCounts[i+1] } var encodePlan EncodePlan var lastElemType reflect.Type inElemBuf := make([]byte, 0, 32) for i := range elementCount { if i > 0 { buf = append(buf, ',') } for _, dec := range dimElemCounts { if i%dec == 0 { buf = append(buf, '{') } } elem := array.Index(i) var elemBuf []byte if isNil, _ := isNilDriverValuer(elem); !isNil { elemType := reflect.TypeOf(elem) if lastElemType != elemType { lastElemType = elemType encodePlan = p.m.PlanEncode(p.ac.ElementType.OID, TextFormatCode, elem) if encodePlan == nil { return nil, fmt.Errorf("unable to encode %v", array.Index(i)) } } elemBuf, err = encodePlan.Encode(elem, inElemBuf) if err != nil { return nil, err } } if elemBuf == nil { buf = append(buf, `NULL`...) } else { buf = append(buf, quoteArrayElementIfNeeded(string(elemBuf))...) } for _, dec := range dimElemCounts { if (i+1)%dec == 0 { buf = append(buf, '}') } } } return buf, nil } type encodePlanArrayCodecBinary struct { ac *ArrayCodec m *Map oid uint32 } func (p *encodePlanArrayCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { array := value.(ArrayGetter) dimensions := array.Dimensions() if dimensions == nil { return nil, nil } arrayHeader := arrayHeader{ Dimensions: dimensions, ElementOID: p.ac.ElementType.OID, } containsNullIndex := len(buf) + 4 buf = arrayHeader.EncodeBinary(buf) elementCount := cardinality(dimensions) var encodePlan EncodePlan var lastElemType reflect.Type for i := range elementCount { sp := len(buf) buf = pgio.AppendInt32(buf, -1) elem := array.Index(i) var elemBuf []byte if isNil, _ := isNilDriverValuer(elem); !isNil { elemType := reflect.TypeOf(elem) if lastElemType != elemType { lastElemType = elemType encodePlan = p.m.PlanEncode(p.ac.ElementType.OID, BinaryFormatCode, elem) if encodePlan == nil { return nil, fmt.Errorf("unable to encode %v", array.Index(i)) } } elemBuf, err = encodePlan.Encode(elem, buf) if err != nil { return nil, err } } if elemBuf == nil { pgio.SetInt32(buf[containsNullIndex:], 1) } else { buf = elemBuf pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4)) } } return buf, nil } func (c *ArrayCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { arrayScanner, ok := target.(ArraySetter) if !ok { return nil } // target / arrayScanner might be a pointer to a nil. If it is create one so we can call ScanIndexType to plan the // scan of the elements. if isNil, _ := isNilDriverValuer(target); isNil { arrayScanner = reflect.New(reflect.TypeOf(target).Elem()).Interface().(ArraySetter) } elementType := arrayScanner.ScanIndexType() elementScanPlan := m.PlanScan(c.ElementType.OID, format, elementType) if _, ok := elementScanPlan.(*scanPlanFail); ok { return nil } return &scanPlanArrayCodec{ arrayCodec: c, m: m, oid: oid, formatCode: format, } } func (c *ArrayCodec) decodeBinary(m *Map, arrayOID uint32, src []byte, array ArraySetter) error { var arrayHeader arrayHeader rp, err := arrayHeader.DecodeBinary(m, src) if err != nil { return err } err = array.SetDimensions(arrayHeader.Dimensions) if err != nil { return err } elementCount := cardinality(arrayHeader.Dimensions) if elementCount == 0 { return nil } elementScanPlan := c.ElementType.Codec.PlanScan(m, c.ElementType.OID, BinaryFormatCode, array.ScanIndex(0)) if elementScanPlan == nil { elementScanPlan = m.PlanScan(c.ElementType.OID, BinaryFormatCode, array.ScanIndex(0)) } for i := range elementCount { elem := array.ScanIndex(i) elemLen := int(int32(binary.BigEndian.Uint32(src[rp:]))) rp += 4 var elemSrc []byte if elemLen >= 0 { elemSrc = src[rp : rp+elemLen] rp += elemLen } err = elementScanPlan.Scan(elemSrc, elem) if err != nil { return fmt.Errorf("failed to scan array element %d: %w", i, err) } } return nil } func (c *ArrayCodec) decodeText(m *Map, arrayOID uint32, src []byte, array ArraySetter) error { uta, err := parseUntypedTextArray(string(src)) if err != nil { return err } err = array.SetDimensions(uta.Dimensions) if err != nil { return err } if len(uta.Elements) == 0 { return nil } elementScanPlan := c.ElementType.Codec.PlanScan(m, c.ElementType.OID, TextFormatCode, array.ScanIndex(0)) if elementScanPlan == nil { elementScanPlan = m.PlanScan(c.ElementType.OID, TextFormatCode, array.ScanIndex(0)) } for i, s := range uta.Elements { elem := array.ScanIndex(i) var elemSrc []byte if s != "NULL" || uta.Quoted[i] { elemSrc = []byte(s) } err = elementScanPlan.Scan(elemSrc, elem) if err != nil { return err } } return nil } type scanPlanArrayCodec struct { arrayCodec *ArrayCodec m *Map oid uint32 formatCode int16 elementScanPlan ScanPlan } func (spac *scanPlanArrayCodec) Scan(src []byte, dst any) error { c := spac.arrayCodec m := spac.m oid := spac.oid formatCode := spac.formatCode array := dst.(ArraySetter) if src == nil { return array.SetDimensions(nil) } switch formatCode { case BinaryFormatCode: return c.decodeBinary(m, oid, src, array) case TextFormatCode: return c.decodeText(m, oid, src, array) default: return fmt.Errorf("unknown format code %d", formatCode) } } func (c *ArrayCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } switch format { case TextFormatCode: return string(src), nil case BinaryFormatCode: buf := make([]byte, len(src)) copy(buf, src) return buf, nil default: return nil, fmt.Errorf("unknown format code %d", format) } } func (c *ArrayCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var slice []any err := m.PlanScan(oid, format, &slice).Scan(src, &slice) return slice, err } func isRagged(slice reflect.Value) bool { if slice.Type().Elem().Kind() != reflect.Slice { return false } sliceLen := slice.Len() innerLen := 0 for i := range sliceLen { if i == 0 { innerLen = slice.Index(i).Len() } else { if slice.Index(i).Len() != innerLen { return true } } if isRagged(slice.Index(i)) { return true } } return false } pgx-5.8.0/pgtype/array_codec_test.go000066400000000000000000000250641512357711200175060ustar00rootroot00000000000000package pgtype_test import ( "context" "encoding/hex" "reflect" "strings" "testing" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func TestArrayCodec(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { for i, tt := range []struct { expected any }{ {[]int16(nil)}, {[]int16{}}, {[]int16{1, 2, 3}}, } { var actual []int16 err := conn.QueryRow( ctx, "select $1::smallint[]", tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } newInt16 := func(n int16) *int16 { return &n } for i, tt := range []struct { expected any }{ {[]*int16{newInt16(1), nil, newInt16(3), nil, newInt16(5)}}, } { var actual []*int16 err := conn.QueryRow( ctx, "select $1::smallint[]", tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } }) } func TestArrayCodecFlatArrayString(t *testing.T) { testCases := []struct { input []string }{ {nil}, {[]string{}}, {[]string{"a"}}, {[]string{"a", "b"}}, // previously had a bug with whitespace handling {[]string{"\v", "\t", "\n", "\r", "\f", " "}}, {[]string{"a\vb", "a\tb", "a\nb", "a\rb", "a\fb", "a b"}}, } queryModes := []pgx.QueryExecMode{pgx.QueryExecModeSimpleProtocol, pgx.QueryExecModeDescribeExec} defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { for i, testCase := range testCases { for _, queryMode := range queryModes { var out []string err := conn.QueryRow(ctx, "select $1::text[]", queryMode, testCase.input).Scan(&out) if err != nil { t.Fatalf("i=%d input=%#v queryMode=%s: Scan failed: %s", i, testCase.input, queryMode, err) } if !reflect.DeepEqual(out, testCase.input) { t.Errorf("i=%d input=%#v queryMode=%s: not equal output=%#v", i, testCase.input, queryMode, out) } } } }) } func TestArrayCodecArray(t *testing.T) { ctr := defaultConnTestRunner ctr.AfterConnect = func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server does not support multi-dimensional arrays") } ctr.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { for i, tt := range []struct { expected any }{ {pgtype.Array[int32]{ Elements: []int32{1, 2, 3, 4}, Dims: []pgtype.ArrayDimension{ {Length: 2, LowerBound: 2}, {Length: 2, LowerBound: 2}, }, Valid: true, }}, } { var actual pgtype.Array[int32] err := conn.QueryRow( ctx, "select $1::int[]", tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } }) } func TestArrayCodecPointerToNil(t *testing.T) { pgxtest.RunWithQueryExecModes(context.Background(), t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { n := int32(42) input := []*int32{&n, nil} var actual []*int32 err := conn.QueryRow( ctx, "select $1::int[]", input, ).Scan(&actual) require.NoError(t, err) require.Equal(t, input, actual) }) } func TestArrayCodecNamedSliceType(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { type _int16Slice []int16 for i, tt := range []struct { expected any }{ {_int16Slice(nil)}, {_int16Slice{}}, {_int16Slice{1, 2, 3}}, } { var actual _int16Slice err := conn.QueryRow( ctx, "select $1::smallint[]", tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } }) } // https://github.com/jackc/pgx/issues/1488 func TestArrayCodecAnySliceArgument(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { type _int16Slice []int16 for i, tt := range []struct { arg any expected []int16 }{ {[]any{1, 2, 3}, []int16{1, 2, 3}}, } { var actual []int16 err := conn.QueryRow( ctx, "select $1::smallint[]", tt.arg, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } }) } // https://github.com/jackc/pgx/issues/1442 func TestArrayCodecAnyArray(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { type _point3 [3]float32 for i, tt := range []struct { expected any }{ {_point3{0, 0, 0}}, {_point3{1, 2, 3}}, } { var actual _point3 err := conn.QueryRow( ctx, "select $1::float4[]", tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } }) } // https://github.com/jackc/pgx/issues/1273#issuecomment-1218262703 func TestArrayCodecSliceArgConversion(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { arg := []string{ "3ad95bfd-ecea-4032-83c3-0c823cafb372", "951baf11-c0cc-4afc-a779-abff0611dbf1", "8327f244-7e2f-45e7-a10b-fbdc9d6f3378", } var expected []pgtype.UUID for _, s := range arg { buf, err := hex.DecodeString(strings.ReplaceAll(s, "-", "")) require.NoError(t, err) var u pgtype.UUID copy(u.Bytes[:], buf) u.Valid = true expected = append(expected, u) } var actual []pgtype.UUID err := conn.QueryRow( ctx, "select $1::uuid[]", arg, ).Scan(&actual) require.NoError(t, err) require.Equal(t, expected, actual) }) } func TestArrayCodecDecodeValue(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { for _, tt := range []struct { sql string expected any }{ { sql: `select '{}'::int4[]`, expected: []any{}, }, { sql: `select '{1,2}'::int8[]`, expected: []any{int64(1), int64(2)}, }, { sql: `select '{foo,bar}'::text[]`, expected: []any{"foo", "bar"}, }, } { t.Run(tt.sql, func(t *testing.T) { rows, err := conn.Query(ctx, tt.sql) require.NoError(t, err) for rows.Next() { values, err := rows.Values() require.NoError(t, err) require.Len(t, values, 1) require.Equal(t, tt.expected, values[0]) } require.NoError(t, rows.Err()) }) } }) } func TestArrayCodecScanMultipleDimensions(t *testing.T) { skipCockroachDB(t, "Server does not support nested arrays (https://github.com/cockroachdb/cockroach/issues/36815)") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, err := conn.Query(ctx, `select '{{1,2,3,4}, {5,6,7,8}, {9,10,11,12}}'::int4[]`) require.NoError(t, err) for rows.Next() { var ss [][]int32 err := rows.Scan(&ss) require.NoError(t, err) require.Equal(t, [][]int32{{1, 2, 3, 4}, {5, 6, 7, 8}, {9, 10, 11, 12}}, ss) } require.NoError(t, rows.Err()) }) } func TestArrayCodecScanMultipleDimensionsEmpty(t *testing.T) { skipCockroachDB(t, "Server does not support nested arrays (https://github.com/cockroachdb/cockroach/issues/36815)") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, err := conn.Query(ctx, `select '{}'::int4[]`) require.NoError(t, err) for rows.Next() { var ss [][]int32 err := rows.Scan(&ss) require.NoError(t, err) require.Equal(t, [][]int32{}, ss) } require.NoError(t, rows.Err()) }) } func TestArrayCodecScanWrongMultipleDimensions(t *testing.T) { skipCockroachDB(t, "Server does not support nested arrays (https://github.com/cockroachdb/cockroach/issues/36815)") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, err := conn.Query(ctx, `select '{{1,2,3,4}, {5,6,7,8}, {9,10,11,12}}'::int4[]`) require.NoError(t, err) for rows.Next() { var ss [][][]int32 err := rows.Scan(&ss) require.Error(t, err, "can't scan into dest[0]: PostgreSQL array has 2 dimensions but slice has 3 dimensions") } }) } func TestArrayCodecEncodeMultipleDimensions(t *testing.T) { skipCockroachDB(t, "Server does not support nested arrays (https://github.com/cockroachdb/cockroach/issues/36815)") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, err := conn.Query(ctx, `select $1::int4[]`, [][]int32{{1, 2, 3, 4}, {5, 6, 7, 8}, {9, 10, 11, 12}}) require.NoError(t, err) for rows.Next() { var ss [][]int32 err := rows.Scan(&ss) require.NoError(t, err) require.Equal(t, [][]int32{{1, 2, 3, 4}, {5, 6, 7, 8}, {9, 10, 11, 12}}, ss) } require.NoError(t, rows.Err()) }) } func TestArrayCodecEncodeMultipleDimensionsRagged(t *testing.T) { skipCockroachDB(t, "Server does not support nested arrays (https://github.com/cockroachdb/cockroach/issues/36815)") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, err := conn.Query(ctx, `select $1::int4[]`, [][]int32{{1, 2, 3, 4}, {5}, {9, 10, 11, 12}}) require.Error(t, err, "cannot convert [][]int32 to ArrayGetter because it is a ragged multi-dimensional") defer rows.Close() }) } // https://github.com/jackc/pgx/issues/1494 func TestArrayCodecDecodeTextArrayWithTextOfNULL(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { { var actual []string err := conn.QueryRow(ctx, `select '{"foo", "NULL", " NULL "}'::text[]`).Scan(&actual) require.NoError(t, err) require.Equal(t, []string{"foo", "NULL", " NULL "}, actual) } { var actual []pgtype.Text err := conn.QueryRow(ctx, `select '{"foo", "NULL", NULL, " NULL "}'::text[]`).Scan(&actual) require.NoError(t, err) require.Equal(t, []pgtype.Text{ {String: "foo", Valid: true}, {String: "NULL", Valid: true}, {}, {String: " NULL ", Valid: true}, }, actual) } }) } func TestArrayCodecDecodeTextArrayPrefersBinaryFormat(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { sd, err := conn.Prepare(ctx, "", `select '{"foo", "NULL", " NULL "}'::text[]`) require.NoError(t, err) require.Equal(t, int16(1), conn.TypeMap().FormatCodeForOID(sd.Fields[0].DataTypeOID)) }) } pgx-5.8.0/pgtype/array_test.go000066400000000000000000000057001512357711200163440ustar00rootroot00000000000000package pgtype import ( "reflect" "testing" ) func TestParseUntypedTextArray(t *testing.T) { tests := []struct { source string result untypedTextArray }{ { source: "{}", result: untypedTextArray{ Elements: []string{}, Quoted: []bool{}, Dimensions: []ArrayDimension{}, }, }, { source: "{1}", result: untypedTextArray{ Elements: []string{"1"}, Quoted: []bool{false}, Dimensions: []ArrayDimension{{Length: 1, LowerBound: 1}}, }, }, { source: "{a,b}", result: untypedTextArray{ Elements: []string{"a", "b"}, Quoted: []bool{false, false}, Dimensions: []ArrayDimension{{Length: 2, LowerBound: 1}}, }, }, { source: `{"NULL"}`, result: untypedTextArray{ Elements: []string{"NULL"}, Quoted: []bool{true}, Dimensions: []ArrayDimension{{Length: 1, LowerBound: 1}}, }, }, { source: `{""}`, result: untypedTextArray{ Elements: []string{""}, Quoted: []bool{true}, Dimensions: []ArrayDimension{{Length: 1, LowerBound: 1}}, }, }, { source: `{"He said, \"Hello.\""}`, result: untypedTextArray{ Elements: []string{`He said, "Hello."`}, Quoted: []bool{true}, Dimensions: []ArrayDimension{{Length: 1, LowerBound: 1}}, }, }, { source: "{{a,b},{c,d},{e,f}}", result: untypedTextArray{ Elements: []string{"a", "b", "c", "d", "e", "f"}, Quoted: []bool{false, false, false, false, false, false}, Dimensions: []ArrayDimension{{Length: 3, LowerBound: 1}, {Length: 2, LowerBound: 1}}, }, }, { source: "{{{a,b},{c,d},{e,f}},{{a,b},{c,d},{e,f}}}", result: untypedTextArray{ Elements: []string{"a", "b", "c", "d", "e", "f", "a", "b", "c", "d", "e", "f"}, Quoted: []bool{false, false, false, false, false, false, false, false, false, false, false, false}, Dimensions: []ArrayDimension{ {Length: 2, LowerBound: 1}, {Length: 3, LowerBound: 1}, {Length: 2, LowerBound: 1}, }, }, }, { source: "[4:4]={1}", result: untypedTextArray{ Elements: []string{"1"}, Quoted: []bool{false}, Dimensions: []ArrayDimension{{Length: 1, LowerBound: 4}}, }, }, { source: "[4:5][2:3]={{a,b},{c,d}}", result: untypedTextArray{ Elements: []string{"a", "b", "c", "d"}, Quoted: []bool{false, false, false, false}, Dimensions: []ArrayDimension{ {Length: 2, LowerBound: 4}, {Length: 2, LowerBound: 2}, }, }, }, { source: "[-4:-2]={1,2,3}", result: untypedTextArray{ Elements: []string{"1", "2", "3"}, Quoted: []bool{false, false, false}, Dimensions: []ArrayDimension{{Length: 3, LowerBound: -4}}, }, }, } for i, tt := range tests { r, err := parseUntypedTextArray(tt.source) if err != nil { t.Errorf("%d: %v", i, err) continue } if !reflect.DeepEqual(*r, tt.result) { t.Errorf("%d: expected %+v to be parsed to %+v, but it was %+v", i, tt.source, tt.result, *r) } } } pgx-5.8.0/pgtype/bits.go000066400000000000000000000103211512357711200151230ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "fmt" "github.com/jackc/pgx/v5/internal/pgio" ) type BitsScanner interface { ScanBits(v Bits) error } type BitsValuer interface { BitsValue() (Bits, error) } // Bits represents the PostgreSQL bit and varbit types. type Bits struct { Bytes []byte Len int32 // Number of bits Valid bool } // ScanBits implements the [BitsScanner] interface. func (b *Bits) ScanBits(v Bits) error { *b = v return nil } // BitsValue implements the [BitsValuer] interface. func (b Bits) BitsValue() (Bits, error) { return b, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Bits) Scan(src any) error { if src == nil { *dst = Bits{} return nil } switch src := src.(type) { case string: return scanPlanTextAnyToBitsScanner{}.Scan([]byte(src), dst) } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (src Bits) Value() (driver.Value, error) { if !src.Valid { return nil, nil } buf, err := BitsCodec{}.PlanEncode(nil, 0, TextFormatCode, src).Encode(src, nil) if err != nil { return nil, err } return string(buf), err } type BitsCodec struct{} func (BitsCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (BitsCodec) PreferredFormat() int16 { return BinaryFormatCode } func (BitsCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(BitsValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanBitsCodecBinary{} case TextFormatCode: return encodePlanBitsCodecText{} } return nil } type encodePlanBitsCodecBinary struct{} func (encodePlanBitsCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { bits, err := value.(BitsValuer).BitsValue() if err != nil { return nil, err } if !bits.Valid { return nil, nil } buf = pgio.AppendInt32(buf, bits.Len) return append(buf, bits.Bytes...), nil } type encodePlanBitsCodecText struct{} func (encodePlanBitsCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { bits, err := value.(BitsValuer).BitsValue() if err != nil { return nil, err } if !bits.Valid { return nil, nil } for i := int32(0); i < bits.Len; i++ { byteIdx := i / 8 bitMask := byte(128 >> byte(i%8)) char := byte('0') if bits.Bytes[byteIdx]&bitMask > 0 { char = '1' } buf = append(buf, char) } return buf, nil } func (BitsCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case BitsScanner: return scanPlanBinaryBitsToBitsScanner{} } case TextFormatCode: switch target.(type) { case BitsScanner: return scanPlanTextAnyToBitsScanner{} } } return nil } func (c BitsCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return codecDecodeToTextFormat(c, m, oid, format, src) } func (c BitsCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var box Bits err := codecScan(c, m, oid, format, src, &box) if err != nil { return nil, err } return box, nil } type scanPlanBinaryBitsToBitsScanner struct{} func (scanPlanBinaryBitsToBitsScanner) Scan(src []byte, dst any) error { scanner := (dst).(BitsScanner) if src == nil { return scanner.ScanBits(Bits{}) } if len(src) < 4 { return fmt.Errorf("invalid length for bit/varbit: %v", len(src)) } bitLen := int32(binary.BigEndian.Uint32(src)) rp := 4 buf := make([]byte, len(src[rp:])) copy(buf, src[rp:]) return scanner.ScanBits(Bits{Bytes: buf, Len: bitLen, Valid: true}) } type scanPlanTextAnyToBitsScanner struct{} func (scanPlanTextAnyToBitsScanner) Scan(src []byte, dst any) error { scanner := (dst).(BitsScanner) if src == nil { return scanner.ScanBits(Bits{}) } bitLen := len(src) byteLen := bitLen / 8 if bitLen%8 > 0 { byteLen++ } buf := make([]byte, byteLen) for i, b := range src { if b == '1' { byteIdx := i / 8 bitIdx := uint(i % 8) buf[byteIdx] = buf[byteIdx] | (128 >> bitIdx) } } return scanner.ScanBits(Bits{Bytes: buf, Len: int32(bitLen), Valid: true}) } pgx-5.8.0/pgtype/bits_test.go000066400000000000000000000035251512357711200161720ustar00rootroot00000000000000package pgtype_test import ( "bytes" "context" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func isExpectedEqBits(a any) func(any) bool { return func(v any) bool { ab := a.(pgtype.Bits) vb := v.(pgtype.Bits) return bytes.Equal(ab.Bytes, vb.Bytes) && ab.Len == vb.Len && ab.Valid == vb.Valid } } func TestBitsCodecBit(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "bit(40)", []pgxtest.ValueRoundTripTest{ { pgtype.Bits{Bytes: []byte{0, 0, 0, 0, 0}, Len: 40, Valid: true}, new(pgtype.Bits), isExpectedEqBits(pgtype.Bits{Bytes: []byte{0, 0, 0, 0, 0}, Len: 40, Valid: true}), }, { pgtype.Bits{Bytes: []byte{0, 1, 128, 254, 255}, Len: 40, Valid: true}, new(pgtype.Bits), isExpectedEqBits(pgtype.Bits{Bytes: []byte{0, 1, 128, 254, 255}, Len: 40, Valid: true}), }, {pgtype.Bits{}, new(pgtype.Bits), isExpectedEqBits(pgtype.Bits{})}, {nil, new(pgtype.Bits), isExpectedEqBits(pgtype.Bits{})}, }) } func TestBitsCodecVarbit(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "varbit", []pgxtest.ValueRoundTripTest{ { pgtype.Bits{Bytes: []byte{}, Len: 0, Valid: true}, new(pgtype.Bits), isExpectedEqBits(pgtype.Bits{Bytes: []byte{}, Len: 0, Valid: true}), }, { pgtype.Bits{Bytes: []byte{0, 1, 128, 254, 255}, Len: 40, Valid: true}, new(pgtype.Bits), isExpectedEqBits(pgtype.Bits{Bytes: []byte{0, 1, 128, 254, 255}, Len: 40, Valid: true}), }, { pgtype.Bits{Bytes: []byte{0, 1, 128, 254, 128}, Len: 33, Valid: true}, new(pgtype.Bits), isExpectedEqBits(pgtype.Bits{Bytes: []byte{0, 1, 128, 254, 128}, Len: 33, Valid: true}), }, {pgtype.Bits{}, new(pgtype.Bits), isExpectedEqBits(pgtype.Bits{})}, {nil, new(pgtype.Bits), isExpectedEqBits(pgtype.Bits{})}, }) } pgx-5.8.0/pgtype/bool.go000066400000000000000000000147761512357711200151370ustar00rootroot00000000000000package pgtype import ( "bytes" "database/sql/driver" "encoding/json" "fmt" "strconv" "strings" ) type BoolScanner interface { ScanBool(v Bool) error } type BoolValuer interface { BoolValue() (Bool, error) } type Bool struct { Bool bool Valid bool } // ScanBool implements the [BoolScanner] interface. func (b *Bool) ScanBool(v Bool) error { *b = v return nil } // BoolValue implements the [BoolValuer] interface. func (b Bool) BoolValue() (Bool, error) { return b, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Bool) Scan(src any) error { if src == nil { *dst = Bool{} return nil } switch src := src.(type) { case bool: *dst = Bool{Bool: src, Valid: true} return nil case string: b, err := strconv.ParseBool(src) if err != nil { return err } *dst = Bool{Bool: b, Valid: true} return nil case []byte: b, err := strconv.ParseBool(string(src)) if err != nil { return err } *dst = Bool{Bool: b, Valid: true} return nil } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (src Bool) Value() (driver.Value, error) { if !src.Valid { return nil, nil } return src.Bool, nil } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (src Bool) MarshalJSON() ([]byte, error) { if !src.Valid { return []byte("null"), nil } if src.Bool { return []byte("true"), nil } else { return []byte("false"), nil } } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (dst *Bool) UnmarshalJSON(b []byte) error { var v *bool err := json.Unmarshal(b, &v) if err != nil { return err } if v == nil { *dst = Bool{} } else { *dst = Bool{Bool: *v, Valid: true} } return nil } type BoolCodec struct{} func (BoolCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (BoolCodec) PreferredFormat() int16 { return BinaryFormatCode } func (BoolCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case BinaryFormatCode: switch value.(type) { case bool: return encodePlanBoolCodecBinaryBool{} case BoolValuer: return encodePlanBoolCodecBinaryBoolValuer{} } case TextFormatCode: switch value.(type) { case bool: return encodePlanBoolCodecTextBool{} case BoolValuer: return encodePlanBoolCodecTextBoolValuer{} } } return nil } type encodePlanBoolCodecBinaryBool struct{} func (encodePlanBoolCodecBinaryBool) Encode(value any, buf []byte) (newBuf []byte, err error) { v := value.(bool) if v { buf = append(buf, 1) } else { buf = append(buf, 0) } return buf, nil } type encodePlanBoolCodecTextBoolValuer struct{} func (encodePlanBoolCodecTextBoolValuer) Encode(value any, buf []byte) (newBuf []byte, err error) { b, err := value.(BoolValuer).BoolValue() if err != nil { return nil, err } if !b.Valid { return nil, nil } if b.Bool { buf = append(buf, 't') } else { buf = append(buf, 'f') } return buf, nil } type encodePlanBoolCodecBinaryBoolValuer struct{} func (encodePlanBoolCodecBinaryBoolValuer) Encode(value any, buf []byte) (newBuf []byte, err error) { b, err := value.(BoolValuer).BoolValue() if err != nil { return nil, err } if !b.Valid { return nil, nil } if b.Bool { buf = append(buf, 1) } else { buf = append(buf, 0) } return buf, nil } type encodePlanBoolCodecTextBool struct{} func (encodePlanBoolCodecTextBool) Encode(value any, buf []byte) (newBuf []byte, err error) { v := value.(bool) if v { buf = append(buf, 't') } else { buf = append(buf, 'f') } return buf, nil } func (BoolCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case *bool: return scanPlanBinaryBoolToBool{} case BoolScanner: return scanPlanBinaryBoolToBoolScanner{} } case TextFormatCode: switch target.(type) { case *bool: return scanPlanTextAnyToBool{} case BoolScanner: return scanPlanTextAnyToBoolScanner{} } } return nil } func (c BoolCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return c.DecodeValue(m, oid, format, src) } func (c BoolCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var b bool err := codecScan(c, m, oid, format, src, &b) if err != nil { return nil, err } return b, nil } type scanPlanBinaryBoolToBool struct{} func (scanPlanBinaryBoolToBool) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 1 { return fmt.Errorf("invalid length for bool: %v", len(src)) } p, ok := (dst).(*bool) if !ok { return ErrScanTargetTypeChanged } *p = src[0] == 1 return nil } type scanPlanTextAnyToBool struct{} func (scanPlanTextAnyToBool) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) == 0 { return fmt.Errorf("cannot scan empty string into %T", dst) } p, ok := (dst).(*bool) if !ok { return ErrScanTargetTypeChanged } v, err := planTextToBool(src) if err != nil { return err } *p = v return nil } type scanPlanBinaryBoolToBoolScanner struct{} func (scanPlanBinaryBoolToBoolScanner) Scan(src []byte, dst any) error { s, ok := (dst).(BoolScanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanBool(Bool{}) } if len(src) != 1 { return fmt.Errorf("invalid length for bool: %v", len(src)) } return s.ScanBool(Bool{Bool: src[0] == 1, Valid: true}) } type scanPlanTextAnyToBoolScanner struct{} func (scanPlanTextAnyToBoolScanner) Scan(src []byte, dst any) error { s, ok := (dst).(BoolScanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanBool(Bool{}) } if len(src) == 0 { return fmt.Errorf("cannot scan empty string into %T", dst) } v, err := planTextToBool(src) if err != nil { return err } return s.ScanBool(Bool{Bool: v, Valid: true}) } // https://www.postgresql.org/docs/current/datatype-boolean.html func planTextToBool(src []byte) (bool, error) { s := string(bytes.ToLower(bytes.TrimSpace(src))) switch { case strings.HasPrefix("true", s), strings.HasPrefix("yes", s), s == "on", s == "1": return true, nil case strings.HasPrefix("false", s), strings.HasPrefix("no", s), strings.HasPrefix("off", s), s == "0": return false, nil default: return false, fmt.Errorf("unknown boolean string representation %q", src) } } pgx-5.8.0/pgtype/bool_test.go000066400000000000000000000032441512357711200161620ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func TestBoolCodec(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "bool", []pgxtest.ValueRoundTripTest{ {true, new(bool), isExpectedEq(true)}, {false, new(bool), isExpectedEq(false)}, {true, new(pgtype.Bool), isExpectedEq(pgtype.Bool{Bool: true, Valid: true})}, {pgtype.Bool{}, new(pgtype.Bool), isExpectedEq(pgtype.Bool{})}, {nil, new(*bool), isExpectedEq((*bool)(nil))}, }) } func TestBoolMarshalJSON(t *testing.T) { successfulTests := []struct { source pgtype.Bool result string }{ {source: pgtype.Bool{}, result: "null"}, {source: pgtype.Bool{Bool: true, Valid: true}, result: "true"}, {source: pgtype.Bool{Bool: false, Valid: true}, result: "false"}, } for i, tt := range successfulTests { r, err := tt.source.MarshalJSON() if err != nil { t.Errorf("%d: %v", i, err) } if string(r) != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, string(r)) } } } func TestBoolUnmarshalJSON(t *testing.T) { successfulTests := []struct { source string result pgtype.Bool }{ {source: "null", result: pgtype.Bool{}}, {source: "true", result: pgtype.Bool{Bool: true, Valid: true}}, {source: "false", result: pgtype.Bool{Bool: false, Valid: true}}, } for i, tt := range successfulTests { var r pgtype.Bool err := r.UnmarshalJSON([]byte(tt.source)) if err != nil { t.Errorf("%d: %v", i, err) } if r != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, r) } } } pgx-5.8.0/pgtype/box.go000066400000000000000000000114751512357711200147650ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "fmt" "math" "strconv" "strings" "github.com/jackc/pgx/v5/internal/pgio" ) type BoxScanner interface { ScanBox(v Box) error } type BoxValuer interface { BoxValue() (Box, error) } type Box struct { P [2]Vec2 Valid bool } // ScanBox implements the [BoxScanner] interface. func (b *Box) ScanBox(v Box) error { *b = v return nil } // BoxValue implements the [BoxValuer] interface. func (b Box) BoxValue() (Box, error) { return b, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Box) Scan(src any) error { if src == nil { *dst = Box{} return nil } switch src := src.(type) { case string: return scanPlanTextAnyToBoxScanner{}.Scan([]byte(src), dst) } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (src Box) Value() (driver.Value, error) { if !src.Valid { return nil, nil } buf, err := BoxCodec{}.PlanEncode(nil, 0, TextFormatCode, src).Encode(src, nil) if err != nil { return nil, err } return string(buf), err } type BoxCodec struct{} func (BoxCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (BoxCodec) PreferredFormat() int16 { return BinaryFormatCode } func (BoxCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(BoxValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanBoxCodecBinary{} case TextFormatCode: return encodePlanBoxCodecText{} } return nil } type encodePlanBoxCodecBinary struct{} func (encodePlanBoxCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { box, err := value.(BoxValuer).BoxValue() if err != nil { return nil, err } if !box.Valid { return nil, nil } buf = pgio.AppendUint64(buf, math.Float64bits(box.P[0].X)) buf = pgio.AppendUint64(buf, math.Float64bits(box.P[0].Y)) buf = pgio.AppendUint64(buf, math.Float64bits(box.P[1].X)) buf = pgio.AppendUint64(buf, math.Float64bits(box.P[1].Y)) return buf, nil } type encodePlanBoxCodecText struct{} func (encodePlanBoxCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { box, err := value.(BoxValuer).BoxValue() if err != nil { return nil, err } if !box.Valid { return nil, nil } buf = append(buf, fmt.Sprintf(`(%s,%s),(%s,%s)`, strconv.FormatFloat(box.P[0].X, 'f', -1, 64), strconv.FormatFloat(box.P[0].Y, 'f', -1, 64), strconv.FormatFloat(box.P[1].X, 'f', -1, 64), strconv.FormatFloat(box.P[1].Y, 'f', -1, 64), )...) return buf, nil } func (BoxCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case BoxScanner: return scanPlanBinaryBoxToBoxScanner{} } case TextFormatCode: switch target.(type) { case BoxScanner: return scanPlanTextAnyToBoxScanner{} } } return nil } type scanPlanBinaryBoxToBoxScanner struct{} func (scanPlanBinaryBoxToBoxScanner) Scan(src []byte, dst any) error { scanner := (dst).(BoxScanner) if src == nil { return scanner.ScanBox(Box{}) } if len(src) != 32 { return fmt.Errorf("invalid length for Box: %v", len(src)) } x1 := binary.BigEndian.Uint64(src) y1 := binary.BigEndian.Uint64(src[8:]) x2 := binary.BigEndian.Uint64(src[16:]) y2 := binary.BigEndian.Uint64(src[24:]) return scanner.ScanBox(Box{ P: [2]Vec2{ {math.Float64frombits(x1), math.Float64frombits(y1)}, {math.Float64frombits(x2), math.Float64frombits(y2)}, }, Valid: true, }) } type scanPlanTextAnyToBoxScanner struct{} func (scanPlanTextAnyToBoxScanner) Scan(src []byte, dst any) error { scanner := (dst).(BoxScanner) if src == nil { return scanner.ScanBox(Box{}) } if len(src) < 11 { return fmt.Errorf("invalid length for Box: %v", len(src)) } str := string(src[1:]) var end int end = strings.IndexByte(str, ',') x1, err := strconv.ParseFloat(str[:end], 64) if err != nil { return err } str = str[end+1:] end = strings.IndexByte(str, ')') y1, err := strconv.ParseFloat(str[:end], 64) if err != nil { return err } str = str[end+3:] end = strings.IndexByte(str, ',') x2, err := strconv.ParseFloat(str[:end], 64) if err != nil { return err } str = str[end+1 : len(str)-1] y2, err := strconv.ParseFloat(str, 64) if err != nil { return err } return scanner.ScanBox(Box{P: [2]Vec2{{x1, y1}, {x2, y2}}, Valid: true}) } func (c BoxCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return codecDecodeToTextFormat(c, m, oid, format, src) } func (c BoxCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var box Box err := codecScan(c, m, oid, format, src, &box) if err != nil { return nil, err } return box, nil } pgx-5.8.0/pgtype/box_test.go000066400000000000000000000016611512357711200160200ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func TestBoxCodec(t *testing.T) { skipCockroachDB(t, "Server does not support box type") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "box", []pgxtest.ValueRoundTripTest{ { pgtype.Box{ P: [2]pgtype.Vec2{{7.1, 5.2345678}, {3.14, 1.678}}, Valid: true, }, new(pgtype.Box), isExpectedEq(pgtype.Box{ P: [2]pgtype.Vec2{{7.1, 5.2345678}, {3.14, 1.678}}, Valid: true, }), }, { pgtype.Box{ P: [2]pgtype.Vec2{{7.1, 5.2345678}, {-13.14, -5.234}}, Valid: true, }, new(pgtype.Box), isExpectedEq(pgtype.Box{ P: [2]pgtype.Vec2{{7.1, 5.2345678}, {-13.14, -5.234}}, Valid: true, }), }, {pgtype.Box{}, new(pgtype.Box), isExpectedEq(pgtype.Box{})}, {nil, new(pgtype.Box), isExpectedEq(pgtype.Box{})}, }) } pgx-5.8.0/pgtype/builtin_wrappers.go000066400000000000000000000532351512357711200175660ustar00rootroot00000000000000package pgtype import ( "errors" "fmt" "math" "math/big" "net" "net/netip" "reflect" "time" ) type int8Wrapper int8 func (w int8Wrapper) SkipUnderlyingTypePlan() {} func (w *int8Wrapper) ScanInt64(v Int8) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *int8") } if v.Int64 < math.MinInt8 { return fmt.Errorf("%d is less than minimum value for int8", v.Int64) } if v.Int64 > math.MaxInt8 { return fmt.Errorf("%d is greater than maximum value for int8", v.Int64) } *w = int8Wrapper(v.Int64) return nil } func (w int8Wrapper) Int64Value() (Int8, error) { return Int8{Int64: int64(w), Valid: true}, nil } type int16Wrapper int16 func (w int16Wrapper) SkipUnderlyingTypePlan() {} func (w *int16Wrapper) ScanInt64(v Int8) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *int16") } if v.Int64 < math.MinInt16 { return fmt.Errorf("%d is less than minimum value for int16", v.Int64) } if v.Int64 > math.MaxInt16 { return fmt.Errorf("%d is greater than maximum value for int16", v.Int64) } *w = int16Wrapper(v.Int64) return nil } func (w int16Wrapper) Int64Value() (Int8, error) { return Int8{Int64: int64(w), Valid: true}, nil } type int32Wrapper int32 func (w int32Wrapper) SkipUnderlyingTypePlan() {} func (w *int32Wrapper) ScanInt64(v Int8) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *int32") } if v.Int64 < math.MinInt32 { return fmt.Errorf("%d is less than minimum value for int32", v.Int64) } if v.Int64 > math.MaxInt32 { return fmt.Errorf("%d is greater than maximum value for int32", v.Int64) } *w = int32Wrapper(v.Int64) return nil } func (w int32Wrapper) Int64Value() (Int8, error) { return Int8{Int64: int64(w), Valid: true}, nil } type int64Wrapper int64 func (w int64Wrapper) SkipUnderlyingTypePlan() {} func (w *int64Wrapper) ScanInt64(v Int8) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *int64") } *w = int64Wrapper(v.Int64) return nil } func (w int64Wrapper) Int64Value() (Int8, error) { return Int8{Int64: int64(w), Valid: true}, nil } type intWrapper int func (w intWrapper) SkipUnderlyingTypePlan() {} func (w *intWrapper) ScanInt64(v Int8) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *int") } if v.Int64 < math.MinInt { return fmt.Errorf("%d is less than minimum value for int", v.Int64) } if v.Int64 > math.MaxInt { return fmt.Errorf("%d is greater than maximum value for int", v.Int64) } *w = intWrapper(v.Int64) return nil } func (w intWrapper) Int64Value() (Int8, error) { return Int8{Int64: int64(w), Valid: true}, nil } type uint8Wrapper uint8 func (w uint8Wrapper) SkipUnderlyingTypePlan() {} func (w *uint8Wrapper) ScanInt64(v Int8) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *uint8") } if v.Int64 < 0 { return fmt.Errorf("%d is less than minimum value for uint8", v.Int64) } if v.Int64 > math.MaxUint8 { return fmt.Errorf("%d is greater than maximum value for uint8", v.Int64) } *w = uint8Wrapper(v.Int64) return nil } func (w uint8Wrapper) Int64Value() (Int8, error) { return Int8{Int64: int64(w), Valid: true}, nil } type uint16Wrapper uint16 func (w uint16Wrapper) SkipUnderlyingTypePlan() {} func (w *uint16Wrapper) ScanInt64(v Int8) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *uint16") } if v.Int64 < 0 { return fmt.Errorf("%d is less than minimum value for uint16", v.Int64) } if v.Int64 > math.MaxUint16 { return fmt.Errorf("%d is greater than maximum value for uint16", v.Int64) } *w = uint16Wrapper(v.Int64) return nil } func (w uint16Wrapper) Int64Value() (Int8, error) { return Int8{Int64: int64(w), Valid: true}, nil } type uint32Wrapper uint32 func (w uint32Wrapper) SkipUnderlyingTypePlan() {} func (w *uint32Wrapper) ScanInt64(v Int8) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *uint32") } if v.Int64 < 0 { return fmt.Errorf("%d is less than minimum value for uint32", v.Int64) } if v.Int64 > math.MaxUint32 { return fmt.Errorf("%d is greater than maximum value for uint32", v.Int64) } *w = uint32Wrapper(v.Int64) return nil } func (w uint32Wrapper) Int64Value() (Int8, error) { return Int8{Int64: int64(w), Valid: true}, nil } type uint64Wrapper uint64 func (w uint64Wrapper) SkipUnderlyingTypePlan() {} func (w *uint64Wrapper) ScanInt64(v Int8) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *uint64") } if v.Int64 < 0 { return fmt.Errorf("%d is less than minimum value for uint64", v.Int64) } *w = uint64Wrapper(v.Int64) return nil } func (w uint64Wrapper) Int64Value() (Int8, error) { if uint64(w) > uint64(math.MaxInt64) { return Int8{}, fmt.Errorf("%d is greater than maximum value for int64", w) } return Int8{Int64: int64(w), Valid: true}, nil } func (w *uint64Wrapper) ScanNumeric(v Numeric) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *uint64") } bi, err := v.toBigInt() if err != nil { return fmt.Errorf("cannot scan into *uint64: %w", err) } if !bi.IsUint64() { return fmt.Errorf("cannot scan %v into *uint64", bi.String()) } *w = uint64Wrapper(bi.Uint64()) return nil } func (w uint64Wrapper) NumericValue() (Numeric, error) { return Numeric{Int: new(big.Int).SetUint64(uint64(w)), Valid: true}, nil } type uintWrapper uint func (w uintWrapper) SkipUnderlyingTypePlan() {} func (w *uintWrapper) ScanInt64(v Int8) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *uint64") } if v.Int64 < 0 { return fmt.Errorf("%d is less than minimum value for uint64", v.Int64) } if uint64(v.Int64) > math.MaxUint { return fmt.Errorf("%d is greater than maximum value for uint", v.Int64) } *w = uintWrapper(v.Int64) return nil } func (w uintWrapper) Int64Value() (Int8, error) { if uint64(w) > uint64(math.MaxInt64) { return Int8{}, fmt.Errorf("%d is greater than maximum value for int64", w) } return Int8{Int64: int64(w), Valid: true}, nil } func (w *uintWrapper) ScanNumeric(v Numeric) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *uint") } bi, err := v.toBigInt() if err != nil { return fmt.Errorf("cannot scan into *uint: %w", err) } if !bi.IsUint64() { return fmt.Errorf("cannot scan %v into *uint", bi.String()) } ui := bi.Uint64() if math.MaxUint < ui { return fmt.Errorf("cannot scan %v into *uint", ui) } *w = uintWrapper(ui) return nil } func (w uintWrapper) NumericValue() (Numeric, error) { return Numeric{Int: new(big.Int).SetUint64(uint64(w)), Valid: true}, nil } type float32Wrapper float32 func (w float32Wrapper) SkipUnderlyingTypePlan() {} func (w *float32Wrapper) ScanInt64(v Int8) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *float32") } *w = float32Wrapper(v.Int64) return nil } func (w float32Wrapper) Int64Value() (Int8, error) { if w > math.MaxInt64 { return Int8{}, fmt.Errorf("%f is greater than maximum value for int64", w) } return Int8{Int64: int64(w), Valid: true}, nil } func (w *float32Wrapper) ScanFloat64(v Float8) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *float32") } *w = float32Wrapper(v.Float64) return nil } func (w float32Wrapper) Float64Value() (Float8, error) { return Float8{Float64: float64(w), Valid: true}, nil } type float64Wrapper float64 func (w float64Wrapper) SkipUnderlyingTypePlan() {} func (w *float64Wrapper) ScanInt64(v Int8) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *float64") } *w = float64Wrapper(v.Int64) return nil } func (w float64Wrapper) Int64Value() (Int8, error) { if w > math.MaxInt64 { return Int8{}, fmt.Errorf("%f is greater than maximum value for int64", w) } return Int8{Int64: int64(w), Valid: true}, nil } func (w *float64Wrapper) ScanFloat64(v Float8) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *float64") } *w = float64Wrapper(v.Float64) return nil } func (w float64Wrapper) Float64Value() (Float8, error) { return Float8{Float64: float64(w), Valid: true}, nil } type stringWrapper string func (w stringWrapper) SkipUnderlyingTypePlan() {} func (w *stringWrapper) ScanText(v Text) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *string") } *w = stringWrapper(v.String) return nil } func (w stringWrapper) TextValue() (Text, error) { return Text{String: string(w), Valid: true}, nil } type timeWrapper time.Time func (w *timeWrapper) ScanDate(v Date) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *time.Time") } switch v.InfinityModifier { case Finite: *w = timeWrapper(v.Time) return nil case Infinity: return fmt.Errorf("cannot scan Infinity into *time.Time") case NegativeInfinity: return fmt.Errorf("cannot scan -Infinity into *time.Time") default: return fmt.Errorf("invalid InfinityModifier: %v", v.InfinityModifier) } } func (w timeWrapper) DateValue() (Date, error) { return Date{Time: time.Time(w), Valid: true}, nil } func (w *timeWrapper) ScanTimestamp(v Timestamp) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *time.Time") } switch v.InfinityModifier { case Finite: *w = timeWrapper(v.Time) return nil case Infinity: return fmt.Errorf("cannot scan Infinity into *time.Time") case NegativeInfinity: return fmt.Errorf("cannot scan -Infinity into *time.Time") default: return fmt.Errorf("invalid InfinityModifier: %v", v.InfinityModifier) } } func (w timeWrapper) TimestampValue() (Timestamp, error) { return Timestamp{Time: time.Time(w), Valid: true}, nil } func (w *timeWrapper) ScanTimestamptz(v Timestamptz) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *time.Time") } switch v.InfinityModifier { case Finite: *w = timeWrapper(v.Time) return nil case Infinity: return fmt.Errorf("cannot scan Infinity into *time.Time") case NegativeInfinity: return fmt.Errorf("cannot scan -Infinity into *time.Time") default: return fmt.Errorf("invalid InfinityModifier: %v", v.InfinityModifier) } } func (w timeWrapper) TimestamptzValue() (Timestamptz, error) { return Timestamptz{Time: time.Time(w), Valid: true}, nil } func (w *timeWrapper) ScanTime(v Time) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *time.Time") } // 24:00:00 is max allowed time in PostgreSQL, but time.Time will normalize that to 00:00:00 the next day. var maxRepresentableByTime int64 = 24*60*60*1000000 - 1 if v.Microseconds > maxRepresentableByTime { return fmt.Errorf("%d microseconds cannot be represented as time.Time", v.Microseconds) } usec := v.Microseconds hours := usec / microsecondsPerHour usec -= hours * microsecondsPerHour minutes := usec / microsecondsPerMinute usec -= minutes * microsecondsPerMinute seconds := usec / microsecondsPerSecond usec -= seconds * microsecondsPerSecond ns := usec * 1000 *w = timeWrapper(time.Date(2000, 1, 1, int(hours), int(minutes), int(seconds), int(ns), time.UTC)) return nil } func (w timeWrapper) TimeValue() (Time, error) { t := time.Time(w) usec := int64(t.Hour())*microsecondsPerHour + int64(t.Minute())*microsecondsPerMinute + int64(t.Second())*microsecondsPerSecond + int64(t.Nanosecond())/1000 return Time{Microseconds: usec, Valid: true}, nil } type durationWrapper time.Duration func (w durationWrapper) SkipUnderlyingTypePlan() {} func (w *durationWrapper) ScanInterval(v Interval) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *time.Interval") } us := int64(v.Months)*microsecondsPerMonth + int64(v.Days)*microsecondsPerDay + v.Microseconds *w = durationWrapper(time.Duration(us) * time.Microsecond) return nil } func (w durationWrapper) IntervalValue() (Interval, error) { return Interval{Microseconds: int64(w) / 1000, Valid: true}, nil } type netIPNetWrapper net.IPNet func (w *netIPNetWrapper) ScanNetipPrefix(v netip.Prefix) error { if !v.IsValid() { return fmt.Errorf("cannot scan NULL into *net.IPNet") } *w = netIPNetWrapper{ IP: v.Addr().AsSlice(), Mask: net.CIDRMask(v.Bits(), v.Addr().BitLen()), } return nil } func (w netIPNetWrapper) NetipPrefixValue() (netip.Prefix, error) { ip, ok := netip.AddrFromSlice(w.IP) if !ok { return netip.Prefix{}, errors.New("invalid net.IPNet") } ones, _ := w.Mask.Size() return netip.PrefixFrom(ip, ones), nil } type netIPWrapper net.IP func (w netIPWrapper) SkipUnderlyingTypePlan() {} func (w *netIPWrapper) ScanNetipPrefix(v netip.Prefix) error { if !v.IsValid() { *w = nil return nil } if v.Addr().BitLen() != v.Bits() { return fmt.Errorf("cannot scan %v to *net.IP", v) } *w = netIPWrapper(v.Addr().AsSlice()) return nil } func (w netIPWrapper) NetipPrefixValue() (netip.Prefix, error) { if w == nil { return netip.Prefix{}, nil } addr, ok := netip.AddrFromSlice([]byte(w)) if !ok { return netip.Prefix{}, errors.New("invalid net.IP") } return netip.PrefixFrom(addr, addr.BitLen()), nil } type netipPrefixWrapper netip.Prefix func (w *netipPrefixWrapper) ScanNetipPrefix(v netip.Prefix) error { *w = netipPrefixWrapper(v) return nil } func (w netipPrefixWrapper) NetipPrefixValue() (netip.Prefix, error) { return netip.Prefix(w), nil } type netipAddrWrapper netip.Addr func (w *netipAddrWrapper) ScanNetipPrefix(v netip.Prefix) error { if !v.IsValid() { *w = netipAddrWrapper(netip.Addr{}) return nil } if v.Addr().BitLen() != v.Bits() { return fmt.Errorf("cannot scan %v to netip.Addr", v) } *w = netipAddrWrapper(v.Addr()) return nil } func (w netipAddrWrapper) NetipPrefixValue() (netip.Prefix, error) { addr := (netip.Addr)(w) if !addr.IsValid() { return netip.Prefix{}, nil } return netip.PrefixFrom(addr, addr.BitLen()), nil } type mapStringToPointerStringWrapper map[string]*string func (w *mapStringToPointerStringWrapper) ScanHstore(v Hstore) error { *w = mapStringToPointerStringWrapper(v) return nil } func (w mapStringToPointerStringWrapper) HstoreValue() (Hstore, error) { return Hstore(w), nil } type mapStringToStringWrapper map[string]string func (w *mapStringToStringWrapper) ScanHstore(v Hstore) error { *w = make(mapStringToStringWrapper, len(v)) for k, v := range v { if v == nil { return fmt.Errorf("cannot scan NULL to string") } (*w)[k] = *v } return nil } func (w mapStringToStringWrapper) HstoreValue() (Hstore, error) { if w == nil { return nil, nil } hstore := make(Hstore, len(w)) for k, v := range w { s := v hstore[k] = &s } return hstore, nil } type fmtStringerWrapper struct { s fmt.Stringer } func (w fmtStringerWrapper) TextValue() (Text, error) { return Text{String: w.s.String(), Valid: true}, nil } type byte16Wrapper [16]byte func (w *byte16Wrapper) ScanUUID(v UUID) error { if !v.Valid { return fmt.Errorf("cannot scan NULL into *[16]byte") } *w = byte16Wrapper(v.Bytes) return nil } func (w byte16Wrapper) UUIDValue() (UUID, error) { return UUID{Bytes: [16]byte(w), Valid: true}, nil } type byteSliceWrapper []byte func (w byteSliceWrapper) SkipUnderlyingTypePlan() {} func (w *byteSliceWrapper) ScanText(v Text) error { if !v.Valid { *w = nil return nil } *w = byteSliceWrapper(v.String) return nil } func (w byteSliceWrapper) TextValue() (Text, error) { if w == nil { return Text{}, nil } return Text{String: string(w), Valid: true}, nil } func (w *byteSliceWrapper) ScanUUID(v UUID) error { if !v.Valid { *w = nil return nil } *w = make(byteSliceWrapper, 16) copy(*w, v.Bytes[:]) return nil } func (w byteSliceWrapper) UUIDValue() (UUID, error) { if w == nil { return UUID{}, nil } uuid := UUID{Valid: true} copy(uuid.Bytes[:], w) return uuid, nil } // structWrapper implements CompositeIndexGetter for a struct. type structWrapper struct { s any exportedFields []reflect.Value } func (w structWrapper) IsNull() bool { return w.s == nil } func (w structWrapper) Index(i int) any { if i >= len(w.exportedFields) { return fmt.Errorf("%#v only has %d public fields - %d is out of bounds", w.s, len(w.exportedFields), i) } return w.exportedFields[i].Interface() } // ptrStructWrapper implements CompositeIndexScanner for a pointer to a struct. type ptrStructWrapper struct { s any exportedFields []reflect.Value } func (w *ptrStructWrapper) ScanNull() error { return fmt.Errorf("cannot scan NULL into %#v", w.s) } func (w *ptrStructWrapper) ScanIndex(i int) any { if i >= len(w.exportedFields) { return fmt.Errorf("%#v only has %d public fields - %d is out of bounds", w.s, len(w.exportedFields), i) } return w.exportedFields[i].Addr().Interface() } type anySliceArrayReflect struct { slice reflect.Value } func (a anySliceArrayReflect) Dimensions() []ArrayDimension { if a.slice.IsNil() { return nil } return []ArrayDimension{{Length: int32(a.slice.Len()), LowerBound: 1}} } func (a anySliceArrayReflect) Index(i int) any { return a.slice.Index(i).Interface() } func (a anySliceArrayReflect) IndexType() any { return reflect.New(a.slice.Type().Elem()).Elem().Interface() } func (a *anySliceArrayReflect) SetDimensions(dimensions []ArrayDimension) error { sliceType := a.slice.Type() if dimensions == nil { a.slice.Set(reflect.Zero(sliceType)) return nil } elementCount := cardinality(dimensions) slice := reflect.MakeSlice(sliceType, elementCount, elementCount) a.slice.Set(slice) return nil } func (a *anySliceArrayReflect) ScanIndex(i int) any { return a.slice.Index(i).Addr().Interface() } func (a *anySliceArrayReflect) ScanIndexType() any { return reflect.New(a.slice.Type().Elem()).Interface() } type anyMultiDimSliceArray struct { slice reflect.Value dims []ArrayDimension } func (a *anyMultiDimSliceArray) Dimensions() []ArrayDimension { if a.slice.IsNil() { return nil } s := a.slice for { a.dims = append(a.dims, ArrayDimension{Length: int32(s.Len()), LowerBound: 1}) if s.Len() > 0 { s = s.Index(0) } else { break } if s.Type().Kind() == reflect.Slice { } else { break } } return a.dims } func (a *anyMultiDimSliceArray) Index(i int) any { if len(a.dims) == 1 { return a.slice.Index(i).Interface() } indexes := make([]int, len(a.dims)) for j := len(a.dims) - 1; j >= 0; j-- { dimLen := int(a.dims[j].Length) indexes[j] = i % dimLen i = i / dimLen } v := a.slice for _, si := range indexes { v = v.Index(si) } return v.Interface() } func (a *anyMultiDimSliceArray) IndexType() any { lowestSliceType := a.slice.Type() for ; lowestSliceType.Elem().Kind() == reflect.Slice; lowestSliceType = lowestSliceType.Elem() { } return reflect.New(lowestSliceType.Elem()).Elem().Interface() } func (a *anyMultiDimSliceArray) SetDimensions(dimensions []ArrayDimension) error { sliceType := a.slice.Type() if dimensions == nil { a.slice.Set(reflect.Zero(sliceType)) return nil } switch len(dimensions) { case 0: // Empty, but non-nil array slice := reflect.MakeSlice(sliceType, 0, 0) a.slice.Set(slice) return nil case 1: elementCount := cardinality(dimensions) slice := reflect.MakeSlice(sliceType, elementCount, elementCount) a.slice.Set(slice) return nil default: sliceDimensionCount := 1 lowestSliceType := sliceType for ; lowestSliceType.Elem().Kind() == reflect.Slice; lowestSliceType = lowestSliceType.Elem() { sliceDimensionCount++ } if sliceDimensionCount != len(dimensions) { return fmt.Errorf("PostgreSQL array has %d dimensions but slice has %d dimensions", len(dimensions), sliceDimensionCount) } elementCount := cardinality(dimensions) flatSlice := reflect.MakeSlice(lowestSliceType, elementCount, elementCount) multiDimSlice := a.makeMultidimensionalSlice(sliceType, dimensions, flatSlice, 0) a.slice.Set(multiDimSlice) // Now that a.slice is a multi-dimensional slice with the underlying data pointed at flatSlice change a.slice to // flatSlice so ScanIndex only has to handle simple one dimensional slices. a.slice = flatSlice return nil } } func (a *anyMultiDimSliceArray) makeMultidimensionalSlice(sliceType reflect.Type, dimensions []ArrayDimension, flatSlice reflect.Value, flatSliceIdx int) reflect.Value { if len(dimensions) == 1 { endIdx := flatSliceIdx + int(dimensions[0].Length) return flatSlice.Slice3(flatSliceIdx, endIdx, endIdx) } sliceLen := int(dimensions[0].Length) slice := reflect.MakeSlice(sliceType, sliceLen, sliceLen) for i := range sliceLen { subSlice := a.makeMultidimensionalSlice(sliceType.Elem(), dimensions[1:], flatSlice, flatSliceIdx+(i*int(dimensions[1].Length))) slice.Index(i).Set(subSlice) } return slice } func (a *anyMultiDimSliceArray) ScanIndex(i int) any { return a.slice.Index(i).Addr().Interface() } func (a *anyMultiDimSliceArray) ScanIndexType() any { lowestSliceType := a.slice.Type() for ; lowestSliceType.Elem().Kind() == reflect.Slice; lowestSliceType = lowestSliceType.Elem() { } return reflect.New(lowestSliceType.Elem()).Interface() } type anyArrayArrayReflect struct { array reflect.Value } func (a anyArrayArrayReflect) Dimensions() []ArrayDimension { return []ArrayDimension{{Length: int32(a.array.Len()), LowerBound: 1}} } func (a anyArrayArrayReflect) Index(i int) any { return a.array.Index(i).Interface() } func (a anyArrayArrayReflect) IndexType() any { return reflect.New(a.array.Type().Elem()).Elem().Interface() } func (a *anyArrayArrayReflect) SetDimensions(dimensions []ArrayDimension) error { if dimensions == nil { return fmt.Errorf("anyArrayArrayReflect: cannot scan NULL into %v", a.array.Type().String()) } if len(dimensions) != 1 { return fmt.Errorf("anyArrayArrayReflect: cannot scan multi-dimensional array into %v", a.array.Type().String()) } if int(dimensions[0].Length) != a.array.Len() { return fmt.Errorf("anyArrayArrayReflect: cannot scan array with length %v into %v", dimensions[0].Length, a.array.Type().String()) } return nil } func (a *anyArrayArrayReflect) ScanIndex(i int) any { return a.array.Index(i).Addr().Interface() } func (a *anyArrayArrayReflect) ScanIndexType() any { return reflect.New(a.array.Type().Elem()).Interface() } pgx-5.8.0/pgtype/bytea.go000066400000000000000000000130311512357711200152670ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/hex" "fmt" ) type BytesScanner interface { // ScanBytes receives a byte slice of driver memory that is only valid until the next database method call. ScanBytes(v []byte) error } type BytesValuer interface { // BytesValue returns a byte slice of the byte data. The caller must not change the returned slice. BytesValue() ([]byte, error) } // DriverBytes is a byte slice that holds a reference to memory owned by the driver. It is only valid from the time it // is scanned until Rows.Next or Rows.Close is called. It is never safe to use DriverBytes with QueryRow as Row.Scan // internally calls Rows.Close before returning. type DriverBytes []byte func (b *DriverBytes) ScanBytes(v []byte) error { *b = v return nil } // PreallocBytes is a byte slice of preallocated memory that scanned bytes will be copied to. If it is too small a new // slice will be allocated. type PreallocBytes []byte func (b *PreallocBytes) ScanBytes(v []byte) error { if v == nil { *b = nil return nil } if len(v) <= len(*b) { *b = (*b)[:len(v)] } else { *b = make(PreallocBytes, len(v)) } copy(*b, v) return nil } // UndecodedBytes can be used as a scan target to get the raw bytes from PostgreSQL without any decoding. type UndecodedBytes []byte type scanPlanAnyToUndecodedBytes struct{} func (scanPlanAnyToUndecodedBytes) Scan(src []byte, dst any) error { dstBuf := dst.(*UndecodedBytes) if src == nil { *dstBuf = nil return nil } *dstBuf = make([]byte, len(src)) copy(*dstBuf, src) return nil } type ByteaCodec struct{} func (ByteaCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (ByteaCodec) PreferredFormat() int16 { return BinaryFormatCode } func (ByteaCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case BinaryFormatCode: switch value.(type) { case []byte: return encodePlanBytesCodecBinaryBytes{} case BytesValuer: return encodePlanBytesCodecBinaryBytesValuer{} } case TextFormatCode: switch value.(type) { case []byte: return encodePlanBytesCodecTextBytes{} case BytesValuer: return encodePlanBytesCodecTextBytesValuer{} } } return nil } type encodePlanBytesCodecBinaryBytes struct{} func (encodePlanBytesCodecBinaryBytes) Encode(value any, buf []byte) (newBuf []byte, err error) { b := value.([]byte) if b == nil { return nil, nil } return append(buf, b...), nil } type encodePlanBytesCodecBinaryBytesValuer struct{} func (encodePlanBytesCodecBinaryBytesValuer) Encode(value any, buf []byte) (newBuf []byte, err error) { b, err := value.(BytesValuer).BytesValue() if err != nil { return nil, err } if b == nil { return nil, nil } return append(buf, b...), nil } type encodePlanBytesCodecTextBytes struct{} func (encodePlanBytesCodecTextBytes) Encode(value any, buf []byte) (newBuf []byte, err error) { b := value.([]byte) if b == nil { return nil, nil } buf = append(buf, `\x`...) buf = append(buf, hex.EncodeToString(b)...) return buf, nil } type encodePlanBytesCodecTextBytesValuer struct{} func (encodePlanBytesCodecTextBytesValuer) Encode(value any, buf []byte) (newBuf []byte, err error) { b, err := value.(BytesValuer).BytesValue() if err != nil { return nil, err } if b == nil { return nil, nil } buf = append(buf, `\x`...) buf = append(buf, hex.EncodeToString(b)...) return buf, nil } func (ByteaCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case *[]byte: return scanPlanBinaryBytesToBytes{} case BytesScanner: return scanPlanBinaryBytesToBytesScanner{} } case TextFormatCode: switch target.(type) { case *[]byte: return scanPlanTextByteaToBytes{} case BytesScanner: return scanPlanTextByteaToBytesScanner{} } } return nil } type scanPlanBinaryBytesToBytes struct{} func (scanPlanBinaryBytesToBytes) Scan(src []byte, dst any) error { dstBuf := dst.(*[]byte) if src == nil { *dstBuf = nil return nil } *dstBuf = make([]byte, len(src)) copy(*dstBuf, src) return nil } type scanPlanBinaryBytesToBytesScanner struct{} func (scanPlanBinaryBytesToBytesScanner) Scan(src []byte, dst any) error { scanner := (dst).(BytesScanner) return scanner.ScanBytes(src) } type scanPlanTextByteaToBytes struct{} func (scanPlanTextByteaToBytes) Scan(src []byte, dst any) error { dstBuf := dst.(*[]byte) if src == nil { *dstBuf = nil return nil } buf, err := decodeHexBytea(src) if err != nil { return err } *dstBuf = buf return nil } type scanPlanTextByteaToBytesScanner struct{} func (scanPlanTextByteaToBytesScanner) Scan(src []byte, dst any) error { scanner := (dst).(BytesScanner) buf, err := decodeHexBytea(src) if err != nil { return err } return scanner.ScanBytes(buf) } func decodeHexBytea(src []byte) ([]byte, error) { if src == nil { return nil, nil } if len(src) < 2 || src[0] != '\\' || src[1] != 'x' { return nil, fmt.Errorf("invalid hex format") } buf := make([]byte, (len(src)-2)/2) _, err := hex.Decode(buf, src[2:]) if err != nil { return nil, err } return buf, nil } func (c ByteaCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return c.DecodeValue(m, oid, format, src) } func (c ByteaCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var buf []byte err := codecScan(c, m, oid, format, src, &buf) if err != nil { return nil, err } return buf, nil } pgx-5.8.0/pgtype/bytea_test.go000066400000000000000000000074401512357711200163350ustar00rootroot00000000000000package pgtype_test import ( "bytes" "context" "fmt" "testing" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/require" ) func isExpectedEqBytes(a any) func(any) bool { return func(v any) bool { ab := a.([]byte) vb := v.([]byte) if (ab == nil) != (vb == nil) { return false } if ab == nil { return true } return bytes.Equal(ab, vb) } } func TestByteaCodec(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "bytea", []pgxtest.ValueRoundTripTest{ {[]byte{1, 2, 3}, new([]byte), isExpectedEqBytes([]byte{1, 2, 3})}, {[]byte{}, new([]byte), isExpectedEqBytes([]byte{})}, {[]byte(nil), new([]byte), isExpectedEqBytes([]byte(nil))}, {nil, new([]byte), isExpectedEqBytes([]byte(nil))}, }) } func TestDriverBytesQueryRow(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var buf []byte err := conn.QueryRow(ctx, `select $1::bytea`, []byte{1, 2}).Scan((*pgtype.DriverBytes)(&buf)) require.EqualError(t, err, "cannot scan into *pgtype.DriverBytes from QueryRow") }) } func TestDriverBytes(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { argBuf := make([]byte, 128) for i := range argBuf { argBuf[i] = byte(i) } rows, err := conn.Query(ctx, `select $1::bytea from generate_series(1, 1000)`, argBuf) require.NoError(t, err) defer rows.Close() rowCount := 0 resultBuf := argBuf detectedResultMutation := false for rows.Next() { rowCount++ // At some point the buffer should be reused and change. if !bytes.Equal(argBuf, resultBuf) { detectedResultMutation = true } err = rows.Scan((*pgtype.DriverBytes)(&resultBuf)) require.NoError(t, err) require.Len(t, resultBuf, len(argBuf)) require.Equal(t, resultBuf, argBuf) require.Equalf(t, cap(resultBuf), len(resultBuf), "cap(resultBuf) is larger than len(resultBuf)") } require.True(t, detectedResultMutation) err = rows.Err() require.NoError(t, err) }) } func TestPreallocBytes(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { origBuf := []byte{5, 6, 7, 8} buf := origBuf err := conn.QueryRow(ctx, `select $1::bytea`, []byte{1, 2}).Scan((*pgtype.PreallocBytes)(&buf)) require.NoError(t, err) require.Len(t, buf, 2) require.Equal(t, 4, cap(buf)) require.Equal(t, []byte{1, 2}, buf) require.Equal(t, []byte{1, 2, 7, 8}, origBuf) err = conn.QueryRow(ctx, `select $1::bytea`, []byte{3, 4, 5, 6, 7}).Scan((*pgtype.PreallocBytes)(&buf)) require.NoError(t, err) require.Len(t, buf, 5) require.Equal(t, 5, cap(buf)) require.Equal(t, []byte{1, 2, 7, 8}, origBuf) }) } func TestUndecodedBytes(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var buf []byte err := conn.QueryRow(ctx, `select 1::int4`).Scan((*pgtype.UndecodedBytes)(&buf)) require.NoError(t, err) require.Len(t, buf, 4) require.Equal(t, []byte{0, 0, 0, 1}, buf) }) } func TestByteaCodecDecodeDatabaseSQLValue(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var buf []byte err := conn.QueryRow(ctx, `select '\xa1b2c3d4'::bytea`).Scan(sqlScannerFunc(func(src any) error { switch src := src.(type) { case []byte: buf = make([]byte, len(src)) copy(buf, src) return nil default: return fmt.Errorf("expected []byte, got %T", src) } })) require.NoError(t, err) require.Len(t, buf, 4) require.Equal(t, []byte{0xa1, 0xb2, 0xc3, 0xd4}, buf) }) } pgx-5.8.0/pgtype/circle.go000066400000000000000000000112711512357711200154300ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "fmt" "math" "strconv" "strings" "github.com/jackc/pgx/v5/internal/pgio" ) type CircleScanner interface { ScanCircle(v Circle) error } type CircleValuer interface { CircleValue() (Circle, error) } type Circle struct { P Vec2 R float64 Valid bool } // ScanCircle implements the [CircleScanner] interface. func (c *Circle) ScanCircle(v Circle) error { *c = v return nil } // CircleValue implements the [CircleValuer] interface. func (c Circle) CircleValue() (Circle, error) { return c, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Circle) Scan(src any) error { if src == nil { *dst = Circle{} return nil } switch src := src.(type) { case string: return scanPlanTextAnyToCircleScanner{}.Scan([]byte(src), dst) } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (src Circle) Value() (driver.Value, error) { if !src.Valid { return nil, nil } buf, err := CircleCodec{}.PlanEncode(nil, 0, TextFormatCode, src).Encode(src, nil) if err != nil { return nil, err } return string(buf), err } type CircleCodec struct{} func (CircleCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (CircleCodec) PreferredFormat() int16 { return BinaryFormatCode } func (CircleCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(CircleValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanCircleCodecBinary{} case TextFormatCode: return encodePlanCircleCodecText{} } return nil } type encodePlanCircleCodecBinary struct{} func (encodePlanCircleCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { circle, err := value.(CircleValuer).CircleValue() if err != nil { return nil, err } if !circle.Valid { return nil, nil } buf = pgio.AppendUint64(buf, math.Float64bits(circle.P.X)) buf = pgio.AppendUint64(buf, math.Float64bits(circle.P.Y)) buf = pgio.AppendUint64(buf, math.Float64bits(circle.R)) return buf, nil } type encodePlanCircleCodecText struct{} func (encodePlanCircleCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { circle, err := value.(CircleValuer).CircleValue() if err != nil { return nil, err } if !circle.Valid { return nil, nil } buf = append(buf, fmt.Sprintf(`<(%s,%s),%s>`, strconv.FormatFloat(circle.P.X, 'f', -1, 64), strconv.FormatFloat(circle.P.Y, 'f', -1, 64), strconv.FormatFloat(circle.R, 'f', -1, 64), )...) return buf, nil } func (CircleCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case CircleScanner: return scanPlanBinaryCircleToCircleScanner{} } case TextFormatCode: switch target.(type) { case CircleScanner: return scanPlanTextAnyToCircleScanner{} } } return nil } func (c CircleCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return codecDecodeToTextFormat(c, m, oid, format, src) } func (c CircleCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var circle Circle err := codecScan(c, m, oid, format, src, &circle) if err != nil { return nil, err } return circle, nil } type scanPlanBinaryCircleToCircleScanner struct{} func (scanPlanBinaryCircleToCircleScanner) Scan(src []byte, dst any) error { scanner := (dst).(CircleScanner) if src == nil { return scanner.ScanCircle(Circle{}) } if len(src) != 24 { return fmt.Errorf("invalid length for Circle: %v", len(src)) } x := binary.BigEndian.Uint64(src) y := binary.BigEndian.Uint64(src[8:]) r := binary.BigEndian.Uint64(src[16:]) return scanner.ScanCircle(Circle{ P: Vec2{math.Float64frombits(x), math.Float64frombits(y)}, R: math.Float64frombits(r), Valid: true, }) } type scanPlanTextAnyToCircleScanner struct{} func (scanPlanTextAnyToCircleScanner) Scan(src []byte, dst any) error { scanner := (dst).(CircleScanner) if src == nil { return scanner.ScanCircle(Circle{}) } if len(src) < 9 { return fmt.Errorf("invalid length for Circle: %v", len(src)) } str := string(src[2:]) end := strings.IndexByte(str, ',') x, err := strconv.ParseFloat(str[:end], 64) if err != nil { return err } str = str[end+1:] end = strings.IndexByte(str, ')') y, err := strconv.ParseFloat(str[:end], 64) if err != nil { return err } str = str[end+2 : len(str)-1] r, err := strconv.ParseFloat(str, 64) if err != nil { return err } return scanner.ScanCircle(Circle{P: Vec2{x, y}, R: r, Valid: true}) } pgx-5.8.0/pgtype/circle_test.go000066400000000000000000000015521512357711200164700ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func TestCircleTranscode(t *testing.T) { skipCockroachDB(t, "Server does not support box type") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "circle", []pgxtest.ValueRoundTripTest{ { pgtype.Circle{P: pgtype.Vec2{1.234, 5.67890123}, R: 3.5, Valid: true}, new(pgtype.Circle), isExpectedEq(pgtype.Circle{P: pgtype.Vec2{1.234, 5.67890123}, R: 3.5, Valid: true}), }, { pgtype.Circle{P: pgtype.Vec2{1.234, 5.67890123}, R: 3.5, Valid: true}, new(pgtype.Circle), isExpectedEq(pgtype.Circle{P: pgtype.Vec2{1.234, 5.67890123}, R: 3.5, Valid: true}), }, {pgtype.Circle{}, new(pgtype.Circle), isExpectedEq(pgtype.Circle{})}, {nil, new(pgtype.Circle), isExpectedEq(pgtype.Circle{})}, }) } pgx-5.8.0/pgtype/composite.go000066400000000000000000000332161512357711200161740ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "errors" "fmt" "strings" "github.com/jackc/pgx/v5/internal/pgio" ) // CompositeIndexGetter is a type accessed by index that can be converted into a PostgreSQL composite. type CompositeIndexGetter interface { // IsNull returns true if the value is SQL NULL. IsNull() bool // Index returns the element at i. Index(i int) any } // CompositeIndexScanner is a type accessed by index that can be scanned from a PostgreSQL composite. type CompositeIndexScanner interface { // ScanNull sets the value to SQL NULL. ScanNull() error // ScanIndex returns a value usable as a scan target for i. ScanIndex(i int) any } type CompositeCodecField struct { Name string Type *Type } type CompositeCodec struct { Fields []CompositeCodecField } func (c *CompositeCodec) FormatSupported(format int16) bool { for _, f := range c.Fields { if !f.Type.Codec.FormatSupported(format) { return false } } return true } func (c *CompositeCodec) PreferredFormat() int16 { if c.FormatSupported(BinaryFormatCode) { return BinaryFormatCode } return TextFormatCode } func (c *CompositeCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(CompositeIndexGetter); !ok { return nil } switch format { case BinaryFormatCode: return &encodePlanCompositeCodecCompositeIndexGetterToBinary{cc: c, m: m} case TextFormatCode: return &encodePlanCompositeCodecCompositeIndexGetterToText{cc: c, m: m} } return nil } type encodePlanCompositeCodecCompositeIndexGetterToBinary struct { cc *CompositeCodec m *Map } func (plan *encodePlanCompositeCodecCompositeIndexGetterToBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { getter := value.(CompositeIndexGetter) if getter.IsNull() { return nil, nil } builder := NewCompositeBinaryBuilder(plan.m, buf) for i, field := range plan.cc.Fields { builder.AppendValue(field.Type.OID, getter.Index(i)) } return builder.Finish() } type encodePlanCompositeCodecCompositeIndexGetterToText struct { cc *CompositeCodec m *Map } func (plan *encodePlanCompositeCodecCompositeIndexGetterToText) Encode(value any, buf []byte) (newBuf []byte, err error) { getter := value.(CompositeIndexGetter) if getter.IsNull() { return nil, nil } b := NewCompositeTextBuilder(plan.m, buf) for i, field := range plan.cc.Fields { b.AppendValue(field.Type.OID, getter.Index(i)) } return b.Finish() } func (c *CompositeCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case CompositeIndexScanner: return &scanPlanBinaryCompositeToCompositeIndexScanner{cc: c, m: m} } case TextFormatCode: switch target.(type) { case CompositeIndexScanner: return &scanPlanTextCompositeToCompositeIndexScanner{cc: c, m: m} } } return nil } type scanPlanBinaryCompositeToCompositeIndexScanner struct { cc *CompositeCodec m *Map } func (plan *scanPlanBinaryCompositeToCompositeIndexScanner) Scan(src []byte, target any) error { targetScanner := (target).(CompositeIndexScanner) if src == nil { return targetScanner.ScanNull() } scanner := NewCompositeBinaryScanner(plan.m, src) for i, field := range plan.cc.Fields { if scanner.Next() { fieldTarget := targetScanner.ScanIndex(i) if fieldTarget != nil { fieldPlan := plan.m.PlanScan(field.Type.OID, BinaryFormatCode, fieldTarget) if fieldPlan == nil { return fmt.Errorf("unable to encode %v into OID %d in binary format", field, field.Type.OID) } err := fieldPlan.Scan(scanner.Bytes(), fieldTarget) if err != nil { return err } } } else { return errors.New("read past end of composite") } } if err := scanner.Err(); err != nil { return err } return nil } type scanPlanTextCompositeToCompositeIndexScanner struct { cc *CompositeCodec m *Map } func (plan *scanPlanTextCompositeToCompositeIndexScanner) Scan(src []byte, target any) error { targetScanner := (target).(CompositeIndexScanner) if src == nil { return targetScanner.ScanNull() } scanner := NewCompositeTextScanner(plan.m, src) for i, field := range plan.cc.Fields { if scanner.Next() { fieldTarget := targetScanner.ScanIndex(i) if fieldTarget != nil { fieldPlan := plan.m.PlanScan(field.Type.OID, TextFormatCode, fieldTarget) if fieldPlan == nil { return fmt.Errorf("unable to encode %v into OID %d in text format", field, field.Type.OID) } err := fieldPlan.Scan(scanner.Bytes(), fieldTarget) if err != nil { return err } } } else { return errors.New("read past end of composite") } } if err := scanner.Err(); err != nil { return err } return nil } func (c *CompositeCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } switch format { case TextFormatCode: return string(src), nil case BinaryFormatCode: buf := make([]byte, len(src)) copy(buf, src) return buf, nil default: return nil, fmt.Errorf("unknown format code %d", format) } } func (c *CompositeCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } switch format { case TextFormatCode: scanner := NewCompositeTextScanner(m, src) values := make(map[string]any, len(c.Fields)) for i := 0; scanner.Next() && i < len(c.Fields); i++ { var v any fieldPlan := m.PlanScan(c.Fields[i].Type.OID, TextFormatCode, &v) if fieldPlan == nil { return nil, fmt.Errorf("unable to scan OID %d in text format into %v", c.Fields[i].Type.OID, v) } err := fieldPlan.Scan(scanner.Bytes(), &v) if err != nil { return nil, err } values[c.Fields[i].Name] = v } if err := scanner.Err(); err != nil { return nil, err } return values, nil case BinaryFormatCode: scanner := NewCompositeBinaryScanner(m, src) values := make(map[string]any, len(c.Fields)) for i := 0; scanner.Next() && i < len(c.Fields); i++ { var v any fieldPlan := m.PlanScan(scanner.OID(), BinaryFormatCode, &v) if fieldPlan == nil { return nil, fmt.Errorf("unable to scan OID %d in binary format into %v", scanner.OID(), v) } err := fieldPlan.Scan(scanner.Bytes(), &v) if err != nil { return nil, err } values[c.Fields[i].Name] = v } if err := scanner.Err(); err != nil { return nil, err } return values, nil default: return nil, fmt.Errorf("unknown format code %d", format) } } type CompositeBinaryScanner struct { m *Map rp int src []byte fieldCount int32 fieldBytes []byte fieldOID uint32 err error } // NewCompositeBinaryScanner a scanner over a binary encoded composite balue. func NewCompositeBinaryScanner(m *Map, src []byte) *CompositeBinaryScanner { rp := 0 if len(src[rp:]) < 4 { return &CompositeBinaryScanner{err: fmt.Errorf("Record incomplete %v", src)} } fieldCount := int32(binary.BigEndian.Uint32(src[rp:])) rp += 4 return &CompositeBinaryScanner{ m: m, rp: rp, src: src, fieldCount: fieldCount, } } // Next advances the scanner to the next field. It returns false after the last field is read or an error occurs. After // Next returns false, the Err method can be called to check if any errors occurred. func (cfs *CompositeBinaryScanner) Next() bool { if cfs.err != nil { return false } if cfs.rp == len(cfs.src) { return false } if len(cfs.src[cfs.rp:]) < 8 { cfs.err = fmt.Errorf("Record incomplete %v", cfs.src) return false } cfs.fieldOID = binary.BigEndian.Uint32(cfs.src[cfs.rp:]) cfs.rp += 4 fieldLen := int(int32(binary.BigEndian.Uint32(cfs.src[cfs.rp:]))) cfs.rp += 4 if fieldLen >= 0 { if len(cfs.src[cfs.rp:]) < fieldLen { cfs.err = fmt.Errorf("Record incomplete rp=%d src=%v", cfs.rp, cfs.src) return false } cfs.fieldBytes = cfs.src[cfs.rp : cfs.rp+fieldLen] cfs.rp += fieldLen } else { cfs.fieldBytes = nil } return true } func (cfs *CompositeBinaryScanner) FieldCount() int { return int(cfs.fieldCount) } // Bytes returns the bytes of the field most recently read by Scan(). func (cfs *CompositeBinaryScanner) Bytes() []byte { return cfs.fieldBytes } // OID returns the OID of the field most recently read by Scan(). func (cfs *CompositeBinaryScanner) OID() uint32 { return cfs.fieldOID } // Err returns any error encountered by the scanner. func (cfs *CompositeBinaryScanner) Err() error { return cfs.err } type CompositeTextScanner struct { m *Map rp int src []byte fieldBytes []byte err error } // NewCompositeTextScanner a scanner over a text encoded composite value. func NewCompositeTextScanner(m *Map, src []byte) *CompositeTextScanner { if len(src) < 2 { return &CompositeTextScanner{err: fmt.Errorf("Record incomplete %v", src)} } if src[0] != '(' { return &CompositeTextScanner{err: fmt.Errorf("composite text format must start with '('")} } if src[len(src)-1] != ')' { return &CompositeTextScanner{err: fmt.Errorf("composite text format must end with ')'")} } return &CompositeTextScanner{ m: m, rp: 1, src: src, } } // Next advances the scanner to the next field. It returns false after the last field is read or an error occurs. After // Next returns false, the Err method can be called to check if any errors occurred. func (cfs *CompositeTextScanner) Next() bool { if cfs.err != nil { return false } if cfs.rp == len(cfs.src) { return false } switch cfs.src[cfs.rp] { case ',', ')': // null cfs.rp++ cfs.fieldBytes = nil return true case '"': // quoted value cfs.rp++ cfs.fieldBytes = make([]byte, 0, 16) for { ch := cfs.src[cfs.rp] if ch == '"' { cfs.rp++ if cfs.src[cfs.rp] == '"' { cfs.fieldBytes = append(cfs.fieldBytes, '"') cfs.rp++ } else { break } } else if ch == '\\' { cfs.rp++ cfs.fieldBytes = append(cfs.fieldBytes, cfs.src[cfs.rp]) cfs.rp++ } else { cfs.fieldBytes = append(cfs.fieldBytes, ch) cfs.rp++ } } cfs.rp++ return true default: // unquoted value start := cfs.rp for { ch := cfs.src[cfs.rp] if ch == ',' || ch == ')' { break } cfs.rp++ } cfs.fieldBytes = cfs.src[start:cfs.rp] cfs.rp++ return true } } // Bytes returns the bytes of the field most recently read by Scan(). func (cfs *CompositeTextScanner) Bytes() []byte { return cfs.fieldBytes } // Err returns any error encountered by the scanner. func (cfs *CompositeTextScanner) Err() error { return cfs.err } type CompositeBinaryBuilder struct { m *Map buf []byte startIdx int fieldCount uint32 err error } func NewCompositeBinaryBuilder(m *Map, buf []byte) *CompositeBinaryBuilder { startIdx := len(buf) buf = append(buf, 0, 0, 0, 0) // allocate room for number of fields return &CompositeBinaryBuilder{m: m, buf: buf, startIdx: startIdx} } func (b *CompositeBinaryBuilder) AppendValue(oid uint32, field any) { if b.err != nil { return } if isNil, _ := isNilDriverValuer(field); isNil { b.buf = pgio.AppendUint32(b.buf, oid) b.buf = pgio.AppendInt32(b.buf, -1) b.fieldCount++ return } plan := b.m.PlanEncode(oid, BinaryFormatCode, field) if plan == nil { b.err = fmt.Errorf("unable to encode %v into OID %d in binary format", field, oid) return } b.buf = pgio.AppendUint32(b.buf, oid) lengthPos := len(b.buf) b.buf = pgio.AppendInt32(b.buf, -1) fieldBuf, err := plan.Encode(field, b.buf) if err != nil { b.err = err return } if fieldBuf != nil { binary.BigEndian.PutUint32(fieldBuf[lengthPos:], uint32(len(fieldBuf)-len(b.buf))) b.buf = fieldBuf } b.fieldCount++ } func (b *CompositeBinaryBuilder) Finish() ([]byte, error) { if b.err != nil { return nil, b.err } binary.BigEndian.PutUint32(b.buf[b.startIdx:], b.fieldCount) return b.buf, nil } type CompositeTextBuilder struct { m *Map buf []byte startIdx int fieldCount uint32 err error fieldBuf [32]byte } func NewCompositeTextBuilder(m *Map, buf []byte) *CompositeTextBuilder { buf = append(buf, '(') // allocate room for number of fields return &CompositeTextBuilder{m: m, buf: buf} } func (b *CompositeTextBuilder) AppendValue(oid uint32, field any) { if b.err != nil { return } if isNil, _ := isNilDriverValuer(field); isNil { b.buf = append(b.buf, ',') return } plan := b.m.PlanEncode(oid, TextFormatCode, field) if plan == nil { b.err = fmt.Errorf("unable to encode %v into OID %d in text format", field, oid) return } fieldBuf, err := plan.Encode(field, b.fieldBuf[0:0]) if err != nil { b.err = err return } if fieldBuf != nil { b.buf = append(b.buf, quoteCompositeFieldIfNeeded(string(fieldBuf))...) } b.buf = append(b.buf, ',') } func (b *CompositeTextBuilder) Finish() ([]byte, error) { if b.err != nil { return nil, b.err } b.buf[len(b.buf)-1] = ')' return b.buf, nil } var quoteCompositeReplacer = strings.NewReplacer(`\`, `\\`, `"`, `\"`) func quoteCompositeField(src string) string { return `"` + quoteCompositeReplacer.Replace(src) + `"` } func quoteCompositeFieldIfNeeded(src string) string { if src == "" || src[0] == ' ' || src[len(src)-1] == ' ' || strings.ContainsAny(src, `(),"\`) { return quoteCompositeField(src) } return src } // CompositeFields represents the values of a composite value. It can be used as an encoding source or as a scan target. // It cannot scan a NULL, but the composite fields can be NULL. type CompositeFields []any func (cf CompositeFields) SkipUnderlyingTypePlan() {} func (cf CompositeFields) IsNull() bool { return cf == nil } func (cf CompositeFields) Index(i int) any { return cf[i] } func (cf CompositeFields) ScanNull() error { return fmt.Errorf("cannot scan NULL into CompositeFields") } func (cf CompositeFields) ScanIndex(i int) any { return cf[i] } pgx-5.8.0/pgtype/composite_test.go000066400000000000000000000231351512357711200172320ustar00rootroot00000000000000package pgtype_test import ( "context" "fmt" "testing" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/stretchr/testify/require" ) func TestCompositeCodecTranscode(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Exec(ctx, `drop type if exists ct_test; create type ct_test as ( a text, b int4 );`) require.NoError(t, err) defer conn.Exec(ctx, "drop type ct_test") dt, err := conn.LoadType(ctx, "ct_test") require.NoError(t, err) conn.TypeMap().RegisterType(dt) formats := []struct { name string code int16 }{ {name: "TextFormat", code: pgx.TextFormatCode}, {name: "BinaryFormat", code: pgx.BinaryFormatCode}, } for _, format := range formats { var a string var b int32 err := conn.QueryRow(ctx, "select $1::ct_test", pgx.QueryResultFormats{format.code}, pgtype.CompositeFields{"hi", int32(42)}, ).Scan( pgtype.CompositeFields{&a, &b}, ) require.NoErrorf(t, err, "%v", format.name) require.EqualValuesf(t, "hi", a, "%v", format.name) require.EqualValuesf(t, 42, b, "%v", format.name) } }) } type point3d struct { X, Y, Z float64 } func (p point3d) IsNull() bool { return false } func (p point3d) Index(i int) any { switch i { case 0: return p.X case 1: return p.Y case 2: return p.Z default: panic("invalid index") } } func (p *point3d) ScanNull() error { return fmt.Errorf("cannot scan NULL into point3d") } func (p *point3d) ScanIndex(i int) any { switch i { case 0: return &p.X case 1: return &p.Y case 2: return &p.Z default: panic("invalid index") } } func TestCompositeCodecTranscodeStruct(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Exec(ctx, `drop type if exists point3d; create type point3d as ( x float8, y float8, z float8 );`) require.NoError(t, err) defer conn.Exec(ctx, "drop type point3d") dt, err := conn.LoadType(ctx, "point3d") require.NoError(t, err) conn.TypeMap().RegisterType(dt) formats := []struct { name string code int16 }{ {name: "TextFormat", code: pgx.TextFormatCode}, {name: "BinaryFormat", code: pgx.BinaryFormatCode}, } for _, format := range formats { input := point3d{X: 1, Y: 2, Z: 3} var output point3d err := conn.QueryRow(ctx, "select $1::point3d", pgx.QueryResultFormats{format.code}, input).Scan(&output) require.NoErrorf(t, err, "%v", format.name) require.Equalf(t, input, output, "%v", format.name) } }) } func TestCompositeCodecTranscodeStructWrapper(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Exec(ctx, `drop type if exists point3d; create type point3d as ( x float8, y float8, z float8 );`) require.NoError(t, err) defer conn.Exec(ctx, "drop type point3d") dt, err := conn.LoadType(ctx, "point3d") require.NoError(t, err) conn.TypeMap().RegisterType(dt) formats := []struct { name string code int16 }{ {name: "TextFormat", code: pgx.TextFormatCode}, {name: "BinaryFormat", code: pgx.BinaryFormatCode}, } type anotherPoint struct { X, Y, Z float64 } for _, format := range formats { input := anotherPoint{X: 1, Y: 2, Z: 3} var output anotherPoint err := conn.QueryRow(ctx, "select $1::point3d", pgx.QueryResultFormats{format.code}, input).Scan(&output) require.NoErrorf(t, err, "%v", format.name) require.Equalf(t, input, output, "%v", format.name) } }) } type parent struct { Name string Location *point3d } func (p parent) IsNull() bool { return false } func (p parent) Index(i int) any { switch i { case 0: return p.Name case 1: return p.Location default: panic("invalid index") } } func (p *parent) ScanNull() error { return fmt.Errorf("cannot scan NULL into parent") } func (p *parent) ScanIndex(i int) any { switch i { case 0: return &p.Name case 1: return &p.Location default: panic("invalid index") } } // https://github.com/jackc/pgx/issues/2453 func TestCompositeCodecTranscodeStructWithNilPointer(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { skipCockroachDB(t, "Server does not support nested composite types") _, err := conn.Exec(ctx, `drop type if exists parent; drop type if exists point3d; create type point3d as ( x float8, y float8, z float8 ); create type parent as ( name text, location point3d );`) require.NoError(t, err) defer conn.Exec(ctx, "drop type parent") defer conn.Exec(ctx, "drop type point3d") dataTypes, err := conn.LoadTypes(ctx, []string{"point3d", "parent"}) require.NoError(t, err) conn.TypeMap().RegisterTypes(dataTypes) formats := []struct { name string code int16 }{ {name: "TextFormat", code: pgx.TextFormatCode}, {name: "BinaryFormat", code: pgx.BinaryFormatCode}, } for _, format := range formats { input := parent{Name: "test", Location: nil} var output parent err := conn.QueryRow(ctx, "select $1::parent", pgx.QueryResultFormats{format.code}, input).Scan(&output) require.NoErrorf(t, err, "%v", format.name) require.Equalf(t, input, output, "%v", format.name) } }) } type parentWithSlice struct { Name string Locations []*point3d } func (p parentWithSlice) IsNull() bool { return false } func (p parentWithSlice) Index(i int) any { switch i { case 0: return p.Name case 1: return p.Locations default: panic("invalid index") } } func (p *parentWithSlice) ScanNull() error { return fmt.Errorf("cannot scan NULL into parent") } func (p *parentWithSlice) ScanIndex(i int) any { switch i { case 0: return &p.Name case 1: return &p.Locations default: panic("invalid index") } } // https://github.com/jackc/pgx/issues/2453 func TestCompositeCodecTranscodeStructWithSliceOfNilPointer(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { skipCockroachDB(t, "Server does not support nested composite types") _, err := conn.Exec(ctx, `drop type if exists parent; drop type if exists point3d; create type point3d as ( x float8, y float8, z float8 ); create type parent_with_slice as ( name text, locations point3d[] );`) require.NoError(t, err) defer conn.Exec(ctx, "drop type parent_with_slice") defer conn.Exec(ctx, "drop type point3d") dataTypes, err := conn.LoadTypes(ctx, []string{"point3d", "parent_with_slice"}) require.NoError(t, err) conn.TypeMap().RegisterTypes(dataTypes) formats := []struct { name string code int16 }{ {name: "TextFormat", code: pgx.TextFormatCode}, {name: "BinaryFormat", code: pgx.BinaryFormatCode}, } for _, format := range formats { input := parentWithSlice{Name: "test", Locations: []*point3d{nil}} var output parentWithSlice err := conn.QueryRow(ctx, "select $1::parent_with_slice", pgx.QueryResultFormats{format.code}, input).Scan(&output) require.NoErrorf(t, err, "%v", format.name) require.Equalf(t, input, output, "%v", format.name) } }) } func TestCompositeCodecDecodeValue(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Exec(ctx, `drop type if exists point3d; create type point3d as ( x float8, y float8, z float8 );`) require.NoError(t, err) defer conn.Exec(ctx, "drop type point3d") dt, err := conn.LoadType(ctx, "point3d") require.NoError(t, err) conn.TypeMap().RegisterType(dt) formats := []struct { name string code int16 }{ {name: "TextFormat", code: pgx.TextFormatCode}, {name: "BinaryFormat", code: pgx.BinaryFormatCode}, } for _, format := range formats { rows, err := conn.Query(ctx, "select '(1,2,3)'::point3d", pgx.QueryResultFormats{format.code}) require.NoErrorf(t, err, "%v", format.name) require.True(t, rows.Next()) values, err := rows.Values() require.NoErrorf(t, err, "%v", format.name) require.Lenf(t, values, 1, "%v", format.name) require.Equalf(t, map[string]any{"x": 1.0, "y": 2.0, "z": 3.0}, values[0], "%v", format.name) require.False(t, rows.Next()) require.NoErrorf(t, rows.Err(), "%v", format.name) } }) } // Test for composite type from table instead of create type. Table types have system / hidden columns like tableoid, // cmax, xmax, etc. These are not included when sending or receiving composite types. // // https://github.com/jackc/pgx/issues/1576 func TestCompositeCodecTranscodeStructWrapperForTable(t *testing.T) { skipCockroachDB(t, "Server does not support composite types from table definitions") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Exec(ctx, `drop table if exists point3d; create table point3d ( x float8, y float8, z float8 );`) require.NoError(t, err) defer conn.Exec(ctx, "drop table point3d") dt, err := conn.LoadType(ctx, "point3d") require.NoError(t, err) conn.TypeMap().RegisterType(dt) formats := []struct { name string code int16 }{ {name: "TextFormat", code: pgx.TextFormatCode}, {name: "BinaryFormat", code: pgx.BinaryFormatCode}, } type anotherPoint struct { X, Y, Z float64 } for _, format := range formats { input := anotherPoint{X: 1, Y: 2, Z: 3} var output anotherPoint err := conn.QueryRow(ctx, "select $1::point3d", pgx.QueryResultFormats{format.code}, input).Scan(&output) require.NoErrorf(t, err, "%v", format.name) require.Equalf(t, input, output, "%v", format.name) } }) } pgx-5.8.0/pgtype/convert.go000066400000000000000000000062151512357711200156510ustar00rootroot00000000000000package pgtype import ( "reflect" ) func NullAssignTo(dst any) error { dstPtr := reflect.ValueOf(dst) // AssignTo dst must always be a pointer if dstPtr.Kind() != reflect.Ptr { return &nullAssignmentError{dst: dst} } dstVal := dstPtr.Elem() switch dstVal.Kind() { case reflect.Ptr, reflect.Slice, reflect.Map: dstVal.Set(reflect.Zero(dstVal.Type())) return nil } return &nullAssignmentError{dst: dst} } var kindTypes map[reflect.Kind]reflect.Type func toInterface(dst reflect.Value, t reflect.Type) (any, bool) { nextDst := dst.Convert(t) return nextDst.Interface(), dst.Type() != nextDst.Type() } // GetAssignToDstType attempts to convert dst to something AssignTo can assign // to. If dst is a pointer to pointer it allocates a value and returns the // dereferences pointer. If dst is a named type such as *Foo where Foo is type // Foo int16, it converts dst to *int16. // // GetAssignToDstType returns the converted dst and a bool representing if any // change was made. func GetAssignToDstType(dst any) (any, bool) { dstPtr := reflect.ValueOf(dst) // AssignTo dst must always be a pointer if dstPtr.Kind() != reflect.Ptr { return nil, false } dstVal := dstPtr.Elem() // if dst is a pointer to pointer, allocate space try again with the dereferenced pointer if dstVal.Kind() == reflect.Ptr { dstVal.Set(reflect.New(dstVal.Type().Elem())) return dstVal.Interface(), true } // if dst is pointer to a base type that has been renamed if baseValType, ok := kindTypes[dstVal.Kind()]; ok { return toInterface(dstPtr, reflect.PtrTo(baseValType)) } if dstVal.Kind() == reflect.Slice { if baseElemType, ok := kindTypes[dstVal.Type().Elem().Kind()]; ok { return toInterface(dstPtr, reflect.PtrTo(reflect.SliceOf(baseElemType))) } } if dstVal.Kind() == reflect.Array { if baseElemType, ok := kindTypes[dstVal.Type().Elem().Kind()]; ok { return toInterface(dstPtr, reflect.PtrTo(reflect.ArrayOf(dstVal.Len(), baseElemType))) } } if dstVal.Kind() == reflect.Struct { if dstVal.Type().NumField() == 1 && dstVal.Type().Field(0).Anonymous { dstPtr = dstVal.Field(0).Addr() nested := dstVal.Type().Field(0).Type if nested.Kind() == reflect.Array { if baseElemType, ok := kindTypes[nested.Elem().Kind()]; ok { return toInterface(dstPtr, reflect.PtrTo(reflect.ArrayOf(nested.Len(), baseElemType))) } } if _, ok := kindTypes[nested.Kind()]; ok && dstPtr.CanInterface() { return dstPtr.Interface(), true } } } return nil, false } func init() { kindTypes = map[reflect.Kind]reflect.Type{ reflect.Bool: reflect.TypeOf(false), reflect.Float32: reflect.TypeOf(float32(0)), reflect.Float64: reflect.TypeOf(float64(0)), reflect.Int: reflect.TypeOf(int(0)), reflect.Int8: reflect.TypeOf(int8(0)), reflect.Int16: reflect.TypeOf(int16(0)), reflect.Int32: reflect.TypeOf(int32(0)), reflect.Int64: reflect.TypeOf(int64(0)), reflect.Uint: reflect.TypeOf(uint(0)), reflect.Uint8: reflect.TypeOf(uint8(0)), reflect.Uint16: reflect.TypeOf(uint16(0)), reflect.Uint32: reflect.TypeOf(uint32(0)), reflect.Uint64: reflect.TypeOf(uint64(0)), reflect.String: reflect.TypeOf(""), } } pgx-5.8.0/pgtype/date.go000066400000000000000000000170051512357711200151050ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "encoding/json" "fmt" "regexp" "strconv" "time" "github.com/jackc/pgx/v5/internal/pgio" ) type DateScanner interface { ScanDate(v Date) error } type DateValuer interface { DateValue() (Date, error) } type Date struct { Time time.Time InfinityModifier InfinityModifier Valid bool } // ScanDate implements the [DateScanner] interface. func (d *Date) ScanDate(v Date) error { *d = v return nil } // DateValue implements the [DateValuer] interface. func (d Date) DateValue() (Date, error) { return d, nil } const ( negativeInfinityDayOffset = -2147483648 infinityDayOffset = 2147483647 ) // Scan implements the [database/sql.Scanner] interface. func (dst *Date) Scan(src any) error { if src == nil { *dst = Date{} return nil } switch src := src.(type) { case string: return scanPlanTextAnyToDateScanner{}.Scan([]byte(src), dst) case time.Time: *dst = Date{Time: src, Valid: true} return nil } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (src Date) Value() (driver.Value, error) { if !src.Valid { return nil, nil } if src.InfinityModifier != Finite { return src.InfinityModifier.String(), nil } return src.Time, nil } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (src Date) MarshalJSON() ([]byte, error) { if !src.Valid { return []byte("null"), nil } var s string switch src.InfinityModifier { case Finite: s = src.Time.Format("2006-01-02") case Infinity: s = "infinity" case NegativeInfinity: s = "-infinity" } return json.Marshal(s) } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (dst *Date) UnmarshalJSON(b []byte) error { var s *string err := json.Unmarshal(b, &s) if err != nil { return err } if s == nil { *dst = Date{} return nil } switch *s { case "infinity": *dst = Date{Valid: true, InfinityModifier: Infinity} case "-infinity": *dst = Date{Valid: true, InfinityModifier: -Infinity} default: t, err := time.ParseInLocation("2006-01-02", *s, time.UTC) if err != nil { return err } *dst = Date{Time: t, Valid: true} } return nil } type DateCodec struct{} func (DateCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (DateCodec) PreferredFormat() int16 { return BinaryFormatCode } func (DateCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(DateValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanDateCodecBinary{} case TextFormatCode: return encodePlanDateCodecText{} } return nil } type encodePlanDateCodecBinary struct{} func (encodePlanDateCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { date, err := value.(DateValuer).DateValue() if err != nil { return nil, err } if !date.Valid { return nil, nil } var daysSinceDateEpoch int32 switch date.InfinityModifier { case Finite: tUnix := time.Date(date.Time.Year(), date.Time.Month(), date.Time.Day(), 0, 0, 0, 0, time.UTC).Unix() dateEpoch := time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC).Unix() secSinceDateEpoch := tUnix - dateEpoch daysSinceDateEpoch = int32(secSinceDateEpoch / 86400) case Infinity: daysSinceDateEpoch = infinityDayOffset case NegativeInfinity: daysSinceDateEpoch = negativeInfinityDayOffset } return pgio.AppendInt32(buf, daysSinceDateEpoch), nil } type encodePlanDateCodecText struct{} func (encodePlanDateCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { date, err := value.(DateValuer).DateValue() if err != nil { return nil, err } if !date.Valid { return nil, nil } switch date.InfinityModifier { case Finite: // Year 0000 is 1 BC bc := false year := date.Time.Year() if year <= 0 { year = -year + 1 bc = true } yearBytes := strconv.AppendInt(make([]byte, 0, 6), int64(year), 10) for i := len(yearBytes); i < 4; i++ { buf = append(buf, '0') } buf = append(buf, yearBytes...) buf = append(buf, '-') if date.Time.Month() < 10 { buf = append(buf, '0') } buf = strconv.AppendInt(buf, int64(date.Time.Month()), 10) buf = append(buf, '-') if date.Time.Day() < 10 { buf = append(buf, '0') } buf = strconv.AppendInt(buf, int64(date.Time.Day()), 10) if bc { buf = append(buf, " BC"...) } case Infinity: buf = append(buf, "infinity"...) case NegativeInfinity: buf = append(buf, "-infinity"...) } return buf, nil } func (DateCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case DateScanner: return scanPlanBinaryDateToDateScanner{} } case TextFormatCode: switch target.(type) { case DateScanner: return scanPlanTextAnyToDateScanner{} } } return nil } type scanPlanBinaryDateToDateScanner struct{} func (scanPlanBinaryDateToDateScanner) Scan(src []byte, dst any) error { scanner := (dst).(DateScanner) if src == nil { return scanner.ScanDate(Date{}) } if len(src) != 4 { return fmt.Errorf("invalid length for date: %v", len(src)) } dayOffset := int32(binary.BigEndian.Uint32(src)) switch dayOffset { case infinityDayOffset: return scanner.ScanDate(Date{InfinityModifier: Infinity, Valid: true}) case negativeInfinityDayOffset: return scanner.ScanDate(Date{InfinityModifier: -Infinity, Valid: true}) default: t := time.Date(2000, 1, int(1+dayOffset), 0, 0, 0, 0, time.UTC) return scanner.ScanDate(Date{Time: t, Valid: true}) } } type scanPlanTextAnyToDateScanner struct{} var dateRegexp = regexp.MustCompile(`^(\d{4,})-(\d\d)-(\d\d)( BC)?$`) func (scanPlanTextAnyToDateScanner) Scan(src []byte, dst any) error { scanner := (dst).(DateScanner) if src == nil { return scanner.ScanDate(Date{}) } sbuf := string(src) match := dateRegexp.FindStringSubmatch(sbuf) if match != nil { year, err := strconv.ParseInt(match[1], 10, 32) if err != nil { return fmt.Errorf("BUG: cannot parse date that regexp matched (year): %w", err) } month, err := strconv.ParseInt(match[2], 10, 32) if err != nil { return fmt.Errorf("BUG: cannot parse date that regexp matched (month): %w", err) } day, err := strconv.ParseInt(match[3], 10, 32) if err != nil { return fmt.Errorf("BUG: cannot parse date that regexp matched (month): %w", err) } // BC matched if len(match[4]) > 0 { year = -year + 1 } t := time.Date(int(year), time.Month(month), int(day), 0, 0, 0, 0, time.UTC) return scanner.ScanDate(Date{Time: t, Valid: true}) } switch sbuf { case "infinity": return scanner.ScanDate(Date{InfinityModifier: Infinity, Valid: true}) case "-infinity": return scanner.ScanDate(Date{InfinityModifier: -Infinity, Valid: true}) default: return fmt.Errorf("invalid date format") } } func (c DateCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } var date Date err := codecScan(c, m, oid, format, src, &date) if err != nil { return nil, err } if date.InfinityModifier != Finite { return date.InfinityModifier.String(), nil } return date.Time, nil } func (c DateCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var date Date err := codecScan(c, m, oid, format, src, &date) if err != nil { return nil, err } if date.InfinityModifier != Finite { return date.InfinityModifier, nil } return date.Time, nil } pgx-5.8.0/pgtype/date_test.go000066400000000000000000000135371512357711200161520ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "time" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/assert" ) func isExpectedEqTime(a any) func(any) bool { return func(v any) bool { at := a.(time.Time) vt := v.(time.Time) return at.Equal(vt) } } func TestDateCodec(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "date", []pgxtest.ValueRoundTripTest{ {time.Date(-100, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(-100, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(-1, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(-1, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(0, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(0, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(1, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(1, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(1900, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(1900, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(1970, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(1970, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(1999, 12, 31, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(1999, 12, 31, 0, 0, 0, 0, time.UTC))}, {time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(2000, 1, 2, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(2000, 1, 2, 0, 0, 0, 0, time.UTC))}, {time.Date(2200, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(2200, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(12200, 1, 2, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(12200, 1, 2, 0, 0, 0, 0, time.UTC))}, {pgtype.Date{InfinityModifier: pgtype.Infinity, Valid: true}, new(pgtype.Date), isExpectedEq(pgtype.Date{InfinityModifier: pgtype.Infinity, Valid: true})}, {pgtype.Date{InfinityModifier: pgtype.NegativeInfinity, Valid: true}, new(pgtype.Date), isExpectedEq(pgtype.Date{InfinityModifier: pgtype.NegativeInfinity, Valid: true})}, {pgtype.Date{}, new(pgtype.Date), isExpectedEq(pgtype.Date{})}, {nil, new(*time.Time), isExpectedEq((*time.Time)(nil))}, }) } func TestDateCodecTextEncode(t *testing.T) { m := pgtype.NewMap() successfulTests := []struct { source pgtype.Date result string }{ {source: pgtype.Date{Time: time.Date(2012, 3, 29, 0, 0, 0, 0, time.UTC), Valid: true}, result: "2012-03-29"}, {source: pgtype.Date{Time: time.Date(2012, 3, 29, 10, 5, 45, 0, time.FixedZone("", -6*60*60)), Valid: true}, result: "2012-03-29"}, {source: pgtype.Date{Time: time.Date(2012, 3, 29, 10, 5, 45, 555*1000*1000, time.FixedZone("", -6*60*60)), Valid: true}, result: "2012-03-29"}, {source: pgtype.Date{Time: time.Date(789, 1, 2, 0, 0, 0, 0, time.UTC), Valid: true}, result: "0789-01-02"}, {source: pgtype.Date{Time: time.Date(89, 1, 2, 0, 0, 0, 0, time.UTC), Valid: true}, result: "0089-01-02"}, {source: pgtype.Date{Time: time.Date(9, 1, 2, 0, 0, 0, 0, time.UTC), Valid: true}, result: "0009-01-02"}, {source: pgtype.Date{Time: time.Date(12200, 1, 2, 0, 0, 0, 0, time.UTC), Valid: true}, result: "12200-01-02"}, {source: pgtype.Date{InfinityModifier: pgtype.Infinity, Valid: true}, result: "infinity"}, {source: pgtype.Date{InfinityModifier: pgtype.NegativeInfinity, Valid: true}, result: "-infinity"}, } for i, tt := range successfulTests { buf, err := m.Encode(pgtype.DateOID, pgtype.TextFormatCode, tt.source, nil) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.result, string(buf), "%d", i) } } func TestDateMarshalJSON(t *testing.T) { successfulTests := []struct { source pgtype.Date result string }{ {source: pgtype.Date{}, result: "null"}, {source: pgtype.Date{Time: time.Date(2012, 3, 29, 0, 0, 0, 0, time.UTC), Valid: true}, result: "\"2012-03-29\""}, {source: pgtype.Date{Time: time.Date(2012, 3, 29, 10, 5, 45, 0, time.FixedZone("", -6*60*60)), Valid: true}, result: "\"2012-03-29\""}, {source: pgtype.Date{Time: time.Date(2012, 3, 29, 10, 5, 45, 555*1000*1000, time.FixedZone("", -6*60*60)), Valid: true}, result: "\"2012-03-29\""}, {source: pgtype.Date{InfinityModifier: pgtype.Infinity, Valid: true}, result: "\"infinity\""}, {source: pgtype.Date{InfinityModifier: pgtype.NegativeInfinity, Valid: true}, result: "\"-infinity\""}, } for i, tt := range successfulTests { r, err := tt.source.MarshalJSON() if err != nil { t.Errorf("%d: %v", i, err) } if string(r) != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, string(r)) } } } func TestDateUnmarshalJSON(t *testing.T) { successfulTests := []struct { source string result pgtype.Date }{ {source: "null", result: pgtype.Date{}}, {source: "\"2012-03-29\"", result: pgtype.Date{Time: time.Date(2012, 3, 29, 0, 0, 0, 0, time.UTC), Valid: true}}, {source: "\"2012-03-29\"", result: pgtype.Date{Time: time.Date(2012, 3, 29, 10, 5, 45, 0, time.FixedZone("", -6*60*60)), Valid: true}}, {source: "\"2012-03-29\"", result: pgtype.Date{Time: time.Date(2012, 3, 29, 10, 5, 45, 555*1000*1000, time.FixedZone("", -6*60*60)), Valid: true}}, {source: "\"infinity\"", result: pgtype.Date{InfinityModifier: pgtype.Infinity, Valid: true}}, {source: "\"-infinity\"", result: pgtype.Date{InfinityModifier: pgtype.NegativeInfinity, Valid: true}}, } for i, tt := range successfulTests { var r pgtype.Date err := r.UnmarshalJSON([]byte(tt.source)) if err != nil { t.Errorf("%d: %v", i, err) } if r.Time.Year() != tt.result.Time.Year() || r.Time.Month() != tt.result.Time.Month() || r.Time.Day() != tt.result.Time.Day() || r.Valid != tt.result.Valid || r.InfinityModifier != tt.result.InfinityModifier { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, r) } } } pgx-5.8.0/pgtype/derived_types_test.go000066400000000000000000000034461512357711200201010ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/stretchr/testify/require" ) func TestDerivedTypes(t *testing.T) { skipCockroachDB(t, "Server does not support composite types (see https://github.com/cockroachdb/cockroach/issues/27792)") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Exec(ctx, ` drop type if exists dt_test; drop domain if exists dt_uint64; create domain dt_uint64 as numeric(20,0); create type dt_test as ( a text, b dt_uint64, c dt_uint64[] );`) require.NoError(t, err) defer conn.Exec(ctx, "drop domain dt_uint64") defer conn.Exec(ctx, "drop type dt_test") dtypes, err := conn.LoadTypes(ctx, []string{"dt_test"}) require.Len(t, dtypes, 6) require.Equal(t, dtypes[0].Name, "public.dt_uint64") require.Equal(t, dtypes[1].Name, "dt_uint64") require.Equal(t, dtypes[2].Name, "public._dt_uint64") require.Equal(t, dtypes[3].Name, "_dt_uint64") require.Equal(t, dtypes[4].Name, "public.dt_test") require.Equal(t, dtypes[5].Name, "dt_test") require.NoError(t, err) conn.TypeMap().RegisterTypes(dtypes) formats := []struct { name string code int16 }{ {name: "TextFormat", code: pgx.TextFormatCode}, {name: "BinaryFormat", code: pgx.BinaryFormatCode}, } for _, format := range formats { var a string var b uint64 var c *[]uint64 row := conn.QueryRow(ctx, "select $1::dt_test", pgx.QueryResultFormats{format.code}, pgtype.CompositeFields{"hi", uint64(42), []uint64{10, 20, 30}}) err := row.Scan(pgtype.CompositeFields{&a, &b, &c}) require.NoError(t, err) require.EqualValuesf(t, "hi", a, "%v", format.name) require.EqualValuesf(t, 42, b, "%v", format.name) } }) } pgx-5.8.0/pgtype/doc.go000066400000000000000000000224061512357711200147360ustar00rootroot00000000000000// Package pgtype converts between Go and PostgreSQL values. /* The primary type is the Map type. It is a map of PostgreSQL types identified by OID (object ID) to a Codec. A Codec is responsible for converting between Go and PostgreSQL values. NewMap creates a Map with all supported standard PostgreSQL types already registered. Additional types can be registered with Map.RegisterType. Use Map.Scan and Map.Encode to decode PostgreSQL values to Go and encode Go values to PostgreSQL respectively. Base Type Mapping pgtype maps between all common base types directly between Go and PostgreSQL. In particular: Go PostgreSQL ----------------------- string varchar text // Integers are automatically be converted to any other integer type if // it can be done without overflow or underflow. int8 int16 smallint int32 int int64 bigint int uint8 uint16 uint32 uint64 uint // Floats are strict and do not automatically convert like integers. float32 float4 float64 float8 time.Time date timestamp timestamptz netip.Addr inet netip.Prefix cidr []byte bytea Null Values pgtype can map NULLs in two ways. The first is types that can directly represent NULL such as Int4. They work in a similar fashion to database/sql. The second is to use a pointer to a pointer. var foo pgtype.Text var bar *string err := conn.QueryRow("select foo, bar from widgets where id=$1", 42).Scan(&foo, &bar) if err != nil { return err } When using nullable pgtype types as parameters for queries, one has to remember to explicitly set their Valid field to true, otherwise the parameter's value will be NULL. JSON Support pgtype automatically marshals and unmarshals data from json and jsonb PostgreSQL types. Extending Existing PostgreSQL Type Support Generally, all Codecs will support interfaces that can be implemented to enable scanning and encoding. For example, PointCodec can use any Go type that implements the PointScanner and PointValuer interfaces. So rather than use pgtype.Point and application can directly use its own point type with pgtype as long as it implements those interfaces. See example_custom_type_test.go for an example of a custom type for the PostgreSQL point type. Sometimes pgx supports a PostgreSQL type such as numeric but the Go type is in an external package that does not have pgx support such as github.com/shopspring/decimal. These types can be registered with pgtype with custom conversion logic. See https://github.com/jackc/pgx-shopspring-decimal and https://github.com/jackc/pgx-gofrs-uuid for example integrations. New PostgreSQL Type Support pgtype uses the PostgreSQL OID to determine how to encode or decode a value. pgtype supports array, composite, domain, and enum types. However, any type created in PostgreSQL with CREATE TYPE will receive a new OID. This means that the OID of each new PostgreSQL type must be registered for pgtype to handle values of that type with the correct Codec. The pgx.Conn LoadType method can return a *Type for array, composite, domain, and enum types by inspecting the database metadata. This *Type can then be registered with Map.RegisterType. For example, the following function could be called after a connection is established: func RegisterDataTypes(ctx context.Context, conn *pgx.Conn) error { dataTypeNames := []string{ "foo", "_foo", "bar", "_bar", } for _, typeName := range dataTypeNames { dataType, err := conn.LoadType(ctx, typeName) if err != nil { return err } conn.TypeMap().RegisterType(dataType) } return nil } A type cannot be registered unless all types it depends on are already registered. e.g. An array type cannot be registered until its element type is registered. ArrayCodec implements support for arrays. If pgtype supports type T then it can easily support []T by registering an ArrayCodec for the appropriate PostgreSQL OID. In addition, Array[T] type can support multi-dimensional arrays. CompositeCodec implements support for PostgreSQL composite types. Go structs can be scanned into if the public fields of the struct are in the exact order and type of the PostgreSQL type or by implementing CompositeIndexScanner and CompositeIndexGetter. Domain types are treated as their underlying type if the underlying type and the domain type are registered. PostgreSQL enums can usually be treated as text. However, EnumCodec implements support for interning strings which can reduce memory usage. While pgtype will often still work with unregistered types it is highly recommended that all types be registered due to an improvement in performance and the elimination of certain edge cases. If an entirely new PostgreSQL type (e.g. PostGIS types) is used then the application or a library can create a new Codec. Then the OID / Codec mapping can be registered with Map.RegisterType. There is no difference between a Codec defined and registered by the application and a Codec built in to pgtype. See any of the Codecs in pgtype for Codec examples and for examples of type registration. Encoding Unknown Types pgtype works best when the OID of the PostgreSQL type is known. But in some cases such as using the simple protocol the OID is unknown. In this case Map.RegisterDefaultPgType can be used to register an assumed OID for a particular Go type. Renamed Types If pgtype does not recognize a type and that type is a renamed simple type simple (e.g. type MyInt32 int32) pgtype acts as if it is the underlying type. It currently cannot automatically detect the underlying type of renamed structs (eg.g. type MyTime time.Time). Compatibility with database/sql pgtype also includes support for custom types implementing the database/sql.Scanner and database/sql/driver.Valuer interfaces. Encoding Typed Nils pgtype encodes untyped and typed nils (e.g. nil and []byte(nil)) to the SQL NULL value without going through the Codec system. This means that Codecs and other encoding logic do not have to handle nil or *T(nil). However, database/sql compatibility requires Value to be called on T(nil) when T implements driver.Valuer. Therefore, driver.Valuer values are only considered NULL when *T(nil) where driver.Valuer is implemented on T not on *T. See https://github.com/golang/go/issues/8415 and https://github.com/golang/go/commit/0ce1d79a6a771f7449ec493b993ed2a720917870. Child Records pgtype's support for arrays and composite records can be used to load records and their children in a single query. See example_child_records_test.go for an example. Overview of Scanning Implementation The first step is to use the OID to lookup the correct Codec. The Map will call the Codec's PlanScan method to get a plan for scanning into the Go value. A Codec will support scanning into one or more Go types. Oftentime these Go types are interfaces rather than explicit types. For example, PointCodec can use any Go type that implements the PointScanner and PointValuer interfaces. If a Go value is not supported directly by a Codec then Map will try see if it is a sql.Scanner. If is then that interface will be used to scan the value. Most sql.Scanners require the input to be in the text format (e.g. UUIDs and numeric). However, pgx will typically have received the value in the binary format. In this case the binary value will be parsed, reencoded as text, and then passed to the sql.Scanner. This may incur additional overhead for query results with a large number of affected values. If a Go value is not supported directly by a Codec then Map will try wrapping it with additional logic and try again. For example, Int8Codec does not support scanning into a renamed type (e.g. type myInt64 int64). But Map will detect that myInt64 is a renamed type and create a plan that converts the value to the underlying int64 type and then passes that to the Codec (see TryFindUnderlyingTypeScanPlan). These plan wrappers are contained in Map.TryWrapScanPlanFuncs. By default these contain shared logic to handle renamed types, pointers to pointers, slices, composite types, etc. Additional plan wrappers can be added to seamlessly integrate types that do not support pgx directly. For example, the before mentioned https://github.com/jackc/pgx-shopspring-decimal package detects decimal.Decimal values, wraps them in something implementing NumericScanner and passes that to the Codec. Map.Scan and Map.Encode are convenience methods that wrap Map.PlanScan and Map.PlanEncode. Determining how to scan or encode a particular type may be a time consuming operation. Hence the planning and execution steps of a conversion are internally separated. Reducing Compiled Binary Size pgx.QueryExecModeExec and pgx.QueryExecModeSimpleProtocol require the default PostgreSQL type to be registered for each Go type used as a query parameter. By default pgx does this for all supported types and their array variants. If an application does not use those query execution modes or manually registers the default PostgreSQL type for the types it uses as query parameters it can use the build tag nopgxregisterdefaulttypes. This omits the default type registration and reduces the compiled binary size by ~2MB. */ package pgtype pgx-5.8.0/pgtype/enum_codec.go000066400000000000000000000053321512357711200162710ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "fmt" ) // EnumCodec is a codec that caches the strings it decodes. If the same string is read multiple times only one copy is // allocated. These strings are only garbage collected when the EnumCodec is garbage collected. EnumCodec can be used // for any text type not only enums, but it should only be used when there are a small number of possible values. type EnumCodec struct { membersMap map[string]string // map to quickly lookup member and reuse string instead of allocating } func (EnumCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (EnumCodec) PreferredFormat() int16 { return TextFormatCode } func (EnumCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case TextFormatCode, BinaryFormatCode: switch value.(type) { case string: return encodePlanTextCodecString{} case []byte: return encodePlanTextCodecByteSlice{} case TextValuer: return encodePlanTextCodecTextValuer{} } } return nil } func (c *EnumCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case TextFormatCode, BinaryFormatCode: switch target.(type) { case *string: return &scanPlanTextAnyToEnumString{codec: c} case *[]byte: return scanPlanAnyToNewByteSlice{} case TextScanner: return &scanPlanTextAnyToEnumTextScanner{codec: c} } } return nil } func (c *EnumCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return c.DecodeValue(m, oid, format, src) } func (c *EnumCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } return c.lookupAndCacheString(src), nil } // lookupAndCacheString looks for src in the members map. If it is not found it is added to the map. func (c *EnumCodec) lookupAndCacheString(src []byte) string { if c.membersMap == nil { c.membersMap = make(map[string]string) } if s, found := c.membersMap[string(src)]; found { return s } s := string(src) c.membersMap[s] = s return s } type scanPlanTextAnyToEnumString struct { codec *EnumCodec } func (plan *scanPlanTextAnyToEnumString) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p := (dst).(*string) *p = plan.codec.lookupAndCacheString(src) return nil } type scanPlanTextAnyToEnumTextScanner struct { codec *EnumCodec } func (plan *scanPlanTextAnyToEnumTextScanner) Scan(src []byte, dst any) error { scanner := (dst).(TextScanner) if src == nil { return scanner.ScanText(Text{}) } return scanner.ScanText(Text{String: plan.codec.lookupAndCacheString(src), Valid: true}) } pgx-5.8.0/pgtype/enum_codec_test.go000066400000000000000000000035071512357711200173320ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" pgx "github.com/jackc/pgx/v5" "github.com/stretchr/testify/require" ) func TestEnumCodec(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Exec(ctx, `drop type if exists enum_test; create type enum_test as enum ('foo', 'bar', 'baz');`) require.NoError(t, err) defer conn.Exec(ctx, "drop type enum_test") dt, err := conn.LoadType(ctx, "enum_test") require.NoError(t, err) conn.TypeMap().RegisterType(dt) var s string err = conn.QueryRow(ctx, `select 'foo'::enum_test`).Scan(&s) require.NoError(t, err) require.Equal(t, "foo", s) err = conn.QueryRow(ctx, `select $1::enum_test`, "bar").Scan(&s) require.NoError(t, err) require.Equal(t, "bar", s) err = conn.QueryRow(ctx, `select 'foo'::enum_test`).Scan(&s) require.NoError(t, err) require.Equal(t, "foo", s) err = conn.QueryRow(ctx, `select $1::enum_test`, "bar").Scan(&s) require.NoError(t, err) require.Equal(t, "bar", s) err = conn.QueryRow(ctx, `select 'baz'::enum_test`).Scan(&s) require.NoError(t, err) require.Equal(t, "baz", s) }) } func TestEnumCodecValues(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Exec(ctx, `drop type if exists enum_test; create type enum_test as enum ('foo', 'bar', 'baz');`) require.NoError(t, err) defer conn.Exec(ctx, "drop type enum_test") dt, err := conn.LoadType(ctx, "enum_test") require.NoError(t, err) conn.TypeMap().RegisterType(dt) rows, err := conn.Query(ctx, `select 'foo'::enum_test`) require.NoError(t, err) require.True(t, rows.Next()) values, err := rows.Values() require.NoError(t, err) require.Equal(t, []any{"foo"}, values) }) } pgx-5.8.0/pgtype/example_child_records_test.go000066400000000000000000000040731512357711200215470ustar00rootroot00000000000000package pgtype_test import ( "context" "fmt" "os" "time" "github.com/jackc/pgx/v5" ) type Player struct { Name string Position string } type Team struct { Name string Players []Player } // This example uses a single query to return parent and child records. func Example_childRecords() { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn, err := pgx.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) if err != nil { fmt.Printf("Unable to establish connection: %v", err) return } if conn.PgConn().ParameterStatus("crdb_version") != "" { // Skip test / example when running on CockroachDB. Since an example can't be skipped fake success instead. fmt.Println(`Alpha Adam: wing Bill: halfback Charlie: fullback Beta Don: halfback Edgar: halfback Frank: fullback`) return } // Setup example schema and data. _, err = conn.Exec(ctx, ` create temporary table teams ( name text primary key ); create temporary table players ( name text primary key, team_name text, position text ); insert into teams (name) values ('Alpha'), ('Beta'); insert into players (name, team_name, position) values ('Adam', 'Alpha', 'wing'), ('Bill', 'Alpha', 'halfback'), ('Charlie', 'Alpha', 'fullback'), ('Don', 'Beta', 'halfback'), ('Edgar', 'Beta', 'halfback'), ('Frank', 'Beta', 'fullback') `) if err != nil { fmt.Printf("Unable to setup example schema and data: %v", err) return } rows, _ := conn.Query(ctx, ` select t.name, (select array_agg(row(p.name, position) order by p.name) from players p where p.team_name = t.name) from teams t order by t.name `) teams, err := pgx.CollectRows(rows, pgx.RowToStructByPos[Team]) if err != nil { fmt.Printf("CollectRows error: %v", err) return } for _, team := range teams { fmt.Println(team.Name) for _, player := range team.Players { fmt.Printf(" %s: %s\n", player.Name, player.Position) } } // Output: // Alpha // Adam: wing // Bill: halfback // Charlie: fullback // Beta // Don: halfback // Edgar: halfback // Frank: fullback } pgx-5.8.0/pgtype/example_custom_type_test.go000066400000000000000000000027601512357711200213170ustar00rootroot00000000000000package pgtype_test import ( "context" "fmt" "os" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" ) // Point represents a point that may be null. type Point struct { X, Y float32 // Coordinates of point Valid bool } func (p *Point) ScanPoint(v pgtype.Point) error { *p = Point{ X: float32(v.P.X), Y: float32(v.P.Y), Valid: v.Valid, } return nil } func (p Point) PointValue() (pgtype.Point, error) { return pgtype.Point{ P: pgtype.Vec2{X: float64(p.X), Y: float64(p.Y)}, Valid: true, }, nil } func (src *Point) String() string { if !src.Valid { return "null point" } return fmt.Sprintf("%.1f, %.1f", src.X, src.Y) } func Example_customType() { conn, err := pgx.Connect(context.Background(), os.Getenv("PGX_TEST_DATABASE")) if err != nil { fmt.Printf("Unable to establish connection: %v", err) return } defer conn.Close(context.Background()) if conn.PgConn().ParameterStatus("crdb_version") != "" { // Skip test / example when running on CockroachDB which doesn't support the point type. Since an example can't be // skipped fake success instead. fmt.Println("null point") fmt.Println("1.5, 2.5") return } p := &Point{} err = conn.QueryRow(context.Background(), "select null::point").Scan(p) if err != nil { fmt.Println(err) return } fmt.Println(p) err = conn.QueryRow(context.Background(), "select point(1.5,2.5)").Scan(p) if err != nil { fmt.Println(err) return } fmt.Println(p) // Output: // null point // 1.5, 2.5 } pgx-5.8.0/pgtype/example_json_test.go000066400000000000000000000011541512357711200177110ustar00rootroot00000000000000package pgtype_test import ( "context" "fmt" "os" "github.com/jackc/pgx/v5" ) func Example_json() { conn, err := pgx.Connect(context.Background(), os.Getenv("PGX_TEST_DATABASE")) if err != nil { fmt.Printf("Unable to establish connection: %v", err) return } type person struct { Name string `json:"name"` Age int `json:"age"` } input := person{ Name: "John", Age: 42, } var output person err = conn.QueryRow(context.Background(), "select $1::json", input).Scan(&output) if err != nil { fmt.Println(err) return } fmt.Println(output.Name, output.Age) // Output: // John 42 } pgx-5.8.0/pgtype/float4.go000066400000000000000000000163721512357711200153670ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "encoding/json" "fmt" "math" "strconv" "github.com/jackc/pgx/v5/internal/pgio" ) type Float4 struct { Float32 float32 Valid bool } // ScanFloat64 implements the [Float64Scanner] interface. func (f *Float4) ScanFloat64(n Float8) error { *f = Float4{Float32: float32(n.Float64), Valid: n.Valid} return nil } // Float64Value implements the [Float64Valuer] interface. func (f Float4) Float64Value() (Float8, error) { return Float8{Float64: float64(f.Float32), Valid: f.Valid}, nil } // ScanInt64 implements the [Int64Scanner] interface. func (f *Float4) ScanInt64(n Int8) error { *f = Float4{Float32: float32(n.Int64), Valid: n.Valid} return nil } // Int64Value implements the [Int64Valuer] interface. func (f Float4) Int64Value() (Int8, error) { return Int8{Int64: int64(f.Float32), Valid: f.Valid}, nil } // Scan implements the [database/sql.Scanner] interface. func (f *Float4) Scan(src any) error { if src == nil { *f = Float4{} return nil } switch src := src.(type) { case float64: *f = Float4{Float32: float32(src), Valid: true} return nil case string: n, err := strconv.ParseFloat(string(src), 32) if err != nil { return err } *f = Float4{Float32: float32(n), Valid: true} return nil } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (f Float4) Value() (driver.Value, error) { if !f.Valid { return nil, nil } return float64(f.Float32), nil } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (f Float4) MarshalJSON() ([]byte, error) { if !f.Valid { return []byte("null"), nil } return json.Marshal(f.Float32) } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (f *Float4) UnmarshalJSON(b []byte) error { var n *float32 err := json.Unmarshal(b, &n) if err != nil { return err } if n == nil { *f = Float4{} } else { *f = Float4{Float32: *n, Valid: true} } return nil } type Float4Codec struct{} func (Float4Codec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (Float4Codec) PreferredFormat() int16 { return BinaryFormatCode } func (Float4Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case BinaryFormatCode: switch value.(type) { case float32: return encodePlanFloat4CodecBinaryFloat32{} case Float64Valuer: return encodePlanFloat4CodecBinaryFloat64Valuer{} case Int64Valuer: return encodePlanFloat4CodecBinaryInt64Valuer{} } case TextFormatCode: switch value.(type) { case float32: return encodePlanTextFloat32{} case Float64Valuer: return encodePlanTextFloat64Valuer{} case Int64Valuer: return encodePlanTextInt64Valuer{} } } return nil } type encodePlanFloat4CodecBinaryFloat32 struct{} func (encodePlanFloat4CodecBinaryFloat32) Encode(value any, buf []byte) (newBuf []byte, err error) { n := value.(float32) return pgio.AppendUint32(buf, math.Float32bits(n)), nil } type encodePlanTextFloat32 struct{} func (encodePlanTextFloat32) Encode(value any, buf []byte) (newBuf []byte, err error) { n := value.(float32) return append(buf, strconv.FormatFloat(float64(n), 'f', -1, 32)...), nil } type encodePlanFloat4CodecBinaryFloat64Valuer struct{} func (encodePlanFloat4CodecBinaryFloat64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Float64Valuer).Float64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } return pgio.AppendUint32(buf, math.Float32bits(float32(n.Float64))), nil } type encodePlanFloat4CodecBinaryInt64Valuer struct{} func (encodePlanFloat4CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } f := float32(n.Int64) return pgio.AppendUint32(buf, math.Float32bits(f)), nil } func (Float4Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case *float32: return scanPlanBinaryFloat4ToFloat32{} case Float64Scanner: return scanPlanBinaryFloat4ToFloat64Scanner{} case Int64Scanner: return scanPlanBinaryFloat4ToInt64Scanner{} case TextScanner: return scanPlanBinaryFloat4ToTextScanner{} } case TextFormatCode: switch target.(type) { case *float32: return scanPlanTextAnyToFloat32{} case Float64Scanner: return scanPlanTextAnyToFloat64Scanner{} case Int64Scanner: return scanPlanTextAnyToInt64Scanner{} } } return nil } type scanPlanBinaryFloat4ToFloat32 struct{} func (scanPlanBinaryFloat4ToFloat32) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 4 { return fmt.Errorf("invalid length for float4: %v", len(src)) } n := int32(binary.BigEndian.Uint32(src)) f := (dst).(*float32) *f = math.Float32frombits(uint32(n)) return nil } type scanPlanBinaryFloat4ToFloat64Scanner struct{} func (scanPlanBinaryFloat4ToFloat64Scanner) Scan(src []byte, dst any) error { s := (dst).(Float64Scanner) if src == nil { return s.ScanFloat64(Float8{}) } if len(src) != 4 { return fmt.Errorf("invalid length for float4: %v", len(src)) } n := int32(binary.BigEndian.Uint32(src)) return s.ScanFloat64(Float8{Float64: float64(math.Float32frombits(uint32(n))), Valid: true}) } type scanPlanBinaryFloat4ToInt64Scanner struct{} func (scanPlanBinaryFloat4ToInt64Scanner) Scan(src []byte, dst any) error { s := (dst).(Int64Scanner) if src == nil { return s.ScanInt64(Int8{}) } if len(src) != 4 { return fmt.Errorf("invalid length for float4: %v", len(src)) } ui32 := int32(binary.BigEndian.Uint32(src)) f32 := math.Float32frombits(uint32(ui32)) i64 := int64(f32) if f32 != float32(i64) { return fmt.Errorf("cannot losslessly convert %v to int64", f32) } return s.ScanInt64(Int8{Int64: i64, Valid: true}) } type scanPlanBinaryFloat4ToTextScanner struct{} func (scanPlanBinaryFloat4ToTextScanner) Scan(src []byte, dst any) error { s := (dst).(TextScanner) if src == nil { return s.ScanText(Text{}) } if len(src) != 4 { return fmt.Errorf("invalid length for float4: %v", len(src)) } ui32 := int32(binary.BigEndian.Uint32(src)) f32 := math.Float32frombits(uint32(ui32)) return s.ScanText(Text{String: strconv.FormatFloat(float64(f32), 'f', -1, 32), Valid: true}) } type scanPlanTextAnyToFloat32 struct{} func (scanPlanTextAnyToFloat32) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } n, err := strconv.ParseFloat(string(src), 32) if err != nil { return err } f := (dst).(*float32) *f = float32(n) return nil } func (c Float4Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } var n float32 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return float64(n), nil } func (c Float4Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var n float32 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return n, nil } pgx-5.8.0/pgtype/float4_test.go000066400000000000000000000040011512357711200164100ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func TestFloat4Codec(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "float4", []pgxtest.ValueRoundTripTest{ {pgtype.Float4{Float32: -1, Valid: true}, new(pgtype.Float4), isExpectedEq(pgtype.Float4{Float32: -1, Valid: true})}, {pgtype.Float4{Float32: 0, Valid: true}, new(pgtype.Float4), isExpectedEq(pgtype.Float4{Float32: 0, Valid: true})}, {pgtype.Float4{Float32: 1, Valid: true}, new(pgtype.Float4), isExpectedEq(pgtype.Float4{Float32: 1, Valid: true})}, {float32(0.00001), new(float32), isExpectedEq(float32(0.00001))}, {float32(9999.99), new(float32), isExpectedEq(float32(9999.99))}, {pgtype.Float4{}, new(pgtype.Float4), isExpectedEq(pgtype.Float4{})}, {int64(1), new(int64), isExpectedEq(int64(1))}, {"1.23", new(string), isExpectedEq("1.23")}, {nil, new(*float32), isExpectedEq((*float32)(nil))}, }) } func TestFloat4MarshalJSON(t *testing.T) { successfulTests := []struct { source pgtype.Float4 result string }{ {source: pgtype.Float4{Float32: 0}, result: "null"}, {source: pgtype.Float4{Float32: 1.23, Valid: true}, result: "1.23"}, } for i, tt := range successfulTests { r, err := tt.source.MarshalJSON() if err != nil { t.Errorf("%d: %v", i, err) } if string(r) != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, string(r)) } } } func TestFloat4UnmarshalJSON(t *testing.T) { successfulTests := []struct { source string result pgtype.Float4 }{ {source: "null", result: pgtype.Float4{Float32: 0}}, {source: "1.23", result: pgtype.Float4{Float32: 1.23, Valid: true}}, } for i, tt := range successfulTests { var r pgtype.Float4 err := r.UnmarshalJSON([]byte(tt.source)) if err != nil { t.Errorf("%d: %v", i, err) } if r != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, r) } } } pgx-5.8.0/pgtype/float8.go000066400000000000000000000200731512357711200153640ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "encoding/json" "fmt" "math" "strconv" "github.com/jackc/pgx/v5/internal/pgio" ) type Float64Scanner interface { ScanFloat64(Float8) error } type Float64Valuer interface { Float64Value() (Float8, error) } type Float8 struct { Float64 float64 Valid bool } // ScanFloat64 implements the [Float64Scanner] interface. func (f *Float8) ScanFloat64(n Float8) error { *f = n return nil } // Float64Value implements the [Float64Valuer] interface. func (f Float8) Float64Value() (Float8, error) { return f, nil } // ScanInt64 implements the [Int64Scanner] interface. func (f *Float8) ScanInt64(n Int8) error { *f = Float8{Float64: float64(n.Int64), Valid: n.Valid} return nil } // Int64Value implements the [Int64Valuer] interface. func (f Float8) Int64Value() (Int8, error) { return Int8{Int64: int64(f.Float64), Valid: f.Valid}, nil } // Scan implements the [database/sql.Scanner] interface. func (f *Float8) Scan(src any) error { if src == nil { *f = Float8{} return nil } switch src := src.(type) { case float64: *f = Float8{Float64: src, Valid: true} return nil case string: n, err := strconv.ParseFloat(string(src), 64) if err != nil { return err } *f = Float8{Float64: n, Valid: true} return nil } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (f Float8) Value() (driver.Value, error) { if !f.Valid { return nil, nil } return f.Float64, nil } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (f Float8) MarshalJSON() ([]byte, error) { if !f.Valid { return []byte("null"), nil } return json.Marshal(f.Float64) } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (f *Float8) UnmarshalJSON(b []byte) error { var n *float64 err := json.Unmarshal(b, &n) if err != nil { return err } if n == nil { *f = Float8{} } else { *f = Float8{Float64: *n, Valid: true} } return nil } type Float8Codec struct{} func (Float8Codec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (Float8Codec) PreferredFormat() int16 { return BinaryFormatCode } func (Float8Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case BinaryFormatCode: switch value.(type) { case float64: return encodePlanFloat8CodecBinaryFloat64{} case Float64Valuer: return encodePlanFloat8CodecBinaryFloat64Valuer{} case Int64Valuer: return encodePlanFloat8CodecBinaryInt64Valuer{} } case TextFormatCode: switch value.(type) { case float64: return encodePlanTextFloat64{} case Float64Valuer: return encodePlanTextFloat64Valuer{} case Int64Valuer: return encodePlanTextInt64Valuer{} } } return nil } type encodePlanFloat8CodecBinaryFloat64 struct{} func (encodePlanFloat8CodecBinaryFloat64) Encode(value any, buf []byte) (newBuf []byte, err error) { n := value.(float64) return pgio.AppendUint64(buf, math.Float64bits(n)), nil } type encodePlanTextFloat64 struct{} func (encodePlanTextFloat64) Encode(value any, buf []byte) (newBuf []byte, err error) { n := value.(float64) return append(buf, strconv.FormatFloat(n, 'f', -1, 64)...), nil } type encodePlanFloat8CodecBinaryFloat64Valuer struct{} func (encodePlanFloat8CodecBinaryFloat64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Float64Valuer).Float64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } return pgio.AppendUint64(buf, math.Float64bits(n.Float64)), nil } type encodePlanTextFloat64Valuer struct{} func (encodePlanTextFloat64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Float64Valuer).Float64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } return append(buf, strconv.FormatFloat(n.Float64, 'f', -1, 64)...), nil } type encodePlanFloat8CodecBinaryInt64Valuer struct{} func (encodePlanFloat8CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } f := float64(n.Int64) return pgio.AppendUint64(buf, math.Float64bits(f)), nil } type encodePlanTextInt64Valuer struct{} func (encodePlanTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } return append(buf, strconv.FormatInt(n.Int64, 10)...), nil } func (Float8Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case *float64: return scanPlanBinaryFloat8ToFloat64{} case Float64Scanner: return scanPlanBinaryFloat8ToFloat64Scanner{} case Int64Scanner: return scanPlanBinaryFloat8ToInt64Scanner{} case TextScanner: return scanPlanBinaryFloat8ToTextScanner{} } case TextFormatCode: switch target.(type) { case *float64: return scanPlanTextAnyToFloat64{} case Float64Scanner: return scanPlanTextAnyToFloat64Scanner{} case Int64Scanner: return scanPlanTextAnyToInt64Scanner{} } } return nil } type scanPlanBinaryFloat8ToFloat64 struct{} func (scanPlanBinaryFloat8ToFloat64) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 8 { return fmt.Errorf("invalid length for float8: %v", len(src)) } n := int64(binary.BigEndian.Uint64(src)) f := (dst).(*float64) *f = math.Float64frombits(uint64(n)) return nil } type scanPlanBinaryFloat8ToFloat64Scanner struct{} func (scanPlanBinaryFloat8ToFloat64Scanner) Scan(src []byte, dst any) error { s := (dst).(Float64Scanner) if src == nil { return s.ScanFloat64(Float8{}) } if len(src) != 8 { return fmt.Errorf("invalid length for float8: %v", len(src)) } n := int64(binary.BigEndian.Uint64(src)) return s.ScanFloat64(Float8{Float64: math.Float64frombits(uint64(n)), Valid: true}) } type scanPlanBinaryFloat8ToInt64Scanner struct{} func (scanPlanBinaryFloat8ToInt64Scanner) Scan(src []byte, dst any) error { s := (dst).(Int64Scanner) if src == nil { return s.ScanInt64(Int8{}) } if len(src) != 8 { return fmt.Errorf("invalid length for float8: %v", len(src)) } ui64 := int64(binary.BigEndian.Uint64(src)) f64 := math.Float64frombits(uint64(ui64)) i64 := int64(f64) if f64 != float64(i64) { return fmt.Errorf("cannot losslessly convert %v to int64", f64) } return s.ScanInt64(Int8{Int64: i64, Valid: true}) } type scanPlanBinaryFloat8ToTextScanner struct{} func (scanPlanBinaryFloat8ToTextScanner) Scan(src []byte, dst any) error { s := (dst).(TextScanner) if src == nil { return s.ScanText(Text{}) } if len(src) != 8 { return fmt.Errorf("invalid length for float8: %v", len(src)) } ui64 := int64(binary.BigEndian.Uint64(src)) f64 := math.Float64frombits(uint64(ui64)) return s.ScanText(Text{String: strconv.FormatFloat(f64, 'f', -1, 64), Valid: true}) } type scanPlanTextAnyToFloat64 struct{} func (scanPlanTextAnyToFloat64) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } n, err := strconv.ParseFloat(string(src), 64) if err != nil { return err } f := (dst).(*float64) *f = n return nil } type scanPlanTextAnyToFloat64Scanner struct{} func (scanPlanTextAnyToFloat64Scanner) Scan(src []byte, dst any) error { s := (dst).(Float64Scanner) if src == nil { return s.ScanFloat64(Float8{}) } n, err := strconv.ParseFloat(string(src), 64) if err != nil { return err } return s.ScanFloat64(Float8{Float64: n, Valid: true}) } func (c Float8Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return c.DecodeValue(m, oid, format, src) } func (c Float8Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var n float64 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return n, nil } pgx-5.8.0/pgtype/float8_test.go000066400000000000000000000040011512357711200164140ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func TestFloat8Codec(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "float8", []pgxtest.ValueRoundTripTest{ {pgtype.Float8{Float64: -1, Valid: true}, new(pgtype.Float8), isExpectedEq(pgtype.Float8{Float64: -1, Valid: true})}, {pgtype.Float8{Float64: 0, Valid: true}, new(pgtype.Float8), isExpectedEq(pgtype.Float8{Float64: 0, Valid: true})}, {pgtype.Float8{Float64: 1, Valid: true}, new(pgtype.Float8), isExpectedEq(pgtype.Float8{Float64: 1, Valid: true})}, {float64(0.00001), new(float64), isExpectedEq(float64(0.00001))}, {float64(9999.99), new(float64), isExpectedEq(float64(9999.99))}, {pgtype.Float8{}, new(pgtype.Float8), isExpectedEq(pgtype.Float8{})}, {int64(1), new(int64), isExpectedEq(int64(1))}, {"1.23", new(string), isExpectedEq("1.23")}, {nil, new(*float64), isExpectedEq((*float64)(nil))}, }) } func TestFloat8MarshalJSON(t *testing.T) { successfulTests := []struct { source pgtype.Float8 result string }{ {source: pgtype.Float8{Float64: 0}, result: "null"}, {source: pgtype.Float8{Float64: 1.23, Valid: true}, result: "1.23"}, } for i, tt := range successfulTests { r, err := tt.source.MarshalJSON() if err != nil { t.Errorf("%d: %v", i, err) } if string(r) != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, string(r)) } } } func TestFloat8UnmarshalJSON(t *testing.T) { successfulTests := []struct { source string result pgtype.Float8 }{ {source: "null", result: pgtype.Float8{Float64: 0}}, {source: "1.23", result: pgtype.Float8{Float64: 1.23, Valid: true}}, } for i, tt := range successfulTests { var r pgtype.Float8 err := r.UnmarshalJSON([]byte(tt.source)) if err != nil { t.Errorf("%d: %v", i, err) } if r != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, r) } } } pgx-5.8.0/pgtype/hstore.go000066400000000000000000000277631512357711200155100ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "errors" "fmt" "strings" "github.com/jackc/pgx/v5/internal/pgio" ) type HstoreScanner interface { ScanHstore(v Hstore) error } type HstoreValuer interface { HstoreValue() (Hstore, error) } // Hstore represents an hstore column that can be null or have null values // associated with its keys. type Hstore map[string]*string // ScanHstore implements the [HstoreScanner] interface. func (h *Hstore) ScanHstore(v Hstore) error { *h = v return nil } // HstoreValue implements the [HstoreValuer] interface. func (h Hstore) HstoreValue() (Hstore, error) { return h, nil } // Scan implements the [database/sql.Scanner] interface. func (h *Hstore) Scan(src any) error { if src == nil { *h = nil return nil } switch src := src.(type) { case string: return scanPlanTextAnyToHstoreScanner{}.scanString(src, h) } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (h Hstore) Value() (driver.Value, error) { if h == nil { return nil, nil } buf, err := HstoreCodec{}.PlanEncode(nil, 0, TextFormatCode, h).Encode(h, nil) if err != nil { return nil, err } return string(buf), err } type HstoreCodec struct{} func (HstoreCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (HstoreCodec) PreferredFormat() int16 { return BinaryFormatCode } func (HstoreCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(HstoreValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanHstoreCodecBinary{} case TextFormatCode: return encodePlanHstoreCodecText{} } return nil } type encodePlanHstoreCodecBinary struct{} func (encodePlanHstoreCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { hstore, err := value.(HstoreValuer).HstoreValue() if err != nil { return nil, err } if hstore == nil { return nil, nil } buf = pgio.AppendInt32(buf, int32(len(hstore))) for k, v := range hstore { buf = pgio.AppendInt32(buf, int32(len(k))) buf = append(buf, k...) if v == nil { buf = pgio.AppendInt32(buf, -1) } else { buf = pgio.AppendInt32(buf, int32(len(*v))) buf = append(buf, (*v)...) } } return buf, nil } type encodePlanHstoreCodecText struct{} func (encodePlanHstoreCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { hstore, err := value.(HstoreValuer).HstoreValue() if err != nil { return nil, err } if len(hstore) == 0 { // distinguish between empty and nil: Not strictly required by Postgres, since its protocol // explicitly marks NULL column values separately. However, the Binary codec does this, and // this means we can "round trip" Encode and Scan without data loss. // nil: []byte(nil); empty: []byte{} if hstore == nil { return nil, nil } return []byte{}, nil } firstPair := true for k, v := range hstore { if firstPair { firstPair = false } else { buf = append(buf, ',', ' ') } // unconditionally quote hstore keys/values like Postgres does // this avoids a Mac OS X Postgres hstore parsing bug: // https://www.postgresql.org/message-id/CA%2BHWA9awUW0%2BRV_gO9r1ABZwGoZxPztcJxPy8vMFSTbTfi4jig%40mail.gmail.com buf = append(buf, '"') buf = append(buf, quoteArrayReplacer.Replace(k)...) buf = append(buf, '"') buf = append(buf, "=>"...) if v == nil { buf = append(buf, "NULL"...) } else { buf = append(buf, '"') buf = append(buf, quoteArrayReplacer.Replace(*v)...) buf = append(buf, '"') } } return buf, nil } func (HstoreCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case HstoreScanner: return scanPlanBinaryHstoreToHstoreScanner{} } case TextFormatCode: switch target.(type) { case HstoreScanner: return scanPlanTextAnyToHstoreScanner{} } } return nil } type scanPlanBinaryHstoreToHstoreScanner struct{} func (scanPlanBinaryHstoreToHstoreScanner) Scan(src []byte, dst any) error { scanner := (dst).(HstoreScanner) if src == nil { return scanner.ScanHstore(Hstore(nil)) } rp := 0 const uint32Len = 4 if len(src[rp:]) < uint32Len { return fmt.Errorf("hstore incomplete %v", src) } pairCount := int(int32(binary.BigEndian.Uint32(src[rp:]))) rp += uint32Len hstore := make(Hstore, pairCount) // one allocation for all *string, rather than one per string, just like text parsing valueStrings := make([]string, pairCount) for i := range pairCount { if len(src[rp:]) < uint32Len { return fmt.Errorf("hstore incomplete %v", src) } keyLen := int(int32(binary.BigEndian.Uint32(src[rp:]))) rp += uint32Len if len(src[rp:]) < keyLen { return fmt.Errorf("hstore incomplete %v", src) } key := string(src[rp : rp+keyLen]) rp += keyLen if len(src[rp:]) < uint32Len { return fmt.Errorf("hstore incomplete %v", src) } valueLen := int(int32(binary.BigEndian.Uint32(src[rp:]))) rp += 4 if valueLen >= 0 { valueStrings[i] = string(src[rp : rp+valueLen]) rp += valueLen hstore[key] = &valueStrings[i] } else { hstore[key] = nil } } return scanner.ScanHstore(hstore) } type scanPlanTextAnyToHstoreScanner struct{} func (s scanPlanTextAnyToHstoreScanner) Scan(src []byte, dst any) error { scanner := (dst).(HstoreScanner) if src == nil { return scanner.ScanHstore(Hstore(nil)) } return s.scanString(string(src), scanner) } // scanString does not return nil hstore values because string cannot be nil. func (scanPlanTextAnyToHstoreScanner) scanString(src string, scanner HstoreScanner) error { hstore, err := parseHstore(src) if err != nil { return err } return scanner.ScanHstore(hstore) } func (c HstoreCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return codecDecodeToTextFormat(c, m, oid, format, src) } func (c HstoreCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var hstore Hstore err := codecScan(c, m, oid, format, src, &hstore) if err != nil { return nil, err } return hstore, nil } type hstoreParser struct { str string pos int nextBackslash int } func newHSP(in string) *hstoreParser { return &hstoreParser{ pos: 0, str: in, nextBackslash: strings.IndexByte(in, '\\'), } } func (p *hstoreParser) atEnd() bool { return p.pos >= len(p.str) } // consume returns the next byte of the string, or end if the string is done. func (p *hstoreParser) consume() (b byte, end bool) { if p.pos >= len(p.str) { return 0, true } b = p.str[p.pos] p.pos++ return b, false } func unexpectedByteErr(actualB, expectedB byte) error { return fmt.Errorf("expected '%c' ('%#v'); found '%c' ('%#v')", expectedB, expectedB, actualB, actualB) } // consumeExpectedByte consumes expectedB from the string, or returns an error. func (p *hstoreParser) consumeExpectedByte(expectedB byte) error { nextB, end := p.consume() if end { return fmt.Errorf("expected '%c' ('%#v'); found end", expectedB, expectedB) } if nextB != expectedB { return unexpectedByteErr(nextB, expectedB) } return nil } // consumeExpected2 consumes two expected bytes or returns an error. // This was a bit faster than using a string argument (better inlining? Not sure). func (p *hstoreParser) consumeExpected2(one, two byte) error { if p.pos+2 > len(p.str) { return errors.New("unexpected end of string") } if p.str[p.pos] != one { return unexpectedByteErr(p.str[p.pos], one) } if p.str[p.pos+1] != two { return unexpectedByteErr(p.str[p.pos+1], two) } p.pos += 2 return nil } var errEOSInQuoted = errors.New(`found end before closing double-quote ('"')`) // consumeDoubleQuoted consumes a double-quoted string from p. The double quote must have been // parsed already. This copies the string from the backing string so it can be garbage collected. func (p *hstoreParser) consumeDoubleQuoted() (string, error) { // fast path: assume most keys/values do not contain escapes nextDoubleQuote := strings.IndexByte(p.str[p.pos:], '"') if nextDoubleQuote == -1 { return "", errEOSInQuoted } nextDoubleQuote += p.pos if p.nextBackslash == -1 || p.nextBackslash > nextDoubleQuote { // clone the string from the source string to ensure it can be garbage collected separately // TODO: use strings.Clone on Go 1.20; this could get optimized away s := strings.Clone(p.str[p.pos:nextDoubleQuote]) p.pos = nextDoubleQuote + 1 return s, nil } // slow path: string contains escapes s, err := p.consumeDoubleQuotedWithEscapes(p.nextBackslash) p.nextBackslash = strings.IndexByte(p.str[p.pos:], '\\') if p.nextBackslash != -1 { p.nextBackslash += p.pos } return s, err } // consumeDoubleQuotedWithEscapes consumes a double-quoted string containing escapes, starting // at p.pos, and with the first backslash at firstBackslash. This copies the string so it can be // garbage collected separately. func (p *hstoreParser) consumeDoubleQuotedWithEscapes(firstBackslash int) (string, error) { // copy the prefix that does not contain backslashes var builder strings.Builder builder.WriteString(p.str[p.pos:firstBackslash]) // skip to the backslash p.pos = firstBackslash // copy bytes until the end, unescaping backslashes for { nextB, end := p.consume() if end { return "", errEOSInQuoted } else if nextB == '"' { break } else if nextB == '\\' { // escape: skip the backslash and copy the char nextB, end = p.consume() if end { return "", errEOSInQuoted } if !(nextB == '\\' || nextB == '"') { return "", fmt.Errorf("unexpected escape in quoted string: found '%#v'", nextB) } builder.WriteByte(nextB) } else { // normal byte: copy it builder.WriteByte(nextB) } } return builder.String(), nil } // consumePairSeparator consumes the Hstore pair separator ", " or returns an error. func (p *hstoreParser) consumePairSeparator() error { return p.consumeExpected2(',', ' ') } // consumeKVSeparator consumes the Hstore key/value separator "=>" or returns an error. func (p *hstoreParser) consumeKVSeparator() error { return p.consumeExpected2('=', '>') } // consumeDoubleQuotedOrNull consumes the Hstore key/value separator "=>" or returns an error. func (p *hstoreParser) consumeDoubleQuotedOrNull() (Text, error) { // peek at the next byte if p.atEnd() { return Text{}, errors.New("found end instead of value") } next := p.str[p.pos] if next == 'N' { // must be the exact string NULL: use consumeExpected2 twice err := p.consumeExpected2('N', 'U') if err != nil { return Text{}, err } err = p.consumeExpected2('L', 'L') if err != nil { return Text{}, err } return Text{String: "", Valid: false}, nil } else if next != '"' { return Text{}, unexpectedByteErr(next, '"') } // skip the double quote p.pos += 1 s, err := p.consumeDoubleQuoted() if err != nil { return Text{}, err } return Text{String: s, Valid: true}, nil } func parseHstore(s string) (Hstore, error) { p := newHSP(s) // This is an over-estimate of the number of key/value pairs. Use '>' because I am guessing it // is less likely to occur in keys/values than '=' or ','. numPairsEstimate := strings.Count(s, ">") // makes one allocation of strings for the entire Hstore, rather than one allocation per value. valueStrings := make([]string, 0, numPairsEstimate) result := make(Hstore, numPairsEstimate) first := true for !p.atEnd() { if !first { err := p.consumePairSeparator() if err != nil { return nil, err } } else { first = false } err := p.consumeExpectedByte('"') if err != nil { return nil, err } key, err := p.consumeDoubleQuoted() if err != nil { return nil, err } err = p.consumeKVSeparator() if err != nil { return nil, err } value, err := p.consumeDoubleQuotedOrNull() if err != nil { return nil, err } if value.Valid { valueStrings = append(valueStrings, value.String) result[key] = &valueStrings[len(valueStrings)-1] } else { result[key] = nil } } return result, nil } pgx-5.8.0/pgtype/hstore_test.go000066400000000000000000000462121512357711200165350ustar00rootroot00000000000000package pgtype_test import ( "context" "fmt" "reflect" "testing" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func isExpectedEqMapStringString(a any) func(any) bool { return func(v any) bool { am := a.(map[string]string) vm := v.(map[string]string) if len(am) != len(vm) { return false } for k, v := range am { if vm[k] != v { return false } } return true } } func isExpectedEqMapStringPointerString(a any) func(any) bool { return func(v any) bool { am := a.(map[string]*string) vm := v.(map[string]*string) if len(am) != len(vm) { return false } for k, v := range am { if (vm[k] == nil) != (v == nil) { return false } if v != nil && *vm[k] != *v { return false } } return true } } // stringPtr returns a pointer to s. func stringPtr(s string) *string { return &s } func TestHstoreCodec(t *testing.T) { ctr := defaultConnTestRunner ctr.AfterConnect = func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var hstoreOID uint32 err := conn.QueryRow(context.Background(), `select oid from pg_type where typname = 'hstore'`).Scan(&hstoreOID) if err != nil { t.Skipf("Skipping: cannot find hstore OID") } conn.TypeMap().RegisterType(&pgtype.Type{Name: "hstore", OID: hstoreOID, Codec: pgtype.HstoreCodec{}}) } tests := []pgxtest.ValueRoundTripTest{ { map[string]string{}, new(map[string]string), isExpectedEqMapStringString(map[string]string{}), }, { map[string]string{"foo": "", "bar": "", "baz": "123"}, new(map[string]string), isExpectedEqMapStringString(map[string]string{"foo": "", "bar": "", "baz": "123"}), }, { map[string]string{"NULL": "bar"}, new(map[string]string), isExpectedEqMapStringString(map[string]string{"NULL": "bar"}), }, { map[string]string{"bar": "NULL"}, new(map[string]string), isExpectedEqMapStringString(map[string]string{"bar": "NULL"}), }, { map[string]string{"": "foo"}, new(map[string]string), isExpectedEqMapStringString(map[string]string{"": "foo"}), }, { map[string]*string{}, new(map[string]*string), isExpectedEqMapStringPointerString(map[string]*string{}), }, { map[string]*string{"foo": stringPtr("bar"), "baq": stringPtr("quz")}, new(map[string]*string), isExpectedEqMapStringPointerString(map[string]*string{"foo": stringPtr("bar"), "baq": stringPtr("quz")}), }, { map[string]*string{"foo": nil, "baq": stringPtr("quz")}, new(map[string]*string), isExpectedEqMapStringPointerString(map[string]*string{"foo": nil, "baq": stringPtr("quz")}), }, {nil, new(*map[string]string), isExpectedEq((*map[string]string)(nil))}, {nil, new(*map[string]*string), isExpectedEq((*map[string]*string)(nil))}, {nil, new(*pgtype.Hstore), isExpectedEq((*pgtype.Hstore)(nil))}, } specialStrings := []string{ `"`, `'`, `\`, `\\`, `=>`, ` `, `\ / / \\ => " ' " '`, "line1\nline2", "tab\tafter", "vtab\vafter", "form\\ffeed", "carriage\rreturn", "curly{}braces", // Postgres on Mac OS X hstore parsing bug: // ą = "\xc4\x85" in UTF-8; isspace(0x85) on Mac OS X returns true instead of false "mac_bugą", } for _, s := range specialStrings { // Special key values // at beginning tests = append(tests, pgxtest.ValueRoundTripTest{ map[string]string{s + "foo": "bar"}, new(map[string]string), isExpectedEqMapStringString(map[string]string{s + "foo": "bar"}), }) // in middle tests = append(tests, pgxtest.ValueRoundTripTest{ map[string]string{"foo" + s + "bar": "bar"}, new(map[string]string), isExpectedEqMapStringString(map[string]string{"foo" + s + "bar": "bar"}), }) // at end tests = append(tests, pgxtest.ValueRoundTripTest{ map[string]string{"foo" + s: "bar"}, new(map[string]string), isExpectedEqMapStringString(map[string]string{"foo" + s: "bar"}), }) // is key tests = append(tests, pgxtest.ValueRoundTripTest{ map[string]string{s: "bar"}, new(map[string]string), isExpectedEqMapStringString(map[string]string{s: "bar"}), }) // Special value values // at beginning tests = append(tests, pgxtest.ValueRoundTripTest{ map[string]string{"foo": s + "bar"}, new(map[string]string), isExpectedEqMapStringString(map[string]string{"foo": s + "bar"}), }) // in middle tests = append(tests, pgxtest.ValueRoundTripTest{ map[string]string{"foo": "foo" + s + "bar"}, new(map[string]string), isExpectedEqMapStringString(map[string]string{"foo": "foo" + s + "bar"}), }) // at end tests = append(tests, pgxtest.ValueRoundTripTest{ map[string]string{"foo": "foo" + s}, new(map[string]string), isExpectedEqMapStringString(map[string]string{"foo": "foo" + s}), }) // is key tests = append(tests, pgxtest.ValueRoundTripTest{ map[string]string{"foo": s}, new(map[string]string), isExpectedEqMapStringString(map[string]string{"foo": s}), }) } pgxtest.RunValueRoundTripTests(context.Background(), t, ctr, pgxtest.KnownOIDQueryExecModes, "hstore", tests) // run the tests using pgtype.Hstore as input and output types, and test all query modes for i := range tests { var h pgtype.Hstore switch typedParam := tests[i].Param.(type) { case map[string]*string: h = pgtype.Hstore(typedParam) case map[string]string: if typedParam != nil { h = pgtype.Hstore{} for k, v := range typedParam { h[k] = stringPtr(v) } } } tests[i].Param = h tests[i].Result = &pgtype.Hstore{} tests[i].Test = func(input any) bool { return reflect.DeepEqual(input, h) } } pgxtest.RunValueRoundTripTests(context.Background(), t, ctr, pgxtest.AllQueryExecModes, "hstore", tests) // run the tests again without the codec registered: uses the text protocol ctrWithoutCodec := defaultConnTestRunner pgxtest.RunValueRoundTripTests(context.Background(), t, ctrWithoutCodec, pgxtest.AllQueryExecModes, "hstore", tests) // scan empty and NULL: should be different in all query modes ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, ctr, pgxtest.AllQueryExecModes, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { h := pgtype.Hstore{"should_be_erased": nil} err := conn.QueryRow(ctx, `select cast(null as hstore)`).Scan(&h) if err != nil { t.Fatal(err) } expectedNil := pgtype.Hstore(nil) if !reflect.DeepEqual(h, expectedNil) { t.Errorf("plain conn.Scan failed expectedNil=%#v actual=%#v", expectedNil, h) } err = conn.QueryRow(ctx, `select cast('' as hstore)`).Scan(&h) if err != nil { t.Fatal(err) } expectedEmpty := pgtype.Hstore{} if !reflect.DeepEqual(h, expectedEmpty) { t.Errorf("plain conn.Scan failed expectedEmpty=%#v actual=%#v", expectedEmpty, h) } }) } func TestParseInvalidInputs(t *testing.T) { // these inputs should be invalid, but previously were considered correct invalidInputs := []string{ // extra comma between values `"a"=>"1", ,b"=>"2"`, // missing doublequote before second value `""=>"", 0"=>""`, } for i, input := range invalidInputs { var hstore pgtype.Hstore err := hstore.Scan(input) if err == nil { t.Errorf("test %d: input=%s (%#v) should fail; parsed correctly", i, input, input) } } } func TestRoundTrip(t *testing.T) { codecs := []struct { name string encodePlan pgtype.EncodePlan scanPlan pgtype.ScanPlan }{ { "text", pgtype.HstoreCodec{}.PlanEncode(nil, 0, pgtype.TextFormatCode, pgtype.Hstore(nil)), pgtype.HstoreCodec{}.PlanScan(nil, 0, pgtype.TextFormatCode, (*pgtype.Hstore)(nil)), }, { "binary", pgtype.HstoreCodec{}.PlanEncode(nil, 0, pgtype.BinaryFormatCode, pgtype.Hstore(nil)), pgtype.HstoreCodec{}.PlanScan(nil, 0, pgtype.BinaryFormatCode, (*pgtype.Hstore)(nil)), }, } inputs := []pgtype.Hstore{ nil, {}, {"": stringPtr("")}, {"k1": stringPtr("v1")}, {"k1": stringPtr("v1"), "k2": stringPtr("v2")}, } for _, codec := range codecs { for i, input := range inputs { t.Run(fmt.Sprintf("%s/%d", codec.name, i), func(t *testing.T) { serialized, err := codec.encodePlan.Encode(input, nil) if err != nil { t.Fatal(err) } var output pgtype.Hstore err = codec.scanPlan.Scan(serialized, &output) if err != nil { t.Fatal(err) } if !reflect.DeepEqual(output, input) { t.Errorf("output=%#v does not match input=%#v", output, input) } }) } } } func BenchmarkHstoreEncode(b *testing.B) { h := pgtype.Hstore{ "a x": stringPtr("100"), "b": stringPtr("200"), "c": stringPtr("300"), "d": stringPtr("400"), "e": stringPtr("500"), } serializeConfigs := []struct { name string encodePlan pgtype.EncodePlan }{ {"text", pgtype.HstoreCodec{}.PlanEncode(nil, 0, pgtype.TextFormatCode, h)}, {"binary", pgtype.HstoreCodec{}.PlanEncode(nil, 0, pgtype.BinaryFormatCode, h)}, } for _, serializeConfig := range serializeConfigs { var buf []byte b.Run(serializeConfig.name, func(b *testing.B) { for b.Loop() { var err error buf, err = serializeConfig.encodePlan.Encode(h, buf) if err != nil { b.Fatal(err) } buf = buf[:0] } }) } } func BenchmarkHstoreScan(b *testing.B) { // empty, NULL, escapes, and based on some real data benchStrings := []string{ "", `"a"=>"b"`, `"a"=>"100", "b"=>"200", "c"=>"300", "d"=>"400", "e"=>"500"`, `"a"=>"100", "b"=>NULL, "c"=>"300", "d"=>NULL, "e"=>"500"`, `"pmd"=>"piokifjzxdy:mhvvmotns:sf1-dttudcp-orx-fuwzw-j8o-tl-jcg-1fb5d6dp50ke3l24", "ausz"=>"aorc-iosdby_tbxsjihj-kss64-32r128y-i2", "mgjo"=>"hxcp-ciag", "hkbee"=>"bokihheb", "gpcvhc"=>"ne-ywik-1", "olzjegk"=>"rxbkzba", "iy_quthhf"=>"sryizraxx", "bwpdpplfz"=>"gbdh-jikmnp_jwugdvjs-drh64-32k128h-p2", "njy_veipyyl"=>"727006795293", "vsgvqlrnqadzvk"=>"1_7_43", "mfdncuqvxp_gqlkytj"=>"fuyin", "cnuiswkwavoupqebov"=>"x32n128w", "mol_lcabioescln_ulstxauvi"=>"qm1-adbcand-tzi-fpnbv-s8j-vi-gqs-1om5b6lx50zk3u24", "arlyhgdxux.fc/bezucmz/mmfed"=>"vihsk", "jtkf.czddftrhr.ici/qbq_ftaz"=>"sse64", "notxkfqmpq.whxmykhtc.bcu/zmxz"=>"zauaklqp-uwo64-32q128a-g2", "ww_affdwqa_o8o_ilskcucq_urzltnf"=>"i6-9-0", "f8d.eq/bbqxwru-vsznvxerae/wsszbjw"=>"dgd", "ygpghkljze.dkrlrrieo.iur/xfqdqreft"=>"pfby-bhqlmm", "pmho-dqxuezyuu.ppslmznja.eam/ikehtxg"=>"wbku", "ckqeavtcqk.jiqdipgji.hjl/luzgqb-agm-wb"=>"ikpq", "akcn-yobdpxkyl.gktsjdo-xqwmivixku.p8y.vq/axqdw"=>"", "r8u.at/fbqrrss-ihxjmygoyc/ztqe-pqqqewnz/nepdj/njjv"=>"txtlffpp:ebwdksxkej", "q8x.wu/wenlhkz-govetdoibn/rcwg-ticalfjq/mgipy/awmjl"=>"dyzvbzvi", "p8l.wx/vadrnki-yfqhzlwcnt/hvun-geqhjsik/eqediipfr/vlc"=>"31900z", "t8z.be/qbtsmci-jqnqphssdg/ejma-slvywzry/txpnybwvn/kxdl"=>"210", "o8b.nb/bijgpwm-axvvqgujax/fjli-mxqwulfe/revyfoyty/oojpsd"=>"123421925786", "p8q.sk/ccpgzee-ufjempgvty/afwh-qvwzjvog/hsyhr/bklplujbfydtfw"=>"1_7_43", "k8y.jp/hqoymrw-flwqwvbntf/dlli-uggxkdqv/mtutu/qotjmacjitwtvcnblr"=>"m32x128f", "r8z.hj/eczodcw-lxzmeeqqii/fjba-psyoidht/gfjjcdbqs/apkqxiznu-muzubvl"=>"106068512341", "u8v.nf/ocnahkw-prhuwrrbjg/gxms-isohcouc/txfle/zfzw.neyygeeur.ejv/rnd_vdyo"=>"ibx64", "i8c.zz/dtiulqn-mmbskzjcib/fxuj-ejxbrnqi/optyp/wbbrancspv.pnkizgxcj.dbm/bldn"=>"znppnwzg-oxp64-32r128h-d2", "d8t.dg/jqtodoh-sokunyljow/svdf-ghplxxcx/wqkwl/dolljeqv.jcn.dxp.jmh.uyf/lyfv"=>"kc-lmpu-1i", "t8i.dy/imltbpr-atmthzarmk/fbbw-uaovyvdj/mmuwq/kseu-snmt.xtlgkstzph.mg/ehjdpgc"=>"", "o8c.yc/wximcpf-wmffadvnxx/tdim-szbqedqp/ztrui/puhx-kcwp.zziulqvvmb.ik/khfaxajj"=>"", "j8i.zc/sajavzi-kemnitliml/nloy-riqothpw/yxmnp/ttrnynffzy.lswpezbdq.wor/xkvqeexio"=>"ltmp-zajsxt", "a8f.xd/tfrrawy-ymihugugaa/ouzi-xdyecmqx/cwvgjvcrh/trgbxgbumo.uh/xmnqbds-nqxxeuqpq"=>"3123748065", "x8n.vx/juiqxkj-swvwogmncw/hvad-pojmevog/ytxit/auvo-duchssbth.uickilmnz.lja/hbeiakj"=>"hwhd", "z8j.bn/iplhrhv-wjdcwdclos/qndu-qvotchss/spvfx/brqotjnytw.aaemsoxor.ign/uwebjm-vzl-kb"=>"zwdg", "t8j.vx/iekvskm-xhikarvbty/czlm-xtipxwok/eeeow/uvtpuzmlqg.jgtpgiujc.wrs/mcofa-qxjjwak"=>"sovxb", "t8g.ab/wuncjdz-vsozsekgxz/aaea-hmgdjylm/qimwsoecgud-grgoowb/zveahbidvwcaebhlzigytiermehxy"=>"0.95", "n8k.ei/ohovibm-obkaatwlyw/bcow-gndyzpyt/aehyf/dpgifsorjx.ehsqntrka.jrr/meakdzy-ckxgnfavwm"=>"nlgw", "u8e.yi/qavbjew-qnmtzbeyce/rmwa-hcqlvadn/bhpml/taoj-wjnh.qqvkjmccfn.ja/nudbtwme-buc64-32j128i-k2"=>""`, `"mbgs"=>"eqjillclhkxz", "bxci"=>"etksm.rudiu", "jijqqm"=>"kj-ryxhwqtco-2", "yivvcxy"=>"fwbujcu", "ybk_ztlajai"=>"601427279990"`, `"wte"=>"nrhw", "lqjm"=>"ifsbygchn", "wbmf"=>"amjsoykkwq\\ghvwbsmz-qeiv-iekd-ukcwbipzy"`, `"otx"=>"fcreomqbwtk:gqhxzhxuh:wrqo-rf1-avhdpfy-nqi-dldof-i8p-mw-jll-l5r9741753c3", "vbjy"=>"akzfspigip_muzyxzwuso-zvoifh-uw", "fmkb"=>"pkoe-lezf", "wfbq"=>"qoviagajeg", "zvxbiv"=>"db-bcngmoq-1", "olictqnpx"=>"taqcnrcwcj_ticfxydekq-fafbkg-ot", "wkt_jtzzqpt"=>"727006795293", "bsdncvmbvj_xivgkws"=>"zczag", "muzq.oyrphhtne.fqm/itc"=>"ihilzgx", "pfsd.xphmjdohu.hrm/yeimpfm"=>"lrrqxrwyud-uvcljo", "qukdxappwo.or/xgcsmdo/dodoj"=>"onflq", "ktqrsqtllo.xxxpkizlg.tnf/unrt"=>"jrveutvddu-loihei-ww", "tr_qmarsis_s8v_skzbuuvy_cnyuxyk"=>"g6-16-0", "z8q.yc/xistcyy-tftbikuuhg/zvhemmi"=>"knv", "zrgwpjnvzq.twkcxxuyk.qwc/nirbacaom"=>"okfdlcpbdg", "suvk-wwwjqdytq.wdjmzxl-nduettmnmf.e8e.ec/qhkan"=>"", "u8m.xa/uvbhlmw-rqrcyyaiju/otsg-bqjfitoq/zqfuq/fifo"=>"brarmrogdb", "b8o.ci/znwkyby-nzuxiguqus/nwou-cxxnqxrr/rtdsp/yawv"=>"juedpptnbt-khocdt-vg:vfxpdswxnc", "u8h.vl/kgmvysr-xhykrjcssj/jfjv-gzalgika/yhrjfytwz/kbm"=>"3900f", "y8b.cm/ttijscl-rznjossaqw/kvto-gvnavnep/bwdqyuzgo/ozoi"=>"40", "p8j.pd/bnucngv-vnqufgvfqw/qshw-obnkmlfx/obczheyis/zzbsos"=>"7009zf", "p8y.fc/ejbndrq-aariupaovi/mrah-hmrhjcsv/lvrmfwwiz/uskogxfuw-zamygae"=>"18747532246", "y8m.oh/xzuhilr-wqmqqzcznb/pcox-idpxmhfj/yzsoj/qebkjaeymc.abqznnelq.gyd/osvb"=>"hsgxlccalq-eeybug-mx", "p8f.ay/tyntrss-nljxedfihd/grvy-znfykhlf/fjsqd/ffxaixyv.jie.bkg.zpd.kim/mgtc"=>"or-vrkdcxm-1i", "i8m.ms/jtykfbi-jdrqsqjdwt/ibaq-zmeuyznf/uczny/ufmj-zklt.omodkgubqw.ip/xztdevd"=>"", "k8m.ui/ymxurqo-kuhofnewjj/twex-iuwljutj/warlx/zptkdgqdpr.uhvqtrclx.ohj/bdkgsozkk"=>"zlgisdikac", "g8b.wk/vecudfr-pljllpgzxi/lbwd-zsracrgq/fucssaowj/syizbmlfqt.si/swpbend-gxrhddxad"=>"156213905", "z8y.ah/azeasta-gffxfwklrn/hukw-hphwntwy/lfswv/tmaeaxekya.vgkxjhtvg.mht/bzolt-koioxpf"=>"wzkra", "f8l.sy/ouekhco-rlhsclfzwx/erfz-uuejogrs/bgvia/zpohrhmrmu.sbdxzlaxo.wii/jbnwfvz-shekbewool"=>"aiey", "j8w.pz/fjtkxhn-zxxizfldde/wsik-uiodldga/ljdtl/gswz-cjmt.ffkelhxcsd.lw/ftcqgdnnho-ibbfql-ww"=>""`, `"uvd"=>"oneotg", "wsm"=>"djjgmwqyple:jtxtfvtjv:du1-nfxzmra-idl-ikxbx-t8n-id-nbo-6d08opx70381", "orq"=>"bkdvjw-xydgbd1", "gblm"=>"jtkcfd-unxbag1_xagyfw-nvachf1", "mfer"=>"jclz-yaim", "jvgvas"=>"jf-vhxh-1", "wwardeuqu"=>"ufimeb-bscfdy1_bfuagy-dhdqra1", "szs_rfgpqmc"=>"727006795293", "ckfxcgrnqc_rloxzxu"=>"qffbw", "yaigdvscju.ba/krpgzji/wvxyg"=>"srgtu", "gtxfjsigdv.pxujnffnp.aza/ycco"=>"ntranp-ahgeem1", "xj_lhdpvsl_i8i_qzrtlpjr_nroujqh"=>"q6-1-8", "czxy-sfym.enlohvvjmp.wb/huvcuhy"=>"", "x8a.of/sqpdqiq-vijrlgkkyl/oncckls"=>"mij", "oomgvfopmc.trnzktrtz.gza/rpeqqyqmm"=>"rgwnma-bwcbxe1", "gaud-giar.xuablvwkbo.wy/wvhmsk-uaycqn1"=>"", "oarbmcqzzw.qkfbtmltz.plh/aqssj-tlrhsof"=>"wxfd", "zepirccplb.qanvqnxlo.eld/emulnov-vgddsefeqv"=>"jnvh", "acby-kywxjuczc.suosfcy-drsgroeqvy.o8m.og/vyuxt"=>"", "q8j.by/lrwxbjt-yzrenlniog/gbmw-mnokcndu/etbcy/ibwr"=>"qpttug-jnxhwe1:grmslxhyky", "i8y.uy/awavkxk-nztmqujxys/pocu-sqjdqvzd/tfdjeflpn/xsj"=>"7900c", "z8g.ia/yzfdvta-ffkciorpfl/kmjc-fgcdomlv/snvhhbjil/nhvn"=>"45", "s8l.ky/dtvxoqu-lzfdnykmdh/wtdg-aktximmy/hofzkpzel/wtghso"=>"14837zg", "v8e.rq/uosznaz-drypoapgpe/vxss-mbxmvkjj/oglvxhxcz/whutvtjmr-tewtidr"=>"18747532246", "m8p.sz/hrgniti-aufhjdsdcc/whcp-cfuwjsnl/exugj/evphviokhl.ashpndixr.jvx/vgtt"=>"zdsacy-ppfuxf1", "w8t.fm/kljwjgc-fijbwsrvxa/dbzl-fhxvlrwk/yidyk/orrt-kgpr.wuzmpnxvtb.lc/dmbqfvt"=>"", "m8j.sv/takylmm-ywnolaflnl/ueih-fdcpfcpv/dslbc/dsspusnhtu.vgkihqtpb.fto/qmyksglfx"=>"wpwuih-deuiej1", "m8x.wi/jwobkio-mwupghbqbi/krqn-hqyfgwuw/mcbyi/yzkt-wtdy.pjxevrogab.tj/qlttbz-ppyzkd1"=>"", "c8j.tr/tzcbhid-lggaiypnny/wyms-zcjgxmwp/eaohd/bcwkheknsr.fqvtgecsf.qbf/uaqzj-jburpix"=>"ckkk", "w8h.wk/msbqvqy-nsmvbojwns/edpo-nsivbrmx/qifaf/sopuabsuvq.foyniwomd.zvj/lhvfwvv-zuufhhspso"=>"fghx"`, `"xxtlvd"=>"ba-zrzy-1", "hlebkcl"=>"entrcad", "ytn_toivqso"=>"601427279990", "czdllqyvkcfemhubpwvxakepubup"=>"jzhpff-vn2-sgiupfiii-qmuuz-ndex-vin-kmfm", "mefjcnjmcspgviisjalxmwdbksmge"=>"2022-11-20"`, `"ukq"=>"uhkbdj", "bmj"=>"mcoknsnhqcb:vmexvsccu:yt1-nscwdfr-zcp-ajfhr-z8i-ta-jhv-58yl03459t86", "cuq"=>"sqphbh-xkxbcgwdx", "dnac"=>"khzjpq-hljdvlbsw_azdisd-nshizhinc", "flgj"=>"zeem-pggu", "ksnn"=>"vpittgnl-xeojllby-toq", "wwxepg"=>"ki-cwee-1", "vigdnntxw"=>"sydsls-zidlsgugi_wviqvl-umwzyztab", "osz_utmlghi"=>"727006795293", "wacdaefqhc_buqmsci"=>"djtcv", "ljdbotgrsi.xn/gvtjfeg/iiyek"=>"lnfgg", "sohcclfodf.wkwiitult.ppm/hhsf"=>"ecpftm-ecmsibfjy", "dz_cgfnddq_o8j_cowdxlfz_rmjunpm"=>"v5-13-1", "niwk-fozq.tbamcxrhez.kl/zuxnisw"=>"", "h8k.xu/nbsezqz-fopcyqlnwt/lfcmgag"=>"dmm", "zebgpskksd.daigyeicb.dlj/dwmcpkohh"=>"hegecl-bnqmkunkl", "irjreiuove.qpmjixctw.mzv/xizjv-bpecdmy"=>"rkfl", "fupz-eiim.hwaqzvpzgv.yg/zhrqmr-qcydocyak"=>"", "djuscbflju.fmhnephvc.cmo/wzcisia-kqmrrhnkiv"=>"vchu", "hauo-olkeyvbrz.qzpaocu-wdbyfrzjkx.c8a.rn/bwhfe"=>"", "l8d.fj/jzojrmv-mbnxftbdzg/qvgo-oayrldze/tqmoa/oizo"=>"buwgyd-bjlrzrlci:ywosrfsnts", "q8l.sj/vifqvao-ynvfejvleb/ourc-jzridgtt/fgxnueuvm/wsg"=>"7900p", "d8b.mi/steijrv-bgajdbugff/kxkj-jhvctoxw/seyrafhni/xxrc"=>"45", "x8k.bn/dnnkttb-ywqrwwxirk/ngvt-eqyaeqsd/qesxmjfos/nlolbe"=>"14837xp", "v8o.az/vtbyyyo-rjuadsmwyb/gszv-ytnisfau/kfunvihsr/famkeacyo-skpueao"=>"18747532246", "f8w.ip/sjzrxbw-idgsgucprq/ster-zxiilwcf/luwzw/tavccuqfph.mcubdrtcr.ibw/dxnj"=>"ntyjnf-zwlyjqbfq", "y8f.mh/qykpkfr-fsnlckrhpe/hvyu-vstwrxkq/dmesn/kuor-acub.fqwqxcpiet.jf/zaxtdyb"=>"", "c8m.et/ekavnnp-gvpmldvoou/jzva-zzzpiecc/dvckb/qqxrfpoaiy.ssfqerwmb.cnz/odsfndorh"=>"liilkb-aekfuqzss", "e8n.gp/sybrxvz-mghjbpphpc/wcuo-naanbtcj/agtov/dztlgdacuz.fpbhhiybg.ncm/otgfu-hnezrwu"=>"ccez", "t8h.cy/bqsdiil-lxmioonwjt/drsw-qevzljvt/rvzjl/btbz-npvi.ypyxowgmfp.gf/jcfbyh-khpgbaayw"=>"", "y8b.df/anmudfn-gahfengbqw/fhdi-ozqtddmu/lvviu/kndwvowlby.jxkizwkac.hbq/fjkqyna-jijxahivma"=>"wxqg"`, } // convert benchStrings into text and binary bytes textBytes := make([][]byte, len(benchStrings)) binaryBytes := make([][]byte, len(benchStrings)) codec := pgtype.HstoreCodec{}.PlanEncode(nil, 0, pgtype.BinaryFormatCode, pgtype.Hstore(nil)) for i, s := range benchStrings { textBytes[i] = []byte(s) var tempH pgtype.Hstore err := tempH.Scan(s) if err != nil { b.Fatal(err) } binaryBytes[i], err = codec.Encode(tempH, nil) if err != nil { b.Fatal(err) } } // benchmark the database/sql.Scan API var h pgtype.Hstore b.Run("databasesql.Scan", func(b *testing.B) { b.ReportAllocs() for b.Loop() { for _, str := range benchStrings { err := h.Scan(str) if err != nil { b.Fatal(err) } } } }) // benchmark the []byte scan API used by pgconn scanConfigs := []struct { name string scanPlan pgtype.ScanPlan inputBytes [][]byte }{ {"text", pgtype.HstoreCodec{}.PlanScan(nil, 0, pgtype.TextFormatCode, &h), textBytes}, {"binary", pgtype.HstoreCodec{}.PlanScan(nil, 0, pgtype.BinaryFormatCode, &h), binaryBytes}, } for _, scanConfig := range scanConfigs { b.Run(scanConfig.name, func(b *testing.B) { b.ReportAllocs() for b.Loop() { for _, input := range scanConfig.inputBytes { err := scanConfig.scanPlan.Scan(input, &h) if err != nil { b.Fatalf("input=%#v err=%s", string(input), err) } } } }) } } pgx-5.8.0/pgtype/inet.go000066400000000000000000000104461512357711200151310ustar00rootroot00000000000000package pgtype import ( "bytes" "database/sql/driver" "errors" "fmt" "net/netip" ) // Network address family is dependent on server socket.h value for AF_INET. // In practice, all platforms appear to have the same value. See // src/include/utils/inet.h for more information. const ( defaultAFInet = 2 defaultAFInet6 = 3 ) type NetipPrefixScanner interface { ScanNetipPrefix(v netip.Prefix) error } type NetipPrefixValuer interface { NetipPrefixValue() (netip.Prefix, error) } // InetCodec handles both inet and cidr PostgreSQL types. The preferred Go types are [netip.Prefix] and [netip.Addr]. If // IsValid() is false then they are treated as SQL NULL. type InetCodec struct{} func (InetCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (InetCodec) PreferredFormat() int16 { return BinaryFormatCode } func (InetCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(NetipPrefixValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanInetCodecBinary{} case TextFormatCode: return encodePlanInetCodecText{} } return nil } type encodePlanInetCodecBinary struct{} func (encodePlanInetCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { prefix, err := value.(NetipPrefixValuer).NetipPrefixValue() if err != nil { return nil, err } if !prefix.IsValid() { return nil, nil } var family byte if prefix.Addr().Is4() { family = defaultAFInet } else { family = defaultAFInet6 } buf = append(buf, family) ones := prefix.Bits() buf = append(buf, byte(ones)) // is_cidr is ignored on server buf = append(buf, 0) if family == defaultAFInet { buf = append(buf, byte(4)) b := prefix.Addr().As4() buf = append(buf, b[:]...) } else { buf = append(buf, byte(16)) b := prefix.Addr().As16() buf = append(buf, b[:]...) } return buf, nil } type encodePlanInetCodecText struct{} func (encodePlanInetCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { prefix, err := value.(NetipPrefixValuer).NetipPrefixValue() if err != nil { return nil, err } if !prefix.IsValid() { return nil, nil } return append(buf, prefix.String()...), nil } func (InetCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case NetipPrefixScanner: return scanPlanBinaryInetToNetipPrefixScanner{} } case TextFormatCode: switch target.(type) { case NetipPrefixScanner: return scanPlanTextAnyToNetipPrefixScanner{} } } return nil } func (c InetCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return codecDecodeToTextFormat(c, m, oid, format, src) } func (c InetCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var prefix netip.Prefix err := codecScan(c, m, oid, format, src, (*netipPrefixWrapper)(&prefix)) if err != nil { return nil, err } if !prefix.IsValid() { return nil, nil } return prefix, nil } type scanPlanBinaryInetToNetipPrefixScanner struct{} func (scanPlanBinaryInetToNetipPrefixScanner) Scan(src []byte, dst any) error { scanner := (dst).(NetipPrefixScanner) if src == nil { return scanner.ScanNetipPrefix(netip.Prefix{}) } if len(src) != 8 && len(src) != 20 { return fmt.Errorf("Received an invalid size for an inet: %d", len(src)) } // ignore family bits := src[1] // ignore is_cidr // ignore addressLength - implicit in length of message addr, ok := netip.AddrFromSlice(src[4:]) if !ok { return errors.New("netip.AddrFromSlice failed") } return scanner.ScanNetipPrefix(netip.PrefixFrom(addr, int(bits))) } type scanPlanTextAnyToNetipPrefixScanner struct{} func (scanPlanTextAnyToNetipPrefixScanner) Scan(src []byte, dst any) error { scanner := (dst).(NetipPrefixScanner) if src == nil { return scanner.ScanNetipPrefix(netip.Prefix{}) } var prefix netip.Prefix if bytes.IndexByte(src, '/') == -1 { addr, err := netip.ParseAddr(string(src)) if err != nil { return err } prefix = netip.PrefixFrom(addr, addr.BitLen()) } else { var err error prefix, err = netip.ParsePrefix(string(src)) if err != nil { return err } } return scanner.ScanNetipPrefix(prefix) } pgx-5.8.0/pgtype/inet_test.go000066400000000000000000000166051512357711200161730ustar00rootroot00000000000000package pgtype_test import ( "context" "net" "net/netip" "testing" "github.com/jackc/pgx/v5/pgxtest" ) func isExpectedEqIPNet(a any) func(any) bool { return func(v any) bool { ap := a.(*net.IPNet) vp := v.(net.IPNet) return ap.IP.Equal(vp.IP) && ap.Mask.String() == vp.Mask.String() } } func TestInetTranscode(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "inet", []pgxtest.ValueRoundTripTest{ {mustParseInet(t, "0.0.0.0/32"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "0.0.0.0/32"))}, {mustParseInet(t, "127.0.0.1/8"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "127.0.0.1/8"))}, {mustParseInet(t, "12.34.56.65/32"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "12.34.56.65/32"))}, {mustParseInet(t, "192.168.1.16/24"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "192.168.1.16/24"))}, {mustParseInet(t, "255.0.0.0/8"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "255.0.0.0/8"))}, {mustParseInet(t, "255.255.255.255/32"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "255.255.255.255/32"))}, {mustParseInet(t, "2607:f8b0:4009:80b::200e"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "2607:f8b0:4009:80b::200e"))}, {mustParseInet(t, "::1/64"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "::1/64"))}, {mustParseInet(t, "::/0"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "::/0"))}, {mustParseInet(t, "::1/128"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "::1/128"))}, {mustParseInet(t, "2607:f8b0:4009:80b::200e/64"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "2607:f8b0:4009:80b::200e/64"))}, {mustParseInet(t, "0.0.0.0/32"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("0.0.0.0/32"))}, {mustParseInet(t, "127.0.0.1/8"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("127.0.0.1/8"))}, {mustParseInet(t, "12.34.56.65/32"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("12.34.56.65/32"))}, {mustParseInet(t, "192.168.1.16/24"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("192.168.1.16/24"))}, {mustParseInet(t, "255.0.0.0/8"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("255.0.0.0/8"))}, {mustParseInet(t, "255.255.255.255/32"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("255.255.255.255/32"))}, {mustParseInet(t, "2607:f8b0:4009:80b::200e"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("2607:f8b0:4009:80b::200e/128"))}, {mustParseInet(t, "::1/64"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("::1/64"))}, {mustParseInet(t, "::/0"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("::/0"))}, {mustParseInet(t, "::1/128"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("::1/128"))}, {mustParseInet(t, "2607:f8b0:4009:80b::200e/64"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("2607:f8b0:4009:80b::200e/64"))}, {netip.MustParsePrefix("0.0.0.0/32"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("0.0.0.0/32"))}, {netip.MustParsePrefix("127.0.0.1/8"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("127.0.0.1/8"))}, {netip.MustParsePrefix("12.34.56.65/32"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("12.34.56.65/32"))}, {netip.MustParsePrefix("192.168.1.16/24"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("192.168.1.16/24"))}, {netip.MustParsePrefix("255.0.0.0/8"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("255.0.0.0/8"))}, {netip.MustParsePrefix("255.255.255.255/32"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("255.255.255.255/32"))}, {netip.MustParsePrefix("::1/64"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("::1/64"))}, {netip.MustParsePrefix("::/0"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("::/0"))}, {netip.MustParsePrefix("::1/128"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("::1/128"))}, {netip.MustParsePrefix("2607:f8b0:4009:80b::200e/64"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("2607:f8b0:4009:80b::200e/64"))}, {netip.MustParseAddr("0.0.0.0"), new(netip.Addr), isExpectedEq(netip.MustParseAddr("0.0.0.0"))}, {netip.MustParseAddr("127.0.0.1"), new(netip.Addr), isExpectedEq(netip.MustParseAddr("127.0.0.1"))}, {netip.MustParseAddr("12.34.56.65"), new(netip.Addr), isExpectedEq(netip.MustParseAddr("12.34.56.65"))}, {netip.MustParseAddr("192.168.1.16"), new(netip.Addr), isExpectedEq(netip.MustParseAddr("192.168.1.16"))}, {netip.MustParseAddr("255.0.0.0"), new(netip.Addr), isExpectedEq(netip.MustParseAddr("255.0.0.0"))}, {netip.MustParseAddr("255.255.255.255"), new(netip.Addr), isExpectedEq(netip.MustParseAddr("255.255.255.255"))}, {netip.MustParseAddr("2607:f8b0:4009:80b::200e"), new(netip.Addr), isExpectedEq(netip.MustParseAddr("2607:f8b0:4009:80b::200e"))}, {netip.MustParseAddr("::1"), new(netip.Addr), isExpectedEq(netip.MustParseAddr("::1"))}, {netip.MustParseAddr("::"), new(netip.Addr), isExpectedEq(netip.MustParseAddr("::"))}, {netip.MustParseAddr("2607:f8b0:4009:80b::200e"), new(netip.Addr), isExpectedEq(netip.MustParseAddr("2607:f8b0:4009:80b::200e"))}, {nil, new(netip.Prefix), isExpectedEq(netip.Prefix{})}, }) } func TestCidrTranscode(t *testing.T) { skipCockroachDB(t, "Server does not support cidr type (see https://github.com/cockroachdb/cockroach/issues/18846)") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "cidr", []pgxtest.ValueRoundTripTest{ {mustParseInet(t, "0.0.0.0/32"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "0.0.0.0/32"))}, {mustParseInet(t, "127.0.0.1/32"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "127.0.0.1/32"))}, {mustParseInet(t, "12.34.56.0/32"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "12.34.56.0/32"))}, {mustParseInet(t, "192.168.1.0/24"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "192.168.1.0/24"))}, {mustParseInet(t, "255.0.0.0/8"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "255.0.0.0/8"))}, {mustParseInet(t, "::/128"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "::/128"))}, {mustParseInet(t, "::/0"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "::/0"))}, {mustParseInet(t, "::1/128"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "::1/128"))}, {mustParseInet(t, "2607:f8b0:4009:80b::200e/128"), new(net.IPNet), isExpectedEqIPNet(mustParseInet(t, "2607:f8b0:4009:80b::200e/128"))}, {netip.MustParsePrefix("0.0.0.0/32"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("0.0.0.0/32"))}, {netip.MustParsePrefix("127.0.0.1/32"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("127.0.0.1/32"))}, {netip.MustParsePrefix("12.34.56.0/32"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("12.34.56.0/32"))}, {netip.MustParsePrefix("192.168.1.0/24"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("192.168.1.0/24"))}, {netip.MustParsePrefix("255.0.0.0/8"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("255.0.0.0/8"))}, {netip.MustParsePrefix("::/128"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("::/128"))}, {netip.MustParsePrefix("::/0"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("::/0"))}, {netip.MustParsePrefix("::1/128"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("::1/128"))}, {netip.MustParsePrefix("2607:f8b0:4009:80b::200e/128"), new(netip.Prefix), isExpectedEq(netip.MustParsePrefix("2607:f8b0:4009:80b::200e/128"))}, {nil, new(netip.Prefix), isExpectedEq(netip.Prefix{})}, }) } pgx-5.8.0/pgtype/int.go000066400000000000000000001207041512357711200147630ustar00rootroot00000000000000// Code generated from pgtype/int.go.erb. DO NOT EDIT. package pgtype import ( "database/sql/driver" "encoding/binary" "encoding/json" "fmt" "math" "strconv" "github.com/jackc/pgx/v5/internal/pgio" ) type Int64Scanner interface { ScanInt64(Int8) error } type Int64Valuer interface { Int64Value() (Int8, error) } type Int2 struct { Int16 int16 Valid bool } // ScanInt64 implements the [Int64Scanner] interface. func (dst *Int2) ScanInt64(n Int8) error { if !n.Valid { *dst = Int2{} return nil } if n.Int64 < math.MinInt16 { return fmt.Errorf("%d is less than minimum value for Int2", n.Int64) } if n.Int64 > math.MaxInt16 { return fmt.Errorf("%d is greater than maximum value for Int2", n.Int64) } *dst = Int2{Int16: int16(n.Int64), Valid: true} return nil } // Int64Value implements the [Int64Valuer] interface. func (n Int2) Int64Value() (Int8, error) { return Int8{Int64: int64(n.Int16), Valid: n.Valid}, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Int2) Scan(src any) error { if src == nil { *dst = Int2{} return nil } var n int64 switch src := src.(type) { case int64: n = src case string: var err error n, err = strconv.ParseInt(src, 10, 16) if err != nil { return err } case []byte: var err error n, err = strconv.ParseInt(string(src), 10, 16) if err != nil { return err } default: return fmt.Errorf("cannot scan %T", src) } if n < math.MinInt16 { return fmt.Errorf("%d is greater than maximum value for Int2", n) } if n > math.MaxInt16 { return fmt.Errorf("%d is greater than maximum value for Int2", n) } *dst = Int2{Int16: int16(n), Valid: true} return nil } // Value implements the [database/sql/driver.Valuer] interface. func (src Int2) Value() (driver.Value, error) { if !src.Valid { return nil, nil } return int64(src.Int16), nil } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (src Int2) MarshalJSON() ([]byte, error) { if !src.Valid { return []byte("null"), nil } return []byte(strconv.FormatInt(int64(src.Int16), 10)), nil } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (dst *Int2) UnmarshalJSON(b []byte) error { var n *int16 err := json.Unmarshal(b, &n) if err != nil { return err } if n == nil { *dst = Int2{} } else { *dst = Int2{Int16: *n, Valid: true} } return nil } type Int2Codec struct{} func (Int2Codec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (Int2Codec) PreferredFormat() int16 { return BinaryFormatCode } func (Int2Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case BinaryFormatCode: switch value.(type) { case int16: return encodePlanInt2CodecBinaryInt16{} case Int64Valuer: return encodePlanInt2CodecBinaryInt64Valuer{} } case TextFormatCode: switch value.(type) { case int16: return encodePlanInt2CodecTextInt16{} case Int64Valuer: return encodePlanInt2CodecTextInt64Valuer{} } } return nil } type encodePlanInt2CodecBinaryInt16 struct{} func (encodePlanInt2CodecBinaryInt16) Encode(value any, buf []byte) (newBuf []byte, err error) { n := value.(int16) return pgio.AppendInt16(buf, int16(n)), nil } type encodePlanInt2CodecTextInt16 struct{} func (encodePlanInt2CodecTextInt16) Encode(value any, buf []byte) (newBuf []byte, err error) { n := value.(int16) return append(buf, strconv.FormatInt(int64(n), 10)...), nil } type encodePlanInt2CodecBinaryInt64Valuer struct{} func (encodePlanInt2CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } if n.Int64 > math.MaxInt16 { return nil, fmt.Errorf("%d is greater than maximum value for int2", n.Int64) } if n.Int64 < math.MinInt16 { return nil, fmt.Errorf("%d is less than minimum value for int2", n.Int64) } return pgio.AppendInt16(buf, int16(n.Int64)), nil } type encodePlanInt2CodecTextInt64Valuer struct{} func (encodePlanInt2CodecTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } if n.Int64 > math.MaxInt16 { return nil, fmt.Errorf("%d is greater than maximum value for int2", n.Int64) } if n.Int64 < math.MinInt16 { return nil, fmt.Errorf("%d is less than minimum value for int2", n.Int64) } return append(buf, strconv.FormatInt(n.Int64, 10)...), nil } func (Int2Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case *int8: return scanPlanBinaryInt2ToInt8{} case *int16: return scanPlanBinaryInt2ToInt16{} case *int32: return scanPlanBinaryInt2ToInt32{} case *int64: return scanPlanBinaryInt2ToInt64{} case *int: return scanPlanBinaryInt2ToInt{} case *uint8: return scanPlanBinaryInt2ToUint8{} case *uint16: return scanPlanBinaryInt2ToUint16{} case *uint32: return scanPlanBinaryInt2ToUint32{} case *uint64: return scanPlanBinaryInt2ToUint64{} case *uint: return scanPlanBinaryInt2ToUint{} case Int64Scanner: return scanPlanBinaryInt2ToInt64Scanner{} case TextScanner: return scanPlanBinaryInt2ToTextScanner{} } case TextFormatCode: switch target.(type) { case *int8: return scanPlanTextAnyToInt8{} case *int16: return scanPlanTextAnyToInt16{} case *int32: return scanPlanTextAnyToInt32{} case *int64: return scanPlanTextAnyToInt64{} case *int: return scanPlanTextAnyToInt{} case *uint8: return scanPlanTextAnyToUint8{} case *uint16: return scanPlanTextAnyToUint16{} case *uint32: return scanPlanTextAnyToUint32{} case *uint64: return scanPlanTextAnyToUint64{} case *uint: return scanPlanTextAnyToUint{} case Int64Scanner: return scanPlanTextAnyToInt64Scanner{} } } return nil } func (c Int2Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } var n int64 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return n, nil } func (c Int2Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var n int16 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return n, nil } type scanPlanBinaryInt2ToInt8 struct{} func (scanPlanBinaryInt2ToInt8) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 2 { return fmt.Errorf("invalid length for int2: %v", len(src)) } p, ok := (dst).(*int8) if !ok { return ErrScanTargetTypeChanged } n := int16(binary.BigEndian.Uint16(src)) if n < math.MinInt8 { return fmt.Errorf("%d is less than minimum value for int8", n) } else if n > math.MaxInt8 { return fmt.Errorf("%d is greater than maximum value for int8", n) } *p = int8(n) return nil } type scanPlanBinaryInt2ToUint8 struct{} func (scanPlanBinaryInt2ToUint8) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 2 { return fmt.Errorf("invalid length for uint2: %v", len(src)) } p, ok := (dst).(*uint8) if !ok { return ErrScanTargetTypeChanged } n := int16(binary.BigEndian.Uint16(src)) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint8", n) } if n > math.MaxUint8 { return fmt.Errorf("%d is greater than maximum value for uint8", n) } *p = uint8(n) return nil } type scanPlanBinaryInt2ToInt16 struct{} func (scanPlanBinaryInt2ToInt16) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 2 { return fmt.Errorf("invalid length for int2: %v", len(src)) } p, ok := (dst).(*int16) if !ok { return ErrScanTargetTypeChanged } *p = int16(binary.BigEndian.Uint16(src)) return nil } type scanPlanBinaryInt2ToUint16 struct{} func (scanPlanBinaryInt2ToUint16) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 2 { return fmt.Errorf("invalid length for uint2: %v", len(src)) } p, ok := (dst).(*uint16) if !ok { return ErrScanTargetTypeChanged } n := int16(binary.BigEndian.Uint16(src)) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint16", n) } *p = uint16(n) return nil } type scanPlanBinaryInt2ToInt32 struct{} func (scanPlanBinaryInt2ToInt32) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 2 { return fmt.Errorf("invalid length for int2: %v", len(src)) } p, ok := (dst).(*int32) if !ok { return ErrScanTargetTypeChanged } *p = int32(int16(binary.BigEndian.Uint16(src))) return nil } type scanPlanBinaryInt2ToUint32 struct{} func (scanPlanBinaryInt2ToUint32) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 2 { return fmt.Errorf("invalid length for uint2: %v", len(src)) } p, ok := (dst).(*uint32) if !ok { return ErrScanTargetTypeChanged } n := int16(binary.BigEndian.Uint16(src)) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint32", n) } *p = uint32(n) return nil } type scanPlanBinaryInt2ToInt64 struct{} func (scanPlanBinaryInt2ToInt64) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 2 { return fmt.Errorf("invalid length for int2: %v", len(src)) } p, ok := (dst).(*int64) if !ok { return ErrScanTargetTypeChanged } *p = int64(int16(binary.BigEndian.Uint16(src))) return nil } type scanPlanBinaryInt2ToUint64 struct{} func (scanPlanBinaryInt2ToUint64) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 2 { return fmt.Errorf("invalid length for uint2: %v", len(src)) } p, ok := (dst).(*uint64) if !ok { return ErrScanTargetTypeChanged } n := int16(binary.BigEndian.Uint16(src)) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint64", n) } *p = uint64(n) return nil } type scanPlanBinaryInt2ToInt struct{} func (scanPlanBinaryInt2ToInt) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 2 { return fmt.Errorf("invalid length for int2: %v", len(src)) } p, ok := (dst).(*int) if !ok { return ErrScanTargetTypeChanged } *p = int(int16(binary.BigEndian.Uint16(src))) return nil } type scanPlanBinaryInt2ToUint struct{} func (scanPlanBinaryInt2ToUint) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 2 { return fmt.Errorf("invalid length for uint2: %v", len(src)) } p, ok := (dst).(*uint) if !ok { return ErrScanTargetTypeChanged } n := int64(int16(binary.BigEndian.Uint16(src))) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint", n) } *p = uint(n) return nil } type scanPlanBinaryInt2ToInt64Scanner struct{} func (scanPlanBinaryInt2ToInt64Scanner) Scan(src []byte, dst any) error { s, ok := (dst).(Int64Scanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanInt64(Int8{}) } if len(src) != 2 { return fmt.Errorf("invalid length for int2: %v", len(src)) } n := int64(int16(binary.BigEndian.Uint16(src))) return s.ScanInt64(Int8{Int64: n, Valid: true}) } type scanPlanBinaryInt2ToTextScanner struct{} func (scanPlanBinaryInt2ToTextScanner) Scan(src []byte, dst any) error { s, ok := (dst).(TextScanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanText(Text{}) } if len(src) != 2 { return fmt.Errorf("invalid length for int2: %v", len(src)) } n := int64(int16(binary.BigEndian.Uint16(src))) return s.ScanText(Text{String: strconv.FormatInt(n, 10), Valid: true}) } type Int4 struct { Int32 int32 Valid bool } // ScanInt64 implements the [Int64Scanner] interface. func (dst *Int4) ScanInt64(n Int8) error { if !n.Valid { *dst = Int4{} return nil } if n.Int64 < math.MinInt32 { return fmt.Errorf("%d is less than minimum value for Int4", n.Int64) } if n.Int64 > math.MaxInt32 { return fmt.Errorf("%d is greater than maximum value for Int4", n.Int64) } *dst = Int4{Int32: int32(n.Int64), Valid: true} return nil } // Int64Value implements the [Int64Valuer] interface. func (n Int4) Int64Value() (Int8, error) { return Int8{Int64: int64(n.Int32), Valid: n.Valid}, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Int4) Scan(src any) error { if src == nil { *dst = Int4{} return nil } var n int64 switch src := src.(type) { case int64: n = src case string: var err error n, err = strconv.ParseInt(src, 10, 32) if err != nil { return err } case []byte: var err error n, err = strconv.ParseInt(string(src), 10, 32) if err != nil { return err } default: return fmt.Errorf("cannot scan %T", src) } if n < math.MinInt32 { return fmt.Errorf("%d is greater than maximum value for Int4", n) } if n > math.MaxInt32 { return fmt.Errorf("%d is greater than maximum value for Int4", n) } *dst = Int4{Int32: int32(n), Valid: true} return nil } // Value implements the [database/sql/driver.Valuer] interface. func (src Int4) Value() (driver.Value, error) { if !src.Valid { return nil, nil } return int64(src.Int32), nil } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (src Int4) MarshalJSON() ([]byte, error) { if !src.Valid { return []byte("null"), nil } return []byte(strconv.FormatInt(int64(src.Int32), 10)), nil } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (dst *Int4) UnmarshalJSON(b []byte) error { var n *int32 err := json.Unmarshal(b, &n) if err != nil { return err } if n == nil { *dst = Int4{} } else { *dst = Int4{Int32: *n, Valid: true} } return nil } type Int4Codec struct{} func (Int4Codec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (Int4Codec) PreferredFormat() int16 { return BinaryFormatCode } func (Int4Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case BinaryFormatCode: switch value.(type) { case int32: return encodePlanInt4CodecBinaryInt32{} case Int64Valuer: return encodePlanInt4CodecBinaryInt64Valuer{} } case TextFormatCode: switch value.(type) { case int32: return encodePlanInt4CodecTextInt32{} case Int64Valuer: return encodePlanInt4CodecTextInt64Valuer{} } } return nil } type encodePlanInt4CodecBinaryInt32 struct{} func (encodePlanInt4CodecBinaryInt32) Encode(value any, buf []byte) (newBuf []byte, err error) { n := value.(int32) return pgio.AppendInt32(buf, int32(n)), nil } type encodePlanInt4CodecTextInt32 struct{} func (encodePlanInt4CodecTextInt32) Encode(value any, buf []byte) (newBuf []byte, err error) { n := value.(int32) return append(buf, strconv.FormatInt(int64(n), 10)...), nil } type encodePlanInt4CodecBinaryInt64Valuer struct{} func (encodePlanInt4CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } if n.Int64 > math.MaxInt32 { return nil, fmt.Errorf("%d is greater than maximum value for int4", n.Int64) } if n.Int64 < math.MinInt32 { return nil, fmt.Errorf("%d is less than minimum value for int4", n.Int64) } return pgio.AppendInt32(buf, int32(n.Int64)), nil } type encodePlanInt4CodecTextInt64Valuer struct{} func (encodePlanInt4CodecTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } if n.Int64 > math.MaxInt32 { return nil, fmt.Errorf("%d is greater than maximum value for int4", n.Int64) } if n.Int64 < math.MinInt32 { return nil, fmt.Errorf("%d is less than minimum value for int4", n.Int64) } return append(buf, strconv.FormatInt(n.Int64, 10)...), nil } func (Int4Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case *int8: return scanPlanBinaryInt4ToInt8{} case *int16: return scanPlanBinaryInt4ToInt16{} case *int32: return scanPlanBinaryInt4ToInt32{} case *int64: return scanPlanBinaryInt4ToInt64{} case *int: return scanPlanBinaryInt4ToInt{} case *uint8: return scanPlanBinaryInt4ToUint8{} case *uint16: return scanPlanBinaryInt4ToUint16{} case *uint32: return scanPlanBinaryInt4ToUint32{} case *uint64: return scanPlanBinaryInt4ToUint64{} case *uint: return scanPlanBinaryInt4ToUint{} case Int64Scanner: return scanPlanBinaryInt4ToInt64Scanner{} case TextScanner: return scanPlanBinaryInt4ToTextScanner{} } case TextFormatCode: switch target.(type) { case *int8: return scanPlanTextAnyToInt8{} case *int16: return scanPlanTextAnyToInt16{} case *int32: return scanPlanTextAnyToInt32{} case *int64: return scanPlanTextAnyToInt64{} case *int: return scanPlanTextAnyToInt{} case *uint8: return scanPlanTextAnyToUint8{} case *uint16: return scanPlanTextAnyToUint16{} case *uint32: return scanPlanTextAnyToUint32{} case *uint64: return scanPlanTextAnyToUint64{} case *uint: return scanPlanTextAnyToUint{} case Int64Scanner: return scanPlanTextAnyToInt64Scanner{} } } return nil } func (c Int4Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } var n int64 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return n, nil } func (c Int4Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var n int32 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return n, nil } type scanPlanBinaryInt4ToInt8 struct{} func (scanPlanBinaryInt4ToInt8) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 4 { return fmt.Errorf("invalid length for int4: %v", len(src)) } p, ok := (dst).(*int8) if !ok { return ErrScanTargetTypeChanged } n := int32(binary.BigEndian.Uint32(src)) if n < math.MinInt8 { return fmt.Errorf("%d is less than minimum value for int8", n) } else if n > math.MaxInt8 { return fmt.Errorf("%d is greater than maximum value for int8", n) } *p = int8(n) return nil } type scanPlanBinaryInt4ToUint8 struct{} func (scanPlanBinaryInt4ToUint8) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 4 { return fmt.Errorf("invalid length for uint4: %v", len(src)) } p, ok := (dst).(*uint8) if !ok { return ErrScanTargetTypeChanged } n := int32(binary.BigEndian.Uint32(src)) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint8", n) } if n > math.MaxUint8 { return fmt.Errorf("%d is greater than maximum value for uint8", n) } *p = uint8(n) return nil } type scanPlanBinaryInt4ToInt16 struct{} func (scanPlanBinaryInt4ToInt16) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 4 { return fmt.Errorf("invalid length for int4: %v", len(src)) } p, ok := (dst).(*int16) if !ok { return ErrScanTargetTypeChanged } n := int32(binary.BigEndian.Uint32(src)) if n < math.MinInt16 { return fmt.Errorf("%d is less than minimum value for int16", n) } else if n > math.MaxInt16 { return fmt.Errorf("%d is greater than maximum value for int16", n) } *p = int16(n) return nil } type scanPlanBinaryInt4ToUint16 struct{} func (scanPlanBinaryInt4ToUint16) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 4 { return fmt.Errorf("invalid length for uint4: %v", len(src)) } p, ok := (dst).(*uint16) if !ok { return ErrScanTargetTypeChanged } n := int32(binary.BigEndian.Uint32(src)) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint16", n) } if n > math.MaxUint16 { return fmt.Errorf("%d is greater than maximum value for uint16", n) } *p = uint16(n) return nil } type scanPlanBinaryInt4ToInt32 struct{} func (scanPlanBinaryInt4ToInt32) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 4 { return fmt.Errorf("invalid length for int4: %v", len(src)) } p, ok := (dst).(*int32) if !ok { return ErrScanTargetTypeChanged } *p = int32(binary.BigEndian.Uint32(src)) return nil } type scanPlanBinaryInt4ToUint32 struct{} func (scanPlanBinaryInt4ToUint32) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 4 { return fmt.Errorf("invalid length for uint4: %v", len(src)) } p, ok := (dst).(*uint32) if !ok { return ErrScanTargetTypeChanged } n := int32(binary.BigEndian.Uint32(src)) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint32", n) } *p = uint32(n) return nil } type scanPlanBinaryInt4ToInt64 struct{} func (scanPlanBinaryInt4ToInt64) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 4 { return fmt.Errorf("invalid length for int4: %v", len(src)) } p, ok := (dst).(*int64) if !ok { return ErrScanTargetTypeChanged } *p = int64(int32(binary.BigEndian.Uint32(src))) return nil } type scanPlanBinaryInt4ToUint64 struct{} func (scanPlanBinaryInt4ToUint64) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 4 { return fmt.Errorf("invalid length for uint4: %v", len(src)) } p, ok := (dst).(*uint64) if !ok { return ErrScanTargetTypeChanged } n := int32(binary.BigEndian.Uint32(src)) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint64", n) } *p = uint64(n) return nil } type scanPlanBinaryInt4ToInt struct{} func (scanPlanBinaryInt4ToInt) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 4 { return fmt.Errorf("invalid length for int4: %v", len(src)) } p, ok := (dst).(*int) if !ok { return ErrScanTargetTypeChanged } *p = int(int32(binary.BigEndian.Uint32(src))) return nil } type scanPlanBinaryInt4ToUint struct{} func (scanPlanBinaryInt4ToUint) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 4 { return fmt.Errorf("invalid length for uint4: %v", len(src)) } p, ok := (dst).(*uint) if !ok { return ErrScanTargetTypeChanged } n := int64(int32(binary.BigEndian.Uint32(src))) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint", n) } *p = uint(n) return nil } type scanPlanBinaryInt4ToInt64Scanner struct{} func (scanPlanBinaryInt4ToInt64Scanner) Scan(src []byte, dst any) error { s, ok := (dst).(Int64Scanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanInt64(Int8{}) } if len(src) != 4 { return fmt.Errorf("invalid length for int4: %v", len(src)) } n := int64(int32(binary.BigEndian.Uint32(src))) return s.ScanInt64(Int8{Int64: n, Valid: true}) } type scanPlanBinaryInt4ToTextScanner struct{} func (scanPlanBinaryInt4ToTextScanner) Scan(src []byte, dst any) error { s, ok := (dst).(TextScanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanText(Text{}) } if len(src) != 4 { return fmt.Errorf("invalid length for int4: %v", len(src)) } n := int64(int32(binary.BigEndian.Uint32(src))) return s.ScanText(Text{String: strconv.FormatInt(n, 10), Valid: true}) } type Int8 struct { Int64 int64 Valid bool } // ScanInt64 implements the [Int64Scanner] interface. func (dst *Int8) ScanInt64(n Int8) error { if !n.Valid { *dst = Int8{} return nil } if n.Int64 < math.MinInt64 { return fmt.Errorf("%d is less than minimum value for Int8", n.Int64) } if n.Int64 > math.MaxInt64 { return fmt.Errorf("%d is greater than maximum value for Int8", n.Int64) } *dst = Int8{Int64: int64(n.Int64), Valid: true} return nil } // Int64Value implements the [Int64Valuer] interface. func (n Int8) Int64Value() (Int8, error) { return Int8{Int64: int64(n.Int64), Valid: n.Valid}, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Int8) Scan(src any) error { if src == nil { *dst = Int8{} return nil } var n int64 switch src := src.(type) { case int64: n = src case string: var err error n, err = strconv.ParseInt(src, 10, 64) if err != nil { return err } case []byte: var err error n, err = strconv.ParseInt(string(src), 10, 64) if err != nil { return err } default: return fmt.Errorf("cannot scan %T", src) } if n < math.MinInt64 { return fmt.Errorf("%d is greater than maximum value for Int8", n) } if n > math.MaxInt64 { return fmt.Errorf("%d is greater than maximum value for Int8", n) } *dst = Int8{Int64: int64(n), Valid: true} return nil } // Value implements the [database/sql/driver.Valuer] interface. func (src Int8) Value() (driver.Value, error) { if !src.Valid { return nil, nil } return int64(src.Int64), nil } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (src Int8) MarshalJSON() ([]byte, error) { if !src.Valid { return []byte("null"), nil } return []byte(strconv.FormatInt(int64(src.Int64), 10)), nil } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (dst *Int8) UnmarshalJSON(b []byte) error { var n *int64 err := json.Unmarshal(b, &n) if err != nil { return err } if n == nil { *dst = Int8{} } else { *dst = Int8{Int64: *n, Valid: true} } return nil } type Int8Codec struct{} func (Int8Codec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (Int8Codec) PreferredFormat() int16 { return BinaryFormatCode } func (Int8Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case BinaryFormatCode: switch value.(type) { case int64: return encodePlanInt8CodecBinaryInt64{} case Int64Valuer: return encodePlanInt8CodecBinaryInt64Valuer{} } case TextFormatCode: switch value.(type) { case int64: return encodePlanInt8CodecTextInt64{} case Int64Valuer: return encodePlanInt8CodecTextInt64Valuer{} } } return nil } type encodePlanInt8CodecBinaryInt64 struct{} func (encodePlanInt8CodecBinaryInt64) Encode(value any, buf []byte) (newBuf []byte, err error) { n := value.(int64) return pgio.AppendInt64(buf, int64(n)), nil } type encodePlanInt8CodecTextInt64 struct{} func (encodePlanInt8CodecTextInt64) Encode(value any, buf []byte) (newBuf []byte, err error) { n := value.(int64) return append(buf, strconv.FormatInt(int64(n), 10)...), nil } type encodePlanInt8CodecBinaryInt64Valuer struct{} func (encodePlanInt8CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } if n.Int64 > math.MaxInt64 { return nil, fmt.Errorf("%d is greater than maximum value for int8", n.Int64) } if n.Int64 < math.MinInt64 { return nil, fmt.Errorf("%d is less than minimum value for int8", n.Int64) } return pgio.AppendInt64(buf, int64(n.Int64)), nil } type encodePlanInt8CodecTextInt64Valuer struct{} func (encodePlanInt8CodecTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } if n.Int64 > math.MaxInt64 { return nil, fmt.Errorf("%d is greater than maximum value for int8", n.Int64) } if n.Int64 < math.MinInt64 { return nil, fmt.Errorf("%d is less than minimum value for int8", n.Int64) } return append(buf, strconv.FormatInt(n.Int64, 10)...), nil } func (Int8Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case *int8: return scanPlanBinaryInt8ToInt8{} case *int16: return scanPlanBinaryInt8ToInt16{} case *int32: return scanPlanBinaryInt8ToInt32{} case *int64: return scanPlanBinaryInt8ToInt64{} case *int: return scanPlanBinaryInt8ToInt{} case *uint8: return scanPlanBinaryInt8ToUint8{} case *uint16: return scanPlanBinaryInt8ToUint16{} case *uint32: return scanPlanBinaryInt8ToUint32{} case *uint64: return scanPlanBinaryInt8ToUint64{} case *uint: return scanPlanBinaryInt8ToUint{} case Int64Scanner: return scanPlanBinaryInt8ToInt64Scanner{} case TextScanner: return scanPlanBinaryInt8ToTextScanner{} } case TextFormatCode: switch target.(type) { case *int8: return scanPlanTextAnyToInt8{} case *int16: return scanPlanTextAnyToInt16{} case *int32: return scanPlanTextAnyToInt32{} case *int64: return scanPlanTextAnyToInt64{} case *int: return scanPlanTextAnyToInt{} case *uint8: return scanPlanTextAnyToUint8{} case *uint16: return scanPlanTextAnyToUint16{} case *uint32: return scanPlanTextAnyToUint32{} case *uint64: return scanPlanTextAnyToUint64{} case *uint: return scanPlanTextAnyToUint{} case Int64Scanner: return scanPlanTextAnyToInt64Scanner{} } } return nil } func (c Int8Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } var n int64 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return n, nil } func (c Int8Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var n int64 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return n, nil } type scanPlanBinaryInt8ToInt8 struct{} func (scanPlanBinaryInt8ToInt8) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 8 { return fmt.Errorf("invalid length for int8: %v", len(src)) } p, ok := (dst).(*int8) if !ok { return ErrScanTargetTypeChanged } n := int64(binary.BigEndian.Uint64(src)) if n < math.MinInt8 { return fmt.Errorf("%d is less than minimum value for int8", n) } else if n > math.MaxInt8 { return fmt.Errorf("%d is greater than maximum value for int8", n) } *p = int8(n) return nil } type scanPlanBinaryInt8ToUint8 struct{} func (scanPlanBinaryInt8ToUint8) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 8 { return fmt.Errorf("invalid length for uint8: %v", len(src)) } p, ok := (dst).(*uint8) if !ok { return ErrScanTargetTypeChanged } n := int64(binary.BigEndian.Uint64(src)) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint8", n) } if n > math.MaxUint8 { return fmt.Errorf("%d is greater than maximum value for uint8", n) } *p = uint8(n) return nil } type scanPlanBinaryInt8ToInt16 struct{} func (scanPlanBinaryInt8ToInt16) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 8 { return fmt.Errorf("invalid length for int8: %v", len(src)) } p, ok := (dst).(*int16) if !ok { return ErrScanTargetTypeChanged } n := int64(binary.BigEndian.Uint64(src)) if n < math.MinInt16 { return fmt.Errorf("%d is less than minimum value for int16", n) } else if n > math.MaxInt16 { return fmt.Errorf("%d is greater than maximum value for int16", n) } *p = int16(n) return nil } type scanPlanBinaryInt8ToUint16 struct{} func (scanPlanBinaryInt8ToUint16) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 8 { return fmt.Errorf("invalid length for uint8: %v", len(src)) } p, ok := (dst).(*uint16) if !ok { return ErrScanTargetTypeChanged } n := int64(binary.BigEndian.Uint64(src)) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint16", n) } if n > math.MaxUint16 { return fmt.Errorf("%d is greater than maximum value for uint16", n) } *p = uint16(n) return nil } type scanPlanBinaryInt8ToInt32 struct{} func (scanPlanBinaryInt8ToInt32) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 8 { return fmt.Errorf("invalid length for int8: %v", len(src)) } p, ok := (dst).(*int32) if !ok { return ErrScanTargetTypeChanged } n := int64(binary.BigEndian.Uint64(src)) if n < math.MinInt32 { return fmt.Errorf("%d is less than minimum value for int32", n) } else if n > math.MaxInt32 { return fmt.Errorf("%d is greater than maximum value for int32", n) } *p = int32(n) return nil } type scanPlanBinaryInt8ToUint32 struct{} func (scanPlanBinaryInt8ToUint32) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 8 { return fmt.Errorf("invalid length for uint8: %v", len(src)) } p, ok := (dst).(*uint32) if !ok { return ErrScanTargetTypeChanged } n := int64(binary.BigEndian.Uint64(src)) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint32", n) } if n > math.MaxUint32 { return fmt.Errorf("%d is greater than maximum value for uint32", n) } *p = uint32(n) return nil } type scanPlanBinaryInt8ToInt64 struct{} func (scanPlanBinaryInt8ToInt64) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 8 { return fmt.Errorf("invalid length for int8: %v", len(src)) } p, ok := (dst).(*int64) if !ok { return ErrScanTargetTypeChanged } *p = int64(binary.BigEndian.Uint64(src)) return nil } type scanPlanBinaryInt8ToUint64 struct{} func (scanPlanBinaryInt8ToUint64) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 8 { return fmt.Errorf("invalid length for uint8: %v", len(src)) } p, ok := (dst).(*uint64) if !ok { return ErrScanTargetTypeChanged } n := int64(binary.BigEndian.Uint64(src)) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint64", n) } *p = uint64(n) return nil } type scanPlanBinaryInt8ToInt struct{} func (scanPlanBinaryInt8ToInt) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 8 { return fmt.Errorf("invalid length for int8: %v", len(src)) } p, ok := (dst).(*int) if !ok { return ErrScanTargetTypeChanged } n := int64(binary.BigEndian.Uint64(src)) if n < math.MinInt { return fmt.Errorf("%d is less than minimum value for int", n) } else if n > math.MaxInt { return fmt.Errorf("%d is greater than maximum value for int", n) } *p = int(n) return nil } type scanPlanBinaryInt8ToUint struct{} func (scanPlanBinaryInt8ToUint) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 8 { return fmt.Errorf("invalid length for uint8: %v", len(src)) } p, ok := (dst).(*uint) if !ok { return ErrScanTargetTypeChanged } n := int64(int64(binary.BigEndian.Uint64(src))) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint", n) } if uint64(n) > math.MaxUint { return fmt.Errorf("%d is greater than maximum value for uint", n) } *p = uint(n) return nil } type scanPlanBinaryInt8ToInt64Scanner struct{} func (scanPlanBinaryInt8ToInt64Scanner) Scan(src []byte, dst any) error { s, ok := (dst).(Int64Scanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanInt64(Int8{}) } if len(src) != 8 { return fmt.Errorf("invalid length for int8: %v", len(src)) } n := int64(int64(binary.BigEndian.Uint64(src))) return s.ScanInt64(Int8{Int64: n, Valid: true}) } type scanPlanBinaryInt8ToTextScanner struct{} func (scanPlanBinaryInt8ToTextScanner) Scan(src []byte, dst any) error { s, ok := (dst).(TextScanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanText(Text{}) } if len(src) != 8 { return fmt.Errorf("invalid length for int8: %v", len(src)) } n := int64(int64(binary.BigEndian.Uint64(src))) return s.ScanText(Text{String: strconv.FormatInt(n, 10), Valid: true}) } type scanPlanTextAnyToInt8 struct{} func (scanPlanTextAnyToInt8) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p, ok := (dst).(*int8) if !ok { return ErrScanTargetTypeChanged } n, err := strconv.ParseInt(string(src), 10, 8) if err != nil { return err } *p = int8(n) return nil } type scanPlanTextAnyToUint8 struct{} func (scanPlanTextAnyToUint8) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p, ok := (dst).(*uint8) if !ok { return ErrScanTargetTypeChanged } n, err := strconv.ParseUint(string(src), 10, 8) if err != nil { return err } *p = uint8(n) return nil } type scanPlanTextAnyToInt16 struct{} func (scanPlanTextAnyToInt16) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p, ok := (dst).(*int16) if !ok { return ErrScanTargetTypeChanged } n, err := strconv.ParseInt(string(src), 10, 16) if err != nil { return err } *p = int16(n) return nil } type scanPlanTextAnyToUint16 struct{} func (scanPlanTextAnyToUint16) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p, ok := (dst).(*uint16) if !ok { return ErrScanTargetTypeChanged } n, err := strconv.ParseUint(string(src), 10, 16) if err != nil { return err } *p = uint16(n) return nil } type scanPlanTextAnyToInt32 struct{} func (scanPlanTextAnyToInt32) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p, ok := (dst).(*int32) if !ok { return ErrScanTargetTypeChanged } n, err := strconv.ParseInt(string(src), 10, 32) if err != nil { return err } *p = int32(n) return nil } type scanPlanTextAnyToUint32 struct{} func (scanPlanTextAnyToUint32) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p, ok := (dst).(*uint32) if !ok { return ErrScanTargetTypeChanged } n, err := strconv.ParseUint(string(src), 10, 32) if err != nil { return err } *p = uint32(n) return nil } type scanPlanTextAnyToInt64 struct{} func (scanPlanTextAnyToInt64) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p, ok := (dst).(*int64) if !ok { return ErrScanTargetTypeChanged } n, err := strconv.ParseInt(string(src), 10, 64) if err != nil { return err } *p = int64(n) return nil } type scanPlanTextAnyToUint64 struct{} func (scanPlanTextAnyToUint64) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p, ok := (dst).(*uint64) if !ok { return ErrScanTargetTypeChanged } n, err := strconv.ParseUint(string(src), 10, 64) if err != nil { return err } *p = uint64(n) return nil } type scanPlanTextAnyToInt struct{} func (scanPlanTextAnyToInt) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p, ok := (dst).(*int) if !ok { return ErrScanTargetTypeChanged } n, err := strconv.ParseInt(string(src), 10, 0) if err != nil { return err } *p = int(n) return nil } type scanPlanTextAnyToUint struct{} func (scanPlanTextAnyToUint) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p, ok := (dst).(*uint) if !ok { return ErrScanTargetTypeChanged } n, err := strconv.ParseUint(string(src), 10, 0) if err != nil { return err } *p = uint(n) return nil } type scanPlanTextAnyToInt64Scanner struct{} func (scanPlanTextAnyToInt64Scanner) Scan(src []byte, dst any) error { s, ok := (dst).(Int64Scanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanInt64(Int8{}) } n, err := strconv.ParseInt(string(src), 10, 64) if err != nil { return err } err = s.ScanInt64(Int8{Int64: n, Valid: true}) if err != nil { return err } return nil } pgx-5.8.0/pgtype/int.go.erb000066400000000000000000000343401512357711200155320ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "encoding/json" "fmt" "math" "strconv" "github.com/jackc/pgx/v5/internal/pgio" ) type Int64Scanner interface { ScanInt64(Int8) error } type Int64Valuer interface { Int64Value() (Int8, error) } <% [2, 4, 8].each do |pg_byte_size| %> <% pg_bit_size = pg_byte_size * 8 %> type Int<%= pg_byte_size %> struct { Int<%= pg_bit_size %> int<%= pg_bit_size %> Valid bool } // ScanInt64 implements the [Int64Scanner] interface. func (dst *Int<%= pg_byte_size %>) ScanInt64(n Int8) error { if !n.Valid { *dst = Int<%= pg_byte_size %>{} return nil } if n.Int64 < math.MinInt<%= pg_bit_size %> { return fmt.Errorf("%d is less than minimum value for Int<%= pg_byte_size %>", n.Int64) } if n.Int64 > math.MaxInt<%= pg_bit_size %> { return fmt.Errorf("%d is greater than maximum value for Int<%= pg_byte_size %>", n.Int64) } *dst = Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: int<%= pg_bit_size %>(n.Int64), Valid: true} return nil } // Int64Value implements the [Int64Valuer] interface. func (n Int<%= pg_byte_size %>) Int64Value() (Int8, error) { return Int8{Int64: int64(n.Int<%= pg_bit_size %>), Valid: n.Valid}, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Int<%= pg_byte_size %>) Scan(src any) error { if src == nil { *dst = Int<%= pg_byte_size %>{} return nil } var n int64 switch src := src.(type) { case int64: n = src case string: var err error n, err = strconv.ParseInt(src, 10, <%= pg_bit_size %>) if err != nil { return err } case []byte: var err error n, err = strconv.ParseInt(string(src), 10, <%= pg_bit_size %>) if err != nil { return err } default: return fmt.Errorf("cannot scan %T", src) } if n < math.MinInt<%= pg_bit_size %> { return fmt.Errorf("%d is greater than maximum value for Int<%= pg_byte_size %>", n) } if n > math.MaxInt<%= pg_bit_size %> { return fmt.Errorf("%d is greater than maximum value for Int<%= pg_byte_size %>", n) } *dst = Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: int<%= pg_bit_size %>(n), Valid: true} return nil } // Value implements the [database/sql/driver.Valuer] interface. func (src Int<%= pg_byte_size %>) Value() (driver.Value, error) { if !src.Valid { return nil, nil } return int64(src.Int<%= pg_bit_size %>), nil } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (src Int<%= pg_byte_size %>) MarshalJSON() ([]byte, error) { if !src.Valid { return []byte("null"), nil } return []byte(strconv.FormatInt(int64(src.Int<%= pg_bit_size %>), 10)), nil } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (dst *Int<%= pg_byte_size %>) UnmarshalJSON(b []byte) error { var n *int<%= pg_bit_size %> err := json.Unmarshal(b, &n) if err != nil { return err } if n == nil { *dst = Int<%= pg_byte_size %>{} } else { *dst = Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: *n, Valid: true} } return nil } type Int<%= pg_byte_size %>Codec struct{} func (Int<%= pg_byte_size %>Codec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (Int<%= pg_byte_size %>Codec) PreferredFormat() int16 { return BinaryFormatCode } func (Int<%= pg_byte_size %>Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case BinaryFormatCode: switch value.(type) { case int<%= pg_bit_size %>: return encodePlanInt<%= pg_byte_size %>CodecBinaryInt<%= pg_bit_size %>{} case Int64Valuer: return encodePlanInt<%= pg_byte_size %>CodecBinaryInt64Valuer{} } case TextFormatCode: switch value.(type) { case int<%= pg_bit_size %>: return encodePlanInt<%= pg_byte_size %>CodecTextInt<%= pg_bit_size %>{} case Int64Valuer: return encodePlanInt<%= pg_byte_size %>CodecTextInt64Valuer{} } } return nil } type encodePlanInt<%= pg_byte_size %>CodecBinaryInt<%= pg_bit_size %> struct{} func (encodePlanInt<%= pg_byte_size %>CodecBinaryInt<%= pg_bit_size %>) Encode(value any, buf []byte) (newBuf []byte, err error) { n := value.(int<%= pg_bit_size %>) return pgio.AppendInt<%= pg_bit_size %>(buf, int<%= pg_bit_size %>(n)), nil } type encodePlanInt<%= pg_byte_size %>CodecTextInt<%= pg_bit_size %> struct{} func (encodePlanInt<%= pg_byte_size %>CodecTextInt<%= pg_bit_size %>) Encode(value any, buf []byte) (newBuf []byte, err error) { n := value.(int<%= pg_bit_size %>) return append(buf, strconv.FormatInt(int64(n), 10)...), nil } type encodePlanInt<%= pg_byte_size %>CodecBinaryInt64Valuer struct{} func (encodePlanInt<%= pg_byte_size %>CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } if n.Int64 > math.MaxInt<%= pg_bit_size %> { return nil, fmt.Errorf("%d is greater than maximum value for int<%= pg_byte_size %>", n.Int64) } if n.Int64 < math.MinInt<%= pg_bit_size %> { return nil, fmt.Errorf("%d is less than minimum value for int<%= pg_byte_size %>", n.Int64) } return pgio.AppendInt<%= pg_bit_size %>(buf, int<%= pg_bit_size %>(n.Int64)), nil } type encodePlanInt<%= pg_byte_size %>CodecTextInt64Valuer struct{} func (encodePlanInt<%= pg_byte_size %>CodecTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } if n.Int64 > math.MaxInt<%= pg_bit_size %> { return nil, fmt.Errorf("%d is greater than maximum value for int<%= pg_byte_size %>", n.Int64) } if n.Int64 < math.MinInt<%= pg_bit_size %> { return nil, fmt.Errorf("%d is less than minimum value for int<%= pg_byte_size %>", n.Int64) } return append(buf, strconv.FormatInt(n.Int64, 10)...), nil } func (Int<%= pg_byte_size %>Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case *int8: return scanPlanBinaryInt<%= pg_byte_size %>ToInt8{} case *int16: return scanPlanBinaryInt<%= pg_byte_size %>ToInt16{} case *int32: return scanPlanBinaryInt<%= pg_byte_size %>ToInt32{} case *int64: return scanPlanBinaryInt<%= pg_byte_size %>ToInt64{} case *int: return scanPlanBinaryInt<%= pg_byte_size %>ToInt{} case *uint8: return scanPlanBinaryInt<%= pg_byte_size %>ToUint8{} case *uint16: return scanPlanBinaryInt<%= pg_byte_size %>ToUint16{} case *uint32: return scanPlanBinaryInt<%= pg_byte_size %>ToUint32{} case *uint64: return scanPlanBinaryInt<%= pg_byte_size %>ToUint64{} case *uint: return scanPlanBinaryInt<%= pg_byte_size %>ToUint{} case Int64Scanner: return scanPlanBinaryInt<%= pg_byte_size %>ToInt64Scanner{} case TextScanner: return scanPlanBinaryInt<%= pg_byte_size %>ToTextScanner{} } case TextFormatCode: switch target.(type) { case *int8: return scanPlanTextAnyToInt8{} case *int16: return scanPlanTextAnyToInt16{} case *int32: return scanPlanTextAnyToInt32{} case *int64: return scanPlanTextAnyToInt64{} case *int: return scanPlanTextAnyToInt{} case *uint8: return scanPlanTextAnyToUint8{} case *uint16: return scanPlanTextAnyToUint16{} case *uint32: return scanPlanTextAnyToUint32{} case *uint64: return scanPlanTextAnyToUint64{} case *uint: return scanPlanTextAnyToUint{} case Int64Scanner: return scanPlanTextAnyToInt64Scanner{} } } return nil } func (c Int<%= pg_byte_size %>Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } var n int64 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return n, nil } func (c Int<%= pg_byte_size %>Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var n int<%= pg_bit_size %> err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return n, nil } <%# PostgreSQL binary format integer to fixed size Go integers %> <% [8, 16, 32, 64].each do |dst_bit_size| %> type scanPlanBinaryInt<%= pg_byte_size %>ToInt<%= dst_bit_size %> struct{} func (scanPlanBinaryInt<%= pg_byte_size %>ToInt<%= dst_bit_size %>) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != <%= pg_byte_size %> { return fmt.Errorf("invalid length for int<%= pg_byte_size %>: %v", len(src)) } p, ok := (dst).(*int<%= dst_bit_size %>) if !ok { return ErrScanTargetTypeChanged } <% if dst_bit_size < pg_bit_size %> n := int<%= pg_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src)) if n < math.MinInt<%= dst_bit_size %> { return fmt.Errorf("%d is less than minimum value for int<%= dst_bit_size %>", n) } else if n > math.MaxInt<%= dst_bit_size %> { return fmt.Errorf("%d is greater than maximum value for int<%= dst_bit_size %>", n) } *p = int<%= dst_bit_size %>(n) <% elsif dst_bit_size == pg_bit_size %> *p = int<%= dst_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src)) <% else %> *p = int<%= dst_bit_size %>(int<%= pg_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src))) <% end %> return nil } type scanPlanBinaryInt<%= pg_byte_size %>ToUint<%= dst_bit_size %> struct{} func (scanPlanBinaryInt<%= pg_byte_size %>ToUint<%= dst_bit_size %>) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != <%= pg_byte_size %> { return fmt.Errorf("invalid length for uint<%= pg_byte_size %>: %v", len(src)) } p, ok := (dst).(*uint<%= dst_bit_size %>) if !ok { return ErrScanTargetTypeChanged } n := int<%= pg_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src)) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint<%= dst_bit_size %>", n) } <% if dst_bit_size < pg_bit_size %> if n > math.MaxUint<%= dst_bit_size %> { return fmt.Errorf("%d is greater than maximum value for uint<%= dst_bit_size %>", n) } <% end %> *p = uint<%= dst_bit_size %>(n) return nil } <% end %> <%# PostgreSQL binary format integer to Go machine integers %> type scanPlanBinaryInt<%= pg_byte_size %>ToInt struct{} func (scanPlanBinaryInt<%= pg_byte_size %>ToInt) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != <%= pg_byte_size %> { return fmt.Errorf("invalid length for int<%= pg_byte_size %>: %v", len(src)) } p, ok := (dst).(*int) if !ok { return ErrScanTargetTypeChanged } <% if 32 < pg_bit_size %> n := int64(binary.BigEndian.Uint<%= pg_bit_size %>(src)) if n < math.MinInt { return fmt.Errorf("%d is less than minimum value for int", n) } else if n > math.MaxInt { return fmt.Errorf("%d is greater than maximum value for int", n) } *p = int(n) <% else %> *p = int(int<%= pg_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src))) <% end %> return nil } type scanPlanBinaryInt<%= pg_byte_size %>ToUint struct{} func (scanPlanBinaryInt<%= pg_byte_size %>ToUint) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != <%= pg_byte_size %> { return fmt.Errorf("invalid length for uint<%= pg_byte_size %>: %v", len(src)) } p, ok := (dst).(*uint) if !ok { return ErrScanTargetTypeChanged } n := int64(int<%= pg_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src))) if n < 0 { return fmt.Errorf("%d is less than minimum value for uint", n) } <% if 32 < pg_bit_size %> if uint64(n) > math.MaxUint { return fmt.Errorf("%d is greater than maximum value for uint", n) } <% end %> *p = uint(n) return nil } <%# PostgreSQL binary format integer to Go Int64Scanner %> type scanPlanBinaryInt<%= pg_byte_size %>ToInt64Scanner struct{} func (scanPlanBinaryInt<%= pg_byte_size %>ToInt64Scanner) Scan(src []byte, dst any) error { s, ok := (dst).(Int64Scanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanInt64(Int8{}) } if len(src) != <%= pg_byte_size %> { return fmt.Errorf("invalid length for int<%= pg_byte_size %>: %v", len(src)) } n := int64(int<%= pg_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src))) return s.ScanInt64(Int8{Int64: n, Valid: true}) } <%# PostgreSQL binary format integer to Go TextScanner %> type scanPlanBinaryInt<%= pg_byte_size %>ToTextScanner struct{} func (scanPlanBinaryInt<%= pg_byte_size %>ToTextScanner) Scan(src []byte, dst any) error { s, ok := (dst).(TextScanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanText(Text{}) } if len(src) != <%= pg_byte_size %> { return fmt.Errorf("invalid length for int<%= pg_byte_size %>: %v", len(src)) } n := int64(int<%= pg_bit_size %>(binary.BigEndian.Uint<%= pg_bit_size %>(src))) return s.ScanText(Text{String: strconv.FormatInt(n, 10), Valid: true}) } <% end %> <%# Any text to all integer types %> <% [ ["8", 8], ["16", 16], ["32", 32], ["64", 64], ["", 0] ].each do |type_suffix, bit_size| %> type scanPlanTextAnyToInt<%= type_suffix %> struct{} func (scanPlanTextAnyToInt<%= type_suffix %>) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p, ok := (dst).(*int<%= type_suffix %>) if !ok { return ErrScanTargetTypeChanged } n, err := strconv.ParseInt(string(src), 10, <%= bit_size %>) if err != nil { return err } *p = int<%= type_suffix %>(n) return nil } type scanPlanTextAnyToUint<%= type_suffix %> struct{} func (scanPlanTextAnyToUint<%= type_suffix %>) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p, ok := (dst).(*uint<%= type_suffix %>) if !ok { return ErrScanTargetTypeChanged } n, err := strconv.ParseUint(string(src), 10, <%= bit_size %>) if err != nil { return err } *p = uint<%= type_suffix %>(n) return nil } <% end %> type scanPlanTextAnyToInt64Scanner struct{} func (scanPlanTextAnyToInt64Scanner) Scan(src []byte, dst any) error { s, ok := (dst).(Int64Scanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanInt64(Int8{}) } n, err := strconv.ParseInt(string(src), 10, 64) if err != nil { return err } err = s.ScanInt64(Int8{Int64: n, Valid: true}) if err != nil { return err } return nil } pgx-5.8.0/pgtype/int_test.go000066400000000000000000000216221512357711200160210ustar00rootroot00000000000000// Code generated from pgtype/int_test.go.erb. DO NOT EDIT. package pgtype_test import ( "context" "math" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func TestInt2Codec(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "int2", []pgxtest.ValueRoundTripTest{ {int8(1), new(int16), isExpectedEq(int16(1))}, {int16(1), new(int16), isExpectedEq(int16(1))}, {int32(1), new(int16), isExpectedEq(int16(1))}, {int64(1), new(int16), isExpectedEq(int16(1))}, {uint8(1), new(int16), isExpectedEq(int16(1))}, {uint16(1), new(int16), isExpectedEq(int16(1))}, {uint32(1), new(int16), isExpectedEq(int16(1))}, {uint64(1), new(int16), isExpectedEq(int16(1))}, {int(1), new(int16), isExpectedEq(int16(1))}, {uint(1), new(int16), isExpectedEq(int16(1))}, {pgtype.Int2{Int16: 1, Valid: true}, new(int16), isExpectedEq(int16(1))}, {int32(-1), new(pgtype.Int2), isExpectedEq(pgtype.Int2{Int16: -1, Valid: true})}, {1, new(int8), isExpectedEq(int8(1))}, {1, new(int16), isExpectedEq(int16(1))}, {1, new(int32), isExpectedEq(int32(1))}, {1, new(int64), isExpectedEq(int64(1))}, {1, new(uint8), isExpectedEq(uint8(1))}, {1, new(uint16), isExpectedEq(uint16(1))}, {1, new(uint32), isExpectedEq(uint32(1))}, {1, new(uint64), isExpectedEq(uint64(1))}, {1, new(int), isExpectedEq(int(1))}, {1, new(uint), isExpectedEq(uint(1))}, {-1, new(int8), isExpectedEq(int8(-1))}, {-1, new(int16), isExpectedEq(int16(-1))}, {-1, new(int32), isExpectedEq(int32(-1))}, {-1, new(int64), isExpectedEq(int64(-1))}, {-1, new(int), isExpectedEq(int(-1))}, {math.MinInt16, new(int16), isExpectedEq(int16(math.MinInt16))}, {-1, new(int16), isExpectedEq(int16(-1))}, {0, new(int16), isExpectedEq(int16(0))}, {1, new(int16), isExpectedEq(int16(1))}, {math.MaxInt16, new(int16), isExpectedEq(int16(math.MaxInt16))}, {1, new(pgtype.Int2), isExpectedEq(pgtype.Int2{Int16: 1, Valid: true})}, {"1", new(string), isExpectedEq("1")}, {pgtype.Int2{}, new(pgtype.Int2), isExpectedEq(pgtype.Int2{})}, {nil, new(*int16), isExpectedEq((*int16)(nil))}, }) } func TestInt2MarshalJSON(t *testing.T) { successfulTests := []struct { source pgtype.Int2 result string }{ {source: pgtype.Int2{Int16: 0}, result: "null"}, {source: pgtype.Int2{Int16: 1, Valid: true}, result: "1"}, } for i, tt := range successfulTests { r, err := tt.source.MarshalJSON() if err != nil { t.Errorf("%d: %v", i, err) } if string(r) != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, string(r)) } } } func TestInt2UnmarshalJSON(t *testing.T) { successfulTests := []struct { source string result pgtype.Int2 }{ {source: "null", result: pgtype.Int2{Int16: 0}}, {source: "1", result: pgtype.Int2{Int16: 1, Valid: true}}, } for i, tt := range successfulTests { var r pgtype.Int2 err := r.UnmarshalJSON([]byte(tt.source)) if err != nil { t.Errorf("%d: %v", i, err) } if r != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, r) } } } func TestInt4Codec(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "int4", []pgxtest.ValueRoundTripTest{ {int8(1), new(int32), isExpectedEq(int32(1))}, {int16(1), new(int32), isExpectedEq(int32(1))}, {int32(1), new(int32), isExpectedEq(int32(1))}, {int64(1), new(int32), isExpectedEq(int32(1))}, {uint8(1), new(int32), isExpectedEq(int32(1))}, {uint16(1), new(int32), isExpectedEq(int32(1))}, {uint32(1), new(int32), isExpectedEq(int32(1))}, {uint64(1), new(int32), isExpectedEq(int32(1))}, {int(1), new(int32), isExpectedEq(int32(1))}, {uint(1), new(int32), isExpectedEq(int32(1))}, {pgtype.Int4{Int32: 1, Valid: true}, new(int32), isExpectedEq(int32(1))}, {int32(-1), new(pgtype.Int4), isExpectedEq(pgtype.Int4{Int32: -1, Valid: true})}, {1, new(int8), isExpectedEq(int8(1))}, {1, new(int16), isExpectedEq(int16(1))}, {1, new(int32), isExpectedEq(int32(1))}, {1, new(int64), isExpectedEq(int64(1))}, {1, new(uint8), isExpectedEq(uint8(1))}, {1, new(uint16), isExpectedEq(uint16(1))}, {1, new(uint32), isExpectedEq(uint32(1))}, {1, new(uint64), isExpectedEq(uint64(1))}, {1, new(int), isExpectedEq(int(1))}, {1, new(uint), isExpectedEq(uint(1))}, {-1, new(int8), isExpectedEq(int8(-1))}, {-1, new(int16), isExpectedEq(int16(-1))}, {-1, new(int32), isExpectedEq(int32(-1))}, {-1, new(int64), isExpectedEq(int64(-1))}, {-1, new(int), isExpectedEq(int(-1))}, {math.MinInt32, new(int32), isExpectedEq(int32(math.MinInt32))}, {-1, new(int32), isExpectedEq(int32(-1))}, {0, new(int32), isExpectedEq(int32(0))}, {1, new(int32), isExpectedEq(int32(1))}, {math.MaxInt32, new(int32), isExpectedEq(int32(math.MaxInt32))}, {1, new(pgtype.Int4), isExpectedEq(pgtype.Int4{Int32: 1, Valid: true})}, {"1", new(string), isExpectedEq("1")}, {pgtype.Int4{}, new(pgtype.Int4), isExpectedEq(pgtype.Int4{})}, {nil, new(*int32), isExpectedEq((*int32)(nil))}, }) } func TestInt4MarshalJSON(t *testing.T) { successfulTests := []struct { source pgtype.Int4 result string }{ {source: pgtype.Int4{Int32: 0}, result: "null"}, {source: pgtype.Int4{Int32: 1, Valid: true}, result: "1"}, } for i, tt := range successfulTests { r, err := tt.source.MarshalJSON() if err != nil { t.Errorf("%d: %v", i, err) } if string(r) != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, string(r)) } } } func TestInt4UnmarshalJSON(t *testing.T) { successfulTests := []struct { source string result pgtype.Int4 }{ {source: "null", result: pgtype.Int4{Int32: 0}}, {source: "1", result: pgtype.Int4{Int32: 1, Valid: true}}, } for i, tt := range successfulTests { var r pgtype.Int4 err := r.UnmarshalJSON([]byte(tt.source)) if err != nil { t.Errorf("%d: %v", i, err) } if r != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, r) } } } func TestInt8Codec(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "int8", []pgxtest.ValueRoundTripTest{ {int8(1), new(int64), isExpectedEq(int64(1))}, {int16(1), new(int64), isExpectedEq(int64(1))}, {int32(1), new(int64), isExpectedEq(int64(1))}, {int64(1), new(int64), isExpectedEq(int64(1))}, {uint8(1), new(int64), isExpectedEq(int64(1))}, {uint16(1), new(int64), isExpectedEq(int64(1))}, {uint32(1), new(int64), isExpectedEq(int64(1))}, {uint64(1), new(int64), isExpectedEq(int64(1))}, {int(1), new(int64), isExpectedEq(int64(1))}, {uint(1), new(int64), isExpectedEq(int64(1))}, {pgtype.Int8{Int64: 1, Valid: true}, new(int64), isExpectedEq(int64(1))}, {int32(-1), new(pgtype.Int8), isExpectedEq(pgtype.Int8{Int64: -1, Valid: true})}, {1, new(int8), isExpectedEq(int8(1))}, {1, new(int16), isExpectedEq(int16(1))}, {1, new(int32), isExpectedEq(int32(1))}, {1, new(int64), isExpectedEq(int64(1))}, {1, new(uint8), isExpectedEq(uint8(1))}, {1, new(uint16), isExpectedEq(uint16(1))}, {1, new(uint32), isExpectedEq(uint32(1))}, {1, new(uint64), isExpectedEq(uint64(1))}, {1, new(int), isExpectedEq(int(1))}, {1, new(uint), isExpectedEq(uint(1))}, {-1, new(int8), isExpectedEq(int8(-1))}, {-1, new(int16), isExpectedEq(int16(-1))}, {-1, new(int32), isExpectedEq(int32(-1))}, {-1, new(int64), isExpectedEq(int64(-1))}, {-1, new(int), isExpectedEq(int(-1))}, {math.MinInt64, new(int64), isExpectedEq(int64(math.MinInt64))}, {-1, new(int64), isExpectedEq(int64(-1))}, {0, new(int64), isExpectedEq(int64(0))}, {1, new(int64), isExpectedEq(int64(1))}, {math.MaxInt64, new(int64), isExpectedEq(int64(math.MaxInt64))}, {1, new(pgtype.Int8), isExpectedEq(pgtype.Int8{Int64: 1, Valid: true})}, {"1", new(string), isExpectedEq("1")}, {pgtype.Int8{}, new(pgtype.Int8), isExpectedEq(pgtype.Int8{})}, {nil, new(*int64), isExpectedEq((*int64)(nil))}, }) } func TestInt8MarshalJSON(t *testing.T) { successfulTests := []struct { source pgtype.Int8 result string }{ {source: pgtype.Int8{Int64: 0}, result: "null"}, {source: pgtype.Int8{Int64: 1, Valid: true}, result: "1"}, } for i, tt := range successfulTests { r, err := tt.source.MarshalJSON() if err != nil { t.Errorf("%d: %v", i, err) } if string(r) != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, string(r)) } } } func TestInt8UnmarshalJSON(t *testing.T) { successfulTests := []struct { source string result pgtype.Int8 }{ {source: "null", result: pgtype.Int8{Int64: 0}}, {source: "1", result: pgtype.Int8{Int64: 1, Valid: true}}, } for i, tt := range successfulTests { var r pgtype.Int8 err := r.UnmarshalJSON([]byte(tt.source)) if err != nil { t.Errorf("%d: %v", i, err) } if r != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, r) } } } pgx-5.8.0/pgtype/int_test.go.erb000066400000000000000000000101551512357711200165670ustar00rootroot00000000000000package pgtype_test import ( "math" "testing" "github.com/jackc/pgx/v5/pgtype" ) <% [2, 4, 8].each do |pg_byte_size| %> <% pg_bit_size = pg_byte_size * 8 %> func TestInt<%= pg_byte_size %>Codec(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "int<%= pg_byte_size %>", []pgxtest.ValueRoundTripTest{ {int8(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))}, {int16(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))}, {int32(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))}, {int64(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))}, {uint8(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))}, {uint16(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))}, {uint32(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))}, {uint64(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))}, {int(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))}, {uint(1), new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))}, {pgtype.Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: 1, Valid: true}, new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))}, {int32(-1), new(pgtype.Int<%= pg_byte_size %>), isExpectedEq(pgtype.Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: -1, Valid: true})}, {1, new(int8), isExpectedEq(int8(1))}, {1, new(int16), isExpectedEq(int16(1))}, {1, new(int32), isExpectedEq(int32(1))}, {1, new(int64), isExpectedEq(int64(1))}, {1, new(uint8), isExpectedEq(uint8(1))}, {1, new(uint16), isExpectedEq(uint16(1))}, {1, new(uint32), isExpectedEq(uint32(1))}, {1, new(uint64), isExpectedEq(uint64(1))}, {1, new(int), isExpectedEq(int(1))}, {1, new(uint), isExpectedEq(uint(1))}, {-1, new(int8), isExpectedEq(int8(-1))}, {-1, new(int16), isExpectedEq(int16(-1))}, {-1, new(int32), isExpectedEq(int32(-1))}, {-1, new(int64), isExpectedEq(int64(-1))}, {-1, new(int), isExpectedEq(int(-1))}, {math.MinInt<%= pg_bit_size %>, new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(math.MinInt<%= pg_bit_size %>))}, {-1, new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(-1))}, {0, new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(0))}, {1, new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(1))}, {math.MaxInt<%= pg_bit_size %>, new(int<%= pg_bit_size %>), isExpectedEq(int<%= pg_bit_size %>(math.MaxInt<%= pg_bit_size %>))}, {1, new(pgtype.Int<%= pg_byte_size %>), isExpectedEq(pgtype.Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: 1, Valid: true})}, {"1", new(string), isExpectedEq("1")}, {pgtype.Int<%= pg_byte_size %>{}, new(pgtype.Int<%= pg_byte_size %>), isExpectedEq(pgtype.Int<%= pg_byte_size %>{})}, {nil, new(*int<%= pg_bit_size %>), isExpectedEq((*int<%= pg_bit_size %>)(nil))}, }) } func TestInt<%= pg_byte_size %>MarshalJSON(t *testing.T) { successfulTests := []struct { source pgtype.Int<%= pg_byte_size %> result string }{ {source: pgtype.Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: 0}, result: "null"}, {source: pgtype.Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: 1, Valid: true}, result: "1"}, } for i, tt := range successfulTests { r, err := tt.source.MarshalJSON() if err != nil { t.Errorf("%d: %v", i, err) } if string(r) != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, string(r)) } } } func TestInt<%= pg_byte_size %>UnmarshalJSON(t *testing.T) { successfulTests := []struct { source string result pgtype.Int<%= pg_byte_size %> }{ {source: "null", result: pgtype.Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: 0}}, {source: "1", result: pgtype.Int<%= pg_byte_size %>{Int<%= pg_bit_size %>: 1, Valid: true}}, } for i, tt := range successfulTests { var r pgtype.Int<%= pg_byte_size %> err := r.UnmarshalJSON([]byte(tt.source)) if err != nil { t.Errorf("%d: %v", i, err) } if r != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, r) } } } <% end %> pgx-5.8.0/pgtype/integration_benchmark_test.go000066400000000000000000001271551512357711200215740ustar00rootroot00000000000000// Code generated from pgtype/integration_benchmark_test.go.erb. DO NOT EDIT. package pgtype_test import ( "context" "testing" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" ) func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_int16_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int16 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_int16_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int16 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_int16_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int16 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_int16_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int16 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_int16_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int16 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_int16_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int16 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_int16_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int16 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_int16_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int16 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_int32_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_int32_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_int32_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_int32_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_int32_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_int32_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_int32_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_int32_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_int64_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_int64_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_int64_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_int64_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_int64_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_int64_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_int64_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_int64_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_uint64_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]uint64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_uint64_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]uint64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_uint64_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]uint64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_uint64_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]uint64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_uint64_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]uint64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_uint64_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]uint64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_uint64_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]uint64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_uint64_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]uint64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_pgtype_Int4_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]pgtype.Int4 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_pgtype_Int4_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]pgtype.Int4 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_pgtype_Int4_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]pgtype.Int4 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_pgtype_Int4_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]pgtype.Int4 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_pgtype_Int4_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]pgtype.Int4 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_pgtype_Int4_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]pgtype.Int4 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_int4_to_Go_pgtype_Int4_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]pgtype.Int4 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_int4_to_Go_pgtype_Int4_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]pgtype.Int4 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::int4 + 0, n::int4 + 1, n::int4 + 2, n::int4 + 3, n::int4 + 4, n::int4 + 5, n::int4 + 6, n::int4 + 7, n::int4 + 8, n::int4 + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_numeric_to_Go_int64_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_numeric_to_Go_int64_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_numeric_to_Go_int64_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0, n::numeric + 1, n::numeric + 2, n::numeric + 3, n::numeric + 4, n::numeric + 5, n::numeric + 6, n::numeric + 7, n::numeric + 8, n::numeric + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_numeric_to_Go_int64_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0, n::numeric + 1, n::numeric + 2, n::numeric + 3, n::numeric + 4, n::numeric + 5, n::numeric + 6, n::numeric + 7, n::numeric + 8, n::numeric + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_numeric_to_Go_int64_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_numeric_to_Go_int64_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_numeric_to_Go_int64_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0, n::numeric + 1, n::numeric + 2, n::numeric + 3, n::numeric + 4, n::numeric + 5, n::numeric + 6, n::numeric + 7, n::numeric + 8, n::numeric + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_numeric_to_Go_int64_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]int64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0, n::numeric + 1, n::numeric + 2, n::numeric + 3, n::numeric + 4, n::numeric + 5, n::numeric + 6, n::numeric + 7, n::numeric + 8, n::numeric + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_numeric_to_Go_float64_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]float64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_numeric_to_Go_float64_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]float64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_numeric_to_Go_float64_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]float64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0, n::numeric + 1, n::numeric + 2, n::numeric + 3, n::numeric + 4, n::numeric + 5, n::numeric + 6, n::numeric + 7, n::numeric + 8, n::numeric + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_numeric_to_Go_float64_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]float64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0, n::numeric + 1, n::numeric + 2, n::numeric + 3, n::numeric + 4, n::numeric + 5, n::numeric + 6, n::numeric + 7, n::numeric + 8, n::numeric + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_numeric_to_Go_float64_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]float64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_numeric_to_Go_float64_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]float64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_numeric_to_Go_float64_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]float64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0, n::numeric + 1, n::numeric + 2, n::numeric + 3, n::numeric + 4, n::numeric + 5, n::numeric + 6, n::numeric + 7, n::numeric + 8, n::numeric + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_numeric_to_Go_float64_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]float64 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0, n::numeric + 1, n::numeric + 2, n::numeric + 3, n::numeric + 4, n::numeric + 5, n::numeric + 6, n::numeric + 7, n::numeric + 8, n::numeric + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_numeric_to_Go_pgtype_Numeric_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]pgtype.Numeric for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_numeric_to_Go_pgtype_Numeric_1_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]pgtype.Numeric for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_numeric_to_Go_pgtype_Numeric_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]pgtype.Numeric for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0, n::numeric + 1, n::numeric + 2, n::numeric + 3, n::numeric + 4, n::numeric + 5, n::numeric + 6, n::numeric + 7, n::numeric + 8, n::numeric + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_numeric_to_Go_pgtype_Numeric_1_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]pgtype.Numeric for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0, n::numeric + 1, n::numeric + 2, n::numeric + 3, n::numeric + 4, n::numeric + 5, n::numeric + 6, n::numeric + 7, n::numeric + 8, n::numeric + 9 from generate_series(1, 1) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_numeric_to_Go_pgtype_Numeric_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]pgtype.Numeric for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_numeric_to_Go_pgtype_Numeric_10_rows_1_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [1]pgtype.Numeric for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0 from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_numeric_to_Go_pgtype_Numeric_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]pgtype.Numeric for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0, n::numeric + 1, n::numeric + 2, n::numeric + 3, n::numeric + 4, n::numeric + 5, n::numeric + 6, n::numeric + 7, n::numeric + 8, n::numeric + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_numeric_to_Go_pgtype_Numeric_100_rows_10_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [10]pgtype.Numeric for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select n::numeric + 0, n::numeric + 1, n::numeric + 2, n::numeric + 3, n::numeric + 4, n::numeric + 5, n::numeric + 6, n::numeric + 7, n::numeric + 8, n::numeric + 9 from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v[0], &v[1], &v[2], &v[3], &v[4], &v[5], &v[6], &v[7], &v[8], &v[9]}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_Int4Array_With_Go_Int4Array_10(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v []int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select array_agg(n) from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_Int4Array_With_Go_Int4Array_10(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v []int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select array_agg(n) from generate_series(1, 10) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_Int4Array_With_Go_Int4Array_100(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v []int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select array_agg(n) from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_Int4Array_With_Go_Int4Array_100(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v []int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select array_agg(n) from generate_series(1, 100) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryTextFormatDecode_PG_Int4Array_With_Go_Int4Array_1000(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v []int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select array_agg(n) from generate_series(1, 1000) n`, pgx.QueryResultFormats{pgx.TextFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } func BenchmarkQueryBinaryFormatDecode_PG_Int4Array_With_Go_Int4Array_1000(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v []int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select array_agg(n) from generate_series(1, 1000) n`, pgx.QueryResultFormats{pgx.BinaryFormatCode}, ) _, err := pgx.ForEachRow(rows, []any{&v}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } pgx-5.8.0/pgtype/integration_benchmark_test.go.erb000066400000000000000000000043321512357711200223320ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype/testutil" "github.com/jackc/pgx/v5" ) <% [ ["int4", ["int16", "int32", "int64", "uint64", "pgtype.Int4"], [[1, 1], [1, 10], [10, 1], [100, 10]]], ["numeric", ["int64", "float64", "pgtype.Numeric"], [[1, 1], [1, 10], [10, 1], [100, 10]]], ].each do |pg_type, go_types, rows_columns| %> <% go_types.each do |go_type| %> <% rows_columns.each do |rows, columns| %> <% [["Text", "pgx.TextFormatCode"], ["Binary", "pgx.BinaryFormatCode"]].each do |format_name, format_code| %> func BenchmarkQuery<%= format_name %>FormatDecode_PG_<%= pg_type %>_to_Go_<%= go_type.gsub(/\W/, "_") %>_<%= rows %>_rows_<%= columns %>_columns(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v [<%= columns %>]<%= go_type %> for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select <% columns.times do |col_idx| %><% if col_idx != 0 %>, <% end %>n::<%= pg_type %> + <%= col_idx%><% end %> from generate_series(1, <%= rows %>) n`, pgx.QueryResultFormats{<%= format_code %>}, ) _, err := pgx.ForEachRow(rows, []any{<% columns.times do |col_idx| %><% if col_idx != 0 %>, <% end %>&v[<%= col_idx%>]<% end %>}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } <% end %> <% end %> <% end %> <% end %> <% [10, 100, 1000].each do |array_size| %> <% [["Text", "pgx.TextFormatCode"], ["Binary", "pgx.BinaryFormatCode"]].each do |format_name, format_code| %> func BenchmarkQuery<%= format_name %>FormatDecode_PG_Int4Array_With_Go_Int4Array_<%= array_size %>(b *testing.B) { defaultConnTestRunner.RunTest(context.Background(), b, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { b.ResetTimer() var v []int32 for i := 0; i < b.N; i++ { rows, _ := conn.Query( ctx, `select array_agg(n) from generate_series(1, <%= array_size %>) n`, pgx.QueryResultFormats{<%= format_code %>}, ) _, err := pgx.ForEachRow(rows, []any{&v}, func() error { return nil }) if err != nil { b.Fatal(err) } } }) } <% end %> <% end %> pgx-5.8.0/pgtype/integration_benchmark_test_gen.sh000077500000000000000000000001611512357711200224200ustar00rootroot00000000000000erb integration_benchmark_test.go.erb > integration_benchmark_test.go goimports -w integration_benchmark_test.go pgx-5.8.0/pgtype/interval.go000066400000000000000000000160601512357711200160140ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "fmt" "strconv" "strings" "github.com/jackc/pgx/v5/internal/pgio" ) const ( microsecondsPerSecond = 1_000_000 microsecondsPerMinute = 60 * microsecondsPerSecond microsecondsPerHour = 60 * microsecondsPerMinute microsecondsPerDay = 24 * microsecondsPerHour microsecondsPerMonth = 30 * microsecondsPerDay ) type IntervalScanner interface { ScanInterval(v Interval) error } type IntervalValuer interface { IntervalValue() (Interval, error) } type Interval struct { Microseconds int64 Days int32 Months int32 Valid bool } // ScanInterval implements the [IntervalScanner] interface. func (interval *Interval) ScanInterval(v Interval) error { *interval = v return nil } // IntervalValue implements the [IntervalValuer] interface. func (interval Interval) IntervalValue() (Interval, error) { return interval, nil } // Scan implements the [database/sql.Scanner] interface. func (interval *Interval) Scan(src any) error { if src == nil { *interval = Interval{} return nil } switch src := src.(type) { case string: return scanPlanTextAnyToIntervalScanner{}.Scan([]byte(src), interval) } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (interval Interval) Value() (driver.Value, error) { if !interval.Valid { return nil, nil } buf, err := IntervalCodec{}.PlanEncode(nil, 0, TextFormatCode, interval).Encode(interval, nil) if err != nil { return nil, err } return string(buf), err } type IntervalCodec struct{} func (IntervalCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (IntervalCodec) PreferredFormat() int16 { return BinaryFormatCode } func (IntervalCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(IntervalValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanIntervalCodecBinary{} case TextFormatCode: return encodePlanIntervalCodecText{} } return nil } type encodePlanIntervalCodecBinary struct{} func (encodePlanIntervalCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { interval, err := value.(IntervalValuer).IntervalValue() if err != nil { return nil, err } if !interval.Valid { return nil, nil } buf = pgio.AppendInt64(buf, interval.Microseconds) buf = pgio.AppendInt32(buf, interval.Days) buf = pgio.AppendInt32(buf, interval.Months) return buf, nil } type encodePlanIntervalCodecText struct{} func (encodePlanIntervalCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { interval, err := value.(IntervalValuer).IntervalValue() if err != nil { return nil, err } if !interval.Valid { return nil, nil } if interval.Months != 0 { buf = append(buf, strconv.FormatInt(int64(interval.Months), 10)...) buf = append(buf, " mon "...) } if interval.Days != 0 { buf = append(buf, strconv.FormatInt(int64(interval.Days), 10)...) buf = append(buf, " day "...) } absMicroseconds := interval.Microseconds if absMicroseconds < 0 { absMicroseconds = -absMicroseconds buf = append(buf, '-') } hours := absMicroseconds / microsecondsPerHour minutes := (absMicroseconds % microsecondsPerHour) / microsecondsPerMinute seconds := (absMicroseconds % microsecondsPerMinute) / microsecondsPerSecond timeStr := fmt.Sprintf("%02d:%02d:%02d", hours, minutes, seconds) buf = append(buf, timeStr...) microseconds := absMicroseconds % microsecondsPerSecond if microseconds != 0 { buf = append(buf, fmt.Sprintf(".%06d", microseconds)...) } return buf, nil } func (IntervalCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case IntervalScanner: return scanPlanBinaryIntervalToIntervalScanner{} } case TextFormatCode: switch target.(type) { case IntervalScanner: return scanPlanTextAnyToIntervalScanner{} } } return nil } type scanPlanBinaryIntervalToIntervalScanner struct{} func (scanPlanBinaryIntervalToIntervalScanner) Scan(src []byte, dst any) error { scanner := (dst).(IntervalScanner) if src == nil { return scanner.ScanInterval(Interval{}) } if len(src) != 16 { return fmt.Errorf("Received an invalid size for an interval: %d", len(src)) } microseconds := int64(binary.BigEndian.Uint64(src)) days := int32(binary.BigEndian.Uint32(src[8:])) months := int32(binary.BigEndian.Uint32(src[12:])) return scanner.ScanInterval(Interval{Microseconds: microseconds, Days: days, Months: months, Valid: true}) } type scanPlanTextAnyToIntervalScanner struct{} func (scanPlanTextAnyToIntervalScanner) Scan(src []byte, dst any) error { scanner := (dst).(IntervalScanner) if src == nil { return scanner.ScanInterval(Interval{}) } var microseconds int64 var days int32 var months int32 parts := strings.Split(string(src), " ") for i := 0; i < len(parts)-1; i += 2 { scalar, err := strconv.ParseInt(parts[i], 10, 64) if err != nil { return fmt.Errorf("bad interval format") } switch parts[i+1] { case "year", "years": months += int32(scalar * 12) case "mon", "mons": months += int32(scalar) case "day", "days": days = int32(scalar) default: return fmt.Errorf("bad interval format: %q", parts[i+1]) } } if len(parts)%2 == 1 { timeParts := strings.SplitN(parts[len(parts)-1], ":", 3) if len(timeParts) != 3 { return fmt.Errorf("bad interval format") } var negative bool if timeParts[0][0] == '-' { negative = true timeParts[0] = timeParts[0][1:] } hours, err := strconv.ParseInt(timeParts[0], 10, 64) if err != nil { return fmt.Errorf("bad interval hour format: %s", timeParts[0]) } minutes, err := strconv.ParseInt(timeParts[1], 10, 64) if err != nil { return fmt.Errorf("bad interval minute format: %s", timeParts[1]) } sec, secFrac, secFracFound := strings.Cut(timeParts[2], ".") seconds, err := strconv.ParseInt(sec, 10, 64) if err != nil { return fmt.Errorf("bad interval second format: %s", sec) } var uSeconds int64 if secFracFound { uSeconds, err = strconv.ParseInt(secFrac, 10, 64) if err != nil { return fmt.Errorf("bad interval decimal format: %s", secFrac) } for i := 0; i < 6-len(secFrac); i++ { uSeconds *= 10 } } microseconds = hours * microsecondsPerHour microseconds += minutes * microsecondsPerMinute microseconds += seconds * microsecondsPerSecond microseconds += uSeconds if negative { microseconds = -microseconds } } return scanner.ScanInterval(Interval{Months: months, Days: days, Microseconds: microseconds, Valid: true}) } func (c IntervalCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return codecDecodeToTextFormat(c, m, oid, format, src) } func (c IntervalCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var interval Interval err := codecScan(c, m, oid, format, src, &interval) if err != nil { return nil, err } return interval, nil } pgx-5.8.0/pgtype/interval_test.go000066400000000000000000000114051512357711200170510ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "time" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/assert" ) func TestIntervalCodec(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "interval", []pgxtest.ValueRoundTripTest{ { pgtype.Interval{Microseconds: 1, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Microseconds: 1, Valid: true}), }, { pgtype.Interval{Microseconds: 1_000_000, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Microseconds: 1_000_000, Valid: true}), }, { pgtype.Interval{Microseconds: 1_000_001, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Microseconds: 1_000_001, Valid: true}), }, { pgtype.Interval{Microseconds: 123_202_800_000_000, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Microseconds: 123_202_800_000_000, Valid: true}), }, { pgtype.Interval{Days: 1, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Days: 1, Valid: true}), }, { pgtype.Interval{Months: 1, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Months: 1, Valid: true}), }, { pgtype.Interval{Months: 12, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Months: 12, Valid: true}), }, { pgtype.Interval{Months: 13, Days: 15, Microseconds: 1_000_001, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Months: 13, Days: 15, Microseconds: 1_000_001, Valid: true}), }, { pgtype.Interval{Microseconds: -1, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Microseconds: -1, Valid: true}), }, { pgtype.Interval{Microseconds: -1_000_000, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Microseconds: -1_000_000, Valid: true}), }, { pgtype.Interval{Microseconds: -1_000_001, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Microseconds: -1_000_001, Valid: true}), }, { pgtype.Interval{Microseconds: -123_202_800_000_000, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Microseconds: -123_202_800_000_000, Valid: true}), }, { pgtype.Interval{Days: -1, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Days: -1, Valid: true}), }, { pgtype.Interval{Months: -1, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Months: -1, Valid: true}), }, { pgtype.Interval{Months: -12, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Months: -12, Valid: true}), }, { pgtype.Interval{Months: -13, Days: -15, Microseconds: -1_000_001, Valid: true}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{Months: -13, Days: -15, Microseconds: -1_000_001, Valid: true}), }, { "1 second", new(pgtype.Interval), isExpectedEq(pgtype.Interval{Microseconds: 1_000_000, Valid: true}), }, { "1.000001 second", new(pgtype.Interval), isExpectedEq(pgtype.Interval{Microseconds: 1_000_001, Valid: true}), }, { "34223 hours", new(pgtype.Interval), isExpectedEq(pgtype.Interval{Microseconds: 123_202_800_000_000, Valid: true}), }, { "1 day", new(pgtype.Interval), isExpectedEq(pgtype.Interval{Days: 1, Valid: true}), }, { "1 month", new(pgtype.Interval), isExpectedEq(pgtype.Interval{Months: 1, Valid: true}), }, { "1 year", new(pgtype.Interval), isExpectedEq(pgtype.Interval{Months: 12, Valid: true}), }, { "-13 mon", new(pgtype.Interval), isExpectedEq(pgtype.Interval{Months: -13, Valid: true}), }, {time.Hour, new(time.Duration), isExpectedEq(time.Hour)}, { pgtype.Interval{Months: 1, Days: 1, Valid: true}, new(time.Duration), isExpectedEq(time.Duration(2_678_400_000_000_000)), }, {pgtype.Interval{}, new(pgtype.Interval), isExpectedEq(pgtype.Interval{})}, {nil, new(pgtype.Interval), isExpectedEq(pgtype.Interval{})}, }) } func TestIntervalTextEncode(t *testing.T) { m := pgtype.NewMap() successfulTests := []struct { source pgtype.Interval result string }{ {source: pgtype.Interval{Months: 2, Days: 1, Microseconds: 0, Valid: true}, result: "2 mon 1 day 00:00:00"}, {source: pgtype.Interval{Months: 0, Days: 0, Microseconds: 0, Valid: true}, result: "00:00:00"}, {source: pgtype.Interval{Months: 0, Days: 0, Microseconds: 6 * 60 * 1_000_000, Valid: true}, result: "00:06:00"}, {source: pgtype.Interval{Months: 0, Days: 1, Microseconds: 6*60*1_000_000 + 30, Valid: true}, result: "1 day 00:06:00.000030"}, } for i, tt := range successfulTests { buf, err := m.Encode(pgtype.DateOID, pgtype.TextFormatCode, tt.source, nil) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.result, string(buf), "%d", i) } } pgx-5.8.0/pgtype/json.go000066400000000000000000000143111512357711200151360ustar00rootroot00000000000000package pgtype import ( "database/sql" "database/sql/driver" "encoding/json" "fmt" "reflect" ) type JSONCodec struct { Marshal func(v any) ([]byte, error) Unmarshal func(data []byte, v any) error } func (*JSONCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (*JSONCodec) PreferredFormat() int16 { return TextFormatCode } func (c *JSONCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch value.(type) { case string: return encodePlanJSONCodecEitherFormatString{} case []byte: return encodePlanJSONCodecEitherFormatByteSlice{} // Handle json.RawMessage specifically because if it is run through json.Marshal it may be mutated. // e.g. `{"foo": "bar"}` -> `{"foo":"bar"}`. case json.RawMessage: return encodePlanJSONCodecEitherFormatJSONRawMessage{} // Cannot rely on driver.Valuer being handled later because anything can be marshalled. // // https://github.com/jackc/pgx/issues/1430 // // Check for driver.Valuer must come before json.Marshaler so that it is guaranteed to be used // when both are implemented https://github.com/jackc/pgx/issues/1805 case driver.Valuer: return &encodePlanDriverValuer{m: m, oid: oid, formatCode: format} // Must come before trying wrap encode plans because a pointer to a struct may be unwrapped to a struct that can be // marshalled. // // https://github.com/jackc/pgx/issues/1681 case json.Marshaler: return &encodePlanJSONCodecEitherFormatMarshal{ marshal: c.Marshal, } } // Because anything can be marshalled the normal wrapping in Map.PlanScan doesn't get a chance to run. So try the // appropriate wrappers here. for _, f := range []TryWrapEncodePlanFunc{ TryWrapDerefPointerEncodePlan, TryWrapFindUnderlyingTypeEncodePlan, } { if wrapperPlan, nextValue, ok := f(value); ok { if nextPlan := c.PlanEncode(m, oid, format, nextValue); nextPlan != nil { wrapperPlan.SetNext(nextPlan) return wrapperPlan } } } return &encodePlanJSONCodecEitherFormatMarshal{ marshal: c.Marshal, } } // JSON needs its on scan plan for pointers to handle 'null'::json(b). // Consider making pointerPointerScanPlan more flexible in the future. type jsonPointerScanPlan struct { next ScanPlan } func (p jsonPointerScanPlan) Scan(src []byte, dst any) error { el := reflect.ValueOf(dst).Elem() if src == nil || string(src) == "null" { el.SetZero() return nil } el.Set(reflect.New(el.Type().Elem())) if p.next != nil { return p.next.Scan(src, el.Interface()) } return nil } type encodePlanJSONCodecEitherFormatString struct{} func (encodePlanJSONCodecEitherFormatString) Encode(value any, buf []byte) (newBuf []byte, err error) { jsonString := value.(string) buf = append(buf, jsonString...) return buf, nil } type encodePlanJSONCodecEitherFormatByteSlice struct{} func (encodePlanJSONCodecEitherFormatByteSlice) Encode(value any, buf []byte) (newBuf []byte, err error) { jsonBytes := value.([]byte) if jsonBytes == nil { return nil, nil } buf = append(buf, jsonBytes...) return buf, nil } type encodePlanJSONCodecEitherFormatJSONRawMessage struct{} func (encodePlanJSONCodecEitherFormatJSONRawMessage) Encode(value any, buf []byte) (newBuf []byte, err error) { jsonBytes := value.(json.RawMessage) if jsonBytes == nil { return nil, nil } buf = append(buf, jsonBytes...) return buf, nil } type encodePlanJSONCodecEitherFormatMarshal struct { marshal func(v any) ([]byte, error) } func (e *encodePlanJSONCodecEitherFormatMarshal) Encode(value any, buf []byte) (newBuf []byte, err error) { jsonBytes, err := e.marshal(value) if err != nil { return nil, err } buf = append(buf, jsonBytes...) return buf, nil } func (c *JSONCodec) PlanScan(m *Map, oid uint32, formatCode int16, target any) ScanPlan { return c.planScan(m, oid, formatCode, target, 0) } // JSON cannot fallback to pointerPointerScanPlan because of 'null'::json(b), // so we need to duplicate the logic here. func (c *JSONCodec) planScan(m *Map, oid uint32, formatCode int16, target any, depth int) ScanPlan { if depth > 8 { return &scanPlanFail{m: m, oid: oid, formatCode: formatCode} } switch target.(type) { case *string: return &scanPlanAnyToString{} case *[]byte: return &scanPlanJSONToByteSlice{} case BytesScanner: return &scanPlanBinaryBytesToBytesScanner{} case sql.Scanner: return &scanPlanCodecSQLScanner{c: c, m: m, oid: oid, formatCode: formatCode} } rv := reflect.ValueOf(target) if rv.Kind() == reflect.Pointer && rv.Elem().Kind() == reflect.Pointer { var plan jsonPointerScanPlan plan.next = c.planScan(m, oid, formatCode, rv.Elem().Interface(), depth+1) return plan } else { return &scanPlanJSONToJSONUnmarshal{unmarshal: c.Unmarshal} } } type scanPlanAnyToString struct{} func (scanPlanAnyToString) Scan(src []byte, dst any) error { p := dst.(*string) *p = string(src) return nil } type scanPlanJSONToByteSlice struct{} func (scanPlanJSONToByteSlice) Scan(src []byte, dst any) error { dstBuf := dst.(*[]byte) if src == nil { *dstBuf = nil return nil } *dstBuf = make([]byte, len(src)) copy(*dstBuf, src) return nil } type scanPlanJSONToJSONUnmarshal struct { unmarshal func(data []byte, v any) error } func (s *scanPlanJSONToJSONUnmarshal) Scan(src []byte, dst any) error { if src == nil { dstValue := reflect.ValueOf(dst) if dstValue.Kind() == reflect.Ptr { el := dstValue.Elem() switch el.Kind() { case reflect.Ptr, reflect.Slice, reflect.Map, reflect.Interface: el.Set(reflect.Zero(el.Type())) return nil } } return fmt.Errorf("cannot scan NULL into %T", dst) } v := reflect.ValueOf(dst) if v.Kind() != reflect.Pointer || v.IsNil() { return fmt.Errorf("cannot scan into non-pointer or nil destinations %T", dst) } elem := v.Elem() elem.Set(reflect.Zero(elem.Type())) return s.unmarshal(src, dst) } func (c *JSONCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } dstBuf := make([]byte, len(src)) copy(dstBuf, src) return dstBuf, nil } func (c *JSONCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var dst any err := c.Unmarshal(src, &dst) return dst, err } pgx-5.8.0/pgtype/json_test.go000066400000000000000000000273261512357711200162070ustar00rootroot00000000000000package pgtype_test import ( "context" "database/sql" "database/sql/driver" "encoding/json" "errors" "fmt" "reflect" "testing" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/require" ) func isExpectedEqMap(a any) func(any) bool { return func(v any) bool { aa := a.(map[string]any) bb := v.(map[string]any) if (aa == nil) != (bb == nil) { return false } if aa == nil { return true } if len(aa) != len(bb) { return false } for k := range aa { if aa[k] != bb[k] { return false } } return true } } func TestJSONCodec(t *testing.T) { type jsonStruct struct { Name string `json:"name"` Age int `json:"age"` } var str string pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "json", []pgxtest.ValueRoundTripTest{ {nil, new(*jsonStruct), isExpectedEq((*jsonStruct)(nil))}, {map[string]any(nil), new(*string), isExpectedEq((*string)(nil))}, {map[string]any(nil), new([]byte), isExpectedEqBytes([]byte(nil))}, {[]byte(nil), new([]byte), isExpectedEqBytes([]byte(nil))}, {nil, new([]byte), isExpectedEqBytes([]byte(nil))}, // Test sql.Scanner. (https://github.com/jackc/pgx/issues/1418) {"42", new(sql.NullInt64), isExpectedEq(sql.NullInt64{Int64: 42, Valid: true})}, // Test driver.Valuer. (https://github.com/jackc/pgx/issues/1430) {sql.NullInt64{Int64: 42, Valid: true}, new(sql.NullInt64), isExpectedEq(sql.NullInt64{Int64: 42, Valid: true})}, // Test driver.Valuer is used before json.Marshaler (https://github.com/jackc/pgx/issues/1805) {Issue1805(7), new(Issue1805), isExpectedEq(Issue1805(7))}, // Test driver.Scanner is used before json.Unmarshaler (https://github.com/jackc/pgx/issues/2146) {Issue2146(7), new(*Issue2146), isPtrExpectedEq(Issue2146(7))}, // Test driver.Scanner without pointer receiver (https://github.com/jackc/pgx/issues/2204) {NonPointerJSONScanner{V: stringPtr("{}")}, NonPointerJSONScanner{V: &str}, func(a any) bool { return str == "{}" }}, }) pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, pgxtest.KnownOIDQueryExecModes, "json", []pgxtest.ValueRoundTripTest{ {[]byte("{}"), new([]byte), isExpectedEqBytes([]byte("{}"))}, {[]byte("null"), new([]byte), isExpectedEqBytes([]byte("null"))}, {[]byte("42"), new([]byte), isExpectedEqBytes([]byte("42"))}, {[]byte(`"hello"`), new([]byte), isExpectedEqBytes([]byte(`"hello"`))}, {[]byte(`"hello"`), new(string), isExpectedEq(`"hello"`)}, {map[string]any{"foo": "bar"}, new(map[string]any), isExpectedEqMap(map[string]any{"foo": "bar"})}, {jsonStruct{Name: "Adam", Age: 10}, new(jsonStruct), isExpectedEq(jsonStruct{Name: "Adam", Age: 10})}, }) } type Issue1805 int func (i *Issue1805) Scan(src any) error { var source []byte switch src.(type) { case string: source = []byte(src.(string)) case []byte: source = src.([]byte) default: return errors.New("unknown source type") } var newI int if err := json.Unmarshal(source, &newI); err != nil { return err } *i = Issue1805(newI) return nil } func (i Issue1805) Value() (driver.Value, error) { b, err := json.Marshal(int(i)) return string(b), err } func (i Issue1805) UnmarshalJSON(bytes []byte) error { return errors.New("UnmarshalJSON called") } func (i Issue1805) MarshalJSON() ([]byte, error) { return nil, errors.New("MarshalJSON called") } type Issue2146 int func (i *Issue2146) Scan(src any) error { var source []byte switch src.(type) { case string: source = []byte(src.(string)) case []byte: source = src.([]byte) default: return errors.New("unknown source type") } var newI int if err := json.Unmarshal(source, &newI); err != nil { return err } *i = Issue2146(newI + 1) return nil } func (i Issue2146) Value() (driver.Value, error) { b, err := json.Marshal(int(i - 1)) return string(b), err } type NonPointerJSONScanner struct { V *string } func (i NonPointerJSONScanner) Scan(src any) error { switch c := src.(type) { case string: *i.V = c case []byte: *i.V = string(c) default: return errors.New("unknown source type") } return nil } func (i NonPointerJSONScanner) Value() (driver.Value, error) { return i.V, nil } // https://github.com/jackc/pgx/issues/1273#issuecomment-1221414648 func TestJSONCodecUnmarshalSQLNull(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { // Slices are nilified slice := []string{"foo", "bar", "baz"} err := conn.QueryRow(ctx, "select null::json").Scan(&slice) require.NoError(t, err) require.Nil(t, slice) // Maps are nilified m := map[string]any{"foo": "bar"} err = conn.QueryRow(ctx, "select null::json").Scan(&m) require.NoError(t, err) require.Nil(t, m) m = map[string]any{"foo": "bar"} err = conn.QueryRow(ctx, "select null::json").Scan(&m) require.NoError(t, err) require.Nil(t, m) // Pointer to pointer are nilified n := 42 p := &n err = conn.QueryRow(ctx, "select null::json").Scan(&p) require.NoError(t, err) require.Nil(t, p) // A string cannot scan a NULL. str := "foobar" err = conn.QueryRow(ctx, "select null::json").Scan(&str) fieldName := "json" if conn.PgConn().ParameterStatus("crdb_version") != "" { fieldName = "jsonb" // Seems like CockroachDB treats json as jsonb. } require.EqualError(t, err, fmt.Sprintf("can't scan into dest[0] (col: %s): cannot scan NULL into *string", fieldName)) // A non-string cannot scan a NULL. err = conn.QueryRow(ctx, "select null::json").Scan(&n) require.EqualError(t, err, fmt.Sprintf("can't scan into dest[0] (col: %s): cannot scan NULL into *int", fieldName)) }) } // https://github.com/jackc/pgx/issues/1470 func TestJSONCodecPointerToPointerToString(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var s *string err := conn.QueryRow(ctx, "select '{}'::json").Scan(&s) require.NoError(t, err) require.NotNil(t, s) require.Equal(t, "{}", *s) err = conn.QueryRow(ctx, "select null::json").Scan(&s) require.NoError(t, err) require.Nil(t, s) }) } // https://github.com/jackc/pgx/issues/1691 func TestJSONCodecPointerToPointerToInt(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { n := 44 p := &n err := conn.QueryRow(ctx, "select 'null'::jsonb").Scan(&p) require.NoError(t, err) require.Nil(t, p) }) } // https://github.com/jackc/pgx/issues/1691 func TestJSONCodecPointerToPointerToStruct(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { type ImageSize struct { Height int `json:"height"` Width int `json:"width"` Str string `json:"str"` } is := &ImageSize{Height: 100, Width: 100, Str: "str"} err := conn.QueryRow(ctx, `select 'null'::jsonb`).Scan(&is) require.NoError(t, err) require.Nil(t, is) }) } func TestJSONCodecClearExistingValueBeforeUnmarshal(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { m := map[string]any{} err := conn.QueryRow(ctx, `select '{"foo": "bar"}'::json`).Scan(&m) require.NoError(t, err) require.Equal(t, map[string]any{"foo": "bar"}, m) err = conn.QueryRow(ctx, `select '{"baz": "quz"}'::json`).Scan(&m) require.NoError(t, err) require.Equal(t, map[string]any{"baz": "quz"}, m) }) } type ParentIssue1681 struct { Child ChildIssue1681 } func (t *ParentIssue1681) MarshalJSON() ([]byte, error) { return []byte(`{"custom":"thing"}`), nil } type ChildIssue1681 struct{} func (t ChildIssue1681) MarshalJSON() ([]byte, error) { return []byte(`{"someVal": false}`), nil } // https://github.com/jackc/pgx/issues/1681 func TestJSONCodecEncodeJSONMarshalerThatCanBeWrapped(t *testing.T) { skipCockroachDB(t, "CockroachDB treats json as jsonb. This causes it to format differently than PostgreSQL.") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var jsonStr string err := conn.QueryRow(context.Background(), "select $1::json", &ParentIssue1681{}).Scan(&jsonStr) require.NoError(t, err) require.Equal(t, `{"custom":"thing"}`, jsonStr) }) } func TestJSONCodecCustomMarshal(t *testing.T) { skipCockroachDB(t, "CockroachDB treats json as jsonb. This causes it to format differently than PostgreSQL.") connTestRunner := defaultConnTestRunner connTestRunner.AfterConnect = func(ctx context.Context, t testing.TB, conn *pgx.Conn) { conn.TypeMap().RegisterType(&pgtype.Type{ Name: "json", OID: pgtype.JSONOID, Codec: &pgtype.JSONCodec{ Marshal: func(v any) ([]byte, error) { return []byte(`{"custom":"value"}`), nil }, Unmarshal: func(data []byte, v any) error { return json.Unmarshal([]byte(`{"custom":"value"}`), v) }, }, }) } pgxtest.RunValueRoundTripTests(context.Background(), t, connTestRunner, pgxtest.KnownOIDQueryExecModes, "json", []pgxtest.ValueRoundTripTest{ // There is no space between "custom" and "value" in json type. {map[string]any{"something": "else"}, new(string), isExpectedEq(`{"custom":"value"}`)}, {[]byte(`{"something":"else"}`), new(map[string]any), func(v any) bool { return reflect.DeepEqual(v, map[string]any{"custom": "value"}) }}, }) } func TestJSONCodecScanToNonPointerValues(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { n := 44 err := conn.QueryRow(ctx, "select '42'::jsonb").Scan(n) require.Error(t, err) var i *int err = conn.QueryRow(ctx, "select '42'::jsonb").Scan(i) require.Error(t, err) m := 0 err = conn.QueryRow(ctx, "select '42'::jsonb").Scan(&m) require.NoError(t, err) require.Equal(t, 42, m) }) } func TestJSONCodecScanNull(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var dest struct{} err := conn.QueryRow(ctx, "select null::jsonb").Scan(&dest) require.Error(t, err) require.Contains(t, err.Error(), "cannot scan NULL into *struct {}") err = conn.QueryRow(ctx, "select 'null'::jsonb").Scan(&dest) require.NoError(t, err) var destPointer *struct{} err = conn.QueryRow(ctx, "select null::jsonb").Scan(&destPointer) require.NoError(t, err) require.Nil(t, destPointer) err = conn.QueryRow(ctx, "select 'null'::jsonb").Scan(&destPointer) require.NoError(t, err) require.Nil(t, destPointer) var raw json.RawMessage require.NoError(t, conn.QueryRow(ctx, "select 'null'::jsonb").Scan(&raw)) require.Equal(t, json.RawMessage("null"), raw) }) } func TestJSONCodecScanNullToPointerToSQLScanner(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var dest *Issue2146 err := conn.QueryRow(ctx, "select null::jsonb").Scan(&dest) require.NoError(t, err) require.Nil(t, dest) }) } type SQLScannerFunc func(src any) error func (f SQLScannerFunc) Scan(src any) error { return f(src) } // https://github.com/jackc/pgx/issues/2403#issuecomment-3480454865 // // Previously, when scanning a json/jsonb value into a sql.Scanner via database/sql the source value was a []byte. // However, when scanning into a sql.Scanner via pgx the source value was a string. This test ensures that the source // value is a []byte. func TestJSONCodecSQLScannerReceivesByteSlice(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { f := SQLScannerFunc(func(src any) error { require.IsType(t, []byte{}, src) return nil }) err := conn.QueryRow(ctx, "select '{}'::json").Scan(&f) require.NoError(t, err) }) } pgx-5.8.0/pgtype/jsonb.go000066400000000000000000000057621512357711200153120ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "fmt" ) type JSONBCodec struct { Marshal func(v any) ([]byte, error) Unmarshal func(data []byte, v any) error } func (*JSONBCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (*JSONBCodec) PreferredFormat() int16 { return TextFormatCode } func (c *JSONBCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case BinaryFormatCode: plan := (&JSONCodec{Marshal: c.Marshal, Unmarshal: c.Unmarshal}).PlanEncode(m, oid, TextFormatCode, value) if plan != nil { return &encodePlanJSONBCodecBinaryWrapper{textPlan: plan} } case TextFormatCode: return (&JSONCodec{Marshal: c.Marshal, Unmarshal: c.Unmarshal}).PlanEncode(m, oid, format, value) } return nil } type encodePlanJSONBCodecBinaryWrapper struct { textPlan EncodePlan } func (plan *encodePlanJSONBCodecBinaryWrapper) Encode(value any, buf []byte) (newBuf []byte, err error) { buf = append(buf, 1) return plan.textPlan.Encode(value, buf) } func (c *JSONBCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: plan := (&JSONCodec{Marshal: c.Marshal, Unmarshal: c.Unmarshal}).PlanScan(m, oid, TextFormatCode, target) if plan != nil { return &scanPlanJSONBCodecBinaryUnwrapper{textPlan: plan} } case TextFormatCode: return (&JSONCodec{Marshal: c.Marshal, Unmarshal: c.Unmarshal}).PlanScan(m, oid, format, target) } return nil } type scanPlanJSONBCodecBinaryUnwrapper struct { textPlan ScanPlan } func (plan *scanPlanJSONBCodecBinaryUnwrapper) Scan(src []byte, dst any) error { if src == nil { return plan.textPlan.Scan(src, dst) } if len(src) == 0 { return fmt.Errorf("jsonb too short") } if src[0] != 1 { return fmt.Errorf("unknown jsonb version number %d", src[0]) } return plan.textPlan.Scan(src[1:], dst) } func (c *JSONBCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } switch format { case BinaryFormatCode: if len(src) == 0 { return nil, fmt.Errorf("jsonb too short") } if src[0] != 1 { return nil, fmt.Errorf("unknown jsonb version number %d", src[0]) } dstBuf := make([]byte, len(src)-1) copy(dstBuf, src[1:]) return dstBuf, nil case TextFormatCode: dstBuf := make([]byte, len(src)) copy(dstBuf, src) return dstBuf, nil default: return nil, fmt.Errorf("unknown format code: %v", format) } } func (c *JSONBCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } switch format { case BinaryFormatCode: if len(src) == 0 { return nil, fmt.Errorf("jsonb too short") } if src[0] != 1 { return nil, fmt.Errorf("unknown jsonb version number %d", src[0]) } src = src[1:] case TextFormatCode: default: return nil, fmt.Errorf("unknown format code: %v", format) } var dst any err := c.Unmarshal(src, &dst) return dst, err } pgx-5.8.0/pgtype/jsonb_test.go000066400000000000000000000101171512357711200163370ustar00rootroot00000000000000package pgtype_test import ( "context" "encoding/json" "reflect" "testing" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/require" ) func TestJSONBTranscode(t *testing.T) { type jsonStruct struct { Name string `json:"name"` Age int `json:"age"` } pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "jsonb", []pgxtest.ValueRoundTripTest{ {nil, new(*jsonStruct), isExpectedEq((*jsonStruct)(nil))}, {map[string]any(nil), new(*string), isExpectedEq((*string)(nil))}, {map[string]any(nil), new([]byte), isExpectedEqBytes([]byte(nil))}, {[]byte(nil), new([]byte), isExpectedEqBytes([]byte(nil))}, {nil, new([]byte), isExpectedEqBytes([]byte(nil))}, }) pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, pgxtest.KnownOIDQueryExecModes, "jsonb", []pgxtest.ValueRoundTripTest{ {[]byte("{}"), new([]byte), isExpectedEqBytes([]byte("{}"))}, {[]byte("null"), new([]byte), isExpectedEqBytes([]byte("null"))}, {[]byte("42"), new([]byte), isExpectedEqBytes([]byte("42"))}, {[]byte(`"hello"`), new([]byte), isExpectedEqBytes([]byte(`"hello"`))}, {[]byte(`"hello"`), new(string), isExpectedEq(`"hello"`)}, {map[string]any{"foo": "bar"}, new(map[string]any), isExpectedEqMap(map[string]any{"foo": "bar"})}, {jsonStruct{Name: "Adam", Age: 10}, new(jsonStruct), isExpectedEq(jsonStruct{Name: "Adam", Age: 10})}, }) } func TestJSONBCodecUnmarshalSQLNull(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { // Slices are nilified slice := []string{"foo", "bar", "baz"} err := conn.QueryRow(ctx, "select null::jsonb").Scan(&slice) require.NoError(t, err) require.Nil(t, slice) // Maps are nilified m := map[string]any{"foo": "bar"} err = conn.QueryRow(ctx, "select null::jsonb").Scan(&m) require.NoError(t, err) require.Nil(t, m) m = map[string]any{"foo": "bar"} err = conn.QueryRow(ctx, "select null::jsonb").Scan(&m) require.NoError(t, err) require.Nil(t, m) // Pointer to pointer are nilified n := 42 p := &n err = conn.QueryRow(ctx, "select null::jsonb").Scan(&p) require.NoError(t, err) require.Nil(t, p) // A string cannot scan a NULL. str := "foobar" err = conn.QueryRow(ctx, "select null::jsonb").Scan(&str) require.EqualError(t, err, "can't scan into dest[0] (col: jsonb): cannot scan NULL into *string") // A non-string cannot scan a NULL. err = conn.QueryRow(ctx, "select null::jsonb").Scan(&n) require.EqualError(t, err, "can't scan into dest[0] (col: jsonb): cannot scan NULL into *int") }) } // https://github.com/jackc/pgx/issues/1681 func TestJSONBCodecEncodeJSONMarshalerThatCanBeWrapped(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var jsonStr string err := conn.QueryRow(context.Background(), "select $1::jsonb", &ParentIssue1681{}).Scan(&jsonStr) require.NoError(t, err) require.Equal(t, `{"custom": "thing"}`, jsonStr) // Note that unlike json, jsonb reformats the JSON string. }) } func TestJSONBCodecCustomMarshal(t *testing.T) { connTestRunner := defaultConnTestRunner connTestRunner.AfterConnect = func(ctx context.Context, t testing.TB, conn *pgx.Conn) { conn.TypeMap().RegisterType(&pgtype.Type{ Name: "jsonb", OID: pgtype.JSONBOID, Codec: &pgtype.JSONBCodec{ Marshal: func(v any) ([]byte, error) { return []byte(`{"custom":"value"}`), nil }, Unmarshal: func(data []byte, v any) error { return json.Unmarshal([]byte(`{"custom":"value"}`), v) }, }, }) } pgxtest.RunValueRoundTripTests(context.Background(), t, connTestRunner, pgxtest.KnownOIDQueryExecModes, "jsonb", []pgxtest.ValueRoundTripTest{ // There is space between "custom" and "value" in jsonb type. {map[string]any{"something": "else"}, new(string), isExpectedEq(`{"custom": "value"}`)}, {[]byte(`{"something":"else"}`), new(map[string]any), func(v any) bool { return reflect.DeepEqual(v, map[string]any{"custom": "value"}) }}, }) } pgx-5.8.0/pgtype/line.go000066400000000000000000000111631512357711200151160ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "fmt" "math" "strconv" "strings" "github.com/jackc/pgx/v5/internal/pgio" ) type LineScanner interface { ScanLine(v Line) error } type LineValuer interface { LineValue() (Line, error) } type Line struct { A, B, C float64 Valid bool } // ScanLine implements the [LineScanner] interface. func (line *Line) ScanLine(v Line) error { *line = v return nil } // LineValue implements the [LineValuer] interface. func (line Line) LineValue() (Line, error) { return line, nil } func (line *Line) Set(src any) error { return fmt.Errorf("cannot convert %v to Line", src) } // Scan implements the [database/sql.Scanner] interface. func (line *Line) Scan(src any) error { if src == nil { *line = Line{} return nil } switch src := src.(type) { case string: return scanPlanTextAnyToLineScanner{}.Scan([]byte(src), line) } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (line Line) Value() (driver.Value, error) { if !line.Valid { return nil, nil } buf, err := LineCodec{}.PlanEncode(nil, 0, TextFormatCode, line).Encode(line, nil) if err != nil { return nil, err } return string(buf), err } type LineCodec struct{} func (LineCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (LineCodec) PreferredFormat() int16 { return BinaryFormatCode } func (LineCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(LineValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanLineCodecBinary{} case TextFormatCode: return encodePlanLineCodecText{} } return nil } type encodePlanLineCodecBinary struct{} func (encodePlanLineCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { line, err := value.(LineValuer).LineValue() if err != nil { return nil, err } if !line.Valid { return nil, nil } buf = pgio.AppendUint64(buf, math.Float64bits(line.A)) buf = pgio.AppendUint64(buf, math.Float64bits(line.B)) buf = pgio.AppendUint64(buf, math.Float64bits(line.C)) return buf, nil } type encodePlanLineCodecText struct{} func (encodePlanLineCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { line, err := value.(LineValuer).LineValue() if err != nil { return nil, err } if !line.Valid { return nil, nil } buf = append(buf, fmt.Sprintf(`{%s,%s,%s}`, strconv.FormatFloat(line.A, 'f', -1, 64), strconv.FormatFloat(line.B, 'f', -1, 64), strconv.FormatFloat(line.C, 'f', -1, 64), )...) return buf, nil } func (LineCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case LineScanner: return scanPlanBinaryLineToLineScanner{} } case TextFormatCode: switch target.(type) { case LineScanner: return scanPlanTextAnyToLineScanner{} } } return nil } type scanPlanBinaryLineToLineScanner struct{} func (scanPlanBinaryLineToLineScanner) Scan(src []byte, dst any) error { scanner := (dst).(LineScanner) if src == nil { return scanner.ScanLine(Line{}) } if len(src) != 24 { return fmt.Errorf("invalid length for line: %v", len(src)) } a := binary.BigEndian.Uint64(src) b := binary.BigEndian.Uint64(src[8:]) c := binary.BigEndian.Uint64(src[16:]) return scanner.ScanLine(Line{ A: math.Float64frombits(a), B: math.Float64frombits(b), C: math.Float64frombits(c), Valid: true, }) } type scanPlanTextAnyToLineScanner struct{} func (scanPlanTextAnyToLineScanner) Scan(src []byte, dst any) error { scanner := (dst).(LineScanner) if src == nil { return scanner.ScanLine(Line{}) } if len(src) < 7 { return fmt.Errorf("invalid length for line: %v", len(src)) } parts := strings.SplitN(string(src[1:len(src)-1]), ",", 3) if len(parts) < 3 { return fmt.Errorf("invalid format for line") } a, err := strconv.ParseFloat(parts[0], 64) if err != nil { return err } b, err := strconv.ParseFloat(parts[1], 64) if err != nil { return err } c, err := strconv.ParseFloat(parts[2], 64) if err != nil { return err } return scanner.ScanLine(Line{A: a, B: b, C: c, Valid: true}) } func (c LineCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return codecDecodeToTextFormat(c, m, oid, format, src) } func (c LineCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var line Line err := codecScan(c, m, oid, format, src, &line) if err != nil { return nil, err } return line, nil } pgx-5.8.0/pgtype/line_test.go000066400000000000000000000025361512357711200161610ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func TestLineTranscode(t *testing.T) { ctr := defaultConnTestRunner ctr.AfterConnect = func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server does not support type line") if _, ok := conn.TypeMap().TypeForName("line"); !ok { t.Skip("Skipping due to no line type") } // line may exist but not be usable on 9.3 :( var isPG93 bool err := conn.QueryRow(context.Background(), "select version() ~ '9.3'").Scan(&isPG93) if err != nil { t.Fatal(err) } if isPG93 { t.Skip("Skipping due to unimplemented line type in PG 9.3") } } pgxtest.RunValueRoundTripTests(context.Background(), t, ctr, nil, "line", []pgxtest.ValueRoundTripTest{ { pgtype.Line{ A: 1.23, B: 4.56, C: 7.89012345, Valid: true, }, new(pgtype.Line), isExpectedEq(pgtype.Line{ A: 1.23, B: 4.56, C: 7.89012345, Valid: true, }), }, { pgtype.Line{ A: -1.23, B: -4.56, C: -7.89, Valid: true, }, new(pgtype.Line), isExpectedEq(pgtype.Line{ A: -1.23, B: -4.56, C: -7.89, Valid: true, }), }, {pgtype.Line{}, new(pgtype.Line), isExpectedEq(pgtype.Line{})}, {nil, new(pgtype.Line), isExpectedEq(pgtype.Line{})}, }) } pgx-5.8.0/pgtype/lseg.go000066400000000000000000000116411512357711200151220ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "fmt" "math" "strconv" "strings" "github.com/jackc/pgx/v5/internal/pgio" ) type LsegScanner interface { ScanLseg(v Lseg) error } type LsegValuer interface { LsegValue() (Lseg, error) } type Lseg struct { P [2]Vec2 Valid bool } // ScanLseg implements the [LsegScanner] interface. func (lseg *Lseg) ScanLseg(v Lseg) error { *lseg = v return nil } // LsegValue implements the [LsegValuer] interface. func (lseg Lseg) LsegValue() (Lseg, error) { return lseg, nil } // Scan implements the [database/sql.Scanner] interface. func (lseg *Lseg) Scan(src any) error { if src == nil { *lseg = Lseg{} return nil } switch src := src.(type) { case string: return scanPlanTextAnyToLsegScanner{}.Scan([]byte(src), lseg) } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (lseg Lseg) Value() (driver.Value, error) { if !lseg.Valid { return nil, nil } buf, err := LsegCodec{}.PlanEncode(nil, 0, TextFormatCode, lseg).Encode(lseg, nil) if err != nil { return nil, err } return string(buf), err } type LsegCodec struct{} func (LsegCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (LsegCodec) PreferredFormat() int16 { return BinaryFormatCode } func (LsegCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(LsegValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanLsegCodecBinary{} case TextFormatCode: return encodePlanLsegCodecText{} } return nil } type encodePlanLsegCodecBinary struct{} func (encodePlanLsegCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { lseg, err := value.(LsegValuer).LsegValue() if err != nil { return nil, err } if !lseg.Valid { return nil, nil } buf = pgio.AppendUint64(buf, math.Float64bits(lseg.P[0].X)) buf = pgio.AppendUint64(buf, math.Float64bits(lseg.P[0].Y)) buf = pgio.AppendUint64(buf, math.Float64bits(lseg.P[1].X)) buf = pgio.AppendUint64(buf, math.Float64bits(lseg.P[1].Y)) return buf, nil } type encodePlanLsegCodecText struct{} func (encodePlanLsegCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { lseg, err := value.(LsegValuer).LsegValue() if err != nil { return nil, err } if !lseg.Valid { return nil, nil } buf = append(buf, fmt.Sprintf(`[(%s,%s),(%s,%s)]`, strconv.FormatFloat(lseg.P[0].X, 'f', -1, 64), strconv.FormatFloat(lseg.P[0].Y, 'f', -1, 64), strconv.FormatFloat(lseg.P[1].X, 'f', -1, 64), strconv.FormatFloat(lseg.P[1].Y, 'f', -1, 64), )...) return buf, nil } func (LsegCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case LsegScanner: return scanPlanBinaryLsegToLsegScanner{} } case TextFormatCode: switch target.(type) { case LsegScanner: return scanPlanTextAnyToLsegScanner{} } } return nil } type scanPlanBinaryLsegToLsegScanner struct{} func (scanPlanBinaryLsegToLsegScanner) Scan(src []byte, dst any) error { scanner := (dst).(LsegScanner) if src == nil { return scanner.ScanLseg(Lseg{}) } if len(src) != 32 { return fmt.Errorf("invalid length for lseg: %v", len(src)) } x1 := binary.BigEndian.Uint64(src) y1 := binary.BigEndian.Uint64(src[8:]) x2 := binary.BigEndian.Uint64(src[16:]) y2 := binary.BigEndian.Uint64(src[24:]) return scanner.ScanLseg(Lseg{ P: [2]Vec2{ {math.Float64frombits(x1), math.Float64frombits(y1)}, {math.Float64frombits(x2), math.Float64frombits(y2)}, }, Valid: true, }) } type scanPlanTextAnyToLsegScanner struct{} func (scanPlanTextAnyToLsegScanner) Scan(src []byte, dst any) error { scanner := (dst).(LsegScanner) if src == nil { return scanner.ScanLseg(Lseg{}) } if len(src) < 11 { return fmt.Errorf("invalid length for lseg: %v", len(src)) } str := string(src[2:]) var end int end = strings.IndexByte(str, ',') x1, err := strconv.ParseFloat(str[:end], 64) if err != nil { return err } str = str[end+1:] end = strings.IndexByte(str, ')') y1, err := strconv.ParseFloat(str[:end], 64) if err != nil { return err } str = str[end+3:] end = strings.IndexByte(str, ',') x2, err := strconv.ParseFloat(str[:end], 64) if err != nil { return err } str = str[end+1 : len(str)-2] y2, err := strconv.ParseFloat(str, 64) if err != nil { return err } return scanner.ScanLseg(Lseg{P: [2]Vec2{{x1, y1}, {x2, y2}}, Valid: true}) } func (c LsegCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return codecDecodeToTextFormat(c, m, oid, format, src) } func (c LsegCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var lseg Lseg err := codecScan(c, m, oid, format, src, &lseg) if err != nil { return nil, err } return lseg, nil } pgx-5.8.0/pgtype/lseg_test.go000066400000000000000000000017011512357711200161550ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func TestLsegTranscode(t *testing.T) { skipCockroachDB(t, "Server does not support type lseg") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "lseg", []pgxtest.ValueRoundTripTest{ { pgtype.Lseg{ P: [2]pgtype.Vec2{{3.14, 1.678}, {7.1, 5.2345678901}}, Valid: true, }, new(pgtype.Lseg), isExpectedEq(pgtype.Lseg{ P: [2]pgtype.Vec2{{3.14, 1.678}, {7.1, 5.2345678901}}, Valid: true, }), }, { pgtype.Lseg{ P: [2]pgtype.Vec2{{7.1, 1.678}, {-13.14, -5.234}}, Valid: true, }, new(pgtype.Lseg), isExpectedEq(pgtype.Lseg{ P: [2]pgtype.Vec2{{7.1, 1.678}, {-13.14, -5.234}}, Valid: true, }), }, {pgtype.Lseg{}, new(pgtype.Lseg), isExpectedEq(pgtype.Lseg{})}, {nil, new(pgtype.Lseg), isExpectedEq(pgtype.Lseg{})}, }) } pgx-5.8.0/pgtype/ltree.go000066400000000000000000000064141512357711200153050ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "fmt" ) type LtreeCodec struct{} func (l LtreeCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } // PreferredFormat returns the preferred format. func (l LtreeCodec) PreferredFormat() int16 { return TextFormatCode } // PlanEncode returns an EncodePlan for encoding value into PostgreSQL format for oid and format. If no plan can be // found then nil is returned. func (l LtreeCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case TextFormatCode: return (TextCodec)(l).PlanEncode(m, oid, format, value) case BinaryFormatCode: switch value.(type) { case string: return encodeLtreeCodecBinaryString{} case []byte: return encodeLtreeCodecBinaryByteSlice{} case TextValuer: return encodeLtreeCodecBinaryTextValuer{} } } return nil } type encodeLtreeCodecBinaryString struct{} func (encodeLtreeCodecBinaryString) Encode(value any, buf []byte) (newBuf []byte, err error) { ltree := value.(string) buf = append(buf, 1) return append(buf, ltree...), nil } type encodeLtreeCodecBinaryByteSlice struct{} func (encodeLtreeCodecBinaryByteSlice) Encode(value any, buf []byte) (newBuf []byte, err error) { ltree := value.([]byte) buf = append(buf, 1) return append(buf, ltree...), nil } type encodeLtreeCodecBinaryTextValuer struct{} func (encodeLtreeCodecBinaryTextValuer) Encode(value any, buf []byte) (newBuf []byte, err error) { t, err := value.(TextValuer).TextValue() if err != nil { return nil, err } if !t.Valid { return nil, nil } buf = append(buf, 1) return append(buf, t.String...), nil } // PlanScan returns a ScanPlan for scanning a PostgreSQL value into a destination with the same type as target. If // no plan can be found then nil is returned. func (l LtreeCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case TextFormatCode: return (TextCodec)(l).PlanScan(m, oid, format, target) case BinaryFormatCode: switch target.(type) { case *string: return scanPlanBinaryLtreeToString{} case TextScanner: return scanPlanBinaryLtreeToTextScanner{} } } return nil } type scanPlanBinaryLtreeToString struct{} func (scanPlanBinaryLtreeToString) Scan(src []byte, target any) error { version := src[0] if version != 1 { return fmt.Errorf("unsupported ltree version %d", version) } p := (target).(*string) *p = string(src[1:]) return nil } type scanPlanBinaryLtreeToTextScanner struct{} func (scanPlanBinaryLtreeToTextScanner) Scan(src []byte, target any) error { version := src[0] if version != 1 { return fmt.Errorf("unsupported ltree version %d", version) } scanner := (target).(TextScanner) return scanner.ScanText(Text{String: string(src[1:]), Valid: true}) } // DecodeDatabaseSQLValue returns src decoded into a value compatible with the sql.Scanner interface. func (l LtreeCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return (TextCodec)(l).DecodeDatabaseSQLValue(m, oid, format, src) } // DecodeValue returns src decoded into its default format. func (l LtreeCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { return (TextCodec)(l).DecodeValue(m, oid, format, src) } pgx-5.8.0/pgtype/ltree_test.go000066400000000000000000000011461512357711200163410ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func TestLtreeCodec(t *testing.T) { skipCockroachDB(t, "Server does not support type ltree") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, pgxtest.KnownOIDQueryExecModes, "ltree", []pgxtest.ValueRoundTripTest{ { Param: "A.B.C", Result: new(string), Test: isExpectedEq("A.B.C"), }, { Param: pgtype.Text{String: "", Valid: true}, Result: new(pgtype.Text), Test: isExpectedEq(pgtype.Text{String: "", Valid: true}), }, }) } pgx-5.8.0/pgtype/macaddr.go000066400000000000000000000067311512357711200155670ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "net" ) type MacaddrCodec struct{} func (MacaddrCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (MacaddrCodec) PreferredFormat() int16 { return BinaryFormatCode } func (MacaddrCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case BinaryFormatCode: switch value.(type) { case net.HardwareAddr: return encodePlanMacaddrCodecBinaryHardwareAddr{} case TextValuer: return encodePlanMacAddrCodecTextValuer{} } case TextFormatCode: switch value.(type) { case net.HardwareAddr: return encodePlanMacaddrCodecTextHardwareAddr{} case TextValuer: return encodePlanTextCodecTextValuer{} } } return nil } type encodePlanMacaddrCodecBinaryHardwareAddr struct{} func (encodePlanMacaddrCodecBinaryHardwareAddr) Encode(value any, buf []byte) (newBuf []byte, err error) { addr := value.(net.HardwareAddr) if addr == nil { return nil, nil } return append(buf, addr...), nil } type encodePlanMacAddrCodecTextValuer struct{} func (encodePlanMacAddrCodecTextValuer) Encode(value any, buf []byte) (newBuf []byte, err error) { t, err := value.(TextValuer).TextValue() if err != nil { return nil, err } if !t.Valid { return nil, nil } addr, err := net.ParseMAC(t.String) if err != nil { return nil, err } return append(buf, addr...), nil } type encodePlanMacaddrCodecTextHardwareAddr struct{} func (encodePlanMacaddrCodecTextHardwareAddr) Encode(value any, buf []byte) (newBuf []byte, err error) { addr := value.(net.HardwareAddr) if addr == nil { return nil, nil } return append(buf, addr.String()...), nil } func (MacaddrCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case *net.HardwareAddr: return scanPlanBinaryMacaddrToHardwareAddr{} case TextScanner: return scanPlanBinaryMacaddrToTextScanner{} } case TextFormatCode: switch target.(type) { case *net.HardwareAddr: return scanPlanTextMacaddrToHardwareAddr{} case TextScanner: return scanPlanTextAnyToTextScanner{} } } return nil } type scanPlanBinaryMacaddrToHardwareAddr struct{} func (scanPlanBinaryMacaddrToHardwareAddr) Scan(src []byte, dst any) error { dstBuf := dst.(*net.HardwareAddr) if src == nil { *dstBuf = nil return nil } *dstBuf = make([]byte, len(src)) copy(*dstBuf, src) return nil } type scanPlanBinaryMacaddrToTextScanner struct{} func (scanPlanBinaryMacaddrToTextScanner) Scan(src []byte, dst any) error { scanner := (dst).(TextScanner) if src == nil { return scanner.ScanText(Text{}) } return scanner.ScanText(Text{String: net.HardwareAddr(src).String(), Valid: true}) } type scanPlanTextMacaddrToHardwareAddr struct{} func (scanPlanTextMacaddrToHardwareAddr) Scan(src []byte, dst any) error { p := dst.(*net.HardwareAddr) if src == nil { *p = nil return nil } addr, err := net.ParseMAC(string(src)) if err != nil { return err } *p = addr return nil } func (c MacaddrCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return codecDecodeToTextFormat(c, m, oid, format, src) } func (c MacaddrCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var addr net.HardwareAddr err := codecScan(c, m, oid, format, src, &addr) if err != nil { return nil, err } return addr, nil } pgx-5.8.0/pgtype/macaddr_test.go000066400000000000000000000034711512357711200166240ustar00rootroot00000000000000package pgtype_test import ( "bytes" "context" "net" "testing" "github.com/jackc/pgx/v5/pgxtest" ) func isExpectedEqHardwareAddr(a any) func(any) bool { return func(v any) bool { aa := a.(net.HardwareAddr) vv := v.(net.HardwareAddr) if (aa == nil) != (vv == nil) { return false } if aa == nil { return true } return bytes.Equal(aa, vv) } } func TestMacaddrCodec(t *testing.T) { skipCockroachDB(t, "Server does not support type macaddr") // Only testing known OID query exec modes as net.HardwareAddr could map to macaddr or macaddr8. pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, pgxtest.KnownOIDQueryExecModes, "macaddr", []pgxtest.ValueRoundTripTest{ { mustParseMacaddr(t, "01:23:45:67:89:ab"), new(net.HardwareAddr), isExpectedEqHardwareAddr(mustParseMacaddr(t, "01:23:45:67:89:ab")), }, { "01:23:45:67:89:ab", new(net.HardwareAddr), isExpectedEqHardwareAddr(mustParseMacaddr(t, "01:23:45:67:89:ab")), }, { mustParseMacaddr(t, "01:23:45:67:89:ab"), new(string), isExpectedEq("01:23:45:67:89:ab"), }, {nil, new(*net.HardwareAddr), isExpectedEq((*net.HardwareAddr)(nil))}, }) pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, pgxtest.KnownOIDQueryExecModes, "macaddr8", []pgxtest.ValueRoundTripTest{ { mustParseMacaddr(t, "01:23:45:67:89:ab:01:08"), new(net.HardwareAddr), isExpectedEqHardwareAddr(mustParseMacaddr(t, "01:23:45:67:89:ab:01:08")), }, { "01:23:45:67:89:ab:01:08", new(net.HardwareAddr), isExpectedEqHardwareAddr(mustParseMacaddr(t, "01:23:45:67:89:ab:01:08")), }, { mustParseMacaddr(t, "01:23:45:67:89:ab:01:08"), new(string), isExpectedEq("01:23:45:67:89:ab:01:08"), }, {nil, new(*net.HardwareAddr), isExpectedEq((*net.HardwareAddr)(nil))}, }) } pgx-5.8.0/pgtype/multirange.go000066400000000000000000000231541512357711200163410ustar00rootroot00000000000000package pgtype import ( "bytes" "database/sql/driver" "encoding/binary" "fmt" "reflect" "github.com/jackc/pgx/v5/internal/pgio" ) // MultirangeGetter is a type that can be converted into a PostgreSQL multirange. type MultirangeGetter interface { // IsNull returns true if the value is SQL NULL. IsNull() bool // Len returns the number of elements in the multirange. Len() int // Index returns the element at i. Index(i int) any // IndexType returns a non-nil scan target of the type Index will return. This is used by MultirangeCodec.PlanEncode. IndexType() any } // MultirangeSetter is a type can be set from a PostgreSQL multirange. type MultirangeSetter interface { // ScanNull sets the value to SQL NULL. ScanNull() error // SetLen prepares the value such that ScanIndex can be called for each element. This will remove any existing // elements. SetLen(n int) error // ScanIndex returns a value usable as a scan target for i. SetLen must be called before ScanIndex. ScanIndex(i int) any // ScanIndexType returns a non-nil scan target of the type ScanIndex will return. This is used by // MultirangeCodec.PlanScan. ScanIndexType() any } // MultirangeCodec is a codec for any multirange type. type MultirangeCodec struct { ElementType *Type } func (c *MultirangeCodec) FormatSupported(format int16) bool { return c.ElementType.Codec.FormatSupported(format) } func (c *MultirangeCodec) PreferredFormat() int16 { return c.ElementType.Codec.PreferredFormat() } func (c *MultirangeCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { multirangeValuer, ok := value.(MultirangeGetter) if !ok { return nil } elementType := multirangeValuer.IndexType() elementEncodePlan := m.PlanEncode(c.ElementType.OID, format, elementType) if elementEncodePlan == nil { return nil } switch format { case BinaryFormatCode: return &encodePlanMultirangeCodecBinary{ac: c, m: m, oid: oid} case TextFormatCode: return &encodePlanMultirangeCodecText{ac: c, m: m, oid: oid} } return nil } type encodePlanMultirangeCodecText struct { ac *MultirangeCodec m *Map oid uint32 } func (p *encodePlanMultirangeCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { multirange := value.(MultirangeGetter) if multirange.IsNull() { return nil, nil } elementCount := multirange.Len() buf = append(buf, '{') var encodePlan EncodePlan var lastElemType reflect.Type inElemBuf := make([]byte, 0, 32) for i := range elementCount { if i > 0 { buf = append(buf, ',') } elem := multirange.Index(i) var elemBuf []byte if elem != nil { elemType := reflect.TypeOf(elem) if lastElemType != elemType { lastElemType = elemType encodePlan = p.m.PlanEncode(p.ac.ElementType.OID, TextFormatCode, elem) if encodePlan == nil { return nil, fmt.Errorf("unable to encode %v", multirange.Index(i)) } } elemBuf, err = encodePlan.Encode(elem, inElemBuf) if err != nil { return nil, err } } if elemBuf == nil { return nil, fmt.Errorf("multirange cannot contain NULL element") } else { buf = append(buf, elemBuf...) } } buf = append(buf, '}') return buf, nil } type encodePlanMultirangeCodecBinary struct { ac *MultirangeCodec m *Map oid uint32 } func (p *encodePlanMultirangeCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { multirange := value.(MultirangeGetter) if multirange.IsNull() { return nil, nil } elementCount := multirange.Len() buf = pgio.AppendInt32(buf, int32(elementCount)) var encodePlan EncodePlan var lastElemType reflect.Type for i := range elementCount { sp := len(buf) buf = pgio.AppendInt32(buf, -1) elem := multirange.Index(i) var elemBuf []byte if elem != nil { elemType := reflect.TypeOf(elem) if lastElemType != elemType { lastElemType = elemType encodePlan = p.m.PlanEncode(p.ac.ElementType.OID, BinaryFormatCode, elem) if encodePlan == nil { return nil, fmt.Errorf("unable to encode %v", multirange.Index(i)) } } elemBuf, err = encodePlan.Encode(elem, buf) if err != nil { return nil, err } } if elemBuf == nil { return nil, fmt.Errorf("multirange cannot contain NULL element") } else { buf = elemBuf pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4)) } } return buf, nil } func (c *MultirangeCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { multirangeScanner, ok := target.(MultirangeSetter) if !ok { return nil } elementType := multirangeScanner.ScanIndexType() elementScanPlan := m.PlanScan(c.ElementType.OID, format, elementType) if _, ok := elementScanPlan.(*scanPlanFail); ok { return nil } return &scanPlanMultirangeCodec{ multirangeCodec: c, m: m, oid: oid, formatCode: format, } } func (c *MultirangeCodec) decodeBinary(m *Map, multirangeOID uint32, src []byte, multirange MultirangeSetter) error { rp := 0 elementCount := int(binary.BigEndian.Uint32(src[rp:])) rp += 4 err := multirange.SetLen(elementCount) if err != nil { return err } if elementCount == 0 { return nil } elementScanPlan := c.ElementType.Codec.PlanScan(m, c.ElementType.OID, BinaryFormatCode, multirange.ScanIndex(0)) if elementScanPlan == nil { elementScanPlan = m.PlanScan(c.ElementType.OID, BinaryFormatCode, multirange.ScanIndex(0)) } for i := range elementCount { elem := multirange.ScanIndex(i) elemLen := int(int32(binary.BigEndian.Uint32(src[rp:]))) rp += 4 var elemSrc []byte if elemLen >= 0 { elemSrc = src[rp : rp+elemLen] rp += elemLen } err = elementScanPlan.Scan(elemSrc, elem) if err != nil { return fmt.Errorf("failed to scan multirange element %d: %w", i, err) } } return nil } func (c *MultirangeCodec) decodeText(m *Map, multirangeOID uint32, src []byte, multirange MultirangeSetter) error { elements, err := parseUntypedTextMultirange(src) if err != nil { return err } err = multirange.SetLen(len(elements)) if err != nil { return err } if len(elements) == 0 { return nil } elementScanPlan := c.ElementType.Codec.PlanScan(m, c.ElementType.OID, TextFormatCode, multirange.ScanIndex(0)) if elementScanPlan == nil { elementScanPlan = m.PlanScan(c.ElementType.OID, TextFormatCode, multirange.ScanIndex(0)) } for i, s := range elements { elem := multirange.ScanIndex(i) err = elementScanPlan.Scan([]byte(s), elem) if err != nil { return err } } return nil } type scanPlanMultirangeCodec struct { multirangeCodec *MultirangeCodec m *Map oid uint32 formatCode int16 elementScanPlan ScanPlan } func (spac *scanPlanMultirangeCodec) Scan(src []byte, dst any) error { c := spac.multirangeCodec m := spac.m oid := spac.oid formatCode := spac.formatCode multirange := dst.(MultirangeSetter) if src == nil { return multirange.ScanNull() } switch formatCode { case BinaryFormatCode: return c.decodeBinary(m, oid, src, multirange) case TextFormatCode: return c.decodeText(m, oid, src, multirange) default: return fmt.Errorf("unknown format code %d", formatCode) } } func (c *MultirangeCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } switch format { case TextFormatCode: return string(src), nil case BinaryFormatCode: buf := make([]byte, len(src)) copy(buf, src) return buf, nil default: return nil, fmt.Errorf("unknown format code %d", format) } } func (c *MultirangeCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var multirange Multirange[Range[any]] err := m.PlanScan(oid, format, &multirange).Scan(src, &multirange) return multirange, err } func parseUntypedTextMultirange(src []byte) ([]string, error) { elements := make([]string, 0) buf := bytes.NewBuffer(src) skipWhitespace(buf) r, _, err := buf.ReadRune() if err != nil { return nil, fmt.Errorf("invalid array: %w", err) } if r != '{' { return nil, fmt.Errorf("invalid multirange, expected '{' got %v", r) } parseValueLoop: for { r, _, err = buf.ReadRune() if err != nil { return nil, fmt.Errorf("invalid multirange: %w", err) } switch r { case ',': // skip range separator case '}': break parseValueLoop default: buf.UnreadRune() value, err := parseRange(buf) if err != nil { return nil, fmt.Errorf("invalid multirange value: %w", err) } elements = append(elements, value) } } skipWhitespace(buf) if buf.Len() > 0 { return nil, fmt.Errorf("unexpected trailing data: %v", buf.String()) } return elements, nil } func parseRange(buf *bytes.Buffer) (string, error) { s := &bytes.Buffer{} boundSepRead := false for { r, _, err := buf.ReadRune() if err != nil { return "", err } switch r { case ',', '}': if r == ',' && !boundSepRead { boundSepRead = true break } buf.UnreadRune() return s.String(), nil } s.WriteRune(r) } } // Multirange is a generic multirange type. // // T should implement [RangeValuer] and *T should implement [RangeScanner]. However, there does not appear to be a way to // enforce the [RangeScanner] constraint. type Multirange[T RangeValuer] []T func (r Multirange[T]) IsNull() bool { return r == nil } func (r Multirange[T]) Len() int { return len(r) } func (r Multirange[T]) Index(i int) any { return r[i] } func (r Multirange[T]) IndexType() any { var zero T return zero } func (r *Multirange[T]) ScanNull() error { *r = nil return nil } func (r *Multirange[T]) SetLen(n int) error { *r = make([]T, n) return nil } func (r Multirange[T]) ScanIndex(i int) any { return &r[i] } func (r Multirange[T]) ScanIndexType() any { return new(T) } pgx-5.8.0/pgtype/multirange_test.go000066400000000000000000000062661512357711200174050ustar00rootroot00000000000000package pgtype_test import ( "context" "reflect" "testing" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/require" ) func TestMultirangeCodecTranscode(t *testing.T) { skipPostgreSQLVersionLessThan(t, 14) skipCockroachDB(t, "Server does not support range types (see https://github.com/cockroachdb/cockroach/issues/27791)") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "int4multirange", []pgxtest.ValueRoundTripTest{ { pgtype.Multirange[pgtype.Range[pgtype.Int4]](nil), new(pgtype.Multirange[pgtype.Range[pgtype.Int4]]), func(a any) bool { return reflect.DeepEqual(pgtype.Multirange[pgtype.Range[pgtype.Int4]](nil), a) }, }, { pgtype.Multirange[pgtype.Range[pgtype.Int4]]{}, new(pgtype.Multirange[pgtype.Range[pgtype.Int4]]), func(a any) bool { return reflect.DeepEqual(pgtype.Multirange[pgtype.Range[pgtype.Int4]]{}, a) }, }, { pgtype.Multirange[pgtype.Range[pgtype.Int4]]{ { Lower: pgtype.Int4{Int32: 1, Valid: true}, Upper: pgtype.Int4{Int32: 5, Valid: true}, LowerType: pgtype.Inclusive, UpperType: pgtype.Exclusive, Valid: true, }, { Lower: pgtype.Int4{Int32: 7, Valid: true}, Upper: pgtype.Int4{Int32: 9, Valid: true}, LowerType: pgtype.Inclusive, UpperType: pgtype.Exclusive, Valid: true, }, }, new(pgtype.Multirange[pgtype.Range[pgtype.Int4]]), func(a any) bool { return reflect.DeepEqual(pgtype.Multirange[pgtype.Range[pgtype.Int4]]{ { Lower: pgtype.Int4{Int32: 1, Valid: true}, Upper: pgtype.Int4{Int32: 5, Valid: true}, LowerType: pgtype.Inclusive, UpperType: pgtype.Exclusive, Valid: true, }, { Lower: pgtype.Int4{Int32: 7, Valid: true}, Upper: pgtype.Int4{Int32: 9, Valid: true}, LowerType: pgtype.Inclusive, UpperType: pgtype.Exclusive, Valid: true, }, }, a) }, }, }) } func TestMultirangeCodecDecodeValue(t *testing.T) { skipPostgreSQLVersionLessThan(t, 14) skipCockroachDB(t, "Server does not support range types (see https://github.com/cockroachdb/cockroach/issues/27791)") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { for _, tt := range []struct { sql string expected any }{ { sql: `select int4multirange(int4range(1, 5), int4range(7,9))`, expected: pgtype.Multirange[pgtype.Range[any]]{ { Lower: int32(1), Upper: int32(5), LowerType: pgtype.Inclusive, UpperType: pgtype.Exclusive, Valid: true, }, { Lower: int32(7), Upper: int32(9), LowerType: pgtype.Inclusive, UpperType: pgtype.Exclusive, Valid: true, }, }, }, } { t.Run(tt.sql, func(t *testing.T) { rows, err := conn.Query(ctx, tt.sql) require.NoError(t, err) for rows.Next() { values, err := rows.Values() require.NoError(t, err) require.Len(t, values, 1) require.Equal(t, tt.expected, values[0]) } require.NoError(t, rows.Err()) }) } }) } pgx-5.8.0/pgtype/numeric.go000066400000000000000000000442651512357711200156420ustar00rootroot00000000000000package pgtype import ( "bytes" "database/sql/driver" "encoding/binary" "fmt" "math" "math/big" "strconv" "strings" "github.com/jackc/pgx/v5/internal/pgio" ) // PostgreSQL internal numeric storage uses 16-bit "digits" with base of 10,000 const nbase = 10_000 const ( pgNumericNaN = 0x00000000c0000000 pgNumericNaNSign = 0xc000 pgNumericPosInf = 0x00000000d0000000 pgNumericPosInfSign = 0xd000 pgNumericNegInf = 0x00000000f0000000 pgNumericNegInfSign = 0xf000 ) var ( big1 *big.Int = big.NewInt(1) big10 *big.Int = big.NewInt(10) big100 *big.Int = big.NewInt(100) big1000 *big.Int = big.NewInt(1000) ) var ( bigNBase *big.Int = big.NewInt(nbase) bigNBaseX2 *big.Int = big.NewInt(nbase * nbase) bigNBaseX3 *big.Int = big.NewInt(nbase * nbase * nbase) bigNBaseX4 *big.Int = big.NewInt(nbase * nbase * nbase * nbase) ) type NumericScanner interface { ScanNumeric(v Numeric) error } type NumericValuer interface { NumericValue() (Numeric, error) } type Numeric struct { Int *big.Int Exp int32 NaN bool InfinityModifier InfinityModifier Valid bool } // ScanNumeric implements the [NumericScanner] interface. func (n *Numeric) ScanNumeric(v Numeric) error { *n = v return nil } // NumericValue implements the [NumericValuer] interface. func (n Numeric) NumericValue() (Numeric, error) { return n, nil } // Float64Value implements the [Float64Valuer] interface. func (n Numeric) Float64Value() (Float8, error) { if !n.Valid { return Float8{}, nil } else if n.NaN { return Float8{Float64: math.NaN(), Valid: true}, nil } else if n.InfinityModifier == Infinity { return Float8{Float64: math.Inf(1), Valid: true}, nil } else if n.InfinityModifier == NegativeInfinity { return Float8{Float64: math.Inf(-1), Valid: true}, nil } buf := make([]byte, 0, 32) if n.Int == nil { buf = append(buf, '0') } else { buf = append(buf, n.Int.String()...) } buf = append(buf, 'e') buf = append(buf, strconv.FormatInt(int64(n.Exp), 10)...) f, err := strconv.ParseFloat(string(buf), 64) if err != nil { return Float8{}, err } return Float8{Float64: f, Valid: true}, nil } // ScanInt64 implements the [Int64Scanner] interface. func (n *Numeric) ScanInt64(v Int8) error { if !v.Valid { *n = Numeric{} return nil } *n = Numeric{Int: big.NewInt(v.Int64), Valid: true} return nil } // Int64Value implements the [Int64Valuer] interface. func (n Numeric) Int64Value() (Int8, error) { if !n.Valid { return Int8{}, nil } bi, err := n.toBigInt() if err != nil { return Int8{}, err } if !bi.IsInt64() { return Int8{}, fmt.Errorf("cannot convert %v to int64", n) } return Int8{Int64: bi.Int64(), Valid: true}, nil } func (n *Numeric) ScanScientific(src string) error { if !strings.ContainsAny("eE", src) { return scanPlanTextAnyToNumericScanner{}.Scan([]byte(src), n) } if bigF, ok := new(big.Float).SetString(string(src)); ok { smallF, _ := bigF.Float64() src = strconv.FormatFloat(smallF, 'f', -1, 64) } num, exp, err := parseNumericString(src) if err != nil { return err } *n = Numeric{Int: num, Exp: exp, Valid: true} return nil } func (n *Numeric) toBigInt() (*big.Int, error) { if n.Exp == 0 { return n.Int, nil } num := &big.Int{} num.Set(n.Int) if n.Exp > 0 { mul := &big.Int{} mul.Exp(big10, big.NewInt(int64(n.Exp)), nil) num.Mul(num, mul) return num, nil } div := &big.Int{} div.Exp(big10, big.NewInt(int64(-n.Exp)), nil) remainder := &big.Int{} num.DivMod(num, div, remainder) if remainder.Sign() != 0 { return nil, fmt.Errorf("cannot convert %v to integer", n) } return num, nil } func parseNumericString(str string) (n *big.Int, exp int32, err error) { idx := strings.IndexByte(str, '.') if idx == -1 { for len(str) > 1 && str[len(str)-1] == '0' && str[len(str)-2] != '-' { str = str[:len(str)-1] exp++ } } else { exp = int32(-(len(str) - idx - 1)) str = str[:idx] + str[idx+1:] } accum := &big.Int{} if _, ok := accum.SetString(str, 10); !ok { return nil, 0, fmt.Errorf("%s is not a number", str) } return accum, exp, nil } func nbaseDigitsToInt64(src []byte) (accum int64, bytesRead, digitsRead int) { digits := min(len(src)/2, 4) rp := 0 for i := range digits { if i > 0 { accum *= nbase } accum += int64(binary.BigEndian.Uint16(src[rp:])) rp += 2 } return accum, rp, digits } // Scan implements the [database/sql.Scanner] interface. func (n *Numeric) Scan(src any) error { if src == nil { *n = Numeric{} return nil } switch src := src.(type) { case string: return scanPlanTextAnyToNumericScanner{}.Scan([]byte(src), n) } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (n Numeric) Value() (driver.Value, error) { if !n.Valid { return nil, nil } buf, err := NumericCodec{}.PlanEncode(nil, 0, TextFormatCode, n).Encode(n, nil) if err != nil { return nil, err } return string(buf), err } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (n Numeric) MarshalJSON() ([]byte, error) { if !n.Valid { return []byte("null"), nil } if n.NaN { return []byte(`"NaN"`), nil } return n.numberTextBytes(), nil } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (n *Numeric) UnmarshalJSON(src []byte) error { if bytes.Equal(src, []byte(`null`)) { *n = Numeric{} return nil } if bytes.Equal(src, []byte(`"NaN"`)) { *n = Numeric{NaN: true, Valid: true} return nil } return scanPlanTextAnyToNumericScanner{}.Scan(src, n) } // numberString returns a string of the number. undefined if NaN, infinite, or NULL func (n Numeric) numberTextBytes() []byte { intStr := n.Int.String() buf := &bytes.Buffer{} if len(intStr) > 0 && intStr[:1] == "-" { intStr = intStr[1:] buf.WriteByte('-') } exp := int(n.Exp) if exp > 0 { buf.WriteString(intStr) for range exp { buf.WriteByte('0') } } else if exp < 0 { if len(intStr) <= -exp { buf.WriteString("0.") leadingZeros := -exp - len(intStr) for range leadingZeros { buf.WriteByte('0') } buf.WriteString(intStr) } else if len(intStr) > -exp { dpPos := len(intStr) + exp buf.WriteString(intStr[:dpPos]) buf.WriteByte('.') buf.WriteString(intStr[dpPos:]) } } else { buf.WriteString(intStr) } return buf.Bytes() } type NumericCodec struct{} func (NumericCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (NumericCodec) PreferredFormat() int16 { return BinaryFormatCode } func (NumericCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case BinaryFormatCode: switch value.(type) { case NumericValuer: return encodePlanNumericCodecBinaryNumericValuer{} case Float64Valuer: return encodePlanNumericCodecBinaryFloat64Valuer{} case Int64Valuer: return encodePlanNumericCodecBinaryInt64Valuer{} } case TextFormatCode: switch value.(type) { case NumericValuer: return encodePlanNumericCodecTextNumericValuer{} case Float64Valuer: return encodePlanNumericCodecTextFloat64Valuer{} case Int64Valuer: return encodePlanNumericCodecTextInt64Valuer{} } } return nil } type encodePlanNumericCodecBinaryNumericValuer struct{} func (encodePlanNumericCodecBinaryNumericValuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(NumericValuer).NumericValue() if err != nil { return nil, err } return encodeNumericBinary(n, buf) } type encodePlanNumericCodecBinaryFloat64Valuer struct{} func (encodePlanNumericCodecBinaryFloat64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Float64Valuer).Float64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } if math.IsNaN(n.Float64) { return encodeNumericBinary(Numeric{NaN: true, Valid: true}, buf) } else if math.IsInf(n.Float64, 1) { return encodeNumericBinary(Numeric{InfinityModifier: Infinity, Valid: true}, buf) } else if math.IsInf(n.Float64, -1) { return encodeNumericBinary(Numeric{InfinityModifier: NegativeInfinity, Valid: true}, buf) } num, exp, err := parseNumericString(strconv.FormatFloat(n.Float64, 'f', -1, 64)) if err != nil { return nil, err } return encodeNumericBinary(Numeric{Int: num, Exp: exp, Valid: true}, buf) } type encodePlanNumericCodecBinaryInt64Valuer struct{} func (encodePlanNumericCodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } return encodeNumericBinary(Numeric{Int: big.NewInt(n.Int64), Valid: true}, buf) } func encodeNumericBinary(n Numeric, buf []byte) (newBuf []byte, err error) { if !n.Valid { return nil, nil } if n.NaN { buf = pgio.AppendUint64(buf, pgNumericNaN) return buf, nil } else if n.InfinityModifier == Infinity { buf = pgio.AppendUint64(buf, pgNumericPosInf) return buf, nil } else if n.InfinityModifier == NegativeInfinity { buf = pgio.AppendUint64(buf, pgNumericNegInf) return buf, nil } var sign int16 if n.Int.Sign() < 0 { sign = 16384 } absInt := &big.Int{} wholePart := &big.Int{} fracPart := &big.Int{} remainder := &big.Int{} absInt.Abs(n.Int) // Normalize absInt and exp to where exp is always a multiple of 4. This makes // converting to 16-bit base 10,000 digits easier. var exp int32 switch n.Exp % 4 { case 1, -3: exp = n.Exp - 1 absInt.Mul(absInt, big10) case 2, -2: exp = n.Exp - 2 absInt.Mul(absInt, big100) case 3, -1: exp = n.Exp - 3 absInt.Mul(absInt, big1000) default: exp = n.Exp } if exp < 0 { divisor := &big.Int{} divisor.Exp(big10, big.NewInt(int64(-exp)), nil) wholePart.DivMod(absInt, divisor, fracPart) fracPart.Add(fracPart, divisor) } else { wholePart = absInt } var wholeDigits, fracDigits []int16 for wholePart.Sign() != 0 { wholePart.DivMod(wholePart, bigNBase, remainder) wholeDigits = append(wholeDigits, int16(remainder.Int64())) } if fracPart.Sign() != 0 { for fracPart.Cmp(big1) != 0 { fracPart.DivMod(fracPart, bigNBase, remainder) fracDigits = append(fracDigits, int16(remainder.Int64())) } } buf = pgio.AppendInt16(buf, int16(len(wholeDigits)+len(fracDigits))) var weight int16 if len(wholeDigits) > 0 { weight = int16(len(wholeDigits) - 1) if exp > 0 { weight += int16(exp / 4) } } else { weight = int16(exp/4) - 1 + int16(len(fracDigits)) } buf = pgio.AppendInt16(buf, weight) buf = pgio.AppendInt16(buf, sign) var dscale int16 if n.Exp < 0 { dscale = int16(-n.Exp) } buf = pgio.AppendInt16(buf, dscale) for i := len(wholeDigits) - 1; i >= 0; i-- { buf = pgio.AppendInt16(buf, wholeDigits[i]) } for i := len(fracDigits) - 1; i >= 0; i-- { buf = pgio.AppendInt16(buf, fracDigits[i]) } return buf, nil } type encodePlanNumericCodecTextNumericValuer struct{} func (encodePlanNumericCodecTextNumericValuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(NumericValuer).NumericValue() if err != nil { return nil, err } return encodeNumericText(n, buf) } type encodePlanNumericCodecTextFloat64Valuer struct{} func (encodePlanNumericCodecTextFloat64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Float64Valuer).Float64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } if math.IsNaN(n.Float64) { buf = append(buf, "NaN"...) } else if math.IsInf(n.Float64, 1) { buf = append(buf, "Infinity"...) } else if math.IsInf(n.Float64, -1) { buf = append(buf, "-Infinity"...) } else { buf = append(buf, strconv.FormatFloat(n.Float64, 'f', -1, 64)...) } return buf, nil } type encodePlanNumericCodecTextInt64Valuer struct{} func (encodePlanNumericCodecTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { n, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !n.Valid { return nil, nil } buf = append(buf, strconv.FormatInt(n.Int64, 10)...) return buf, nil } func encodeNumericText(n Numeric, buf []byte) (newBuf []byte, err error) { if !n.Valid { return nil, nil } if n.NaN { buf = append(buf, "NaN"...) return buf, nil } else if n.InfinityModifier == Infinity { buf = append(buf, "Infinity"...) return buf, nil } else if n.InfinityModifier == NegativeInfinity { buf = append(buf, "-Infinity"...) return buf, nil } buf = append(buf, n.numberTextBytes()...) return buf, nil } func (NumericCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case NumericScanner: return scanPlanBinaryNumericToNumericScanner{} case Float64Scanner: return scanPlanBinaryNumericToFloat64Scanner{} case Int64Scanner: return scanPlanBinaryNumericToInt64Scanner{} case TextScanner: return scanPlanBinaryNumericToTextScanner{} } case TextFormatCode: switch target.(type) { case NumericScanner: return scanPlanTextAnyToNumericScanner{} case Float64Scanner: return scanPlanTextAnyToFloat64Scanner{} case Int64Scanner: return scanPlanTextAnyToInt64Scanner{} } } return nil } type scanPlanBinaryNumericToNumericScanner struct{} func (scanPlanBinaryNumericToNumericScanner) Scan(src []byte, dst any) error { scanner := (dst).(NumericScanner) if src == nil { return scanner.ScanNumeric(Numeric{}) } if len(src) < 8 { return fmt.Errorf("numeric incomplete %v", src) } rp := 0 ndigits := binary.BigEndian.Uint16(src[rp:]) rp += 2 weight := int16(binary.BigEndian.Uint16(src[rp:])) rp += 2 sign := binary.BigEndian.Uint16(src[rp:]) rp += 2 dscale := int16(binary.BigEndian.Uint16(src[rp:])) rp += 2 if sign == pgNumericNaNSign { return scanner.ScanNumeric(Numeric{NaN: true, Valid: true}) } else if sign == pgNumericPosInfSign { return scanner.ScanNumeric(Numeric{InfinityModifier: Infinity, Valid: true}) } else if sign == pgNumericNegInfSign { return scanner.ScanNumeric(Numeric{InfinityModifier: NegativeInfinity, Valid: true}) } if ndigits == 0 { return scanner.ScanNumeric(Numeric{Int: big.NewInt(0), Valid: true}) } if len(src[rp:]) < int(ndigits)*2 { return fmt.Errorf("numeric incomplete %v", src) } accum := &big.Int{} for i := 0; i < int(ndigits+3)/4; i++ { int64accum, bytesRead, digitsRead := nbaseDigitsToInt64(src[rp:]) rp += bytesRead if i > 0 { var mul *big.Int switch digitsRead { case 1: mul = bigNBase case 2: mul = bigNBaseX2 case 3: mul = bigNBaseX3 case 4: mul = bigNBaseX4 default: return fmt.Errorf("invalid digitsRead: %d (this can't happen)", digitsRead) } accum.Mul(accum, mul) } accum.Add(accum, big.NewInt(int64accum)) } exp := (int32(weight) - int32(ndigits) + 1) * 4 if dscale > 0 { fracNBaseDigits := int(ndigits) - int(weight) - 1 fracDecimalDigits := fracNBaseDigits * 4 dscaleInt := int(dscale) if dscaleInt > fracDecimalDigits { multCount := dscaleInt - fracDecimalDigits for range multCount { accum.Mul(accum, big10) exp-- } } else if dscaleInt < fracDecimalDigits { divCount := fracDecimalDigits - dscaleInt for range divCount { accum.Div(accum, big10) exp++ } } } reduced := &big.Int{} remainder := &big.Int{} if exp >= 0 { for { reduced.DivMod(accum, big10, remainder) if remainder.Sign() != 0 { break } accum.Set(reduced) exp++ } } if sign != 0 { accum.Neg(accum) } return scanner.ScanNumeric(Numeric{Int: accum, Exp: exp, Valid: true}) } type scanPlanBinaryNumericToFloat64Scanner struct{} func (scanPlanBinaryNumericToFloat64Scanner) Scan(src []byte, dst any) error { scanner := (dst).(Float64Scanner) if src == nil { return scanner.ScanFloat64(Float8{}) } var n Numeric err := scanPlanBinaryNumericToNumericScanner{}.Scan(src, &n) if err != nil { return err } f8, err := n.Float64Value() if err != nil { return err } return scanner.ScanFloat64(f8) } type scanPlanBinaryNumericToInt64Scanner struct{} func (scanPlanBinaryNumericToInt64Scanner) Scan(src []byte, dst any) error { scanner := (dst).(Int64Scanner) if src == nil { return scanner.ScanInt64(Int8{}) } var n Numeric err := scanPlanBinaryNumericToNumericScanner{}.Scan(src, &n) if err != nil { return err } bigInt, err := n.toBigInt() if err != nil { return err } if !bigInt.IsInt64() { return fmt.Errorf("%v is out of range for int64", bigInt) } return scanner.ScanInt64(Int8{Int64: bigInt.Int64(), Valid: true}) } type scanPlanBinaryNumericToTextScanner struct{} func (scanPlanBinaryNumericToTextScanner) Scan(src []byte, dst any) error { scanner := (dst).(TextScanner) if src == nil { return scanner.ScanText(Text{}) } var n Numeric err := scanPlanBinaryNumericToNumericScanner{}.Scan(src, &n) if err != nil { return err } sbuf, err := encodeNumericText(n, nil) if err != nil { return err } return scanner.ScanText(Text{String: string(sbuf), Valid: true}) } type scanPlanTextAnyToNumericScanner struct{} func (scanPlanTextAnyToNumericScanner) Scan(src []byte, dst any) error { scanner := (dst).(NumericScanner) if src == nil { return scanner.ScanNumeric(Numeric{}) } if string(src) == "NaN" { return scanner.ScanNumeric(Numeric{NaN: true, Valid: true}) } else if string(src) == "Infinity" { return scanner.ScanNumeric(Numeric{InfinityModifier: Infinity, Valid: true}) } else if string(src) == "-Infinity" { return scanner.ScanNumeric(Numeric{InfinityModifier: NegativeInfinity, Valid: true}) } num, exp, err := parseNumericString(string(src)) if err != nil { return err } return scanner.ScanNumeric(Numeric{Int: num, Exp: exp, Valid: true}) } func (c NumericCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } if format == TextFormatCode { return string(src), nil } var n Numeric err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } buf, err := m.Encode(oid, TextFormatCode, n, nil) if err != nil { return nil, err } return string(buf), nil } func (c NumericCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var n Numeric err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return n, nil } pgx-5.8.0/pgtype/numeric_test.go000066400000000000000000000365131512357711200166760ustar00rootroot00000000000000package pgtype_test import ( "context" "encoding/json" "math" "math/big" "math/rand/v2" "reflect" "strconv" "strings" "testing" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func mustParseBigInt(t *testing.T, src string) *big.Int { i := &big.Int{} if _, ok := i.SetString(src, 10); !ok { t.Fatalf("could not parse big.Int: %s", src) } return i } func isExpectedEqNumeric(a any) func(any) bool { return func(v any) bool { aa := a.(pgtype.Numeric) vv := v.(pgtype.Numeric) if aa.Valid != vv.Valid { return false } // If NULL doesn't matter what the rest of the values are. if !aa.Valid { return true } if !(aa.NaN == vv.NaN && aa.InfinityModifier == vv.InfinityModifier) { return false } // If NaN or InfinityModifier are set then Int and Exp don't matter. if aa.NaN || aa.InfinityModifier != pgtype.Finite { return true } aaInt := (&big.Int{}).Set(aa.Int) vvInt := (&big.Int{}).Set(vv.Int) if aa.Exp < vv.Exp { mul := (&big.Int{}).Exp(big.NewInt(10), big.NewInt(int64(vv.Exp-aa.Exp)), nil) vvInt.Mul(vvInt, mul) } else if aa.Exp > vv.Exp { mul := (&big.Int{}).Exp(big.NewInt(10), big.NewInt(int64(aa.Exp-vv.Exp)), nil) aaInt.Mul(aaInt, mul) } return aaInt.Cmp(vvInt) == 0 } } func mustParseNumeric(t *testing.T, src string) pgtype.Numeric { var n pgtype.Numeric plan := pgtype.NumericCodec{}.PlanScan(nil, pgtype.NumericOID, pgtype.TextFormatCode, &n) require.NotNil(t, plan) err := plan.Scan([]byte(src), &n) require.NoError(t, err) return n } func TestNumericCodec(t *testing.T) { skipCockroachDB(t, "server formats numeric text format differently") max := new(big.Int).Exp(big.NewInt(10), big.NewInt(147454), nil) max.Add(max, big.NewInt(1)) longestNumeric := pgtype.Numeric{Int: max, Exp: -16383, Valid: true} pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "numeric", []pgxtest.ValueRoundTripTest{ {mustParseNumeric(t, "1"), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, "1"))}, {mustParseNumeric(t, "3.14159"), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, "3.14159"))}, {mustParseNumeric(t, "100010001"), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, "100010001"))}, {mustParseNumeric(t, "100010001.0001"), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, "100010001.0001"))}, {mustParseNumeric(t, "4237234789234789289347892374324872138321894178943189043890124832108934.43219085471578891547854892438945012347981"), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, "4237234789234789289347892374324872138321894178943189043890124832108934.43219085471578891547854892438945012347981"))}, {mustParseNumeric(t, "0.8925092023480223478923478978978937897879595901237890234789243679037419057877231734823098432903527585734549035904590854890345905434578345789347890402348952348905890489054234237489234987723894789234"), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, "0.8925092023480223478923478978978937897879595901237890234789243679037419057877231734823098432903527585734549035904590854890345905434578345789347890402348952348905890489054234237489234987723894789234"))}, {mustParseNumeric(t, "0.000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000123"), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, "0.000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000123"))}, {mustParseNumeric(t, "67"+strings.Repeat("0", 44535)+".0"), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, "67"+strings.Repeat("0", 44535)+".0"))}, {pgtype.Numeric{Int: mustParseBigInt(t, "243723409723490243842378942378901237502734019231380123"), Exp: 23790, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{Int: mustParseBigInt(t, "243723409723490243842378942378901237502734019231380123"), Exp: 23790, Valid: true})}, {pgtype.Numeric{Int: mustParseBigInt(t, "2437"), Exp: 23790, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{Int: mustParseBigInt(t, "2437"), Exp: 23790, Valid: true})}, {pgtype.Numeric{Int: mustParseBigInt(t, "43723409723490243842378942378901237502734019231380123"), Exp: 80, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{Int: mustParseBigInt(t, "43723409723490243842378942378901237502734019231380123"), Exp: 80, Valid: true})}, {pgtype.Numeric{Int: mustParseBigInt(t, "43723409723490243842378942378901237502734019231380123"), Exp: 81, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{Int: mustParseBigInt(t, "43723409723490243842378942378901237502734019231380123"), Exp: 81, Valid: true})}, {pgtype.Numeric{Int: mustParseBigInt(t, "43723409723490243842378942378901237502734019231380123"), Exp: 82, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{Int: mustParseBigInt(t, "43723409723490243842378942378901237502734019231380123"), Exp: 82, Valid: true})}, {pgtype.Numeric{Int: mustParseBigInt(t, "43723409723490243842378942378901237502734019231380123"), Exp: 83, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{Int: mustParseBigInt(t, "43723409723490243842378942378901237502734019231380123"), Exp: 83, Valid: true})}, {pgtype.Numeric{Int: mustParseBigInt(t, "43723409723490243842378942378901237502734019231380123"), Exp: 84, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{Int: mustParseBigInt(t, "43723409723490243842378942378901237502734019231380123"), Exp: 84, Valid: true})}, {pgtype.Numeric{Int: mustParseBigInt(t, "913423409823409243892349028349023482934092340892390101"), Exp: -14021, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{Int: mustParseBigInt(t, "913423409823409243892349028349023482934092340892390101"), Exp: -14021, Valid: true})}, {pgtype.Numeric{Int: mustParseBigInt(t, "13423409823409243892349028349023482934092340892390101"), Exp: -90, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{Int: mustParseBigInt(t, "13423409823409243892349028349023482934092340892390101"), Exp: -90, Valid: true})}, {pgtype.Numeric{Int: mustParseBigInt(t, "13423409823409243892349028349023482934092340892390101"), Exp: -91, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{Int: mustParseBigInt(t, "13423409823409243892349028349023482934092340892390101"), Exp: -91, Valid: true})}, {pgtype.Numeric{Int: mustParseBigInt(t, "13423409823409243892349028349023482934092340892390101"), Exp: -92, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{Int: mustParseBigInt(t, "13423409823409243892349028349023482934092340892390101"), Exp: -92, Valid: true})}, {pgtype.Numeric{Int: mustParseBigInt(t, "13423409823409243892349028349023482934092340892390101"), Exp: -93, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{Int: mustParseBigInt(t, "13423409823409243892349028349023482934092340892390101"), Exp: -93, Valid: true})}, {pgtype.Numeric{NaN: true, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{NaN: true, Valid: true})}, {longestNumeric, new(pgtype.Numeric), isExpectedEqNumeric(longestNumeric)}, {mustParseNumeric(t, "1"), new(int64), isExpectedEq(int64(1))}, {math.NaN(), new(float64), func(a any) bool { return math.IsNaN(a.(float64)) }}, {float32(math.NaN()), new(float32), func(a any) bool { return math.IsNaN(float64(a.(float32))) }}, {int64(-1), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, "-1"))}, {int64(0), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, "0"))}, {int64(1), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, "1"))}, {int64(math.MinInt64), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, strconv.FormatInt(math.MinInt64, 10)))}, {int64(math.MinInt64 + 1), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, strconv.FormatInt(math.MinInt64+1, 10)))}, {int64(math.MaxInt64), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, strconv.FormatInt(math.MaxInt64, 10)))}, {int64(math.MaxInt64 - 1), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, strconv.FormatInt(math.MaxInt64-1, 10)))}, {uint64(100), new(uint64), isExpectedEq(uint64(100))}, {uint64(math.MaxUint64), new(uint64), isExpectedEq(uint64(math.MaxUint64))}, {uint(math.MaxUint), new(uint), isExpectedEq(uint(math.MaxUint))}, {uint(100), new(uint), isExpectedEq(uint(100))}, {"1.23", new(string), isExpectedEq("1.23")}, {pgtype.Numeric{}, new(pgtype.Numeric), isExpectedEq(pgtype.Numeric{})}, {nil, new(pgtype.Numeric), isExpectedEq(pgtype.Numeric{})}, {mustParseNumeric(t, "1"), new(string), isExpectedEq("1")}, {pgtype.Numeric{NaN: true, Valid: true}, new(string), isExpectedEq("NaN")}, }) pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "int8", []pgxtest.ValueRoundTripTest{ {mustParseNumeric(t, "-1"), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, "-1"))}, {mustParseNumeric(t, "0"), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, "0"))}, {mustParseNumeric(t, "1"), new(pgtype.Numeric), isExpectedEqNumeric(mustParseNumeric(t, "1"))}, }) } func TestNumericCodecInfinity(t *testing.T) { skipCockroachDB(t, "server formats numeric text format differently") skipPostgreSQLVersionLessThan(t, 14) pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "numeric", []pgxtest.ValueRoundTripTest{ {math.Inf(1), new(float64), isExpectedEq(math.Inf(1))}, {float32(math.Inf(1)), new(float32), isExpectedEq(float32(math.Inf(1)))}, {math.Inf(-1), new(float64), isExpectedEq(math.Inf(-1))}, {float32(math.Inf(-1)), new(float32), isExpectedEq(float32(math.Inf(-1)))}, {pgtype.Numeric{InfinityModifier: pgtype.Infinity, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{InfinityModifier: pgtype.Infinity, Valid: true})}, {pgtype.Numeric{InfinityModifier: pgtype.NegativeInfinity, Valid: true}, new(pgtype.Numeric), isExpectedEqNumeric(pgtype.Numeric{InfinityModifier: pgtype.NegativeInfinity, Valid: true})}, {pgtype.Numeric{InfinityModifier: pgtype.Infinity, Valid: true}, new(string), isExpectedEq("Infinity")}, {pgtype.Numeric{InfinityModifier: pgtype.NegativeInfinity, Valid: true}, new(string), isExpectedEq("-Infinity")}, }) } func TestNumericFloat64Valuer(t *testing.T) { for i, tt := range []struct { n pgtype.Numeric f pgtype.Float8 }{ {mustParseNumeric(t, "1"), pgtype.Float8{Float64: 1, Valid: true}}, {mustParseNumeric(t, "0.0000000000000000001"), pgtype.Float8{Float64: 0.0000000000000000001, Valid: true}}, {mustParseNumeric(t, "-99999999999"), pgtype.Float8{Float64: -99999999999, Valid: true}}, {pgtype.Numeric{InfinityModifier: pgtype.Infinity, Valid: true}, pgtype.Float8{Float64: math.Inf(1), Valid: true}}, {pgtype.Numeric{InfinityModifier: pgtype.NegativeInfinity, Valid: true}, pgtype.Float8{Float64: math.Inf(-1), Valid: true}}, {pgtype.Numeric{Valid: true}, pgtype.Float8{Valid: true}}, {pgtype.Numeric{}, pgtype.Float8{}}, } { f, err := tt.n.Float64Value() assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.f, f, "%d", i) } f, err := pgtype.Numeric{NaN: true, Valid: true}.Float64Value() assert.NoError(t, err) assert.True(t, math.IsNaN(f.Float64)) assert.True(t, f.Valid) } func TestNumericCodecFuzz(t *testing.T) { skipCockroachDB(t, "server formats numeric text format differently") r := rand.New(rand.NewPCG(0, 0)) max := &big.Int{} max.SetString("9999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999", 10) tests := make([]pgxtest.ValueRoundTripTest, 0, 2000) for range 10 { for j := -50; j < 50; j++ { byteLen := (max.BitLen() + 7) / 8 bytes := make([]byte, byteLen) for k := 0; k < byteLen; { val := r.Uint64() for b := 0; b < 8 && k < byteLen; b++ { bytes[k] = byte(val >> (b * 8)) k++ } } num := new(big.Int).SetBytes(bytes) num.Mod(num, max) n := pgtype.Numeric{Int: num, Exp: int32(j), Valid: true} tests = append(tests, pgxtest.ValueRoundTripTest{n, new(pgtype.Numeric), isExpectedEqNumeric(n)}) negNum := &big.Int{} negNum.Neg(num) n = pgtype.Numeric{Int: negNum, Exp: int32(j), Valid: true} tests = append(tests, pgxtest.ValueRoundTripTest{n, new(pgtype.Numeric), isExpectedEqNumeric(n)}) } } pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "numeric", tests) } func TestNumericMarshalJSON(t *testing.T) { skipCockroachDB(t, "server formats numeric text format differently") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { for i, tt := range []struct { decString string }{ {"NaN"}, {"0"}, {"1"}, {"-1"}, {"1000000000000000000"}, {"1234.56789"}, {"1.56789"}, {"0.00000000000056789"}, {"0.00123000"}, {"123e-3"}, {"243723409723490243842378942378901237502734019231380123e23790"}, {"3409823409243892349028349023482934092340892390101e-14021"}, {"-1.1"}, {"-1.0231"}, {"-10.0231"}, {"-0.1"}, // failed with "invalid character '.' in numeric literal" {"-0.01"}, // failed with "invalid character '-' after decimal point in numeric literal" {"-0.001"}, // failed with "invalid character '-' after top-level value" } { var num pgtype.Numeric var pgJSON string err := conn.QueryRow(ctx, `select $1::numeric, to_json($1::numeric)`, tt.decString).Scan(&num, &pgJSON) require.NoErrorf(t, err, "%d", i) goJSON, err := json.Marshal(num) require.NoErrorf(t, err, "%d", i) require.Equal(t, pgJSON, string(goJSON)) } }) } func TestNumericUnmarshalJSON(t *testing.T) { tests := []struct { name string want *pgtype.Numeric src []byte wantErr bool }{ { name: "null", want: &pgtype.Numeric{}, src: []byte(`null`), wantErr: false, }, { name: "NaN", want: &pgtype.Numeric{Valid: true, NaN: true}, src: []byte(`"NaN"`), wantErr: false, }, { name: "0", want: &pgtype.Numeric{Valid: true, Int: big.NewInt(0)}, src: []byte("0"), wantErr: false, }, { name: "1", want: &pgtype.Numeric{Valid: true, Int: big.NewInt(1)}, src: []byte("1"), wantErr: false, }, { name: "-1", want: &pgtype.Numeric{Valid: true, Int: big.NewInt(-1)}, src: []byte("-1"), wantErr: false, }, { name: "bigInt", want: &pgtype.Numeric{Valid: true, Int: big.NewInt(1), Exp: 30}, src: []byte("1000000000000000000000000000000"), wantErr: false, }, { name: "float: 1234.56789", want: &pgtype.Numeric{Valid: true, Int: big.NewInt(123456789), Exp: -5}, src: []byte("1234.56789"), wantErr: false, }, { name: "invalid value", want: &pgtype.Numeric{}, src: []byte("0xffff"), wantErr: true, }, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { got := &pgtype.Numeric{} if err := got.UnmarshalJSON(tt.src); (err != nil) != tt.wantErr { t.Errorf("UnmarshalJSON() error = %v, wantErr %v", err, tt.wantErr) } if !reflect.DeepEqual(got, tt.want) { t.Errorf("UnmarshalJSON() got = %v, want %v", got, tt.want) } }) } } pgx-5.8.0/pgtype/path.go000066400000000000000000000123221512357711200151210ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "fmt" "math" "strconv" "strings" "github.com/jackc/pgx/v5/internal/pgio" ) type PathScanner interface { ScanPath(v Path) error } type PathValuer interface { PathValue() (Path, error) } type Path struct { P []Vec2 Closed bool Valid bool } // ScanPath implements the [PathScanner] interface. func (path *Path) ScanPath(v Path) error { *path = v return nil } // PathValue implements the [PathValuer] interface. func (path Path) PathValue() (Path, error) { return path, nil } // Scan implements the [database/sql.Scanner] interface. func (path *Path) Scan(src any) error { if src == nil { *path = Path{} return nil } switch src := src.(type) { case string: return scanPlanTextAnyToPathScanner{}.Scan([]byte(src), path) } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (path Path) Value() (driver.Value, error) { if !path.Valid { return nil, nil } buf, err := PathCodec{}.PlanEncode(nil, 0, TextFormatCode, path).Encode(path, nil) if err != nil { return nil, err } return string(buf), err } type PathCodec struct{} func (PathCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (PathCodec) PreferredFormat() int16 { return BinaryFormatCode } func (PathCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(PathValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanPathCodecBinary{} case TextFormatCode: return encodePlanPathCodecText{} } return nil } type encodePlanPathCodecBinary struct{} func (encodePlanPathCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { path, err := value.(PathValuer).PathValue() if err != nil { return nil, err } if !path.Valid { return nil, nil } var closeByte byte if path.Closed { closeByte = 1 } buf = append(buf, closeByte) buf = pgio.AppendInt32(buf, int32(len(path.P))) for _, p := range path.P { buf = pgio.AppendUint64(buf, math.Float64bits(p.X)) buf = pgio.AppendUint64(buf, math.Float64bits(p.Y)) } return buf, nil } type encodePlanPathCodecText struct{} func (encodePlanPathCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { path, err := value.(PathValuer).PathValue() if err != nil { return nil, err } if !path.Valid { return nil, nil } var startByte, endByte byte if path.Closed { startByte = '(' endByte = ')' } else { startByte = '[' endByte = ']' } buf = append(buf, startByte) for i, p := range path.P { if i > 0 { buf = append(buf, ',') } buf = append(buf, fmt.Sprintf(`(%s,%s)`, strconv.FormatFloat(p.X, 'f', -1, 64), strconv.FormatFloat(p.Y, 'f', -1, 64), )...) } buf = append(buf, endByte) return buf, nil } func (PathCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case PathScanner: return scanPlanBinaryPathToPathScanner{} } case TextFormatCode: switch target.(type) { case PathScanner: return scanPlanTextAnyToPathScanner{} } } return nil } type scanPlanBinaryPathToPathScanner struct{} func (scanPlanBinaryPathToPathScanner) Scan(src []byte, dst any) error { scanner := (dst).(PathScanner) if src == nil { return scanner.ScanPath(Path{}) } if len(src) < 5 { return fmt.Errorf("invalid length for Path: %v", len(src)) } closed := src[0] == 1 pointCount := int(binary.BigEndian.Uint32(src[1:])) rp := 5 if 5+pointCount*16 != len(src) { return fmt.Errorf("invalid length for Path with %d points: %v", pointCount, len(src)) } points := make([]Vec2, pointCount) for i := range points { x := binary.BigEndian.Uint64(src[rp:]) rp += 8 y := binary.BigEndian.Uint64(src[rp:]) rp += 8 points[i] = Vec2{math.Float64frombits(x), math.Float64frombits(y)} } return scanner.ScanPath(Path{ P: points, Closed: closed, Valid: true, }) } type scanPlanTextAnyToPathScanner struct{} func (scanPlanTextAnyToPathScanner) Scan(src []byte, dst any) error { scanner := (dst).(PathScanner) if src == nil { return scanner.ScanPath(Path{}) } if len(src) < 7 { return fmt.Errorf("invalid length for Path: %v", len(src)) } closed := src[0] == '(' points := make([]Vec2, 0) str := string(src[2:]) for { end := strings.IndexByte(str, ',') x, err := strconv.ParseFloat(str[:end], 64) if err != nil { return err } str = str[end+1:] end = strings.IndexByte(str, ')') y, err := strconv.ParseFloat(str[:end], 64) if err != nil { return err } points = append(points, Vec2{x, y}) if end+3 < len(str) { str = str[end+3:] } else { break } } return scanner.ScanPath(Path{P: points, Closed: closed, Valid: true}) } func (c PathCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return codecDecodeToTextFormat(c, m, oid, format, src) } func (c PathCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var path Path err := codecScan(c, m, oid, format, src, &path) if err != nil { return nil, err } return path, nil } pgx-5.8.0/pgtype/path_test.go000066400000000000000000000032211512357711200161560ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func isExpectedEqPath(a any) func(any) bool { return func(v any) bool { ap := a.(pgtype.Path) vp := v.(pgtype.Path) if !(ap.Valid == vp.Valid && ap.Closed == vp.Closed && len(ap.P) == len(vp.P)) { return false } for i := range ap.P { if ap.P[i] != vp.P[i] { return false } } return true } } func TestPathTranscode(t *testing.T) { skipCockroachDB(t, "Server does not support type path") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "path", []pgxtest.ValueRoundTripTest{ { pgtype.Path{ P: []pgtype.Vec2{{3.14, 1.678901234}, {7.1, 5.234}}, Closed: false, Valid: true, }, new(pgtype.Path), isExpectedEqPath(pgtype.Path{ P: []pgtype.Vec2{{3.14, 1.678901234}, {7.1, 5.234}}, Closed: false, Valid: true, }), }, { pgtype.Path{ P: []pgtype.Vec2{{3.14, 1.678}, {7.1, 5.234}, {23.1, 9.34}}, Closed: true, Valid: true, }, new(pgtype.Path), isExpectedEqPath(pgtype.Path{ P: []pgtype.Vec2{{3.14, 1.678}, {7.1, 5.234}, {23.1, 9.34}}, Closed: true, Valid: true, }), }, { pgtype.Path{ P: []pgtype.Vec2{{7.1, 1.678}, {-13.14, -5.234}}, Closed: true, Valid: true, }, new(pgtype.Path), isExpectedEqPath(pgtype.Path{ P: []pgtype.Vec2{{7.1, 1.678}, {-13.14, -5.234}}, Closed: true, Valid: true, }), }, {pgtype.Path{}, new(pgtype.Path), isExpectedEqPath(pgtype.Path{})}, {nil, new(pgtype.Path), isExpectedEqPath(pgtype.Path{})}, }) } pgx-5.8.0/pgtype/pgtype.go000066400000000000000000001707371512357711200155140ustar00rootroot00000000000000package pgtype import ( "database/sql" "database/sql/driver" "errors" "fmt" "net" "net/netip" "reflect" "time" ) // PostgreSQL oids for common types const ( BoolOID = 16 ByteaOID = 17 QCharOID = 18 NameOID = 19 Int8OID = 20 Int2OID = 21 Int4OID = 23 TextOID = 25 OIDOID = 26 TIDOID = 27 XIDOID = 28 CIDOID = 29 JSONOID = 114 XMLOID = 142 XMLArrayOID = 143 JSONArrayOID = 199 XID8ArrayOID = 271 PointOID = 600 LsegOID = 601 PathOID = 602 BoxOID = 603 PolygonOID = 604 LineOID = 628 LineArrayOID = 629 CIDROID = 650 CIDRArrayOID = 651 Float4OID = 700 Float8OID = 701 CircleOID = 718 CircleArrayOID = 719 UnknownOID = 705 Macaddr8OID = 774 MacaddrOID = 829 InetOID = 869 BoolArrayOID = 1000 QCharArrayOID = 1002 NameArrayOID = 1003 Int2ArrayOID = 1005 Int4ArrayOID = 1007 TextArrayOID = 1009 TIDArrayOID = 1010 ByteaArrayOID = 1001 XIDArrayOID = 1011 CIDArrayOID = 1012 BPCharArrayOID = 1014 VarcharArrayOID = 1015 Int8ArrayOID = 1016 PointArrayOID = 1017 LsegArrayOID = 1018 PathArrayOID = 1019 BoxArrayOID = 1020 Float4ArrayOID = 1021 Float8ArrayOID = 1022 PolygonArrayOID = 1027 OIDArrayOID = 1028 ACLItemOID = 1033 ACLItemArrayOID = 1034 MacaddrArrayOID = 1040 InetArrayOID = 1041 BPCharOID = 1042 VarcharOID = 1043 DateOID = 1082 TimeOID = 1083 TimestampOID = 1114 TimestampArrayOID = 1115 DateArrayOID = 1182 TimeArrayOID = 1183 TimestamptzOID = 1184 TimestamptzArrayOID = 1185 IntervalOID = 1186 IntervalArrayOID = 1187 NumericArrayOID = 1231 TimetzOID = 1266 TimetzArrayOID = 1270 BitOID = 1560 BitArrayOID = 1561 VarbitOID = 1562 VarbitArrayOID = 1563 NumericOID = 1700 RecordOID = 2249 RecordArrayOID = 2287 UUIDOID = 2950 UUIDArrayOID = 2951 JSONBOID = 3802 JSONBArrayOID = 3807 DaterangeOID = 3912 DaterangeArrayOID = 3913 Int4rangeOID = 3904 Int4rangeArrayOID = 3905 NumrangeOID = 3906 NumrangeArrayOID = 3907 TsrangeOID = 3908 TsrangeArrayOID = 3909 TstzrangeOID = 3910 TstzrangeArrayOID = 3911 Int8rangeOID = 3926 Int8rangeArrayOID = 3927 JSONPathOID = 4072 JSONPathArrayOID = 4073 Int4multirangeOID = 4451 NummultirangeOID = 4532 TsmultirangeOID = 4533 TstzmultirangeOID = 4534 DatemultirangeOID = 4535 Int8multirangeOID = 4536 XID8OID = 5069 Int4multirangeArrayOID = 6150 NummultirangeArrayOID = 6151 TsmultirangeArrayOID = 6152 TstzmultirangeArrayOID = 6153 DatemultirangeArrayOID = 6155 Int8multirangeArrayOID = 6157 ) type InfinityModifier int8 const ( Infinity InfinityModifier = 1 Finite InfinityModifier = 0 NegativeInfinity InfinityModifier = -Infinity ) func (im InfinityModifier) String() string { switch im { case Finite: return "finite" case Infinity: return "infinity" case NegativeInfinity: return "-infinity" default: return "invalid" } } // PostgreSQL format codes const ( TextFormatCode = 0 BinaryFormatCode = 1 ) // A Codec converts between Go and PostgreSQL values. A Codec must not be mutated after it is registered with a Map. type Codec interface { // FormatSupported returns true if the format is supported. FormatSupported(int16) bool // PreferredFormat returns the preferred format. PreferredFormat() int16 // PlanEncode returns an EncodePlan for encoding value into PostgreSQL format for oid and format. If no plan can be // found then nil is returned. PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan // PlanScan returns a ScanPlan for scanning a PostgreSQL value into a destination with the same type as target. If // no plan can be found then nil is returned. PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan // DecodeDatabaseSQLValue returns src decoded into a value compatible with the sql.Scanner interface. DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) // DecodeValue returns src decoded into its default format. DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) } type nullAssignmentError struct { dst any } func (e *nullAssignmentError) Error() string { return fmt.Sprintf("cannot assign NULL to %T", e.dst) } // Type represents a PostgreSQL data type. It must not be mutated after it is registered with a Map. type Type struct { Codec Codec Name string OID uint32 } // Map is the mapping between PostgreSQL server types and Go type handling logic. It can encode values for // transmission to a PostgreSQL server and scan received values. type Map struct { oidToType map[uint32]*Type nameToType map[string]*Type reflectTypeToName map[reflect.Type]string oidToFormatCode map[uint32]int16 reflectTypeToType map[reflect.Type]*Type memoizedEncodePlans map[uint32]map[reflect.Type][2]EncodePlan // TryWrapEncodePlanFuncs is a slice of functions that will wrap a value that cannot be encoded by the Codec. Every // time a wrapper is found the PlanEncode method will be recursively called with the new value. This allows several layers of wrappers // to be built up. There are default functions placed in this slice by NewMap(). In most cases these functions // should run last. i.e. Additional functions should typically be prepended not appended. TryWrapEncodePlanFuncs []TryWrapEncodePlanFunc // TryWrapScanPlanFuncs is a slice of functions that will wrap a target that cannot be scanned into by the Codec. Every // time a wrapper is found the PlanScan method will be recursively called with the new target. This allows several layers of wrappers // to be built up. There are default functions placed in this slice by NewMap(). In most cases these functions // should run last. i.e. Additional functions should typically be prepended not appended. TryWrapScanPlanFuncs []TryWrapScanPlanFunc } // Copy returns a new Map containing the same registered types. func (m *Map) Copy() *Map { newMap := NewMap() for _, type_ := range m.oidToType { newMap.RegisterType(type_) } return newMap } func NewMap() *Map { defaultMapInitOnce.Do(initDefaultMap) return &Map{ oidToType: make(map[uint32]*Type), nameToType: make(map[string]*Type), reflectTypeToName: make(map[reflect.Type]string), oidToFormatCode: make(map[uint32]int16), memoizedEncodePlans: make(map[uint32]map[reflect.Type][2]EncodePlan), TryWrapEncodePlanFuncs: []TryWrapEncodePlanFunc{ TryWrapDerefPointerEncodePlan, TryWrapBuiltinTypeEncodePlan, TryWrapFindUnderlyingTypeEncodePlan, TryWrapStructEncodePlan, TryWrapSliceEncodePlan, TryWrapMultiDimSliceEncodePlan, TryWrapArrayEncodePlan, }, TryWrapScanPlanFuncs: []TryWrapScanPlanFunc{ TryPointerPointerScanPlan, TryWrapBuiltinTypeScanPlan, TryFindUnderlyingTypeScanPlan, TryWrapStructScanPlan, TryWrapPtrSliceScanPlan, TryWrapPtrMultiDimSliceScanPlan, TryWrapPtrArrayScanPlan, }, } } // RegisterTypes registers multiple data types in the sequence they are provided. func (m *Map) RegisterTypes(types []*Type) { for _, t := range types { m.RegisterType(t) } } // RegisterType registers a data type with the Map. t must not be mutated after it is registered. func (m *Map) RegisterType(t *Type) { m.oidToType[t.OID] = t m.nameToType[t.Name] = t m.oidToFormatCode[t.OID] = t.Codec.PreferredFormat() // Invalidated by type registration m.reflectTypeToType = nil for k := range m.memoizedEncodePlans { delete(m.memoizedEncodePlans, k) } } // RegisterDefaultPgType registers a mapping of a Go type to a PostgreSQL type name. Typically the data type to be // encoded or decoded is determined by the PostgreSQL OID. But if the OID of a value to be encoded or decoded is // unknown, this additional mapping will be used by TypeForValue to determine a suitable data type. func (m *Map) RegisterDefaultPgType(value any, name string) { m.reflectTypeToName[reflect.TypeOf(value)] = name // Invalidated by type registration m.reflectTypeToType = nil for k := range m.memoizedEncodePlans { delete(m.memoizedEncodePlans, k) } } // TypeForOID returns the Type registered for the given OID. The returned Type must not be mutated. func (m *Map) TypeForOID(oid uint32) (*Type, bool) { if dt, ok := m.oidToType[oid]; ok { return dt, true } dt, ok := defaultMap.oidToType[oid] return dt, ok } // TypeForName returns the Type registered for the given name. The returned Type must not be mutated. func (m *Map) TypeForName(name string) (*Type, bool) { if dt, ok := m.nameToType[name]; ok { return dt, true } dt, ok := defaultMap.nameToType[name] return dt, ok } func (m *Map) buildReflectTypeToType() { m.reflectTypeToType = make(map[reflect.Type]*Type) for reflectType, name := range m.reflectTypeToName { if dt, ok := m.TypeForName(name); ok { m.reflectTypeToType[reflectType] = dt } } } // TypeForValue finds a data type suitable for v. Use RegisterType to register types that can encode and decode // themselves. Use RegisterDefaultPgType to register that can be handled by a registered data type. The returned Type // must not be mutated. func (m *Map) TypeForValue(v any) (*Type, bool) { if m.reflectTypeToType == nil { m.buildReflectTypeToType() } if dt, ok := m.reflectTypeToType[reflect.TypeOf(v)]; ok { return dt, true } dt, ok := defaultMap.reflectTypeToType[reflect.TypeOf(v)] return dt, ok } // FormatCodeForOID returns the preferred format code for type oid. If the type is not registered it returns the text // format code. func (m *Map) FormatCodeForOID(oid uint32) int16 { if fc, ok := m.oidToFormatCode[oid]; ok { return fc } if fc, ok := defaultMap.oidToFormatCode[oid]; ok { return fc } return TextFormatCode } // EncodePlan is a precompiled plan to encode a particular type into a particular OID and format. type EncodePlan interface { // Encode appends the encoded bytes of value to buf. If value is the SQL value NULL then append nothing and return // (nil, nil). The caller of Encode is responsible for writing the correct NULL value or the length of the data // written. Encode(value any, buf []byte) (newBuf []byte, err error) } // ScanPlan is a precompiled plan to scan into a type of destination. type ScanPlan interface { // Scan scans src into target. src is only valid during the call to Scan. The ScanPlan must not retain a reference to // src. Scan(src []byte, target any) error } type scanPlanCodecSQLScanner struct { c Codec m *Map oid uint32 formatCode int16 } func (plan *scanPlanCodecSQLScanner) Scan(src []byte, dst any) error { value, err := plan.c.DecodeDatabaseSQLValue(plan.m, plan.oid, plan.formatCode, src) if err != nil { return err } scanner := dst.(sql.Scanner) return scanner.Scan(value) } type scanPlanSQLScanner struct { formatCode int16 } func (plan *scanPlanSQLScanner) Scan(src []byte, dst any) error { scanner := dst.(sql.Scanner) if src == nil { // This is necessary because interface value []byte:nil does not equal nil:nil for the binary format path and the // text format path would be converted to empty string. return scanner.Scan(nil) } else if plan.formatCode == BinaryFormatCode { return scanner.Scan(src) } else { return scanner.Scan(string(src)) } } type scanPlanString struct{} func (scanPlanString) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p := (dst).(*string) *p = string(src) return nil } type scanPlanAnyTextToBytes struct{} func (scanPlanAnyTextToBytes) Scan(src []byte, dst any) error { dstBuf := dst.(*[]byte) if src == nil { *dstBuf = nil return nil } *dstBuf = make([]byte, len(src)) copy(*dstBuf, src) return nil } type scanPlanFail struct { m *Map oid uint32 formatCode int16 } func (plan *scanPlanFail) Scan(src []byte, dst any) error { // If src is NULL it might be possible to scan into dst even though it is the types are not compatible. While this // may seem to be a contrived case it can occur when selecting NULL directly. PostgreSQL assigns it the type of text. // It would be surprising to the caller to have to cast the NULL (e.g. `select null::int`). So try to figure out a // compatible data type for dst and scan with that. // // See https://github.com/jackc/pgx/issues/1326 if src == nil { // As a horrible hack try all types to find anything that can scan into dst. for oid := range plan.m.oidToType { // using planScan instead of Scan or PlanScan to avoid polluting the planned scan cache. plan := plan.m.planScan(oid, plan.formatCode, dst, 0) if _, ok := plan.(*scanPlanFail); !ok { return plan.Scan(src, dst) } } for oid := range defaultMap.oidToType { if _, ok := plan.m.oidToType[oid]; !ok { plan := plan.m.planScan(oid, plan.formatCode, dst, 0) if _, ok := plan.(*scanPlanFail); !ok { return plan.Scan(src, dst) } } } } var format string switch plan.formatCode { case TextFormatCode: format = "text" case BinaryFormatCode: format = "binary" default: format = fmt.Sprintf("unknown %d", plan.formatCode) } var dataTypeName string if t, ok := plan.m.TypeForOID(plan.oid); ok { dataTypeName = t.Name } else { dataTypeName = "unknown type" } return fmt.Errorf("cannot scan %s (OID %d) in %v format into %T", dataTypeName, plan.oid, format, dst) } // TryWrapScanPlanFunc is a function that tries to create a wrapper plan for target. If successful it returns a plan // that will convert the target passed to Scan and then call the next plan. nextTarget is target as it will be converted // by plan. It must be used to find another suitable ScanPlan. When it is found SetNext must be called on plan for it // to be usabled. ok indicates if a suitable wrapper was found. type TryWrapScanPlanFunc func(target any) (plan WrappedScanPlanNextSetter, nextTarget any, ok bool) type pointerPointerScanPlan struct { dstType reflect.Type next ScanPlan } func (plan *pointerPointerScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *pointerPointerScanPlan) Scan(src []byte, dst any) error { el := reflect.ValueOf(dst).Elem() if src == nil { el.Set(reflect.Zero(el.Type())) return nil } el.Set(reflect.New(el.Type().Elem())) return plan.next.Scan(src, el.Interface()) } // TryPointerPointerScanPlan handles a pointer to a pointer by setting the target to nil for SQL NULL and allocating and // scanning for non-NULL. func TryPointerPointerScanPlan(target any) (plan WrappedScanPlanNextSetter, nextTarget any, ok bool) { if dstValue := reflect.ValueOf(target); dstValue.Kind() == reflect.Ptr { elemValue := dstValue.Elem() if elemValue.Kind() == reflect.Ptr { plan = &pointerPointerScanPlan{dstType: dstValue.Type()} return plan, reflect.Zero(elemValue.Type()).Interface(), true } } return nil, nil, false } // SkipUnderlyingTypePlanner prevents PlanScan and PlanDecode from trying to use the underlying type. type SkipUnderlyingTypePlanner interface { SkipUnderlyingTypePlan() } var elemKindToPointerTypes map[reflect.Kind]reflect.Type = map[reflect.Kind]reflect.Type{ reflect.Int: reflect.TypeOf(new(int)), reflect.Int8: reflect.TypeOf(new(int8)), reflect.Int16: reflect.TypeOf(new(int16)), reflect.Int32: reflect.TypeOf(new(int32)), reflect.Int64: reflect.TypeOf(new(int64)), reflect.Uint: reflect.TypeOf(new(uint)), reflect.Uint8: reflect.TypeOf(new(uint8)), reflect.Uint16: reflect.TypeOf(new(uint16)), reflect.Uint32: reflect.TypeOf(new(uint32)), reflect.Uint64: reflect.TypeOf(new(uint64)), reflect.Float32: reflect.TypeOf(new(float32)), reflect.Float64: reflect.TypeOf(new(float64)), reflect.String: reflect.TypeOf(new(string)), reflect.Bool: reflect.TypeOf(new(bool)), } type underlyingTypeScanPlan struct { dstType reflect.Type nextDstType reflect.Type next ScanPlan } func (plan *underlyingTypeScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *underlyingTypeScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, reflect.ValueOf(dst).Convert(plan.nextDstType).Interface()) } // TryFindUnderlyingTypeScanPlan tries to convert to a Go builtin type. e.g. If value was of type MyString and // MyString was defined as a string then a wrapper plan would be returned that converts MyString to string. func TryFindUnderlyingTypeScanPlan(dst any) (plan WrappedScanPlanNextSetter, nextDst any, ok bool) { if _, ok := dst.(SkipUnderlyingTypePlanner); ok { return nil, nil, false } dstValue := reflect.ValueOf(dst) if dstValue.Kind() == reflect.Ptr { var elemValue reflect.Value if dstValue.IsNil() { elemValue = reflect.New(dstValue.Type().Elem()).Elem() } else { elemValue = dstValue.Elem() } nextDstType := elemKindToPointerTypes[elemValue.Kind()] if nextDstType == nil { if elemValue.Kind() == reflect.Slice { if elemValue.Type().Elem().Kind() == reflect.Uint8 { var v *[]byte nextDstType = reflect.TypeOf(v) } } // Get underlying type of any array. // https://github.com/jackc/pgx/issues/2107 if elemValue.Kind() == reflect.Array { nextDstType = reflect.PointerTo(reflect.ArrayOf(elemValue.Len(), elemValue.Type().Elem())) } } if nextDstType != nil && dstValue.Type() != nextDstType && dstValue.CanConvert(nextDstType) { return &underlyingTypeScanPlan{dstType: dstValue.Type(), nextDstType: nextDstType}, dstValue.Convert(nextDstType).Interface(), true } } return nil, nil, false } type WrappedScanPlanNextSetter interface { SetNext(ScanPlan) ScanPlan } // TryWrapBuiltinTypeScanPlan tries to wrap a builtin type with a wrapper that provides additional methods. e.g. If // value was of type int32 then a wrapper plan would be returned that converts target to a value that implements // Int64Scanner. func TryWrapBuiltinTypeScanPlan(target any) (plan WrappedScanPlanNextSetter, nextDst any, ok bool) { switch target := target.(type) { case *int8: return &wrapInt8ScanPlan{}, (*int8Wrapper)(target), true case *int16: return &wrapInt16ScanPlan{}, (*int16Wrapper)(target), true case *int32: return &wrapInt32ScanPlan{}, (*int32Wrapper)(target), true case *int64: return &wrapInt64ScanPlan{}, (*int64Wrapper)(target), true case *int: return &wrapIntScanPlan{}, (*intWrapper)(target), true case *uint8: return &wrapUint8ScanPlan{}, (*uint8Wrapper)(target), true case *uint16: return &wrapUint16ScanPlan{}, (*uint16Wrapper)(target), true case *uint32: return &wrapUint32ScanPlan{}, (*uint32Wrapper)(target), true case *uint64: return &wrapUint64ScanPlan{}, (*uint64Wrapper)(target), true case *uint: return &wrapUintScanPlan{}, (*uintWrapper)(target), true case *float32: return &wrapFloat32ScanPlan{}, (*float32Wrapper)(target), true case *float64: return &wrapFloat64ScanPlan{}, (*float64Wrapper)(target), true case *string: return &wrapStringScanPlan{}, (*stringWrapper)(target), true case *time.Time: return &wrapTimeScanPlan{}, (*timeWrapper)(target), true case *time.Duration: return &wrapDurationScanPlan{}, (*durationWrapper)(target), true case *net.IPNet: return &wrapNetIPNetScanPlan{}, (*netIPNetWrapper)(target), true case *net.IP: return &wrapNetIPScanPlan{}, (*netIPWrapper)(target), true case *netip.Prefix: return &wrapNetipPrefixScanPlan{}, (*netipPrefixWrapper)(target), true case *netip.Addr: return &wrapNetipAddrScanPlan{}, (*netipAddrWrapper)(target), true case *map[string]*string: return &wrapMapStringToPointerStringScanPlan{}, (*mapStringToPointerStringWrapper)(target), true case *map[string]string: return &wrapMapStringToStringScanPlan{}, (*mapStringToStringWrapper)(target), true case *[16]byte: return &wrapByte16ScanPlan{}, (*byte16Wrapper)(target), true case *[]byte: return &wrapByteSliceScanPlan{}, (*byteSliceWrapper)(target), true } return nil, nil, false } type wrapInt8ScanPlan struct { next ScanPlan } func (plan *wrapInt8ScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapInt8ScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*int8Wrapper)(dst.(*int8))) } type wrapInt16ScanPlan struct { next ScanPlan } func (plan *wrapInt16ScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapInt16ScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*int16Wrapper)(dst.(*int16))) } type wrapInt32ScanPlan struct { next ScanPlan } func (plan *wrapInt32ScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapInt32ScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*int32Wrapper)(dst.(*int32))) } type wrapInt64ScanPlan struct { next ScanPlan } func (plan *wrapInt64ScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapInt64ScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*int64Wrapper)(dst.(*int64))) } type wrapIntScanPlan struct { next ScanPlan } func (plan *wrapIntScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapIntScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*intWrapper)(dst.(*int))) } type wrapUint8ScanPlan struct { next ScanPlan } func (plan *wrapUint8ScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapUint8ScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*uint8Wrapper)(dst.(*uint8))) } type wrapUint16ScanPlan struct { next ScanPlan } func (plan *wrapUint16ScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapUint16ScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*uint16Wrapper)(dst.(*uint16))) } type wrapUint32ScanPlan struct { next ScanPlan } func (plan *wrapUint32ScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapUint32ScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*uint32Wrapper)(dst.(*uint32))) } type wrapUint64ScanPlan struct { next ScanPlan } func (plan *wrapUint64ScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapUint64ScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*uint64Wrapper)(dst.(*uint64))) } type wrapUintScanPlan struct { next ScanPlan } func (plan *wrapUintScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapUintScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*uintWrapper)(dst.(*uint))) } type wrapFloat32ScanPlan struct { next ScanPlan } func (plan *wrapFloat32ScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapFloat32ScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*float32Wrapper)(dst.(*float32))) } type wrapFloat64ScanPlan struct { next ScanPlan } func (plan *wrapFloat64ScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapFloat64ScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*float64Wrapper)(dst.(*float64))) } type wrapStringScanPlan struct { next ScanPlan } func (plan *wrapStringScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapStringScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*stringWrapper)(dst.(*string))) } type wrapTimeScanPlan struct { next ScanPlan } func (plan *wrapTimeScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapTimeScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*timeWrapper)(dst.(*time.Time))) } type wrapDurationScanPlan struct { next ScanPlan } func (plan *wrapDurationScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapDurationScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*durationWrapper)(dst.(*time.Duration))) } type wrapNetIPNetScanPlan struct { next ScanPlan } func (plan *wrapNetIPNetScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapNetIPNetScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*netIPNetWrapper)(dst.(*net.IPNet))) } type wrapNetIPScanPlan struct { next ScanPlan } func (plan *wrapNetIPScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapNetIPScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*netIPWrapper)(dst.(*net.IP))) } type wrapNetipPrefixScanPlan struct { next ScanPlan } func (plan *wrapNetipPrefixScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapNetipPrefixScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*netipPrefixWrapper)(dst.(*netip.Prefix))) } type wrapNetipAddrScanPlan struct { next ScanPlan } func (plan *wrapNetipAddrScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapNetipAddrScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*netipAddrWrapper)(dst.(*netip.Addr))) } type wrapMapStringToPointerStringScanPlan struct { next ScanPlan } func (plan *wrapMapStringToPointerStringScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapMapStringToPointerStringScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*mapStringToPointerStringWrapper)(dst.(*map[string]*string))) } type wrapMapStringToStringScanPlan struct { next ScanPlan } func (plan *wrapMapStringToStringScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapMapStringToStringScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*mapStringToStringWrapper)(dst.(*map[string]string))) } type wrapByte16ScanPlan struct { next ScanPlan } func (plan *wrapByte16ScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapByte16ScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*byte16Wrapper)(dst.(*[16]byte))) } type wrapByteSliceScanPlan struct { next ScanPlan } func (plan *wrapByteSliceScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapByteSliceScanPlan) Scan(src []byte, dst any) error { return plan.next.Scan(src, (*byteSliceWrapper)(dst.(*[]byte))) } type pointerEmptyInterfaceScanPlan struct { codec Codec m *Map oid uint32 formatCode int16 } func (plan *pointerEmptyInterfaceScanPlan) Scan(src []byte, dst any) error { value, err := plan.codec.DecodeValue(plan.m, plan.oid, plan.formatCode, src) if err != nil { return err } ptrAny := dst.(*any) *ptrAny = value return nil } // TryWrapStructPlan tries to wrap a struct with a wrapper that implements CompositeIndexGetter. func TryWrapStructScanPlan(target any) (plan WrappedScanPlanNextSetter, nextValue any, ok bool) { targetValue := reflect.ValueOf(target) if targetValue.Kind() != reflect.Ptr { return nil, nil, false } var targetElemValue reflect.Value if targetValue.IsNil() { targetElemValue = reflect.Zero(targetValue.Type().Elem()) } else { targetElemValue = targetValue.Elem() } targetElemType := targetElemValue.Type() if targetElemType.Kind() == reflect.Struct { exportedFields := getExportedFieldValues(targetElemValue) if len(exportedFields) == 0 { return nil, nil, false } w := ptrStructWrapper{ s: target, exportedFields: exportedFields, } return &wrapAnyPtrStructScanPlan{}, &w, true } return nil, nil, false } type wrapAnyPtrStructScanPlan struct { next ScanPlan } func (plan *wrapAnyPtrStructScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapAnyPtrStructScanPlan) Scan(src []byte, target any) error { w := ptrStructWrapper{ s: target, exportedFields: getExportedFieldValues(reflect.ValueOf(target).Elem()), } return plan.next.Scan(src, &w) } // TryWrapPtrSliceScanPlan tries to wrap a pointer to a single dimension slice. func TryWrapPtrSliceScanPlan(target any) (plan WrappedScanPlanNextSetter, nextValue any, ok bool) { // Avoid using reflect path for common types. switch target := target.(type) { case *[]int16: return &wrapPtrSliceScanPlan[int16]{}, (*FlatArray[int16])(target), true case *[]int32: return &wrapPtrSliceScanPlan[int32]{}, (*FlatArray[int32])(target), true case *[]int64: return &wrapPtrSliceScanPlan[int64]{}, (*FlatArray[int64])(target), true case *[]float32: return &wrapPtrSliceScanPlan[float32]{}, (*FlatArray[float32])(target), true case *[]float64: return &wrapPtrSliceScanPlan[float64]{}, (*FlatArray[float64])(target), true case *[]string: return &wrapPtrSliceScanPlan[string]{}, (*FlatArray[string])(target), true case *[]time.Time: return &wrapPtrSliceScanPlan[time.Time]{}, (*FlatArray[time.Time])(target), true } targetType := reflect.TypeOf(target) if targetType.Kind() != reflect.Ptr { return nil, nil, false } targetElemType := targetType.Elem() if targetElemType.Kind() == reflect.Slice { slice := reflect.New(targetElemType).Elem() return &wrapPtrSliceReflectScanPlan{}, &anySliceArrayReflect{slice: slice}, true } return nil, nil, false } type wrapPtrSliceScanPlan[T any] struct { next ScanPlan } func (plan *wrapPtrSliceScanPlan[T]) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapPtrSliceScanPlan[T]) Scan(src []byte, target any) error { return plan.next.Scan(src, (*FlatArray[T])(target.(*[]T))) } type wrapPtrSliceReflectScanPlan struct { next ScanPlan } func (plan *wrapPtrSliceReflectScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapPtrSliceReflectScanPlan) Scan(src []byte, target any) error { return plan.next.Scan(src, &anySliceArrayReflect{slice: reflect.ValueOf(target).Elem()}) } // TryWrapPtrMultiDimSliceScanPlan tries to wrap a pointer to a multi-dimension slice. func TryWrapPtrMultiDimSliceScanPlan(target any) (plan WrappedScanPlanNextSetter, nextValue any, ok bool) { targetValue := reflect.ValueOf(target) if targetValue.Kind() != reflect.Ptr { return nil, nil, false } targetElemValue := targetValue.Elem() if targetElemValue.Kind() == reflect.Slice { elemElemKind := targetElemValue.Type().Elem().Kind() if elemElemKind == reflect.Slice { if !isRagged(targetElemValue) { return &wrapPtrMultiDimSliceScanPlan{}, &anyMultiDimSliceArray{slice: targetValue.Elem()}, true } } } return nil, nil, false } type wrapPtrMultiDimSliceScanPlan struct { next ScanPlan } func (plan *wrapPtrMultiDimSliceScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapPtrMultiDimSliceScanPlan) Scan(src []byte, target any) error { return plan.next.Scan(src, &anyMultiDimSliceArray{slice: reflect.ValueOf(target).Elem()}) } // TryWrapPtrArrayScanPlan tries to wrap a pointer to a single dimension array. func TryWrapPtrArrayScanPlan(target any) (plan WrappedScanPlanNextSetter, nextValue any, ok bool) { targetValue := reflect.ValueOf(target) if targetValue.Kind() != reflect.Ptr { return nil, nil, false } targetElemValue := targetValue.Elem() if targetElemValue.Kind() == reflect.Array { return &wrapPtrArrayReflectScanPlan{}, &anyArrayArrayReflect{array: targetElemValue}, true } return nil, nil, false } type wrapPtrArrayReflectScanPlan struct { next ScanPlan } func (plan *wrapPtrArrayReflectScanPlan) SetNext(next ScanPlan) { plan.next = next } func (plan *wrapPtrArrayReflectScanPlan) Scan(src []byte, target any) error { return plan.next.Scan(src, &anyArrayArrayReflect{array: reflect.ValueOf(target).Elem()}) } // PlanScan prepares a plan to scan a value into target. func (m *Map) PlanScan(oid uint32, formatCode int16, target any) ScanPlan { return m.planScan(oid, formatCode, target, 0) } func (m *Map) planScan(oid uint32, formatCode int16, target any, depth int) ScanPlan { if depth > 8 { return &scanPlanFail{m: m, oid: oid, formatCode: formatCode} } if target == nil { return &scanPlanFail{m: m, oid: oid, formatCode: formatCode} } if _, ok := target.(*UndecodedBytes); ok { return scanPlanAnyToUndecodedBytes{} } switch formatCode { case BinaryFormatCode: switch target.(type) { case *string: switch oid { case TextOID, VarcharOID: return scanPlanString{} } } case TextFormatCode: switch target.(type) { case *string: return scanPlanString{} case *[]byte: if oid != ByteaOID { return scanPlanAnyTextToBytes{} } case TextScanner: return scanPlanTextAnyToTextScanner{} } } var dt *Type if dataType, ok := m.TypeForOID(oid); ok { dt = dataType } else if dataType, ok := m.TypeForValue(target); ok { dt = dataType oid = dt.OID // Preserve assumed OID in case we are recursively called below. } if dt != nil { if plan := dt.Codec.PlanScan(m, oid, formatCode, target); plan != nil { return plan } } // This needs to happen before trying m.TryWrapScanPlanFuncs. Otherwise, a sql.Scanner would not get called if it was // defined on a type that could be unwrapped such as `type myString string`. // // https://github.com/jackc/pgtype/issues/197 if _, ok := target.(sql.Scanner); ok { if dt == nil { return &scanPlanSQLScanner{formatCode: formatCode} } else { return &scanPlanCodecSQLScanner{c: dt.Codec, m: m, oid: oid, formatCode: formatCode} } } for _, f := range m.TryWrapScanPlanFuncs { if wrapperPlan, nextDst, ok := f(target); ok { if nextPlan := m.planScan(oid, formatCode, nextDst, depth+1); nextPlan != nil { if _, failed := nextPlan.(*scanPlanFail); !failed { wrapperPlan.SetNext(nextPlan) return wrapperPlan } } } } if _, ok := target.(*any); ok { var codec Codec if dt != nil { codec = dt.Codec } else { if formatCode == TextFormatCode { codec = TextCodec{} } else { codec = ByteaCodec{} } } return &pointerEmptyInterfaceScanPlan{codec: codec, m: m, oid: oid, formatCode: formatCode} } return &scanPlanFail{m: m, oid: oid, formatCode: formatCode} } func (m *Map) Scan(oid uint32, formatCode int16, src []byte, dst any) error { if dst == nil { return nil } plan := m.PlanScan(oid, formatCode, dst) return plan.Scan(src, dst) } var ErrScanTargetTypeChanged = errors.New("scan target type changed") func codecScan(codec Codec, m *Map, oid uint32, format int16, src []byte, dst any) error { scanPlan := codec.PlanScan(m, oid, format, dst) if scanPlan == nil { return fmt.Errorf("PlanScan did not find a plan") } return scanPlan.Scan(src, dst) } func codecDecodeToTextFormat(codec Codec, m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } if format == TextFormatCode { return string(src), nil } else { value, err := codec.DecodeValue(m, oid, format, src) if err != nil { return nil, err } buf, err := m.Encode(oid, TextFormatCode, value, nil) if err != nil { return nil, err } return string(buf), nil } } // PlanEncode returns an EncodePlan for encoding value into PostgreSQL format for oid and format. If no plan can be // found then nil is returned. func (m *Map) PlanEncode(oid uint32, format int16, value any) EncodePlan { return m.planEncodeDepth(oid, format, value, 0) } func (m *Map) planEncodeDepth(oid uint32, format int16, value any, depth int) EncodePlan { // Guard against infinite recursion. if depth > 8 { return nil } oidMemo := m.memoizedEncodePlans[oid] if oidMemo == nil { oidMemo = make(map[reflect.Type][2]EncodePlan) m.memoizedEncodePlans[oid] = oidMemo } targetReflectType := reflect.TypeOf(value) typeMemo := oidMemo[targetReflectType] plan := typeMemo[format] if plan == nil { plan = m.planEncode(oid, format, value, depth) typeMemo[format] = plan oidMemo[targetReflectType] = typeMemo } return plan } func (m *Map) planEncode(oid uint32, format int16, value any, depth int) EncodePlan { if format == TextFormatCode { switch value.(type) { case string: return encodePlanStringToAnyTextFormat{} case TextValuer: return encodePlanTextValuerToAnyTextFormat{} } } var dt *Type if dataType, ok := m.TypeForOID(oid); ok { dt = dataType } else { // If no type for the OID was found, then either it is unknowable (e.g. the simple protocol) or it is an // unregistered type. In either case try to find the type and OID that matches the value (e.g. a []byte would be // registered to PostgreSQL bytea). if dataType, ok := m.TypeForValue(value); ok { dt = dataType oid = dt.OID // Preserve assumed OID in case we are recursively called below. } } if dt != nil { if plan := dt.Codec.PlanEncode(m, oid, format, value); plan != nil { return plan } } for _, f := range m.TryWrapEncodePlanFuncs { if wrapperPlan, nextValue, ok := f(value); ok { if nextPlan := m.planEncodeDepth(oid, format, nextValue, depth+1); nextPlan != nil { wrapperPlan.SetNext(nextPlan) return wrapperPlan } } } if _, ok := value.(driver.Valuer); ok { return &encodePlanDriverValuer{m: m, oid: oid, formatCode: format} } return nil } type encodePlanStringToAnyTextFormat struct{} func (encodePlanStringToAnyTextFormat) Encode(value any, buf []byte) (newBuf []byte, err error) { s := value.(string) return append(buf, s...), nil } type encodePlanTextValuerToAnyTextFormat struct{} func (encodePlanTextValuerToAnyTextFormat) Encode(value any, buf []byte) (newBuf []byte, err error) { t, err := value.(TextValuer).TextValue() if err != nil { return nil, err } if !t.Valid { return nil, nil } return append(buf, t.String...), nil } type encodePlanDriverValuer struct { m *Map oid uint32 formatCode int16 } func (plan *encodePlanDriverValuer) Encode(value any, buf []byte) (newBuf []byte, err error) { dv := value.(driver.Valuer) if dv == nil { return nil, nil } v, err := dv.Value() if err != nil { return nil, err } if v == nil { return nil, nil } newBuf, err = plan.m.Encode(plan.oid, plan.formatCode, v, buf) if err == nil { return newBuf, nil } s, ok := v.(string) if !ok { return nil, err } var scannedValue any scanErr := plan.m.Scan(plan.oid, TextFormatCode, []byte(s), &scannedValue) if scanErr != nil { return nil, err } // Prevent infinite loop. We can't encode this. See https://github.com/jackc/pgx/issues/1331. if reflect.TypeOf(value) == reflect.TypeOf(scannedValue) { return nil, fmt.Errorf("tried to encode %v via encoding to text and scanning but failed due to receiving same type back", value) } var err2 error newBuf, err2 = plan.m.Encode(plan.oid, BinaryFormatCode, scannedValue, buf) if err2 != nil { return nil, err } return newBuf, nil } // TryWrapEncodePlanFunc is a function that tries to create a wrapper plan for value. If successful it returns a plan // that will convert the value passed to Encode and then call the next plan. nextValue is value as it will be converted // by plan. It must be used to find another suitable EncodePlan. When it is found SetNext must be called on plan for it // to be usabled. ok indicates if a suitable wrapper was found. type TryWrapEncodePlanFunc func(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) type derefPointerEncodePlan struct { next EncodePlan } func (plan *derefPointerEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *derefPointerEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { ptr := reflect.ValueOf(value) if ptr.IsNil() { return nil, nil } return plan.next.Encode(ptr.Elem().Interface(), buf) } // TryWrapDerefPointerEncodePlan tries to dereference a pointer. e.g. If value was of type *string then a wrapper plan // would be returned that dereferences the value. func TryWrapDerefPointerEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) { if _, ok := value.(driver.Valuer); ok { return nil, nil, false } if valueType := reflect.TypeOf(value); valueType != nil && valueType.Kind() == reflect.Ptr { return &derefPointerEncodePlan{}, reflect.New(valueType.Elem()).Elem().Interface(), true } return nil, nil, false } var kindToTypes map[reflect.Kind]reflect.Type = map[reflect.Kind]reflect.Type{ reflect.Int: reflect.TypeOf(int(0)), reflect.Int8: reflect.TypeOf(int8(0)), reflect.Int16: reflect.TypeOf(int16(0)), reflect.Int32: reflect.TypeOf(int32(0)), reflect.Int64: reflect.TypeOf(int64(0)), reflect.Uint: reflect.TypeOf(uint(0)), reflect.Uint8: reflect.TypeOf(uint8(0)), reflect.Uint16: reflect.TypeOf(uint16(0)), reflect.Uint32: reflect.TypeOf(uint32(0)), reflect.Uint64: reflect.TypeOf(uint64(0)), reflect.Float32: reflect.TypeOf(float32(0)), reflect.Float64: reflect.TypeOf(float64(0)), reflect.String: reflect.TypeOf(""), reflect.Bool: reflect.TypeOf(false), } var byteSliceType = reflect.TypeOf([]byte{}) type underlyingTypeEncodePlan struct { nextValueType reflect.Type next EncodePlan } func (plan *underlyingTypeEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *underlyingTypeEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(reflect.ValueOf(value).Convert(plan.nextValueType).Interface(), buf) } // TryWrapFindUnderlyingTypeEncodePlan tries to convert to a Go builtin type. e.g. If value was of type MyString and // MyString was defined as a string then a wrapper plan would be returned that converts MyString to string. func TryWrapFindUnderlyingTypeEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) { if value == nil { return nil, nil, false } if _, ok := value.(driver.Valuer); ok { return nil, nil, false } if _, ok := value.(SkipUnderlyingTypePlanner); ok { return nil, nil, false } refValue := reflect.ValueOf(value) nextValueType := kindToTypes[refValue.Kind()] if nextValueType != nil && refValue.Type() != nextValueType { return &underlyingTypeEncodePlan{nextValueType: nextValueType}, refValue.Convert(nextValueType).Interface(), true } // []byte is a special case. It is a slice but we treat it as a scalar type. In the case of a named type like // json.RawMessage which is defined as []byte the underlying type should be considered as []byte. But any other slice // does not have a special underlying type. // // https://github.com/jackc/pgx/issues/1763 if refValue.Type() != byteSliceType && refValue.Type().AssignableTo(byteSliceType) { return &underlyingTypeEncodePlan{nextValueType: byteSliceType}, refValue.Convert(byteSliceType).Interface(), true } // Get underlying type of any array. // https://github.com/jackc/pgx/issues/2107 if refValue.Kind() == reflect.Array { underlyingArrayType := reflect.ArrayOf(refValue.Len(), refValue.Type().Elem()) if refValue.Type() != underlyingArrayType { return &underlyingTypeEncodePlan{nextValueType: underlyingArrayType}, refValue.Convert(underlyingArrayType).Interface(), true } } return nil, nil, false } type WrappedEncodePlanNextSetter interface { SetNext(EncodePlan) EncodePlan } // TryWrapBuiltinTypeEncodePlan tries to wrap a builtin type with a wrapper that provides additional methods. e.g. If // value was of type int32 then a wrapper plan would be returned that converts value to a type that implements // Int64Valuer. func TryWrapBuiltinTypeEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) { if _, ok := value.(driver.Valuer); ok { return nil, nil, false } switch value := value.(type) { case int8: return &wrapInt8EncodePlan{}, int8Wrapper(value), true case int16: return &wrapInt16EncodePlan{}, int16Wrapper(value), true case int32: return &wrapInt32EncodePlan{}, int32Wrapper(value), true case int64: return &wrapInt64EncodePlan{}, int64Wrapper(value), true case int: return &wrapIntEncodePlan{}, intWrapper(value), true case uint8: return &wrapUint8EncodePlan{}, uint8Wrapper(value), true case uint16: return &wrapUint16EncodePlan{}, uint16Wrapper(value), true case uint32: return &wrapUint32EncodePlan{}, uint32Wrapper(value), true case uint64: return &wrapUint64EncodePlan{}, uint64Wrapper(value), true case uint: return &wrapUintEncodePlan{}, uintWrapper(value), true case float32: return &wrapFloat32EncodePlan{}, float32Wrapper(value), true case float64: return &wrapFloat64EncodePlan{}, float64Wrapper(value), true case string: return &wrapStringEncodePlan{}, stringWrapper(value), true case time.Time: return &wrapTimeEncodePlan{}, timeWrapper(value), true case time.Duration: return &wrapDurationEncodePlan{}, durationWrapper(value), true case net.IPNet: return &wrapNetIPNetEncodePlan{}, netIPNetWrapper(value), true case net.IP: return &wrapNetIPEncodePlan{}, netIPWrapper(value), true case netip.Prefix: return &wrapNetipPrefixEncodePlan{}, netipPrefixWrapper(value), true case netip.Addr: return &wrapNetipAddrEncodePlan{}, netipAddrWrapper(value), true case map[string]*string: return &wrapMapStringToPointerStringEncodePlan{}, mapStringToPointerStringWrapper(value), true case map[string]string: return &wrapMapStringToStringEncodePlan{}, mapStringToStringWrapper(value), true case [16]byte: return &wrapByte16EncodePlan{}, byte16Wrapper(value), true case []byte: return &wrapByteSliceEncodePlan{}, byteSliceWrapper(value), true case fmt.Stringer: return &wrapFmtStringerEncodePlan{}, fmtStringerWrapper{value}, true } return nil, nil, false } type wrapInt8EncodePlan struct { next EncodePlan } func (plan *wrapInt8EncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapInt8EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(int8Wrapper(value.(int8)), buf) } type wrapInt16EncodePlan struct { next EncodePlan } func (plan *wrapInt16EncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapInt16EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(int16Wrapper(value.(int16)), buf) } type wrapInt32EncodePlan struct { next EncodePlan } func (plan *wrapInt32EncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapInt32EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(int32Wrapper(value.(int32)), buf) } type wrapInt64EncodePlan struct { next EncodePlan } func (plan *wrapInt64EncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapInt64EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(int64Wrapper(value.(int64)), buf) } type wrapIntEncodePlan struct { next EncodePlan } func (plan *wrapIntEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapIntEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(intWrapper(value.(int)), buf) } type wrapUint8EncodePlan struct { next EncodePlan } func (plan *wrapUint8EncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapUint8EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(uint8Wrapper(value.(uint8)), buf) } type wrapUint16EncodePlan struct { next EncodePlan } func (plan *wrapUint16EncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapUint16EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(uint16Wrapper(value.(uint16)), buf) } type wrapUint32EncodePlan struct { next EncodePlan } func (plan *wrapUint32EncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapUint32EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(uint32Wrapper(value.(uint32)), buf) } type wrapUint64EncodePlan struct { next EncodePlan } func (plan *wrapUint64EncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapUint64EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(uint64Wrapper(value.(uint64)), buf) } type wrapUintEncodePlan struct { next EncodePlan } func (plan *wrapUintEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapUintEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(uintWrapper(value.(uint)), buf) } type wrapFloat32EncodePlan struct { next EncodePlan } func (plan *wrapFloat32EncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapFloat32EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(float32Wrapper(value.(float32)), buf) } type wrapFloat64EncodePlan struct { next EncodePlan } func (plan *wrapFloat64EncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapFloat64EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(float64Wrapper(value.(float64)), buf) } type wrapStringEncodePlan struct { next EncodePlan } func (plan *wrapStringEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapStringEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(stringWrapper(value.(string)), buf) } type wrapTimeEncodePlan struct { next EncodePlan } func (plan *wrapTimeEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapTimeEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(timeWrapper(value.(time.Time)), buf) } type wrapDurationEncodePlan struct { next EncodePlan } func (plan *wrapDurationEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapDurationEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(durationWrapper(value.(time.Duration)), buf) } type wrapNetIPNetEncodePlan struct { next EncodePlan } func (plan *wrapNetIPNetEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapNetIPNetEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(netIPNetWrapper(value.(net.IPNet)), buf) } type wrapNetIPEncodePlan struct { next EncodePlan } func (plan *wrapNetIPEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapNetIPEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(netIPWrapper(value.(net.IP)), buf) } type wrapNetipPrefixEncodePlan struct { next EncodePlan } func (plan *wrapNetipPrefixEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapNetipPrefixEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(netipPrefixWrapper(value.(netip.Prefix)), buf) } type wrapNetipAddrEncodePlan struct { next EncodePlan } func (plan *wrapNetipAddrEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapNetipAddrEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(netipAddrWrapper(value.(netip.Addr)), buf) } type wrapMapStringToPointerStringEncodePlan struct { next EncodePlan } func (plan *wrapMapStringToPointerStringEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapMapStringToPointerStringEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(mapStringToPointerStringWrapper(value.(map[string]*string)), buf) } type wrapMapStringToStringEncodePlan struct { next EncodePlan } func (plan *wrapMapStringToStringEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapMapStringToStringEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(mapStringToStringWrapper(value.(map[string]string)), buf) } type wrapByte16EncodePlan struct { next EncodePlan } func (plan *wrapByte16EncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapByte16EncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(byte16Wrapper(value.([16]byte)), buf) } type wrapByteSliceEncodePlan struct { next EncodePlan } func (plan *wrapByteSliceEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapByteSliceEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(byteSliceWrapper(value.([]byte)), buf) } type wrapFmtStringerEncodePlan struct { next EncodePlan } func (plan *wrapFmtStringerEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapFmtStringerEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode(fmtStringerWrapper{value.(fmt.Stringer)}, buf) } // TryWrapStructPlan tries to wrap a struct with a wrapper that implements CompositeIndexGetter. func TryWrapStructEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) { if _, ok := value.(driver.Valuer); ok { return nil, nil, false } if valueType := reflect.TypeOf(value); valueType != nil && valueType.Kind() == reflect.Struct { exportedFields := getExportedFieldValues(reflect.ValueOf(value)) if len(exportedFields) == 0 { return nil, nil, false } w := structWrapper{ s: value, exportedFields: exportedFields, } return &wrapAnyStructEncodePlan{}, w, true } return nil, nil, false } type wrapAnyStructEncodePlan struct { next EncodePlan } func (plan *wrapAnyStructEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapAnyStructEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { w := structWrapper{ s: value, exportedFields: getExportedFieldValues(reflect.ValueOf(value)), } return plan.next.Encode(w, buf) } func getExportedFieldValues(structValue reflect.Value) []reflect.Value { structType := structValue.Type() exportedFields := make([]reflect.Value, 0, structValue.NumField()) for i := 0; i < structType.NumField(); i++ { sf := structType.Field(i) if sf.IsExported() { exportedFields = append(exportedFields, structValue.Field(i)) } } return exportedFields } func TryWrapSliceEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) { if _, ok := value.(driver.Valuer); ok { return nil, nil, false } // Avoid using reflect path for common types. switch value := value.(type) { case []int16: return &wrapSliceEncodePlan[int16]{}, (FlatArray[int16])(value), true case []int32: return &wrapSliceEncodePlan[int32]{}, (FlatArray[int32])(value), true case []int64: return &wrapSliceEncodePlan[int64]{}, (FlatArray[int64])(value), true case []float32: return &wrapSliceEncodePlan[float32]{}, (FlatArray[float32])(value), true case []float64: return &wrapSliceEncodePlan[float64]{}, (FlatArray[float64])(value), true case []string: return &wrapSliceEncodePlan[string]{}, (FlatArray[string])(value), true case []time.Time: return &wrapSliceEncodePlan[time.Time]{}, (FlatArray[time.Time])(value), true } if valueType := reflect.TypeOf(value); valueType != nil && valueType.Kind() == reflect.Slice { w := anySliceArrayReflect{ slice: reflect.ValueOf(value), } return &wrapSliceEncodeReflectPlan{}, w, true } return nil, nil, false } type wrapSliceEncodePlan[T any] struct { next EncodePlan } func (plan *wrapSliceEncodePlan[T]) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapSliceEncodePlan[T]) Encode(value any, buf []byte) (newBuf []byte, err error) { return plan.next.Encode((FlatArray[T])(value.([]T)), buf) } type wrapSliceEncodeReflectPlan struct { next EncodePlan } func (plan *wrapSliceEncodeReflectPlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapSliceEncodeReflectPlan) Encode(value any, buf []byte) (newBuf []byte, err error) { w := anySliceArrayReflect{ slice: reflect.ValueOf(value), } return plan.next.Encode(w, buf) } func TryWrapMultiDimSliceEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) { if _, ok := value.(driver.Valuer); ok { return nil, nil, false } sliceValue := reflect.ValueOf(value) if sliceValue.Kind() == reflect.Slice { valueElemType := sliceValue.Type().Elem() if valueElemType.Kind() == reflect.Slice { if !isRagged(sliceValue) { w := anyMultiDimSliceArray{ slice: reflect.ValueOf(value), } return &wrapMultiDimSliceEncodePlan{}, &w, true } } } return nil, nil, false } type wrapMultiDimSliceEncodePlan struct { next EncodePlan } func (plan *wrapMultiDimSliceEncodePlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapMultiDimSliceEncodePlan) Encode(value any, buf []byte) (newBuf []byte, err error) { w := anyMultiDimSliceArray{ slice: reflect.ValueOf(value), } return plan.next.Encode(&w, buf) } func TryWrapArrayEncodePlan(value any) (plan WrappedEncodePlanNextSetter, nextValue any, ok bool) { if _, ok := value.(driver.Valuer); ok { return nil, nil, false } if valueType := reflect.TypeOf(value); valueType != nil && valueType.Kind() == reflect.Array { w := anyArrayArrayReflect{ array: reflect.ValueOf(value), } return &wrapArrayEncodeReflectPlan{}, w, true } return nil, nil, false } type wrapArrayEncodeReflectPlan struct { next EncodePlan } func (plan *wrapArrayEncodeReflectPlan) SetNext(next EncodePlan) { plan.next = next } func (plan *wrapArrayEncodeReflectPlan) Encode(value any, buf []byte) (newBuf []byte, err error) { w := anyArrayArrayReflect{ array: reflect.ValueOf(value), } return plan.next.Encode(w, buf) } func newEncodeError(value any, m *Map, oid uint32, formatCode int16, err error) error { var format string switch formatCode { case TextFormatCode: format = "text" case BinaryFormatCode: format = "binary" default: format = fmt.Sprintf("unknown (%d)", formatCode) } var dataTypeName string if t, ok := m.TypeForOID(oid); ok { dataTypeName = t.Name } else { dataTypeName = "unknown type" } return fmt.Errorf("unable to encode %#v into %s format for %s (OID %d): %w", value, format, dataTypeName, oid, err) } // Encode appends the encoded bytes of value to buf. If value is the SQL value NULL then append nothing and return // (nil, nil). The caller of Encode is responsible for writing the correct NULL value or the length of the data // written. func (m *Map) Encode(oid uint32, formatCode int16, value any, buf []byte) (newBuf []byte, err error) { if isNil, callNilDriverValuer := isNilDriverValuer(value); isNil { if callNilDriverValuer { newBuf, err = (&encodePlanDriverValuer{m: m, oid: oid, formatCode: formatCode}).Encode(value, buf) if err != nil { return nil, newEncodeError(value, m, oid, formatCode, err) } return newBuf, nil } else { return nil, nil } } plan := m.PlanEncode(oid, formatCode, value) if plan == nil { return nil, newEncodeError(value, m, oid, formatCode, errors.New("cannot find encode plan")) } newBuf, err = plan.Encode(value, buf) if err != nil { return nil, newEncodeError(value, m, oid, formatCode, err) } return newBuf, nil } // SQLScanner returns a database/sql.Scanner for v. This is necessary for types like Array[T] and Range[T] where the // type needs assistance from Map to implement the sql.Scanner interface. It is not necessary for types like Box that // implement sql.Scanner directly. // // This uses the type of v to look up the PostgreSQL OID that v presumably came from. This means v must be registered // with m by calling RegisterDefaultPgType. func (m *Map) SQLScanner(v any) sql.Scanner { if s, ok := v.(sql.Scanner); ok { return s } return &sqlScannerWrapper{m: m, v: v} } type sqlScannerWrapper struct { m *Map v any } func (w *sqlScannerWrapper) Scan(src any) error { t, ok := w.m.TypeForValue(w.v) if !ok { return fmt.Errorf("cannot convert to sql.Scanner: cannot find registered type for %T", w.v) } var bufSrc []byte if src != nil { switch src := src.(type) { case string: bufSrc = []byte(src) case []byte: bufSrc = src default: bufSrc = fmt.Append(nil, bufSrc) } } return w.m.Scan(t.OID, TextFormatCode, bufSrc, w.v) } var valuerReflectType = reflect.TypeFor[driver.Valuer]() // isNilDriverValuer returns true if value is any type of nil unless it implements driver.Valuer. *T is not considered to implement // driver.Valuer if it is only implemented by T. func isNilDriverValuer(value any) (isNil, callNilDriverValuer bool) { if value == nil { return true, false } refVal := reflect.ValueOf(value) kind := refVal.Kind() switch kind { case reflect.Chan, reflect.Func, reflect.Map, reflect.Ptr, reflect.UnsafePointer, reflect.Interface, reflect.Slice: if !refVal.IsNil() { return false, false } if _, ok := value.(driver.Valuer); ok { if kind == reflect.Ptr { // The type assertion will succeed if driver.Valuer is implemented on T or *T. Check if it is implemented on *T // by checking if it is not implemented on *T. return true, !refVal.Type().Elem().Implements(valuerReflectType) } else { return true, true } } return true, false default: return false, false } } pgx-5.8.0/pgtype/pgtype_default.go000066400000000000000000000433051512357711200172060ustar00rootroot00000000000000package pgtype import ( "encoding/json" "encoding/xml" "net" "net/netip" "reflect" "sync" "time" ) var ( // defaultMap contains default mappings between PostgreSQL server types and Go type handling logic. defaultMap *Map defaultMapInitOnce = sync.Once{} ) func initDefaultMap() { defaultMap = &Map{ oidToType: make(map[uint32]*Type), nameToType: make(map[string]*Type), reflectTypeToName: make(map[reflect.Type]string), oidToFormatCode: make(map[uint32]int16), memoizedEncodePlans: make(map[uint32]map[reflect.Type][2]EncodePlan), TryWrapEncodePlanFuncs: []TryWrapEncodePlanFunc{ TryWrapDerefPointerEncodePlan, TryWrapBuiltinTypeEncodePlan, TryWrapFindUnderlyingTypeEncodePlan, TryWrapStructEncodePlan, TryWrapSliceEncodePlan, TryWrapMultiDimSliceEncodePlan, TryWrapArrayEncodePlan, }, TryWrapScanPlanFuncs: []TryWrapScanPlanFunc{ TryPointerPointerScanPlan, TryWrapBuiltinTypeScanPlan, TryFindUnderlyingTypeScanPlan, TryWrapStructScanPlan, TryWrapPtrSliceScanPlan, TryWrapPtrMultiDimSliceScanPlan, TryWrapPtrArrayScanPlan, }, } // Base types defaultMap.RegisterType(&Type{Name: "aclitem", OID: ACLItemOID, Codec: &TextFormatOnlyCodec{TextCodec{}}}) defaultMap.RegisterType(&Type{Name: "bit", OID: BitOID, Codec: BitsCodec{}}) defaultMap.RegisterType(&Type{Name: "bool", OID: BoolOID, Codec: BoolCodec{}}) defaultMap.RegisterType(&Type{Name: "box", OID: BoxOID, Codec: BoxCodec{}}) defaultMap.RegisterType(&Type{Name: "bpchar", OID: BPCharOID, Codec: TextCodec{}}) defaultMap.RegisterType(&Type{Name: "bytea", OID: ByteaOID, Codec: ByteaCodec{}}) defaultMap.RegisterType(&Type{Name: "char", OID: QCharOID, Codec: QCharCodec{}}) defaultMap.RegisterType(&Type{Name: "cid", OID: CIDOID, Codec: Uint32Codec{}}) defaultMap.RegisterType(&Type{Name: "cidr", OID: CIDROID, Codec: InetCodec{}}) defaultMap.RegisterType(&Type{Name: "circle", OID: CircleOID, Codec: CircleCodec{}}) defaultMap.RegisterType(&Type{Name: "date", OID: DateOID, Codec: DateCodec{}}) defaultMap.RegisterType(&Type{Name: "float4", OID: Float4OID, Codec: Float4Codec{}}) defaultMap.RegisterType(&Type{Name: "float8", OID: Float8OID, Codec: Float8Codec{}}) defaultMap.RegisterType(&Type{Name: "inet", OID: InetOID, Codec: InetCodec{}}) defaultMap.RegisterType(&Type{Name: "int2", OID: Int2OID, Codec: Int2Codec{}}) defaultMap.RegisterType(&Type{Name: "int4", OID: Int4OID, Codec: Int4Codec{}}) defaultMap.RegisterType(&Type{Name: "int8", OID: Int8OID, Codec: Int8Codec{}}) defaultMap.RegisterType(&Type{Name: "interval", OID: IntervalOID, Codec: IntervalCodec{}}) defaultMap.RegisterType(&Type{Name: "json", OID: JSONOID, Codec: &JSONCodec{Marshal: json.Marshal, Unmarshal: json.Unmarshal}}) defaultMap.RegisterType(&Type{Name: "jsonb", OID: JSONBOID, Codec: &JSONBCodec{Marshal: json.Marshal, Unmarshal: json.Unmarshal}}) defaultMap.RegisterType(&Type{Name: "jsonpath", OID: JSONPathOID, Codec: &TextFormatOnlyCodec{TextCodec{}}}) defaultMap.RegisterType(&Type{Name: "line", OID: LineOID, Codec: LineCodec{}}) defaultMap.RegisterType(&Type{Name: "lseg", OID: LsegOID, Codec: LsegCodec{}}) defaultMap.RegisterType(&Type{Name: "macaddr8", OID: Macaddr8OID, Codec: MacaddrCodec{}}) defaultMap.RegisterType(&Type{Name: "macaddr", OID: MacaddrOID, Codec: MacaddrCodec{}}) defaultMap.RegisterType(&Type{Name: "name", OID: NameOID, Codec: TextCodec{}}) defaultMap.RegisterType(&Type{Name: "numeric", OID: NumericOID, Codec: NumericCodec{}}) defaultMap.RegisterType(&Type{Name: "oid", OID: OIDOID, Codec: Uint32Codec{}}) defaultMap.RegisterType(&Type{Name: "path", OID: PathOID, Codec: PathCodec{}}) defaultMap.RegisterType(&Type{Name: "point", OID: PointOID, Codec: PointCodec{}}) defaultMap.RegisterType(&Type{Name: "polygon", OID: PolygonOID, Codec: PolygonCodec{}}) defaultMap.RegisterType(&Type{Name: "record", OID: RecordOID, Codec: RecordCodec{}}) defaultMap.RegisterType(&Type{Name: "text", OID: TextOID, Codec: TextCodec{}}) defaultMap.RegisterType(&Type{Name: "tid", OID: TIDOID, Codec: TIDCodec{}}) defaultMap.RegisterType(&Type{Name: "time", OID: TimeOID, Codec: TimeCodec{}}) defaultMap.RegisterType(&Type{Name: "timestamp", OID: TimestampOID, Codec: &TimestampCodec{}}) defaultMap.RegisterType(&Type{Name: "timestamptz", OID: TimestamptzOID, Codec: &TimestamptzCodec{}}) defaultMap.RegisterType(&Type{Name: "unknown", OID: UnknownOID, Codec: TextCodec{}}) defaultMap.RegisterType(&Type{Name: "uuid", OID: UUIDOID, Codec: UUIDCodec{}}) defaultMap.RegisterType(&Type{Name: "varbit", OID: VarbitOID, Codec: BitsCodec{}}) defaultMap.RegisterType(&Type{Name: "varchar", OID: VarcharOID, Codec: TextCodec{}}) defaultMap.RegisterType(&Type{Name: "xid", OID: XIDOID, Codec: Uint32Codec{}}) defaultMap.RegisterType(&Type{Name: "xid8", OID: XID8OID, Codec: Uint64Codec{}}) defaultMap.RegisterType(&Type{Name: "xml", OID: XMLOID, Codec: &XMLCodec{ Marshal: xml.Marshal, // xml.Unmarshal does not support unmarshalling into *any. However, XMLCodec.DecodeValue calls Unmarshal with a // *any. Wrap xml.Marshal with a function that copies the data into a new byte slice in this case. Not implementing // directly in XMLCodec.DecodeValue to allow for the unlikely possibility that someone uses an alternative XML // unmarshaler that does support unmarshalling into *any. // // https://github.com/jackc/pgx/issues/2227 // https://github.com/jackc/pgx/pull/2228 Unmarshal: func(data []byte, v any) error { if v, ok := v.(*any); ok { dstBuf := make([]byte, len(data)) copy(dstBuf, data) *v = dstBuf return nil } return xml.Unmarshal(data, v) }, }}) // Range types defaultMap.RegisterType(&Type{Name: "daterange", OID: DaterangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[DateOID]}}) defaultMap.RegisterType(&Type{Name: "int4range", OID: Int4rangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[Int4OID]}}) defaultMap.RegisterType(&Type{Name: "int8range", OID: Int8rangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[Int8OID]}}) defaultMap.RegisterType(&Type{Name: "numrange", OID: NumrangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[NumericOID]}}) defaultMap.RegisterType(&Type{Name: "tsrange", OID: TsrangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[TimestampOID]}}) defaultMap.RegisterType(&Type{Name: "tstzrange", OID: TstzrangeOID, Codec: &RangeCodec{ElementType: defaultMap.oidToType[TimestamptzOID]}}) // Multirange types defaultMap.RegisterType(&Type{Name: "datemultirange", OID: DatemultirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[DaterangeOID]}}) defaultMap.RegisterType(&Type{Name: "int4multirange", OID: Int4multirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[Int4rangeOID]}}) defaultMap.RegisterType(&Type{Name: "int8multirange", OID: Int8multirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[Int8rangeOID]}}) defaultMap.RegisterType(&Type{Name: "nummultirange", OID: NummultirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[NumrangeOID]}}) defaultMap.RegisterType(&Type{Name: "tsmultirange", OID: TsmultirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[TsrangeOID]}}) defaultMap.RegisterType(&Type{Name: "tstzmultirange", OID: TstzmultirangeOID, Codec: &MultirangeCodec{ElementType: defaultMap.oidToType[TstzrangeOID]}}) // Array types defaultMap.RegisterType(&Type{Name: "_aclitem", OID: ACLItemArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[ACLItemOID]}}) defaultMap.RegisterType(&Type{Name: "_bit", OID: BitArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[BitOID]}}) defaultMap.RegisterType(&Type{Name: "_bool", OID: BoolArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[BoolOID]}}) defaultMap.RegisterType(&Type{Name: "_box", OID: BoxArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[BoxOID]}}) defaultMap.RegisterType(&Type{Name: "_bpchar", OID: BPCharArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[BPCharOID]}}) defaultMap.RegisterType(&Type{Name: "_bytea", OID: ByteaArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[ByteaOID]}}) defaultMap.RegisterType(&Type{Name: "_char", OID: QCharArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[QCharOID]}}) defaultMap.RegisterType(&Type{Name: "_cid", OID: CIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[CIDOID]}}) defaultMap.RegisterType(&Type{Name: "_cidr", OID: CIDRArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[CIDROID]}}) defaultMap.RegisterType(&Type{Name: "_circle", OID: CircleArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[CircleOID]}}) defaultMap.RegisterType(&Type{Name: "_date", OID: DateArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[DateOID]}}) defaultMap.RegisterType(&Type{Name: "_daterange", OID: DaterangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[DaterangeOID]}}) defaultMap.RegisterType(&Type{Name: "_float4", OID: Float4ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Float4OID]}}) defaultMap.RegisterType(&Type{Name: "_float8", OID: Float8ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Float8OID]}}) defaultMap.RegisterType(&Type{Name: "_inet", OID: InetArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[InetOID]}}) defaultMap.RegisterType(&Type{Name: "_int2", OID: Int2ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int2OID]}}) defaultMap.RegisterType(&Type{Name: "_int4", OID: Int4ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int4OID]}}) defaultMap.RegisterType(&Type{Name: "_int4range", OID: Int4rangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int4rangeOID]}}) defaultMap.RegisterType(&Type{Name: "_int8", OID: Int8ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int8OID]}}) defaultMap.RegisterType(&Type{Name: "_int8range", OID: Int8rangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[Int8rangeOID]}}) defaultMap.RegisterType(&Type{Name: "_interval", OID: IntervalArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[IntervalOID]}}) defaultMap.RegisterType(&Type{Name: "_json", OID: JSONArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[JSONOID]}}) defaultMap.RegisterType(&Type{Name: "_jsonb", OID: JSONBArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[JSONBOID]}}) defaultMap.RegisterType(&Type{Name: "_jsonpath", OID: JSONPathArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[JSONPathOID]}}) defaultMap.RegisterType(&Type{Name: "_line", OID: LineArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[LineOID]}}) defaultMap.RegisterType(&Type{Name: "_lseg", OID: LsegArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[LsegOID]}}) defaultMap.RegisterType(&Type{Name: "_macaddr", OID: MacaddrArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[MacaddrOID]}}) defaultMap.RegisterType(&Type{Name: "_name", OID: NameArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[NameOID]}}) defaultMap.RegisterType(&Type{Name: "_numeric", OID: NumericArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[NumericOID]}}) defaultMap.RegisterType(&Type{Name: "_numrange", OID: NumrangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[NumrangeOID]}}) defaultMap.RegisterType(&Type{Name: "_oid", OID: OIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[OIDOID]}}) defaultMap.RegisterType(&Type{Name: "_path", OID: PathArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[PathOID]}}) defaultMap.RegisterType(&Type{Name: "_point", OID: PointArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[PointOID]}}) defaultMap.RegisterType(&Type{Name: "_polygon", OID: PolygonArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[PolygonOID]}}) defaultMap.RegisterType(&Type{Name: "_record", OID: RecordArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[RecordOID]}}) defaultMap.RegisterType(&Type{Name: "_text", OID: TextArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TextOID]}}) defaultMap.RegisterType(&Type{Name: "_tid", OID: TIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TIDOID]}}) defaultMap.RegisterType(&Type{Name: "_time", OID: TimeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TimeOID]}}) defaultMap.RegisterType(&Type{Name: "_timestamp", OID: TimestampArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TimestampOID]}}) defaultMap.RegisterType(&Type{Name: "_timestamptz", OID: TimestamptzArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TimestamptzOID]}}) defaultMap.RegisterType(&Type{Name: "_tsrange", OID: TsrangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TsrangeOID]}}) defaultMap.RegisterType(&Type{Name: "_tstzrange", OID: TstzrangeArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[TstzrangeOID]}}) defaultMap.RegisterType(&Type{Name: "_uuid", OID: UUIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[UUIDOID]}}) defaultMap.RegisterType(&Type{Name: "_varbit", OID: VarbitArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[VarbitOID]}}) defaultMap.RegisterType(&Type{Name: "_varchar", OID: VarcharArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[VarcharOID]}}) defaultMap.RegisterType(&Type{Name: "_xid", OID: XIDArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[XIDOID]}}) defaultMap.RegisterType(&Type{Name: "_xid8", OID: XID8ArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[XID8OID]}}) defaultMap.RegisterType(&Type{Name: "_xml", OID: XMLArrayOID, Codec: &ArrayCodec{ElementType: defaultMap.oidToType[XMLOID]}}) // Integer types that directly map to a PostgreSQL type registerDefaultPgTypeVariants[int16](defaultMap, "int2") registerDefaultPgTypeVariants[int32](defaultMap, "int4") registerDefaultPgTypeVariants[int64](defaultMap, "int8") // Integer types that do not have a direct match to a PostgreSQL type registerDefaultPgTypeVariants[int8](defaultMap, "int8") registerDefaultPgTypeVariants[int](defaultMap, "int8") registerDefaultPgTypeVariants[uint8](defaultMap, "int8") registerDefaultPgTypeVariants[uint16](defaultMap, "int8") registerDefaultPgTypeVariants[uint32](defaultMap, "int8") registerDefaultPgTypeVariants[uint64](defaultMap, "numeric") registerDefaultPgTypeVariants[uint](defaultMap, "numeric") registerDefaultPgTypeVariants[float32](defaultMap, "float4") registerDefaultPgTypeVariants[float64](defaultMap, "float8") registerDefaultPgTypeVariants[bool](defaultMap, "bool") registerDefaultPgTypeVariants[time.Time](defaultMap, "timestamptz") registerDefaultPgTypeVariants[time.Duration](defaultMap, "interval") registerDefaultPgTypeVariants[string](defaultMap, "text") registerDefaultPgTypeVariants[json.RawMessage](defaultMap, "json") registerDefaultPgTypeVariants[[]byte](defaultMap, "bytea") registerDefaultPgTypeVariants[net.IP](defaultMap, "inet") registerDefaultPgTypeVariants[net.IPNet](defaultMap, "cidr") registerDefaultPgTypeVariants[netip.Addr](defaultMap, "inet") registerDefaultPgTypeVariants[netip.Prefix](defaultMap, "cidr") // pgtype provided structs registerDefaultPgTypeVariants[Bits](defaultMap, "varbit") registerDefaultPgTypeVariants[Bool](defaultMap, "bool") registerDefaultPgTypeVariants[Box](defaultMap, "box") registerDefaultPgTypeVariants[Circle](defaultMap, "circle") registerDefaultPgTypeVariants[Date](defaultMap, "date") registerDefaultPgTypeVariants[Range[Date]](defaultMap, "daterange") registerDefaultPgTypeVariants[Multirange[Range[Date]]](defaultMap, "datemultirange") registerDefaultPgTypeVariants[Float4](defaultMap, "float4") registerDefaultPgTypeVariants[Float8](defaultMap, "float8") registerDefaultPgTypeVariants[Range[Float8]](defaultMap, "numrange") // There is no PostgreSQL builtin float8range so map it to numrange. registerDefaultPgTypeVariants[Multirange[Range[Float8]]](defaultMap, "nummultirange") // There is no PostgreSQL builtin float8multirange so map it to nummultirange. registerDefaultPgTypeVariants[Int2](defaultMap, "int2") registerDefaultPgTypeVariants[Int4](defaultMap, "int4") registerDefaultPgTypeVariants[Range[Int4]](defaultMap, "int4range") registerDefaultPgTypeVariants[Multirange[Range[Int4]]](defaultMap, "int4multirange") registerDefaultPgTypeVariants[Int8](defaultMap, "int8") registerDefaultPgTypeVariants[Range[Int8]](defaultMap, "int8range") registerDefaultPgTypeVariants[Multirange[Range[Int8]]](defaultMap, "int8multirange") registerDefaultPgTypeVariants[Interval](defaultMap, "interval") registerDefaultPgTypeVariants[Line](defaultMap, "line") registerDefaultPgTypeVariants[Lseg](defaultMap, "lseg") registerDefaultPgTypeVariants[Numeric](defaultMap, "numeric") registerDefaultPgTypeVariants[Range[Numeric]](defaultMap, "numrange") registerDefaultPgTypeVariants[Multirange[Range[Numeric]]](defaultMap, "nummultirange") registerDefaultPgTypeVariants[Path](defaultMap, "path") registerDefaultPgTypeVariants[Point](defaultMap, "point") registerDefaultPgTypeVariants[Polygon](defaultMap, "polygon") registerDefaultPgTypeVariants[TID](defaultMap, "tid") registerDefaultPgTypeVariants[Text](defaultMap, "text") registerDefaultPgTypeVariants[Time](defaultMap, "time") registerDefaultPgTypeVariants[Timestamp](defaultMap, "timestamp") registerDefaultPgTypeVariants[Timestamptz](defaultMap, "timestamptz") registerDefaultPgTypeVariants[Range[Timestamp]](defaultMap, "tsrange") registerDefaultPgTypeVariants[Multirange[Range[Timestamp]]](defaultMap, "tsmultirange") registerDefaultPgTypeVariants[Range[Timestamptz]](defaultMap, "tstzrange") registerDefaultPgTypeVariants[Multirange[Range[Timestamptz]]](defaultMap, "tstzmultirange") registerDefaultPgTypeVariants[UUID](defaultMap, "uuid") defaultMap.buildReflectTypeToType() } pgx-5.8.0/pgtype/pgtype_test.go000066400000000000000000000427511512357711200165450ustar00rootroot00000000000000package pgtype_test import ( "context" "database/sql" "database/sql/driver" "encoding/json" "errors" "fmt" "net" "os" "reflect" "regexp" "strconv" "testing" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" _ "github.com/jackc/pgx/v5/stdlib" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) var defaultConnTestRunner pgxtest.ConnTestRunner func init() { defaultConnTestRunner = pgxtest.DefaultConnTestRunner() defaultConnTestRunner.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config, err := pgx.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) return config } } // Test for renamed types type ( _string string _bool bool _uint8 uint8 _int8 int8 _int16 int16 _int16Slice []int16 _int32Slice []int32 _int64Slice []int64 _float32Slice []float32 _float64Slice []float64 _byteSlice []byte ) // unregisteredOID represents an actual type that is not registered. Cannot use 0 because that represents that the type // is not known (e.g. when using the simple protocol). const unregisteredOID = uint32(1) func mustParseInet(t testing.TB, s string) *net.IPNet { ip, ipnet, err := net.ParseCIDR(s) if err == nil { if ipv4 := ip.To4(); ipv4 != nil { ipnet.IP = ipv4 } else { ipnet.IP = ip } return ipnet } // May be bare IP address. // ip = net.ParseIP(s) if ip == nil { t.Fatal(errors.New("unable to parse inet address")) } ipnet = &net.IPNet{IP: ip, Mask: net.CIDRMask(128, 128)} if ipv4 := ip.To4(); ipv4 != nil { ipnet.IP = ipv4 ipnet.Mask = net.CIDRMask(32, 32) } return ipnet } func mustParseMacaddr(t testing.TB, s string) net.HardwareAddr { addr, err := net.ParseMAC(s) if err != nil { t.Fatal(err) } return addr } func skipCockroachDB(t testing.TB, msg string) { conn, err := pgx.Connect(context.Background(), os.Getenv("PGX_TEST_DATABASE")) if err != nil { t.Fatal(err) } defer conn.Close(context.Background()) if conn.PgConn().ParameterStatus("crdb_version") != "" { t.Skip(msg) } } func skipPostgreSQLVersionLessThan(t testing.TB, minVersion int64) { conn, err := pgx.Connect(context.Background(), os.Getenv("PGX_TEST_DATABASE")) if err != nil { t.Fatal(err) } defer conn.Close(context.Background()) serverVersionStr := conn.PgConn().ParameterStatus("server_version") serverVersionStr = regexp.MustCompile(`^[0-9]+`).FindString(serverVersionStr) // if not PostgreSQL do nothing if serverVersionStr == "" { return } serverVersion, err := strconv.ParseInt(serverVersionStr, 10, 64) require.NoError(t, err) if serverVersion < minVersion { t.Skipf("Test requires PostgreSQL v%d+", minVersion) } } // sqlScannerFunc lets an arbitrary function be used as a sql.Scanner. type sqlScannerFunc func(src any) error func (f sqlScannerFunc) Scan(src any) error { return f(src) } // driverValuerFunc lets an arbitrary function be used as a driver.Valuer. type driverValuerFunc func() (driver.Value, error) func (f driverValuerFunc) Value() (driver.Value, error) { return f() } func TestMapScanNilIsNoOp(t *testing.T) { m := pgtype.NewMap() err := m.Scan(pgtype.TextOID, pgx.TextFormatCode, []byte("foo"), nil) assert.NoError(t, err) } func TestMapScanTextFormatInterfacePtr(t *testing.T) { m := pgtype.NewMap() var got any err := m.Scan(pgtype.TextOID, pgx.TextFormatCode, []byte("foo"), &got) require.NoError(t, err) assert.Equal(t, "foo", got) } func TestMapScanTextFormatNonByteaIntoByteSlice(t *testing.T) { m := pgtype.NewMap() var got []byte err := m.Scan(pgtype.JSONBOID, pgx.TextFormatCode, []byte("{}"), &got) require.NoError(t, err) assert.Equal(t, []byte("{}"), got) } func TestMapScanBinaryFormatInterfacePtr(t *testing.T) { m := pgtype.NewMap() var got any err := m.Scan(pgtype.TextOID, pgx.BinaryFormatCode, []byte("foo"), &got) require.NoError(t, err) assert.Equal(t, "foo", got) } func TestMapScanUnknownOIDToPtrToAny(t *testing.T) { unknownOID := uint32(999999) srcBuf := []byte("foo") m := pgtype.NewMap() var a any err := m.Scan(unknownOID, pgx.TextFormatCode, srcBuf, &a) assert.NoError(t, err) assert.Equal(t, "foo", a) err = m.Scan(unknownOID, pgx.BinaryFormatCode, srcBuf, &a) assert.NoError(t, err) assert.Equal(t, []byte("foo"), a) } func TestMapScanUnknownOIDToStringsAndBytes(t *testing.T) { unknownOID := uint32(999999) srcBuf := []byte("foo") m := pgtype.NewMap() var s string err := m.Scan(unknownOID, pgx.TextFormatCode, srcBuf, &s) assert.NoError(t, err) assert.Equal(t, "foo", s) var rs _string err = m.Scan(unknownOID, pgx.TextFormatCode, srcBuf, &rs) assert.NoError(t, err) assert.Equal(t, "foo", string(rs)) var b []byte err = m.Scan(unknownOID, pgx.TextFormatCode, srcBuf, &b) assert.NoError(t, err) assert.Equal(t, []byte("foo"), b) var rb _byteSlice err = m.Scan(unknownOID, pgx.TextFormatCode, srcBuf, &rb) assert.NoError(t, err) assert.Equal(t, []byte("foo"), []byte(rb)) } func TestMapScanPointerToNilStructDoesNotCrash(t *testing.T) { m := pgtype.NewMap() type myStruct struct{} var p *myStruct err := m.Scan(0, pgx.TextFormatCode, []byte("(foo,bar)"), &p) require.NotNil(t, err) } func TestMapScanUnknownOIDTextFormat(t *testing.T) { m := pgtype.NewMap() var n int32 err := m.Scan(0, pgx.TextFormatCode, []byte("123"), &n) assert.NoError(t, err) assert.EqualValues(t, 123, n) } func TestMapScanUnknownOIDIntoSQLScanner(t *testing.T) { m := pgtype.NewMap() var s sql.NullString err := m.Scan(0, pgx.TextFormatCode, []byte(nil), &s) assert.NoError(t, err) assert.Equal(t, "", s.String) assert.False(t, s.Valid) } type scannerString string func (ss *scannerString) Scan(v any) error { *ss = scannerString("scanned") return nil } // https://github.com/jackc/pgtype/issues/197 func TestMapScanUnregisteredOIDIntoRenamedStringSQLScanner(t *testing.T) { m := pgtype.NewMap() var s scannerString err := m.Scan(unregisteredOID, pgx.TextFormatCode, []byte(nil), &s) assert.NoError(t, err) assert.Equal(t, "scanned", string(s)) } type pgCustomInt int64 func (ci *pgCustomInt) Scan(src any) error { *ci = pgCustomInt(src.(int64)) return nil } func TestScanPlanBinaryInt32ScanScanner(t *testing.T) { m := pgtype.NewMap() src := []byte{0, 42} var v pgCustomInt plan := m.PlanScan(pgtype.Int2OID, pgtype.BinaryFormatCode, &v) err := plan.Scan(src, &v) require.NoError(t, err) require.EqualValues(t, 42, v) ptr := new(pgCustomInt) plan = m.PlanScan(pgtype.Int2OID, pgtype.BinaryFormatCode, &ptr) err = plan.Scan(src, &ptr) require.NoError(t, err) require.EqualValues(t, 42, *ptr) ptr = new(pgCustomInt) err = plan.Scan(nil, &ptr) require.NoError(t, err) assert.Nil(t, ptr) ptr = nil plan = m.PlanScan(pgtype.Int2OID, pgtype.BinaryFormatCode, &ptr) err = plan.Scan(src, &ptr) require.NoError(t, err) require.EqualValues(t, 42, *ptr) ptr = nil plan = m.PlanScan(pgtype.Int2OID, pgtype.BinaryFormatCode, &ptr) err = plan.Scan(nil, &ptr) require.NoError(t, err) assert.Nil(t, ptr) } // Test for https://github.com/jackc/pgtype/issues/164 func TestScanPlanInterface(t *testing.T) { m := pgtype.NewMap() src := []byte{0, 42} var v any plan := m.PlanScan(pgtype.Int2OID, pgtype.BinaryFormatCode, v) err := plan.Scan(src, v) assert.Error(t, err) } func TestPointerPointerStructScan(t *testing.T) { m := pgtype.NewMap() type composite struct { ID int } int4Type, _ := m.TypeForOID(pgtype.Int4OID) pgt := &pgtype.Type{ Codec: &pgtype.CompositeCodec{ Fields: []pgtype.CompositeCodecField{ { Name: "id", Type: int4Type, }, }, }, Name: "composite", OID: 215333, } m.RegisterType(pgt) var c *composite plan := m.PlanScan(pgt.OID, pgtype.TextFormatCode, &c) err := plan.Scan([]byte("(1)"), &c) require.NoError(t, err) require.Equal(t, 1, c.ID) } // https://github.com/jackc/pgx/issues/1263 func TestMapScanPtrToPtrToSlice(t *testing.T) { m := pgtype.NewMap() src := []byte("{foo,bar}") var v *[]string plan := m.PlanScan(pgtype.TextArrayOID, pgtype.TextFormatCode, &v) err := plan.Scan(src, &v) require.NoError(t, err) require.Equal(t, []string{"foo", "bar"}, *v) } func TestMapScanPtrToPtrToSliceOfStruct(t *testing.T) { type Team struct { TeamID int Name string } // Have to use binary format because text format doesn't include type information. m := pgtype.NewMap() src := []byte{0x0, 0x0, 0x0, 0x1, 0x0, 0x0, 0x0, 0x0, 0x0, 0x0, 0x8, 0xc9, 0x0, 0x0, 0x0, 0x2, 0x0, 0x0, 0x0, 0x1, 0x0, 0x0, 0x0, 0x1e, 0x0, 0x0, 0x0, 0x2, 0x0, 0x0, 0x0, 0x17, 0x0, 0x0, 0x0, 0x4, 0x0, 0x0, 0x0, 0x1, 0x0, 0x0, 0x0, 0x19, 0x0, 0x0, 0x0, 0x6, 0x74, 0x65, 0x61, 0x6d, 0x20, 0x31, 0x0, 0x0, 0x0, 0x1e, 0x0, 0x0, 0x0, 0x2, 0x0, 0x0, 0x0, 0x17, 0x0, 0x0, 0x0, 0x4, 0x0, 0x0, 0x0, 0x2, 0x0, 0x0, 0x0, 0x19, 0x0, 0x0, 0x0, 0x6, 0x74, 0x65, 0x61, 0x6d, 0x20, 0x32} var v *[]Team plan := m.PlanScan(pgtype.RecordArrayOID, pgtype.BinaryFormatCode, &v) err := plan.Scan(src, &v) require.NoError(t, err) require.Equal(t, []Team{{1, "team 1"}, {2, "team 2"}}, *v) } type databaseValuerString string func (s databaseValuerString) Value() (driver.Value, error) { return fmt.Sprintf("%d", len(s)), nil } // https://github.com/jackc/pgx/issues/1319 func TestMapEncodeTextFormatDatabaseValuerThatIsRenamedSimpleType(t *testing.T) { m := pgtype.NewMap() src := databaseValuerString("foo") buf, err := m.Encode(pgtype.TextOID, pgtype.TextFormatCode, src, nil) require.NoError(t, err) require.Equal(t, "3", string(buf)) } type databaseValuerFmtStringer string func (s databaseValuerFmtStringer) Value() (driver.Value, error) { return nil, nil } func (s databaseValuerFmtStringer) String() string { return "foobar" } // https://github.com/jackc/pgx/issues/1311 func TestMapEncodeTextFormatDatabaseValuerThatIsFmtStringer(t *testing.T) { m := pgtype.NewMap() src := databaseValuerFmtStringer("") buf, err := m.Encode(pgtype.TextOID, pgtype.TextFormatCode, src, nil) require.NoError(t, err) require.Nil(t, buf) } type databaseValuerStringFormat struct { n int32 } func (v databaseValuerStringFormat) Value() (driver.Value, error) { return fmt.Sprint(v.n), nil } func TestMapEncodeBinaryFormatDatabaseValuerThatReturnsString(t *testing.T) { m := pgtype.NewMap() src := databaseValuerStringFormat{n: 42} buf, err := m.Encode(pgtype.Int4OID, pgtype.BinaryFormatCode, src, nil) require.NoError(t, err) require.Equal(t, []byte{0, 0, 0, 42}, buf) } // https://github.com/jackc/pgx/issues/1445 func TestMapEncodeDatabaseValuerThatReturnsStringIntoUnregisteredTypeTextFormat(t *testing.T) { m := pgtype.NewMap() buf, err := m.Encode(unregisteredOID, pgtype.TextFormatCode, driverValuerFunc(func() (driver.Value, error) { return "foo", nil }), nil) require.NoError(t, err) require.Equal(t, []byte("foo"), buf) } // https://github.com/jackc/pgx/issues/1445 func TestMapEncodeDatabaseValuerThatReturnsByteSliceIntoUnregisteredTypeTextFormat(t *testing.T) { m := pgtype.NewMap() buf, err := m.Encode(unregisteredOID, pgtype.TextFormatCode, driverValuerFunc(func() (driver.Value, error) { return []byte{0, 1, 2, 3}, nil }), nil) require.NoError(t, err) require.Equal(t, []byte(`\x00010203`), buf) } func TestMapEncodeStringIntoUnregisteredTypeTextFormat(t *testing.T) { m := pgtype.NewMap() buf, err := m.Encode(unregisteredOID, pgtype.TextFormatCode, "foo", nil) require.NoError(t, err) require.Equal(t, []byte("foo"), buf) } func TestMapEncodeByteSliceIntoUnregisteredTypeTextFormat(t *testing.T) { m := pgtype.NewMap() buf, err := m.Encode(unregisteredOID, pgtype.TextFormatCode, []byte{0, 1, 2, 3}, nil) require.NoError(t, err) require.Equal(t, []byte(`\x00010203`), buf) } // https://github.com/jackc/pgx/issues/1763 func TestMapEncodeNamedTypeOfByteSliceIntoTextTextFormat(t *testing.T) { m := pgtype.NewMap() buf, err := m.Encode(pgtype.TextOID, pgtype.TextFormatCode, json.RawMessage(`{"foo": "bar"}`), nil) require.NoError(t, err) require.Equal(t, []byte(`{"foo": "bar"}`), buf) } // https://github.com/jackc/pgx/issues/1326 func TestMapScanPointerToRenamedType(t *testing.T) { srcBuf := []byte("foo") m := pgtype.NewMap() var rs *_string err := m.Scan(pgtype.TextOID, pgx.TextFormatCode, srcBuf, &rs) assert.NoError(t, err) require.NotNil(t, rs) assert.Equal(t, "foo", string(*rs)) } // https://github.com/jackc/pgx/issues/1326 func TestMapScanNullToWrongType(t *testing.T) { m := pgtype.NewMap() var n *int32 err := m.Scan(pgtype.TextOID, pgx.TextFormatCode, nil, &n) assert.NoError(t, err) assert.Nil(t, n) var pn pgtype.Int4 err = m.Scan(pgtype.TextOID, pgx.TextFormatCode, nil, &pn) assert.NoError(t, err) assert.False(t, pn.Valid) } func TestScanToSliceOfRenamedUint8(t *testing.T) { m := pgtype.NewMap() var ruint8 []_uint8 err := m.Scan(pgtype.Int2ArrayOID, pgx.TextFormatCode, []byte("{2,4}"), &ruint8) assert.NoError(t, err) assert.Equal(t, []_uint8{2, 4}, ruint8) } func TestMapScanTextToBool(t *testing.T) { tests := []struct { name string src []byte want bool }{ {"t", []byte("t"), true}, {"f", []byte("f"), false}, {"y", []byte("y"), true}, {"n", []byte("n"), false}, {"1", []byte("1"), true}, {"0", []byte("0"), false}, {"true", []byte("true"), true}, {"false", []byte("false"), false}, {"yes", []byte("yes"), true}, {"no", []byte("no"), false}, {"on", []byte("on"), true}, {"off", []byte("off"), false}, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { m := pgtype.NewMap() var v bool err := m.Scan(pgtype.BoolOID, pgx.TextFormatCode, tt.src, &v) require.NoError(t, err) assert.Equal(t, tt.want, v) }) } } func TestMapScanTextToBoolError(t *testing.T) { tests := []struct { name string src []byte want string }{ {"nil", nil, "cannot scan NULL into *bool"}, {"empty", []byte{}, "cannot scan empty string into *bool"}, {"foo", []byte("foo"), "unknown boolean string representation \"foo\""}, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { m := pgtype.NewMap() var v bool err := m.Scan(pgtype.BoolOID, pgx.TextFormatCode, tt.src, &v) require.ErrorContains(t, err, tt.want) }) } } type databaseValuerUUID [16]byte func (v databaseValuerUUID) Value() (driver.Value, error) { return fmt.Sprintf("%x", v), nil } // https://github.com/jackc/pgx/issues/1502 func TestMapEncodePlanCacheUUIDTypeConfusion(t *testing.T) { expected := []byte{ 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0xb, 0x86, 0, 0, 0, 2, 0, 0, 0, 1, 0, 0, 0, 16, 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 0, 0, 0, 16, 15, 14, 13, 12, 11, 10, 9, 8, 7, 6, 5, 4, 3, 2, 1, 0, } m := pgtype.NewMap() buf, err := m.Encode(pgtype.UUIDArrayOID, pgtype.BinaryFormatCode, []databaseValuerUUID{{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}, {15, 14, 13, 12, 11, 10, 9, 8, 7, 6, 5, 4, 3, 2, 1}}, nil) require.NoError(t, err) require.Equal(t, expected, buf) // This actually *should* fail. In the actual query path this error is detected and the encoding falls back to the // text format. In the bug this test is guarding against regression this would panic. _, err = m.Encode(pgtype.UUIDArrayOID, pgtype.BinaryFormatCode, []string{"00010203-0405-0607-0809-0a0b0c0d0e0f", "0f0e0d0c-0b0a-0908-0706-0504-03020100"}, nil) require.Error(t, err) } // https://github.com/jackc/pgx/issues/1763 func TestMapEncodeRawJSONIntoUnknownOID(t *testing.T) { m := pgtype.NewMap() buf, err := m.Encode(0, pgtype.TextFormatCode, json.RawMessage(`{"foo": "bar"}`), nil) require.NoError(t, err) require.Equal(t, []byte(`{"foo": "bar"}`), buf) } // PlanScan previously used a cache to improve performance. However, the cache could get confused in certain cases. The // example below was one such failure case. func TestCachedPlanScanConfusion(t *testing.T) { m := pgtype.NewMap() var err error var tags any err = m.Scan(pgtype.TextArrayOID, pgx.TextFormatCode, []byte("{foo,bar,baz}"), &tags) require.NoError(t, err) var cells [][]string err = m.Scan(pgtype.TextArrayOID, pgx.TextFormatCode, []byte("{{foo,bar},{baz,quz}}"), &cells) require.NoError(t, err) } func BenchmarkMapScanInt4IntoBinaryDecoder(b *testing.B) { m := pgtype.NewMap() src := []byte{0, 0, 0, 42} var v pgtype.Int4 for b.Loop() { v = pgtype.Int4{} err := m.Scan(pgtype.Int4OID, pgtype.BinaryFormatCode, src, &v) if err != nil { b.Fatal(err) } if v != (pgtype.Int4{Int32: 42, Valid: true}) { b.Fatal("scan failed due to bad value") } } } func BenchmarkMapScanInt4IntoGoInt32(b *testing.B) { m := pgtype.NewMap() src := []byte{0, 0, 0, 42} var v int32 for b.Loop() { v = 0 err := m.Scan(pgtype.Int4OID, pgtype.BinaryFormatCode, src, &v) if err != nil { b.Fatal(err) } if v != 42 { b.Fatal("scan failed due to bad value") } } } func BenchmarkScanPlanScanInt4IntoBinaryDecoder(b *testing.B) { m := pgtype.NewMap() src := []byte{0, 0, 0, 42} var v pgtype.Int4 plan := m.PlanScan(pgtype.Int4OID, pgtype.BinaryFormatCode, &v) for b.Loop() { v = pgtype.Int4{} err := plan.Scan(src, &v) if err != nil { b.Fatal(err) } if v != (pgtype.Int4{Int32: 42, Valid: true}) { b.Fatal("scan failed due to bad value") } } } func BenchmarkScanPlanScanInt4IntoGoInt32(b *testing.B) { m := pgtype.NewMap() src := []byte{0, 0, 0, 42} var v int32 plan := m.PlanScan(pgtype.Int4OID, pgtype.BinaryFormatCode, &v) for b.Loop() { v = 0 err := plan.Scan(src, &v) if err != nil { b.Fatal(err) } if v != 42 { b.Fatal("scan failed due to bad value") } } } func isExpectedEq(a any) func(any) bool { return func(v any) bool { return a == v } } func isPtrExpectedEq(a any) func(any) bool { return func(v any) bool { val := reflect.ValueOf(v) return a == val.Elem().Interface() } } pgx-5.8.0/pgtype/point.go000066400000000000000000000127531512357711200153260ustar00rootroot00000000000000package pgtype import ( "bytes" "database/sql/driver" "encoding/binary" "fmt" "math" "strconv" "strings" "github.com/jackc/pgx/v5/internal/pgio" ) type Vec2 struct { X float64 Y float64 } type PointScanner interface { ScanPoint(v Point) error } type PointValuer interface { PointValue() (Point, error) } type Point struct { P Vec2 Valid bool } // ScanPoint implements the [PointScanner] interface. func (p *Point) ScanPoint(v Point) error { *p = v return nil } // PointValue implements the [PointValuer] interface. func (p Point) PointValue() (Point, error) { return p, nil } func parsePoint(src []byte) (*Point, error) { if src == nil || bytes.Equal(src, []byte("null")) { return &Point{}, nil } if len(src) < 5 { return nil, fmt.Errorf("invalid length for point: %v", len(src)) } if src[0] == '"' && src[len(src)-1] == '"' { src = src[1 : len(src)-1] } sx, sy, found := strings.Cut(string(src[1:len(src)-1]), ",") if !found { return nil, fmt.Errorf("invalid format for point") } x, err := strconv.ParseFloat(sx, 64) if err != nil { return nil, err } y, err := strconv.ParseFloat(sy, 64) if err != nil { return nil, err } return &Point{P: Vec2{x, y}, Valid: true}, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Point) Scan(src any) error { if src == nil { *dst = Point{} return nil } switch src := src.(type) { case string: return scanPlanTextAnyToPointScanner{}.Scan([]byte(src), dst) } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (src Point) Value() (driver.Value, error) { if !src.Valid { return nil, nil } buf, err := PointCodec{}.PlanEncode(nil, 0, TextFormatCode, src).Encode(src, nil) if err != nil { return nil, err } return string(buf), err } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (src Point) MarshalJSON() ([]byte, error) { if !src.Valid { return []byte("null"), nil } var buff bytes.Buffer buff.WriteByte('"') buff.WriteString(fmt.Sprintf("(%g,%g)", src.P.X, src.P.Y)) buff.WriteByte('"') return buff.Bytes(), nil } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (dst *Point) UnmarshalJSON(point []byte) error { p, err := parsePoint(point) if err != nil { return err } *dst = *p return nil } type PointCodec struct{} func (PointCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (PointCodec) PreferredFormat() int16 { return BinaryFormatCode } func (PointCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(PointValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanPointCodecBinary{} case TextFormatCode: return encodePlanPointCodecText{} } return nil } type encodePlanPointCodecBinary struct{} func (encodePlanPointCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { point, err := value.(PointValuer).PointValue() if err != nil { return nil, err } if !point.Valid { return nil, nil } buf = pgio.AppendUint64(buf, math.Float64bits(point.P.X)) buf = pgio.AppendUint64(buf, math.Float64bits(point.P.Y)) return buf, nil } type encodePlanPointCodecText struct{} func (encodePlanPointCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { point, err := value.(PointValuer).PointValue() if err != nil { return nil, err } if !point.Valid { return nil, nil } return append(buf, fmt.Sprintf(`(%s,%s)`, strconv.FormatFloat(point.P.X, 'f', -1, 64), strconv.FormatFloat(point.P.Y, 'f', -1, 64), )...), nil } func (PointCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case PointScanner: return scanPlanBinaryPointToPointScanner{} } case TextFormatCode: switch target.(type) { case PointScanner: return scanPlanTextAnyToPointScanner{} } } return nil } func (c PointCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return codecDecodeToTextFormat(c, m, oid, format, src) } func (c PointCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var point Point err := codecScan(c, m, oid, format, src, &point) if err != nil { return nil, err } return point, nil } type scanPlanBinaryPointToPointScanner struct{} func (scanPlanBinaryPointToPointScanner) Scan(src []byte, dst any) error { scanner := (dst).(PointScanner) if src == nil { return scanner.ScanPoint(Point{}) } if len(src) != 16 { return fmt.Errorf("invalid length for point: %v", len(src)) } x := binary.BigEndian.Uint64(src) y := binary.BigEndian.Uint64(src[8:]) return scanner.ScanPoint(Point{ P: Vec2{math.Float64frombits(x), math.Float64frombits(y)}, Valid: true, }) } type scanPlanTextAnyToPointScanner struct{} func (scanPlanTextAnyToPointScanner) Scan(src []byte, dst any) error { scanner := (dst).(PointScanner) if src == nil { return scanner.ScanPoint(Point{}) } if len(src) < 5 { return fmt.Errorf("invalid length for point: %v", len(src)) } sx, sy, found := strings.Cut(string(src[1:len(src)-1]), ",") if !found { return fmt.Errorf("invalid format for point") } x, err := strconv.ParseFloat(sx, 64) if err != nil { return err } y, err := strconv.ParseFloat(sy, 64) if err != nil { return err } return scanner.ScanPoint(Point{P: Vec2{x, y}, Valid: true}) } pgx-5.8.0/pgtype/point_test.go000066400000000000000000000044071512357711200163620ustar00rootroot00000000000000package pgtype_test import ( "context" "reflect" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/require" ) func TestPointCodec(t *testing.T) { skipCockroachDB(t, "Server does not support type point") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "point", []pgxtest.ValueRoundTripTest{ { pgtype.Point{P: pgtype.Vec2{1.234, 5.6789012345}, Valid: true}, new(pgtype.Point), isExpectedEq(pgtype.Point{P: pgtype.Vec2{1.234, 5.6789012345}, Valid: true}), }, { pgtype.Point{P: pgtype.Vec2{-1.234, -5.6789}, Valid: true}, new(pgtype.Point), isExpectedEq(pgtype.Point{P: pgtype.Vec2{-1.234, -5.6789}, Valid: true}), }, {pgtype.Point{}, new(pgtype.Point), isExpectedEq(pgtype.Point{})}, {nil, new(pgtype.Point), isExpectedEq(pgtype.Point{})}, }) } func TestPoint_MarshalJSON(t *testing.T) { tests := []struct { name string point pgtype.Point want []byte }{ { name: "second", point: pgtype.Point{ P: pgtype.Vec2{X: 12.245, Y: 432.12}, Valid: true, }, want: []byte(`"(12.245,432.12)"`), }, { name: "third", point: pgtype.Point{ P: pgtype.Vec2{}, }, want: []byte("null"), }, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { got, err := tt.point.MarshalJSON() require.NoError(t, err) if !reflect.DeepEqual(got, tt.want) { t.Errorf("MarshalJSON() got = %v, want %v", got, tt.want) } }) } } func TestPoint_UnmarshalJSON(t *testing.T) { tests := []struct { name string valid bool arg []byte wantErr bool }{ { name: "first", valid: true, arg: []byte(`"(123.123,54.12)"`), wantErr: false, }, { name: "second", valid: false, arg: []byte(`"(123.123,54.1sad2)"`), wantErr: true, }, { name: "third", valid: false, arg: []byte("null"), wantErr: false, }, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { dst := &pgtype.Point{} if err := dst.UnmarshalJSON(tt.arg); (err != nil) != tt.wantErr { t.Errorf("UnmarshalJSON() error = %v, wantErr %v", err, tt.wantErr) } if dst.Valid != tt.valid { t.Errorf("Valid mismatch: %v != %v", dst.Valid, tt.valid) } }) } } pgx-5.8.0/pgtype/polygon.go000066400000000000000000000121101512357711200156470ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "fmt" "math" "strconv" "strings" "github.com/jackc/pgx/v5/internal/pgio" ) type PolygonScanner interface { ScanPolygon(v Polygon) error } type PolygonValuer interface { PolygonValue() (Polygon, error) } type Polygon struct { P []Vec2 Valid bool } // ScanPolygon implements the [PolygonScanner] interface. func (p *Polygon) ScanPolygon(v Polygon) error { *p = v return nil } // PolygonValue implements the [PolygonValuer] interface. func (p Polygon) PolygonValue() (Polygon, error) { return p, nil } // Scan implements the [database/sql.Scanner] interface. func (p *Polygon) Scan(src any) error { if src == nil { *p = Polygon{} return nil } switch src := src.(type) { case string: return scanPlanTextAnyToPolygonScanner{}.Scan([]byte(src), p) } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (p Polygon) Value() (driver.Value, error) { if !p.Valid { return nil, nil } buf, err := PolygonCodec{}.PlanEncode(nil, 0, TextFormatCode, p).Encode(p, nil) if err != nil { return nil, err } return string(buf), err } type PolygonCodec struct{} func (PolygonCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (PolygonCodec) PreferredFormat() int16 { return BinaryFormatCode } func (PolygonCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(PolygonValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanPolygonCodecBinary{} case TextFormatCode: return encodePlanPolygonCodecText{} } return nil } type encodePlanPolygonCodecBinary struct{} func (encodePlanPolygonCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { polygon, err := value.(PolygonValuer).PolygonValue() if err != nil { return nil, err } if !polygon.Valid { return nil, nil } buf = pgio.AppendInt32(buf, int32(len(polygon.P))) for _, p := range polygon.P { buf = pgio.AppendUint64(buf, math.Float64bits(p.X)) buf = pgio.AppendUint64(buf, math.Float64bits(p.Y)) } return buf, nil } type encodePlanPolygonCodecText struct{} func (encodePlanPolygonCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { polygon, err := value.(PolygonValuer).PolygonValue() if err != nil { return nil, err } if !polygon.Valid { return nil, nil } buf = append(buf, '(') for i, p := range polygon.P { if i > 0 { buf = append(buf, ',') } buf = append(buf, fmt.Sprintf(`(%s,%s)`, strconv.FormatFloat(p.X, 'f', -1, 64), strconv.FormatFloat(p.Y, 'f', -1, 64), )...) } buf = append(buf, ')') return buf, nil } func (PolygonCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case PolygonScanner: return scanPlanBinaryPolygonToPolygonScanner{} } case TextFormatCode: switch target.(type) { case PolygonScanner: return scanPlanTextAnyToPolygonScanner{} } } return nil } type scanPlanBinaryPolygonToPolygonScanner struct{} func (scanPlanBinaryPolygonToPolygonScanner) Scan(src []byte, dst any) error { scanner := (dst).(PolygonScanner) if src == nil { return scanner.ScanPolygon(Polygon{}) } if len(src) < 5 { return fmt.Errorf("invalid length for polygon: %v", len(src)) } pointCount := int(binary.BigEndian.Uint32(src)) rp := 4 if 4+pointCount*16 != len(src) { return fmt.Errorf("invalid length for Polygon with %d points: %v", pointCount, len(src)) } points := make([]Vec2, pointCount) for i := range points { x := binary.BigEndian.Uint64(src[rp:]) rp += 8 y := binary.BigEndian.Uint64(src[rp:]) rp += 8 points[i] = Vec2{math.Float64frombits(x), math.Float64frombits(y)} } return scanner.ScanPolygon(Polygon{ P: points, Valid: true, }) } type scanPlanTextAnyToPolygonScanner struct{} func (scanPlanTextAnyToPolygonScanner) Scan(src []byte, dst any) error { scanner := (dst).(PolygonScanner) if src == nil { return scanner.ScanPolygon(Polygon{}) } if len(src) < 7 { return fmt.Errorf("invalid length for Polygon: %v", len(src)) } points := make([]Vec2, 0) str := string(src[2:]) for { end := strings.IndexByte(str, ',') x, err := strconv.ParseFloat(str[:end], 64) if err != nil { return err } str = str[end+1:] end = strings.IndexByte(str, ')') y, err := strconv.ParseFloat(str[:end], 64) if err != nil { return err } points = append(points, Vec2{x, y}) if end+3 < len(str) { str = str[end+3:] } else { break } } return scanner.ScanPolygon(Polygon{P: points, Valid: true}) } func (c PolygonCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return codecDecodeToTextFormat(c, m, oid, format, src) } func (c PolygonCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var polygon Polygon err := codecScan(c, m, oid, format, src, &polygon) if err != nil { return nil, err } return polygon, nil } pgx-5.8.0/pgtype/polygon_test.go000066400000000000000000000025521512357711200167170ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func isExpectedEqPolygon(a any) func(any) bool { return func(v any) bool { ap := a.(pgtype.Polygon) vp := v.(pgtype.Polygon) if !(ap.Valid == vp.Valid && len(ap.P) == len(vp.P)) { return false } for i := range ap.P { if ap.P[i] != vp.P[i] { return false } } return true } } func TestPolygonTranscode(t *testing.T) { skipCockroachDB(t, "Server does not support type polygon") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "polygon", []pgxtest.ValueRoundTripTest{ { pgtype.Polygon{ P: []pgtype.Vec2{{3.14, 1.678901234}, {7.1, 5.234}, {5.0, 3.234}}, Valid: true, }, new(pgtype.Polygon), isExpectedEqPolygon(pgtype.Polygon{ P: []pgtype.Vec2{{3.14, 1.678901234}, {7.1, 5.234}, {5.0, 3.234}}, Valid: true, }), }, { pgtype.Polygon{ P: []pgtype.Vec2{{3.14, -1.678}, {7.1, -5.234}, {23.1, 9.34}}, Valid: true, }, new(pgtype.Polygon), isExpectedEqPolygon(pgtype.Polygon{ P: []pgtype.Vec2{{3.14, -1.678}, {7.1, -5.234}, {23.1, 9.34}}, Valid: true, }), }, {pgtype.Polygon{}, new(pgtype.Polygon), isExpectedEqPolygon(pgtype.Polygon{})}, {nil, new(pgtype.Polygon), isExpectedEqPolygon(pgtype.Polygon{})}, }) } pgx-5.8.0/pgtype/qchar.go000066400000000000000000000061321512357711200152650ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "fmt" "math" ) // QCharCodec is for PostgreSQL's special 8-bit-only "char" type more akin to the C // language's char type, or Go's byte type. (Note that the name in PostgreSQL // itself is "char", in double-quotes, and not char.) It gets used a lot in // PostgreSQL's system tables to hold a single ASCII character value (eg // pg_class.relkind). It is named Qchar for quoted char to disambiguate from SQL // standard type char. type QCharCodec struct{} func (QCharCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (QCharCodec) PreferredFormat() int16 { return BinaryFormatCode } func (QCharCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case TextFormatCode, BinaryFormatCode: switch value.(type) { case byte: return encodePlanQcharCodecByte{} case rune: return encodePlanQcharCodecRune{} } } return nil } type encodePlanQcharCodecByte struct{} func (encodePlanQcharCodecByte) Encode(value any, buf []byte) (newBuf []byte, err error) { b := value.(byte) buf = append(buf, b) return buf, nil } type encodePlanQcharCodecRune struct{} func (encodePlanQcharCodecRune) Encode(value any, buf []byte) (newBuf []byte, err error) { r := value.(rune) if r > math.MaxUint8 { return nil, fmt.Errorf(`%v cannot be encoded to "char"`, r) } b := byte(r) buf = append(buf, b) return buf, nil } func (QCharCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case TextFormatCode, BinaryFormatCode: switch target.(type) { case *byte: return scanPlanQcharCodecByte{} case *rune: return scanPlanQcharCodecRune{} } } return nil } type scanPlanQcharCodecByte struct{} func (scanPlanQcharCodecByte) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) > 1 { return fmt.Errorf(`invalid length for "char": %v`, len(src)) } b := dst.(*byte) // In the text format the zero value is returned as a zero byte value instead of 0 if len(src) == 0 { *b = 0 } else { *b = src[0] } return nil } type scanPlanQcharCodecRune struct{} func (scanPlanQcharCodecRune) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) > 1 { return fmt.Errorf(`invalid length for "char": %v`, len(src)) } r := dst.(*rune) // In the text format the zero value is returned as a zero byte value instead of 0 if len(src) == 0 { *r = 0 } else { *r = rune(src[0]) } return nil } func (c QCharCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } var r rune err := codecScan(c, m, oid, format, src, &r) if err != nil { return nil, err } return string(r), nil } func (c QCharCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var r rune err := codecScan(c, m, oid, format, src, &r) if err != nil { return nil, err } return r, nil } pgx-5.8.0/pgtype/qchar_test.go000066400000000000000000000015451512357711200163270ustar00rootroot00000000000000package pgtype_test import ( "context" "math" "testing" "github.com/jackc/pgx/v5/pgxtest" ) func TestQcharTranscode(t *testing.T) { skipCockroachDB(t, "Server does not support qchar") var tests []pgxtest.ValueRoundTripTest for i := 0; i <= math.MaxUint8; i++ { tests = append(tests, pgxtest.ValueRoundTripTest{rune(i), new(rune), isExpectedEq(rune(i))}) tests = append(tests, pgxtest.ValueRoundTripTest{byte(i), new(byte), isExpectedEq(byte(i))}) } tests = append(tests, pgxtest.ValueRoundTripTest{nil, new(*rune), isExpectedEq((*rune)(nil))}) tests = append(tests, pgxtest.ValueRoundTripTest{nil, new(*byte), isExpectedEq((*byte)(nil))}) // Can only test with known OIDs as rune and byte would be considered numbers. pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, pgxtest.KnownOIDQueryExecModes, `"char"`, tests) } pgx-5.8.0/pgtype/range.go000066400000000000000000000141131512357711200152610ustar00rootroot00000000000000package pgtype import ( "bytes" "encoding/binary" "fmt" ) type BoundType byte const ( Inclusive = BoundType('i') Exclusive = BoundType('e') Unbounded = BoundType('U') Empty = BoundType('E') ) func (bt BoundType) String() string { return string(bt) } type untypedTextRange struct { Lower string Upper string LowerType BoundType UpperType BoundType } func parseUntypedTextRange(src string) (*untypedTextRange, error) { utr := &untypedTextRange{} if src == "empty" { utr.LowerType = Empty utr.UpperType = Empty return utr, nil } buf := bytes.NewBufferString(src) skipWhitespace(buf) r, _, err := buf.ReadRune() if err != nil { return nil, fmt.Errorf("invalid lower bound: %w", err) } switch r { case '(': utr.LowerType = Exclusive case '[': utr.LowerType = Inclusive default: return nil, fmt.Errorf("missing lower bound, instead got: %v", string(r)) } r, _, err = buf.ReadRune() if err != nil { return nil, fmt.Errorf("invalid lower value: %w", err) } buf.UnreadRune() if r == ',' { utr.LowerType = Unbounded } else { utr.Lower, err = rangeParseValue(buf) if err != nil { return nil, fmt.Errorf("invalid lower value: %w", err) } } r, _, err = buf.ReadRune() if err != nil { return nil, fmt.Errorf("missing range separator: %w", err) } if r != ',' { return nil, fmt.Errorf("missing range separator: %v", r) } r, _, err = buf.ReadRune() if err != nil { return nil, fmt.Errorf("invalid upper value: %w", err) } if r == ')' || r == ']' { utr.UpperType = Unbounded } else { buf.UnreadRune() utr.Upper, err = rangeParseValue(buf) if err != nil { return nil, fmt.Errorf("invalid upper value: %w", err) } r, _, err = buf.ReadRune() if err != nil { return nil, fmt.Errorf("missing upper bound: %w", err) } switch r { case ')': utr.UpperType = Exclusive case ']': utr.UpperType = Inclusive default: return nil, fmt.Errorf("missing upper bound, instead got: %v", string(r)) } } skipWhitespace(buf) if buf.Len() > 0 { return nil, fmt.Errorf("unexpected trailing data: %v", buf.String()) } return utr, nil } func rangeParseValue(buf *bytes.Buffer) (string, error) { r, _, err := buf.ReadRune() if err != nil { return "", err } if r == '"' { return rangeParseQuotedValue(buf) } buf.UnreadRune() s := &bytes.Buffer{} for { r, _, err := buf.ReadRune() if err != nil { return "", err } switch r { case '\\': r, _, err = buf.ReadRune() if err != nil { return "", err } case ',', '[', ']', '(', ')': buf.UnreadRune() return s.String(), nil } s.WriteRune(r) } } func rangeParseQuotedValue(buf *bytes.Buffer) (string, error) { s := &bytes.Buffer{} for { r, _, err := buf.ReadRune() if err != nil { return "", err } switch r { case '\\': r, _, err = buf.ReadRune() if err != nil { return "", err } case '"': r, _, err = buf.ReadRune() if err != nil { return "", err } if r != '"' { buf.UnreadRune() return s.String(), nil } } s.WriteRune(r) } } type untypedBinaryRange struct { Lower []byte Upper []byte LowerType BoundType UpperType BoundType } // 0 = () = 00000 // 1 = empty = 00001 // 2 = [) = 00010 // 4 = (] = 00100 // 6 = [] = 00110 // 8 = ) = 01000 // 12 = ] = 01100 // 16 = ( = 10000 // 18 = [ = 10010 // 24 = = 11000 const ( emptyMask = 1 lowerInclusiveMask = 2 upperInclusiveMask = 4 lowerUnboundedMask = 8 upperUnboundedMask = 16 ) func parseUntypedBinaryRange(src []byte) (*untypedBinaryRange, error) { ubr := &untypedBinaryRange{} if len(src) == 0 { return nil, fmt.Errorf("range too short: %v", len(src)) } rangeType := src[0] rp := 1 if rangeType&emptyMask > 0 { if len(src[rp:]) > 0 { return nil, fmt.Errorf("unexpected trailing bytes parsing empty range: %v", len(src[rp:])) } ubr.LowerType = Empty ubr.UpperType = Empty return ubr, nil } if rangeType&lowerInclusiveMask > 0 { ubr.LowerType = Inclusive } else if rangeType&lowerUnboundedMask > 0 { ubr.LowerType = Unbounded } else { ubr.LowerType = Exclusive } if rangeType&upperInclusiveMask > 0 { ubr.UpperType = Inclusive } else if rangeType&upperUnboundedMask > 0 { ubr.UpperType = Unbounded } else { ubr.UpperType = Exclusive } if ubr.LowerType == Unbounded && ubr.UpperType == Unbounded { if len(src[rp:]) > 0 { return nil, fmt.Errorf("unexpected trailing bytes parsing unbounded range: %v", len(src[rp:])) } return ubr, nil } if len(src[rp:]) < 4 { return nil, fmt.Errorf("too few bytes for size: %v", src[rp:]) } valueLen := int(binary.BigEndian.Uint32(src[rp:])) rp += 4 val := src[rp : rp+valueLen] rp += valueLen if ubr.LowerType != Unbounded { ubr.Lower = val } else { ubr.Upper = val if len(src[rp:]) > 0 { return nil, fmt.Errorf("unexpected trailing bytes parsing range: %v", len(src[rp:])) } return ubr, nil } if ubr.UpperType != Unbounded { if len(src[rp:]) < 4 { return nil, fmt.Errorf("too few bytes for size: %v", src[rp:]) } valueLen := int(binary.BigEndian.Uint32(src[rp:])) rp += 4 ubr.Upper = src[rp : rp+valueLen] rp += valueLen } if len(src[rp:]) > 0 { return nil, fmt.Errorf("unexpected trailing bytes parsing range: %v", len(src[rp:])) } return ubr, nil } // Range is a generic range type. type Range[T any] struct { Lower T Upper T LowerType BoundType UpperType BoundType Valid bool } func (r Range[T]) IsNull() bool { return !r.Valid } func (r Range[T]) BoundTypes() (lower, upper BoundType) { return r.LowerType, r.UpperType } func (r Range[T]) Bounds() (lower, upper any) { return &r.Lower, &r.Upper } func (r *Range[T]) ScanNull() error { *r = Range[T]{} return nil } func (r *Range[T]) ScanBounds() (lowerTarget, upperTarget any) { return &r.Lower, &r.Upper } func (r *Range[T]) SetBoundTypes(lower, upper BoundType) error { if lower == Unbounded || lower == Empty { var zero T r.Lower = zero } if upper == Unbounded || upper == Empty { var zero T r.Upper = zero } r.LowerType = lower r.UpperType = upper r.Valid = true return nil } pgx-5.8.0/pgtype/range_codec.go000066400000000000000000000231121512357711200164150ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "fmt" "github.com/jackc/pgx/v5/internal/pgio" ) // RangeValuer is a type that can be converted into a PostgreSQL range. type RangeValuer interface { // IsNull returns true if the value is SQL NULL. IsNull() bool // BoundTypes returns the lower and upper bound types. BoundTypes() (lower, upper BoundType) // Bounds returns the lower and upper range values. Bounds() (lower, upper any) } // RangeScanner is a type can be scanned from a PostgreSQL range. type RangeScanner interface { // ScanNull sets the value to SQL NULL. ScanNull() error // ScanBounds returns values usable as a scan target. The returned values may not be scanned if the range is empty or // the bound type is unbounded. ScanBounds() (lowerTarget, upperTarget any) // SetBoundTypes sets the lower and upper bound types. ScanBounds will be called and the returned values scanned // (if appropriate) before SetBoundTypes is called. If the bound types are unbounded or empty this method must // also set the bound values. SetBoundTypes(lower, upper BoundType) error } // RangeCodec is a codec for any range type. type RangeCodec struct { ElementType *Type } func (c *RangeCodec) FormatSupported(format int16) bool { return c.ElementType.Codec.FormatSupported(format) } func (c *RangeCodec) PreferredFormat() int16 { if c.FormatSupported(BinaryFormatCode) { return BinaryFormatCode } return TextFormatCode } func (c *RangeCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(RangeValuer); !ok { return nil } switch format { case BinaryFormatCode: return &encodePlanRangeCodecRangeValuerToBinary{rc: c, m: m} case TextFormatCode: return &encodePlanRangeCodecRangeValuerToText{rc: c, m: m} } return nil } type encodePlanRangeCodecRangeValuerToBinary struct { rc *RangeCodec m *Map } func (plan *encodePlanRangeCodecRangeValuerToBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { getter := value.(RangeValuer) if getter.IsNull() { return nil, nil } lowerType, upperType := getter.BoundTypes() lower, upper := getter.Bounds() var rangeType byte switch lowerType { case Inclusive: rangeType |= lowerInclusiveMask case Unbounded: rangeType |= lowerUnboundedMask case Exclusive: case Empty: return append(buf, emptyMask), nil default: return nil, fmt.Errorf("unknown LowerType: %v", lowerType) } switch upperType { case Inclusive: rangeType |= upperInclusiveMask case Unbounded: rangeType |= upperUnboundedMask case Exclusive: default: return nil, fmt.Errorf("unknown UpperType: %v", upperType) } buf = append(buf, rangeType) if lowerType != Unbounded { if lower == nil { return nil, fmt.Errorf("Lower cannot be NULL unless LowerType is Unbounded") } sp := len(buf) buf = pgio.AppendInt32(buf, -1) lowerPlan := plan.m.PlanEncode(plan.rc.ElementType.OID, BinaryFormatCode, lower) if lowerPlan == nil { return nil, fmt.Errorf("cannot encode %v as element of range", lower) } buf, err = lowerPlan.Encode(lower, buf) if err != nil { return nil, fmt.Errorf("failed to encode %v as element of range: %w", lower, err) } if buf == nil { return nil, fmt.Errorf("Lower cannot be NULL unless LowerType is Unbounded") } pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4)) } if upperType != Unbounded { if upper == nil { return nil, fmt.Errorf("Upper cannot be NULL unless UpperType is Unbounded") } sp := len(buf) buf = pgio.AppendInt32(buf, -1) upperPlan := plan.m.PlanEncode(plan.rc.ElementType.OID, BinaryFormatCode, upper) if upperPlan == nil { return nil, fmt.Errorf("cannot encode %v as element of range", upper) } buf, err = upperPlan.Encode(upper, buf) if err != nil { return nil, fmt.Errorf("failed to encode %v as element of range: %w", upper, err) } if buf == nil { return nil, fmt.Errorf("Upper cannot be NULL unless UpperType is Unbounded") } pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4)) } return buf, nil } type encodePlanRangeCodecRangeValuerToText struct { rc *RangeCodec m *Map } func (plan *encodePlanRangeCodecRangeValuerToText) Encode(value any, buf []byte) (newBuf []byte, err error) { getter := value.(RangeValuer) if getter.IsNull() { return nil, nil } lowerType, upperType := getter.BoundTypes() lower, upper := getter.Bounds() switch lowerType { case Exclusive, Unbounded: buf = append(buf, '(') case Inclusive: buf = append(buf, '[') case Empty: return append(buf, "empty"...), nil default: return nil, fmt.Errorf("unknown lower bound type %v", lowerType) } if lowerType != Unbounded { if lower == nil { return nil, fmt.Errorf("Lower cannot be NULL unless LowerType is Unbounded") } lowerPlan := plan.m.PlanEncode(plan.rc.ElementType.OID, TextFormatCode, lower) if lowerPlan == nil { return nil, fmt.Errorf("cannot encode %v as element of range", lower) } buf, err = lowerPlan.Encode(lower, buf) if err != nil { return nil, fmt.Errorf("failed to encode %v as element of range: %w", lower, err) } if buf == nil { return nil, fmt.Errorf("Lower cannot be NULL unless LowerType is Unbounded") } } buf = append(buf, ',') if upperType != Unbounded { if upper == nil { return nil, fmt.Errorf("Upper cannot be NULL unless UpperType is Unbounded") } upperPlan := plan.m.PlanEncode(plan.rc.ElementType.OID, TextFormatCode, upper) if upperPlan == nil { return nil, fmt.Errorf("cannot encode %v as element of range", upper) } buf, err = upperPlan.Encode(upper, buf) if err != nil { return nil, fmt.Errorf("failed to encode %v as element of range: %w", upper, err) } if buf == nil { return nil, fmt.Errorf("Upper cannot be NULL unless UpperType is Unbounded") } } switch upperType { case Exclusive, Unbounded: buf = append(buf, ')') case Inclusive: buf = append(buf, ']') default: return nil, fmt.Errorf("unknown upper bound type %v", upperType) } return buf, nil } func (c *RangeCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case RangeScanner: return &scanPlanBinaryRangeToRangeScanner{rc: c, m: m} } case TextFormatCode: switch target.(type) { case RangeScanner: return &scanPlanTextRangeToRangeScanner{rc: c, m: m} } } return nil } type scanPlanBinaryRangeToRangeScanner struct { rc *RangeCodec m *Map } func (plan *scanPlanBinaryRangeToRangeScanner) Scan(src []byte, target any) error { rangeScanner := (target).(RangeScanner) if src == nil { return rangeScanner.ScanNull() } ubr, err := parseUntypedBinaryRange(src) if err != nil { return err } if ubr.LowerType == Empty { return rangeScanner.SetBoundTypes(ubr.LowerType, ubr.UpperType) } lowerTarget, upperTarget := rangeScanner.ScanBounds() if ubr.LowerType == Inclusive || ubr.LowerType == Exclusive { lowerPlan := plan.m.PlanScan(plan.rc.ElementType.OID, BinaryFormatCode, lowerTarget) if lowerPlan == nil { return fmt.Errorf("cannot scan into %v from range element", lowerTarget) } err = lowerPlan.Scan(ubr.Lower, lowerTarget) if err != nil { return fmt.Errorf("cannot scan into %v from range element: %w", lowerTarget, err) } } if ubr.UpperType == Inclusive || ubr.UpperType == Exclusive { upperPlan := plan.m.PlanScan(plan.rc.ElementType.OID, BinaryFormatCode, upperTarget) if upperPlan == nil { return fmt.Errorf("cannot scan into %v from range element", upperTarget) } err = upperPlan.Scan(ubr.Upper, upperTarget) if err != nil { return fmt.Errorf("cannot scan into %v from range element: %w", upperTarget, err) } } return rangeScanner.SetBoundTypes(ubr.LowerType, ubr.UpperType) } type scanPlanTextRangeToRangeScanner struct { rc *RangeCodec m *Map } func (plan *scanPlanTextRangeToRangeScanner) Scan(src []byte, target any) error { rangeScanner := (target).(RangeScanner) if src == nil { return rangeScanner.ScanNull() } utr, err := parseUntypedTextRange(string(src)) if err != nil { return err } if utr.LowerType == Empty { return rangeScanner.SetBoundTypes(utr.LowerType, utr.UpperType) } lowerTarget, upperTarget := rangeScanner.ScanBounds() if utr.LowerType == Inclusive || utr.LowerType == Exclusive { lowerPlan := plan.m.PlanScan(plan.rc.ElementType.OID, TextFormatCode, lowerTarget) if lowerPlan == nil { return fmt.Errorf("cannot scan into %v from range element", lowerTarget) } err = lowerPlan.Scan([]byte(utr.Lower), lowerTarget) if err != nil { return fmt.Errorf("cannot scan into %v from range element: %w", lowerTarget, err) } } if utr.UpperType == Inclusive || utr.UpperType == Exclusive { upperPlan := plan.m.PlanScan(plan.rc.ElementType.OID, TextFormatCode, upperTarget) if upperPlan == nil { return fmt.Errorf("cannot scan into %v from range element", upperTarget) } err = upperPlan.Scan([]byte(utr.Upper), upperTarget) if err != nil { return fmt.Errorf("cannot scan into %v from range element: %w", upperTarget, err) } } return rangeScanner.SetBoundTypes(utr.LowerType, utr.UpperType) } func (c *RangeCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } switch format { case TextFormatCode: return string(src), nil case BinaryFormatCode: buf := make([]byte, len(src)) copy(buf, src) return buf, nil default: return nil, fmt.Errorf("unknown format code %d", format) } } func (c *RangeCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var r Range[any] err := c.PlanScan(m, oid, format, &r).Scan(src, &r) return r, err } pgx-5.8.0/pgtype/range_codec_test.go000066400000000000000000000117261512357711200174640ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/require" ) func TestRangeCodecTranscode(t *testing.T) { skipCockroachDB(t, "Server does not support range types (see https://github.com/cockroachdb/cockroach/issues/27791)") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "int4range", []pgxtest.ValueRoundTripTest{ { pgtype.Range[pgtype.Int4]{LowerType: pgtype.Empty, UpperType: pgtype.Empty, Valid: true}, new(pgtype.Range[pgtype.Int4]), isExpectedEq(pgtype.Range[pgtype.Int4]{LowerType: pgtype.Empty, UpperType: pgtype.Empty, Valid: true}), }, { pgtype.Range[pgtype.Int4]{ LowerType: pgtype.Inclusive, Lower: pgtype.Int4{Int32: 1, Valid: true}, Upper: pgtype.Int4{Int32: 5, Valid: true}, UpperType: pgtype.Exclusive, Valid: true, }, new(pgtype.Range[pgtype.Int4]), isExpectedEq(pgtype.Range[pgtype.Int4]{ LowerType: pgtype.Inclusive, Lower: pgtype.Int4{Int32: 1, Valid: true}, Upper: pgtype.Int4{Int32: 5, Valid: true}, UpperType: pgtype.Exclusive, Valid: true, }), }, {pgtype.Range[pgtype.Int4]{}, new(pgtype.Range[pgtype.Int4]), isExpectedEq(pgtype.Range[pgtype.Int4]{})}, {nil, new(pgtype.Range[pgtype.Int4]), isExpectedEq(pgtype.Range[pgtype.Int4]{})}, }) } func TestRangeCodecTranscodeCompatibleRangeElementTypes(t *testing.T) { ctr := defaultConnTestRunner ctr.AfterConnect = func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server does not support range types (see https://github.com/cockroachdb/cockroach/issues/27791)") } pgxtest.RunValueRoundTripTests(context.Background(), t, ctr, nil, "numrange", []pgxtest.ValueRoundTripTest{ { pgtype.Range[pgtype.Float8]{LowerType: pgtype.Empty, UpperType: pgtype.Empty, Valid: true}, new(pgtype.Range[pgtype.Float8]), isExpectedEq(pgtype.Range[pgtype.Float8]{LowerType: pgtype.Empty, UpperType: pgtype.Empty, Valid: true}), }, { pgtype.Range[pgtype.Float8]{ LowerType: pgtype.Inclusive, Lower: pgtype.Float8{Float64: 1, Valid: true}, Upper: pgtype.Float8{Float64: 5, Valid: true}, UpperType: pgtype.Exclusive, Valid: true, }, new(pgtype.Range[pgtype.Float8]), isExpectedEq(pgtype.Range[pgtype.Float8]{ LowerType: pgtype.Inclusive, Lower: pgtype.Float8{Float64: 1, Valid: true}, Upper: pgtype.Float8{Float64: 5, Valid: true}, UpperType: pgtype.Exclusive, Valid: true, }), }, {pgtype.Range[pgtype.Float8]{}, new(pgtype.Range[pgtype.Float8]), isExpectedEq(pgtype.Range[pgtype.Float8]{})}, {nil, new(pgtype.Range[pgtype.Float8]), isExpectedEq(pgtype.Range[pgtype.Float8]{})}, }) } func TestRangeCodecScanRangeTwiceWithUnbounded(t *testing.T) { skipCockroachDB(t, "Server does not support range types (see https://github.com/cockroachdb/cockroach/issues/27791)") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var r pgtype.Range[pgtype.Int4] err := conn.QueryRow(context.Background(), `select '[1,5)'::int4range`).Scan(&r) require.NoError(t, err) require.Equal( t, pgtype.Range[pgtype.Int4]{ Lower: pgtype.Int4{Int32: 1, Valid: true}, Upper: pgtype.Int4{Int32: 5, Valid: true}, LowerType: pgtype.Inclusive, UpperType: pgtype.Exclusive, Valid: true, }, r, ) err = conn.QueryRow(ctx, `select '[1,)'::int4range`).Scan(&r) require.NoError(t, err) require.Equal( t, pgtype.Range[pgtype.Int4]{ Lower: pgtype.Int4{Int32: 1, Valid: true}, Upper: pgtype.Int4{}, LowerType: pgtype.Inclusive, UpperType: pgtype.Unbounded, Valid: true, }, r, ) err = conn.QueryRow(ctx, `select 'empty'::int4range`).Scan(&r) require.NoError(t, err) require.Equal( t, pgtype.Range[pgtype.Int4]{ Lower: pgtype.Int4{}, Upper: pgtype.Int4{}, LowerType: pgtype.Empty, UpperType: pgtype.Empty, Valid: true, }, r, ) }) } func TestRangeCodecDecodeValue(t *testing.T) { skipCockroachDB(t, "Server does not support range types (see https://github.com/cockroachdb/cockroach/issues/27791)") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { for _, tt := range []struct { sql string expected any }{ { sql: `select '[1,5)'::int4range`, expected: pgtype.Range[any]{ Lower: int32(1), Upper: int32(5), LowerType: pgtype.Inclusive, UpperType: pgtype.Exclusive, Valid: true, }, }, } { t.Run(tt.sql, func(t *testing.T) { rows, err := conn.Query(ctx, tt.sql) require.NoError(t, err) for rows.Next() { values, err := rows.Values() require.NoError(t, err) require.Len(t, values, 1) require.Equal(t, tt.expected, values[0]) } require.NoError(t, rows.Err()) }) } }) } pgx-5.8.0/pgtype/range_test.go000066400000000000000000000123571512357711200163300ustar00rootroot00000000000000package pgtype import ( "bytes" "testing" ) func TestParseUntypedTextRange(t *testing.T) { tests := []struct { src string result untypedTextRange err error }{ { src: `[1,2)`, result: untypedTextRange{Lower: "1", Upper: "2", LowerType: Inclusive, UpperType: Exclusive}, err: nil, }, { src: `[1,2]`, result: untypedTextRange{Lower: "1", Upper: "2", LowerType: Inclusive, UpperType: Inclusive}, err: nil, }, { src: `(1,3)`, result: untypedTextRange{Lower: "1", Upper: "3", LowerType: Exclusive, UpperType: Exclusive}, err: nil, }, { src: ` [1,2) `, result: untypedTextRange{Lower: "1", Upper: "2", LowerType: Inclusive, UpperType: Exclusive}, err: nil, }, { src: `[ foo , bar )`, result: untypedTextRange{Lower: " foo ", Upper: " bar ", LowerType: Inclusive, UpperType: Exclusive}, err: nil, }, { src: `["foo","bar")`, result: untypedTextRange{Lower: "foo", Upper: "bar", LowerType: Inclusive, UpperType: Exclusive}, err: nil, }, { src: `["f""oo","b""ar")`, result: untypedTextRange{Lower: `f"oo`, Upper: `b"ar`, LowerType: Inclusive, UpperType: Exclusive}, err: nil, }, { src: `["f""oo","b""ar")`, result: untypedTextRange{Lower: `f"oo`, Upper: `b"ar`, LowerType: Inclusive, UpperType: Exclusive}, err: nil, }, { src: `["","bar")`, result: untypedTextRange{Lower: ``, Upper: `bar`, LowerType: Inclusive, UpperType: Exclusive}, err: nil, }, { src: `[f\"oo\,,b\\ar\))`, result: untypedTextRange{Lower: `f"oo,`, Upper: `b\ar)`, LowerType: Inclusive, UpperType: Exclusive}, err: nil, }, { src: `empty`, result: untypedTextRange{Lower: "", Upper: "", LowerType: Empty, UpperType: Empty}, err: nil, }, } for i, tt := range tests { r, err := parseUntypedTextRange(tt.src) if err != tt.err { t.Errorf("%d. `%v`: expected err %v, got %v", i, tt.src, tt.err, err) continue } if r.LowerType != tt.result.LowerType { t.Errorf("%d. `%v`: expected result lower type %v, got %v", i, tt.src, string(tt.result.LowerType), string(r.LowerType)) } if r.UpperType != tt.result.UpperType { t.Errorf("%d. `%v`: expected result upper type %v, got %v", i, tt.src, string(tt.result.UpperType), string(r.UpperType)) } if r.Lower != tt.result.Lower { t.Errorf("%d. `%v`: expected result lower %v, got %v", i, tt.src, tt.result.Lower, r.Lower) } if r.Upper != tt.result.Upper { t.Errorf("%d. `%v`: expected result upper %v, got %v", i, tt.src, tt.result.Upper, r.Upper) } } } func TestParseUntypedBinaryRange(t *testing.T) { tests := []struct { src []byte result untypedBinaryRange err error }{ { src: []byte{0, 0, 0, 0, 2, 0, 4, 0, 0, 0, 2, 0, 5}, result: untypedBinaryRange{Lower: []byte{0, 4}, Upper: []byte{0, 5}, LowerType: Exclusive, UpperType: Exclusive}, err: nil, }, { src: []byte{1}, result: untypedBinaryRange{Lower: nil, Upper: nil, LowerType: Empty, UpperType: Empty}, err: nil, }, { src: []byte{2, 0, 0, 0, 2, 0, 4, 0, 0, 0, 2, 0, 5}, result: untypedBinaryRange{Lower: []byte{0, 4}, Upper: []byte{0, 5}, LowerType: Inclusive, UpperType: Exclusive}, err: nil, }, { src: []byte{4, 0, 0, 0, 2, 0, 4, 0, 0, 0, 2, 0, 5}, result: untypedBinaryRange{Lower: []byte{0, 4}, Upper: []byte{0, 5}, LowerType: Exclusive, UpperType: Inclusive}, err: nil, }, { src: []byte{6, 0, 0, 0, 2, 0, 4, 0, 0, 0, 2, 0, 5}, result: untypedBinaryRange{Lower: []byte{0, 4}, Upper: []byte{0, 5}, LowerType: Inclusive, UpperType: Inclusive}, err: nil, }, { src: []byte{8, 0, 0, 0, 2, 0, 5}, result: untypedBinaryRange{Lower: nil, Upper: []byte{0, 5}, LowerType: Unbounded, UpperType: Exclusive}, err: nil, }, { src: []byte{12, 0, 0, 0, 2, 0, 5}, result: untypedBinaryRange{Lower: nil, Upper: []byte{0, 5}, LowerType: Unbounded, UpperType: Inclusive}, err: nil, }, { src: []byte{16, 0, 0, 0, 2, 0, 4}, result: untypedBinaryRange{Lower: []byte{0, 4}, Upper: nil, LowerType: Exclusive, UpperType: Unbounded}, err: nil, }, { src: []byte{18, 0, 0, 0, 2, 0, 4}, result: untypedBinaryRange{Lower: []byte{0, 4}, Upper: nil, LowerType: Inclusive, UpperType: Unbounded}, err: nil, }, { src: []byte{24}, result: untypedBinaryRange{Lower: nil, Upper: nil, LowerType: Unbounded, UpperType: Unbounded}, err: nil, }, } for i, tt := range tests { r, err := parseUntypedBinaryRange(tt.src) if err != tt.err { t.Errorf("%d. `%v`: expected err %v, got %v", i, tt.src, tt.err, err) continue } if r.LowerType != tt.result.LowerType { t.Errorf("%d. `%v`: expected result lower type %v, got %v", i, tt.src, string(tt.result.LowerType), string(r.LowerType)) } if r.UpperType != tt.result.UpperType { t.Errorf("%d. `%v`: expected result upper type %v, got %v", i, tt.src, string(tt.result.UpperType), string(r.UpperType)) } if !bytes.Equal(r.Lower, tt.result.Lower) { t.Errorf("%d. `%v`: expected result lower %v, got %v", i, tt.src, tt.result.Lower, r.Lower) } if !bytes.Equal(r.Upper, tt.result.Upper) { t.Errorf("%d. `%v`: expected result upper %v, got %v", i, tt.src, tt.result.Upper, r.Upper) } } } pgx-5.8.0/pgtype/record_codec.go000066400000000000000000000057671512357711200166170ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "fmt" ) // ArrayGetter is a type that can be converted into a PostgreSQL array. // RecordCodec is a codec for the generic PostgreSQL record type such as is created with the "row" function. Record can // only decode the binary format. The text format output format from PostgreSQL does not include type information and // is therefore impossible to decode. Encoding is impossible because PostgreSQL does not support input of generic // records. type RecordCodec struct{} func (RecordCodec) FormatSupported(format int16) bool { return format == BinaryFormatCode } func (RecordCodec) PreferredFormat() int16 { return BinaryFormatCode } func (RecordCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { return nil } func (RecordCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { if format == BinaryFormatCode { switch target.(type) { case CompositeIndexScanner: return &scanPlanBinaryRecordToCompositeIndexScanner{m: m} } } return nil } type scanPlanBinaryRecordToCompositeIndexScanner struct { m *Map } func (plan *scanPlanBinaryRecordToCompositeIndexScanner) Scan(src []byte, target any) error { targetScanner := (target).(CompositeIndexScanner) if src == nil { return targetScanner.ScanNull() } scanner := NewCompositeBinaryScanner(plan.m, src) for i := 0; scanner.Next(); i++ { fieldTarget := targetScanner.ScanIndex(i) if fieldTarget != nil { fieldPlan := plan.m.PlanScan(scanner.OID(), BinaryFormatCode, fieldTarget) if fieldPlan == nil { return fmt.Errorf("unable to scan OID %d in binary format into %v", scanner.OID(), fieldTarget) } err := fieldPlan.Scan(scanner.Bytes(), fieldTarget) if err != nil { return err } } } if err := scanner.Err(); err != nil { return err } return nil } func (RecordCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } switch format { case TextFormatCode: return string(src), nil case BinaryFormatCode: buf := make([]byte, len(src)) copy(buf, src) return buf, nil default: return nil, fmt.Errorf("unknown format code %d", format) } } func (RecordCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } switch format { case TextFormatCode: return string(src), nil case BinaryFormatCode: scanner := NewCompositeBinaryScanner(m, src) values := make([]any, scanner.FieldCount()) for i := 0; scanner.Next(); i++ { var v any fieldPlan := m.PlanScan(scanner.OID(), BinaryFormatCode, &v) if fieldPlan == nil { return nil, fmt.Errorf("unable to scan OID %d in binary format into %v", scanner.OID(), v) } err := fieldPlan.Scan(scanner.Bytes(), &v) if err != nil { return nil, err } values[i] = v } if err := scanner.Err(); err != nil { return nil, err } return values, nil default: return nil, fmt.Errorf("unknown format code %d", format) } } pgx-5.8.0/pgtype/record_codec_test.go000066400000000000000000000034051512357711200176410ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/stretchr/testify/require" ) func TestRecordCodec(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var a string var b int32 err := conn.QueryRow(ctx, `select row('foo'::text, 42::int4)`).Scan(pgtype.CompositeFields{&a, &b}) require.NoError(t, err) require.Equal(t, "foo", a) require.Equal(t, int32(42), b) }) } func TestRecordCodecDecodeValue(t *testing.T) { skipCockroachDB(t, "Server converts row int4 to int8") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { for _, tt := range []struct { sql string expected any }{ { sql: `select row()`, expected: []any{}, }, { sql: `select row('foo'::text, 42::int4)`, expected: []any{"foo", int32(42)}, }, { sql: `select row(100.0::float4, 1.09::float4)`, expected: []any{float32(100), float32(1.09)}, }, { sql: `select row('foo'::text, array[1, 2, null, 4]::int4[], 42::int4)`, expected: []any{"foo", []any{int32(1), int32(2), nil, int32(4)}, int32(42)}, }, { sql: `select row(null)`, expected: []any{nil}, }, { sql: `select null::record`, expected: nil, }, } { t.Run(tt.sql, func(t *testing.T) { rows, err := conn.Query(context.Background(), tt.sql) require.NoError(t, err) defer rows.Close() for rows.Next() { values, err := rows.Values() require.NoError(t, err) require.Len(t, values, 1) require.Equal(t, tt.expected, values[0]) } require.NoError(t, rows.Err()) }) } }) } pgx-5.8.0/pgtype/register_default_pg_types.go000066400000000000000000000021761512357711200214350ustar00rootroot00000000000000//go:build !nopgxregisterdefaulttypes package pgtype func registerDefaultPgTypeVariants[T any](m *Map, name string) { arrayName := "_" + name var value T m.RegisterDefaultPgType(value, name) // T m.RegisterDefaultPgType(&value, name) // *T var sliceT []T m.RegisterDefaultPgType(sliceT, arrayName) // []T m.RegisterDefaultPgType(&sliceT, arrayName) // *[]T var slicePtrT []*T m.RegisterDefaultPgType(slicePtrT, arrayName) // []*T m.RegisterDefaultPgType(&slicePtrT, arrayName) // *[]*T var arrayOfT Array[T] m.RegisterDefaultPgType(arrayOfT, arrayName) // Array[T] m.RegisterDefaultPgType(&arrayOfT, arrayName) // *Array[T] var arrayOfPtrT Array[*T] m.RegisterDefaultPgType(arrayOfPtrT, arrayName) // Array[*T] m.RegisterDefaultPgType(&arrayOfPtrT, arrayName) // *Array[*T] var flatArrayOfT FlatArray[T] m.RegisterDefaultPgType(flatArrayOfT, arrayName) // FlatArray[T] m.RegisterDefaultPgType(&flatArrayOfT, arrayName) // *FlatArray[T] var flatArrayOfPtrT FlatArray[*T] m.RegisterDefaultPgType(flatArrayOfPtrT, arrayName) // FlatArray[*T] m.RegisterDefaultPgType(&flatArrayOfPtrT, arrayName) // *FlatArray[*T] } pgx-5.8.0/pgtype/register_default_pg_types_disabled.go000066400000000000000000000001711512357711200232550ustar00rootroot00000000000000//go:build nopgxregisterdefaulttypes package pgtype func registerDefaultPgTypeVariants[T any](m *Map, name string) { } pgx-5.8.0/pgtype/text.go000066400000000000000000000110521512357711200151500ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/json" "fmt" ) type TextScanner interface { ScanText(v Text) error } type TextValuer interface { TextValue() (Text, error) } type Text struct { String string Valid bool } // ScanText implements the [TextScanner] interface. func (t *Text) ScanText(v Text) error { *t = v return nil } // TextValue implements the [TextValuer] interface. func (t Text) TextValue() (Text, error) { return t, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Text) Scan(src any) error { if src == nil { *dst = Text{} return nil } switch src := src.(type) { case string: *dst = Text{String: src, Valid: true} return nil case []byte: *dst = Text{String: string(src), Valid: true} return nil } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (src Text) Value() (driver.Value, error) { if !src.Valid { return nil, nil } return src.String, nil } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (src Text) MarshalJSON() ([]byte, error) { if !src.Valid { return []byte("null"), nil } return json.Marshal(src.String) } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (dst *Text) UnmarshalJSON(b []byte) error { var s *string err := json.Unmarshal(b, &s) if err != nil { return err } if s == nil { *dst = Text{} } else { *dst = Text{String: *s, Valid: true} } return nil } type TextCodec struct{} func (TextCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (TextCodec) PreferredFormat() int16 { return TextFormatCode } func (TextCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case TextFormatCode, BinaryFormatCode: switch value.(type) { case string: return encodePlanTextCodecString{} case []byte: return encodePlanTextCodecByteSlice{} case TextValuer: return encodePlanTextCodecTextValuer{} } } return nil } type encodePlanTextCodecString struct{} func (encodePlanTextCodecString) Encode(value any, buf []byte) (newBuf []byte, err error) { s := value.(string) buf = append(buf, s...) return buf, nil } type encodePlanTextCodecByteSlice struct{} func (encodePlanTextCodecByteSlice) Encode(value any, buf []byte) (newBuf []byte, err error) { s := value.([]byte) buf = append(buf, s...) return buf, nil } type encodePlanTextCodecStringer struct{} func (encodePlanTextCodecStringer) Encode(value any, buf []byte) (newBuf []byte, err error) { s := value.(fmt.Stringer) buf = append(buf, s.String()...) return buf, nil } type encodePlanTextCodecTextValuer struct{} func (encodePlanTextCodecTextValuer) Encode(value any, buf []byte) (newBuf []byte, err error) { text, err := value.(TextValuer).TextValue() if err != nil { return nil, err } if !text.Valid { return nil, nil } buf = append(buf, text.String...) return buf, nil } func (TextCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case TextFormatCode, BinaryFormatCode: switch target.(type) { case *string: return scanPlanTextAnyToString{} case *[]byte: return scanPlanAnyToNewByteSlice{} case BytesScanner: return scanPlanAnyToByteScanner{} case TextScanner: return scanPlanTextAnyToTextScanner{} } } return nil } func (c TextCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return c.DecodeValue(m, oid, format, src) } func (c TextCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } return string(src), nil } type scanPlanTextAnyToString struct{} func (scanPlanTextAnyToString) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } p := (dst).(*string) *p = string(src) return nil } type scanPlanAnyToNewByteSlice struct{} func (scanPlanAnyToNewByteSlice) Scan(src []byte, dst any) error { p := (dst).(*[]byte) if src == nil { *p = nil } else { *p = make([]byte, len(src)) copy(*p, src) } return nil } type scanPlanAnyToByteScanner struct{} func (scanPlanAnyToByteScanner) Scan(src []byte, dst any) error { p := (dst).(BytesScanner) return p.ScanBytes(src) } type scanPlanTextAnyToTextScanner struct{} func (scanPlanTextAnyToTextScanner) Scan(src []byte, dst any) error { scanner := (dst).(TextScanner) if src == nil { return scanner.ScanText(Text{}) } return scanner.ScanText(Text{String: string(src), Valid: true}) } pgx-5.8.0/pgtype/text_format_only_codec.go000066400000000000000000000004241512357711200207170ustar00rootroot00000000000000package pgtype type TextFormatOnlyCodec struct { Codec } func (c *TextFormatOnlyCodec) FormatSupported(format int16) bool { return format == TextFormatCode && c.Codec.FormatSupported(format) } func (TextFormatOnlyCodec) PreferredFormat() int16 { return TextFormatCode } pgx-5.8.0/pgtype/text_test.go000066400000000000000000000134201512357711200162100ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/require" ) type someFmtStringer struct{} func (someFmtStringer) String() string { return "some fmt.Stringer" } func TestTextCodec(t *testing.T) { for _, pgTypeName := range []string{"text", "varchar"} { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, pgTypeName, []pgxtest.ValueRoundTripTest{ { pgtype.Text{String: "", Valid: true}, new(pgtype.Text), isExpectedEq(pgtype.Text{String: "", Valid: true}), }, { pgtype.Text{String: "foo", Valid: true}, new(pgtype.Text), isExpectedEq(pgtype.Text{String: "foo", Valid: true}), }, {nil, new(pgtype.Text), isExpectedEq(pgtype.Text{})}, {"foo", new(string), isExpectedEq("foo")}, {someFmtStringer{}, new(string), isExpectedEq("some fmt.Stringer")}, }) } } // name is PostgreSQL's special 63-byte data type, used for identifiers like table names. The pg_class.relname column // is a good example of where the name data type is used. // // TextCodec does not do length checking. Inputting a longer name into PostgreSQL will result in silent truncation to // 63 bytes. // // Length checking would be possible with a Codec specialized for "name" but it would be perfect because a // custom-compiled PostgreSQL could have set NAMEDATALEN to a different value rather than the default 63. // // So this is simply a smoke test of the name type. func TestTextCodecName(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "name", []pgxtest.ValueRoundTripTest{ { pgtype.Text{String: "", Valid: true}, new(pgtype.Text), isExpectedEq(pgtype.Text{String: "", Valid: true}), }, { pgtype.Text{String: "foo", Valid: true}, new(pgtype.Text), isExpectedEq(pgtype.Text{String: "foo", Valid: true}), }, {nil, new(pgtype.Text), isExpectedEq(pgtype.Text{})}, {"foo", new(string), isExpectedEq("foo")}, }) } // Test fixed length char types like char(3) func TestTextCodecBPChar(t *testing.T) { skipCockroachDB(t, "Server does not properly handle bpchar with multi-byte character") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "char(3)", []pgxtest.ValueRoundTripTest{ { pgtype.Text{String: "a ", Valid: true}, new(pgtype.Text), isExpectedEq(pgtype.Text{String: "a ", Valid: true}), }, {nil, new(pgtype.Text), isExpectedEq(pgtype.Text{})}, {" ", new(string), isExpectedEq(" ")}, {"", new(string), isExpectedEq(" ")}, {" 嗨 ", new(string), isExpectedEq(" 嗨 ")}, }) } // ACLItem is used for PostgreSQL's aclitem data type. A sample aclitem // might look like this: // // postgres=arwdDxt/postgres // // Note, however, that because the user/role name part of an aclitem is // an identifier, it follows all the usual formatting rules for SQL // identifiers: if it contains spaces and other special characters, // it should appear in double-quotes: // // postgres=arwdDxt/"role with spaces" // // It only supports the text format. func TestTextCodecACLItem(t *testing.T) { ctr := defaultConnTestRunner ctr.AfterConnect = func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server does not support type aclitem") } pgxtest.RunValueRoundTripTests(context.Background(), t, ctr, nil, "aclitem", []pgxtest.ValueRoundTripTest{ { pgtype.Text{String: "postgres=arwdDxt/postgres", Valid: true}, new(pgtype.Text), isExpectedEq(pgtype.Text{String: "postgres=arwdDxt/postgres", Valid: true}), }, {pgtype.Text{}, new(pgtype.Text), isExpectedEq(pgtype.Text{})}, {nil, new(pgtype.Text), isExpectedEq(pgtype.Text{})}, }) } func TestTextCodecACLItemRoleWithSpecialCharacters(t *testing.T) { ctr := defaultConnTestRunner ctr.AfterConnect = func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server does not support type aclitem") // The tricky test user, below, has to actually exist so that it can be used in a test // of aclitem formatting. It turns out aclitems cannot contain non-existing users/roles. roleWithSpecialCharacters := ` tricky, ' } " \ test user ` commandTag, err := conn.Exec(ctx, `select * from pg_roles where rolname = $1`, roleWithSpecialCharacters) require.NoError(t, err) if commandTag.RowsAffected() == 0 { t.Skipf("Role with special characters does not exist.") } } pgxtest.RunValueRoundTripTests(context.Background(), t, ctr, nil, "aclitem", []pgxtest.ValueRoundTripTest{ { pgtype.Text{String: `postgres=arwdDxt/" tricky, ' } "" \ test user "`, Valid: true}, new(pgtype.Text), isExpectedEq(pgtype.Text{String: `postgres=arwdDxt/" tricky, ' } "" \ test user "`, Valid: true}), }, }) } func TestTextMarshalJSON(t *testing.T) { successfulTests := []struct { source pgtype.Text result string }{ {source: pgtype.Text{String: ""}, result: "null"}, {source: pgtype.Text{String: "a", Valid: true}, result: "\"a\""}, } for i, tt := range successfulTests { r, err := tt.source.MarshalJSON() if err != nil { t.Errorf("%d: %v", i, err) } if string(r) != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, string(r)) } } } func TestTextUnmarshalJSON(t *testing.T) { successfulTests := []struct { source string result pgtype.Text }{ {source: "null", result: pgtype.Text{String: ""}}, {source: "\"a\"", result: pgtype.Text{String: "a", Valid: true}}, } for i, tt := range successfulTests { var r pgtype.Text err := r.UnmarshalJSON([]byte(tt.source)) if err != nil { t.Errorf("%d: %v", i, err) } if r != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, r) } } } pgx-5.8.0/pgtype/tid.go000066400000000000000000000120571512357711200147520ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "fmt" "strconv" "strings" "github.com/jackc/pgx/v5/internal/pgio" ) type TIDScanner interface { ScanTID(v TID) error } type TIDValuer interface { TIDValue() (TID, error) } // TID is PostgreSQL's Tuple Identifier type. // // When one does // // select ctid, * from some_table; // // it is the data type of the ctid hidden system column. // // It is currently implemented as a pair unsigned two byte integers. // Its conversion functions can be found in src/backend/utils/adt/tid.c // in the PostgreSQL sources. type TID struct { BlockNumber uint32 OffsetNumber uint16 Valid bool } // ScanTID implements the [TIDScanner] interface. func (b *TID) ScanTID(v TID) error { *b = v return nil } // TIDValue implements the [TIDValuer] interface. func (b TID) TIDValue() (TID, error) { return b, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *TID) Scan(src any) error { if src == nil { *dst = TID{} return nil } switch src := src.(type) { case string: return scanPlanTextAnyToTIDScanner{}.Scan([]byte(src), dst) } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (src TID) Value() (driver.Value, error) { if !src.Valid { return nil, nil } buf, err := TIDCodec{}.PlanEncode(nil, 0, TextFormatCode, src).Encode(src, nil) if err != nil { return nil, err } return string(buf), err } type TIDCodec struct{} func (TIDCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (TIDCodec) PreferredFormat() int16 { return BinaryFormatCode } func (TIDCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(TIDValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanTIDCodecBinary{} case TextFormatCode: return encodePlanTIDCodecText{} } return nil } type encodePlanTIDCodecBinary struct{} func (encodePlanTIDCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { tid, err := value.(TIDValuer).TIDValue() if err != nil { return nil, err } if !tid.Valid { return nil, nil } buf = pgio.AppendUint32(buf, tid.BlockNumber) buf = pgio.AppendUint16(buf, tid.OffsetNumber) return buf, nil } type encodePlanTIDCodecText struct{} func (encodePlanTIDCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { tid, err := value.(TIDValuer).TIDValue() if err != nil { return nil, err } if !tid.Valid { return nil, nil } buf = append(buf, fmt.Sprintf(`(%d,%d)`, tid.BlockNumber, tid.OffsetNumber)...) return buf, nil } func (TIDCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case TIDScanner: return scanPlanBinaryTIDToTIDScanner{} case TextScanner: return scanPlanBinaryTIDToTextScanner{} } case TextFormatCode: switch target.(type) { case TIDScanner: return scanPlanTextAnyToTIDScanner{} } } return nil } type scanPlanBinaryTIDToTIDScanner struct{} func (scanPlanBinaryTIDToTIDScanner) Scan(src []byte, dst any) error { scanner := (dst).(TIDScanner) if src == nil { return scanner.ScanTID(TID{}) } if len(src) != 6 { return fmt.Errorf("invalid length for tid: %v", len(src)) } return scanner.ScanTID(TID{ BlockNumber: binary.BigEndian.Uint32(src), OffsetNumber: binary.BigEndian.Uint16(src[4:]), Valid: true, }) } type scanPlanBinaryTIDToTextScanner struct{} func (scanPlanBinaryTIDToTextScanner) Scan(src []byte, dst any) error { scanner := (dst).(TextScanner) if src == nil { return scanner.ScanText(Text{}) } if len(src) != 6 { return fmt.Errorf("invalid length for tid: %v", len(src)) } blockNumber := binary.BigEndian.Uint32(src) offsetNumber := binary.BigEndian.Uint16(src[4:]) return scanner.ScanText(Text{ String: fmt.Sprintf(`(%d,%d)`, blockNumber, offsetNumber), Valid: true, }) } type scanPlanTextAnyToTIDScanner struct{} func (scanPlanTextAnyToTIDScanner) Scan(src []byte, dst any) error { scanner := (dst).(TIDScanner) if src == nil { return scanner.ScanTID(TID{}) } if len(src) < 5 { return fmt.Errorf("invalid length for tid: %v", len(src)) } block, offset, found := strings.Cut(string(src[1:len(src)-1]), ",") if !found { return fmt.Errorf("invalid format for tid") } blockNumber, err := strconv.ParseUint(block, 10, 32) if err != nil { return err } offsetNumber, err := strconv.ParseUint(offset, 10, 16) if err != nil { return err } return scanner.ScanTID(TID{BlockNumber: uint32(blockNumber), OffsetNumber: uint16(offsetNumber), Valid: true}) } func (c TIDCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return codecDecodeToTextFormat(c, m, oid, format, src) } func (c TIDCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var tid TID err := codecScan(c, m, oid, format, src, &tid) if err != nil { return nil, err } return tid, nil } pgx-5.8.0/pgtype/tid_test.go000066400000000000000000000020631512357711200160050ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func TestTIDCodec(t *testing.T) { skipCockroachDB(t, "Server does not support type tid") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "tid", []pgxtest.ValueRoundTripTest{ { pgtype.TID{BlockNumber: 42, OffsetNumber: 43, Valid: true}, new(pgtype.TID), isExpectedEq(pgtype.TID{BlockNumber: 42, OffsetNumber: 43, Valid: true}), }, { pgtype.TID{BlockNumber: 4294967295, OffsetNumber: 65535, Valid: true}, new(pgtype.TID), isExpectedEq(pgtype.TID{BlockNumber: 4294967295, OffsetNumber: 65535, Valid: true}), }, { pgtype.TID{BlockNumber: 42, OffsetNumber: 43, Valid: true}, new(string), isExpectedEq("(42,43)"), }, { pgtype.TID{BlockNumber: 4294967295, OffsetNumber: 65535, Valid: true}, new(string), isExpectedEq("(4294967295,65535)"), }, {pgtype.TID{}, new(pgtype.TID), isExpectedEq(pgtype.TID{})}, {nil, new(pgtype.TID), isExpectedEq(pgtype.TID{})}, }) } pgx-5.8.0/pgtype/time.go000066400000000000000000000141771512357711200151350ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "fmt" "strconv" "github.com/jackc/pgx/v5/internal/pgio" ) type TimeScanner interface { ScanTime(v Time) error } type TimeValuer interface { TimeValue() (Time, error) } // Time represents the PostgreSQL time type. The PostgreSQL time is a time of day without time zone. // // Time is represented as the number of microseconds since midnight in the same way that PostgreSQL does. Other time and // date types in pgtype can use time.Time as the underlying representation. However, pgtype.Time type cannot due to // needing to handle 24:00:00. time.Time converts that to 00:00:00 on the following day. // // The time with time zone type is not supported. Use of time with time zone is discouraged by the PostgreSQL documentation. type Time struct { Microseconds int64 // Number of microseconds since midnight Valid bool } // ScanTime implements the [TimeScanner] interface. func (t *Time) ScanTime(v Time) error { *t = v return nil } // TimeValue implements the [TimeValuer] interface. func (t Time) TimeValue() (Time, error) { return t, nil } // Scan implements the [database/sql.Scanner] interface. func (t *Time) Scan(src any) error { if src == nil { *t = Time{} return nil } switch src := src.(type) { case string: err := scanPlanTextAnyToTimeScanner{}.Scan([]byte(src), t) if err != nil { t.Microseconds = 0 t.Valid = false } return err } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (t Time) Value() (driver.Value, error) { if !t.Valid { return nil, nil } buf, err := TimeCodec{}.PlanEncode(nil, 0, TextFormatCode, t).Encode(t, nil) if err != nil { return nil, err } return string(buf), err } type TimeCodec struct{} func (TimeCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (TimeCodec) PreferredFormat() int16 { return BinaryFormatCode } func (TimeCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(TimeValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanTimeCodecBinary{} case TextFormatCode: return encodePlanTimeCodecText{} } return nil } type encodePlanTimeCodecBinary struct{} func (encodePlanTimeCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { t, err := value.(TimeValuer).TimeValue() if err != nil { return nil, err } if !t.Valid { return nil, nil } return pgio.AppendInt64(buf, t.Microseconds), nil } type encodePlanTimeCodecText struct{} func (encodePlanTimeCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { t, err := value.(TimeValuer).TimeValue() if err != nil { return nil, err } if !t.Valid { return nil, nil } usec := t.Microseconds hours := usec / microsecondsPerHour usec -= hours * microsecondsPerHour minutes := usec / microsecondsPerMinute usec -= minutes * microsecondsPerMinute seconds := usec / microsecondsPerSecond usec -= seconds * microsecondsPerSecond s := fmt.Sprintf("%02d:%02d:%02d.%06d", hours, minutes, seconds, usec) return append(buf, s...), nil } func (TimeCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case TimeScanner: return scanPlanBinaryTimeToTimeScanner{} case TextScanner: return scanPlanBinaryTimeToTextScanner{} } case TextFormatCode: switch target.(type) { case TimeScanner: return scanPlanTextAnyToTimeScanner{} } } return nil } type scanPlanBinaryTimeToTimeScanner struct{} func (scanPlanBinaryTimeToTimeScanner) Scan(src []byte, dst any) error { scanner := (dst).(TimeScanner) if src == nil { return scanner.ScanTime(Time{}) } if len(src) != 8 { return fmt.Errorf("invalid length for time: %v", len(src)) } usec := int64(binary.BigEndian.Uint64(src)) return scanner.ScanTime(Time{Microseconds: usec, Valid: true}) } type scanPlanBinaryTimeToTextScanner struct{} func (scanPlanBinaryTimeToTextScanner) Scan(src []byte, dst any) error { ts, ok := (dst).(TextScanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return ts.ScanText(Text{}) } if len(src) != 8 { return fmt.Errorf("invalid length for time: %v", len(src)) } usec := int64(binary.BigEndian.Uint64(src)) tim := Time{Microseconds: usec, Valid: true} buf, err := TimeCodec{}.PlanEncode(nil, 0, TextFormatCode, tim).Encode(tim, nil) if err != nil { return err } return ts.ScanText(Text{String: string(buf), Valid: true}) } type scanPlanTextAnyToTimeScanner struct{} func (scanPlanTextAnyToTimeScanner) Scan(src []byte, dst any) error { scanner := (dst).(TimeScanner) if src == nil { return scanner.ScanTime(Time{}) } s := string(src) if len(s) < 8 || s[2] != ':' || s[5] != ':' { return fmt.Errorf("cannot decode %v into Time", s) } hours, err := strconv.ParseInt(s[0:2], 10, 64) if err != nil { return fmt.Errorf("cannot decode %v into Time", s) } usec := hours * microsecondsPerHour minutes, err := strconv.ParseInt(s[3:5], 10, 64) if err != nil { return fmt.Errorf("cannot decode %v into Time", s) } usec += minutes * microsecondsPerMinute seconds, err := strconv.ParseInt(s[6:8], 10, 64) if err != nil { return fmt.Errorf("cannot decode %v into Time", s) } usec += seconds * microsecondsPerSecond if len(s) > 9 { if s[8] != '.' || len(s) > 15 { return fmt.Errorf("cannot decode %v into Time", s) } fraction := s[9:] n, err := strconv.ParseInt(fraction, 10, 64) if err != nil { return fmt.Errorf("cannot decode %v into Time", s) } for i := len(fraction); i < 6; i++ { n *= 10 } usec += n } return scanner.ScanTime(Time{Microseconds: usec, Valid: true}) } func (c TimeCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { return codecDecodeToTextFormat(c, m, oid, format, src) } func (c TimeCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var t Time err := codecScan(c, m, oid, format, src, &t) if err != nil { return nil, err } return t, nil } pgx-5.8.0/pgtype/time_test.go000066400000000000000000000071051512357711200161650ustar00rootroot00000000000000package pgtype_test import ( "context" "strconv" "testing" "time" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/assert" ) func TestTimeCodec(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "time", []pgxtest.ValueRoundTripTest{ { pgtype.Time{Microseconds: 0, Valid: true}, new(pgtype.Time), isExpectedEq(pgtype.Time{Microseconds: 0, Valid: true}), }, { pgtype.Time{Microseconds: 1, Valid: true}, new(pgtype.Time), isExpectedEq(pgtype.Time{Microseconds: 1, Valid: true}), }, { pgtype.Time{Microseconds: 86_399_999_999, Valid: true}, new(pgtype.Time), isExpectedEq(pgtype.Time{Microseconds: 86_399_999_999, Valid: true}), }, { pgtype.Time{Microseconds: 86_400_000_000, Valid: true}, new(pgtype.Time), isExpectedEq(pgtype.Time{Microseconds: 86_400_000_000, Valid: true}), }, { time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC), new(pgtype.Time), isExpectedEq(pgtype.Time{Microseconds: 0, Valid: true}), }, { pgtype.Time{Microseconds: 0, Valid: true}, new(time.Time), isExpectedEq(time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC)), }, {pgtype.Time{}, new(pgtype.Time), isExpectedEq(pgtype.Time{})}, {nil, new(pgtype.Time), isExpectedEq(pgtype.Time{})}, }) } func TestTimeTextScanner(t *testing.T) { var pgTime pgtype.Time assert.NoError(t, pgTime.Scan("07:37:16")) assert.Equal(t, true, pgTime.Valid) assert.Equal(t, int64(7*time.Hour+37*time.Minute+16*time.Second), pgTime.Microseconds*int64(time.Microsecond)) assert.NoError(t, pgTime.Scan("15:04:05")) assert.Equal(t, true, pgTime.Valid) assert.Equal(t, int64(15*time.Hour+4*time.Minute+5*time.Second), pgTime.Microseconds*int64(time.Microsecond)) // parsing of fractional digits assert.NoError(t, pgTime.Scan("15:04:05.00")) assert.Equal(t, true, pgTime.Valid) assert.Equal(t, int64(15*time.Hour+4*time.Minute+5*time.Second), pgTime.Microseconds*int64(time.Microsecond)) const mirco = "789123" const woFraction = int64(4*time.Hour + 5*time.Minute + 6*time.Second) // time without fraction for i := 0; i <= len(mirco); i++ { assert.NoError(t, pgTime.Scan("04:05:06."+mirco[:i])) assert.Equal(t, true, pgTime.Valid) frac, _ := strconv.ParseInt(mirco[:i], 10, 64) for k := i; k < 6; k++ { frac *= 10 } assert.Equal(t, woFraction+frac*int64(time.Microsecond), pgTime.Microseconds*int64(time.Microsecond)) } // parsing of too long fraction errors assert.Error(t, pgTime.Scan("04:05:06.7891234")) assert.Equal(t, false, pgTime.Valid) assert.Equal(t, int64(0), pgTime.Microseconds) // parsing of timetz errors assert.Error(t, pgTime.Scan("04:05:06.789-08")) assert.Equal(t, false, pgTime.Valid) assert.Equal(t, int64(0), pgTime.Microseconds) assert.Error(t, pgTime.Scan("04:05:06-08:00")) assert.Equal(t, false, pgTime.Valid) assert.Equal(t, int64(0), pgTime.Microseconds) // parsing of date errors assert.Error(t, pgTime.Scan("1997-12-17")) assert.Equal(t, false, pgTime.Valid) assert.Equal(t, int64(0), pgTime.Microseconds) // parsing of text errors assert.Error(t, pgTime.Scan("12345678")) assert.Equal(t, false, pgTime.Valid) assert.Equal(t, int64(0), pgTime.Microseconds) assert.Error(t, pgTime.Scan("12-34-56")) assert.Equal(t, false, pgTime.Valid) assert.Equal(t, int64(0), pgTime.Microseconds) assert.Error(t, pgTime.Scan("12:34-56")) assert.Equal(t, false, pgTime.Valid) assert.Equal(t, int64(0), pgTime.Microseconds) assert.Error(t, pgTime.Scan("12-34:56")) assert.Equal(t, false, pgTime.Valid) assert.Equal(t, int64(0), pgTime.Microseconds) } pgx-5.8.0/pgtype/timestamp.go000066400000000000000000000211661512357711200161760ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "encoding/json" "fmt" "strings" "time" "github.com/jackc/pgx/v5/internal/pgio" ) const ( pgTimestampFormat = "2006-01-02 15:04:05.999999999" jsonISO8601 = "2006-01-02T15:04:05.999999999" ) type TimestampScanner interface { ScanTimestamp(v Timestamp) error } type TimestampValuer interface { TimestampValue() (Timestamp, error) } // Timestamp represents the PostgreSQL timestamp type. type Timestamp struct { Time time.Time // Time zone will be ignored when encoding to PostgreSQL. InfinityModifier InfinityModifier Valid bool } // ScanTimestamp implements the [TimestampScanner] interface. func (ts *Timestamp) ScanTimestamp(v Timestamp) error { *ts = v return nil } // TimestampValue implements the [TimestampValuer] interface. func (ts Timestamp) TimestampValue() (Timestamp, error) { return ts, nil } // Scan implements the [database/sql.Scanner] interface. func (ts *Timestamp) Scan(src any) error { if src == nil { *ts = Timestamp{} return nil } switch src := src.(type) { case string: return (&scanPlanTextTimestampToTimestampScanner{}).Scan([]byte(src), ts) case time.Time: *ts = Timestamp{Time: src, Valid: true} return nil } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (ts Timestamp) Value() (driver.Value, error) { if !ts.Valid { return nil, nil } if ts.InfinityModifier != Finite { return ts.InfinityModifier.String(), nil } return ts.Time, nil } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (ts Timestamp) MarshalJSON() ([]byte, error) { if !ts.Valid { return []byte("null"), nil } var s string switch ts.InfinityModifier { case Finite: s = ts.Time.Format(jsonISO8601) case Infinity: s = "infinity" case NegativeInfinity: s = "-infinity" } return json.Marshal(s) } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (ts *Timestamp) UnmarshalJSON(b []byte) error { var s *string err := json.Unmarshal(b, &s) if err != nil { return err } if s == nil { *ts = Timestamp{} return nil } switch *s { case "infinity": *ts = Timestamp{Valid: true, InfinityModifier: Infinity} case "-infinity": *ts = Timestamp{Valid: true, InfinityModifier: -Infinity} default: // Parse time with or without timezonr tss := *s // PostgreSQL uses ISO 8601 without timezone for to_json function and casting from a string to timestampt tim, err := time.Parse(time.RFC3339Nano, tss) if err == nil { *ts = Timestamp{Time: tim, Valid: true} return nil } tim, err = time.ParseInLocation(jsonISO8601, tss, time.UTC) if err == nil { *ts = Timestamp{Time: tim, Valid: true} return nil } ts.Valid = false return fmt.Errorf("cannot unmarshal %s to timestamp with layout %s or %s (%w)", *s, time.RFC3339Nano, jsonISO8601, err) } return nil } type TimestampCodec struct { // ScanLocation is the location that the time is assumed to be in for scanning. This is different from // TimestamptzCodec.ScanLocation in that this setting does change the instant in time that the timestamp represents. ScanLocation *time.Location } func (*TimestampCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (*TimestampCodec) PreferredFormat() int16 { return BinaryFormatCode } func (*TimestampCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(TimestampValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanTimestampCodecBinary{} case TextFormatCode: return encodePlanTimestampCodecText{} } return nil } type encodePlanTimestampCodecBinary struct{} func (encodePlanTimestampCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { ts, err := value.(TimestampValuer).TimestampValue() if err != nil { return nil, err } if !ts.Valid { return nil, nil } var microsecSinceY2K int64 switch ts.InfinityModifier { case Finite: t := discardTimeZone(ts.Time) microsecSinceUnixEpoch := t.Unix()*1_000_000 + int64(t.Nanosecond())/1000 microsecSinceY2K = microsecSinceUnixEpoch - microsecFromUnixEpochToY2K case Infinity: microsecSinceY2K = infinityMicrosecondOffset case NegativeInfinity: microsecSinceY2K = negativeInfinityMicrosecondOffset } buf = pgio.AppendInt64(buf, microsecSinceY2K) return buf, nil } type encodePlanTimestampCodecText struct{} func (encodePlanTimestampCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { ts, err := value.(TimestampValuer).TimestampValue() if err != nil { return nil, err } if !ts.Valid { return nil, nil } var s string switch ts.InfinityModifier { case Finite: t := discardTimeZone(ts.Time) // Year 0000 is 1 BC bc := false if year := t.Year(); year <= 0 { year = -year + 1 t = time.Date(year, t.Month(), t.Day(), t.Hour(), t.Minute(), t.Second(), t.Nanosecond(), time.UTC) bc = true } s = t.Truncate(time.Microsecond).Format(pgTimestampFormat) if bc { s = s + " BC" } case Infinity: s = "infinity" case NegativeInfinity: s = "-infinity" } buf = append(buf, s...) return buf, nil } func discardTimeZone(t time.Time) time.Time { if t.Location() != time.UTC { return time.Date(t.Year(), t.Month(), t.Day(), t.Hour(), t.Minute(), t.Second(), t.Nanosecond(), time.UTC) } return t } func (c *TimestampCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case TimestampScanner: return &scanPlanBinaryTimestampToTimestampScanner{location: c.ScanLocation} } case TextFormatCode: switch target.(type) { case TimestampScanner: return &scanPlanTextTimestampToTimestampScanner{location: c.ScanLocation} } } return nil } type scanPlanBinaryTimestampToTimestampScanner struct{ location *time.Location } func (plan *scanPlanBinaryTimestampToTimestampScanner) Scan(src []byte, dst any) error { scanner := (dst).(TimestampScanner) if src == nil { return scanner.ScanTimestamp(Timestamp{}) } if len(src) != 8 { return fmt.Errorf("invalid length for timestamp: %v", len(src)) } var ts Timestamp microsecSinceY2K := int64(binary.BigEndian.Uint64(src)) switch microsecSinceY2K { case infinityMicrosecondOffset: ts = Timestamp{Valid: true, InfinityModifier: Infinity} case negativeInfinityMicrosecondOffset: ts = Timestamp{Valid: true, InfinityModifier: -Infinity} default: tim := time.Unix( microsecFromUnixEpochToY2K/1_000_000+microsecSinceY2K/1_000_000, (microsecFromUnixEpochToY2K%1_000_000*1_000)+(microsecSinceY2K%1_000_000*1000), ).UTC() if plan.location != nil { tim = time.Date(tim.Year(), tim.Month(), tim.Day(), tim.Hour(), tim.Minute(), tim.Second(), tim.Nanosecond(), plan.location) } ts = Timestamp{Time: tim, Valid: true} } return scanner.ScanTimestamp(ts) } type scanPlanTextTimestampToTimestampScanner struct{ location *time.Location } func (plan *scanPlanTextTimestampToTimestampScanner) Scan(src []byte, dst any) error { scanner := (dst).(TimestampScanner) if src == nil { return scanner.ScanTimestamp(Timestamp{}) } var ts Timestamp sbuf := string(src) switch sbuf { case "infinity": ts = Timestamp{Valid: true, InfinityModifier: Infinity} case "-infinity": ts = Timestamp{Valid: true, InfinityModifier: -Infinity} default: bc := false if strings.HasSuffix(sbuf, " BC") { sbuf = sbuf[:len(sbuf)-3] bc = true } tim, err := time.Parse(pgTimestampFormat, sbuf) if err != nil { return err } if bc { year := -tim.Year() + 1 tim = time.Date(year, tim.Month(), tim.Day(), tim.Hour(), tim.Minute(), tim.Second(), tim.Nanosecond(), tim.Location()) } if plan.location != nil { tim = time.Date(tim.Year(), tim.Month(), tim.Day(), tim.Hour(), tim.Minute(), tim.Second(), tim.Nanosecond(), plan.location) } ts = Timestamp{Time: tim, Valid: true} } return scanner.ScanTimestamp(ts) } func (c *TimestampCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } var ts Timestamp err := codecScan(c, m, oid, format, src, &ts) if err != nil { return nil, err } if ts.InfinityModifier != Finite { return ts.InfinityModifier.String(), nil } return ts.Time, nil } func (c *TimestampCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var ts Timestamp err := codecScan(c, m, oid, format, src, &ts) if err != nil { return nil, err } if ts.InfinityModifier != Finite { return ts.InfinityModifier, nil } return ts.Time, nil } pgx-5.8.0/pgtype/timestamp_test.go000066400000000000000000000201621512357711200172300ustar00rootroot00000000000000package pgtype_test import ( "context" "encoding/json" "testing" "time" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func TestTimestampCodec(t *testing.T) { skipCockroachDB(t, "Server does not support infinite timestamps (see https://github.com/cockroachdb/cockroach/issues/41564)") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "timestamp", []pgxtest.ValueRoundTripTest{ {time.Date(-100, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(-100, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(-1, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(-1, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(0, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(0, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(1, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(1, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(1900, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(1900, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(1970, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(1970, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(1999, 12, 31, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(1999, 12, 31, 0, 0, 0, 0, time.UTC))}, {time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC))}, {time.Date(2000, 1, 2, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(2000, 1, 2, 0, 0, 0, 0, time.UTC))}, {time.Date(2200, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEqTime(time.Date(2200, 1, 1, 0, 0, 0, 0, time.UTC))}, // Nanosecond truncation {time.Date(2020, 1, 1, 0, 0, 0, 999999999, time.UTC), new(time.Time), isExpectedEqTime(time.Date(2020, 1, 1, 0, 0, 0, 999999000, time.UTC))}, {time.Date(2020, 1, 1, 0, 0, 0, 999999001, time.UTC), new(time.Time), isExpectedEqTime(time.Date(2020, 1, 1, 0, 0, 0, 999999000, time.UTC))}, {pgtype.Timestamp{InfinityModifier: pgtype.Infinity, Valid: true}, new(pgtype.Timestamp), isExpectedEq(pgtype.Timestamp{InfinityModifier: pgtype.Infinity, Valid: true})}, {pgtype.Timestamp{InfinityModifier: pgtype.NegativeInfinity, Valid: true}, new(pgtype.Timestamp), isExpectedEq(pgtype.Timestamp{InfinityModifier: pgtype.NegativeInfinity, Valid: true})}, {pgtype.Timestamp{}, new(pgtype.Timestamp), isExpectedEq(pgtype.Timestamp{})}, {nil, new(*time.Time), isExpectedEq((*time.Time)(nil))}, }) } func TestTimestampCodecWithScanLocationUTC(t *testing.T) { skipCockroachDB(t, "Server does not support infinite timestamps (see https://github.com/cockroachdb/cockroach/issues/41564)") connTestRunner := defaultConnTestRunner connTestRunner.AfterConnect = func(ctx context.Context, t testing.TB, conn *pgx.Conn) { conn.TypeMap().RegisterType(&pgtype.Type{ Name: "timestamp", OID: pgtype.TimestampOID, Codec: &pgtype.TimestampCodec{ScanLocation: time.UTC}, }) } pgxtest.RunValueRoundTripTests(context.Background(), t, connTestRunner, nil, "timestamp", []pgxtest.ValueRoundTripTest{ // Have to use pgtype.Timestamp instead of time.Time as source because otherwise the simple and exec query exec // modes will encode the time for timestamptz. That is, they will convert it from local time zone. {pgtype.Timestamp{Time: time.Date(2000, 1, 1, 0, 0, 0, 0, time.Local), Valid: true}, new(time.Time), isExpectedEq(time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC))}, }) } func TestTimestampCodecWithScanLocationLocal(t *testing.T) { skipCockroachDB(t, "Server does not support infinite timestamps (see https://github.com/cockroachdb/cockroach/issues/41564)") connTestRunner := defaultConnTestRunner connTestRunner.AfterConnect = func(ctx context.Context, t testing.TB, conn *pgx.Conn) { conn.TypeMap().RegisterType(&pgtype.Type{ Name: "timestamp", OID: pgtype.TimestampOID, Codec: &pgtype.TimestampCodec{ScanLocation: time.Local}, }) } pgxtest.RunValueRoundTripTests(context.Background(), t, connTestRunner, nil, "timestamp", []pgxtest.ValueRoundTripTest{ {time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEq(time.Date(2000, 1, 1, 0, 0, 0, 0, time.Local))}, }) } // https://github.com/jackc/pgx/v4/pgtype/pull/128 func TestTimestampTranscodeBigTimeBinary(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { in := &pgtype.Timestamp{Time: time.Date(294276, 12, 31, 23, 59, 59, 999999000, time.UTC), Valid: true} var out pgtype.Timestamp err := conn.QueryRow(ctx, "select $1::timestamp", in).Scan(&out) if err != nil { t.Fatal(err) } require.Equal(t, in.Valid, out.Valid) require.Truef(t, in.Time.Equal(out.Time), "expected %v got %v", in.Time, out.Time) }) } // https://github.com/jackc/pgtype/issues/74 func TestTimestampCodecDecodeTextInvalid(t *testing.T) { c := &pgtype.TimestampCodec{} var ts pgtype.Timestamp plan := c.PlanScan(nil, pgtype.TimestampOID, pgtype.TextFormatCode, &ts) err := plan.Scan([]byte(`eeeee`), &ts) require.Error(t, err) } func TestTimestampMarshalJSON(t *testing.T) { tsStruct := struct { TS pgtype.Timestamp `json:"ts"` }{} tm := time.Date(2012, 3, 29, 10, 5, 45, 0, time.UTC) tsString := "\"" + tm.Format("2006-01-02T15:04:05") + "\"" // `"2012-03-29T10:05:45"` var pgt pgtype.Timestamp _ = pgt.Scan(tm) successfulTests := []struct { source pgtype.Timestamp result string }{ {source: pgtype.Timestamp{}, result: "null"}, {source: pgtype.Timestamp{Time: tm, Valid: true}, result: tsString}, {source: pgt, result: tsString}, {source: pgtype.Timestamp{Time: tm.Add(time.Second * 555 / 1000), Valid: true}, result: `"2012-03-29T10:05:45.555"`}, {source: pgtype.Timestamp{InfinityModifier: pgtype.Infinity, Valid: true}, result: "\"infinity\""}, {source: pgtype.Timestamp{InfinityModifier: pgtype.NegativeInfinity, Valid: true}, result: "\"-infinity\""}, } for i, tt := range successfulTests { r, err := tt.source.MarshalJSON() if err != nil { t.Errorf("%d: %v", i, err) } if !assert.Equal(t, tt.result, string(r)) { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, string(r)) } tsStruct.TS = tt.source b, err := json.Marshal(tsStruct) assert.NoErrorf(t, err, "failed to marshal %v %s", tt.source, err) t2 := tsStruct t2.TS = pgtype.Timestamp{} // Clear out the value so that we can compare after unmarshalling err = json.Unmarshal(b, &t2) assert.NoErrorf(t, err, "failed to unmarshal %v with %s", tt.source, err) assert.True(t, tsStruct.TS.Time.Unix() == t2.TS.Time.Unix()) } } func TestTimestampUnmarshalJSONErrors(t *testing.T) { tsStruct := struct { TS pgtype.Timestamp `json:"ts"` }{} goodJson1 := []byte(`{"ts":"2012-03-29T10:05:45"}`) assert.NoError(t, json.Unmarshal(goodJson1, &tsStruct)) goodJson2 := []byte(`{"ts":"2012-03-29T10:05:45Z"}`) assert.NoError(t, json.Unmarshal(goodJson2, &tsStruct)) badJson := []byte(`{"ts":"2012-03-29"}`) assert.Error(t, json.Unmarshal(badJson, &tsStruct)) } func TestTimestampUnmarshalJSON(t *testing.T) { successfulTests := []struct { source string result pgtype.Timestamp }{ {source: "null", result: pgtype.Timestamp{}}, {source: "\"2012-03-29T10:05:45\"", result: pgtype.Timestamp{Time: time.Date(2012, 3, 29, 10, 5, 45, 0, time.UTC), Valid: true}}, {source: "\"2012-03-29T10:05:45.555\"", result: pgtype.Timestamp{Time: time.Date(2012, 3, 29, 10, 5, 45, 555*1000*1000, time.UTC), Valid: true}}, {source: "\"infinity\"", result: pgtype.Timestamp{InfinityModifier: pgtype.Infinity, Valid: true}}, {source: "\"-infinity\"", result: pgtype.Timestamp{InfinityModifier: pgtype.NegativeInfinity, Valid: true}}, } for i, tt := range successfulTests { var r pgtype.Timestamp err := r.UnmarshalJSON([]byte(tt.source)) if err != nil { t.Errorf("%d: %v", i, err) } if !r.Time.Equal(tt.result.Time) || r.Valid != tt.result.Valid || r.InfinityModifier != tt.result.InfinityModifier { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, r) } } } pgx-5.8.0/pgtype/timestamptz.go000066400000000000000000000210551512357711200165510ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "encoding/json" "fmt" "strings" "time" "github.com/jackc/pgx/v5/internal/pgio" ) const ( pgTimestamptzHourFormat = "2006-01-02 15:04:05.999999999Z07" pgTimestamptzMinuteFormat = "2006-01-02 15:04:05.999999999Z07:00" pgTimestamptzSecondFormat = "2006-01-02 15:04:05.999999999Z07:00:00" microsecFromUnixEpochToY2K = 946_684_800 * 1_000_000 ) const ( negativeInfinityMicrosecondOffset = -9223372036854775808 infinityMicrosecondOffset = 9223372036854775807 ) type TimestamptzScanner interface { ScanTimestamptz(v Timestamptz) error } type TimestamptzValuer interface { TimestamptzValue() (Timestamptz, error) } // Timestamptz represents the PostgreSQL timestamptz type. type Timestamptz struct { Time time.Time InfinityModifier InfinityModifier Valid bool } // ScanTimestamptz implements the [TimestamptzScanner] interface. func (tstz *Timestamptz) ScanTimestamptz(v Timestamptz) error { *tstz = v return nil } // TimestamptzValue implements the [TimestamptzValuer] interface. func (tstz Timestamptz) TimestamptzValue() (Timestamptz, error) { return tstz, nil } // Scan implements the [database/sql.Scanner] interface. func (tstz *Timestamptz) Scan(src any) error { if src == nil { *tstz = Timestamptz{} return nil } switch src := src.(type) { case string: return (&scanPlanTextTimestamptzToTimestamptzScanner{}).Scan([]byte(src), tstz) case time.Time: *tstz = Timestamptz{Time: src, Valid: true} return nil } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (tstz Timestamptz) Value() (driver.Value, error) { if !tstz.Valid { return nil, nil } if tstz.InfinityModifier != Finite { return tstz.InfinityModifier.String(), nil } return tstz.Time, nil } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (tstz Timestamptz) MarshalJSON() ([]byte, error) { if !tstz.Valid { return []byte("null"), nil } var s string switch tstz.InfinityModifier { case Finite: s = tstz.Time.Format(time.RFC3339Nano) case Infinity: s = "infinity" case NegativeInfinity: s = "-infinity" } return json.Marshal(s) } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (tstz *Timestamptz) UnmarshalJSON(b []byte) error { var s *string err := json.Unmarshal(b, &s) if err != nil { return err } if s == nil { *tstz = Timestamptz{} return nil } switch *s { case "infinity": *tstz = Timestamptz{Valid: true, InfinityModifier: Infinity} case "-infinity": *tstz = Timestamptz{Valid: true, InfinityModifier: -Infinity} default: // PostgreSQL uses ISO 8601 for to_json function and casting from a string to timestamptz tim, err := time.Parse(time.RFC3339Nano, *s) if err != nil { return err } *tstz = Timestamptz{Time: tim, Valid: true} } return nil } type TimestamptzCodec struct { // ScanLocation is the location to return scanned timestamptz values in. This does not change the instant in time that // the timestamptz represents. ScanLocation *time.Location } func (*TimestamptzCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (*TimestamptzCodec) PreferredFormat() int16 { return BinaryFormatCode } func (*TimestamptzCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(TimestamptzValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanTimestamptzCodecBinary{} case TextFormatCode: return encodePlanTimestamptzCodecText{} } return nil } type encodePlanTimestamptzCodecBinary struct{} func (encodePlanTimestamptzCodecBinary) Encode(value any, buf []byte) (newBuf []byte, err error) { ts, err := value.(TimestamptzValuer).TimestamptzValue() if err != nil { return nil, err } if !ts.Valid { return nil, nil } var microsecSinceY2K int64 switch ts.InfinityModifier { case Finite: microsecSinceUnixEpoch := ts.Time.Unix()*1000000 + int64(ts.Time.Nanosecond())/1000 microsecSinceY2K = microsecSinceUnixEpoch - microsecFromUnixEpochToY2K case Infinity: microsecSinceY2K = infinityMicrosecondOffset case NegativeInfinity: microsecSinceY2K = negativeInfinityMicrosecondOffset } buf = pgio.AppendInt64(buf, microsecSinceY2K) return buf, nil } type encodePlanTimestamptzCodecText struct{} func (encodePlanTimestamptzCodecText) Encode(value any, buf []byte) (newBuf []byte, err error) { ts, err := value.(TimestamptzValuer).TimestamptzValue() if err != nil { return nil, err } if !ts.Valid { return nil, nil } var s string switch ts.InfinityModifier { case Finite: t := ts.Time.UTC().Truncate(time.Microsecond) // Year 0000 is 1 BC bc := false if year := t.Year(); year <= 0 { year = -year + 1 t = time.Date(year, t.Month(), t.Day(), t.Hour(), t.Minute(), t.Second(), t.Nanosecond(), time.UTC) bc = true } s = t.Format(pgTimestamptzSecondFormat) if bc { s = s + " BC" } case Infinity: s = "infinity" case NegativeInfinity: s = "-infinity" } buf = append(buf, s...) return buf, nil } func (c *TimestamptzCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case TimestamptzScanner: return &scanPlanBinaryTimestamptzToTimestamptzScanner{location: c.ScanLocation} } case TextFormatCode: switch target.(type) { case TimestamptzScanner: return &scanPlanTextTimestamptzToTimestamptzScanner{location: c.ScanLocation} } } return nil } type scanPlanBinaryTimestamptzToTimestamptzScanner struct{ location *time.Location } func (plan *scanPlanBinaryTimestamptzToTimestamptzScanner) Scan(src []byte, dst any) error { scanner := (dst).(TimestamptzScanner) if src == nil { return scanner.ScanTimestamptz(Timestamptz{}) } if len(src) != 8 { return fmt.Errorf("invalid length for timestamptz: %v", len(src)) } var tstz Timestamptz microsecSinceY2K := int64(binary.BigEndian.Uint64(src)) switch microsecSinceY2K { case infinityMicrosecondOffset: tstz = Timestamptz{Valid: true, InfinityModifier: Infinity} case negativeInfinityMicrosecondOffset: tstz = Timestamptz{Valid: true, InfinityModifier: -Infinity} default: tim := time.Unix( microsecFromUnixEpochToY2K/1_000_000+microsecSinceY2K/1_000_000, (microsecFromUnixEpochToY2K%1_000_000*1_000)+(microsecSinceY2K%1_000_000*1_000), ) if plan.location != nil { tim = tim.In(plan.location) } tstz = Timestamptz{Time: tim, Valid: true} } return scanner.ScanTimestamptz(tstz) } type scanPlanTextTimestamptzToTimestamptzScanner struct{ location *time.Location } func (plan *scanPlanTextTimestamptzToTimestamptzScanner) Scan(src []byte, dst any) error { scanner := (dst).(TimestamptzScanner) if src == nil { return scanner.ScanTimestamptz(Timestamptz{}) } var tstz Timestamptz sbuf := string(src) switch sbuf { case "infinity": tstz = Timestamptz{Valid: true, InfinityModifier: Infinity} case "-infinity": tstz = Timestamptz{Valid: true, InfinityModifier: -Infinity} default: bc := false if strings.HasSuffix(sbuf, " BC") { sbuf = sbuf[:len(sbuf)-3] bc = true } var format string if len(sbuf) >= 9 && (sbuf[len(sbuf)-9] == '-' || sbuf[len(sbuf)-9] == '+') { format = pgTimestamptzSecondFormat } else if len(sbuf) >= 6 && (sbuf[len(sbuf)-6] == '-' || sbuf[len(sbuf)-6] == '+') { format = pgTimestamptzMinuteFormat } else { format = pgTimestamptzHourFormat } tim, err := time.Parse(format, sbuf) if err != nil { return err } if bc { year := -tim.Year() + 1 tim = time.Date(year, tim.Month(), tim.Day(), tim.Hour(), tim.Minute(), tim.Second(), tim.Nanosecond(), tim.Location()) } if plan.location != nil { tim = tim.In(plan.location) } tstz = Timestamptz{Time: tim, Valid: true} } return scanner.ScanTimestamptz(tstz) } func (c *TimestamptzCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } var tstz Timestamptz err := codecScan(c, m, oid, format, src, &tstz) if err != nil { return nil, err } if tstz.InfinityModifier != Finite { return tstz.InfinityModifier.String(), nil } return tstz.Time, nil } func (c *TimestamptzCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var tstz Timestamptz err := codecScan(c, m, oid, format, src, &tstz) if err != nil { return nil, err } if tstz.InfinityModifier != Finite { return tstz.InfinityModifier, nil } return tstz.Time, nil } pgx-5.8.0/pgtype/timestamptz_test.go000066400000000000000000000160071512357711200176110ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "time" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/require" ) func TestTimestamptzCodec(t *testing.T) { skipCockroachDB(t, "Server does not support infinite timestamps (see https://github.com/cockroachdb/cockroach/issues/41564)") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "timestamptz", []pgxtest.ValueRoundTripTest{ {time.Date(-100, 1, 1, 0, 0, 0, 0, time.Local), new(time.Time), isExpectedEqTime(time.Date(-100, 1, 1, 0, 0, 0, 0, time.Local))}, {time.Date(-1, 1, 1, 0, 0, 0, 0, time.Local), new(time.Time), isExpectedEqTime(time.Date(-1, 1, 1, 0, 0, 0, 0, time.Local))}, {time.Date(0, 1, 1, 0, 0, 0, 0, time.Local), new(time.Time), isExpectedEqTime(time.Date(0, 1, 1, 0, 0, 0, 0, time.Local))}, {time.Date(1, 1, 1, 0, 0, 0, 0, time.Local), new(time.Time), isExpectedEqTime(time.Date(1, 1, 1, 0, 0, 0, 0, time.Local))}, {time.Date(1900, 1, 1, 0, 0, 0, 0, time.Local), new(time.Time), isExpectedEqTime(time.Date(1900, 1, 1, 0, 0, 0, 0, time.Local))}, {time.Date(1970, 1, 1, 0, 0, 0, 0, time.Local), new(time.Time), isExpectedEqTime(time.Date(1970, 1, 1, 0, 0, 0, 0, time.Local))}, {time.Date(1999, 12, 31, 0, 0, 0, 0, time.Local), new(time.Time), isExpectedEqTime(time.Date(1999, 12, 31, 0, 0, 0, 0, time.Local))}, {time.Date(2000, 1, 1, 0, 0, 0, 0, time.Local), new(time.Time), isExpectedEqTime(time.Date(2000, 1, 1, 0, 0, 0, 0, time.Local))}, {time.Date(2000, 1, 2, 0, 0, 0, 0, time.Local), new(time.Time), isExpectedEqTime(time.Date(2000, 1, 2, 0, 0, 0, 0, time.Local))}, {time.Date(2200, 1, 1, 0, 0, 0, 0, time.Local), new(time.Time), isExpectedEqTime(time.Date(2200, 1, 1, 0, 0, 0, 0, time.Local))}, // Nanosecond truncation {time.Date(2020, 1, 1, 0, 0, 0, 999999999, time.Local), new(time.Time), isExpectedEqTime(time.Date(2020, 1, 1, 0, 0, 0, 999999000, time.Local))}, {time.Date(2020, 1, 1, 0, 0, 0, 999999001, time.Local), new(time.Time), isExpectedEqTime(time.Date(2020, 1, 1, 0, 0, 0, 999999000, time.Local))}, {pgtype.Timestamptz{InfinityModifier: pgtype.Infinity, Valid: true}, new(pgtype.Timestamptz), isExpectedEq(pgtype.Timestamptz{InfinityModifier: pgtype.Infinity, Valid: true})}, {pgtype.Timestamptz{InfinityModifier: pgtype.NegativeInfinity, Valid: true}, new(pgtype.Timestamptz), isExpectedEq(pgtype.Timestamptz{InfinityModifier: pgtype.NegativeInfinity, Valid: true})}, {pgtype.Timestamptz{}, new(pgtype.Timestamptz), isExpectedEq(pgtype.Timestamptz{})}, {nil, new(*time.Time), isExpectedEq((*time.Time)(nil))}, }) } func TestTimestamptzCodecWithLocationUTC(t *testing.T) { skipCockroachDB(t, "Server does not support infinite timestamps (see https://github.com/cockroachdb/cockroach/issues/41564)") connTestRunner := defaultConnTestRunner connTestRunner.AfterConnect = func(ctx context.Context, t testing.TB, conn *pgx.Conn) { conn.TypeMap().RegisterType(&pgtype.Type{ Name: "timestamptz", OID: pgtype.TimestamptzOID, Codec: &pgtype.TimestamptzCodec{ScanLocation: time.UTC}, }) } pgxtest.RunValueRoundTripTests(context.Background(), t, connTestRunner, nil, "timestamptz", []pgxtest.ValueRoundTripTest{ {time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC), new(time.Time), isExpectedEq(time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC))}, }) } func TestTimestamptzCodecWithLocationLocal(t *testing.T) { skipCockroachDB(t, "Server does not support infinite timestamps (see https://github.com/cockroachdb/cockroach/issues/41564)") connTestRunner := defaultConnTestRunner connTestRunner.AfterConnect = func(ctx context.Context, t testing.TB, conn *pgx.Conn) { conn.TypeMap().RegisterType(&pgtype.Type{ Name: "timestamptz", OID: pgtype.TimestamptzOID, Codec: &pgtype.TimestamptzCodec{ScanLocation: time.Local}, }) } pgxtest.RunValueRoundTripTests(context.Background(), t, connTestRunner, nil, "timestamptz", []pgxtest.ValueRoundTripTest{ {time.Date(2000, 1, 1, 0, 0, 0, 0, time.Local), new(time.Time), isExpectedEq(time.Date(2000, 1, 1, 0, 0, 0, 0, time.Local))}, }) } // https://github.com/jackc/pgx/v4/pgtype/pull/128 func TestTimestamptzTranscodeBigTimeBinary(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { in := &pgtype.Timestamptz{Time: time.Date(294276, 12, 31, 23, 59, 59, 999999000, time.UTC), Valid: true} var out pgtype.Timestamptz err := conn.QueryRow(ctx, "select $1::timestamptz", in).Scan(&out) if err != nil { t.Fatal(err) } require.Equal(t, in.Valid, out.Valid) require.Truef(t, in.Time.Equal(out.Time), "expected %v got %v", in.Time, out.Time) }) } // https://github.com/jackc/pgtype/issues/74 func TestTimestamptzDecodeTextInvalid(t *testing.T) { c := &pgtype.TimestamptzCodec{} var tstz pgtype.Timestamptz plan := c.PlanScan(nil, pgtype.TimestamptzOID, pgtype.TextFormatCode, &tstz) err := plan.Scan([]byte(`eeeee`), &tstz) require.Error(t, err) } func TestTimestamptzMarshalJSON(t *testing.T) { successfulTests := []struct { source pgtype.Timestamptz result string }{ {source: pgtype.Timestamptz{}, result: "null"}, {source: pgtype.Timestamptz{Time: time.Date(2012, 3, 29, 10, 5, 45, 0, time.FixedZone("", -6*60*60)), Valid: true}, result: "\"2012-03-29T10:05:45-06:00\""}, {source: pgtype.Timestamptz{Time: time.Date(2012, 3, 29, 10, 5, 45, 555*1000*1000, time.FixedZone("", -6*60*60)), Valid: true}, result: "\"2012-03-29T10:05:45.555-06:00\""}, {source: pgtype.Timestamptz{InfinityModifier: pgtype.Infinity, Valid: true}, result: "\"infinity\""}, {source: pgtype.Timestamptz{InfinityModifier: pgtype.NegativeInfinity, Valid: true}, result: "\"-infinity\""}, } for i, tt := range successfulTests { r, err := tt.source.MarshalJSON() if err != nil { t.Errorf("%d: %v", i, err) } if string(r) != tt.result { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, string(r)) } } } func TestTimestamptzUnmarshalJSON(t *testing.T) { successfulTests := []struct { source string result pgtype.Timestamptz }{ {source: "null", result: pgtype.Timestamptz{}}, {source: "\"2012-03-29T10:05:45-06:00\"", result: pgtype.Timestamptz{Time: time.Date(2012, 3, 29, 10, 5, 45, 0, time.FixedZone("", -6*60*60)), Valid: true}}, {source: "\"2012-03-29T10:05:45.555-06:00\"", result: pgtype.Timestamptz{Time: time.Date(2012, 3, 29, 10, 5, 45, 555*1000*1000, time.FixedZone("", -6*60*60)), Valid: true}}, {source: "\"infinity\"", result: pgtype.Timestamptz{InfinityModifier: pgtype.Infinity, Valid: true}}, {source: "\"-infinity\"", result: pgtype.Timestamptz{InfinityModifier: pgtype.NegativeInfinity, Valid: true}}, } for i, tt := range successfulTests { var r pgtype.Timestamptz err := r.UnmarshalJSON([]byte(tt.source)) if err != nil { t.Errorf("%d: %v", i, err) } if !r.Time.Equal(tt.result.Time) || r.Valid != tt.result.Valid || r.InfinityModifier != tt.result.InfinityModifier { t.Errorf("%d: expected %v to convert to %v, but it was %v", i, tt.source, tt.result, r) } } } pgx-5.8.0/pgtype/uint32.go000066400000000000000000000170421512357711200153150ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "encoding/json" "fmt" "math" "strconv" "github.com/jackc/pgx/v5/internal/pgio" ) type Uint32Scanner interface { ScanUint32(v Uint32) error } type Uint32Valuer interface { Uint32Value() (Uint32, error) } // Uint32 is the core type that is used to represent PostgreSQL types such as OID, CID, and XID. type Uint32 struct { Uint32 uint32 Valid bool } // ScanUint32 implements the [Uint32Scanner] interface. func (n *Uint32) ScanUint32(v Uint32) error { *n = v return nil } // Uint32Value implements the [Uint32Valuer] interface. func (n Uint32) Uint32Value() (Uint32, error) { return n, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Uint32) Scan(src any) error { if src == nil { *dst = Uint32{} return nil } var n int64 switch src := src.(type) { case int64: n = src case string: un, err := strconv.ParseUint(src, 10, 32) if err != nil { return err } n = int64(un) default: return fmt.Errorf("cannot scan %T", src) } if n < 0 { return fmt.Errorf("%d is less than the minimum value for Uint32", n) } if n > math.MaxUint32 { return fmt.Errorf("%d is greater than maximum value for Uint32", n) } *dst = Uint32{Uint32: uint32(n), Valid: true} return nil } // Value implements the [database/sql/driver.Valuer] interface. func (src Uint32) Value() (driver.Value, error) { if !src.Valid { return nil, nil } return int64(src.Uint32), nil } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (src Uint32) MarshalJSON() ([]byte, error) { if !src.Valid { return []byte("null"), nil } return json.Marshal(src.Uint32) } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (dst *Uint32) UnmarshalJSON(b []byte) error { var n *uint32 err := json.Unmarshal(b, &n) if err != nil { return err } if n == nil { *dst = Uint32{} } else { *dst = Uint32{Uint32: *n, Valid: true} } return nil } type Uint32Codec struct{} func (Uint32Codec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (Uint32Codec) PreferredFormat() int16 { return BinaryFormatCode } func (Uint32Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case BinaryFormatCode: switch value.(type) { case uint32: return encodePlanUint32CodecBinaryUint32{} case Uint32Valuer: return encodePlanUint32CodecBinaryUint32Valuer{} case Int64Valuer: return encodePlanUint32CodecBinaryInt64Valuer{} } case TextFormatCode: switch value.(type) { case uint32: return encodePlanUint32CodecTextUint32{} case Int64Valuer: return encodePlanUint32CodecTextInt64Valuer{} } } return nil } type encodePlanUint32CodecBinaryUint32 struct{} func (encodePlanUint32CodecBinaryUint32) Encode(value any, buf []byte) (newBuf []byte, err error) { v := value.(uint32) return pgio.AppendUint32(buf, v), nil } type encodePlanUint32CodecBinaryUint32Valuer struct{} func (encodePlanUint32CodecBinaryUint32Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { v, err := value.(Uint32Valuer).Uint32Value() if err != nil { return nil, err } if !v.Valid { return nil, nil } return pgio.AppendUint32(buf, v.Uint32), nil } type encodePlanUint32CodecBinaryInt64Valuer struct{} func (encodePlanUint32CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { v, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !v.Valid { return nil, nil } if v.Int64 < 0 { return nil, fmt.Errorf("%d is less than minimum value for uint32", v.Int64) } if v.Int64 > math.MaxUint32 { return nil, fmt.Errorf("%d is greater than maximum value for uint32", v.Int64) } return pgio.AppendUint32(buf, uint32(v.Int64)), nil } type encodePlanUint32CodecTextUint32 struct{} func (encodePlanUint32CodecTextUint32) Encode(value any, buf []byte) (newBuf []byte, err error) { v := value.(uint32) return append(buf, strconv.FormatUint(uint64(v), 10)...), nil } type encodePlanUint32CodecTextUint32Valuer struct{} func (encodePlanUint32CodecTextUint32Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { v, err := value.(Uint32Valuer).Uint32Value() if err != nil { return nil, err } if !v.Valid { return nil, nil } return append(buf, strconv.FormatUint(uint64(v.Uint32), 10)...), nil } type encodePlanUint32CodecTextInt64Valuer struct{} func (encodePlanUint32CodecTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { v, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !v.Valid { return nil, nil } if v.Int64 < 0 { return nil, fmt.Errorf("%d is less than minimum value for uint32", v.Int64) } if v.Int64 > math.MaxUint32 { return nil, fmt.Errorf("%d is greater than maximum value for uint32", v.Int64) } return append(buf, strconv.FormatInt(v.Int64, 10)...), nil } func (Uint32Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case *uint32: return scanPlanBinaryUint32ToUint32{} case Uint32Scanner: return scanPlanBinaryUint32ToUint32Scanner{} case TextScanner: return scanPlanBinaryUint32ToTextScanner{} } case TextFormatCode: switch target.(type) { case *uint32: return scanPlanTextAnyToUint32{} case Uint32Scanner: return scanPlanTextAnyToUint32Scanner{} } } return nil } func (c Uint32Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } var n uint32 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return int64(n), nil } func (c Uint32Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var n uint32 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return n, nil } type scanPlanBinaryUint32ToUint32 struct{} func (scanPlanBinaryUint32ToUint32) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 4 { return fmt.Errorf("invalid length for uint32: %v", len(src)) } p := (dst).(*uint32) *p = binary.BigEndian.Uint32(src) return nil } type scanPlanBinaryUint32ToUint32Scanner struct{} func (scanPlanBinaryUint32ToUint32Scanner) Scan(src []byte, dst any) error { s, ok := (dst).(Uint32Scanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanUint32(Uint32{}) } if len(src) != 4 { return fmt.Errorf("invalid length for uint32: %v", len(src)) } n := binary.BigEndian.Uint32(src) return s.ScanUint32(Uint32{Uint32: n, Valid: true}) } type scanPlanBinaryUint32ToTextScanner struct{} func (scanPlanBinaryUint32ToTextScanner) Scan(src []byte, dst any) error { s, ok := (dst).(TextScanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanText(Text{}) } if len(src) != 4 { return fmt.Errorf("invalid length for uint32: %v", len(src)) } n := uint64(binary.BigEndian.Uint32(src)) return s.ScanText(Text{String: strconv.FormatUint(n, 10), Valid: true}) } type scanPlanTextAnyToUint32Scanner struct{} func (scanPlanTextAnyToUint32Scanner) Scan(src []byte, dst any) error { s, ok := (dst).(Uint32Scanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanUint32(Uint32{}) } n, err := strconv.ParseUint(string(src), 10, 32) if err != nil { return err } return s.ScanUint32(Uint32{Uint32: uint32(n), Valid: true}) } pgx-5.8.0/pgtype/uint32_test.go000066400000000000000000000012141512357711200163460ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func TestUint32Codec(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, pgxtest.KnownOIDQueryExecModes, "oid", []pgxtest.ValueRoundTripTest{ { pgtype.Uint32{Uint32: pgtype.TextOID, Valid: true}, new(pgtype.Uint32), isExpectedEq(pgtype.Uint32{Uint32: pgtype.TextOID, Valid: true}), }, {pgtype.Uint32{}, new(pgtype.Uint32), isExpectedEq(pgtype.Uint32{})}, {nil, new(pgtype.Uint32), isExpectedEq(pgtype.Uint32{})}, {"1147", new(string), isExpectedEq("1147")}, }) } pgx-5.8.0/pgtype/uint64.go000066400000000000000000000156171512357711200153300ustar00rootroot00000000000000package pgtype import ( "database/sql/driver" "encoding/binary" "fmt" "math" "strconv" "github.com/jackc/pgx/v5/internal/pgio" ) type Uint64Scanner interface { ScanUint64(v Uint64) error } type Uint64Valuer interface { Uint64Value() (Uint64, error) } // Uint64 is the core type that is used to represent PostgreSQL types such as XID8. type Uint64 struct { Uint64 uint64 Valid bool } // ScanUint64 implements the [Uint64Scanner] interface. func (n *Uint64) ScanUint64(v Uint64) error { *n = v return nil } // Uint64Value implements the [Uint64Valuer] interface. func (n Uint64) Uint64Value() (Uint64, error) { return n, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Uint64) Scan(src any) error { if src == nil { *dst = Uint64{} return nil } var n uint64 switch src := src.(type) { case int64: if src < 0 { return fmt.Errorf("%d is less than the minimum value for Uint64", src) } n = uint64(src) case string: un, err := strconv.ParseUint(src, 10, 64) if err != nil { return err } n = un default: return fmt.Errorf("cannot scan %T", src) } *dst = Uint64{Uint64: n, Valid: true} return nil } // Value implements the [database/sql/driver.Valuer] interface. func (src Uint64) Value() (driver.Value, error) { if !src.Valid { return nil, nil } // If the value is greater than the maximum value for int64, return it as a string instead of losing data or returning // an error. if src.Uint64 > math.MaxInt64 { return strconv.FormatUint(src.Uint64, 10), nil } return int64(src.Uint64), nil } type Uint64Codec struct{} func (Uint64Codec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (Uint64Codec) PreferredFormat() int16 { return BinaryFormatCode } func (Uint64Codec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch format { case BinaryFormatCode: switch value.(type) { case uint64: return encodePlanUint64CodecBinaryUint64{} case Uint64Valuer: return encodePlanUint64CodecBinaryUint64Valuer{} case Int64Valuer: return encodePlanUint64CodecBinaryInt64Valuer{} } case TextFormatCode: switch value.(type) { case uint64: return encodePlanUint64CodecTextUint64{} case Int64Valuer: return encodePlanUint64CodecTextInt64Valuer{} } } return nil } type encodePlanUint64CodecBinaryUint64 struct{} func (encodePlanUint64CodecBinaryUint64) Encode(value any, buf []byte) (newBuf []byte, err error) { v := value.(uint64) return pgio.AppendUint64(buf, v), nil } type encodePlanUint64CodecBinaryUint64Valuer struct{} func (encodePlanUint64CodecBinaryUint64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { v, err := value.(Uint64Valuer).Uint64Value() if err != nil { return nil, err } if !v.Valid { return nil, nil } return pgio.AppendUint64(buf, v.Uint64), nil } type encodePlanUint64CodecBinaryInt64Valuer struct{} func (encodePlanUint64CodecBinaryInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { v, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !v.Valid { return nil, nil } if v.Int64 < 0 { return nil, fmt.Errorf("%d is less than minimum value for uint64", v.Int64) } return pgio.AppendUint64(buf, uint64(v.Int64)), nil } type encodePlanUint64CodecTextUint64 struct{} func (encodePlanUint64CodecTextUint64) Encode(value any, buf []byte) (newBuf []byte, err error) { v := value.(uint64) return append(buf, strconv.FormatUint(uint64(v), 10)...), nil } type encodePlanUint64CodecTextUint64Valuer struct{} func (encodePlanUint64CodecTextUint64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { v, err := value.(Uint64Valuer).Uint64Value() if err != nil { return nil, err } if !v.Valid { return nil, nil } return append(buf, strconv.FormatUint(v.Uint64, 10)...), nil } type encodePlanUint64CodecTextInt64Valuer struct{} func (encodePlanUint64CodecTextInt64Valuer) Encode(value any, buf []byte) (newBuf []byte, err error) { v, err := value.(Int64Valuer).Int64Value() if err != nil { return nil, err } if !v.Valid { return nil, nil } if v.Int64 < 0 { return nil, fmt.Errorf("%d is less than minimum value for uint64", v.Int64) } return append(buf, strconv.FormatInt(v.Int64, 10)...), nil } func (Uint64Codec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case *uint64: return scanPlanBinaryUint64ToUint64{} case Uint64Scanner: return scanPlanBinaryUint64ToUint64Scanner{} case TextScanner: return scanPlanBinaryUint64ToTextScanner{} } case TextFormatCode: switch target.(type) { case *uint64: return scanPlanTextAnyToUint64{} case Uint64Scanner: return scanPlanTextAnyToUint64Scanner{} } } return nil } func (c Uint64Codec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } var n uint64 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return int64(n), nil } func (c Uint64Codec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var n uint64 err := codecScan(c, m, oid, format, src, &n) if err != nil { return nil, err } return n, nil } type scanPlanBinaryUint64ToUint64 struct{} func (scanPlanBinaryUint64ToUint64) Scan(src []byte, dst any) error { if src == nil { return fmt.Errorf("cannot scan NULL into %T", dst) } if len(src) != 8 { return fmt.Errorf("invalid length for uint64: %v", len(src)) } p := (dst).(*uint64) *p = binary.BigEndian.Uint64(src) return nil } type scanPlanBinaryUint64ToUint64Scanner struct{} func (scanPlanBinaryUint64ToUint64Scanner) Scan(src []byte, dst any) error { s, ok := (dst).(Uint64Scanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanUint64(Uint64{}) } if len(src) != 8 { return fmt.Errorf("invalid length for uint64: %v", len(src)) } n := binary.BigEndian.Uint64(src) return s.ScanUint64(Uint64{Uint64: n, Valid: true}) } type scanPlanBinaryUint64ToTextScanner struct{} func (scanPlanBinaryUint64ToTextScanner) Scan(src []byte, dst any) error { s, ok := (dst).(TextScanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanText(Text{}) } if len(src) != 8 { return fmt.Errorf("invalid length for uint64: %v", len(src)) } n := uint64(binary.BigEndian.Uint64(src)) return s.ScanText(Text{String: strconv.FormatUint(n, 10), Valid: true}) } type scanPlanTextAnyToUint64Scanner struct{} func (scanPlanTextAnyToUint64Scanner) Scan(src []byte, dst any) error { s, ok := (dst).(Uint64Scanner) if !ok { return ErrScanTargetTypeChanged } if src == nil { return s.ScanUint64(Uint64{}) } n, err := strconv.ParseUint(string(src), 10, 64) if err != nil { return err } return s.ScanUint64(Uint64{Uint64: n, Valid: true}) } pgx-5.8.0/pgtype/uint64_test.go000066400000000000000000000015411512357711200163560ustar00rootroot00000000000000package pgtype_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" ) func TestUint64Codec(t *testing.T) { skipCockroachDB(t, "Server does not support xid8 (https://github.com/cockroachdb/cockroach/issues/36815)") skipPostgreSQLVersionLessThan(t, 13) pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, pgxtest.KnownOIDQueryExecModes, "xid8", []pgxtest.ValueRoundTripTest{ { pgtype.Uint64{Uint64: 1 << 36, Valid: true}, new(pgtype.Uint64), isExpectedEq(pgtype.Uint64{Uint64: 1 << 36, Valid: true}), }, {pgtype.Uint64{}, new(pgtype.Uint64), isExpectedEq(pgtype.Uint64{})}, {nil, new(pgtype.Uint64), isExpectedEq(pgtype.Uint64{})}, { uint64(1 << 36), new(uint64), isExpectedEq(uint64(1 << 36)), }, {"1147", new(string), isExpectedEq("1147")}, }) } pgx-5.8.0/pgtype/uuid.go000066400000000000000000000135001512357711200151320ustar00rootroot00000000000000package pgtype import ( "bytes" "database/sql/driver" "encoding/hex" "fmt" ) type UUIDScanner interface { ScanUUID(v UUID) error } type UUIDValuer interface { UUIDValue() (UUID, error) } type UUID struct { Bytes [16]byte Valid bool } // ScanUUID implements the [UUIDScanner] interface. func (b *UUID) ScanUUID(v UUID) error { *b = v return nil } // UUIDValue implements the [UUIDValuer] interface. func (b UUID) UUIDValue() (UUID, error) { return b, nil } // parseUUID converts a string UUID in standard form to a byte array. func parseUUID(src string) (dst [16]byte, err error) { switch len(src) { case 36: src = src[0:8] + src[9:13] + src[14:18] + src[19:23] + src[24:] case 32: // dashes already stripped, assume valid default: // assume invalid. return dst, fmt.Errorf("cannot parse UUID %v", src) } buf, err := hex.DecodeString(src) if err != nil { return dst, err } copy(dst[:], buf) return dst, err } // encodeUUID converts a uuid byte array to UUID standard string form. func encodeUUID(src [16]byte) string { var buf [36]byte hex.Encode(buf[0:8], src[:4]) buf[8] = '-' hex.Encode(buf[9:13], src[4:6]) buf[13] = '-' hex.Encode(buf[14:18], src[6:8]) buf[18] = '-' hex.Encode(buf[19:23], src[8:10]) buf[23] = '-' hex.Encode(buf[24:], src[10:]) return string(buf[:]) } // Scan implements the [database/sql.Scanner] interface. func (dst *UUID) Scan(src any) error { if src == nil { *dst = UUID{} return nil } switch src := src.(type) { case string: buf, err := parseUUID(src) if err != nil { return err } *dst = UUID{Bytes: buf, Valid: true} return nil } return fmt.Errorf("cannot scan %T", src) } // Value implements the [database/sql/driver.Valuer] interface. func (src UUID) Value() (driver.Value, error) { if !src.Valid { return nil, nil } return encodeUUID(src.Bytes), nil } func (src UUID) String() string { if !src.Valid { return "" } return encodeUUID(src.Bytes) } // MarshalJSON implements the [encoding/json.Marshaler] interface. func (src UUID) MarshalJSON() ([]byte, error) { if !src.Valid { return []byte("null"), nil } var buff bytes.Buffer buff.WriteByte('"') buff.WriteString(encodeUUID(src.Bytes)) buff.WriteByte('"') return buff.Bytes(), nil } // UnmarshalJSON implements the [encoding/json.Unmarshaler] interface. func (dst *UUID) UnmarshalJSON(src []byte) error { if bytes.Equal(src, []byte("null")) { *dst = UUID{} return nil } if len(src) != 38 { return fmt.Errorf("invalid length for UUID: %v", len(src)) } buf, err := parseUUID(string(src[1 : len(src)-1])) if err != nil { return err } *dst = UUID{Bytes: buf, Valid: true} return nil } type UUIDCodec struct{} func (UUIDCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (UUIDCodec) PreferredFormat() int16 { return BinaryFormatCode } func (UUIDCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { if _, ok := value.(UUIDValuer); !ok { return nil } switch format { case BinaryFormatCode: return encodePlanUUIDCodecBinaryUUIDValuer{} case TextFormatCode: return encodePlanUUIDCodecTextUUIDValuer{} } return nil } type encodePlanUUIDCodecBinaryUUIDValuer struct{} func (encodePlanUUIDCodecBinaryUUIDValuer) Encode(value any, buf []byte) (newBuf []byte, err error) { uuid, err := value.(UUIDValuer).UUIDValue() if err != nil { return nil, err } if !uuid.Valid { return nil, nil } return append(buf, uuid.Bytes[:]...), nil } type encodePlanUUIDCodecTextUUIDValuer struct{} func (encodePlanUUIDCodecTextUUIDValuer) Encode(value any, buf []byte) (newBuf []byte, err error) { uuid, err := value.(UUIDValuer).UUIDValue() if err != nil { return nil, err } if !uuid.Valid { return nil, nil } return append(buf, encodeUUID(uuid.Bytes)...), nil } func (UUIDCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch format { case BinaryFormatCode: switch target.(type) { case UUIDScanner: return scanPlanBinaryUUIDToUUIDScanner{} case TextScanner: return scanPlanBinaryUUIDToTextScanner{} } case TextFormatCode: switch target.(type) { case UUIDScanner: return scanPlanTextAnyToUUIDScanner{} } } return nil } type scanPlanBinaryUUIDToUUIDScanner struct{} func (scanPlanBinaryUUIDToUUIDScanner) Scan(src []byte, dst any) error { scanner := (dst).(UUIDScanner) if src == nil { return scanner.ScanUUID(UUID{}) } if len(src) != 16 { return fmt.Errorf("invalid length for UUID: %v", len(src)) } uuid := UUID{Valid: true} copy(uuid.Bytes[:], src) return scanner.ScanUUID(uuid) } type scanPlanBinaryUUIDToTextScanner struct{} func (scanPlanBinaryUUIDToTextScanner) Scan(src []byte, dst any) error { scanner := (dst).(TextScanner) if src == nil { return scanner.ScanText(Text{}) } if len(src) != 16 { return fmt.Errorf("invalid length for UUID: %v", len(src)) } var buf [16]byte copy(buf[:], src) return scanner.ScanText(Text{String: encodeUUID(buf), Valid: true}) } type scanPlanTextAnyToUUIDScanner struct{} func (scanPlanTextAnyToUUIDScanner) Scan(src []byte, dst any) error { scanner := (dst).(UUIDScanner) if src == nil { return scanner.ScanUUID(UUID{}) } buf, err := parseUUID(string(src)) if err != nil { return err } return scanner.ScanUUID(UUID{Bytes: buf, Valid: true}) } func (c UUIDCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } var uuid UUID err := codecScan(c, m, oid, format, src, &uuid) if err != nil { return nil, err } return encodeUUID(uuid.Bytes), nil } func (c UUIDCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var uuid UUID err := codecScan(c, m, oid, format, src, &uuid) if err != nil { return nil, err } return uuid.Bytes, nil } pgx-5.8.0/pgtype/uuid_test.go000066400000000000000000000111541512357711200161740ustar00rootroot00000000000000package pgtype_test import ( "context" "reflect" "testing" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/require" ) type renamedUUIDByteArray [16]byte func TestUUIDCodec(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "uuid", []pgxtest.ValueRoundTripTest{ { pgtype.UUID{Bytes: [16]byte{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}, Valid: true}, new(pgtype.UUID), isExpectedEq(pgtype.UUID{Bytes: [16]byte{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}, Valid: true}), }, { "00010203-0405-0607-0809-0a0b0c0d0e0f", new(pgtype.UUID), isExpectedEq(pgtype.UUID{Bytes: [16]byte{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}, Valid: true}), }, { "000102030405060708090a0b0c0d0e0f", new(pgtype.UUID), isExpectedEq(pgtype.UUID{Bytes: [16]byte{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}, Valid: true}), }, { pgtype.UUID{Bytes: [16]byte{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}, Valid: true}, new(string), isExpectedEq("00010203-0405-0607-0809-0a0b0c0d0e0f"), }, {pgtype.UUID{}, new([]byte), isExpectedEqBytes([]byte(nil))}, {pgtype.UUID{}, new(pgtype.UUID), isExpectedEq(pgtype.UUID{})}, {nil, new(pgtype.UUID), isExpectedEq(pgtype.UUID{})}, }) pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, pgxtest.KnownOIDQueryExecModes, "uuid", []pgxtest.ValueRoundTripTest{ { [16]byte{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}, new(pgtype.UUID), isExpectedEq(pgtype.UUID{Bytes: [16]byte{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}, Valid: true}), }, { renamedUUIDByteArray{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}, new(pgtype.UUID), isExpectedEq(pgtype.UUID{Bytes: [16]byte{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}, Valid: true}), }, { []byte{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}, new(renamedUUIDByteArray), isExpectedEq(renamedUUIDByteArray{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}), }, { []byte{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}, new(pgtype.UUID), isExpectedEq(pgtype.UUID{Bytes: [16]byte{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}, Valid: true}), }, }) } func TestUUID_String(t *testing.T) { tests := []struct { name string src pgtype.UUID want string }{ { name: "first", src: pgtype.UUID{ Bytes: [16]byte{29, 72, 90, 122, 109, 24, 69, 153, 140, 108, 52, 66, 86, 22, 136, 122}, Valid: true, }, want: "1d485a7a-6d18-4599-8c6c-34425616887a", }, { name: "third", src: pgtype.UUID{ Bytes: [16]byte{}, }, want: "", }, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { got := tt.src.String() if !reflect.DeepEqual(got, tt.want) { t.Errorf("MarshalJSON() got = %v, want %v", got, tt.want) } }) } } func TestUUID_MarshalJSON(t *testing.T) { tests := []struct { name string src pgtype.UUID want []byte }{ { name: "first", src: pgtype.UUID{ Bytes: [16]byte{29, 72, 90, 122, 109, 24, 69, 153, 140, 108, 52, 66, 86, 22, 136, 122}, Valid: true, }, want: []byte(`"1d485a7a-6d18-4599-8c6c-34425616887a"`), }, { name: "third", src: pgtype.UUID{ Bytes: [16]byte{}, }, want: []byte("null"), }, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { got, err := tt.src.MarshalJSON() require.NoError(t, err) if !reflect.DeepEqual(got, tt.want) { t.Errorf("MarshalJSON() got = %v, want %v", got, tt.want) } }) } } func TestUUID_UnmarshalJSON(t *testing.T) { tests := []struct { name string want *pgtype.UUID src []byte wantErr bool }{ { name: "first", want: &pgtype.UUID{ Bytes: [16]byte{29, 72, 90, 122, 109, 24, 69, 153, 140, 108, 52, 66, 86, 22, 136, 122}, Valid: true, }, src: []byte(`"1d485a7a-6d18-4599-8c6c-34425616887a"`), wantErr: false, }, { name: "second", want: &pgtype.UUID{ Bytes: [16]byte{}, }, src: []byte("null"), wantErr: false, }, { name: "third", want: &pgtype.UUID{ Bytes: [16]byte{}, Valid: false, }, src: []byte("1d485a7a-6d18-4599-8c6c-34425616887a"), wantErr: true, }, } for _, tt := range tests { t.Run(tt.name, func(t *testing.T) { got := &pgtype.UUID{} if err := got.UnmarshalJSON(tt.src); (err != nil) != tt.wantErr { t.Errorf("UnmarshalJSON() error = %v, wantErr %v", err, tt.wantErr) } if !reflect.DeepEqual(got, tt.want) { t.Errorf("UnmarshalJSON() got = %v, want %v", got, tt.want) } }) } } pgx-5.8.0/pgtype/xml.go000066400000000000000000000117551512357711200147760ustar00rootroot00000000000000package pgtype import ( "database/sql" "database/sql/driver" "encoding/xml" "fmt" "reflect" ) type XMLCodec struct { Marshal func(v any) ([]byte, error) Unmarshal func(data []byte, v any) error } func (*XMLCodec) FormatSupported(format int16) bool { return format == TextFormatCode || format == BinaryFormatCode } func (*XMLCodec) PreferredFormat() int16 { return TextFormatCode } func (c *XMLCodec) PlanEncode(m *Map, oid uint32, format int16, value any) EncodePlan { switch value.(type) { case string: return encodePlanXMLCodecEitherFormatString{} case []byte: return encodePlanXMLCodecEitherFormatByteSlice{} // Cannot rely on driver.Valuer being handled later because anything can be marshalled. // // https://github.com/jackc/pgx/issues/1430 // // Check for driver.Valuer must come before xml.Marshaler so that it is guaranteed to be used // when both are implemented https://github.com/jackc/pgx/issues/1805 case driver.Valuer: return &encodePlanDriverValuer{m: m, oid: oid, formatCode: format} // Must come before trying wrap encode plans because a pointer to a struct may be unwrapped to a struct that can be // marshalled. // // https://github.com/jackc/pgx/issues/1681 case xml.Marshaler: return &encodePlanXMLCodecEitherFormatMarshal{ marshal: c.Marshal, } } // Because anything can be marshalled the normal wrapping in Map.PlanScan doesn't get a chance to run. So try the // appropriate wrappers here. for _, f := range []TryWrapEncodePlanFunc{ TryWrapDerefPointerEncodePlan, TryWrapFindUnderlyingTypeEncodePlan, } { if wrapperPlan, nextValue, ok := f(value); ok { if nextPlan := c.PlanEncode(m, oid, format, nextValue); nextPlan != nil { wrapperPlan.SetNext(nextPlan) return wrapperPlan } } } return &encodePlanXMLCodecEitherFormatMarshal{ marshal: c.Marshal, } } type encodePlanXMLCodecEitherFormatString struct{} func (encodePlanXMLCodecEitherFormatString) Encode(value any, buf []byte) (newBuf []byte, err error) { xmlString := value.(string) buf = append(buf, xmlString...) return buf, nil } type encodePlanXMLCodecEitherFormatByteSlice struct{} func (encodePlanXMLCodecEitherFormatByteSlice) Encode(value any, buf []byte) (newBuf []byte, err error) { xmlBytes := value.([]byte) if xmlBytes == nil { return nil, nil } buf = append(buf, xmlBytes...) return buf, nil } type encodePlanXMLCodecEitherFormatMarshal struct { marshal func(v any) ([]byte, error) } func (e *encodePlanXMLCodecEitherFormatMarshal) Encode(value any, buf []byte) (newBuf []byte, err error) { xmlBytes, err := e.marshal(value) if err != nil { return nil, err } buf = append(buf, xmlBytes...) return buf, nil } func (c *XMLCodec) PlanScan(m *Map, oid uint32, format int16, target any) ScanPlan { switch target.(type) { case *string: return scanPlanAnyToString{} case **string: // This is to fix **string scanning. It seems wrong to special case **string, but it's not clear what a better // solution would be. // // https://github.com/jackc/pgx/issues/1470 -- **string // https://github.com/jackc/pgx/issues/1691 -- ** anything else if wrapperPlan, nextDst, ok := TryPointerPointerScanPlan(target); ok { if nextPlan := m.planScan(oid, format, nextDst, 0); nextPlan != nil { if _, failed := nextPlan.(*scanPlanFail); !failed { wrapperPlan.SetNext(nextPlan) return wrapperPlan } } } case *[]byte: return scanPlanXMLToByteSlice{} case BytesScanner: return scanPlanBinaryBytesToBytesScanner{} // Cannot rely on sql.Scanner being handled later because scanPlanXMLToXMLUnmarshal will take precedence. // // https://github.com/jackc/pgx/issues/1418 case sql.Scanner: return &scanPlanSQLScanner{formatCode: format} } return &scanPlanXMLToXMLUnmarshal{ unmarshal: c.Unmarshal, } } type scanPlanXMLToByteSlice struct{} func (scanPlanXMLToByteSlice) Scan(src []byte, dst any) error { dstBuf := dst.(*[]byte) if src == nil { *dstBuf = nil return nil } *dstBuf = make([]byte, len(src)) copy(*dstBuf, src) return nil } type scanPlanXMLToXMLUnmarshal struct { unmarshal func(data []byte, v any) error } func (s *scanPlanXMLToXMLUnmarshal) Scan(src []byte, dst any) error { if src == nil { dstValue := reflect.ValueOf(dst) if dstValue.Kind() == reflect.Ptr { el := dstValue.Elem() switch el.Kind() { case reflect.Ptr, reflect.Slice, reflect.Map, reflect.Interface, reflect.Struct: el.Set(reflect.Zero(el.Type())) return nil } } return fmt.Errorf("cannot scan NULL into %T", dst) } elem := reflect.ValueOf(dst).Elem() elem.Set(reflect.Zero(elem.Type())) return s.unmarshal(src, dst) } func (c *XMLCodec) DecodeDatabaseSQLValue(m *Map, oid uint32, format int16, src []byte) (driver.Value, error) { if src == nil { return nil, nil } dstBuf := make([]byte, len(src)) copy(dstBuf, src) return dstBuf, nil } func (c *XMLCodec) DecodeValue(m *Map, oid uint32, format int16, src []byte) (any, error) { if src == nil { return nil, nil } var dst any err := c.Unmarshal(src, &dst) return dst, err } pgx-5.8.0/pgtype/xml_test.go000066400000000000000000000110151512357711200160220ustar00rootroot00000000000000package pgtype_test import ( "context" "database/sql" "encoding/xml" "testing" pgx "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) type xmlStruct struct { XMLName xml.Name `xml:"person"` Name string `xml:"name"` Age int `xml:"age,attr"` } func TestXMLCodec(t *testing.T) { skipCockroachDB(t, "CockroachDB does not support XML.") pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "xml", []pgxtest.ValueRoundTripTest{ {nil, new(*xmlStruct), isExpectedEq((*xmlStruct)(nil))}, {map[string]any(nil), new(*string), isExpectedEq((*string)(nil))}, {map[string]any(nil), new([]byte), isExpectedEqBytes([]byte(nil))}, {[]byte(nil), new([]byte), isExpectedEqBytes([]byte(nil))}, {nil, new([]byte), isExpectedEqBytes([]byte(nil))}, // Test sql.Scanner. {"", new(sql.NullString), isExpectedEq(sql.NullString{String: "", Valid: true})}, // Test driver.Valuer. {sql.NullString{String: "", Valid: true}, new(sql.NullString), isExpectedEq(sql.NullString{String: "", Valid: true})}, }) pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, pgxtest.KnownOIDQueryExecModes, "xml", []pgxtest.ValueRoundTripTest{ {[]byte(``), new([]byte), isExpectedEqBytes([]byte(``))}, {[]byte(``), new([]byte), isExpectedEqBytes([]byte(``))}, {[]byte(``), new(string), isExpectedEq(``)}, {[]byte(``), new([]byte), isExpectedEqBytes([]byte(``))}, {[]byte(``), new(string), isExpectedEq(``)}, {[]byte(""), new([]byte), isExpectedEqBytes([]byte(""))}, {xmlStruct{Name: "Adam", Age: 10}, new(xmlStruct), isExpectedEq(xmlStruct{XMLName: xml.Name{Local: "person"}, Name: "Adam", Age: 10})}, {xmlStruct{XMLName: xml.Name{Local: "person"}, Name: "Adam", Age: 10}, new(xmlStruct), isExpectedEq(xmlStruct{XMLName: xml.Name{Local: "person"}, Name: "Adam", Age: 10})}, {[]byte(`Adam`), new(xmlStruct), isExpectedEq(xmlStruct{XMLName: xml.Name{Local: "person"}, Name: "Adam", Age: 10})}, }) } // https://github.com/jackc/pgx/issues/1273#issuecomment-1221414648 func TestXMLCodecUnmarshalSQLNull(t *testing.T) { skipCockroachDB(t, "CockroachDB does not support XML.") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { // Byte arrays are nilified slice := []byte{10, 4} err := conn.QueryRow(ctx, "select null::xml").Scan(&slice) assert.NoError(t, err) assert.Nil(t, slice) // Non-pointer structs are zeroed m := xmlStruct{Name: "Adam"} err = conn.QueryRow(ctx, "select null::xml").Scan(&m) assert.NoError(t, err) assert.Empty(t, m) // Pointers to structs are nilified pm := &xmlStruct{Name: "Adam"} err = conn.QueryRow(ctx, "select null::xml").Scan(&pm) assert.NoError(t, err) assert.Nil(t, pm) // Pointer to pointer are nilified n := "" p := &n err = conn.QueryRow(ctx, "select null::xml").Scan(&p) assert.NoError(t, err) assert.Nil(t, p) // A string cannot scan a NULL. str := "foobar" err = conn.QueryRow(ctx, "select null::xml").Scan(&str) assert.EqualError(t, err, "can't scan into dest[0] (col: xml): cannot scan NULL into *string") }) } func TestXMLCodecPointerToPointerToString(t *testing.T) { skipCockroachDB(t, "CockroachDB does not support XML.") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var s *string err := conn.QueryRow(ctx, "select ''::xml").Scan(&s) require.NoError(t, err) require.NotNil(t, s) require.Equal(t, "", *s) err = conn.QueryRow(ctx, "select null::xml").Scan(&s) require.NoError(t, err) require.Nil(t, s) }) } func TestXMLCodecDecodeValue(t *testing.T) { skipCockroachDB(t, "CockroachDB does not support XML.") defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, _ testing.TB, conn *pgx.Conn) { for _, tt := range []struct { sql string expected any }{ { sql: `select 'bar'::xml`, expected: []byte("bar"), }, } { t.Run(tt.sql, func(t *testing.T) { rows, err := conn.Query(ctx, tt.sql) require.NoError(t, err) for rows.Next() { values, err := rows.Values() require.NoError(t, err) require.Len(t, values, 1) require.Equal(t, tt.expected, values[0]) } require.NoError(t, rows.Err()) }) } }) } pgx-5.8.0/pgtype/zeronull/000077500000000000000000000000001512357711200155105ustar00rootroot00000000000000pgx-5.8.0/pgtype/zeronull/doc.go000066400000000000000000000016201512357711200166030ustar00rootroot00000000000000// Package zeronull contains types that automatically convert between database NULLs and Go zero values. /* Sometimes the distinction between a zero value and a NULL value is not useful at the application level. For example, in PostgreSQL an empty string may be stored as NULL. There is usually no application level distinction between an empty string and a NULL string. Package zeronull implements types that seamlessly convert between PostgreSQL NULL and the zero value. It is recommended to convert types at usage time rather than instantiate these types directly. In the example below, middlename would be stored as a NULL. firstname := "John" middlename := "" lastname := "Smith" _, err := conn.Exec( ctx, "insert into people(firstname, middlename, lastname) values($1, $2, $3)", zeronull.Text(firstname), zeronull.Text(middlename), zeronull.Text(lastname), ) */ package zeronull pgx-5.8.0/pgtype/zeronull/float8.go000066400000000000000000000021351512357711200172350ustar00rootroot00000000000000package zeronull import ( "database/sql/driver" "github.com/jackc/pgx/v5/pgtype" ) type Float8 float64 // SkipUnderlyingTypePlan implements the [pgtype.SkipUnderlyingTypePlanner] interface. func (Float8) SkipUnderlyingTypePlan() {} // ScanFloat64 implements the [pgtype.Float64Scanner] interface. func (f *Float8) ScanFloat64(n pgtype.Float8) error { if !n.Valid { *f = 0 return nil } *f = Float8(n.Float64) return nil } // Float64Value implements the [pgtype.Float64Valuer] interface. func (f Float8) Float64Value() (pgtype.Float8, error) { if f == 0 { return pgtype.Float8{}, nil } return pgtype.Float8{Float64: float64(f), Valid: true}, nil } // Scan implements the [database/sql.Scanner] interface. func (f *Float8) Scan(src any) error { if src == nil { *f = 0 return nil } var nullable pgtype.Float8 err := nullable.Scan(src) if err != nil { return err } *f = Float8(nullable.Float64) return nil } // Value implements the [database/sql/driver.Valuer] interface. func (f Float8) Value() (driver.Value, error) { if f == 0 { return nil, nil } return float64(f), nil } pgx-5.8.0/pgtype/zeronull/float8_test.go000066400000000000000000000012071512357711200202730ustar00rootroot00000000000000package zeronull_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype/zeronull" "github.com/jackc/pgx/v5/pgxtest" ) func isExpectedEq(a any) func(any) bool { return func(v any) bool { return a == v } } func TestFloat8Transcode(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "float8", []pgxtest.ValueRoundTripTest{ { (zeronull.Float8)(1), new(zeronull.Float8), isExpectedEq((zeronull.Float8)(1)), }, { nil, new(zeronull.Float8), isExpectedEq((zeronull.Float8)(0)), }, { (zeronull.Float8)(0), new(any), isExpectedEq(nil), }, }) } pgx-5.8.0/pgtype/zeronull/int.go000066400000000000000000000073441512357711200166410ustar00rootroot00000000000000// Code generated from pgtype/zeronull/int.go.erb. DO NOT EDIT. package zeronull import ( "database/sql/driver" "fmt" "math" "github.com/jackc/pgx/v5/pgtype" ) type Int2 int16 // SkipUnderlyingTypePlan implements the [pgtype.SkipUnderlyingTypePlanner] interface. func (Int2) SkipUnderlyingTypePlan() {} // ScanInt64 implements the [pgtype.Int64Scanner] interface. func (dst *Int2) ScanInt64(n pgtype.Int8) error { if !n.Valid { *dst = 0 return nil } if n.Int64 < math.MinInt16 { return fmt.Errorf("%d is less than minimum value for Int2", n.Int64) } if n.Int64 > math.MaxInt16 { return fmt.Errorf("%d is greater than maximum value for Int2", n.Int64) } *dst = Int2(n.Int64) return nil } // Int64Value implements the [pgtype.Int64Valuer] interface. func (src Int2) Int64Value() (pgtype.Int8, error) { if src == 0 { return pgtype.Int8{}, nil } return pgtype.Int8{Int64: int64(src), Valid: true}, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Int2) Scan(src any) error { if src == nil { *dst = 0 return nil } var nullable pgtype.Int2 err := nullable.Scan(src) if err != nil { return err } *dst = Int2(nullable.Int16) return nil } // Value implements the [database/sql/driver.Valuer] interface. func (src Int2) Value() (driver.Value, error) { if src == 0 { return nil, nil } return int64(src), nil } type Int4 int32 // SkipUnderlyingTypePlan implements the [pgtype.SkipUnderlyingTypePlanner] interface. func (Int4) SkipUnderlyingTypePlan() {} // ScanInt64 implements the [pgtype.Int64Scanner] interface. func (dst *Int4) ScanInt64(n pgtype.Int8) error { if !n.Valid { *dst = 0 return nil } if n.Int64 < math.MinInt32 { return fmt.Errorf("%d is less than minimum value for Int4", n.Int64) } if n.Int64 > math.MaxInt32 { return fmt.Errorf("%d is greater than maximum value for Int4", n.Int64) } *dst = Int4(n.Int64) return nil } // Int64Value implements the [pgtype.Int64Valuer] interface. func (src Int4) Int64Value() (pgtype.Int8, error) { if src == 0 { return pgtype.Int8{}, nil } return pgtype.Int8{Int64: int64(src), Valid: true}, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Int4) Scan(src any) error { if src == nil { *dst = 0 return nil } var nullable pgtype.Int4 err := nullable.Scan(src) if err != nil { return err } *dst = Int4(nullable.Int32) return nil } // Value implements the [database/sql/driver.Valuer] interface. func (src Int4) Value() (driver.Value, error) { if src == 0 { return nil, nil } return int64(src), nil } type Int8 int64 // SkipUnderlyingTypePlan implements the [pgtype.SkipUnderlyingTypePlanner] interface. func (Int8) SkipUnderlyingTypePlan() {} // ScanInt64 implements the [pgtype.Int64Scanner] interface. func (dst *Int8) ScanInt64(n pgtype.Int8) error { if !n.Valid { *dst = 0 return nil } if n.Int64 < math.MinInt64 { return fmt.Errorf("%d is less than minimum value for Int8", n.Int64) } if n.Int64 > math.MaxInt64 { return fmt.Errorf("%d is greater than maximum value for Int8", n.Int64) } *dst = Int8(n.Int64) return nil } // Int64Value implements the [pgtype.Int64Valuer] interface. func (src Int8) Int64Value() (pgtype.Int8, error) { if src == 0 { return pgtype.Int8{}, nil } return pgtype.Int8{Int64: int64(src), Valid: true}, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Int8) Scan(src any) error { if src == nil { *dst = 0 return nil } var nullable pgtype.Int8 err := nullable.Scan(src) if err != nil { return err } *dst = Int8(nullable.Int64) return nil } // Value implements the [database/sql/driver.Valuer] interface. func (src Int8) Value() (driver.Value, error) { if src == 0 { return nil, nil } return int64(src), nil } pgx-5.8.0/pgtype/zeronull/int.go.erb000066400000000000000000000032011512357711200173740ustar00rootroot00000000000000package zeronull import ( "database/sql/driver" "fmt" "math" "github.com/jackc/pgx/v5/pgtype" ) <% [2, 4, 8].each do |pg_byte_size| %> <% pg_bit_size = pg_byte_size * 8 %> type Int<%= pg_byte_size %> int<%= pg_bit_size %> // SkipUnderlyingTypePlan implements the [pgtype.SkipUnderlyingTypePlanner] interface. func (Int<%= pg_byte_size %>) SkipUnderlyingTypePlan() {} // ScanInt64 implements the [pgtype.Int64Scanner] interface. func (dst *Int<%= pg_byte_size %>) ScanInt64(n pgtype.Int8) error { if !n.Valid { *dst = 0 return nil } if n.Int64 < math.MinInt<%= pg_bit_size %> { return fmt.Errorf("%d is less than minimum value for Int<%= pg_byte_size %>", n.Int64) } if n.Int64 > math.MaxInt<%= pg_bit_size %> { return fmt.Errorf("%d is greater than maximum value for Int<%= pg_byte_size %>", n.Int64) } *dst = Int<%= pg_byte_size %>(n.Int64) return nil } // Int64Value implements the [pgtype.Int64Valuer] interface. func (src Int<%= pg_byte_size %>) Int64Value() (pgtype.Int8, error) { if src == 0 { return pgtype.Int8{}, nil } return pgtype.Int8{Int64: int64(src), Valid: true}, nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Int<%= pg_byte_size %>) Scan(src any) error { if src == nil { *dst = 0 return nil } var nullable pgtype.Int<%= pg_byte_size %> err := nullable.Scan(src) if err != nil { return err } *dst = Int<%= pg_byte_size %>(nullable.Int<%= pg_bit_size %>) return nil } // Value implements the [database/sql/driver.Valuer] interface. func (src Int<%= pg_byte_size %>) Value() (driver.Value, error) { if src == 0 { return nil, nil } return int64(src), nil } <% end %> pgx-5.8.0/pgtype/zeronull/int_test.go000066400000000000000000000026141512357711200176730ustar00rootroot00000000000000// Code generated from pgtype/zeronull/int_test.go.erb. DO NOT EDIT. package zeronull_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype/zeronull" "github.com/jackc/pgx/v5/pgxtest" ) func TestInt2Transcode(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "int2", []pgxtest.ValueRoundTripTest{ { (zeronull.Int2)(1), new(zeronull.Int2), isExpectedEq((zeronull.Int2)(1)), }, { nil, new(zeronull.Int2), isExpectedEq((zeronull.Int2)(0)), }, { (zeronull.Int2)(0), new(any), isExpectedEq(nil), }, }) } func TestInt4Transcode(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "int4", []pgxtest.ValueRoundTripTest{ { (zeronull.Int4)(1), new(zeronull.Int4), isExpectedEq((zeronull.Int4)(1)), }, { nil, new(zeronull.Int4), isExpectedEq((zeronull.Int4)(0)), }, { (zeronull.Int4)(0), new(any), isExpectedEq(nil), }, }) } func TestInt8Transcode(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "int8", []pgxtest.ValueRoundTripTest{ { (zeronull.Int8)(1), new(zeronull.Int8), isExpectedEq((zeronull.Int8)(1)), }, { nil, new(zeronull.Int8), isExpectedEq((zeronull.Int8)(0)), }, { (zeronull.Int8)(0), new(any), isExpectedEq(nil), }, }) } pgx-5.8.0/pgtype/zeronull/int_test.go.erb000066400000000000000000000013771512357711200204470ustar00rootroot00000000000000package zeronull_test import ( "testing" "github.com/jackc/pgx/v5/pgtype/testutil" "github.com/jackc/pgx/v5/pgtype/zeronull" ) <% [2, 4, 8].each do |pg_byte_size| %> <% pg_bit_size = pg_byte_size * 8 %> func TestInt<%= pg_byte_size %>Transcode(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "int<%= pg_byte_size %>", []pgxtest.ValueRoundTripTest{ { (zeronull.Int<%= pg_byte_size %>)(1), new(zeronull.Int<%= pg_byte_size %>), isExpectedEq((zeronull.Int<%= pg_byte_size %>)(1)), }, { nil, new(zeronull.Int<%= pg_byte_size %>), isExpectedEq((zeronull.Int<%= pg_byte_size %>)(0)), }, { (zeronull.Int<%= pg_byte_size %>)(0), new(any), isExpectedEq(nil), }, }) } <% end %> pgx-5.8.0/pgtype/zeronull/text.go000066400000000000000000000015541512357711200170300ustar00rootroot00000000000000package zeronull import ( "database/sql/driver" "github.com/jackc/pgx/v5/pgtype" ) type Text string // SkipUnderlyingTypePlan implements the [pgtype.SkipUnderlyingTypePlanner] interface. func (Text) SkipUnderlyingTypePlan() {} // ScanText implements the [pgtype.TextScanner] interface. func (dst *Text) ScanText(v pgtype.Text) error { if !v.Valid { *dst = "" return nil } *dst = Text(v.String) return nil } // Scan implements the [database/sql.Scanner] interface. func (dst *Text) Scan(src any) error { if src == nil { *dst = "" return nil } var nullable pgtype.Text err := nullable.Scan(src) if err != nil { return err } *dst = Text(nullable.String) return nil } // Value implements the [database/sql/driver.Valuer] interface. func (src Text) Value() (driver.Value, error) { if src == "" { return nil, nil } return string(src), nil } pgx-5.8.0/pgtype/zeronull/text_test.go000066400000000000000000000010461512357711200200630ustar00rootroot00000000000000package zeronull_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype/zeronull" "github.com/jackc/pgx/v5/pgxtest" ) func TestTextTranscode(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "text", []pgxtest.ValueRoundTripTest{ { (zeronull.Text)("foo"), new(zeronull.Text), isExpectedEq((zeronull.Text)("foo")), }, { nil, new(zeronull.Text), isExpectedEq((zeronull.Text)("")), }, { (zeronull.Text)(""), new(any), isExpectedEq(nil), }, }) } pgx-5.8.0/pgtype/zeronull/timestamp.go000066400000000000000000000030231512357711200200400ustar00rootroot00000000000000package zeronull import ( "database/sql/driver" "fmt" "time" "github.com/jackc/pgx/v5/pgtype" ) type Timestamp time.Time // SkipUnderlyingTypePlan implements the [pgtype.SkipUnderlyingTypePlanner] interface. func (Timestamp) SkipUnderlyingTypePlan() {} // ScanTimestamp implements the [pgtype.TimestampScanner] interface. func (ts *Timestamp) ScanTimestamp(v pgtype.Timestamp) error { if !v.Valid { *ts = Timestamp{} return nil } switch v.InfinityModifier { case pgtype.Finite: *ts = Timestamp(v.Time) return nil case pgtype.Infinity: return fmt.Errorf("cannot scan Infinity into *time.Time") case pgtype.NegativeInfinity: return fmt.Errorf("cannot scan -Infinity into *time.Time") default: return fmt.Errorf("invalid InfinityModifier: %v", v.InfinityModifier) } } // TimestampValue implements the [pgtype.TimestampValuer] interface. func (ts Timestamp) TimestampValue() (pgtype.Timestamp, error) { if time.Time(ts).IsZero() { return pgtype.Timestamp{}, nil } return pgtype.Timestamp{Time: time.Time(ts), Valid: true}, nil } // Scan implements the [database/sql.Scanner] interface. func (ts *Timestamp) Scan(src any) error { if src == nil { *ts = Timestamp{} return nil } var nullable pgtype.Timestamp err := nullable.Scan(src) if err != nil { return err } *ts = Timestamp(nullable.Time) return nil } // Value implements the [database/sql/driver.Valuer] interface. func (ts Timestamp) Value() (driver.Value, error) { if time.Time(ts).IsZero() { return nil, nil } return time.Time(ts), nil } pgx-5.8.0/pgtype/zeronull/timestamp_test.go000066400000000000000000000016051512357711200211030ustar00rootroot00000000000000package zeronull_test import ( "context" "testing" "time" "github.com/jackc/pgx/v5/pgtype/zeronull" "github.com/jackc/pgx/v5/pgxtest" ) func isExpectedEqTimestamp(a any) func(any) bool { return func(v any) bool { at := time.Time(a.(zeronull.Timestamp)) vt := time.Time(v.(zeronull.Timestamp)) return at.Equal(vt) } } func TestTimestampTranscode(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "timestamp", []pgxtest.ValueRoundTripTest{ { (zeronull.Timestamp)(time.Date(2020, 1, 1, 0, 0, 0, 0, time.UTC)), new(zeronull.Timestamp), isExpectedEqTimestamp((zeronull.Timestamp)(time.Date(2020, 1, 1, 0, 0, 0, 0, time.UTC))), }, { nil, new(zeronull.Timestamp), isExpectedEqTimestamp((zeronull.Timestamp)(time.Time{})), }, { (zeronull.Timestamp)(time.Time{}), new(any), isExpectedEq(nil), }, }) } pgx-5.8.0/pgtype/zeronull/timestamptz.go000066400000000000000000000030751512357711200204250ustar00rootroot00000000000000package zeronull import ( "database/sql/driver" "fmt" "time" "github.com/jackc/pgx/v5/pgtype" ) type Timestamptz time.Time // SkipUnderlyingTypePlan implements the [pgtype.SkipUnderlyingTypePlanner] interface. func (Timestamptz) SkipUnderlyingTypePlan() {} // ScanTimestamptz implements the [pgtype.TimestamptzScanner] interface. func (ts *Timestamptz) ScanTimestamptz(v pgtype.Timestamptz) error { if !v.Valid { *ts = Timestamptz{} return nil } switch v.InfinityModifier { case pgtype.Finite: *ts = Timestamptz(v.Time) return nil case pgtype.Infinity: return fmt.Errorf("cannot scan Infinity into *time.Time") case pgtype.NegativeInfinity: return fmt.Errorf("cannot scan -Infinity into *time.Time") default: return fmt.Errorf("invalid InfinityModifier: %v", v.InfinityModifier) } } // TimestamptzValue implements the [pgtype.TimestamptzValuer] interface. func (ts Timestamptz) TimestamptzValue() (pgtype.Timestamptz, error) { if time.Time(ts).IsZero() { return pgtype.Timestamptz{}, nil } return pgtype.Timestamptz{Time: time.Time(ts), Valid: true}, nil } // Scan implements the [database/sql.Scanner] interface. func (ts *Timestamptz) Scan(src any) error { if src == nil { *ts = Timestamptz{} return nil } var nullable pgtype.Timestamptz err := nullable.Scan(src) if err != nil { return err } *ts = Timestamptz(nullable.Time) return nil } // Value implements the [database/sql/driver.Valuer] interface. func (ts Timestamptz) Value() (driver.Value, error) { if time.Time(ts).IsZero() { return nil, nil } return time.Time(ts), nil } pgx-5.8.0/pgtype/zeronull/timestamptz_test.go000066400000000000000000000016371512357711200214660ustar00rootroot00000000000000package zeronull_test import ( "context" "testing" "time" "github.com/jackc/pgx/v5/pgtype/zeronull" "github.com/jackc/pgx/v5/pgxtest" ) func isExpectedEqTimestamptz(a any) func(any) bool { return func(v any) bool { at := time.Time(a.(zeronull.Timestamptz)) vt := time.Time(v.(zeronull.Timestamptz)) return at.Equal(vt) } } func TestTimestamptzTranscode(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "timestamptz", []pgxtest.ValueRoundTripTest{ { (zeronull.Timestamptz)(time.Date(2020, 1, 1, 0, 0, 0, 0, time.UTC)), new(zeronull.Timestamptz), isExpectedEqTimestamptz((zeronull.Timestamptz)(time.Date(2020, 1, 1, 0, 0, 0, 0, time.UTC))), }, { nil, new(zeronull.Timestamptz), isExpectedEqTimestamptz((zeronull.Timestamptz)(time.Time{})), }, { (zeronull.Timestamptz)(time.Time{}), new(any), isExpectedEq(nil), }, }) } pgx-5.8.0/pgtype/zeronull/uuid.go000066400000000000000000000023151512357711200170060ustar00rootroot00000000000000package zeronull import ( "database/sql/driver" "github.com/jackc/pgx/v5/pgtype" ) type UUID [16]byte // SkipUnderlyingTypePlan implements the [pgtype.SkipUnderlyingTypePlanner] interface. func (UUID) SkipUnderlyingTypePlan() {} // ScanUUID implements the [pgtype.UUIDScanner] interface. func (u *UUID) ScanUUID(v pgtype.UUID) error { if !v.Valid { *u = UUID{} return nil } *u = UUID(v.Bytes) return nil } // UUIDValue implements the [pgtype.UUIDValuer] interface. func (u UUID) UUIDValue() (pgtype.UUID, error) { if u == (UUID{}) { return pgtype.UUID{}, nil } return pgtype.UUID{Bytes: u, Valid: true}, nil } // Scan implements the [database/sql.Scanner] interface. func (u *UUID) Scan(src any) error { if src == nil { *u = UUID{} return nil } var nullable pgtype.UUID err := nullable.Scan(src) if err != nil { return err } *u = UUID(nullable.Bytes) return nil } // Value implements the [database/sql/driver.Valuer] interface. func (u UUID) Value() (driver.Value, error) { if u == (UUID{}) { return nil, nil } buf, err := pgtype.UUIDCodec{}.PlanEncode(nil, pgtype.UUIDOID, pgtype.TextFormatCode, u).Encode(u, nil) if err != nil { return nil, err } return string(buf), nil } pgx-5.8.0/pgtype/zeronull/uuid_test.go000066400000000000000000000012501512357711200200420ustar00rootroot00000000000000package zeronull_test import ( "context" "testing" "github.com/jackc/pgx/v5/pgtype/zeronull" "github.com/jackc/pgx/v5/pgxtest" ) func TestUUIDTranscode(t *testing.T) { pgxtest.RunValueRoundTripTests(context.Background(), t, defaultConnTestRunner, nil, "uuid", []pgxtest.ValueRoundTripTest{ { (zeronull.UUID)([16]byte{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15}), new(zeronull.UUID), isExpectedEq((zeronull.UUID)([16]byte{0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15})), }, { nil, new(zeronull.UUID), isExpectedEq((zeronull.UUID)([16]byte{})), }, { (zeronull.UUID)([16]byte{}), new(any), isExpectedEq(nil), }, }) } pgx-5.8.0/pgtype/zeronull/zeronull.go000066400000000000000000000010761512357711200177150ustar00rootroot00000000000000package zeronull import ( "github.com/jackc/pgx/v5/pgtype" ) // Register registers the zeronull types so they can be used in query exec modes that do not know the server OIDs. func Register(m *pgtype.Map) { m.RegisterDefaultPgType(Float8(0), "float8") m.RegisterDefaultPgType(Int2(0), "int2") m.RegisterDefaultPgType(Int4(0), "int4") m.RegisterDefaultPgType(Int8(0), "int8") m.RegisterDefaultPgType(Text(""), "text") m.RegisterDefaultPgType(Timestamp{}, "timestamp") m.RegisterDefaultPgType(Timestamptz{}, "timestamptz") m.RegisterDefaultPgType(UUID{}, "uuid") } pgx-5.8.0/pgtype/zeronull/zeronull_test.go000066400000000000000000000012401512357711200207450ustar00rootroot00000000000000package zeronull_test import ( "context" "os" "testing" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgtype/zeronull" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/require" ) var defaultConnTestRunner pgxtest.ConnTestRunner func init() { defaultConnTestRunner = pgxtest.DefaultConnTestRunner() defaultConnTestRunner.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config, err := pgx.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) return config } defaultConnTestRunner.AfterConnect = func(ctx context.Context, t testing.TB, conn *pgx.Conn) { zeronull.Register(conn.TypeMap()) } } pgx-5.8.0/pgx_test.go000066400000000000000000000006241512357711200145140ustar00rootroot00000000000000package pgx_test import ( "context" "os" "testing" "github.com/jackc/pgx/v5" _ "github.com/jackc/pgx/v5/stdlib" ) func skipCockroachDB(t testing.TB, msg string) { conn, err := pgx.Connect(context.Background(), os.Getenv("PGX_TEST_DATABASE")) if err != nil { t.Fatal(err) } defer conn.Close(context.Background()) if conn.PgConn().ParameterStatus("crdb_version") != "" { t.Skip(msg) } } pgx-5.8.0/pgxpool/000077500000000000000000000000001512357711200140165ustar00rootroot00000000000000pgx-5.8.0/pgxpool/batch_results.go000066400000000000000000000016151512357711200172120ustar00rootroot00000000000000package pgxpool import ( "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" ) type errBatchResults struct { err error } func (br errBatchResults) Exec() (pgconn.CommandTag, error) { return pgconn.CommandTag{}, br.err } func (br errBatchResults) Query() (pgx.Rows, error) { return errRows{err: br.err}, br.err } func (br errBatchResults) QueryRow() pgx.Row { return errRow{err: br.err} } func (br errBatchResults) Close() error { return br.err } type poolBatchResults struct { br pgx.BatchResults c *Conn } func (br *poolBatchResults) Exec() (pgconn.CommandTag, error) { return br.br.Exec() } func (br *poolBatchResults) Query() (pgx.Rows, error) { return br.br.Query() } func (br *poolBatchResults) QueryRow() pgx.Row { return br.br.QueryRow() } func (br *poolBatchResults) Close() error { err := br.br.Close() if br.c != nil { br.c.Release() br.c = nil } return err } pgx-5.8.0/pgxpool/bench_test.go000066400000000000000000000033211512357711200164620ustar00rootroot00000000000000package pgxpool_test import ( "context" "os" "testing" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgxpool" "github.com/stretchr/testify/require" ) func BenchmarkAcquireAndRelease(b *testing.B) { pool, err := pgxpool.New(context.Background(), os.Getenv("PGX_TEST_DATABASE")) require.NoError(b, err) defer pool.Close() for b.Loop() { c, err := pool.Acquire(context.Background()) if err != nil { b.Fatal(err) } c.Release() } } func BenchmarkMinimalPreparedSelectBaseline(b *testing.B) { config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(b, err) config.AfterConnect = func(ctx context.Context, c *pgx.Conn) error { _, err := c.Prepare(ctx, "ps1", "select $1::int8") return err } db, err := pgxpool.NewWithConfig(context.Background(), config) require.NoError(b, err) conn, err := db.Acquire(context.Background()) require.NoError(b, err) defer conn.Release() var n int64 for i := 0; b.Loop(); i++ { err = conn.QueryRow(context.Background(), "ps1", i).Scan(&n) if err != nil { b.Fatal(err) } if n != int64(i) { b.Fatalf("expected %d, got %d", i, n) } } } func BenchmarkMinimalPreparedSelect(b *testing.B) { config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(b, err) config.AfterConnect = func(ctx context.Context, c *pgx.Conn) error { _, err := c.Prepare(ctx, "ps1", "select $1::int8") return err } db, err := pgxpool.NewWithConfig(context.Background(), config) require.NoError(b, err) var n int64 for i := 0; b.Loop(); i++ { err = db.QueryRow(context.Background(), "ps1", i).Scan(&n) if err != nil { b.Fatal(err) } if n != int64(i) { b.Fatalf("expected %d, got %d", i, n) } } } pgx-5.8.0/pgxpool/common_test.go000066400000000000000000000171031512357711200166760ustar00rootroot00000000000000package pgxpool_test import ( "context" "testing" "time" "github.com/jackc/pgx/v5/pgxpool" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) // Conn.Release is an asynchronous process that returns immediately. There is no signal when the actual work is // completed. To test something that relies on the actual work for Conn.Release being completed we must simply wait. // This function wraps the sleep so there is more meaning for the callers. func waitForReleaseToComplete() { time.Sleep(500 * time.Millisecond) } type execer interface { Exec(ctx context.Context, sql string, arguments ...any) (pgconn.CommandTag, error) } func testExec(t *testing.T, ctx context.Context, db execer) { results, err := db.Exec(ctx, "set time zone 'America/Chicago'") require.NoError(t, err) assert.EqualValues(t, "SET", results.String()) } type queryer interface { Query(ctx context.Context, sql string, args ...any) (pgx.Rows, error) } func testQuery(t *testing.T, ctx context.Context, db queryer) { var sum, rowCount int32 rows, err := db.Query(ctx, "select generate_series(1,$1)", 10) require.NoError(t, err) for rows.Next() { var n int32 rows.Scan(&n) sum += n rowCount++ } assert.NoError(t, rows.Err()) assert.Equal(t, int32(10), rowCount) assert.Equal(t, int32(55), sum) } type queryRower interface { QueryRow(ctx context.Context, sql string, args ...any) pgx.Row } func testQueryRow(t *testing.T, ctx context.Context, db queryRower) { var what, who string err := db.QueryRow(ctx, "select 'hello', $1::text", "world").Scan(&what, &who) assert.NoError(t, err) assert.Equal(t, "hello", what) assert.Equal(t, "world", who) } type sendBatcher interface { SendBatch(context.Context, *pgx.Batch) pgx.BatchResults } func testSendBatch(t *testing.T, ctx context.Context, db sendBatcher) { batch := &pgx.Batch{} batch.Queue("select 1") batch.Queue("select 2") br := db.SendBatch(ctx, batch) var err error var n int32 err = br.QueryRow().Scan(&n) assert.NoError(t, err) assert.EqualValues(t, 1, n) err = br.QueryRow().Scan(&n) assert.NoError(t, err) assert.EqualValues(t, 2, n) err = br.Close() assert.NoError(t, err) } type copyFromer interface { CopyFrom(context.Context, pgx.Identifier, []string, pgx.CopyFromSource) (int64, error) } func testCopyFrom(t *testing.T, ctx context.Context, db interface { execer queryer copyFromer }, ) { _, err := db.Exec(ctx, `create temporary table foo(a int2, b int4, c int8, d varchar, e text, f date, g timestamptz)`) require.NoError(t, err) tzedTime := time.Date(2010, 2, 3, 4, 5, 6, 0, time.Local) inputRows := [][]any{ {int16(0), int32(1), int64(2), "abc", "efg", time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC), tzedTime}, {nil, nil, nil, nil, nil, nil, nil}, } copyCount, err := db.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a", "b", "c", "d", "e", "f", "g"}, pgx.CopyFromRows(inputRows)) assert.NoError(t, err) assert.EqualValues(t, len(inputRows), copyCount) rows, err := db.Query(ctx, "select * from foo") assert.NoError(t, err) var outputRows [][]any for rows.Next() { row, err := rows.Values() if err != nil { t.Errorf("Unexpected error for rows.Values(): %v", err) } outputRows = append(outputRows, row) } assert.NoError(t, rows.Err()) assert.Equal(t, inputRows, outputRows) } func assertConfigsEqual(t *testing.T, expected, actual *pgxpool.Config, testName string) { if !assert.NotNil(t, expected) { return } if !assert.NotNil(t, actual) { return } assert.Equalf(t, expected.ConnString(), actual.ConnString(), "%s - ConnString", testName) // Can't test function equality, so just test that they are set or not. assert.Equalf(t, expected.AfterConnect == nil, actual.AfterConnect == nil, "%s - AfterConnect", testName) assert.Equalf(t, expected.BeforeAcquire == nil, actual.BeforeAcquire == nil, "%s - BeforeAcquire", testName) assert.Equalf(t, expected.PrepareConn == nil, actual.PrepareConn == nil, "%s - PrepareConn", testName) assert.Equalf(t, expected.AfterRelease == nil, actual.AfterRelease == nil, "%s - AfterRelease", testName) assert.Equalf(t, expected.MaxConnLifetime, actual.MaxConnLifetime, "%s - MaxConnLifetime", testName) assert.Equalf(t, expected.MaxConnIdleTime, actual.MaxConnIdleTime, "%s - MaxConnIdleTime", testName) assert.Equalf(t, expected.MaxConns, actual.MaxConns, "%s - MaxConns", testName) assert.Equalf(t, expected.MinConns, actual.MinConns, "%s - MinConns", testName) assert.Equalf(t, expected.MinIdleConns, actual.MinIdleConns, "%s - MinIdleConns", testName) assert.Equalf(t, expected.HealthCheckPeriod, actual.HealthCheckPeriod, "%s - HealthCheckPeriod", testName) assertConnConfigsEqual(t, expected.ConnConfig, actual.ConnConfig, testName) } func assertConnConfigsEqual(t *testing.T, expected, actual *pgx.ConnConfig, testName string) { if !assert.NotNil(t, expected) { return } if !assert.NotNil(t, actual) { return } assert.Equalf(t, expected.Tracer, actual.Tracer, "%s - Tracer", testName) assert.Equalf(t, expected.ConnString(), actual.ConnString(), "%s - ConnString", testName) assert.Equalf(t, expected.StatementCacheCapacity, actual.StatementCacheCapacity, "%s - StatementCacheCapacity", testName) assert.Equalf(t, expected.DescriptionCacheCapacity, actual.DescriptionCacheCapacity, "%s - DescriptionCacheCapacity", testName) assert.Equalf(t, expected.DefaultQueryExecMode, actual.DefaultQueryExecMode, "%s - DefaultQueryExecMode", testName) assert.Equalf(t, expected.Host, actual.Host, "%s - Host", testName) assert.Equalf(t, expected.Database, actual.Database, "%s - Database", testName) assert.Equalf(t, expected.Port, actual.Port, "%s - Port", testName) assert.Equalf(t, expected.User, actual.User, "%s - User", testName) assert.Equalf(t, expected.Password, actual.Password, "%s - Password", testName) assert.Equalf(t, expected.ConnectTimeout, actual.ConnectTimeout, "%s - ConnectTimeout", testName) assert.Equalf(t, expected.RuntimeParams, actual.RuntimeParams, "%s - RuntimeParams", testName) // Can't test function equality, so just test that they are set or not. assert.Equalf(t, expected.ValidateConnect == nil, actual.ValidateConnect == nil, "%s - ValidateConnect", testName) assert.Equalf(t, expected.AfterConnect == nil, actual.AfterConnect == nil, "%s - AfterConnect", testName) if assert.Equalf(t, expected.TLSConfig == nil, actual.TLSConfig == nil, "%s - TLSConfig", testName) { if expected.TLSConfig != nil { assert.Equalf(t, expected.TLSConfig.InsecureSkipVerify, actual.TLSConfig.InsecureSkipVerify, "%s - TLSConfig InsecureSkipVerify", testName) assert.Equalf(t, expected.TLSConfig.ServerName, actual.TLSConfig.ServerName, "%s - TLSConfig ServerName", testName) } } if assert.Equalf(t, len(expected.Fallbacks), len(actual.Fallbacks), "%s - Fallbacks", testName) { for i := range expected.Fallbacks { assert.Equalf(t, expected.Fallbacks[i].Host, actual.Fallbacks[i].Host, "%s - Fallback %d - Host", testName, i) assert.Equalf(t, expected.Fallbacks[i].Port, actual.Fallbacks[i].Port, "%s - Fallback %d - Port", testName, i) if assert.Equalf(t, expected.Fallbacks[i].TLSConfig == nil, actual.Fallbacks[i].TLSConfig == nil, "%s - Fallback %d - TLSConfig", testName, i) { if expected.Fallbacks[i].TLSConfig != nil { assert.Equalf(t, expected.Fallbacks[i].TLSConfig.InsecureSkipVerify, actual.Fallbacks[i].TLSConfig.InsecureSkipVerify, "%s - Fallback %d - TLSConfig InsecureSkipVerify", testName) assert.Equalf(t, expected.Fallbacks[i].TLSConfig.ServerName, actual.Fallbacks[i].TLSConfig.ServerName, "%s - Fallback %d - TLSConfig ServerName", testName) } } } } } pgx-5.8.0/pgxpool/conn.go000066400000000000000000000072311512357711200153050ustar00rootroot00000000000000package pgxpool import ( "context" "sync/atomic" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/puddle/v2" ) // Conn is an acquired *pgx.Conn from a Pool. type Conn struct { res *puddle.Resource[*connResource] p *Pool } // Release returns c to the pool it was acquired from. Once Release has been called, other methods must not be called. // However, it is safe to call Release multiple times. Subsequent calls after the first will be ignored. func (c *Conn) Release() { if c.res == nil { return } conn := c.Conn() res := c.res c.res = nil if c.p.releaseTracer != nil { c.p.releaseTracer.TraceRelease(c.p, TraceReleaseData{Conn: conn}) } if conn.IsClosed() || conn.PgConn().IsBusy() || conn.PgConn().TxStatus() != 'I' { res.Destroy() // Signal to the health check to run since we just destroyed a connections // and we might be below minConns now c.p.triggerHealthCheck() return } // If the pool is consistently being used, we might never get to check the // lifetime of a connection since we only check idle connections in checkConnsHealth // so we also check the lifetime here and force a health check if c.p.isExpired(res) { atomic.AddInt64(&c.p.lifetimeDestroyCount, 1) res.Destroy() // Signal to the health check to run since we just destroyed a connections // and we might be below minConns now c.p.triggerHealthCheck() return } if c.p.afterRelease == nil { res.Release() return } go func() { if c.p.afterRelease(conn) { res.Release() } else { res.Destroy() // Signal to the health check to run since we just destroyed a connections // and we might be below minConns now c.p.triggerHealthCheck() } }() } // Hijack assumes ownership of the connection from the pool. Caller is responsible for closing the connection. Hijack // will panic if called on an already released or hijacked connection. func (c *Conn) Hijack() *pgx.Conn { if c.res == nil { panic("cannot hijack already released or hijacked connection") } conn := c.Conn() res := c.res c.res = nil res.Hijack() return conn } func (c *Conn) Exec(ctx context.Context, sql string, arguments ...any) (pgconn.CommandTag, error) { return c.Conn().Exec(ctx, sql, arguments...) } func (c *Conn) Query(ctx context.Context, sql string, args ...any) (pgx.Rows, error) { return c.Conn().Query(ctx, sql, args...) } func (c *Conn) QueryRow(ctx context.Context, sql string, args ...any) pgx.Row { return c.Conn().QueryRow(ctx, sql, args...) } func (c *Conn) SendBatch(ctx context.Context, b *pgx.Batch) pgx.BatchResults { return c.Conn().SendBatch(ctx, b) } func (c *Conn) CopyFrom(ctx context.Context, tableName pgx.Identifier, columnNames []string, rowSrc pgx.CopyFromSource) (int64, error) { return c.Conn().CopyFrom(ctx, tableName, columnNames, rowSrc) } // Begin starts a transaction block from the *Conn without explicitly setting a transaction mode (see BeginTx with TxOptions if transaction mode is required). func (c *Conn) Begin(ctx context.Context) (pgx.Tx, error) { return c.Conn().Begin(ctx) } // BeginTx starts a transaction block from the *Conn with txOptions determining the transaction mode. func (c *Conn) BeginTx(ctx context.Context, txOptions pgx.TxOptions) (pgx.Tx, error) { return c.Conn().BeginTx(ctx, txOptions) } func (c *Conn) Ping(ctx context.Context) error { return c.Conn().Ping(ctx) } func (c *Conn) Conn() *pgx.Conn { return c.connResource().conn } func (c *Conn) connResource() *connResource { return c.res.Value() } func (c *Conn) getPoolRow(r pgx.Row) *poolRow { return c.connResource().getPoolRow(c, r) } func (c *Conn) getPoolRows(r pgx.Rows) *poolRows { return c.connResource().getPoolRows(c, r) } pgx-5.8.0/pgxpool/conn_test.go000066400000000000000000000035701512357711200163460ustar00rootroot00000000000000package pgxpool_test import ( "context" "os" "testing" "time" "github.com/jackc/pgx/v5/pgxpool" "github.com/stretchr/testify/require" ) func TestConnExec(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() c, err := pool.Acquire(ctx) require.NoError(t, err) defer c.Release() testExec(t, ctx, c) } func TestConnQuery(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() c, err := pool.Acquire(ctx) require.NoError(t, err) defer c.Release() testQuery(t, ctx, c) } func TestConnQueryRow(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() c, err := pool.Acquire(ctx) require.NoError(t, err) defer c.Release() testQueryRow(t, ctx, c) } func TestConnSendBatch(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() c, err := pool.Acquire(ctx) require.NoError(t, err) defer c.Release() testSendBatch(t, ctx, c) } func TestConnCopyFrom(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() c, err := pool.Acquire(ctx) require.NoError(t, err) defer c.Release() testCopyFrom(t, ctx, c) } pgx-5.8.0/pgxpool/doc.go000066400000000000000000000017701512357711200151170ustar00rootroot00000000000000// Package pgxpool is a concurrency-safe connection pool for pgx. /* pgxpool implements a nearly identical interface to pgx connections. Creating a Pool The primary way of creating a pool is with [pgxpool.New]: pool, err := pgxpool.New(context.Background(), os.Getenv("DATABASE_URL")) The database connection string can be in URL or keyword/value format. PostgreSQL settings, pgx settings, and pool settings can be specified here. In addition, a config struct can be created by [ParseConfig]. config, err := pgxpool.ParseConfig(os.Getenv("DATABASE_URL")) if err != nil { // ... } config.AfterConnect = func(ctx context.Context, conn *pgx.Conn) error { // do something with every new connection } pool, err := pgxpool.NewWithConfig(context.Background(), config) A pool returns without waiting for any connections to be established. Acquire a connection immediately after creating the pool to check if a connection can successfully be established. */ package pgxpool pgx-5.8.0/pgxpool/helper_test.go000066400000000000000000000014051512357711200166630ustar00rootroot00000000000000package pgxpool_test import ( "context" "net" "time" "github.com/jackc/pgx/v5/pgconn" ) // delayProxy is a that introduces a configurable delay on reads from the database connection. type delayProxy struct { net.Conn readDelay time.Duration } func newDelayProxy(conn net.Conn, readDelay time.Duration) *delayProxy { p := &delayProxy{ Conn: conn, readDelay: readDelay, } return p } func (dp *delayProxy) Read(b []byte) (int, error) { if dp.readDelay > 0 { time.Sleep(dp.readDelay) } return dp.Conn.Read(b) } func newDelayProxyDialFunc(readDelay time.Duration) pgconn.DialFunc { return func(ctx context.Context, network, addr string) (net.Conn, error) { conn, err := net.Dial(network, addr) return newDelayProxy(conn, readDelay), err } } pgx-5.8.0/pgxpool/pool.go000066400000000000000000000654201512357711200153250ustar00rootroot00000000000000package pgxpool import ( "context" "errors" "math/rand/v2" "runtime" "strconv" "sync" "sync/atomic" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/puddle/v2" ) var ( defaultMaxConns = int32(4) defaultMinConns = int32(0) defaultMinIdleConns = int32(0) defaultMaxConnLifetime = time.Hour defaultMaxConnIdleTime = time.Minute * 30 defaultHealthCheckPeriod = time.Minute ) type connResource struct { conn *pgx.Conn conns []Conn poolRows []poolRow poolRowss []poolRows maxAgeTime time.Time } func (cr *connResource) getConn(p *Pool, res *puddle.Resource[*connResource]) *Conn { if len(cr.conns) == 0 { cr.conns = make([]Conn, 128) } c := &cr.conns[len(cr.conns)-1] cr.conns = cr.conns[0 : len(cr.conns)-1] c.res = res c.p = p return c } func (cr *connResource) getPoolRow(c *Conn, r pgx.Row) *poolRow { if len(cr.poolRows) == 0 { cr.poolRows = make([]poolRow, 128) } pr := &cr.poolRows[len(cr.poolRows)-1] cr.poolRows = cr.poolRows[0 : len(cr.poolRows)-1] pr.c = c pr.r = r return pr } func (cr *connResource) getPoolRows(c *Conn, r pgx.Rows) *poolRows { if len(cr.poolRowss) == 0 { cr.poolRowss = make([]poolRows, 128) } pr := &cr.poolRowss[len(cr.poolRowss)-1] cr.poolRowss = cr.poolRowss[0 : len(cr.poolRowss)-1] pr.c = c pr.r = r return pr } // Pool allows for connection reuse. type Pool struct { // 64 bit fields accessed with atomics must be at beginning of struct to guarantee alignment for certain 32-bit // architectures. See BUGS section of https://pkg.go.dev/sync/atomic and https://github.com/jackc/pgx/issues/1288. newConnsCount int64 lifetimeDestroyCount int64 idleDestroyCount int64 p *puddle.Pool[*connResource] config *Config beforeConnect func(context.Context, *pgx.ConnConfig) error afterConnect func(context.Context, *pgx.Conn) error prepareConn func(context.Context, *pgx.Conn) (bool, error) afterRelease func(*pgx.Conn) bool beforeClose func(*pgx.Conn) shouldPing func(context.Context, ShouldPingParams) bool minConns int32 minIdleConns int32 maxConns int32 maxConnLifetime time.Duration maxConnLifetimeJitter time.Duration maxConnIdleTime time.Duration healthCheckPeriod time.Duration pingTimeout time.Duration healthCheckMu sync.Mutex healthCheckTimer *time.Timer healthCheckChan chan struct{} acquireTracer AcquireTracer releaseTracer ReleaseTracer closeOnce sync.Once closeChan chan struct{} } // ShouldPingParams are the parameters passed to ShouldPing. type ShouldPingParams struct { Conn *pgx.Conn IdleDuration time.Duration } // Config is the configuration struct for creating a pool. It must be created by [ParseConfig] and then it can be // modified. type Config struct { ConnConfig *pgx.ConnConfig // BeforeConnect is called before a new connection is made. It is passed a copy of the underlying pgx.ConnConfig and // will not impact any existing open connections. BeforeConnect func(context.Context, *pgx.ConnConfig) error // AfterConnect is called after a connection is established, but before it is added to the pool. AfterConnect func(context.Context, *pgx.Conn) error // BeforeAcquire is called before a connection is acquired from the pool. It must return true to allow the // acquisition or false to indicate that the connection should be destroyed and a different connection should be // acquired. // // Deprecated: Use PrepareConn instead. If both PrepareConn and BeforeAcquire are set, PrepareConn will take // precedence, ignoring BeforeAcquire. BeforeAcquire func(context.Context, *pgx.Conn) bool // PrepareConn is called before a connection is acquired from the pool. If this function returns true, the connection // is considered valid, otherwise the connection is destroyed. If the function returns a non-nil error, the instigating // query will fail with the returned error. // // Specifically, this means that: // // - If it returns true and a nil error, the query proceeds as normal. // - If it returns true and an error, the connection will be returned to the pool, and the instigating query will fail with the returned error. // - If it returns false, and an error, the connection will be destroyed, and the query will fail with the returned error. // - If it returns false and a nil error, the connection will be destroyed, and the instigating query will be retried on a new connection. PrepareConn func(context.Context, *pgx.Conn) (bool, error) // AfterRelease is called after a connection is released, but before it is returned to the pool. It must return true to // return the connection to the pool or false to destroy the connection. AfterRelease func(*pgx.Conn) bool // BeforeClose is called right before a connection is closed and removed from the pool. BeforeClose func(*pgx.Conn) // ShouldPing is called after a connection is acquired from the pool. If it returns true, the connection is pinged to check for liveness. // If this func is not set, the default behavior is to ping connections that have been idle for at least 1 second. ShouldPing func(context.Context, ShouldPingParams) bool // MaxConnLifetime is the duration since creation after which a connection will be automatically closed. MaxConnLifetime time.Duration // MaxConnLifetimeJitter is the duration after MaxConnLifetime to randomly decide to close a connection. // This helps prevent all connections from being closed at the exact same time, starving the pool. MaxConnLifetimeJitter time.Duration // MaxConnIdleTime is the duration after which an idle connection will be automatically closed by the health check. MaxConnIdleTime time.Duration // PingTimeout is the maximum amount of time to wait for a connection to pong before considering it as unhealthy and // destroying it. If zero, the default is no timeout. PingTimeout time.Duration // MaxConns is the maximum size of the pool. The default is the greater of 4 or runtime.NumCPU(). MaxConns int32 // MinConns is the minimum size of the pool. After connection closes, the pool might dip below MinConns. A low // number of MinConns might mean the pool is empty after MaxConnLifetime until the health check has a chance // to create new connections. MinConns int32 // MinIdleConns is the minimum number of idle connections in the pool. You can increase this to ensure that // there are always idle connections available. This can help reduce tail latencies during request processing, // as you can avoid the latency of establishing a new connection while handling requests. It is superior // to MinConns for this purpose. // Similar to MinConns, the pool might temporarily dip below MinIdleConns after connection closes. MinIdleConns int32 // HealthCheckPeriod is the duration between checks of the health of idle connections. HealthCheckPeriod time.Duration createdByParseConfig bool // Used to enforce created by ParseConfig rule. } // Copy returns a deep copy of the config that is safe to use and modify. // The only exception is the tls.Config: // according to the tls.Config docs it must not be modified after creation. func (c *Config) Copy() *Config { newConfig := new(Config) *newConfig = *c newConfig.ConnConfig = c.ConnConfig.Copy() return newConfig } // ConnString returns the connection string as parsed by pgxpool.ParseConfig into pgxpool.Config. func (c *Config) ConnString() string { return c.ConnConfig.ConnString() } // New creates a new Pool. See [ParseConfig] for information on connString format. func New(ctx context.Context, connString string) (*Pool, error) { config, err := ParseConfig(connString) if err != nil { return nil, err } return NewWithConfig(ctx, config) } // NewWithConfig creates a new Pool. config must have been created by [ParseConfig]. func NewWithConfig(ctx context.Context, config *Config) (*Pool, error) { // Default values are set in ParseConfig. Enforce initial creation by ParseConfig rather than setting defaults from // zero values. if !config.createdByParseConfig { panic("config must be created by ParseConfig") } prepareConn := config.PrepareConn if prepareConn == nil && config.BeforeAcquire != nil { prepareConn = func(ctx context.Context, conn *pgx.Conn) (bool, error) { return config.BeforeAcquire(ctx, conn), nil } } p := &Pool{ config: config, beforeConnect: config.BeforeConnect, afterConnect: config.AfterConnect, prepareConn: prepareConn, afterRelease: config.AfterRelease, beforeClose: config.BeforeClose, minConns: config.MinConns, minIdleConns: config.MinIdleConns, maxConns: config.MaxConns, maxConnLifetime: config.MaxConnLifetime, maxConnLifetimeJitter: config.MaxConnLifetimeJitter, maxConnIdleTime: config.MaxConnIdleTime, pingTimeout: config.PingTimeout, healthCheckPeriod: config.HealthCheckPeriod, healthCheckChan: make(chan struct{}, 1), closeChan: make(chan struct{}), } if t, ok := config.ConnConfig.Tracer.(AcquireTracer); ok { p.acquireTracer = t } if t, ok := config.ConnConfig.Tracer.(ReleaseTracer); ok { p.releaseTracer = t } if config.ShouldPing != nil { p.shouldPing = config.ShouldPing } else { p.shouldPing = func(ctx context.Context, params ShouldPingParams) bool { return params.IdleDuration > time.Second } } var err error p.p, err = puddle.NewPool( &puddle.Config[*connResource]{ Constructor: func(ctx context.Context) (*connResource, error) { atomic.AddInt64(&p.newConnsCount, 1) connConfig := p.config.ConnConfig.Copy() // Connection will continue in background even if Acquire is canceled. Ensure that a connect won't hang forever. if connConfig.ConnectTimeout <= 0 { connConfig.ConnectTimeout = 2 * time.Minute } if p.beforeConnect != nil { if err := p.beforeConnect(ctx, connConfig); err != nil { return nil, err } } conn, err := pgx.ConnectConfig(ctx, connConfig) if err != nil { return nil, err } if p.afterConnect != nil { err = p.afterConnect(ctx, conn) if err != nil { conn.Close(ctx) return nil, err } } jitterSecs := rand.Float64() * config.MaxConnLifetimeJitter.Seconds() maxAgeTime := time.Now().Add(config.MaxConnLifetime).Add(time.Duration(jitterSecs) * time.Second) cr := &connResource{ conn: conn, conns: make([]Conn, 64), poolRows: make([]poolRow, 64), poolRowss: make([]poolRows, 64), maxAgeTime: maxAgeTime, } return cr, nil }, Destructor: func(value *connResource) { ctx, cancel := context.WithTimeout(context.Background(), 15*time.Second) conn := value.conn if p.beforeClose != nil { p.beforeClose(conn) } conn.Close(ctx) select { case <-conn.PgConn().CleanupDone(): case <-ctx.Done(): } cancel() }, MaxSize: config.MaxConns, }, ) if err != nil { return nil, err } go func() { targetIdleResources := max(int(p.minConns), int(p.minIdleConns)) p.createIdleResources(ctx, targetIdleResources) p.backgroundHealthCheck() }() return p, nil } // ParseConfig builds a Config from connString. It parses connString with the same behavior as [pgx.ParseConfig] with the // addition of the following variables: // // - pool_max_conns: integer greater than 0 (default 4) // - pool_min_conns: integer 0 or greater (default 0) // - pool_max_conn_lifetime: duration string (default 1 hour) // - pool_max_conn_idle_time: duration string (default 30 minutes) // - pool_health_check_period: duration string (default 1 minute) // - pool_max_conn_lifetime_jitter: duration string (default 0) // // See Config for definitions of these arguments. // // # Example Keyword/Value // user=jack password=secret host=pg.example.com port=5432 dbname=mydb sslmode=verify-ca pool_max_conns=10 pool_max_conn_lifetime=1h30m // // # Example URL // postgres://jack:secret@pg.example.com:5432/mydb?sslmode=verify-ca&pool_max_conns=10&pool_max_conn_lifetime=1h30m func ParseConfig(connString string) (*Config, error) { connConfig, err := pgx.ParseConfig(connString) if err != nil { return nil, err } config := &Config{ ConnConfig: connConfig, createdByParseConfig: true, } if s, ok := config.ConnConfig.Config.RuntimeParams["pool_max_conns"]; ok { delete(connConfig.Config.RuntimeParams, "pool_max_conns") n, err := strconv.ParseInt(s, 10, 32) if err != nil { return nil, pgconn.NewParseConfigError(connString, "cannot parse pool_max_conns", err) } if n < 1 { return nil, pgconn.NewParseConfigError(connString, "pool_max_conns too small", err) } config.MaxConns = int32(n) } else { config.MaxConns = defaultMaxConns if numCPU := int32(runtime.NumCPU()); numCPU > config.MaxConns { config.MaxConns = numCPU } } if s, ok := config.ConnConfig.Config.RuntimeParams["pool_min_conns"]; ok { delete(connConfig.Config.RuntimeParams, "pool_min_conns") n, err := strconv.ParseInt(s, 10, 32) if err != nil { return nil, pgconn.NewParseConfigError(connString, "cannot parse pool_min_conns", err) } config.MinConns = int32(n) } else { config.MinConns = defaultMinConns } if s, ok := config.ConnConfig.Config.RuntimeParams["pool_min_idle_conns"]; ok { delete(connConfig.Config.RuntimeParams, "pool_min_idle_conns") n, err := strconv.ParseInt(s, 10, 32) if err != nil { return nil, pgconn.NewParseConfigError(connString, "cannot parse pool_min_idle_conns", err) } config.MinIdleConns = int32(n) } else { config.MinIdleConns = defaultMinIdleConns } if s, ok := config.ConnConfig.Config.RuntimeParams["pool_max_conn_lifetime"]; ok { delete(connConfig.Config.RuntimeParams, "pool_max_conn_lifetime") d, err := time.ParseDuration(s) if err != nil { return nil, pgconn.NewParseConfigError(connString, "cannot parse pool_max_conn_lifetime", err) } config.MaxConnLifetime = d } else { config.MaxConnLifetime = defaultMaxConnLifetime } if s, ok := config.ConnConfig.Config.RuntimeParams["pool_max_conn_idle_time"]; ok { delete(connConfig.Config.RuntimeParams, "pool_max_conn_idle_time") d, err := time.ParseDuration(s) if err != nil { return nil, pgconn.NewParseConfigError(connString, "cannot parse pool_max_conn_idle_time", err) } config.MaxConnIdleTime = d } else { config.MaxConnIdleTime = defaultMaxConnIdleTime } if s, ok := config.ConnConfig.Config.RuntimeParams["pool_health_check_period"]; ok { delete(connConfig.Config.RuntimeParams, "pool_health_check_period") d, err := time.ParseDuration(s) if err != nil { return nil, pgconn.NewParseConfigError(connString, "cannot parse pool_health_check_period", err) } config.HealthCheckPeriod = d } else { config.HealthCheckPeriod = defaultHealthCheckPeriod } if s, ok := config.ConnConfig.Config.RuntimeParams["pool_max_conn_lifetime_jitter"]; ok { delete(connConfig.Config.RuntimeParams, "pool_max_conn_lifetime_jitter") d, err := time.ParseDuration(s) if err != nil { return nil, pgconn.NewParseConfigError(connString, "cannot parse pool_max_conn_lifetime_jitter", err) } config.MaxConnLifetimeJitter = d } return config, nil } // Close closes all connections in the pool and rejects future Acquire calls. Blocks until all connections are returned // to pool and closed. func (p *Pool) Close() { p.closeOnce.Do(func() { close(p.closeChan) p.p.Close() }) } func (p *Pool) isExpired(res *puddle.Resource[*connResource]) bool { return time.Now().After(res.Value().maxAgeTime) } func (p *Pool) triggerHealthCheck() { const healthCheckDelay = 500 * time.Millisecond p.healthCheckMu.Lock() defer p.healthCheckMu.Unlock() if p.healthCheckTimer == nil { // Destroy is asynchronous so we give it time to actually remove itself from // the pool otherwise we might try to check the pool size too soon p.healthCheckTimer = time.AfterFunc(healthCheckDelay, func() { select { case <-p.closeChan: case p.healthCheckChan <- struct{}{}: default: } }) return } p.healthCheckTimer.Reset(healthCheckDelay) } func (p *Pool) backgroundHealthCheck() { ticker := time.NewTicker(p.healthCheckPeriod) defer ticker.Stop() for { select { case <-p.closeChan: return case <-p.healthCheckChan: p.checkHealth() case <-ticker.C: p.checkHealth() } } } func (p *Pool) checkHealth() { for { // If checkMinConns failed we don't destroy any connections since we couldn't // even get to minConns if err := p.checkMinConns(); err != nil { // Should we log this error somewhere? break } if !p.checkConnsHealth() { // Since we didn't destroy any connections we can stop looping break } // Technically Destroy is asynchronous but 500ms should be enough for it to // remove it from the underlying pool select { case <-p.closeChan: return case <-time.After(500 * time.Millisecond): } } } // checkConnsHealth will check all idle connections, destroy a connection if // it's idle or too old, and returns true if any were destroyed func (p *Pool) checkConnsHealth() bool { var destroyed bool totalConns := p.Stat().TotalConns() resources := p.p.AcquireAllIdle() for _, res := range resources { // We're okay going under minConns if the lifetime is up if p.isExpired(res) && totalConns >= p.minConns { atomic.AddInt64(&p.lifetimeDestroyCount, 1) res.Destroy() destroyed = true // Since Destroy is async we manually decrement totalConns. totalConns-- } else if res.IdleDuration() > p.maxConnIdleTime && totalConns > p.minConns { atomic.AddInt64(&p.idleDestroyCount, 1) res.Destroy() destroyed = true // Since Destroy is async we manually decrement totalConns. totalConns-- } else { res.ReleaseUnused() } } return destroyed } func (p *Pool) checkMinConns() error { // TotalConns can include ones that are being destroyed but we should have // sleep(500ms) around all of the destroys to help prevent that from throwing // off this check // Create the number of connections needed to get to both minConns and minIdleConns toCreate := max(p.minConns-p.Stat().TotalConns(), p.minIdleConns-p.Stat().IdleConns()) if toCreate > 0 { return p.createIdleResources(context.Background(), int(toCreate)) } return nil } func (p *Pool) createIdleResources(parentCtx context.Context, targetResources int) error { ctx, cancel := context.WithCancel(parentCtx) defer cancel() errs := make(chan error, targetResources) for range targetResources { go func() { err := p.p.CreateResource(ctx) // Ignore ErrNotAvailable since it means that the pool has become full since we started creating resource. if err == puddle.ErrNotAvailable { err = nil } errs <- err }() } var firstError error for range targetResources { err := <-errs if err != nil && firstError == nil { cancel() firstError = err } } return firstError } // Acquire returns a connection (*Conn) from the Pool func (p *Pool) Acquire(ctx context.Context) (c *Conn, err error) { if p.acquireTracer != nil { ctx = p.acquireTracer.TraceAcquireStart(ctx, p, TraceAcquireStartData{}) defer func() { var conn *pgx.Conn if c != nil { conn = c.Conn() } p.acquireTracer.TraceAcquireEnd(ctx, p, TraceAcquireEndData{Conn: conn, Err: err}) }() } // Try to acquire from the connection pool up to maxConns + 1 times, so that // any that fatal errors would empty the pool and still at least try 1 fresh // connection. for range int(p.maxConns) + 1 { res, err := p.p.Acquire(ctx) if err != nil { return nil, err } cr := res.Value() shouldPingParams := ShouldPingParams{Conn: cr.conn, IdleDuration: res.IdleDuration()} if p.shouldPing(ctx, shouldPingParams) { pingCtx := ctx if p.pingTimeout > 0 { var cancel context.CancelFunc pingCtx, cancel = context.WithTimeout(ctx, p.pingTimeout) defer cancel() } err := cr.conn.Ping(pingCtx) if err != nil { res.Destroy() continue } } if p.prepareConn != nil { ok, err := p.prepareConn(ctx, cr.conn) if !ok { res.Destroy() } if err != nil { if ok { res.Release() } return nil, err } if !ok { continue } } return cr.getConn(p, res), nil } return nil, errors.New("pgxpool: detected infinite loop acquiring connection; likely bug in PrepareConn or BeforeAcquire hook") } // AcquireFunc acquires a *Conn and calls f with that *Conn. ctx will only affect the Acquire. It has no effect on the // call of f. The return value is either an error acquiring the *Conn or the return value of f. The *Conn is // automatically released after the call of f. func (p *Pool) AcquireFunc(ctx context.Context, f func(*Conn) error) error { conn, err := p.Acquire(ctx) if err != nil { return err } defer conn.Release() return f(conn) } // AcquireAllIdle atomically acquires all currently idle connections. Its intended use is for health check and // keep-alive functionality. It does not update pool statistics. func (p *Pool) AcquireAllIdle(ctx context.Context) []*Conn { resources := p.p.AcquireAllIdle() conns := make([]*Conn, 0, len(resources)) for _, res := range resources { cr := res.Value() if p.prepareConn != nil { ok, err := p.prepareConn(ctx, cr.conn) if !ok || err != nil { res.Destroy() continue } } conns = append(conns, cr.getConn(p, res)) } return conns } // Reset closes all connections, but leaves the pool open. It is intended for use when an error is detected that would // disrupt all connections (such as a network interruption or a server state change). // // It is safe to reset a pool while connections are checked out. Those connections will be closed when they are returned // to the pool. func (p *Pool) Reset() { p.p.Reset() } // Config returns a copy of config that was used to initialize this pool. func (p *Pool) Config() *Config { return p.config.Copy() } // Stat returns a pgxpool.Stat struct with a snapshot of Pool statistics. func (p *Pool) Stat() *Stat { return &Stat{ s: p.p.Stat(), newConnsCount: atomic.LoadInt64(&p.newConnsCount), lifetimeDestroyCount: atomic.LoadInt64(&p.lifetimeDestroyCount), idleDestroyCount: atomic.LoadInt64(&p.idleDestroyCount), } } // Exec acquires a connection from the Pool and executes the given SQL. // SQL can be either a prepared statement name or an SQL string. // Arguments should be referenced positionally from the SQL string as $1, $2, etc. // The acquired connection is returned to the pool when the Exec function returns. func (p *Pool) Exec(ctx context.Context, sql string, arguments ...any) (pgconn.CommandTag, error) { c, err := p.Acquire(ctx) if err != nil { return pgconn.CommandTag{}, err } defer c.Release() return c.Exec(ctx, sql, arguments...) } // Query acquires a connection and executes a query that returns pgx.Rows. // Arguments should be referenced positionally from the SQL string as $1, $2, etc. // See pgx.Rows documentation to close the returned Rows and return the acquired connection to the Pool. // // If there is an error, the returned pgx.Rows will be returned in an error state. // If preferred, ignore the error returned from Query and handle errors using the returned pgx.Rows. // // For extra control over how the query is executed, the types QuerySimpleProtocol, QueryResultFormats, and // QueryResultFormatsByOID may be used as the first args to control exactly how the query is executed. This is rarely // needed. See the documentation for those types for details. func (p *Pool) Query(ctx context.Context, sql string, args ...any) (pgx.Rows, error) { c, err := p.Acquire(ctx) if err != nil { return errRows{err: err}, err } rows, err := c.Query(ctx, sql, args...) if err != nil { c.Release() return errRows{err: err}, err } return c.getPoolRows(rows), nil } // QueryRow acquires a connection and executes a query that is expected // to return at most one row (pgx.Row). Errors are deferred until pgx.Row's // Scan method is called. If the query selects no rows, pgx.Row's Scan will // return ErrNoRows. Otherwise, pgx.Row's Scan scans the first selected row // and discards the rest. The acquired connection is returned to the Pool when // pgx.Row's Scan method is called. // // Arguments should be referenced positionally from the SQL string as $1, $2, etc. // // For extra control over how the query is executed, the types QuerySimpleProtocol, QueryResultFormats, and // QueryResultFormatsByOID may be used as the first args to control exactly how the query is executed. This is rarely // needed. See the documentation for those types for details. func (p *Pool) QueryRow(ctx context.Context, sql string, args ...any) pgx.Row { c, err := p.Acquire(ctx) if err != nil { return errRow{err: err} } row := c.QueryRow(ctx, sql, args...) return c.getPoolRow(row) } func (p *Pool) SendBatch(ctx context.Context, b *pgx.Batch) pgx.BatchResults { c, err := p.Acquire(ctx) if err != nil { return errBatchResults{err: err} } br := c.SendBatch(ctx, b) return &poolBatchResults{br: br, c: c} } // Begin acquires a connection from the Pool and starts a transaction. Unlike database/sql, the context only affects the begin command. i.e. there is no // auto-rollback on context cancellation. Begin initiates a transaction block without explicitly setting a transaction mode for the block (see BeginTx with TxOptions if transaction mode is required). // *pgxpool.Tx is returned, which implements the pgx.Tx interface. // Commit or Rollback must be called on the returned transaction to finalize the transaction block. func (p *Pool) Begin(ctx context.Context) (pgx.Tx, error) { return p.BeginTx(ctx, pgx.TxOptions{}) } // BeginTx acquires a connection from the Pool and starts a transaction with pgx.TxOptions determining the transaction mode. // Unlike database/sql, the context only affects the begin command. i.e. there is no auto-rollback on context cancellation. // *pgxpool.Tx is returned, which implements the pgx.Tx interface. // Commit or Rollback must be called on the returned transaction to finalize the transaction block. func (p *Pool) BeginTx(ctx context.Context, txOptions pgx.TxOptions) (pgx.Tx, error) { c, err := p.Acquire(ctx) if err != nil { return nil, err } t, err := c.BeginTx(ctx, txOptions) if err != nil { c.Release() return nil, err } return &Tx{t: t, c: c}, nil } func (p *Pool) CopyFrom(ctx context.Context, tableName pgx.Identifier, columnNames []string, rowSrc pgx.CopyFromSource) (int64, error) { c, err := p.Acquire(ctx) if err != nil { return 0, err } defer c.Release() return c.Conn().CopyFrom(ctx, tableName, columnNames, rowSrc) } // Ping acquires a connection from the Pool and executes an empty sql statement against it. // If the sql returns without error, the database Ping is considered successful, otherwise, the error is returned. func (p *Pool) Ping(ctx context.Context) error { c, err := p.Acquire(ctx) if err != nil { return err } defer c.Release() return c.Ping(ctx) } pgx-5.8.0/pgxpool/pool_test.go000066400000000000000000001005541512357711200163620ustar00rootroot00000000000000package pgxpool_test import ( "context" "errors" "fmt" "math" "os" "sync/atomic" "testing" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgxpool" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func TestConnect(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() connString := os.Getenv("PGX_TEST_DATABASE") pool, err := pgxpool.New(ctx, connString) require.NoError(t, err) assert.Equal(t, connString, pool.Config().ConnString()) pool.Close() } func TestConnectConfig(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() connString := os.Getenv("PGX_TEST_DATABASE") config, err := pgxpool.ParseConfig(connString) require.NoError(t, err) pool, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) assertConfigsEqual(t, config, pool.Config(), "Pool.Config() returns original config") pool.Close() } func TestParseConfigExtractsPoolArguments(t *testing.T) { t.Parallel() config, err := pgxpool.ParseConfig("pool_max_conns=42 pool_min_conns=1 pool_min_idle_conns=2") assert.NoError(t, err) assert.EqualValues(t, 42, config.MaxConns) assert.EqualValues(t, 1, config.MinConns) assert.EqualValues(t, 2, config.MinIdleConns) assert.NotContains(t, config.ConnConfig.Config.RuntimeParams, "pool_max_conns") assert.NotContains(t, config.ConnConfig.Config.RuntimeParams, "pool_min_conns") } func TestConstructorIgnoresContext(t *testing.T) { t.Parallel() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) assert.NoError(t, err) var cancel func() config.BeforeConnect = func(context.Context, *pgx.ConnConfig) error { // cancel the query's context before we actually Dial to ensure the Dial's // context isn't cancelled cancel() return nil } pool, err := pgxpool.NewWithConfig(context.Background(), config) require.NoError(t, err) assert.EqualValues(t, 0, pool.Stat().TotalConns()) var ctx context.Context ctx, cancel = context.WithCancel(context.Background()) defer cancel() _, err = pool.Exec(ctx, "SELECT 1") assert.ErrorIs(t, err, context.Canceled) assert.EqualValues(t, 1, pool.Stat().TotalConns()) } func TestConnectConfigRequiresConnConfigFromParseConfig(t *testing.T) { t.Parallel() config := &pgxpool.Config{} require.PanicsWithValue(t, "config must be created by ParseConfig", func() { pgxpool.NewWithConfig(context.Background(), config) }) } func TestConfigCopyReturnsEqualConfig(t *testing.T) { connString := "postgres://jack:secret@localhost:5432/mydb?application_name=pgxtest&search_path=myschema&connect_timeout=5" original, err := pgxpool.ParseConfig(connString) require.NoError(t, err) copied := original.Copy() assertConfigsEqual(t, original, copied, t.Name()) } func TestConfigCopyCanBeUsedToConnect(t *testing.T) { connString := os.Getenv("PGX_TEST_DATABASE") original, err := pgxpool.ParseConfig(connString) require.NoError(t, err) copied := original.Copy() assert.NotPanics(t, func() { _, err = pgxpool.NewWithConfig(context.Background(), copied) }) assert.NoError(t, err) } func TestPoolAcquireAndConnRelease(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() c, err := pool.Acquire(ctx) require.NoError(t, err) c.Release() } func TestPoolAcquireAndConnHijack(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() c, err := pool.Acquire(ctx) require.NoError(t, err) connsBeforeHijack := pool.Stat().TotalConns() conn := c.Hijack() defer conn.Close(ctx) connsAfterHijack := pool.Stat().TotalConns() require.Equal(t, connsBeforeHijack-1, connsAfterHijack) var n int32 err = conn.QueryRow(ctx, `select 1`).Scan(&n) require.NoError(t, err) require.Equal(t, int32(1), n) } func TestPoolAcquireChecksIdleConns(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() controllerConn, err := pgx.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer controllerConn.Close(ctx) pgxtest.SkipCockroachDB(t, controllerConn, "Server does not support pg_terminate_backend() (https://github.com/cockroachdb/cockroach/issues/35897)") pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() var conns []*pgxpool.Conn for range 3 { c, err := pool.Acquire(ctx) require.NoError(t, err) conns = append(conns, c) } require.EqualValues(t, 3, pool.Stat().TotalConns()) var pids []uint32 for _, c := range conns { pids = append(pids, c.Conn().PgConn().PID()) c.Release() } _, err = controllerConn.Exec(ctx, `select pg_terminate_backend(n) from unnest($1::int[]) n`, pids) require.NoError(t, err) // All conns are dead they don't know it and neither does the pool. require.EqualValues(t, 3, pool.Stat().TotalConns()) // Wait long enough so the pool will realize it needs to check the connections. time.Sleep(time.Second) // Pool should try all existing connections and find them dead, then create a new connection which should successfully ping. err = pool.Ping(ctx) require.NoError(t, err) // The original 3 conns should have been terminated and the a new conn established for the ping. require.EqualValues(t, 1, pool.Stat().TotalConns()) c, err := pool.Acquire(ctx) require.NoError(t, err) cPID := c.Conn().PgConn().PID() c.Release() require.NotContains(t, pids, cPID) } func TestPoolAcquireChecksIdleConnsWithShouldPing(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() controllerConn, err := pgx.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer controllerConn.Close(ctx) config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) // Replace the default ShouldPing func var shouldPingLastCalledWith *pgxpool.ShouldPingParams config.ShouldPing = func(ctx context.Context, params pgxpool.ShouldPingParams) bool { shouldPingLastCalledWith = ¶ms return false } pool, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer pool.Close() c, err := pool.Acquire(ctx) require.NoError(t, err) c.Release() time.Sleep(time.Millisecond * 200) c, err = pool.Acquire(ctx) require.NoError(t, err) conn := c.Conn() require.NotNil(t, shouldPingLastCalledWith) assert.Equal(t, conn, shouldPingLastCalledWith.Conn) assert.InDelta(t, time.Millisecond*200, shouldPingLastCalledWith.IdleDuration, float64(time.Millisecond*100)) c.Release() } // https://github.com/jackc/pgx/issues/2379 func TestPoolAcquireWithMaxConnsEqualsMaxInt32(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.MaxConns = math.MaxInt32 pool, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer pool.Close() c, err := pool.Acquire(ctx) require.NoError(t, err) c.Release() } func TestPoolAcquireFunc(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() var n int32 err = pool.AcquireFunc(ctx, func(c *pgxpool.Conn) error { return c.QueryRow(ctx, "select 1").Scan(&n) }) require.NoError(t, err) require.EqualValues(t, 1, n) } func TestPoolAcquireFuncReturnsFnError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() err = pool.AcquireFunc(ctx, func(c *pgxpool.Conn) error { return fmt.Errorf("some error") }) require.EqualError(t, err, "some error") } func TestPoolBeforeConnect(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.BeforeConnect = func(ctx context.Context, cfg *pgx.ConnConfig) error { cfg.Config.RuntimeParams["application_name"] = "pgx" return nil } db, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer db.Close() var str string err = db.QueryRow(ctx, "SHOW application_name").Scan(&str) require.NoError(t, err) assert.EqualValues(t, "pgx", str) } func TestPoolAfterConnect(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.AfterConnect = func(ctx context.Context, c *pgx.Conn) error { _, err := c.Prepare(ctx, "ps1", "select 1") return err } db, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer db.Close() var n int32 err = db.QueryRow(ctx, "ps1").Scan(&n) require.NoError(t, err) assert.EqualValues(t, 1, n) } func TestPoolBeforeAcquire(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) acquireAttempts := 0 config.BeforeAcquire = func(ctx context.Context, c *pgx.Conn) bool { acquireAttempts++ return acquireAttempts%2 == 0 } db, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer db.Close() conns := make([]*pgxpool.Conn, 4) for i := range conns { conns[i], err = db.Acquire(ctx) assert.NoError(t, err) } for _, c := range conns { c.Release() } waitForReleaseToComplete() assert.EqualValues(t, 8, acquireAttempts) conns = db.AcquireAllIdle(ctx) assert.Len(t, conns, 2) for _, c := range conns { c.Release() } waitForReleaseToComplete() assert.EqualValues(t, 12, acquireAttempts) } func TestPoolPrepareConn(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) acquireAttempts := 0 config.PrepareConn = func(context.Context, *pgx.Conn) (bool, error) { acquireAttempts++ var err error if acquireAttempts%3 == 0 { err = errors.New("PrepareConn error") } return acquireAttempts%2 == 0, err } db, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) t.Cleanup(db.Close) var errorCount int conns := make([]*pgxpool.Conn, 0, 4) for { conn, err := db.Acquire(ctx) if err != nil { errorCount++ continue } conns = append(conns, conn) if len(conns) == 4 { break } } const wantErrorCount = 3 assert.Equal(t, wantErrorCount, errorCount, "Acquire() should have failed %d times", wantErrorCount) for _, c := range conns { c.Release() } waitForReleaseToComplete() assert.EqualValues(t, len(conns)*2+wantErrorCount-1, acquireAttempts) conns = db.AcquireAllIdle(ctx) assert.Len(t, conns, 1) for _, c := range conns { c.Release() } waitForReleaseToComplete() assert.EqualValues(t, 14, acquireAttempts) } func TestPoolAfterRelease(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() func() { pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() }() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) afterReleaseCount := 0 config.AfterRelease = func(c *pgx.Conn) bool { afterReleaseCount++ return afterReleaseCount%2 == 1 } db, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer db.Close() connPIDs := map[uint32]struct{}{} for range 10 { conn, err := db.Acquire(ctx) assert.NoError(t, err) connPIDs[conn.Conn().PgConn().PID()] = struct{}{} conn.Release() waitForReleaseToComplete() } assert.EqualValues(t, 5, len(connPIDs)) } func TestPoolBeforeClose(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() func() { pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() }() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) connPIDs := make(chan uint32, 5) config.BeforeClose = func(c *pgx.Conn) { connPIDs <- c.PgConn().PID() } db, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer db.Close() acquiredPIDs := make([]uint32, 0, 5) closedPIDs := make([]uint32, 0, 5) for range 5 { conn, err := db.Acquire(ctx) assert.NoError(t, err) acquiredPIDs = append(acquiredPIDs, conn.Conn().PgConn().PID()) conn.Release() db.Reset() closedPIDs = append(closedPIDs, <-connPIDs) } assert.ElementsMatch(t, acquiredPIDs, closedPIDs) } func TestPoolAcquireAllIdle(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() db, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer db.Close() conns := make([]*pgxpool.Conn, 3) for i := range conns { conns[i], err = db.Acquire(ctx) assert.NoError(t, err) } for _, c := range conns { if c != nil { c.Release() } } waitForReleaseToComplete() conns = db.AcquireAllIdle(ctx) assert.Len(t, conns, 3) for _, c := range conns { c.Release() } } func TestPoolReset(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() db, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer db.Close() conns := make([]*pgxpool.Conn, 3) for i := range conns { conns[i], err = db.Acquire(ctx) assert.NoError(t, err) } db.Reset() for _, c := range conns { if c != nil { c.Release() } } waitForReleaseToComplete() require.EqualValues(t, 0, db.Stat().TotalConns()) } func TestConnReleaseChecksMaxConnLifetime(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.MaxConnLifetime = 250 * time.Millisecond db, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer db.Close() c, err := db.Acquire(ctx) require.NoError(t, err) time.Sleep(config.MaxConnLifetime) c.Release() waitForReleaseToComplete() stats := db.Stat() assert.EqualValues(t, 0, stats.TotalConns()) } func TestConnReleaseClosesBusyConn(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() db, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer db.Close() c, err := db.Acquire(ctx) require.NoError(t, err) _, err = c.Query(ctx, "select generate_series(1,10)") require.NoError(t, err) c.Release() waitForReleaseToComplete() // wait for the connection to actually be destroyed for range 1000 { if db.Stat().TotalConns() == 0 { break } time.Sleep(time.Millisecond) } stats := db.Stat() assert.EqualValues(t, 0, stats.TotalConns()) } func TestPoolBackgroundChecksMaxConnLifetime(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.MaxConnLifetime = 100 * time.Millisecond config.HealthCheckPeriod = 100 * time.Millisecond db, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer db.Close() c, err := db.Acquire(ctx) require.NoError(t, err) c.Release() time.Sleep(config.MaxConnLifetime + 500*time.Millisecond) stats := db.Stat() assert.EqualValues(t, 0, stats.TotalConns()) assert.EqualValues(t, 0, stats.MaxIdleDestroyCount()) assert.EqualValues(t, 1, stats.MaxLifetimeDestroyCount()) assert.EqualValues(t, 1, stats.NewConnsCount()) } func TestPoolBackgroundChecksMaxConnIdleTime(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.MaxConnLifetime = 1 * time.Minute config.MaxConnIdleTime = 100 * time.Millisecond config.HealthCheckPeriod = 150 * time.Millisecond db, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer db.Close() c, err := db.Acquire(ctx) require.NoError(t, err) c.Release() time.Sleep(config.HealthCheckPeriod) for range 1000 { if db.Stat().TotalConns() == 0 { break } time.Sleep(time.Millisecond) } stats := db.Stat() assert.EqualValues(t, 0, stats.TotalConns()) assert.EqualValues(t, 1, stats.MaxIdleDestroyCount()) assert.EqualValues(t, 0, stats.MaxLifetimeDestroyCount()) assert.EqualValues(t, 1, stats.NewConnsCount()) } func TestPoolBackgroundChecksMinConns(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.HealthCheckPeriod = 100 * time.Millisecond config.MinConns = 2 db, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer db.Close() stats := db.Stat() for !(stats.IdleConns() == 2 && stats.MaxLifetimeDestroyCount() == 0 && stats.NewConnsCount() == 2) && ctx.Err() == nil { time.Sleep(50 * time.Millisecond) stats = db.Stat() } require.EqualValues(t, 2, stats.IdleConns()) require.EqualValues(t, 0, stats.MaxLifetimeDestroyCount()) require.EqualValues(t, 2, stats.NewConnsCount()) c, err := db.Acquire(ctx) require.NoError(t, err) stats = db.Stat() require.EqualValues(t, 1, stats.IdleConns()) require.EqualValues(t, 0, stats.MaxLifetimeDestroyCount()) require.EqualValues(t, 2, stats.NewConnsCount()) err = c.Conn().Close(ctx) require.NoError(t, err) c.Release() stats = db.Stat() for !(stats.IdleConns() == 2 && stats.MaxIdleDestroyCount() == 0 && stats.NewConnsCount() == 3) && ctx.Err() == nil { time.Sleep(50 * time.Millisecond) stats = db.Stat() } require.EqualValues(t, 2, stats.TotalConns()) require.EqualValues(t, 0, stats.MaxIdleDestroyCount()) require.EqualValues(t, 3, stats.NewConnsCount()) } func TestPoolExec(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() testExec(t, ctx, pool) } func TestPoolQuery(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() // Test common usage testQuery(t, ctx, pool) waitForReleaseToComplete() // Test expected pool behavior rows, err := pool.Query(ctx, "select generate_series(1,$1)", 10) require.NoError(t, err) stats := pool.Stat() assert.EqualValues(t, 1, stats.AcquiredConns()) assert.EqualValues(t, 1, stats.TotalConns()) rows.Close() assert.NoError(t, rows.Err()) waitForReleaseToComplete() stats = pool.Stat() assert.EqualValues(t, 0, stats.AcquiredConns()) assert.EqualValues(t, 1, stats.TotalConns()) } func TestPoolQueryRow(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() testQueryRow(t, ctx, pool) waitForReleaseToComplete() stats := pool.Stat() assert.EqualValues(t, 0, stats.AcquiredConns()) assert.EqualValues(t, 1, stats.TotalConns()) } // https://github.com/jackc/pgx/issues/677 func TestPoolQueryRowErrNoRows(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() err = pool.QueryRow(ctx, "select n from generate_series(1,10) n where n=0").Scan(nil) require.Equal(t, pgx.ErrNoRows, err) } // https://github.com/jackc/pgx/issues/1628 func TestPoolQueryRowScanPanicReleasesConnection(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() require.Panics(t, func() { var greeting *string pool.QueryRow(ctx, "select 'Hello, world!'").Scan(greeting) // Note lack of &. This means that a typed nil is passed to Scan. }) // If the connection is not released this will block forever in the defer pool.Close(). } func TestPoolSendBatch(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() testSendBatch(t, ctx, pool) waitForReleaseToComplete() stats := pool.Stat() assert.EqualValues(t, 0, stats.AcquiredConns()) assert.EqualValues(t, 1, stats.TotalConns()) } func TestPoolCopyFrom(t *testing.T) { // Not able to use testCopyFrom because it relies on temporary tables and the pool may run subsequent calls under // different connections. t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() _, err = pool.Exec(ctx, `drop table if exists poolcopyfromtest`) require.NoError(t, err) _, err = pool.Exec(ctx, `create table poolcopyfromtest(a int2, b int4, c int8, d varchar, e text, f date, g timestamptz)`) require.NoError(t, err) defer pool.Exec(ctx, `drop table poolcopyfromtest`) tzedTime := time.Date(2010, 2, 3, 4, 5, 6, 0, time.Local) inputRows := [][]any{ {int16(0), int32(1), int64(2), "abc", "efg", time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC), tzedTime}, {nil, nil, nil, nil, nil, nil, nil}, } copyCount, err := pool.CopyFrom(ctx, pgx.Identifier{"poolcopyfromtest"}, []string{"a", "b", "c", "d", "e", "f", "g"}, pgx.CopyFromRows(inputRows)) assert.NoError(t, err) assert.EqualValues(t, len(inputRows), copyCount) rows, err := pool.Query(ctx, "select * from poolcopyfromtest") assert.NoError(t, err) var outputRows [][]any for rows.Next() { row, err := rows.Values() if err != nil { t.Errorf("Unexpected error for rows.Values(): %v", err) } outputRows = append(outputRows, row) } assert.NoError(t, rows.Err()) assert.Equal(t, inputRows, outputRows) } func TestConnReleaseClosesConnInFailedTransaction(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() c, err := pool.Acquire(ctx) require.NoError(t, err) pid := c.Conn().PgConn().PID() assert.Equal(t, byte('I'), c.Conn().PgConn().TxStatus()) _, err = c.Exec(ctx, "begin") assert.NoError(t, err) assert.Equal(t, byte('T'), c.Conn().PgConn().TxStatus()) _, err = c.Exec(ctx, "selct") assert.Error(t, err) assert.Equal(t, byte('E'), c.Conn().PgConn().TxStatus()) c.Release() waitForReleaseToComplete() c, err = pool.Acquire(ctx) require.NoError(t, err) assert.NotEqual(t, pid, c.Conn().PgConn().PID()) assert.Equal(t, byte('I'), c.Conn().PgConn().TxStatus()) c.Release() } func TestConnReleaseClosesConnInTransaction(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() c, err := pool.Acquire(ctx) require.NoError(t, err) pid := c.Conn().PgConn().PID() assert.Equal(t, byte('I'), c.Conn().PgConn().TxStatus()) _, err = c.Exec(ctx, "begin") assert.NoError(t, err) assert.Equal(t, byte('T'), c.Conn().PgConn().TxStatus()) c.Release() waitForReleaseToComplete() c, err = pool.Acquire(ctx) require.NoError(t, err) assert.NotEqual(t, pid, c.Conn().PgConn().PID()) assert.Equal(t, byte('I'), c.Conn().PgConn().TxStatus()) c.Release() } func TestConnReleaseDestroysClosedConn(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() c, err := pool.Acquire(ctx) require.NoError(t, err) err = c.Conn().Close(ctx) require.NoError(t, err) assert.EqualValues(t, 1, pool.Stat().TotalConns()) c.Release() waitForReleaseToComplete() // wait for the connection to actually be destroyed for range 1000 { if pool.Stat().TotalConns() == 0 { break } time.Sleep(time.Millisecond) } assert.EqualValues(t, 0, pool.Stat().TotalConns()) } func TestConnPoolQueryConcurrentLoad(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() n := 100 done := make(chan bool) for range n { go func() { defer func() { done <- true }() testQuery(t, ctx, pool) testQueryRow(t, ctx, pool) }() } for range n { <-done } } func TestConnReleaseWhenBeginFail(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() db, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer db.Close() tx, err := db.BeginTx(ctx, pgx.TxOptions{ IsoLevel: pgx.TxIsoLevel("foo"), }) assert.Error(t, err) if !assert.Zero(t, tx) { err := tx.Rollback(ctx) assert.NoError(t, err) } for range 1000 { if db.Stat().TotalConns() == 0 { break } time.Sleep(time.Millisecond) } assert.EqualValues(t, 0, db.Stat().TotalConns()) } func TestTxBeginFuncNestedTransactionCommit(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() db, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer db.Close() createSql := ` drop table if exists pgxpooltx; create temporary table pgxpooltx( id integer, unique (id) ); ` _, err = db.Exec(ctx, createSql) require.NoError(t, err) defer func() { db.Exec(ctx, "drop table pgxpooltx") }() err = pgx.BeginFunc(ctx, db, func(db pgx.Tx) error { _, err := db.Exec(ctx, "insert into pgxpooltx(id) values (1)") require.NoError(t, err) err = pgx.BeginFunc(ctx, db, func(db pgx.Tx) error { _, err := db.Exec(ctx, "insert into pgxpooltx(id) values (2)") require.NoError(t, err) err = pgx.BeginFunc(ctx, db, func(db pgx.Tx) error { _, err := db.Exec(ctx, "insert into pgxpooltx(id) values (3)") require.NoError(t, err) return nil }) require.NoError(t, err) return nil }) require.NoError(t, err) return nil }) require.NoError(t, err) var n int64 err = db.QueryRow(ctx, "select count(*) from pgxpooltx").Scan(&n) require.NoError(t, err) require.EqualValues(t, 3, n) } func TestTxBeginFuncNestedTransactionRollback(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() db, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer db.Close() createSql := ` drop table if exists pgxpooltx; create temporary table pgxpooltx( id integer, unique (id) ); ` _, err = db.Exec(ctx, createSql) require.NoError(t, err) defer func() { db.Exec(ctx, "drop table pgxpooltx") }() err = pgx.BeginFunc(ctx, db, func(db pgx.Tx) error { _, err := db.Exec(ctx, "insert into pgxpooltx(id) values (1)") require.NoError(t, err) err = pgx.BeginFunc(ctx, db, func(db pgx.Tx) error { _, err := db.Exec(ctx, "insert into pgxpooltx(id) values (2)") require.NoError(t, err) return errors.New("do a rollback") }) require.EqualError(t, err, "do a rollback") _, err = db.Exec(ctx, "insert into pgxpooltx(id) values (3)") require.NoError(t, err) return nil }) require.NoError(t, err) var n int64 err = db.QueryRow(ctx, "select count(*) from pgxpooltx").Scan(&n) require.NoError(t, err) require.EqualValues(t, 2, n) } func TestIdempotentPoolClose(t *testing.T) { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) // Close the open pool. require.NotPanics(t, func() { pool.Close() }) // Close the already closed pool. require.NotPanics(t, func() { pool.Close() }) } func TestConnectEagerlyReachesMinPoolSize(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.MinConns = int32(12) config.MaxConns = int32(15) acquireAttempts := int64(0) connectAttempts := int64(0) config.PrepareConn = func(ctx context.Context, conn *pgx.Conn) (bool, error) { atomic.AddInt64(&acquireAttempts, 1) return true, nil } config.BeforeConnect = func(ctx context.Context, cfg *pgx.ConnConfig) error { atomic.AddInt64(&connectAttempts, 1) return nil } pool, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer pool.Close() for range 500 { time.Sleep(10 * time.Millisecond) stat := pool.Stat() if stat.IdleConns() == 12 && stat.AcquireCount() == 0 && stat.TotalConns() == 12 && atomic.LoadInt64(&acquireAttempts) == 0 && atomic.LoadInt64(&connectAttempts) == 12 { return } } t.Fatal("did not reach min pool size") } func TestPoolSendBatchBatchCloseTwice(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() errChan := make(chan error) testCount := 5000 for range testCount { go func() { batch := &pgx.Batch{} batch.Queue("select 1") batch.Queue("select 2") br := pool.SendBatch(ctx, batch) defer br.Close() var err error var n int32 err = br.QueryRow().Scan(&n) if err != nil { errChan <- err return } if n != 1 { errChan <- fmt.Errorf("expected 1 got %v", n) return } err = br.QueryRow().Scan(&n) if err != nil { errChan <- err return } if n != 2 { errChan <- fmt.Errorf("expected 2 got %v", n) return } err = br.Close() errChan <- err }() } for range testCount { err := <-errChan assert.NoError(t, err) } } func TestPoolAcquirePingTimeout(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.PingTimeout = 200 * time.Millisecond config.ConnConfig.DialFunc = newDelayProxyDialFunc(500 * time.Millisecond) var conID *uint32 // Only ping the connection with the original PID to force creation of a new connection config.ShouldPing = func(_ context.Context, params pgxpool.ShouldPingParams) bool { if conID != nil && params.Conn.PgConn().PID() == *conID { return true } return false } // Limit to a single connection to ensure the same connection is reused config.MinConns = 1 config.MaxConns = 1 pool, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer pool.Close() c, err := pool.Acquire(ctx) require.NoError(t, err) require.EqualValues(t, 1, pool.Stat().TotalConns()) originalPID := c.Conn().PgConn().PID() conID = &originalPID c.Release() require.EqualValues(t, 1, pool.Stat().TotalConns()) c, err = pool.Acquire(ctx) require.NoError(t, err) require.EqualValues(t, 1, pool.Stat().TotalConns()) newPID := c.Conn().PgConn().PID() c.Release() require.EqualValues(t, 1, pool.Stat().TotalConns()) assert.Nil(t, ctx.Err()) assert.NotEqualValues(t, originalPID, newPID, "Expected new connection due to ping timeout, but got same connection") } pgx-5.8.0/pgxpool/rows.go000066400000000000000000000043411512357711200153410ustar00rootroot00000000000000package pgxpool import ( "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" ) type errRows struct { err error } func (errRows) Close() {} func (e errRows) Err() error { return e.err } func (errRows) CommandTag() pgconn.CommandTag { return pgconn.CommandTag{} } func (errRows) FieldDescriptions() []pgconn.FieldDescription { return nil } func (errRows) Next() bool { return false } func (e errRows) Scan(dest ...any) error { return e.err } func (e errRows) Values() ([]any, error) { return nil, e.err } func (e errRows) RawValues() [][]byte { return nil } func (e errRows) Conn() *pgx.Conn { return nil } type errRow struct { err error } func (e errRow) Scan(dest ...any) error { return e.err } type poolRows struct { r pgx.Rows c *Conn err error } func (rows *poolRows) Close() { rows.r.Close() if rows.c != nil { rows.c.Release() rows.c = nil } } func (rows *poolRows) Err() error { if rows.err != nil { return rows.err } return rows.r.Err() } func (rows *poolRows) CommandTag() pgconn.CommandTag { return rows.r.CommandTag() } func (rows *poolRows) FieldDescriptions() []pgconn.FieldDescription { return rows.r.FieldDescriptions() } func (rows *poolRows) Next() bool { if rows.err != nil { return false } n := rows.r.Next() if !n { rows.Close() } return n } func (rows *poolRows) Scan(dest ...any) error { err := rows.r.Scan(dest...) if err != nil { rows.Close() } return err } func (rows *poolRows) Values() ([]any, error) { values, err := rows.r.Values() if err != nil { rows.Close() } return values, err } func (rows *poolRows) RawValues() [][]byte { return rows.r.RawValues() } func (rows *poolRows) Conn() *pgx.Conn { return rows.r.Conn() } type poolRow struct { r pgx.Row c *Conn err error } func (row *poolRow) Scan(dest ...any) error { if row.err != nil { return row.err } panicked := true defer func() { if panicked && row.c != nil { row.c.Release() } }() err := row.r.Scan(dest...) panicked = false if row.c != nil { row.c.Release() } return err } pgx-5.8.0/pgxpool/stat.go000066400000000000000000000051211512357711200153170ustar00rootroot00000000000000package pgxpool import ( "time" "github.com/jackc/puddle/v2" ) // Stat is a snapshot of Pool statistics. type Stat struct { s *puddle.Stat newConnsCount int64 lifetimeDestroyCount int64 idleDestroyCount int64 } // AcquireCount returns the cumulative count of successful acquires from the pool. func (s *Stat) AcquireCount() int64 { return s.s.AcquireCount() } // AcquireDuration returns the total duration of all successful acquires from // the pool. func (s *Stat) AcquireDuration() time.Duration { return s.s.AcquireDuration() } // AcquiredConns returns the number of currently acquired connections in the pool. func (s *Stat) AcquiredConns() int32 { return s.s.AcquiredResources() } // CanceledAcquireCount returns the cumulative count of acquires from the pool // that were canceled by a context. func (s *Stat) CanceledAcquireCount() int64 { return s.s.CanceledAcquireCount() } // ConstructingConns returns the number of conns with construction in progress in // the pool. func (s *Stat) ConstructingConns() int32 { return s.s.ConstructingResources() } // EmptyAcquireCount returns the cumulative count of successful acquires from the pool // that waited for a resource to be released or constructed because the pool was // empty. func (s *Stat) EmptyAcquireCount() int64 { return s.s.EmptyAcquireCount() } // IdleConns returns the number of currently idle conns in the pool. func (s *Stat) IdleConns() int32 { return s.s.IdleResources() } // MaxConns returns the maximum size of the pool. func (s *Stat) MaxConns() int32 { return s.s.MaxResources() } // TotalConns returns the total number of resources currently in the pool. // The value is the sum of ConstructingConns, AcquiredConns, and // IdleConns. func (s *Stat) TotalConns() int32 { return s.s.TotalResources() } // NewConnsCount returns the cumulative count of new connections opened. func (s *Stat) NewConnsCount() int64 { return s.newConnsCount } // MaxLifetimeDestroyCount returns the cumulative count of connections destroyed // because they exceeded MaxConnLifetime. func (s *Stat) MaxLifetimeDestroyCount() int64 { return s.lifetimeDestroyCount } // MaxIdleDestroyCount returns the cumulative count of connections destroyed because // they exceeded MaxConnIdleTime. func (s *Stat) MaxIdleDestroyCount() int64 { return s.idleDestroyCount } // EmptyAcquireWaitTime returns the cumulative time waited for successful acquires // from the pool for a resource to be released or constructed because the pool was // empty. func (s *Stat) EmptyAcquireWaitTime() time.Duration { return s.s.EmptyAcquireWaitTime() } pgx-5.8.0/pgxpool/tracer.go000066400000000000000000000015331512357711200156270ustar00rootroot00000000000000package pgxpool import ( "context" "github.com/jackc/pgx/v5" ) // AcquireTracer traces Acquire. type AcquireTracer interface { // TraceAcquireStart is called at the beginning of Acquire. // The returned context is used for the rest of the call and will be passed to the TraceAcquireEnd. TraceAcquireStart(ctx context.Context, pool *Pool, data TraceAcquireStartData) context.Context // TraceAcquireEnd is called when a connection has been acquired. TraceAcquireEnd(ctx context.Context, pool *Pool, data TraceAcquireEndData) } type TraceAcquireStartData struct{} type TraceAcquireEndData struct { Conn *pgx.Conn Err error } // ReleaseTracer traces Release. type ReleaseTracer interface { // TraceRelease is called at the beginning of Release. TraceRelease(pool *Pool, data TraceReleaseData) } type TraceReleaseData struct { Conn *pgx.Conn } pgx-5.8.0/pgxpool/tracer_test.go000066400000000000000000000071751512357711200166760ustar00rootroot00000000000000package pgxpool_test import ( "context" "os" "testing" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgxpool" "github.com/stretchr/testify/require" ) type testTracer struct { traceAcquireStart func(ctx context.Context, pool *pgxpool.Pool, data pgxpool.TraceAcquireStartData) context.Context traceAcquireEnd func(ctx context.Context, pool *pgxpool.Pool, data pgxpool.TraceAcquireEndData) traceRelease func(pool *pgxpool.Pool, data pgxpool.TraceReleaseData) } type ctxKey string func (tt *testTracer) TraceAcquireStart(ctx context.Context, pool *pgxpool.Pool, data pgxpool.TraceAcquireStartData) context.Context { if tt.traceAcquireStart != nil { return tt.traceAcquireStart(ctx, pool, data) } return ctx } func (tt *testTracer) TraceAcquireEnd(ctx context.Context, pool *pgxpool.Pool, data pgxpool.TraceAcquireEndData) { if tt.traceAcquireEnd != nil { tt.traceAcquireEnd(ctx, pool, data) } } func (tt *testTracer) TraceRelease(pool *pgxpool.Pool, data pgxpool.TraceReleaseData) { if tt.traceRelease != nil { tt.traceRelease(pool, data) } } func (tt *testTracer) TraceQueryStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryStartData) context.Context { return ctx } func (tt *testTracer) TraceQueryEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryEndData) { } func TestTraceAcquire(t *testing.T) { t.Parallel() tracer := &testTracer{} ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.ConnConfig.Tracer = tracer pool, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer pool.Close() traceAcquireStartCalled := false tracer.traceAcquireStart = func(ctx context.Context, pool *pgxpool.Pool, data pgxpool.TraceAcquireStartData) context.Context { traceAcquireStartCalled = true require.NotNil(t, pool) return context.WithValue(ctx, ctxKey("fromTraceAcquireStart"), "foo") } traceAcquireEndCalled := false tracer.traceAcquireEnd = func(ctx context.Context, pool *pgxpool.Pool, data pgxpool.TraceAcquireEndData) { traceAcquireEndCalled = true require.Equal(t, "foo", ctx.Value(ctxKey("fromTraceAcquireStart"))) require.NotNil(t, pool) require.NotNil(t, data.Conn) require.NoError(t, data.Err) } c, err := pool.Acquire(ctx) require.NoError(t, err) defer c.Release() require.True(t, traceAcquireStartCalled) require.True(t, traceAcquireEndCalled) traceAcquireStartCalled = false traceAcquireEndCalled = false tracer.traceAcquireEnd = func(ctx context.Context, pool *pgxpool.Pool, data pgxpool.TraceAcquireEndData) { traceAcquireEndCalled = true require.NotNil(t, pool) require.Nil(t, data.Conn) require.Error(t, data.Err) } ctx, cancel = context.WithCancel(ctx) cancel() _, err = pool.Acquire(ctx) require.ErrorIs(t, err, context.Canceled) require.True(t, traceAcquireStartCalled) require.True(t, traceAcquireEndCalled) } func TestTraceRelease(t *testing.T) { t.Parallel() tracer := &testTracer{} ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.ConnConfig.Tracer = tracer pool, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer pool.Close() traceReleaseCalled := false tracer.traceRelease = func(pool *pgxpool.Pool, data pgxpool.TraceReleaseData) { traceReleaseCalled = true require.NotNil(t, pool) require.NotNil(t, data.Conn) } c, err := pool.Acquire(ctx) require.NoError(t, err) c.Release() require.True(t, traceReleaseCalled) } pgx-5.8.0/pgxpool/tx.go000066400000000000000000000054461512357711200150110ustar00rootroot00000000000000package pgxpool import ( "context" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" ) // Tx represents a database transaction acquired from a Pool. type Tx struct { t pgx.Tx c *Conn } // Begin starts a pseudo nested transaction implemented with a savepoint. func (tx *Tx) Begin(ctx context.Context) (pgx.Tx, error) { return tx.t.Begin(ctx) } // Commit commits the transaction and returns the associated connection back to the Pool. Commit will return an error // where errors.Is(ErrTxClosed) is true if the Tx is already closed, but is otherwise safe to call multiple times. If // the commit fails with a rollback status (e.g. the transaction was already in a broken state) then ErrTxCommitRollback // will be returned. func (tx *Tx) Commit(ctx context.Context) error { err := tx.t.Commit(ctx) if tx.c != nil { tx.c.Release() tx.c = nil } return err } // Rollback rolls back the transaction and returns the associated connection back to the Pool. Rollback will return // where an error where errors.Is(ErrTxClosed) is true if the Tx is already closed, but is otherwise safe to call // multiple times. Hence, defer tx.Rollback() is safe even if tx.Commit() will be called first in a non-error condition. func (tx *Tx) Rollback(ctx context.Context) error { err := tx.t.Rollback(ctx) if tx.c != nil { tx.c.Release() tx.c = nil } return err } func (tx *Tx) CopyFrom(ctx context.Context, tableName pgx.Identifier, columnNames []string, rowSrc pgx.CopyFromSource) (int64, error) { return tx.t.CopyFrom(ctx, tableName, columnNames, rowSrc) } func (tx *Tx) SendBatch(ctx context.Context, b *pgx.Batch) pgx.BatchResults { return tx.t.SendBatch(ctx, b) } func (tx *Tx) LargeObjects() pgx.LargeObjects { return tx.t.LargeObjects() } // Prepare creates a prepared statement with name and sql. If the name is empty, // an anonymous prepared statement will be used. sql can contain placeholders // for bound parameters. These placeholders are referenced positionally as $1, $2, etc. // // Prepare is idempotent; i.e. it is safe to call Prepare multiple times with the same // name and sql arguments. This allows a code path to Prepare and Query/Exec without // needing to first check whether the statement has already been prepared. func (tx *Tx) Prepare(ctx context.Context, name, sql string) (*pgconn.StatementDescription, error) { return tx.t.Prepare(ctx, name, sql) } func (tx *Tx) Exec(ctx context.Context, sql string, arguments ...any) (pgconn.CommandTag, error) { return tx.t.Exec(ctx, sql, arguments...) } func (tx *Tx) Query(ctx context.Context, sql string, args ...any) (pgx.Rows, error) { return tx.t.Query(ctx, sql, args...) } func (tx *Tx) QueryRow(ctx context.Context, sql string, args ...any) pgx.Row { return tx.t.QueryRow(ctx, sql, args...) } func (tx *Tx) Conn() *pgx.Conn { return tx.t.Conn() } pgx-5.8.0/pgxpool/tx_test.go000066400000000000000000000036071512357711200160450ustar00rootroot00000000000000package pgxpool_test import ( "context" "os" "testing" "time" "github.com/jackc/pgx/v5/pgxpool" "github.com/stretchr/testify/require" ) func TestTxExec(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() tx, err := pool.Begin(ctx) require.NoError(t, err) defer tx.Rollback(ctx) testExec(t, ctx, tx) } func TestTxQuery(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() tx, err := pool.Begin(ctx) require.NoError(t, err) defer tx.Rollback(ctx) testQuery(t, ctx, tx) } func TestTxQueryRow(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() tx, err := pool.Begin(ctx) require.NoError(t, err) defer tx.Rollback(ctx) testQueryRow(t, ctx, tx) } func TestTxSendBatch(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() tx, err := pool.Begin(ctx) require.NoError(t, err) defer tx.Rollback(ctx) testSendBatch(t, ctx, tx) } func TestTxCopyFrom(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pool, err := pgxpool.New(ctx, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer pool.Close() tx, err := pool.Begin(ctx) require.NoError(t, err) defer tx.Rollback(ctx) testCopyFrom(t, ctx, tx) } pgx-5.8.0/pgxtest/000077500000000000000000000000001512357711200140245ustar00rootroot00000000000000pgx-5.8.0/pgxtest/pgxtest.go000066400000000000000000000117171512357711200160600ustar00rootroot00000000000000// Package pgxtest provides utilities for testing pgx and packages that integrate with pgx. package pgxtest import ( "context" "fmt" "reflect" "regexp" "strconv" "testing" "github.com/jackc/pgx/v5" ) var AllQueryExecModes = []pgx.QueryExecMode{ pgx.QueryExecModeCacheStatement, pgx.QueryExecModeCacheDescribe, pgx.QueryExecModeDescribeExec, pgx.QueryExecModeExec, pgx.QueryExecModeSimpleProtocol, } // KnownOIDQueryExecModes is a slice of all query exec modes where the param and result OIDs are known before sending the query. var KnownOIDQueryExecModes = []pgx.QueryExecMode{ pgx.QueryExecModeCacheStatement, pgx.QueryExecModeCacheDescribe, pgx.QueryExecModeDescribeExec, } // ConnTestRunner controls how a *pgx.Conn is created and closed by tests. All fields are required. Use DefaultConnTestRunner to get a // ConnTestRunner with reasonable default values. type ConnTestRunner struct { // CreateConfig returns a *pgx.ConnConfig suitable for use with pgx.ConnectConfig. CreateConfig func(ctx context.Context, t testing.TB) *pgx.ConnConfig // AfterConnect is called after conn is established. It allows for arbitrary connection setup before a test begins. AfterConnect func(ctx context.Context, t testing.TB, conn *pgx.Conn) // AfterTest is called after the test is run. It allows for validating the state of the connection before it is closed. AfterTest func(ctx context.Context, t testing.TB, conn *pgx.Conn) // CloseConn closes conn. CloseConn func(ctx context.Context, t testing.TB, conn *pgx.Conn) } // DefaultConnTestRunner returns a new ConnTestRunner with all fields set to reasonable default values. func DefaultConnTestRunner() ConnTestRunner { return ConnTestRunner{ CreateConfig: func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config, err := pgx.ParseConfig("") if err != nil { t.Fatalf("ParseConfig failed: %v", err) } return config }, AfterConnect: func(ctx context.Context, t testing.TB, conn *pgx.Conn) {}, AfterTest: func(ctx context.Context, t testing.TB, conn *pgx.Conn) {}, CloseConn: func(ctx context.Context, t testing.TB, conn *pgx.Conn) { err := conn.Close(ctx) if err != nil { t.Errorf("Close failed: %v", err) } }, } } func (ctr *ConnTestRunner) RunTest(ctx context.Context, t testing.TB, f func(ctx context.Context, t testing.TB, conn *pgx.Conn)) { t.Helper() config := ctr.CreateConfig(ctx, t) conn, err := pgx.ConnectConfig(ctx, config) if err != nil { t.Fatalf("ConnectConfig failed: %v", err) } defer ctr.CloseConn(ctx, t, conn) ctr.AfterConnect(ctx, t, conn) f(ctx, t, conn) ctr.AfterTest(ctx, t, conn) } // RunWithQueryExecModes runs a f in a new test for each element of modes with a new connection created using connector. // If modes is nil all pgx.QueryExecModes are tested. func RunWithQueryExecModes(ctx context.Context, t *testing.T, ctr ConnTestRunner, modes []pgx.QueryExecMode, f func(ctx context.Context, t testing.TB, conn *pgx.Conn)) { if modes == nil { modes = AllQueryExecModes } for _, mode := range modes { ctrWithMode := ctr ctrWithMode.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := ctr.CreateConfig(ctx, t) config.DefaultQueryExecMode = mode return config } t.Run(mode.String(), func(t *testing.T) { ctrWithMode.RunTest(ctx, t, f) }, ) } } type ValueRoundTripTest struct { Param any Result any Test func(any) bool } func RunValueRoundTripTests( ctx context.Context, t testing.TB, ctr ConnTestRunner, modes []pgx.QueryExecMode, pgTypeName string, tests []ValueRoundTripTest, ) { t.Helper() if modes == nil { modes = AllQueryExecModes } ctr.RunTest(ctx, t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { t.Helper() sql := fmt.Sprintf("select $1::%s", pgTypeName) for i, tt := range tests { for _, mode := range modes { err := conn.QueryRow(ctx, sql, mode, tt.Param).Scan(tt.Result) if err != nil { t.Errorf("%d. %v: %v", i, mode, err) } result := reflect.ValueOf(tt.Result) if result.Kind() == reflect.Ptr { result = result.Elem() } if !tt.Test(result.Interface()) { t.Errorf("%d. %v: unexpected result for %v: %v", i, mode, tt.Param, result.Interface()) } } } }) } // SkipCockroachDB calls Skip on t with msg if the connection is to a CockroachDB server. func SkipCockroachDB(t testing.TB, conn *pgx.Conn, msg string) { if conn.PgConn().ParameterStatus("crdb_version") != "" { t.Skip(msg) } } func SkipPostgreSQLVersionLessThan(t testing.TB, conn *pgx.Conn, minVersion int64) { serverVersionStr := conn.PgConn().ParameterStatus("server_version") serverVersionStr = regexp.MustCompile(`^[0-9]+`).FindString(serverVersionStr) // if not PostgreSQL do nothing if serverVersionStr == "" { return } serverVersion, err := strconv.ParseInt(serverVersionStr, 10, 64) if err != nil { t.Fatalf("postgres version parsed failed: %s", err) } if serverVersion < minVersion { t.Skipf("Test requires PostgreSQL v%d+", minVersion) } } pgx-5.8.0/pipeline_test.go000066400000000000000000000040561512357711200155260ustar00rootroot00000000000000package pgx_test import ( "context" "testing" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" "github.com/stretchr/testify/require" ) func TestPipelineWithoutPreparedOrDescribedStatements(t *testing.T) { t.Parallel() defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pipeline := conn.PgConn().StartPipeline(ctx) eqb := pgx.ExtendedQueryBuilder{} err := eqb.Build(conn.TypeMap(), nil, []any{1, 2}) require.NoError(t, err) pipeline.SendQueryParams(`select $1::bigint + $2::bigint`, eqb.ParamValues, nil, eqb.ParamFormats, eqb.ResultFormats) err = eqb.Build(conn.TypeMap(), nil, []any{3, 4, 5}) require.NoError(t, err) pipeline.SendQueryParams(`select $1::bigint + $2::bigint + $3::bigint`, eqb.ParamValues, nil, eqb.ParamFormats, eqb.ResultFormats) err = pipeline.Sync() require.NoError(t, err) results, err := pipeline.GetResults() require.NoError(t, err) rr, ok := results.(*pgconn.ResultReader) require.True(t, ok) rows := pgx.RowsFromResultReader(conn.TypeMap(), rr) rowCount := 0 var n int64 for rows.Next() { err = rows.Scan(&n) require.NoError(t, err) rowCount++ } require.NoError(t, rows.Err()) require.Equal(t, 1, rowCount) require.Equal(t, "SELECT 1", rows.CommandTag().String()) require.EqualValues(t, 3, n) results, err = pipeline.GetResults() require.NoError(t, err) rr, ok = results.(*pgconn.ResultReader) require.True(t, ok) rows = pgx.RowsFromResultReader(conn.TypeMap(), rr) rowCount = 0 n = 0 for rows.Next() { err = rows.Scan(&n) require.NoError(t, err) rowCount++ } require.NoError(t, rows.Err()) require.Equal(t, 1, rowCount) require.Equal(t, "SELECT 1", rows.CommandTag().String()) require.EqualValues(t, 12, n) results, err = pipeline.GetResults() require.NoError(t, err) _, ok = results.(*pgconn.PipelineSync) require.True(t, ok) results, err = pipeline.GetResults() require.NoError(t, err) require.Nil(t, results) err = pipeline.Close() require.NoError(t, err) }) } pgx-5.8.0/query_test.go000066400000000000000000001661131512357711200150710ustar00rootroot00000000000000package pgx_test import ( "bytes" "context" "database/sql" "database/sql/driver" "encoding/json" "errors" "fmt" "os" "strconv" "strings" "testing" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func TestConnQueryScan(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) var sum, rowCount int32 rows, err := conn.Query(context.Background(), "select generate_series(1,$1)", 10) if err != nil { t.Fatalf("conn.Query failed: %v", err) } defer rows.Close() for rows.Next() { var n int32 rows.Scan(&n) sum += n rowCount++ } if rows.Err() != nil { t.Fatalf("conn.Query failed: %v", rows.Err()) } assert.Equal(t, "SELECT 10", rows.CommandTag().String()) if rowCount != 10 { t.Error("Select called onDataRow wrong number of times") } if sum != 55 { t.Error("Wrong values returned") } } func TestConnQueryRowsFieldDescriptionsBeforeNext(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) rows, err := conn.Query(context.Background(), "select 'hello' as msg") require.NoError(t, err) defer rows.Close() require.Len(t, rows.FieldDescriptions(), 1) assert.Equal(t, "msg", rows.FieldDescriptions()[0].Name) } func TestConnQueryWithoutResultSetCommandTag(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) rows, err := conn.Query(context.Background(), "create temporary table t (id serial);") assert.NoError(t, err) rows.Close() assert.NoError(t, rows.Err()) assert.Equal(t, "CREATE TABLE", rows.CommandTag().String()) } func TestConnQueryScanWithManyColumns(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) columnCount := 1000 sql := "select " for i := range columnCount { if i > 0 { sql += "," } sql += fmt.Sprintf(" %d", i) } sql += " from generate_series(1,5)" dest := make([]int, columnCount) var rowCount int rows, err := conn.Query(context.Background(), sql) if err != nil { t.Fatalf("conn.Query failed: %v", err) } defer rows.Close() for rows.Next() { destPtrs := make([]any, columnCount) for i := range destPtrs { destPtrs[i] = &dest[i] } if err := rows.Scan(destPtrs...); err != nil { t.Fatalf("rows.Scan failed: %v", err) } rowCount++ for i := range dest { if dest[i] != i { t.Errorf("dest[%d] => %d, want %d", i, dest[i], i) } } } if rows.Err() != nil { t.Fatalf("conn.Query failed: %v", rows.Err()) } if rowCount != 5 { t.Errorf("rowCount => %d, want %d", rowCount, 5) } } func TestConnQueryValues(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) var rowCount int32 rows, err := conn.Query(context.Background(), "select 'foo'::text, 'bar'::varchar, n, null, n from generate_series(1,$1) n", 10) if err != nil { t.Fatalf("conn.Query failed: %v", err) } defer rows.Close() for rows.Next() { rowCount++ values, err := rows.Values() require.NoError(t, err) require.Len(t, values, 5) assert.Equal(t, "foo", values[0]) assert.Equal(t, "bar", values[1]) assert.EqualValues(t, rowCount, values[2]) assert.Nil(t, values[3]) assert.EqualValues(t, rowCount, values[4]) } if rows.Err() != nil { t.Fatalf("conn.Query failed: %v", rows.Err()) } if rowCount != 10 { t.Error("Select called onDataRow wrong number of times") } } // https://github.com/jackc/pgx/issues/666 func TestConnQueryValuesWhenUnableToDecode(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) // Note that this relies on pgtype.Record not supporting the text protocol. This seems safe as it is impossible to // decode the text protocol because unlike the binary protocol there is no way to determine the OIDs of the elements. rows, err := conn.Query(context.Background(), "select (array[1::oid], null)", pgx.QueryResultFormats{pgx.TextFormatCode}) require.NoError(t, err) defer rows.Close() require.True(t, rows.Next()) values, err := rows.Values() require.NoError(t, err) require.Equal(t, "({1},)", values[0]) } func TestConnQueryValuesWithUnregisteredOID(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) tx, err := conn.Begin(ctx) require.NoError(t, err) defer tx.Rollback(ctx) _, err = tx.Exec(ctx, "create type fruit as enum('orange', 'apple', 'pear')") require.NoError(t, err) rows, err := conn.Query(context.Background(), "select 'orange'::fruit") require.NoError(t, err) defer rows.Close() require.True(t, rows.Next()) values, err := rows.Values() require.NoError(t, err) require.Equal(t, "orange", values[0]) } func TestConnQueryArgsAndScanWithUnregisteredOID(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { tx, err := conn.Begin(ctx) require.NoError(t, err) defer tx.Rollback(ctx) _, err = tx.Exec(ctx, "create type fruit as enum('orange', 'apple', 'pear')") require.NoError(t, err) var result string err = conn.QueryRow(ctx, "select $1::fruit", "orange").Scan(&result) require.NoError(t, err) require.Equal(t, "orange", result) }) } // https://github.com/jackc/pgx/issues/478 func TestConnQueryReadRowMultipleTimes(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) var rowCount int32 rows, err := conn.Query(context.Background(), "select 'foo'::text, 'bar'::varchar, n, null, n from generate_series(1,$1) n", 10) require.NoError(t, err) defer rows.Close() for rows.Next() { rowCount++ for range 2 { values, err := rows.Values() require.NoError(t, err) require.Len(t, values, 5) require.Equal(t, "foo", values[0]) require.Equal(t, "bar", values[1]) require.EqualValues(t, rowCount, values[2]) require.Nil(t, values[3]) require.EqualValues(t, rowCount, values[4]) var a, b string var c int32 var d pgtype.Text var e int32 err = rows.Scan(&a, &b, &c, &d, &e) require.NoError(t, err) require.Equal(t, "foo", a) require.Equal(t, "bar", b) require.Equal(t, rowCount, c) require.False(t, d.Valid) require.Equal(t, rowCount, e) } } require.NoError(t, rows.Err()) require.Equal(t, int32(10), rowCount) } // https://github.com/jackc/pgx/issues/228 func TestRowsScanDoesNotAllowScanningBinaryFormatValuesIntoString(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server does not support point type") var s string err := conn.QueryRow(context.Background(), "select point(1,2)").Scan(&s) if err == nil || !(strings.Contains(err.Error(), "cannot scan point (OID 600) in binary format into *string")) { t.Fatalf("Expected Scan to fail to scan binary value into string but: %v", err) } ensureConnValid(t, conn) } func TestConnQueryRawValues(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) var rowCount int32 rows, err := conn.Query( context.Background(), "select 'foo'::text, 'bar'::varchar, n, null, n from generate_series(1,$1) n", pgx.QueryExecModeSimpleProtocol, 10, ) require.NoError(t, err) defer rows.Close() for rows.Next() { rowCount++ rawValues := rows.RawValues() assert.Len(t, rawValues, 5) assert.Equal(t, "foo", string(rawValues[0])) assert.Equal(t, "bar", string(rawValues[1])) assert.Equal(t, strconv.FormatInt(int64(rowCount), 10), string(rawValues[2])) assert.Nil(t, rawValues[3]) assert.Equal(t, strconv.FormatInt(int64(rowCount), 10), string(rawValues[4])) } require.NoError(t, rows.Err()) assert.EqualValues(t, 10, rowCount) } // Test that a connection stays valid when query results are closed early func TestConnQueryCloseEarly(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) // Immediately close query without reading any rows rows, err := conn.Query(context.Background(), "select generate_series(1,$1)", 10) if err != nil { t.Fatalf("conn.Query failed: %v", err) } rows.Close() ensureConnValid(t, conn) // Read partial response then close rows, err = conn.Query(context.Background(), "select generate_series(1,$1)", 10) if err != nil { t.Fatalf("conn.Query failed: %v", err) } ok := rows.Next() if !ok { t.Fatal("rows.Next terminated early") } var n int32 rows.Scan(&n) if n != 1 { t.Fatalf("Expected 1 from first row, but got %v", n) } rows.Close() ensureConnValid(t, conn) } func TestConnQueryCloseEarlyWithErrorOnWire(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) rows, err := conn.Query(context.Background(), "select 1/(10-n) from generate_series(1,10) n") if err != nil { t.Fatalf("conn.Query failed: %v", err) } assert.False(t, pgconn.SafeToRetry(err)) rows.Close() ensureConnValid(t, conn) } // Test that a connection stays valid when query results read incorrectly func TestConnQueryReadWrongTypeError(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) // Read a single value incorrectly rows, err := conn.Query(context.Background(), "select n::int4 from generate_series(1,$1) n", 10) if err != nil { t.Fatalf("conn.Query failed: %v", err) } rowsRead := 0 for rows.Next() { var t time.Time rows.Scan(&t) rowsRead++ } if rowsRead != 1 { t.Fatalf("Expected error to cause only 1 row to be read, but %d were read", rowsRead) } if rows.Err() == nil { t.Fatal("Expected Rows to have an error after an improper read but it didn't") } if rows.Err().Error() != "can't scan into dest[0] (col: n): cannot scan int4 (OID 23) in binary format into *time.Time" { t.Fatalf("Expected different Rows.Err(): %v", rows.Err()) } ensureConnValid(t, conn) } // Test that a connection stays valid when query results read incorrectly func TestConnQueryReadTooManyValues(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) // Read too many values rows, err := conn.Query(context.Background(), "select generate_series(1,$1)", 10) if err != nil { t.Fatalf("conn.Query failed: %v", err) } rowsRead := 0 for rows.Next() { var n, m int32 rows.Scan(&n, &m) rowsRead++ } if rowsRead != 1 { t.Fatalf("Expected error to cause only 1 row to be read, but %d were read", rowsRead) } if rows.Err() == nil { t.Fatal("Expected Rows to have an error after an improper read but it didn't") } ensureConnValid(t, conn) } func TestConnQueryScanIgnoreColumn(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) rows, err := conn.Query(context.Background(), "select 1::int8, 2::int8, 3::int8") if err != nil { t.Fatalf("conn.Query failed: %v", err) } ok := rows.Next() if !ok { t.Fatal("rows.Next terminated early") } var n, m int64 err = rows.Scan(&n, nil, &m) if err != nil { t.Fatalf("rows.Scan failed: %v", err) } rows.Close() if n != 1 { t.Errorf("Expected n to equal 1, but it was %d", n) } if m != 3 { t.Errorf("Expected n to equal 3, but it was %d", m) } ensureConnValid(t, conn) } // https://github.com/jackc/pgx/issues/570 func TestConnQueryDeferredError(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server does not support deferred constraint (https://github.com/cockroachdb/cockroach/issues/31632)") mustExec(t, conn, `create temporary table t ( id text primary key, n int not null, unique (n) deferrable initially deferred ); insert into t (id, n) values ('a', 1), ('b', 2), ('c', 3);`) rows, err := conn.Query(context.Background(), `update t set n=n+1 where id='b' returning *`) if err != nil { t.Fatal(err) } defer rows.Close() for rows.Next() { var id string var n int32 err = rows.Scan(&id, &n) if err != nil { t.Fatal(err) } } if rows.Err() == nil { t.Fatal("expected error 23505 but got none") } if err, ok := rows.Err().(*pgconn.PgError); !ok || err.Code != "23505" { t.Fatalf("expected error 23505, got %v", err) } ensureConnValid(t, conn) } func TestConnQueryErrorWhileReturningRows(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server uses numeric instead of int") for range 100 { func() { sql := `select 42 / (random() * 20)::integer from generate_series(1,100000)` rows, err := conn.Query(context.Background(), sql) if err != nil { t.Fatal(err) } defer rows.Close() for rows.Next() { var n int32 if err := rows.Scan(&n); err != nil { t.Fatalf("Row scan failed: %v", err) } } if _, ok := rows.Err().(*pgconn.PgError); !ok { t.Fatalf("Expected pgconn.PgError, got %v", rows.Err()) } ensureConnValid(t, conn) }() } } func TestQueryEncodeError(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) rows, err := conn.Query(context.Background(), "select $1::integer", "wrong") if err != nil { t.Errorf("conn.Query failure: %v", err) } assert.False(t, pgconn.SafeToRetry(err)) defer rows.Close() rows.Next() if rows.Err() == nil { t.Error("Expected rows.Err() to return error, but it didn't") } if !strings.Contains(rows.Err().Error(), "SQLSTATE 22P02") { t.Error("Expected rows.Err() to return different error:", rows.Err()) } } func TestQueryRowCoreTypes(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) type allTypes struct { s string f32 float32 f64 float64 b bool t time.Time oid uint32 } var actual, zero allTypes tests := []struct { sql string queryArgs []any scanArgs []any expected allTypes }{ {"select $1::text", []any{"Jack"}, []any{&actual.s}, allTypes{s: "Jack"}}, {"select $1::float4", []any{float32(1.23)}, []any{&actual.f32}, allTypes{f32: 1.23}}, {"select $1::float8", []any{float64(1.23)}, []any{&actual.f64}, allTypes{f64: 1.23}}, {"select $1::bool", []any{true}, []any{&actual.b}, allTypes{b: true}}, {"select $1::timestamptz", []any{time.Unix(123, 5000)}, []any{&actual.t}, allTypes{t: time.Unix(123, 5000)}}, {"select $1::timestamp", []any{time.Date(2010, 1, 2, 3, 4, 5, 0, time.UTC)}, []any{&actual.t}, allTypes{t: time.Date(2010, 1, 2, 3, 4, 5, 0, time.UTC)}}, {"select $1::date", []any{time.Date(1987, 1, 2, 0, 0, 0, 0, time.UTC)}, []any{&actual.t}, allTypes{t: time.Date(1987, 1, 2, 0, 0, 0, 0, time.UTC)}}, {"select $1::oid", []any{uint32(42)}, []any{&actual.oid}, allTypes{oid: 42}}, } for i, tt := range tests { actual = zero err := conn.QueryRow(context.Background(), tt.sql, tt.queryArgs...).Scan(tt.scanArgs...) if err != nil { t.Errorf("%d. Unexpected failure: %v (sql -> %v, queryArgs -> %v)", i, err, tt.sql, tt.queryArgs) } if actual.s != tt.expected.s || actual.f32 != tt.expected.f32 || actual.b != tt.expected.b || !actual.t.Equal(tt.expected.t) || actual.oid != tt.expected.oid { t.Errorf("%d. Expected %v, got %v (sql -> %v, queryArgs -> %v)", i, tt.expected, actual, tt.sql, tt.queryArgs) } ensureConnValid(t, conn) // Check that Scan errors when a core type is null err = conn.QueryRow(context.Background(), tt.sql, nil).Scan(tt.scanArgs...) if err == nil { t.Errorf("%d. Expected null to cause error, but it didn't (sql -> %v)", i, tt.sql) } ensureConnValid(t, conn) } } func TestQueryRowCoreIntegerEncoding(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) type allTypes struct { i16 int16 i32 int32 i64 int64 } var actual, zero allTypes successfulEncodeTests := []struct { sql string queryArg any scanArg any expected allTypes }{ // Check any integer type where value is within int2 range can be encoded {"select $1::int2", int(42), &actual.i16, allTypes{i16: 42}}, {"select $1::int2", int8(42), &actual.i16, allTypes{i16: 42}}, {"select $1::int2", int16(42), &actual.i16, allTypes{i16: 42}}, {"select $1::int2", int32(42), &actual.i16, allTypes{i16: 42}}, {"select $1::int2", int64(42), &actual.i16, allTypes{i16: 42}}, {"select $1::int2", uint(42), &actual.i16, allTypes{i16: 42}}, {"select $1::int2", uint8(42), &actual.i16, allTypes{i16: 42}}, {"select $1::int2", uint16(42), &actual.i16, allTypes{i16: 42}}, {"select $1::int2", uint32(42), &actual.i16, allTypes{i16: 42}}, {"select $1::int2", uint64(42), &actual.i16, allTypes{i16: 42}}, // Check any integer type where value is within int4 range can be encoded {"select $1::int4", int(42), &actual.i32, allTypes{i32: 42}}, {"select $1::int4", int8(42), &actual.i32, allTypes{i32: 42}}, {"select $1::int4", int16(42), &actual.i32, allTypes{i32: 42}}, {"select $1::int4", int32(42), &actual.i32, allTypes{i32: 42}}, {"select $1::int4", int64(42), &actual.i32, allTypes{i32: 42}}, {"select $1::int4", uint(42), &actual.i32, allTypes{i32: 42}}, {"select $1::int4", uint8(42), &actual.i32, allTypes{i32: 42}}, {"select $1::int4", uint16(42), &actual.i32, allTypes{i32: 42}}, {"select $1::int4", uint32(42), &actual.i32, allTypes{i32: 42}}, {"select $1::int4", uint64(42), &actual.i32, allTypes{i32: 42}}, // Check any integer type where value is within int8 range can be encoded {"select $1::int8", int(42), &actual.i64, allTypes{i64: 42}}, {"select $1::int8", int8(42), &actual.i64, allTypes{i64: 42}}, {"select $1::int8", int16(42), &actual.i64, allTypes{i64: 42}}, {"select $1::int8", int32(42), &actual.i64, allTypes{i64: 42}}, {"select $1::int8", int64(42), &actual.i64, allTypes{i64: 42}}, {"select $1::int8", uint(42), &actual.i64, allTypes{i64: 42}}, {"select $1::int8", uint8(42), &actual.i64, allTypes{i64: 42}}, {"select $1::int8", uint16(42), &actual.i64, allTypes{i64: 42}}, {"select $1::int8", uint32(42), &actual.i64, allTypes{i64: 42}}, {"select $1::int8", uint64(42), &actual.i64, allTypes{i64: 42}}, } for i, tt := range successfulEncodeTests { actual = zero err := conn.QueryRow(context.Background(), tt.sql, tt.queryArg).Scan(tt.scanArg) if err != nil { t.Errorf("%d. Unexpected failure: %v (sql -> %v, queryArg -> %v)", i, err, tt.sql, tt.queryArg) continue } if actual != tt.expected { t.Errorf("%d. Expected %v, got %v (sql -> %v, queryArg -> %v)", i, tt.expected, actual, tt.sql, tt.queryArg) } ensureConnValid(t, conn) } failedEncodeTests := []struct { sql string queryArg any }{ // Check any integer type where value is outside pg:int2 range cannot be encoded {"select $1::int2", int(32769)}, {"select $1::int2", int32(32769)}, {"select $1::int2", int32(32769)}, {"select $1::int2", int64(32769)}, {"select $1::int2", uint(32769)}, {"select $1::int2", uint16(32769)}, {"select $1::int2", uint32(32769)}, {"select $1::int2", uint64(32769)}, // Check any integer type where value is outside pg:int4 range cannot be encoded {"select $1::int4", int64(2147483649)}, {"select $1::int4", uint32(2147483649)}, {"select $1::int4", uint64(2147483649)}, // Check any integer type where value is outside pg:int8 range cannot be encoded {"select $1::int8", uint64(9223372036854775809)}, } for i, tt := range failedEncodeTests { err := conn.QueryRow(context.Background(), tt.sql, tt.queryArg).Scan(nil) if err == nil { t.Errorf("%d. Expected failure to encode, but unexpectedly succeeded: %v (sql -> %v, queryArg -> %v)", i, err, tt.sql, tt.queryArg) } else if !strings.Contains(err.Error(), "is greater than") { t.Errorf("%d. Expected failure to encode, but got: %v (sql -> %v, queryArg -> %v)", i, err, tt.sql, tt.queryArg) } ensureConnValid(t, conn) } } func TestQueryRowCoreIntegerDecoding(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) type allTypes struct { ui uint ui8 uint8 ui16 uint16 ui32 uint32 ui64 uint64 i int i8 int8 i16 int16 i32 int32 i64 int64 } var actual, zero allTypes successfulDecodeTests := []struct { sql string scanArg any expected allTypes }{ // Check any integer type where value is within Go:int range can be decoded {"select 42::int2", &actual.i, allTypes{i: 42}}, {"select 42::int4", &actual.i, allTypes{i: 42}}, {"select 42::int8", &actual.i, allTypes{i: 42}}, {"select -42::int2", &actual.i, allTypes{i: -42}}, {"select -42::int4", &actual.i, allTypes{i: -42}}, {"select -42::int8", &actual.i, allTypes{i: -42}}, // Check any integer type where value is within Go:int8 range can be decoded {"select 42::int2", &actual.i8, allTypes{i8: 42}}, {"select 42::int4", &actual.i8, allTypes{i8: 42}}, {"select 42::int8", &actual.i8, allTypes{i8: 42}}, {"select -42::int2", &actual.i8, allTypes{i8: -42}}, {"select -42::int4", &actual.i8, allTypes{i8: -42}}, {"select -42::int8", &actual.i8, allTypes{i8: -42}}, // Check any integer type where value is within Go:int16 range can be decoded {"select 42::int2", &actual.i16, allTypes{i16: 42}}, {"select 42::int4", &actual.i16, allTypes{i16: 42}}, {"select 42::int8", &actual.i16, allTypes{i16: 42}}, {"select -42::int2", &actual.i16, allTypes{i16: -42}}, {"select -42::int4", &actual.i16, allTypes{i16: -42}}, {"select -42::int8", &actual.i16, allTypes{i16: -42}}, // Check any integer type where value is within Go:int32 range can be decoded {"select 42::int2", &actual.i32, allTypes{i32: 42}}, {"select 42::int4", &actual.i32, allTypes{i32: 42}}, {"select 42::int8", &actual.i32, allTypes{i32: 42}}, {"select -42::int2", &actual.i32, allTypes{i32: -42}}, {"select -42::int4", &actual.i32, allTypes{i32: -42}}, {"select -42::int8", &actual.i32, allTypes{i32: -42}}, // Check any integer type where value is within Go:int64 range can be decoded {"select 42::int2", &actual.i64, allTypes{i64: 42}}, {"select 42::int4", &actual.i64, allTypes{i64: 42}}, {"select 42::int8", &actual.i64, allTypes{i64: 42}}, {"select -42::int2", &actual.i64, allTypes{i64: -42}}, {"select -42::int4", &actual.i64, allTypes{i64: -42}}, {"select -42::int8", &actual.i64, allTypes{i64: -42}}, // Check any integer type where value is within Go:uint range can be decoded {"select 128::int2", &actual.ui, allTypes{ui: 128}}, {"select 128::int4", &actual.ui, allTypes{ui: 128}}, {"select 128::int8", &actual.ui, allTypes{ui: 128}}, // Check any integer type where value is within Go:uint8 range can be decoded {"select 128::int2", &actual.ui8, allTypes{ui8: 128}}, {"select 128::int4", &actual.ui8, allTypes{ui8: 128}}, {"select 128::int8", &actual.ui8, allTypes{ui8: 128}}, // Check any integer type where value is within Go:uint16 range can be decoded {"select 42::int2", &actual.ui16, allTypes{ui16: 42}}, {"select 32768::int4", &actual.ui16, allTypes{ui16: 32768}}, {"select 32768::int8", &actual.ui16, allTypes{ui16: 32768}}, // Check any integer type where value is within Go:uint32 range can be decoded {"select 42::int2", &actual.ui32, allTypes{ui32: 42}}, {"select 42::int4", &actual.ui32, allTypes{ui32: 42}}, {"select 2147483648::int8", &actual.ui32, allTypes{ui32: 2147483648}}, // Check any integer type where value is within Go:uint64 range can be decoded {"select 42::int2", &actual.ui64, allTypes{ui64: 42}}, {"select 42::int4", &actual.ui64, allTypes{ui64: 42}}, {"select 42::int8", &actual.ui64, allTypes{ui64: 42}}, } for i, tt := range successfulDecodeTests { actual = zero err := conn.QueryRow(context.Background(), tt.sql).Scan(tt.scanArg) if err != nil { t.Errorf("%d. Unexpected failure: %v (sql -> %v)", i, err, tt.sql) continue } if actual != tt.expected { t.Errorf("%d. Expected %v, got %v (sql -> %v)", i, tt.expected, actual, tt.sql) } ensureConnValid(t, conn) } failedDecodeTests := []struct { sql string scanArg any }{ // Check any integer type where value is outside Go:int8 range cannot be decoded {"select 128::int2", &actual.i8}, {"select 128::int4", &actual.i8}, {"select 128::int8", &actual.i8}, {"select -129::int2", &actual.i8}, {"select -129::int4", &actual.i8}, {"select -129::int8", &actual.i8}, // Check any integer type where value is outside Go:int16 range cannot be decoded {"select 32768::int4", &actual.i16}, {"select 32768::int8", &actual.i16}, {"select -32769::int4", &actual.i16}, {"select -32769::int8", &actual.i16}, // Check any integer type where value is outside Go:int32 range cannot be decoded {"select 2147483648::int8", &actual.i32}, {"select -2147483649::int8", &actual.i32}, // Check any integer type where value is outside Go:uint range cannot be decoded {"select -1::int2", &actual.ui}, {"select -1::int4", &actual.ui}, {"select -1::int8", &actual.ui}, // Check any integer type where value is outside Go:uint8 range cannot be decoded {"select 256::int2", &actual.ui8}, {"select 256::int4", &actual.ui8}, {"select 256::int8", &actual.ui8}, {"select -1::int2", &actual.ui8}, {"select -1::int4", &actual.ui8}, {"select -1::int8", &actual.ui8}, // Check any integer type where value is outside Go:uint16 cannot be decoded {"select 65536::int4", &actual.ui16}, {"select 65536::int8", &actual.ui16}, {"select -1::int2", &actual.ui16}, {"select -1::int4", &actual.ui16}, {"select -1::int8", &actual.ui16}, // Check any integer type where value is outside Go:uint32 range cannot be decoded {"select 4294967296::int8", &actual.ui32}, {"select -1::int2", &actual.ui32}, {"select -1::int4", &actual.ui32}, {"select -1::int8", &actual.ui32}, // Check any integer type where value is outside Go:uint64 range cannot be decoded {"select -1::int2", &actual.ui64}, {"select -1::int4", &actual.ui64}, {"select -1::int8", &actual.ui64}, } for i, tt := range failedDecodeTests { err := conn.QueryRow(context.Background(), tt.sql).Scan(tt.scanArg) if err == nil { t.Errorf("%d. Expected failure to decode, but unexpectedly succeeded: %v (sql -> %v)", i, err, tt.sql) } else if !strings.Contains(err.Error(), "can't scan") { t.Errorf("%d. Expected failure to decode, but got: %v (sql -> %v)", i, err, tt.sql) } ensureConnValid(t, conn) } } func TestQueryRowCoreByteSlice(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) tests := []struct { sql string queryArg any expected []byte }{ {"select $1::text", "Jack", []byte("Jack")}, {"select $1::text", []byte("Jack"), []byte("Jack")}, {"select $1::varchar", []byte("Jack"), []byte("Jack")}, {"select $1::bytea", []byte{0, 15, 255, 17}, []byte{0, 15, 255, 17}}, } for i, tt := range tests { var actual []byte err := conn.QueryRow(context.Background(), tt.sql, tt.queryArg).Scan(&actual) if err != nil { t.Errorf("%d. Unexpected failure: %v (sql -> %v)", i, err, tt.sql) } if !bytes.Equal(actual, tt.expected) { t.Errorf("%d. Expected %v, got %v (sql -> %v)", i, tt.expected, actual, tt.sql) } ensureConnValid(t, conn) } } func TestQueryRowErrors(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) if conn.PgConn().ParameterStatus("crdb_version") != "" { t.Skip("Skipping due to known server missing point type") } type allTypes struct { i16 int16 s string } var actual, zero allTypes tests := []struct { sql string queryArgs []any scanArgs []any err string }{ {"select $1::badtype", []any{"Jack"}, []any{&actual.i16}, `type "badtype" does not exist`}, {"SYNTAX ERROR", []any{}, []any{&actual.i16}, "SQLSTATE 42601"}, {"select $1::text", []any{"Jack"}, []any{&actual.i16}, "cannot scan text (OID 25) in text format into *int16"}, {"select $1::point", []any{int(705)}, []any{&actual.s}, "unable to encode 705 into binary format for point (OID 600)"}, } for i, tt := range tests { actual = zero err := conn.QueryRow(context.Background(), tt.sql, tt.queryArgs...).Scan(tt.scanArgs...) if err == nil { t.Errorf("%d. Unexpected success (sql -> %v, queryArgs -> %v)", i, tt.sql, tt.queryArgs) } if err != nil && !strings.Contains(err.Error(), tt.err) { t.Errorf("%d. Expected error to contain %s, but got %v (sql -> %v, queryArgs -> %v)", i, tt.err, err, tt.sql, tt.queryArgs) } ensureConnValid(t, conn) } } func TestQueryRowNoResults(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) var n int32 err := conn.QueryRow(context.Background(), "select 1 where 1=0").Scan(&n) if err != pgx.ErrNoRows { t.Errorf("Expected pgx.ErrNoRows, got %v", err) } ensureConnValid(t, conn) } func TestQueryRowEmptyQuery(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() var n int32 err := conn.QueryRow(ctx, "").Scan(&n) require.Error(t, err) require.False(t, pgconn.Timeout(err)) ensureConnValid(t, conn) } func TestReadingValueAfterEmptyArray(t *testing.T) { conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) var a []string var b int32 err := conn.QueryRow(context.Background(), "select '{}'::text[], 42::integer").Scan(&a, &b) if err != nil { t.Fatalf("conn.QueryRow failed: %v", err) } if len(a) != 0 { t.Errorf("Expected 'a' to have length 0, but it was: %d", len(a)) } if b != 42 { t.Errorf("Expected 'b' to 42, but it was: %d", b) } } func TestReadingNullByteArray(t *testing.T) { conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) var a []byte err := conn.QueryRow(context.Background(), "select null::text").Scan(&a) if err != nil { t.Fatalf("conn.QueryRow failed: %v", err) } if a != nil { t.Errorf("Expected 'a' to be nil, but it was: %v", a) } } func TestReadingNullByteArrays(t *testing.T) { conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) rows, err := conn.Query(context.Background(), "select null::text union all select null::text") if err != nil { t.Fatalf("conn.Query failed: %v", err) } count := 0 for rows.Next() { count++ var a []byte if err := rows.Scan(&a); err != nil { t.Fatalf("failed to scan row: %v", err) } if a != nil { t.Errorf("Expected 'a' to be nil, but it was: %v", a) } } if count != 2 { t.Errorf("Expected to read 2 rows, read: %d", count) } } func TestQueryNullSliceIsSet(t *testing.T) { conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) a := []int32{1, 2, 3} err := conn.QueryRow(context.Background(), "select null::int[]").Scan(&a) if err != nil { t.Fatalf("conn.QueryRow failed: %v", err) } if a != nil { t.Errorf("Expected 'a' to be nil, but it was: %v", a) } } func TestConnQueryDatabaseSQLScanner(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) var num sql.NullFloat64 err := conn.QueryRow(context.Background(), "select '1234.567'::float8").Scan(&num) if err != nil { t.Fatalf("Scan failed: %v", err) } require.True(t, num.Valid) require.Equal(t, 1234.567, num.Float64) ensureConnValid(t, conn) } func TestConnQueryDatabaseSQLDriverValuer(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) expected := sql.NullFloat64{Float64: 1234.567, Valid: true} var actual sql.NullFloat64 err := conn.QueryRow(context.Background(), "select $1::float8", &expected).Scan(&actual) require.NoError(t, err) require.Equal(t, expected, actual) ensureConnValid(t, conn) } // https://github.com/jackc/pgx/issues/339 func TestConnQueryDatabaseSQLDriverValuerWithAutoGeneratedPointerReceiver(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) mustExec(t, conn, "create temporary table t(n numeric)") var d *sql.NullInt64 commandTag, err := conn.Exec(context.Background(), `insert into t(n) values($1)`, d) if err != nil { t.Fatal(err) } if commandTag.String() != "INSERT 0 1" { t.Fatalf("want %s, got %s", "INSERT 0 1", commandTag) } ensureConnValid(t, conn) } type nilPointerAsEmptyJSONObject struct { ID string Name string } func (v *nilPointerAsEmptyJSONObject) Value() (driver.Value, error) { if v == nil { return "{}", nil } return json.Marshal(v) } // https://github.com/jackc/pgx/issues/1566 func TestConnQueryDatabaseSQLDriverValuerCalledOnNilPointerImplementers(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) mustExec(t, conn, "create temporary table t(v json not null)") var v *nilPointerAsEmptyJSONObject commandTag, err := conn.Exec(context.Background(), `insert into t(v) values($1)`, v) require.NoError(t, err) require.Equal(t, "INSERT 0 1", commandTag.String()) var s string err = conn.QueryRow(context.Background(), "select v from t").Scan(&s) require.NoError(t, err) require.Equal(t, "{}", s) _, err = conn.Exec(context.Background(), `delete from t`) require.NoError(t, err) v = &nilPointerAsEmptyJSONObject{ID: "1", Name: "foo"} commandTag, err = conn.Exec(context.Background(), `insert into t(v) values($1)`, v) require.NoError(t, err) require.Equal(t, "INSERT 0 1", commandTag.String()) var v2 *nilPointerAsEmptyJSONObject err = conn.QueryRow(context.Background(), "select v from t").Scan(&v2) require.NoError(t, err) require.Equal(t, v, v2) ensureConnValid(t, conn) } type nilSliceAsEmptySlice []byte func (j nilSliceAsEmptySlice) Value() (driver.Value, error) { if len(j) == 0 { return []byte("[]"), nil } return []byte(j), nil } func (j *nilSliceAsEmptySlice) UnmarshalJSON(data []byte) error { *j = bytes.Clone(data) return nil } // https://github.com/jackc/pgx/issues/1860 func TestConnQueryDatabaseSQLDriverValuerCalledOnNilSliceImplementers(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) mustExec(t, conn, "create temporary table t(v json not null)") var v nilSliceAsEmptySlice commandTag, err := conn.Exec(context.Background(), `insert into t(v) values($1)`, v) require.NoError(t, err) require.Equal(t, "INSERT 0 1", commandTag.String()) var s string err = conn.QueryRow(context.Background(), "select v from t").Scan(&s) require.NoError(t, err) require.Equal(t, "[]", s) _, err = conn.Exec(context.Background(), `delete from t`) require.NoError(t, err) v = nilSliceAsEmptySlice(`{"name": "foo"}`) commandTag, err = conn.Exec(context.Background(), `insert into t(v) values($1)`, v) require.NoError(t, err) require.Equal(t, "INSERT 0 1", commandTag.String()) var v2 nilSliceAsEmptySlice err = conn.QueryRow(context.Background(), "select v from t").Scan(&v2) require.NoError(t, err) require.Equal(t, v, v2) ensureConnValid(t, conn) } type nilMapAsEmptyObject map[string]any func (j nilMapAsEmptyObject) Value() (driver.Value, error) { if j == nil { return []byte("{}"), nil } return json.Marshal(j) } func (j *nilMapAsEmptyObject) UnmarshalJSON(data []byte) error { var m map[string]any err := json.Unmarshal(data, &m) if err != nil { return err } *j = m return nil } // https://github.com/jackc/pgx/pull/2019#discussion_r1605806751 func TestConnQueryDatabaseSQLDriverValuerCalledOnNilMapImplementers(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) mustExec(t, conn, "create temporary table t(v json not null)") var v nilMapAsEmptyObject commandTag, err := conn.Exec(context.Background(), `insert into t(v) values($1)`, v) require.NoError(t, err) require.Equal(t, "INSERT 0 1", commandTag.String()) var s string err = conn.QueryRow(context.Background(), "select v from t").Scan(&s) require.NoError(t, err) require.Equal(t, "{}", s) _, err = conn.Exec(context.Background(), `delete from t`) require.NoError(t, err) v = nilMapAsEmptyObject{"name": "foo"} commandTag, err = conn.Exec(context.Background(), `insert into t(v) values($1)`, v) require.NoError(t, err) require.Equal(t, "INSERT 0 1", commandTag.String()) var v2 nilMapAsEmptyObject err = conn.QueryRow(context.Background(), "select v from t").Scan(&v2) require.NoError(t, err) require.Equal(t, v, v2) ensureConnValid(t, conn) } func TestConnQueryDatabaseSQLDriverScannerWithBinaryPgTypeThatAcceptsSameType(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) var actual sql.NullString err := conn.QueryRow(context.Background(), "select '6ba7b810-9dad-11d1-80b4-00c04fd430c8'::uuid").Scan(&actual) require.NoError(t, err) require.True(t, actual.Valid) require.Equal(t, "6ba7b810-9dad-11d1-80b4-00c04fd430c8", actual.String) ensureConnValid(t, conn) } // https://github.com/jackc/pgx/issues/1273#issuecomment-1221672175 func TestConnQueryDatabaseSQLDriverValuerTextWhenBinaryIsPreferred(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) arg := sql.NullString{String: "1.234", Valid: true} var result pgtype.Numeric err := conn.QueryRow(context.Background(), "select $1::numeric", arg).Scan(&result) require.NoError(t, err) require.True(t, result.Valid) f64, err := result.Float64Value() require.NoError(t, err) require.Equal(t, pgtype.Float8{Float64: 1.234, Valid: true}, f64) ensureConnValid(t, conn) } // https://github.com/jackc/pgx/issues/1426 func TestConnQueryDatabaseSQLNullFloat64NegativeZeroPointZero(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) tests := []float64{ -0.01, -0.001, -0.0001, } for _, val := range tests { var result sql.NullFloat64 err := conn.QueryRow(context.Background(), "select $1::numeric", val).Scan(&result) require.NoError(t, err) require.Equal(t, sql.NullFloat64{Float64: val, Valid: true}, result) } ensureConnValid(t, conn) } func TestConnQueryDatabaseSQLNullX(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) type row struct { boolValid sql.NullBool boolNull sql.NullBool int64Valid sql.NullInt64 int64Null sql.NullInt64 float64Valid sql.NullFloat64 float64Null sql.NullFloat64 stringValid sql.NullString stringNull sql.NullString } expected := row{ boolValid: sql.NullBool{Bool: true, Valid: true}, int64Valid: sql.NullInt64{Int64: 123, Valid: true}, float64Valid: sql.NullFloat64{Float64: 3.14, Valid: true}, stringValid: sql.NullString{String: "pgx", Valid: true}, } var actual row err := conn.QueryRow( context.Background(), "select $1::bool, $2::bool, $3::int8, $4::int8, $5::float8, $6::float8, $7::text, $8::text", expected.boolValid, expected.boolNull, expected.int64Valid, expected.int64Null, expected.float64Valid, expected.float64Null, expected.stringValid, expected.stringNull, ).Scan( &actual.boolValid, &actual.boolNull, &actual.int64Valid, &actual.int64Null, &actual.float64Valid, &actual.float64Null, &actual.stringValid, &actual.stringNull, ) if err != nil { t.Fatalf("Scan failed: %v", err) } if expected != actual { t.Errorf("Expected %v, but got %v", expected, actual) } ensureConnValid(t, conn) } func TestQueryContextSuccess(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) ctx := t.Context() rows, err := conn.Query(ctx, "select 42::integer") if err != nil { t.Fatal(err) } var result, rowCount int for rows.Next() { err = rows.Scan(&result) if err != nil { t.Fatal(err) } rowCount++ } if rows.Err() != nil { t.Fatal(rows.Err()) } if rowCount != 1 { t.Fatalf("Expected 1 row, got %d", rowCount) } if result != 42 { t.Fatalf("Expected result 42, got %d", result) } ensureConnValid(t, conn) } func TestQueryContextErrorWhileReceivingRows(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server uses numeric instead of int") ctx := t.Context() rows, err := conn.Query(ctx, "select 10/(10-n) from generate_series(1, 100) n") if err != nil { t.Fatal(err) } var result, rowCount int for rows.Next() { err = rows.Scan(&result) if err != nil { t.Fatal(err) } rowCount++ } if rows.Err() == nil || rows.Err().Error() != "ERROR: division by zero (SQLSTATE 22012)" { t.Fatalf("Expected division by zero error, but got %v", rows.Err()) } if rowCount != 9 { t.Fatalf("Expected 9 rows, got %d", rowCount) } if result != 10 { t.Fatalf("Expected result 10, got %d", result) } ensureConnValid(t, conn) } func TestQueryRowContextSuccess(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) ctx := t.Context() var result int err := conn.QueryRow(ctx, "select 42::integer").Scan(&result) if err != nil { t.Fatal(err) } if result != 42 { t.Fatalf("Expected result 42, got %d", result) } ensureConnValid(t, conn) } func TestQueryRowContextErrorWhileReceivingRow(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) ctx := t.Context() var result int err := conn.QueryRow(ctx, "select 10/0").Scan(&result) if err == nil || err.Error() != "ERROR: division by zero (SQLSTATE 22012)" { t.Fatalf("Expected division by zero error, but got %v", err) } ensureConnValid(t, conn) } func TestQueryCloseBefore(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) closeConn(t, conn) _, err := conn.Query(context.Background(), "select 1") require.Error(t, err) assert.True(t, pgconn.SafeToRetry(err)) } func TestScanRow(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) resultReader := conn.PgConn().ExecParams(context.Background(), "select generate_series(1,$1)", [][]byte{[]byte("10")}, nil, nil, nil) var sum, rowCount int32 for resultReader.NextRow() { var n int32 err := pgx.ScanRow(conn.TypeMap(), resultReader.FieldDescriptions(), resultReader.Values(), &n) assert.NoError(t, err) sum += n rowCount++ } _, err := resultReader.Close() require.NoError(t, err) assert.EqualValues(t, 10, rowCount) assert.EqualValues(t, 55, sum) } func TestConnSimpleProtocol(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) // Test all supported low-level types { expected := int64(42) var actual int64 err := conn.QueryRow( context.Background(), "select $1::int8", pgx.QueryExecModeSimpleProtocol, expected, ).Scan(&actual) if err != nil { t.Error(err) } if expected != actual { t.Errorf("expected %v got %v", expected, actual) } } { expected := float64(1.23) var actual float64 err := conn.QueryRow( context.Background(), "select $1::float8", pgx.QueryExecModeSimpleProtocol, expected, ).Scan(&actual) if err != nil { t.Error(err) } if expected != actual { t.Errorf("expected %v got %v", expected, actual) } } { expected := true var actual bool err := conn.QueryRow( context.Background(), "select $1::boolean", pgx.QueryExecModeSimpleProtocol, expected, ).Scan(&actual) if err != nil { t.Error(err) } if expected != actual { t.Errorf("expected %v got %v", expected, actual) } } { expected := []byte{0, 1, 20, 35, 64, 80, 120, 3, 255, 240, 128, 95} var actual []byte err := conn.QueryRow( context.Background(), "select $1::bytea", pgx.QueryExecModeSimpleProtocol, expected, ).Scan(&actual) if err != nil { t.Error(err) } if !bytes.Equal(actual, expected) { t.Errorf("expected %v got %v", expected, actual) } } { expected := "test" var actual string err := conn.QueryRow( context.Background(), "select $1::text", pgx.QueryExecModeSimpleProtocol, expected, ).Scan(&actual) if err != nil { t.Error(err) } if expected != actual { t.Errorf("expected %v got %v", expected, actual) } } { tests := []struct { expected []string }{ {[]string(nil)}, {[]string{}}, {[]string{"test", "foo", "bar"}}, {[]string{`foo'bar"\baz;quz`, `foo'bar"\baz;quz`}}, } for i, tt := range tests { var actual []string err := conn.QueryRow( context.Background(), "select $1::text[]", pgx.QueryExecModeSimpleProtocol, tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } } { tests := []struct { expected []int16 }{ {[]int16(nil)}, {[]int16{}}, {[]int16{1, 2, 3}}, } for i, tt := range tests { var actual []int16 err := conn.QueryRow( context.Background(), "select $1::smallint[]", pgx.QueryExecModeSimpleProtocol, tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } } { tests := []struct { expected []int32 }{ {[]int32(nil)}, {[]int32{}}, {[]int32{1, 2, 3}}, } for i, tt := range tests { var actual []int32 err := conn.QueryRow( context.Background(), "select $1::int[]", pgx.QueryExecModeSimpleProtocol, tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } } { tests := []struct { expected []int64 }{ {[]int64(nil)}, {[]int64{}}, {[]int64{1, 2, 3}}, } for i, tt := range tests { var actual []int64 err := conn.QueryRow( context.Background(), "select $1::bigint[]", pgx.QueryExecModeSimpleProtocol, tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } } { tests := []struct { expected []int }{ {[]int(nil)}, {[]int{}}, {[]int{1, 2, 3}}, } for i, tt := range tests { var actual []int err := conn.QueryRow( context.Background(), "select $1::bigint[]", pgx.QueryExecModeSimpleProtocol, tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } } { tests := []struct { expected []uint16 }{ {[]uint16(nil)}, {[]uint16{}}, {[]uint16{1, 2, 3}}, } for i, tt := range tests { var actual []uint16 err := conn.QueryRow( context.Background(), "select $1::smallint[]", pgx.QueryExecModeSimpleProtocol, tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } } { tests := []struct { expected []uint32 }{ {[]uint32(nil)}, {[]uint32{}}, {[]uint32{1, 2, 3}}, } for i, tt := range tests { var actual []uint32 err := conn.QueryRow( context.Background(), "select $1::bigint[]", pgx.QueryExecModeSimpleProtocol, tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } } { tests := []struct { expected []uint64 }{ {[]uint64(nil)}, {[]uint64{}}, {[]uint64{1, 2, 3}}, } for i, tt := range tests { var actual []uint64 err := conn.QueryRow( context.Background(), "select $1::bigint[]", pgx.QueryExecModeSimpleProtocol, tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } } { tests := []struct { expected []uint }{ {[]uint(nil)}, {[]uint{}}, {[]uint{1, 2, 3}}, } for i, tt := range tests { var actual []uint err := conn.QueryRow( context.Background(), "select $1::bigint[]", pgx.QueryExecModeSimpleProtocol, tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } } { tests := []struct { expected []float32 }{ {[]float32(nil)}, {[]float32{}}, {[]float32{1, 2, 3}}, } for i, tt := range tests { var actual []float32 err := conn.QueryRow( context.Background(), "select $1::float4[]", pgx.QueryExecModeSimpleProtocol, tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } } { tests := []struct { expected []float64 }{ {[]float64(nil)}, {[]float64{}}, {[]float64{1, 2, 3}}, } for i, tt := range tests { var actual []float64 err := conn.QueryRow( context.Background(), "select $1::float8[]", pgx.QueryExecModeSimpleProtocol, tt.expected, ).Scan(&actual) assert.NoErrorf(t, err, "%d", i) assert.Equalf(t, tt.expected, actual, "%d", i) } } // Test high-level type { if conn.PgConn().ParameterStatus("crdb_version") == "" { // CockroachDB doesn't support circle type. expected := pgtype.Circle{P: pgtype.Vec2{X: 1, Y: 2}, R: 1.5, Valid: true} actual := expected err := conn.QueryRow( context.Background(), "select $1::circle", pgx.QueryExecModeSimpleProtocol, &expected, ).Scan(&actual) if err != nil { t.Error(err) } if expected != actual { t.Errorf("expected %v got %v", expected, actual) } } } // Test multiple args in single query { expectedInt64 := int64(234423) expectedFloat64 := float64(-0.2312) expectedBool := true expectedBytes := []byte{255, 0, 23, 16, 87, 45, 9, 23, 45, 223} expectedString := "test" var actualInt64 int64 var actualFloat64 float64 var actualBool bool var actualBytes []byte var actualString string err := conn.QueryRow( context.Background(), "select $1::int8, $2::float8, $3::boolean, $4::bytea, $5::text", pgx.QueryExecModeSimpleProtocol, expectedInt64, expectedFloat64, expectedBool, expectedBytes, expectedString, ).Scan(&actualInt64, &actualFloat64, &actualBool, &actualBytes, &actualString) if err != nil { t.Error(err) } if expectedInt64 != actualInt64 { t.Errorf("expected %v got %v", expectedInt64, actualInt64) } if expectedFloat64 != actualFloat64 { t.Errorf("expected %v got %v", expectedFloat64, actualFloat64) } if expectedBool != actualBool { t.Errorf("expected %v got %v", expectedBool, actualBool) } if !bytes.Equal(expectedBytes, actualBytes) { t.Errorf("expected %v got %v", expectedBytes, actualBytes) } if expectedString != actualString { t.Errorf("expected %v got %v", expectedString, actualString) } } // Test dangerous cases { expected := "foo';drop table users;" var actual string err := conn.QueryRow( context.Background(), "select $1", pgx.QueryExecModeSimpleProtocol, expected, ).Scan(&actual) if err != nil { t.Error(err) } if expected != actual { t.Errorf("expected %v got %v", expected, actual) } } ensureConnValid(t, conn) } func TestConnSimpleProtocolRefusesNonUTF8ClientEncoding(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server does not support changing client_encoding (https://www.cockroachlabs.com/docs/stable/set-vars.html)") mustExec(t, conn, "set client_encoding to 'SQL_ASCII'") var expected string err := conn.QueryRow( context.Background(), "select $1", pgx.QueryExecModeSimpleProtocol, "test", ).Scan(&expected) if err == nil { t.Error("expected error when client_encoding not UTF8, but no error occurred") } ensureConnValid(t, conn) } func TestConnSimpleProtocolRefusesNonStandardConformingStrings(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server does not support standard_conforming_strings = off (https://github.com/cockroachdb/cockroach/issues/36215)") mustExec(t, conn, "set standard_conforming_strings to off") var expected string err := conn.QueryRow( context.Background(), "select $1", pgx.QueryExecModeSimpleProtocol, `\'; drop table users; --`, ).Scan(&expected) if err == nil { t.Error("expected error when standard_conforming_strings is off, but no error occurred") } ensureConnValid(t, conn) } // https://github.com/jackc/pgx/issues/895 func TestQueryErrorWithDisabledStatementCache(t *testing.T) { t.Parallel() config := mustParseConfig(t, os.Getenv("PGX_TEST_DATABASE")) config.DefaultQueryExecMode = pgx.QueryExecModeDescribeExec config.StatementCacheCapacity = 0 config.DescriptionCacheCapacity = 0 conn := mustConnect(t, config) defer closeConn(t, conn) _, err := conn.Exec(context.Background(), "create temporary table t_unq(id text primary key);") require.NoError(t, err) _, err = conn.Exec(context.Background(), "insert into t_unq (id) values ($1)", "abc") require.NoError(t, err) rows, err := conn.Query(context.Background(), "insert into t_unq (id) values ($1)", "abc") require.NoError(t, err) rows.Close() err = rows.Err() require.Error(t, err) var pgErr *pgconn.PgError if errors.As(err, &pgErr) { assert.Equal(t, "23505", pgErr.Code) } else { t.Errorf("err is not a *pgconn.PgError: %T", err) } ensureConnValid(t, conn) } func TestConnQueryQueryExecModeCacheDescribeSafeEvenWhenTypesChange(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server does not support alter column type from int to float4") _, err := conn.Exec(ctx, `create temporary table to_change ( name text primary key, age int ); insert into to_change (name, age) values ('John', 42);`) require.NoError(t, err) var name string var ageInt32 int32 err = conn.QueryRow(ctx, "select * from to_change where age = $1", pgx.QueryExecModeCacheDescribe, int32(42)).Scan(&name, &ageInt32) require.NoError(t, err) require.Equal(t, "John", name) require.Equal(t, int32(42), ageInt32) _, err = conn.Exec(ctx, `alter table to_change alter column age type float4;`) require.NoError(t, err) err = conn.QueryRow(ctx, "select * from to_change where age = $1", pgx.QueryExecModeCacheDescribe, int32(42)).Scan(&name, &ageInt32) require.NoError(t, err) require.Equal(t, "John", name) require.Equal(t, int32(42), ageInt32) var ageFloat32 float32 err = conn.QueryRow(ctx, "select * from to_change where age = $1", pgx.QueryExecModeCacheDescribe, int32(42)).Scan(&name, &ageFloat32) require.NoError(t, err) require.Equal(t, "John", name) require.Equal(t, float32(42), ageFloat32) _, err = conn.Exec(ctx, `alter table to_change drop column name;`) require.NoError(t, err) // Number of result columns has changed, so just like with a prepared statement, this will fail the first time. err = conn.QueryRow(ctx, "select * from to_change where age = $1", pgx.QueryExecModeCacheDescribe, int32(42)).Scan(&ageFloat32) require.EqualError(t, err, "ERROR: bind message has 2 result formats but query has 1 columns (SQLSTATE 08P01)") // But it will work the second time after the cache is invalidated. err = conn.QueryRow(ctx, "select * from to_change where age = $1", pgx.QueryExecModeCacheDescribe, int32(42)).Scan(&ageFloat32) require.NoError(t, err) require.Equal(t, float32(42), ageFloat32) _, err = conn.Exec(ctx, `alter table to_change alter column age type numeric;`) require.NoError(t, err) err = conn.QueryRow(ctx, "select * from to_change where age = $1", pgx.QueryExecModeCacheDescribe, int32(42)).Scan(&ageFloat32) require.NoError(t, err) require.Equal(t, float32(42), ageFloat32) } func TestQueryWithQueryRewriter(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { qr := testQueryRewriter{sql: "select $1::int", args: []any{42}} rows, err := conn.Query(ctx, "should be replaced", &qr) require.NoError(t, err) var n int32 var rowCount int for rows.Next() { rowCount++ err = rows.Scan(&n) require.NoError(t, err) } require.NoError(t, rows.Err()) }) } // https://github.com/jackc/pgx/issues/2402 func TestQueryWithEmptyQuery(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { emptyQueryStrings := []string{"", " ", "/* ping */", "-- ping"} for _, eq := range emptyQueryStrings { rows, err := conn.Query(ctx, eq) require.NoError(t, err) require.Equal(t, []pgconn.FieldDescription(nil), rows.FieldDescriptions()) require.False(t, rows.Next()) require.NoError(t, rows.Err()) } }) } // This example uses Query without using any helpers to read the results. Normally CollectRows, ForEachRow, or another // helper function should be used. func ExampleConn_Query() { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn, err := pgx.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) if err != nil { fmt.Printf("Unable to establish connection: %v", err) return } if conn.PgConn().ParameterStatus("crdb_version") != "" { // Skip test / example when running on CockroachDB. Since an example can't be skipped fake success instead. fmt.Println(`Cheeseburger: $10 Fries: $5 Soft Drink: $3`) return } // Setup example schema and data. _, err = conn.Exec(ctx, ` create temporary table products ( id int primary key generated by default as identity, name varchar(100) not null, price int not null ); insert into products (name, price) values ('Cheeseburger', 10), ('Double Cheeseburger', 14), ('Fries', 5), ('Soft Drink', 3); `) if err != nil { fmt.Printf("Unable to setup example schema and data: %v", err) return } rows, err := conn.Query(ctx, "select name, price from products where price < $1 order by price desc", 12) // It is unnecessary to check err. If an error occurred it will be returned by rows.Err() later. But in rare // cases it may be useful to detect the error as early as possible. if err != nil { fmt.Printf("Query error: %v", err) return } // Ensure rows is closed. It is safe to close rows multiple times. defer rows.Close() // Iterate through the result set for rows.Next() { var name string var price int32 err = rows.Scan(&name, &price) if err != nil { fmt.Printf("Scan error: %v", err) return } fmt.Printf("%s: $%d\n", name, price) } // rows is closed automatically when rows.Next() returns false so it is not necessary to manually close rows. // The first error encountered by the original Query call, rows.Next or rows.Scan will be returned here. if rows.Err() != nil { fmt.Printf("rows error: %v", rows.Err()) return } // Output: // Cheeseburger: $10 // Fries: $5 // Soft Drink: $3 } pgx-5.8.0/rows.go000066400000000000000000000613671512357711200136640ustar00rootroot00000000000000package pgx import ( "context" "errors" "fmt" "reflect" "strings" "sync" "time" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgtype" ) // Rows is the result set returned from *Conn.Query. Rows must be closed before // the *Conn can be used again. Rows are closed by explicitly calling Close(), // calling Next() until it returns false, or when a fatal error occurs. // // Once a Rows is closed the only methods that may be called are Close(), Err(), // and CommandTag(). // // Rows is an interface instead of a struct to allow tests to mock Query. However, // adding a method to an interface is technically a breaking change. Because of this // the Rows interface is partially excluded from semantic version requirements. // Methods will not be removed or changed, but new methods may be added. type Rows interface { // Close closes the rows, making the connection ready for use again. It is safe // to call Close after rows is already closed. Close() // Err returns any error that occurred while executing a query or reading its results. Err must be called after the // Rows is closed (either by calling Close or by Next returning false) to check if the query was successful. If it is // called before the Rows is closed it may return nil even if the query failed on the server. Err() error // CommandTag returns the command tag from this query. It is only available after Rows is closed. CommandTag() pgconn.CommandTag // FieldDescriptions returns the field descriptions of the columns. It may return nil. In particular this can occur // when there was an error executing the query. FieldDescriptions() []pgconn.FieldDescription // Next prepares the next row for reading. It returns true if there is another row and false if no more rows are // available or a fatal error has occurred. It automatically closes rows upon returning false (whether due to all rows // having been read or due to an error). // // Callers should check rows.Err() after rows.Next() returns false to detect whether result-set reading ended // prematurely due to an error. See Conn.Query for details. // // For simpler error handling, consider using the higher-level pgx v5 CollectRows() and ForEachRow() helpers instead. Next() bool // Scan reads the values from the current row into dest values positionally. dest can include pointers to core types, // values implementing the Scanner interface, and nil. nil will skip the value entirely. It is an error to call Scan // without first calling Next() and checking that it returned true. Rows is automatically closed upon error. Scan(dest ...any) error // Values returns the decoded row values. As with Scan(), it is an error to // call Values without first calling Next() and checking that it returned // true. Values() ([]any, error) // RawValues returns the unparsed bytes of the row values. The returned data is only valid until the next Next // call or the Rows is closed. RawValues() [][]byte // Conn returns the underlying *Conn on which the query was executed. This may return nil if Rows did not come from a // *Conn (e.g. if it was created by RowsFromResultReader) Conn() *Conn } // Row is a convenience wrapper over Rows that is returned by QueryRow. // // Row is an interface instead of a struct to allow tests to mock QueryRow. However, // adding a method to an interface is technically a breaking change. Because of this // the Row interface is partially excluded from semantic version requirements. // Methods will not be removed or changed, but new methods may be added. type Row interface { // Scan works the same as Rows. with the following exceptions. If no // rows were found it returns ErrNoRows. If multiple rows are returned it // ignores all but the first. Scan(dest ...any) error } // RowScanner scans an entire row at a time into the RowScanner. type RowScanner interface { // ScanRows scans the row. ScanRow(rows Rows) error } // connRow implements the Row interface for Conn.QueryRow. type connRow baseRows func (r *connRow) Scan(dest ...any) (err error) { rows := (*baseRows)(r) if rows.Err() != nil { return rows.Err() } for _, d := range dest { if _, ok := d.(*pgtype.DriverBytes); ok { rows.Close() return fmt.Errorf("cannot scan into *pgtype.DriverBytes from QueryRow") } } if !rows.Next() { if rows.Err() == nil { return ErrNoRows } return rows.Err() } rows.Scan(dest...) rows.Close() return rows.Err() } // baseRows implements the Rows interface for Conn.Query. type baseRows struct { typeMap *pgtype.Map resultReader *pgconn.ResultReader values [][]byte commandTag pgconn.CommandTag err error closed bool scanPlans []pgtype.ScanPlan scanTypes []reflect.Type conn *Conn multiResultReader *pgconn.MultiResultReader queryTracer QueryTracer batchTracer BatchTracer ctx context.Context startTime time.Time sql string args []any rowCount int } func (rows *baseRows) FieldDescriptions() []pgconn.FieldDescription { return rows.resultReader.FieldDescriptions() } func (rows *baseRows) Close() { if rows.closed { return } rows.closed = true if rows.resultReader != nil { var closeErr error rows.commandTag, closeErr = rows.resultReader.Close() if rows.err == nil { rows.err = closeErr } } if rows.multiResultReader != nil { closeErr := rows.multiResultReader.Close() if rows.err == nil { rows.err = closeErr } } if rows.err != nil && rows.conn != nil && rows.sql != "" { if sc := rows.conn.statementCache; sc != nil { sc.Invalidate(rows.sql) } if sc := rows.conn.descriptionCache; sc != nil { sc.Invalidate(rows.sql) } } if rows.batchTracer != nil { rows.batchTracer.TraceBatchQuery(rows.ctx, rows.conn, TraceBatchQueryData{SQL: rows.sql, Args: rows.args, CommandTag: rows.commandTag, Err: rows.err}) } else if rows.queryTracer != nil { rows.queryTracer.TraceQueryEnd(rows.ctx, rows.conn, TraceQueryEndData{rows.commandTag, rows.err}) } // Zero references to other memory allocations. This allows them to be GC'd even when the Rows still referenced. In // particular, when using pgxpool GC could be delayed as pgxpool.poolRows are allocated in large slices. // // https://github.com/jackc/pgx/pull/2269 rows.values = nil rows.scanPlans = nil rows.scanTypes = nil rows.ctx = nil rows.sql = "" rows.args = nil } func (rows *baseRows) CommandTag() pgconn.CommandTag { return rows.commandTag } func (rows *baseRows) Err() error { return rows.err } // fatal signals an error occurred after the query was sent to the server. It // closes the rows automatically. func (rows *baseRows) fatal(err error) { if rows.err != nil { return } rows.err = err rows.Close() } func (rows *baseRows) Next() bool { if rows.closed { return false } if rows.resultReader.NextRow() { rows.rowCount++ rows.values = rows.resultReader.Values() return true } else { rows.Close() return false } } func (rows *baseRows) Scan(dest ...any) error { m := rows.typeMap fieldDescriptions := rows.FieldDescriptions() values := rows.values if len(fieldDescriptions) != len(values) { err := fmt.Errorf("number of field descriptions must equal number of values, got %d and %d", len(fieldDescriptions), len(values)) rows.fatal(err) return err } if len(dest) == 1 { if rc, ok := dest[0].(RowScanner); ok { err := rc.ScanRow(rows) if err != nil { rows.fatal(err) } return err } } if len(fieldDescriptions) != len(dest) { err := fmt.Errorf("number of field descriptions must equal number of destinations, got %d and %d", len(fieldDescriptions), len(dest)) rows.fatal(err) return err } if rows.scanPlans == nil { rows.scanPlans = make([]pgtype.ScanPlan, len(values)) rows.scanTypes = make([]reflect.Type, len(values)) for i := range dest { rows.scanPlans[i] = m.PlanScan(fieldDescriptions[i].DataTypeOID, fieldDescriptions[i].Format, dest[i]) rows.scanTypes[i] = reflect.TypeOf(dest[i]) } } for i, dst := range dest { if dst == nil { continue } if rows.scanTypes[i] != reflect.TypeOf(dst) { rows.scanPlans[i] = m.PlanScan(fieldDescriptions[i].DataTypeOID, fieldDescriptions[i].Format, dest[i]) rows.scanTypes[i] = reflect.TypeOf(dest[i]) } err := rows.scanPlans[i].Scan(values[i], dst) if err != nil { err = ScanArgError{ColumnIndex: i, FieldName: fieldDescriptions[i].Name, Err: err} rows.fatal(err) return err } } return nil } func (rows *baseRows) Values() ([]any, error) { if rows.closed { return nil, errors.New("rows is closed") } values := make([]any, 0, len(rows.FieldDescriptions())) for i := range rows.FieldDescriptions() { buf := rows.values[i] fd := &rows.FieldDescriptions()[i] if buf == nil { values = append(values, nil) continue } if dt, ok := rows.typeMap.TypeForOID(fd.DataTypeOID); ok { value, err := dt.Codec.DecodeValue(rows.typeMap, fd.DataTypeOID, fd.Format, buf) if err != nil { rows.fatal(err) } values = append(values, value) } else { switch fd.Format { case TextFormatCode: values = append(values, string(buf)) case BinaryFormatCode: newBuf := make([]byte, len(buf)) copy(newBuf, buf) values = append(values, newBuf) default: rows.fatal(errors.New("unknown format code")) } } if rows.Err() != nil { return nil, rows.Err() } } return values, rows.Err() } func (rows *baseRows) RawValues() [][]byte { return rows.values } func (rows *baseRows) Conn() *Conn { return rows.conn } type ScanArgError struct { ColumnIndex int FieldName string Err error } func (e ScanArgError) Error() string { if e.FieldName == "?column?" { // Don't include the fieldname if it's unknown return fmt.Sprintf("can't scan into dest[%d]: %v", e.ColumnIndex, e.Err) } return fmt.Sprintf("can't scan into dest[%d] (col: %s): %v", e.ColumnIndex, e.FieldName, e.Err) } func (e ScanArgError) Unwrap() error { return e.Err } // ScanRow decodes raw row data into dest. It can be used to scan rows read from the lower level pgconn interface. // // typeMap - OID to Go type mapping. // fieldDescriptions - OID and format of values // values - the raw data as returned from the PostgreSQL server // dest - the destination that values will be decoded into func ScanRow(typeMap *pgtype.Map, fieldDescriptions []pgconn.FieldDescription, values [][]byte, dest ...any) error { if len(fieldDescriptions) != len(values) { return fmt.Errorf("number of field descriptions must equal number of values, got %d and %d", len(fieldDescriptions), len(values)) } if len(fieldDescriptions) != len(dest) { return fmt.Errorf("number of field descriptions must equal number of destinations, got %d and %d", len(fieldDescriptions), len(dest)) } for i, d := range dest { if d == nil { continue } err := typeMap.Scan(fieldDescriptions[i].DataTypeOID, fieldDescriptions[i].Format, values[i], d) if err != nil { return ScanArgError{ColumnIndex: i, FieldName: fieldDescriptions[i].Name, Err: err} } } return nil } // RowsFromResultReader returns a Rows that will read from values resultReader and decode with typeMap. It can be used // to read from the lower level pgconn interface. func RowsFromResultReader(typeMap *pgtype.Map, resultReader *pgconn.ResultReader) Rows { return &baseRows{ typeMap: typeMap, resultReader: resultReader, } } // ForEachRow iterates through rows. For each row it scans into the elements of scans and calls fn. If any row // fails to scan or fn returns an error the query will be aborted and the error will be returned. Rows will be closed // when ForEachRow returns. func ForEachRow(rows Rows, scans []any, fn func() error) (pgconn.CommandTag, error) { defer rows.Close() for rows.Next() { err := rows.Scan(scans...) if err != nil { return pgconn.CommandTag{}, err } err = fn() if err != nil { return pgconn.CommandTag{}, err } } if err := rows.Err(); err != nil { return pgconn.CommandTag{}, err } return rows.CommandTag(), nil } // CollectableRow is the subset of Rows methods that a RowToFunc is allowed to call. type CollectableRow interface { FieldDescriptions() []pgconn.FieldDescription Scan(dest ...any) error Values() ([]any, error) RawValues() [][]byte } // RowToFunc is a function that scans or otherwise converts row to a T. type RowToFunc[T any] func(row CollectableRow) (T, error) // AppendRows iterates through rows, calling fn for each row, and appending the results into a slice of T. // // This function closes the rows automatically on return. func AppendRows[T any, S ~[]T](slice S, rows Rows, fn RowToFunc[T]) (S, error) { defer rows.Close() for rows.Next() { value, err := fn(rows) if err != nil { return nil, err } slice = append(slice, value) } if err := rows.Err(); err != nil { return nil, err } return slice, nil } // CollectRows iterates through rows, calling fn for each row, and collecting the results into a slice of T. // // This function closes the rows automatically on return. func CollectRows[T any](rows Rows, fn RowToFunc[T]) ([]T, error) { return AppendRows([]T{}, rows, fn) } // CollectOneRow calls fn for the first row in rows and returns the result. If no rows are found returns an error where errors.Is(ErrNoRows) is true. // CollectOneRow is to CollectRows as QueryRow is to Query. // // This function closes the rows automatically on return. func CollectOneRow[T any](rows Rows, fn RowToFunc[T]) (T, error) { defer rows.Close() var value T var err error if !rows.Next() { if err = rows.Err(); err != nil { return value, err } return value, ErrNoRows } value, err = fn(rows) if err != nil { return value, err } // The defer rows.Close() won't have executed yet. If the query returned more than one row, rows would still be open. // rows.Close() must be called before rows.Err() so we explicitly call it here. rows.Close() return value, rows.Err() } // CollectExactlyOneRow calls fn for the first row in rows and returns the result. // - If no rows are found returns an error where errors.Is(ErrNoRows) is true. // - If more than 1 row is found returns an error where errors.Is(ErrTooManyRows) is true. // // This function closes the rows automatically on return. func CollectExactlyOneRow[T any](rows Rows, fn RowToFunc[T]) (T, error) { defer rows.Close() var ( err error value T ) if !rows.Next() { if err = rows.Err(); err != nil { return value, err } return value, ErrNoRows } value, err = fn(rows) if err != nil { return value, err } if rows.Next() { var zero T return zero, ErrTooManyRows } return value, rows.Err() } // RowTo returns a T scanned from row. func RowTo[T any](row CollectableRow) (T, error) { var value T err := row.Scan(&value) return value, err } // RowTo returns a the address of a T scanned from row. func RowToAddrOf[T any](row CollectableRow) (*T, error) { var value T err := row.Scan(&value) return &value, err } // RowToMap returns a map scanned from row. func RowToMap(row CollectableRow) (map[string]any, error) { var value map[string]any err := row.Scan((*mapRowScanner)(&value)) return value, err } type mapRowScanner map[string]any func (rs *mapRowScanner) ScanRow(rows Rows) error { values, err := rows.Values() if err != nil { return err } *rs = make(mapRowScanner, len(values)) for i := range values { (*rs)[string(rows.FieldDescriptions()[i].Name)] = values[i] } return nil } // RowToStructByPos returns a T scanned from row. T must be a struct. T must have the same number of public fields as row // has fields. The row and T fields will be matched by position. If the "db" struct tag is "-" then the field will be // ignored. func RowToStructByPos[T any](row CollectableRow) (T, error) { var value T err := (&positionalStructRowScanner{ptrToStruct: &value}).ScanRow(row) return value, err } // RowToAddrOfStructByPos returns the address of a T scanned from row. T must be a struct. T must have the same number a // public fields as row has fields. The row and T fields will be matched by position. If the "db" struct tag is "-" then // the field will be ignored. func RowToAddrOfStructByPos[T any](row CollectableRow) (*T, error) { var value T err := (&positionalStructRowScanner{ptrToStruct: &value}).ScanRow(row) return &value, err } type positionalStructRowScanner struct { ptrToStruct any } func (rs *positionalStructRowScanner) ScanRow(rows CollectableRow) error { typ := reflect.TypeOf(rs.ptrToStruct).Elem() fields := lookupStructFields(typ) if len(rows.RawValues()) > len(fields) { return fmt.Errorf( "got %d values, but dst struct has only %d fields", len(rows.RawValues()), len(fields), ) } scanTargets := setupStructScanTargets(rs.ptrToStruct, fields) return rows.Scan(scanTargets...) } // Map from reflect.Type -> []structRowField var positionalStructFieldMap sync.Map func lookupStructFields(t reflect.Type) []structRowField { if cached, ok := positionalStructFieldMap.Load(t); ok { return cached.([]structRowField) } fieldStack := make([]int, 0, 1) fields := computeStructFields(t, make([]structRowField, 0, t.NumField()), &fieldStack) fieldsIface, _ := positionalStructFieldMap.LoadOrStore(t, fields) return fieldsIface.([]structRowField) } func computeStructFields( t reflect.Type, fields []structRowField, fieldStack *[]int, ) []structRowField { tail := len(*fieldStack) *fieldStack = append(*fieldStack, 0) for i := 0; i < t.NumField(); i++ { sf := t.Field(i) (*fieldStack)[tail] = i // Handle anonymous struct embedding, but do not try to handle embedded pointers. if sf.Anonymous && sf.Type.Kind() == reflect.Struct { fields = computeStructFields(sf.Type, fields, fieldStack) } else if sf.PkgPath == "" { dbTag, _ := sf.Tag.Lookup(structTagKey) if dbTag == "-" { // Field is ignored, skip it. continue } fields = append(fields, structRowField{ path: append([]int(nil), *fieldStack...), }) } } *fieldStack = (*fieldStack)[:tail] return fields } // RowToStructByName returns a T scanned from row. T must be a struct. T must have the same number of named public // fields as row has fields. The row and T fields will be matched by name. The match is case-insensitive. The database // column name can be overridden with a "db" struct tag. If the "db" struct tag is "-" then the field will be ignored. func RowToStructByName[T any](row CollectableRow) (T, error) { var value T err := (&namedStructRowScanner{ptrToStruct: &value}).ScanRow(row) return value, err } // RowToAddrOfStructByName returns the address of a T scanned from row. T must be a struct. T must have the same number // of named public fields as row has fields. The row and T fields will be matched by name. The match is // case-insensitive. The database column name can be overridden with a "db" struct tag. If the "db" struct tag is "-" // then the field will be ignored. func RowToAddrOfStructByName[T any](row CollectableRow) (*T, error) { var value T err := (&namedStructRowScanner{ptrToStruct: &value}).ScanRow(row) return &value, err } // RowToStructByNameLax returns a T scanned from row. T must be a struct. T must have greater than or equal number of named public // fields as row has fields. The row and T fields will be matched by name. The match is case-insensitive. The database // column name can be overridden with a "db" struct tag. If the "db" struct tag is "-" then the field will be ignored. func RowToStructByNameLax[T any](row CollectableRow) (T, error) { var value T err := (&namedStructRowScanner{ptrToStruct: &value, lax: true}).ScanRow(row) return value, err } // RowToAddrOfStructByNameLax returns the address of a T scanned from row. T must be a struct. T must have greater than or // equal number of named public fields as row has fields. The row and T fields will be matched by name. The match is // case-insensitive. The database column name can be overridden with a "db" struct tag. If the "db" struct tag is "-" // then the field will be ignored. func RowToAddrOfStructByNameLax[T any](row CollectableRow) (*T, error) { var value T err := (&namedStructRowScanner{ptrToStruct: &value, lax: true}).ScanRow(row) return &value, err } type namedStructRowScanner struct { ptrToStruct any lax bool } func (rs *namedStructRowScanner) ScanRow(rows CollectableRow) error { typ := reflect.TypeOf(rs.ptrToStruct).Elem() fldDescs := rows.FieldDescriptions() namedStructFields, err := lookupNamedStructFields(typ, fldDescs) if err != nil { return err } if !rs.lax && namedStructFields.missingField != "" { return fmt.Errorf("cannot find field %s in returned row", namedStructFields.missingField) } fields := namedStructFields.fields scanTargets := setupStructScanTargets(rs.ptrToStruct, fields) return rows.Scan(scanTargets...) } // Map from namedStructFieldMap -> *namedStructFields var namedStructFieldMap sync.Map type namedStructFieldsKey struct { t reflect.Type colNames string } type namedStructFields struct { fields []structRowField // missingField is the first field from the struct without a corresponding row field. // This is used to construct the correct error message for non-lax queries. missingField string } func lookupNamedStructFields( t reflect.Type, fldDescs []pgconn.FieldDescription, ) (*namedStructFields, error) { key := namedStructFieldsKey{ t: t, colNames: joinFieldNames(fldDescs), } if cached, ok := namedStructFieldMap.Load(key); ok { return cached.(*namedStructFields), nil } // We could probably do two-levels of caching, where we compute the key -> fields mapping // for a type only once, cache it by type, then use that to compute the column -> fields // mapping for a given set of columns. fieldStack := make([]int, 0, 1) fields, missingField := computeNamedStructFields( fldDescs, t, make([]structRowField, len(fldDescs)), &fieldStack, ) for i, f := range fields { if f.path == nil { return nil, fmt.Errorf( "struct doesn't have corresponding row field %s", fldDescs[i].Name, ) } } fieldsIface, _ := namedStructFieldMap.LoadOrStore( key, &namedStructFields{fields: fields, missingField: missingField}, ) return fieldsIface.(*namedStructFields), nil } func joinFieldNames(fldDescs []pgconn.FieldDescription) string { switch len(fldDescs) { case 0: return "" case 1: return fldDescs[0].Name } totalSize := len(fldDescs) - 1 // Space for separator bytes. for _, d := range fldDescs { totalSize += len(d.Name) } var b strings.Builder b.Grow(totalSize) b.WriteString(fldDescs[0].Name) for _, d := range fldDescs[1:] { b.WriteByte(0) // Join with NUL byte as it's (presumably) not a valid column character. b.WriteString(d.Name) } return b.String() } func computeNamedStructFields( fldDescs []pgconn.FieldDescription, t reflect.Type, fields []structRowField, fieldStack *[]int, ) ([]structRowField, string) { var missingField string tail := len(*fieldStack) *fieldStack = append(*fieldStack, 0) for i := 0; i < t.NumField(); i++ { sf := t.Field(i) (*fieldStack)[tail] = i if sf.PkgPath != "" && !sf.Anonymous { // Field is unexported, skip it. continue } // Handle anonymous struct embedding, but do not try to handle embedded pointers. if sf.Anonymous && sf.Type.Kind() == reflect.Struct { var missingSubField string fields, missingSubField = computeNamedStructFields( fldDescs, sf.Type, fields, fieldStack, ) if missingField == "" { missingField = missingSubField } } else { dbTag, dbTagPresent := sf.Tag.Lookup(structTagKey) if dbTagPresent { dbTag, _, _ = strings.Cut(dbTag, ",") } if dbTag == "-" { // Field is ignored, skip it. continue } colName := dbTag if !dbTagPresent { colName = sf.Name } fpos := fieldPosByName(fldDescs, colName, !dbTagPresent) if fpos == -1 { if missingField == "" { missingField = colName } continue } fields[fpos] = structRowField{ path: append([]int(nil), *fieldStack...), } } } *fieldStack = (*fieldStack)[:tail] return fields, missingField } const structTagKey = "db" func fieldPosByName(fldDescs []pgconn.FieldDescription, field string, normalize bool) (i int) { i = -1 if normalize { field = strings.ReplaceAll(field, "_", "") } for i, desc := range fldDescs { if normalize { if strings.EqualFold(strings.ReplaceAll(desc.Name, "_", ""), field) { return i } } else { if desc.Name == field { return i } } } return } // structRowField describes a field of a struct. // // TODO: It would be a bit more efficient to track the path using the pointer // offset within the (outermost) struct and use unsafe.Pointer arithmetic to // construct references when scanning rows. However, it's not clear it's worth // using unsafe for this. type structRowField struct { path []int } func setupStructScanTargets(receiver any, fields []structRowField) []any { scanTargets := make([]any, len(fields)) v := reflect.ValueOf(receiver).Elem() for i, f := range fields { scanTargets[i] = v.FieldByIndex(f.path).Addr().Interface() } return scanTargets } pgx-5.8.0/rows_test.go000066400000000000000000000726471512357711200147260ustar00rootroot00000000000000package pgx_test import ( "context" "errors" "fmt" "os" "testing" "time" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgxtest" ) type testRowScanner struct { name string age int32 } func (rs *testRowScanner) ScanRow(rows pgx.Rows) error { return rows.Scan(&rs.name, &rs.age) } func TestRowScanner(t *testing.T) { t.Parallel() defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var s testRowScanner err := conn.QueryRow(ctx, "select 'Adam' as name, 72 as height").Scan(&s) require.NoError(t, err) require.Equal(t, "Adam", s.name) require.Equal(t, int32(72), s.age) }) } type testErrRowScanner string func (ers *testErrRowScanner) ScanRow(rows pgx.Rows) error { return errors.New(string(*ers)) } // https://github.com/jackc/pgx/issues/1654 func TestRowScannerErrorIsFatalToRows(t *testing.T) { t.Parallel() defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { s := testErrRowScanner("foo") err := conn.QueryRow(ctx, "select 'Adam' as name, 72 as height").Scan(&s) require.EqualError(t, err, "foo") }) } func TestForEachRow(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var actualResults []any rows, _ := conn.Query( context.Background(), "select n, n * 2 from generate_series(1, $1) n", 3, ) var a, b int ct, err := pgx.ForEachRow(rows, []any{&a, &b}, func() error { actualResults = append(actualResults, []any{a, b}) return nil }) require.NoError(t, err) expectedResults := []any{ []any{1, 2}, []any{2, 4}, []any{3, 6}, } require.Equal(t, expectedResults, actualResults) require.EqualValues(t, 3, ct.RowsAffected()) }) } func TestForEachRowScanError(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var actualResults []any rows, _ := conn.Query( context.Background(), "select 'foo', 'bar' from generate_series(1, $1) n", 3, ) var a, b int ct, err := pgx.ForEachRow(rows, []any{&a, &b}, func() error { actualResults = append(actualResults, []any{a, b}) return nil }) require.EqualError(t, err, "can't scan into dest[0]: cannot scan text (OID 25) in text format into *int") require.Equal(t, pgconn.CommandTag{}, ct) }) } func TestForEachRowAbort(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query( context.Background(), "select n, n * 2 from generate_series(1, $1) n", 3, ) var a, b int ct, err := pgx.ForEachRow(rows, []any{&a, &b}, func() error { return errors.New("abort") }) require.EqualError(t, err, "abort") require.Equal(t, pgconn.CommandTag{}, ct) }) } func ExampleForEachRow() { conn, err := pgx.Connect(context.Background(), os.Getenv("PGX_TEST_DATABASE")) if err != nil { fmt.Printf("Unable to establish connection: %v", err) return } rows, _ := conn.Query( context.Background(), "select n, n * 2 from generate_series(1, $1) n", 3, ) var a, b int _, err = pgx.ForEachRow(rows, []any{&a, &b}, func() error { fmt.Printf("%v, %v\n", a, b) return nil }) if err != nil { fmt.Printf("ForEachRow error: %v", err) return } // Output: // 1, 2 // 2, 4 // 3, 6 } func TestCollectRows(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select n from generate_series(0, 99) n`) numbers, err := pgx.CollectRows(rows, func(row pgx.CollectableRow) (int32, error) { var n int32 err := row.Scan(&n) return n, err }) require.NoError(t, err) assert.Len(t, numbers, 100) for i := range numbers { assert.Equal(t, int32(i), numbers[i]) } }) } func TestCollectRowsEmpty(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select n from generate_series(1, 0) n`) numbers, err := pgx.CollectRows(rows, func(row pgx.CollectableRow) (int32, error) { var n int32 err := row.Scan(&n) return n, err }) require.NoError(t, err) require.NotNil(t, numbers) assert.Empty(t, numbers) }) } // This example uses CollectRows with a manually written collector function. In most cases RowTo, RowToAddrOf, // RowToStructByPos, RowToAddrOfStructByPos, or another generic function would be used. func ExampleCollectRows() { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn, err := pgx.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) if err != nil { fmt.Printf("Unable to establish connection: %v", err) return } rows, _ := conn.Query(ctx, `select n from generate_series(1, 5) n`) numbers, err := pgx.CollectRows(rows, func(row pgx.CollectableRow) (int32, error) { var n int32 err := row.Scan(&n) return n, err }) if err != nil { fmt.Printf("CollectRows error: %v", err) return } fmt.Println(numbers) // Output: // [1 2 3 4 5] } func TestCollectOneRow(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 42`) n, err := pgx.CollectOneRow(rows, func(row pgx.CollectableRow) (int32, error) { var n int32 err := row.Scan(&n) return n, err }) assert.NoError(t, err) assert.Equal(t, int32(42), n) }) } func TestCollectOneRowNotFound(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 42 where false`) n, err := pgx.CollectOneRow(rows, func(row pgx.CollectableRow) (int32, error) { var n int32 err := row.Scan(&n) return n, err }) assert.ErrorIs(t, err, pgx.ErrNoRows) assert.Equal(t, int32(0), n) }) } func TestCollectOneRowIgnoresExtraRows(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select n from generate_series(42, 99) n`) n, err := pgx.CollectOneRow(rows, func(row pgx.CollectableRow) (int32, error) { var n int32 err := row.Scan(&n) return n, err }) require.NoError(t, err) assert.NoError(t, err) assert.Equal(t, int32(42), n) }) } // https://github.com/jackc/pgx/issues/1334 func TestCollectOneRowPrefersPostgreSQLErrorOverErrNoRows(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Exec(ctx, `create temporary table t (name text not null unique)`) require.NoError(t, err) var name string rows, _ := conn.Query(ctx, `insert into t (name) values ('foo') returning name`) name, err = pgx.CollectOneRow(rows, func(row pgx.CollectableRow) (string, error) { var n string err := row.Scan(&n) return n, err }) require.NoError(t, err) require.Equal(t, "foo", name) rows, _ = conn.Query(ctx, `insert into t (name) values ('foo') returning name`) name, err = pgx.CollectOneRow(rows, func(row pgx.CollectableRow) (string, error) { var n string err := row.Scan(&n) return n, err }) require.Error(t, err) var pgErr *pgconn.PgError require.ErrorAs(t, err, &pgErr) require.Equal(t, "23505", pgErr.Code) require.Equal(t, "", name) }) } func TestCollectExactlyOneRow(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 42`) n, err := pgx.CollectExactlyOneRow(rows, func(row pgx.CollectableRow) (int32, error) { var n int32 err := row.Scan(&n) return n, err }) assert.NoError(t, err) assert.Equal(t, int32(42), n) }) } func TestCollectExactlyOneRowNotFound(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 42 where false`) n, err := pgx.CollectExactlyOneRow(rows, func(row pgx.CollectableRow) (int32, error) { var n int32 err := row.Scan(&n) return n, err }) assert.ErrorIs(t, err, pgx.ErrNoRows) assert.Equal(t, int32(0), n) }) } func TestCollectExactlyOneRowExtraRows(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select n from generate_series(42, 99) n`) n, err := pgx.CollectExactlyOneRow(rows, func(row pgx.CollectableRow) (int32, error) { var n int32 err := row.Scan(&n) return n, err }) assert.ErrorIs(t, err, pgx.ErrTooManyRows) assert.Equal(t, int32(0), n) }) } func TestRowTo(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select n from generate_series(0, 99) n`) numbers, err := pgx.CollectRows(rows, pgx.RowTo[int32]) require.NoError(t, err) assert.Len(t, numbers, 100) for i := range numbers { assert.Equal(t, int32(i), numbers[i]) } }) } func ExampleRowTo() { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn, err := pgx.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) if err != nil { fmt.Printf("Unable to establish connection: %v", err) return } rows, _ := conn.Query(ctx, `select n from generate_series(1, 5) n`) numbers, err := pgx.CollectRows(rows, pgx.RowTo[int32]) if err != nil { fmt.Printf("CollectRows error: %v", err) return } fmt.Println(numbers) // Output: // [1 2 3 4 5] } func TestRowToAddrOf(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select n from generate_series(0, 99) n`) numbers, err := pgx.CollectRows(rows, pgx.RowToAddrOf[int32]) require.NoError(t, err) assert.Len(t, numbers, 100) for i := range numbers { assert.Equal(t, int32(i), *numbers[i]) } }) } func ExampleRowToAddrOf() { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn, err := pgx.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) if err != nil { fmt.Printf("Unable to establish connection: %v", err) return } rows, _ := conn.Query(ctx, `select n from generate_series(1, 5) n`) pNumbers, err := pgx.CollectRows(rows, pgx.RowToAddrOf[int32]) if err != nil { fmt.Printf("CollectRows error: %v", err) return } for _, p := range pNumbers { fmt.Println(*p) } // Output: // 1 // 2 // 3 // 4 // 5 } func TestRowToMap(t *testing.T) { defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 'Joe' as name, n as age from generate_series(0, 9) n`) slice, err := pgx.CollectRows(rows, pgx.RowToMap) require.NoError(t, err) assert.Len(t, slice, 10) for i := range slice { assert.Equal(t, "Joe", slice[i]["name"]) assert.EqualValues(t, i, slice[i]["age"]) } }) } func TestRowToStructByPos(t *testing.T) { type person struct { Name string Age int32 } defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 'Joe' as name, n as age from generate_series(0, 9) n`) slice, err := pgx.CollectRows(rows, pgx.RowToStructByPos[person]) require.NoError(t, err) assert.Len(t, slice, 10) for i := range slice { assert.Equal(t, "Joe", slice[i].Name) assert.EqualValues(t, i, slice[i].Age) } }) } func TestRowToStructByPosIgnoredField(t *testing.T) { type person struct { Name string Age int32 `db:"-"` } defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 'Joe' as name from generate_series(0, 9) n`) slice, err := pgx.CollectRows(rows, pgx.RowToStructByPos[person]) require.NoError(t, err) assert.Len(t, slice, 10) for i := range slice { assert.Equal(t, "Joe", slice[i].Name) } }) } func TestRowToStructByPosEmbeddedStruct(t *testing.T) { type Name struct { First string Last string } type person struct { Name Age int32 } defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 'John' as first_name, 'Smith' as last_name, n as age from generate_series(0, 9) n`) slice, err := pgx.CollectRows(rows, pgx.RowToStructByPos[person]) require.NoError(t, err) assert.Len(t, slice, 10) for i := range slice { assert.Equal(t, "John", slice[i].Name.First) assert.Equal(t, "Smith", slice[i].Name.Last) assert.EqualValues(t, i, slice[i].Age) } }) } func TestRowToStructByPosMultipleEmbeddedStruct(t *testing.T) { type Sandwich struct { Bread string Salad string } type Drink struct { Ml int } type meal struct { Sandwich Drink } defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 'Baguette' as bread, 'Lettuce' as salad, drink_ml from generate_series(0, 9) drink_ml`) slice, err := pgx.CollectRows(rows, pgx.RowToStructByPos[meal]) require.NoError(t, err) assert.Len(t, slice, 10) for i := range slice { assert.Equal(t, "Baguette", slice[i].Sandwich.Bread) assert.Equal(t, "Lettuce", slice[i].Sandwich.Salad) assert.EqualValues(t, i, slice[i].Drink.Ml) } }) } func TestRowToStructByPosEmbeddedUnexportedStruct(t *testing.T) { type name struct { First string Last string } type person struct { name Age int32 } defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 'John' as first_name, 'Smith' as last_name, n as age from generate_series(0, 9) n`) slice, err := pgx.CollectRows(rows, pgx.RowToStructByPos[person]) require.NoError(t, err) assert.Len(t, slice, 10) for i := range slice { assert.Equal(t, "John", slice[i].name.First) assert.Equal(t, "Smith", slice[i].name.Last) assert.EqualValues(t, i, slice[i].Age) } }) } // Pointer to struct is not supported. But check that we don't panic. func TestRowToStructByPosEmbeddedPointerToStruct(t *testing.T) { type Name struct { First string Last string } type person struct { *Name Age int32 } defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 'John' as first_name, 'Smith' as last_name, n as age from generate_series(0, 9) n`) _, err := pgx.CollectRows(rows, pgx.RowToStructByPos[person]) require.EqualError(t, err, "got 3 values, but dst struct has only 2 fields") }) } func ExampleRowToStructByPos() { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn, err := pgx.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) if err != nil { fmt.Printf("Unable to establish connection: %v", err) return } if conn.PgConn().ParameterStatus("crdb_version") != "" { // Skip test / example when running on CockroachDB. Since an example can't be skipped fake success instead. fmt.Println(`Cheeseburger: $10 Fries: $5 Soft Drink: $3`) return } // Setup example schema and data. _, err = conn.Exec(ctx, ` create temporary table products ( id int primary key generated by default as identity, name varchar(100) not null, price int not null ); insert into products (name, price) values ('Cheeseburger', 10), ('Double Cheeseburger', 14), ('Fries', 5), ('Soft Drink', 3); `) if err != nil { fmt.Printf("Unable to setup example schema and data: %v", err) return } type product struct { ID int32 Name string Price int32 } rows, _ := conn.Query(ctx, "select * from products where price < $1 order by price desc", 12) products, err := pgx.CollectRows(rows, pgx.RowToStructByPos[product]) if err != nil { fmt.Printf("CollectRows error: %v", err) return } for _, p := range products { fmt.Printf("%s: $%d\n", p.Name, p.Price) } // Output: // Cheeseburger: $10 // Fries: $5 // Soft Drink: $3 } func TestRowToAddrOfStructPos(t *testing.T) { type person struct { Name string Age int32 } defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 'Joe' as name, n as age from generate_series(0, 9) n`) slice, err := pgx.CollectRows(rows, pgx.RowToAddrOfStructByPos[person]) require.NoError(t, err) assert.Len(t, slice, 10) for i := range slice { assert.Equal(t, "Joe", slice[i].Name) assert.EqualValues(t, i, slice[i].Age) } }) } func TestRowToStructByName(t *testing.T) { type person struct { Last string First string Age int32 AccountID string } defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 'John' as first, 'Smith' as last, n as age, 'd5e49d3f' as account_id from generate_series(0, 9) n`) slice, err := pgx.CollectRows(rows, pgx.RowToStructByName[person]) assert.NoError(t, err) assert.Len(t, slice, 10) for i := range slice { assert.Equal(t, "Smith", slice[i].Last) assert.Equal(t, "John", slice[i].First) assert.EqualValues(t, i, slice[i].Age) assert.Equal(t, "d5e49d3f", slice[i].AccountID) } // check missing fields in a returned row rows, _ = conn.Query(ctx, `select 'Smith' as last, n as age from generate_series(0, 9) n`) _, err = pgx.CollectRows(rows, pgx.RowToStructByName[person]) assert.ErrorContains(t, err, "cannot find field First in returned row") // check missing field in a destination struct rows, _ = conn.Query(ctx, `select 'John' as first, 'Smith' as last, n as age, 'd5e49d3f' as account_id, null as ignore from generate_series(0, 9) n`) _, err = pgx.CollectRows(rows, pgx.RowToAddrOfStructByName[person]) assert.ErrorContains(t, err, "struct doesn't have corresponding row field ignore") }) } func TestRowToStructByNameDbTags(t *testing.T) { type person struct { Last string `db:"last_name"` First string `db:"first_name"` Age int32 `db:"age"` AccountID string `db:"account_id"` AnotherAccountID string `db:"account__id"` } defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 'John' as first_name, 'Smith' as last_name, n as age, 'd5e49d3f' as account_id, '5e49d321' as account__id from generate_series(0, 9) n`) slice, err := pgx.CollectRows(rows, pgx.RowToStructByName[person]) assert.NoError(t, err) assert.Len(t, slice, 10) for i := range slice { assert.Equal(t, "Smith", slice[i].Last) assert.Equal(t, "John", slice[i].First) assert.EqualValues(t, i, slice[i].Age) assert.Equal(t, "d5e49d3f", slice[i].AccountID) assert.Equal(t, "5e49d321", slice[i].AnotherAccountID) } // check missing fields in a returned row rows, _ = conn.Query(ctx, `select 'Smith' as last_name, n as age from generate_series(0, 9) n`) _, err = pgx.CollectRows(rows, pgx.RowToStructByName[person]) assert.ErrorContains(t, err, "cannot find field first_name in returned row") // check missing field in a destination struct rows, _ = conn.Query(ctx, `select 'John' as first_name, 'Smith' as last_name, n as age, 'd5e49d3f' as account_id, '5e49d321' as account__id, null as ignore from generate_series(0, 9) n`) _, err = pgx.CollectRows(rows, pgx.RowToAddrOfStructByName[person]) assert.ErrorContains(t, err, "struct doesn't have corresponding row field ignore") }) } func TestRowToStructByNameEmbeddedStruct(t *testing.T) { type Name struct { Last string `db:"last_name"` First string `db:"first_name"` } type person struct { Ignore bool `db:"-"` Name Age int32 } defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 'John' as first_name, 'Smith' as last_name, n as age from generate_series(0, 9) n`) slice, err := pgx.CollectRows(rows, pgx.RowToStructByName[person]) assert.NoError(t, err) assert.Len(t, slice, 10) for i := range slice { assert.Equal(t, "Smith", slice[i].Name.Last) assert.Equal(t, "John", slice[i].Name.First) assert.EqualValues(t, i, slice[i].Age) } // check missing fields in a returned row rows, _ = conn.Query(ctx, `select 'Smith' as last_name, n as age from generate_series(0, 9) n`) _, err = pgx.CollectRows(rows, pgx.RowToStructByName[person]) assert.ErrorContains(t, err, "cannot find field first_name in returned row") // check missing field in a destination struct rows, _ = conn.Query(ctx, `select 'John' as first_name, 'Smith' as last_name, n as age, null as ignore from generate_series(0, 9) n`) _, err = pgx.CollectRows(rows, pgx.RowToAddrOfStructByName[person]) assert.ErrorContains(t, err, "struct doesn't have corresponding row field ignore") }) } func ExampleRowToStructByName() { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn, err := pgx.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) if err != nil { fmt.Printf("Unable to establish connection: %v", err) return } if conn.PgConn().ParameterStatus("crdb_version") != "" { // Skip test / example when running on CockroachDB. Since an example can't be skipped fake success instead. fmt.Println(`Cheeseburger: $10 Fries: $5 Soft Drink: $3`) return } // Setup example schema and data. _, err = conn.Exec(ctx, ` create temporary table products ( id int primary key generated by default as identity, name varchar(100) not null, price int not null ); insert into products (name, price) values ('Cheeseburger', 10), ('Double Cheeseburger', 14), ('Fries', 5), ('Soft Drink', 3); `) if err != nil { fmt.Printf("Unable to setup example schema and data: %v", err) return } type product struct { ID int32 Name string Price int32 } rows, _ := conn.Query(ctx, "select * from products where price < $1 order by price desc", 12) products, err := pgx.CollectRows(rows, pgx.RowToStructByName[product]) if err != nil { fmt.Printf("CollectRows error: %v", err) return } for _, p := range products { fmt.Printf("%s: $%d\n", p.Name, p.Price) } // Output: // Cheeseburger: $10 // Fries: $5 // Soft Drink: $3 } func TestRowToStructByNameLax(t *testing.T) { type person struct { Last string First string Age int32 Ignore bool `db:"-"` } defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 'John' as first, 'Smith' as last, n as age from generate_series(0, 9) n`) slice, err := pgx.CollectRows(rows, pgx.RowToStructByNameLax[person]) assert.NoError(t, err) assert.Len(t, slice, 10) for i := range slice { assert.Equal(t, "Smith", slice[i].Last) assert.Equal(t, "John", slice[i].First) assert.EqualValues(t, i, slice[i].Age) } // check missing fields in a returned row rows, _ = conn.Query(ctx, `select 'John' as first, n as age from generate_series(0, 9) n`) slice, err = pgx.CollectRows(rows, pgx.RowToStructByNameLax[person]) assert.NoError(t, err) assert.Len(t, slice, 10) for i := range slice { assert.Equal(t, "John", slice[i].First) assert.EqualValues(t, i, slice[i].Age) } // check extra fields in a returned row rows, _ = conn.Query(ctx, `select 'John' as first, 'Smith' as last, n as age, null as ignore from generate_series(0, 9) n`) _, err = pgx.CollectRows(rows, pgx.RowToAddrOfStructByNameLax[person]) assert.ErrorContains(t, err, "struct doesn't have corresponding row field ignore") // check missing fields in a destination struct rows, _ = conn.Query(ctx, `select 'Smith' as last, 'D.' as middle, n as age from generate_series(0, 9) n`) _, err = pgx.CollectRows(rows, pgx.RowToAddrOfStructByNameLax[person]) assert.ErrorContains(t, err, "struct doesn't have corresponding row field middle") // check ignored fields in a destination struct rows, _ = conn.Query(ctx, `select 'Smith' as last, n as age, null as ignore from generate_series(0, 9) n`) _, err = pgx.CollectRows(rows, pgx.RowToAddrOfStructByNameLax[person]) assert.ErrorContains(t, err, "struct doesn't have corresponding row field ignore") }) } func TestRowToStructByNameLaxEmbeddedStruct(t *testing.T) { type Name struct { Last string `db:"last_name"` First string `db:"first_name"` } type person struct { Ignore bool `db:"-"` Name Age int32 } defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { rows, _ := conn.Query(ctx, `select 'John' as first_name, 'Smith' as last_name, n as age from generate_series(0, 9) n`) slice, err := pgx.CollectRows(rows, pgx.RowToStructByNameLax[person]) assert.NoError(t, err) assert.Len(t, slice, 10) for i := range slice { assert.Equal(t, "Smith", slice[i].Name.Last) assert.Equal(t, "John", slice[i].Name.First) assert.EqualValues(t, i, slice[i].Age) } // check missing fields in a returned row rows, _ = conn.Query(ctx, `select 'John' as first_name, n as age from generate_series(0, 9) n`) slice, err = pgx.CollectRows(rows, pgx.RowToStructByNameLax[person]) assert.NoError(t, err) assert.Len(t, slice, 10) for i := range slice { assert.Equal(t, "John", slice[i].Name.First) assert.EqualValues(t, i, slice[i].Age) } // check extra fields in a returned row rows, _ = conn.Query(ctx, `select 'John' as first_name, 'Smith' as last_name, n as age, null as ignore from generate_series(0, 9) n`) _, err = pgx.CollectRows(rows, pgx.RowToAddrOfStructByNameLax[person]) assert.ErrorContains(t, err, "struct doesn't have corresponding row field ignore") // check missing fields in a destination struct rows, _ = conn.Query(ctx, `select 'Smith' as last_name, 'D.' as middle_name, n as age from generate_series(0, 9) n`) _, err = pgx.CollectRows(rows, pgx.RowToAddrOfStructByNameLax[person]) assert.ErrorContains(t, err, "struct doesn't have corresponding row field middle_name") // check ignored fields in a destination struct rows, _ = conn.Query(ctx, `select 'Smith' as last_name, n as age, null as ignore from generate_series(0, 9) n`) _, err = pgx.CollectRows(rows, pgx.RowToAddrOfStructByNameLax[person]) assert.ErrorContains(t, err, "struct doesn't have corresponding row field ignore") }) } func TestRowToStructByNameLaxRowValue(t *testing.T) { type AnotherTable struct{} type User struct { UserID int `json:"userId" db:"user_id"` Name string `json:"name" db:"name"` } type UserAPIKey struct { UserAPIKeyID int `json:"userApiKeyId" db:"user_api_key_id"` UserID int `json:"userId" db:"user_id"` User *User `json:"user" db:"user"` AnotherTable *AnotherTable `json:"anotherTable" db:"another_table"` } defaultConnTestRunner.RunTest(context.Background(), t, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "") rows, _ := conn.Query(ctx, ` WITH user_api_keys AS ( SELECT 1 AS user_id, 101 AS user_api_key_id, 'abc123' AS api_key ), users AS ( SELECT 1 AS user_id, 'John Doe' AS name ) SELECT user_api_keys.user_api_key_id, user_api_keys.user_id, row(users.*) AS user FROM user_api_keys LEFT JOIN users ON users.user_id = user_api_keys.user_id WHERE user_api_keys.api_key = 'abc123'; `) slice, err := pgx.CollectRows(rows, pgx.RowToStructByNameLax[UserAPIKey]) assert.NoError(t, err) assert.ElementsMatch(t, slice, []UserAPIKey{{UserAPIKeyID: 101, UserID: 1, User: &User{UserID: 1, Name: "John Doe"}, AnotherTable: nil}}) }) } func ExampleRowToStructByNameLax() { ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() conn, err := pgx.Connect(ctx, os.Getenv("PGX_TEST_DATABASE")) if err != nil { fmt.Printf("Unable to establish connection: %v", err) return } if conn.PgConn().ParameterStatus("crdb_version") != "" { // Skip test / example when running on CockroachDB. Since an example can't be skipped fake success instead. fmt.Println(`Cheeseburger: $10 Fries: $5 Soft Drink: $3`) return } // Setup example schema and data. _, err = conn.Exec(ctx, ` create temporary table products ( id int primary key generated by default as identity, name varchar(100) not null, price int not null ); insert into products (name, price) values ('Cheeseburger', 10), ('Double Cheeseburger', 14), ('Fries', 5), ('Soft Drink', 3); `) if err != nil { fmt.Printf("Unable to setup example schema and data: %v", err) return } type product struct { ID int32 Name string Type string Price int32 } rows, _ := conn.Query(ctx, "select * from products where price < $1 order by price desc", 12) products, err := pgx.CollectRows(rows, pgx.RowToStructByNameLax[product]) if err != nil { fmt.Printf("CollectRows error: %v", err) return } for _, p := range products { fmt.Printf("%s: $%d\n", p.Name, p.Price) } // Output: // Cheeseburger: $10 // Fries: $5 // Soft Drink: $3 } pgx-5.8.0/stdlib/000077500000000000000000000000001512357711200136075ustar00rootroot00000000000000pgx-5.8.0/stdlib/bench_test.go000066400000000000000000000045771512357711200162710ustar00rootroot00000000000000package stdlib_test import ( "database/sql" "fmt" "os" "strconv" "strings" "testing" "time" ) func getSelectRowsCounts(b *testing.B) []int64 { var rowCounts []int64 { s := os.Getenv("PGX_BENCH_SELECT_ROWS_COUNTS") if s != "" { for p := range strings.SplitSeq(s, " ") { n, err := strconv.ParseInt(p, 10, 64) if err != nil { b.Fatalf("Bad PGX_BENCH_SELECT_ROWS_COUNTS value: %v", err) } rowCounts = append(rowCounts, n) } } } if len(rowCounts) == 0 { rowCounts = []int64{1, 10, 100, 1000} } return rowCounts } type BenchRowSimple struct { ID int32 FirstName string LastName string Sex string BirthDate time.Time Weight int32 Height int32 UpdateTime time.Time } func BenchmarkSelectRowsScanSimple(b *testing.B) { db := openDB(b) defer closeDB(b, db) rowCounts := getSelectRowsCounts(b) for _, rowCount := range rowCounts { b.Run(fmt.Sprintf("%d rows", rowCount), func(b *testing.B) { br := &BenchRowSimple{} for b.Loop() { rows, err := db.Query("select n, 'Adam', 'Smith ' || n, 'male', '1952-06-16'::date, 258, 72, '2001-01-28 01:02:03-05'::timestamptz from generate_series(1, $1) n", rowCount) if err != nil { b.Fatal(err) } for rows.Next() { rows.Scan(&br.ID, &br.FirstName, &br.LastName, &br.Sex, &br.BirthDate, &br.Weight, &br.Height, &br.UpdateTime) } if rows.Err() != nil { b.Fatal(rows.Err()) } } }) } } type BenchRowNull struct { ID sql.NullInt32 FirstName sql.NullString LastName sql.NullString Sex sql.NullString BirthDate sql.NullTime Weight sql.NullInt32 Height sql.NullInt32 UpdateTime sql.NullTime } func BenchmarkSelectRowsScanNull(b *testing.B) { db := openDB(b) defer closeDB(b, db) rowCounts := getSelectRowsCounts(b) for _, rowCount := range rowCounts { b.Run(fmt.Sprintf("%d rows", rowCount), func(b *testing.B) { br := &BenchRowSimple{} for b.Loop() { rows, err := db.Query("select n, 'Adam', 'Smith ' || n, 'male', '1952-06-16'::date, 258, 72, '2001-01-28 01:02:03-05'::timestamptz from generate_series(100000, 100000 + $1) n", rowCount) if err != nil { b.Fatal(err) } for rows.Next() { rows.Scan(&br.ID, &br.FirstName, &br.LastName, &br.Sex, &br.BirthDate, &br.Weight, &br.Height, &br.UpdateTime) } if rows.Err() != nil { b.Fatal(rows.Err()) } } }) } } pgx-5.8.0/stdlib/sql.go000066400000000000000000000631711512357711200147450ustar00rootroot00000000000000// Package stdlib is the compatibility layer from pgx to database/sql. // // A database/sql connection can be established through sql.Open. // // db, err := sql.Open("pgx", "postgres://pgx_md5:secret@localhost:5432/pgx_test?sslmode=disable") // if err != nil { // return err // } // // Or from a keyword/value string. // // db, err := sql.Open("pgx", "user=postgres password=secret host=localhost port=5432 database=pgx_test sslmode=disable") // if err != nil { // return err // } // // Or from a *pgxpool.Pool. // // pool, err := pgxpool.New(context.Background(), os.Getenv("DATABASE_URL")) // if err != nil { // return err // } // // db := stdlib.OpenDBFromPool(pool) // // Or a pgx.ConnConfig can be used to set configuration not accessible via connection string. In this case the // pgx.ConnConfig must first be registered with the driver. This registration returns a connection string which is used // with sql.Open. // // connConfig, _ := pgx.ParseConfig(os.Getenv("DATABASE_URL")) // connConfig.Tracer = &tracelog.TraceLog{Logger: myLogger, LogLevel: tracelog.LogLevelInfo} // connStr := stdlib.RegisterConnConfig(connConfig) // db, _ := sql.Open("pgx", connStr) // // pgx uses standard PostgreSQL positional parameters in queries. e.g. $1, $2. It does not support named parameters. // // db.QueryRow("select * from users where id=$1", userID) // // (*sql.Conn) Raw() can be used to get a *pgx.Conn from the standard database/sql.DB connection pool. This allows // operations that use pgx specific functionality. // // // Given db is a *sql.DB // conn, err := db.Conn(context.Background()) // if err != nil { // // handle error from acquiring connection from DB pool // } // // err = conn.Raw(func(driverConn any) error { // conn := driverConn.(*stdlib.Conn).Conn() // conn is a *pgx.Conn // // Do pgx specific stuff with conn // conn.CopyFrom(...) // return nil // }) // if err != nil { // // handle error that occurred while using *pgx.Conn // } // // # PostgreSQL Specific Data Types // // The pgtype package provides support for PostgreSQL specific types. *pgtype.Map.SQLScanner is an adapter that makes // these types usable as a sql.Scanner. // // m := pgtype.NewMap() // var a []int64 // err := db.QueryRow("select '{1,2,3}'::bigint[]").Scan(m.SQLScanner(&a)) package stdlib import ( "context" "database/sql" "database/sql/driver" "errors" "fmt" "io" "math" "math/rand/v2" "reflect" "slices" "strconv" "strings" "sync" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxpool" ) // Only intrinsic types should be binary format with database/sql. var databaseSQLResultFormats pgx.QueryResultFormatsByOID var pgxDriver *Driver func init() { pgxDriver = &Driver{ configs: make(map[string]*pgx.ConnConfig), } // if pgx driver was already registered by different pgx major version then we // skip registration under the default name. if !slices.Contains(sql.Drivers(), "pgx") { sql.Register("pgx", pgxDriver) } sql.Register("pgx/v5", pgxDriver) databaseSQLResultFormats = pgx.QueryResultFormatsByOID{ pgtype.BoolOID: 1, pgtype.ByteaOID: 1, pgtype.CIDOID: 1, pgtype.DateOID: 1, pgtype.Float4OID: 1, pgtype.Float8OID: 1, pgtype.Int2OID: 1, pgtype.Int4OID: 1, pgtype.Int8OID: 1, pgtype.OIDOID: 1, pgtype.TimestampOID: 1, pgtype.TimestamptzOID: 1, pgtype.XIDOID: 1, } } // OptionOpenDB options for configuring the driver when opening a new db pool. type OptionOpenDB func(*connector) // ShouldPingParams are passed to OptionShouldPing to decide whether to ping before reusing a connection. type ShouldPingParams struct { // Conn is the underlying pgx connection. Conn *pgx.Conn // IdleDuration is how long it has been since ResetSession last ran. IdleDuration time.Duration } // OptionShouldPing controls whether stdlib should issue a liveness ping before reusing a connection. // If the function returns true, stdlib will ping. // If it returns false, stdlib will skip the ping. // If not provided, default is ping only when IdleDuration > 1s. func OptionShouldPing(f func(context.Context, ShouldPingParams) bool) OptionOpenDB { return func(dc *connector) { dc.ShouldPing = f } } // OptionBeforeConnect provides a callback for before connect. It is passed a shallow copy of the ConnConfig that will // be used to connect, so only its immediate members should be modified. Used only if db is opened with *pgx.ConnConfig. func OptionBeforeConnect(bc func(context.Context, *pgx.ConnConfig) error) OptionOpenDB { return func(dc *connector) { dc.BeforeConnect = bc } } // OptionAfterConnect provides a callback for after connect. Used only if db is opened with *pgx.ConnConfig. func OptionAfterConnect(ac func(context.Context, *pgx.Conn) error) OptionOpenDB { return func(dc *connector) { dc.AfterConnect = ac } } // OptionResetSession provides a callback that can be used to add custom logic prior to executing a query on the // connection if the connection has been used before. // If ResetSessionFunc returns ErrBadConn error the connection will be discarded. func OptionResetSession(rs func(context.Context, *pgx.Conn) error) OptionOpenDB { return func(dc *connector) { dc.ResetSession = rs } } // RandomizeHostOrderFunc is a BeforeConnect hook that randomizes the host order in the provided connConfig, so that a // new host becomes primary each time. This is useful to distribute connections for multi-master databases like // CockroachDB. If you use this you likely should set https://golang.org/pkg/database/sql/#DB.SetConnMaxLifetime as well // to ensure that connections are periodically rebalanced across your nodes. func RandomizeHostOrderFunc(ctx context.Context, connConfig *pgx.ConnConfig) error { if len(connConfig.Fallbacks) == 0 { return nil } newFallbacks := append([]*pgconn.FallbackConfig{{ Host: connConfig.Host, Port: connConfig.Port, TLSConfig: connConfig.TLSConfig, }}, connConfig.Fallbacks...) rand.Shuffle(len(newFallbacks), func(i, j int) { newFallbacks[i], newFallbacks[j] = newFallbacks[j], newFallbacks[i] }) // Use the one that sorted last as the primary and keep the rest as the fallbacks newPrimary := newFallbacks[len(newFallbacks)-1] connConfig.Host = newPrimary.Host connConfig.Port = newPrimary.Port connConfig.TLSConfig = newPrimary.TLSConfig connConfig.Fallbacks = newFallbacks[:len(newFallbacks)-1] return nil } func GetConnector(config pgx.ConnConfig, opts ...OptionOpenDB) driver.Connector { c := connector{ ConnConfig: config, BeforeConnect: func(context.Context, *pgx.ConnConfig) error { return nil }, // noop before connect by default AfterConnect: func(context.Context, *pgx.Conn) error { return nil }, // noop after connect by default ResetSession: func(context.Context, *pgx.Conn) error { return nil }, // noop reset session by default driver: pgxDriver, } for _, opt := range opts { opt(&c) } return c } // GetPoolConnector creates a new driver.Connector from the given *pgxpool.Pool. By using this be sure to set the // maximum idle connections of the *sql.DB created with this connector to zero since they must be managed from the // *pgxpool.Pool. This is required to avoid acquiring all the connections from the pgxpool and starving any direct // users of the pgxpool. func GetPoolConnector(pool *pgxpool.Pool, opts ...OptionOpenDB) driver.Connector { c := connector{ pool: pool, ResetSession: func(context.Context, *pgx.Conn) error { return nil }, // noop reset session by default driver: pgxDriver, } for _, opt := range opts { opt(&c) } return c } func OpenDB(config pgx.ConnConfig, opts ...OptionOpenDB) *sql.DB { c := GetConnector(config, opts...) return sql.OpenDB(c) } // OpenDBFromPool creates a new *sql.DB from the given *pgxpool.Pool. Note that this method automatically sets the // maximum number of idle connections in *sql.DB to zero, since they must be managed from the *pgxpool.Pool. This is // required to avoid acquiring all the connections from the pgxpool and starving any direct users of the pgxpool. Note // that closing the returned *sql.DB will not close the *pgxpool.Pool. func OpenDBFromPool(pool *pgxpool.Pool, opts ...OptionOpenDB) *sql.DB { c := GetPoolConnector(pool, opts...) db := sql.OpenDB(c) db.SetMaxIdleConns(0) return db } type connector struct { pgx.ConnConfig pool *pgxpool.Pool BeforeConnect func(context.Context, *pgx.ConnConfig) error // function to call before creation of every new connection AfterConnect func(context.Context, *pgx.Conn) error // function to call after creation of every new connection ResetSession func(context.Context, *pgx.Conn) error // function is called before a connection is reused ShouldPing func(context.Context, ShouldPingParams) bool // function to decide if stdlib should ping before reusing a connection driver *Driver } // Connect implement driver.Connector interface func (c connector) Connect(ctx context.Context) (driver.Conn, error) { var ( connConfig pgx.ConnConfig conn *pgx.Conn close func(context.Context) error err error ) if c.pool == nil { // Create a shallow copy of the config, so that BeforeConnect can safely modify it connConfig = c.ConnConfig if err = c.BeforeConnect(ctx, &connConfig); err != nil { return nil, err } if conn, err = pgx.ConnectConfig(ctx, &connConfig); err != nil { return nil, err } if err = c.AfterConnect(ctx, conn); err != nil { return nil, err } close = conn.Close } else { var pconn *pgxpool.Conn pconn, err = c.pool.Acquire(ctx) if err != nil { return nil, err } conn = pconn.Conn() close = func(_ context.Context) error { pconn.Release() return nil } } return &Conn{ conn: conn, close: close, driver: c.driver, connConfig: connConfig, resetSessionFunc: c.ResetSession, shouldPing: c.ShouldPing, psRefCounts: make(map[*pgconn.StatementDescription]int), }, nil } // Driver implement driver.Connector interface func (c connector) Driver() driver.Driver { return c.driver } // GetDefaultDriver returns the driver initialized in the init function // and used when the pgx driver is registered. func GetDefaultDriver() driver.Driver { return pgxDriver } type Driver struct { configMutex sync.Mutex configs map[string]*pgx.ConnConfig sequence int } func (d *Driver) Open(name string) (driver.Conn, error) { ctx, cancel := context.WithTimeout(context.Background(), 60*time.Second) // Ensure eventual timeout defer cancel() connector, err := d.OpenConnector(name) if err != nil { return nil, err } return connector.Connect(ctx) } func (d *Driver) OpenConnector(name string) (driver.Connector, error) { return &driverConnector{driver: d, name: name}, nil } func (d *Driver) registerConnConfig(c *pgx.ConnConfig) string { d.configMutex.Lock() connStr := fmt.Sprintf("registeredConnConfig%d", d.sequence) d.sequence++ d.configs[connStr] = c d.configMutex.Unlock() return connStr } func (d *Driver) unregisterConnConfig(connStr string) { d.configMutex.Lock() delete(d.configs, connStr) d.configMutex.Unlock() } type driverConnector struct { driver *Driver name string } func (dc *driverConnector) Connect(ctx context.Context) (driver.Conn, error) { var connConfig *pgx.ConnConfig dc.driver.configMutex.Lock() connConfig = dc.driver.configs[dc.name] dc.driver.configMutex.Unlock() if connConfig == nil { var err error connConfig, err = pgx.ParseConfig(dc.name) if err != nil { return nil, err } } conn, err := pgx.ConnectConfig(ctx, connConfig) if err != nil { return nil, err } c := &Conn{ conn: conn, close: conn.Close, driver: dc.driver, connConfig: *connConfig, resetSessionFunc: func(context.Context, *pgx.Conn) error { return nil }, psRefCounts: make(map[*pgconn.StatementDescription]int), } return c, nil } func (dc *driverConnector) Driver() driver.Driver { return dc.driver } // RegisterConnConfig registers a ConnConfig and returns the connection string to use with Open. func RegisterConnConfig(c *pgx.ConnConfig) string { return pgxDriver.registerConnConfig(c) } // UnregisterConnConfig removes the ConnConfig registration for connStr. func UnregisterConnConfig(connStr string) { pgxDriver.unregisterConnConfig(connStr) } type Conn struct { conn *pgx.Conn close func(context.Context) error driver *Driver connConfig pgx.ConnConfig resetSessionFunc func(context.Context, *pgx.Conn) error // Function is called before a connection is reused shouldPing func(context.Context, ShouldPingParams) bool // Function to decide if stdlib should ping before reusing a connection lastResetSessionTime time.Time // psRefCounts contains reference counts for prepared statements. Prepare uses the underlying pgx logic to generate // deterministic statement names from the statement text. If this query has already been prepared then the existing // *pgconn.StatementDescription will be returned. However, this means that if Close is called on the returned Stmt // then the underlying prepared statement will be closed even when the underlying prepared statement is still in use // by another database/sql Stmt. To prevent this psRefCounts keeps track of how many database/sql statements are using // the same underlying statement and only closes the underlying statement when the reference count reaches 0. psRefCounts map[*pgconn.StatementDescription]int } // Conn returns the underlying *pgx.Conn func (c *Conn) Conn() *pgx.Conn { return c.conn } func (c *Conn) Prepare(query string) (driver.Stmt, error) { return c.PrepareContext(context.Background(), query) } func (c *Conn) PrepareContext(ctx context.Context, query string) (driver.Stmt, error) { if c.conn.IsClosed() { return nil, driver.ErrBadConn } sd, err := c.conn.Prepare(ctx, query, query) if err != nil { return nil, err } c.psRefCounts[sd]++ return &Stmt{sd: sd, conn: c}, nil } func (c *Conn) Close() error { ctx, cancel := context.WithTimeout(context.Background(), time.Second*5) defer cancel() return c.close(ctx) } func (c *Conn) Begin() (driver.Tx, error) { return c.BeginTx(context.Background(), driver.TxOptions{}) } func (c *Conn) BeginTx(ctx context.Context, opts driver.TxOptions) (driver.Tx, error) { if c.conn.IsClosed() { return nil, driver.ErrBadConn } var pgxOpts pgx.TxOptions switch sql.IsolationLevel(opts.Isolation) { case sql.LevelDefault: case sql.LevelReadUncommitted: pgxOpts.IsoLevel = pgx.ReadUncommitted case sql.LevelReadCommitted: pgxOpts.IsoLevel = pgx.ReadCommitted case sql.LevelRepeatableRead, sql.LevelSnapshot: pgxOpts.IsoLevel = pgx.RepeatableRead case sql.LevelSerializable: pgxOpts.IsoLevel = pgx.Serializable default: return nil, fmt.Errorf("unsupported isolation: %v", opts.Isolation) } if opts.ReadOnly { pgxOpts.AccessMode = pgx.ReadOnly } tx, err := c.conn.BeginTx(ctx, pgxOpts) if err != nil { return nil, err } return wrapTx{ctx: ctx, tx: tx}, nil } func (c *Conn) ExecContext(ctx context.Context, query string, argsV []driver.NamedValue) (driver.Result, error) { if c.conn.IsClosed() { return nil, driver.ErrBadConn } args := make([]any, len(argsV)) convertNamedArguments(args, argsV) commandTag, err := c.conn.Exec(ctx, query, args...) // if we got a network error before we had a chance to send the query, retry if err != nil { if pgconn.SafeToRetry(err) { return nil, driver.ErrBadConn } } return driver.RowsAffected(commandTag.RowsAffected()), err } func (c *Conn) QueryContext(ctx context.Context, query string, argsV []driver.NamedValue) (driver.Rows, error) { if c.conn.IsClosed() { return nil, driver.ErrBadConn } args := make([]any, 1+len(argsV)) args[0] = databaseSQLResultFormats convertNamedArguments(args[1:], argsV) rows, err := c.conn.Query(ctx, query, args...) if err != nil { if pgconn.SafeToRetry(err) { return nil, driver.ErrBadConn } return nil, err } // Preload first row because otherwise we won't know what columns are available when database/sql asks. more := rows.Next() if err = rows.Err(); err != nil { rows.Close() return nil, err } return &Rows{conn: c, rows: rows, skipNext: true, skipNextMore: more}, nil } func (c *Conn) Ping(ctx context.Context) error { if c.conn.IsClosed() { return driver.ErrBadConn } err := c.conn.Ping(ctx) if err != nil { // A Ping failure implies some sort of fatal state. The connection is almost certainly already closed by the // failure, but manually close it just to be sure. c.Close() return driver.ErrBadConn } return nil } func (c *Conn) CheckNamedValue(*driver.NamedValue) error { // Underlying pgx supports sql.Scanner and driver.Valuer interfaces natively. So everything can be passed through directly. return nil } func (c *Conn) ResetSession(ctx context.Context) error { if c.conn.IsClosed() { return driver.ErrBadConn } now := time.Now() idle := now.Sub(c.lastResetSessionTime) doPing := idle > time.Second // default behavior: ping only if idle > 1s if c.shouldPing != nil { doPing = c.shouldPing(ctx, ShouldPingParams{ Conn: c.conn, IdleDuration: idle, }) } if doPing { if err := c.conn.PgConn().Ping(ctx); err != nil { return driver.ErrBadConn } } c.lastResetSessionTime = now return c.resetSessionFunc(ctx, c.conn) } type Stmt struct { sd *pgconn.StatementDescription conn *Conn } func (s *Stmt) Close() error { ctx, cancel := context.WithTimeout(context.Background(), time.Second*5) defer cancel() refCount := s.conn.psRefCounts[s.sd] if refCount == 1 { delete(s.conn.psRefCounts, s.sd) } else { s.conn.psRefCounts[s.sd]-- return nil } return s.conn.conn.Deallocate(ctx, s.sd.SQL) } func (s *Stmt) NumInput() int { return len(s.sd.ParamOIDs) } func (s *Stmt) Exec(argsV []driver.Value) (driver.Result, error) { return nil, errors.New("Stmt.Exec deprecated and not implemented") } func (s *Stmt) ExecContext(ctx context.Context, argsV []driver.NamedValue) (driver.Result, error) { return s.conn.ExecContext(ctx, s.sd.SQL, argsV) } func (s *Stmt) Query(argsV []driver.Value) (driver.Rows, error) { return nil, errors.New("Stmt.Query deprecated and not implemented") } func (s *Stmt) QueryContext(ctx context.Context, argsV []driver.NamedValue) (driver.Rows, error) { return s.conn.QueryContext(ctx, s.sd.SQL, argsV) } type rowValueFunc func(src []byte) (driver.Value, error) type Rows struct { conn *Conn rows pgx.Rows valueFuncs []rowValueFunc skipNext bool skipNextMore bool columnNames []string } func (r *Rows) Columns() []string { if r.columnNames == nil { fields := r.rows.FieldDescriptions() r.columnNames = make([]string, len(fields)) for i, fd := range fields { r.columnNames[i] = string(fd.Name) } } return r.columnNames } // ColumnTypeDatabaseTypeName returns the database system type name. If the name is unknown the OID is returned. func (r *Rows) ColumnTypeDatabaseTypeName(index int) string { if dt, ok := r.conn.conn.TypeMap().TypeForOID(r.rows.FieldDescriptions()[index].DataTypeOID); ok { return strings.ToUpper(dt.Name) } return strconv.FormatInt(int64(r.rows.FieldDescriptions()[index].DataTypeOID), 10) } const varHeaderSize = 4 // ColumnTypeLength returns the length of the column type if the column is a // variable length type. If the column is not a variable length type ok // should return false. func (r *Rows) ColumnTypeLength(index int) (int64, bool) { fd := r.rows.FieldDescriptions()[index] switch fd.DataTypeOID { case pgtype.TextOID, pgtype.ByteaOID: return math.MaxInt64, true case pgtype.VarcharOID, pgtype.BPCharArrayOID: return int64(fd.TypeModifier - varHeaderSize), true case pgtype.VarbitOID: return int64(fd.TypeModifier), true default: return 0, false } } // ColumnTypePrecisionScale should return the precision and scale for decimal // types. If not applicable, ok should be false. func (r *Rows) ColumnTypePrecisionScale(index int) (precision, scale int64, ok bool) { fd := r.rows.FieldDescriptions()[index] switch fd.DataTypeOID { case pgtype.NumericOID: mod := fd.TypeModifier - varHeaderSize precision = int64((mod >> 16) & 0xffff) scale = int64(mod & 0xffff) return precision, scale, true default: return 0, 0, false } } // ColumnTypeScanType returns the value type that can be used to scan types into. func (r *Rows) ColumnTypeScanType(index int) reflect.Type { fd := r.rows.FieldDescriptions()[index] switch fd.DataTypeOID { case pgtype.Float8OID: return reflect.TypeOf(float64(0)) case pgtype.Float4OID: return reflect.TypeOf(float32(0)) case pgtype.Int8OID: return reflect.TypeOf(int64(0)) case pgtype.Int4OID: return reflect.TypeOf(int32(0)) case pgtype.Int2OID: return reflect.TypeOf(int16(0)) case pgtype.BoolOID: return reflect.TypeOf(false) case pgtype.NumericOID: return reflect.TypeOf(float64(0)) case pgtype.DateOID, pgtype.TimestampOID, pgtype.TimestamptzOID: return reflect.TypeOf(time.Time{}) case pgtype.ByteaOID: return reflect.TypeOf([]byte(nil)) default: return reflect.TypeOf("") } } func (r *Rows) Close() error { r.rows.Close() return r.rows.Err() } func (r *Rows) Next(dest []driver.Value) error { m := r.conn.conn.TypeMap() fieldDescriptions := r.rows.FieldDescriptions() if r.valueFuncs == nil { r.valueFuncs = make([]rowValueFunc, len(fieldDescriptions)) for i, fd := range fieldDescriptions { dataTypeOID := fd.DataTypeOID format := fd.Format switch fd.DataTypeOID { case pgtype.BoolOID: var d bool scanPlan := m.PlanScan(dataTypeOID, format, &d) r.valueFuncs[i] = func(src []byte) (driver.Value, error) { err := scanPlan.Scan(src, &d) return d, err } case pgtype.ByteaOID: var d []byte scanPlan := m.PlanScan(dataTypeOID, format, &d) r.valueFuncs[i] = func(src []byte) (driver.Value, error) { err := scanPlan.Scan(src, &d) return d, err } case pgtype.CIDOID, pgtype.OIDOID, pgtype.XIDOID: var d pgtype.Uint32 scanPlan := m.PlanScan(dataTypeOID, format, &d) r.valueFuncs[i] = func(src []byte) (driver.Value, error) { err := scanPlan.Scan(src, &d) if err != nil { return nil, err } return d.Value() } case pgtype.DateOID: var d pgtype.Date scanPlan := m.PlanScan(dataTypeOID, format, &d) r.valueFuncs[i] = func(src []byte) (driver.Value, error) { err := scanPlan.Scan(src, &d) if err != nil { return nil, err } return d.Value() } case pgtype.Float4OID: var d float32 scanPlan := m.PlanScan(dataTypeOID, format, &d) r.valueFuncs[i] = func(src []byte) (driver.Value, error) { err := scanPlan.Scan(src, &d) return float64(d), err } case pgtype.Float8OID: var d float64 scanPlan := m.PlanScan(dataTypeOID, format, &d) r.valueFuncs[i] = func(src []byte) (driver.Value, error) { err := scanPlan.Scan(src, &d) return d, err } case pgtype.Int2OID: var d int16 scanPlan := m.PlanScan(dataTypeOID, format, &d) r.valueFuncs[i] = func(src []byte) (driver.Value, error) { err := scanPlan.Scan(src, &d) return int64(d), err } case pgtype.Int4OID: var d int32 scanPlan := m.PlanScan(dataTypeOID, format, &d) r.valueFuncs[i] = func(src []byte) (driver.Value, error) { err := scanPlan.Scan(src, &d) return int64(d), err } case pgtype.Int8OID: var d int64 scanPlan := m.PlanScan(dataTypeOID, format, &d) r.valueFuncs[i] = func(src []byte) (driver.Value, error) { err := scanPlan.Scan(src, &d) return d, err } case pgtype.JSONOID, pgtype.JSONBOID: var d []byte scanPlan := m.PlanScan(dataTypeOID, format, &d) r.valueFuncs[i] = func(src []byte) (driver.Value, error) { err := scanPlan.Scan(src, &d) if err != nil { return nil, err } return d, nil } case pgtype.TimestampOID: var d pgtype.Timestamp scanPlan := m.PlanScan(dataTypeOID, format, &d) r.valueFuncs[i] = func(src []byte) (driver.Value, error) { err := scanPlan.Scan(src, &d) if err != nil { return nil, err } return d.Value() } case pgtype.TimestamptzOID: var d pgtype.Timestamptz scanPlan := m.PlanScan(dataTypeOID, format, &d) r.valueFuncs[i] = func(src []byte) (driver.Value, error) { err := scanPlan.Scan(src, &d) if err != nil { return nil, err } return d.Value() } case pgtype.XMLOID: var d []byte scanPlan := m.PlanScan(dataTypeOID, format, &d) r.valueFuncs[i] = func(src []byte) (driver.Value, error) { err := scanPlan.Scan(src, &d) if err != nil { return nil, err } return d, nil } default: var d string scanPlan := m.PlanScan(dataTypeOID, format, &d) r.valueFuncs[i] = func(src []byte) (driver.Value, error) { err := scanPlan.Scan(src, &d) return d, err } } } } var more bool if r.skipNext { more = r.skipNextMore r.skipNext = false } else { more = r.rows.Next() } if !more { if r.rows.Err() == nil { return io.EOF } else { return r.rows.Err() } } for i, rv := range r.rows.RawValues() { if rv != nil { var err error dest[i], err = r.valueFuncs[i](rv) if err != nil { return fmt.Errorf("convert field %d failed: %w", i, err) } } else { dest[i] = nil } } return nil } func convertNamedArguments(args []any, argsV []driver.NamedValue) { for i, v := range argsV { if v.Value != nil { args[i] = v.Value.(any) } else { args[i] = nil } } } type wrapTx struct { ctx context.Context tx pgx.Tx } func (wtx wrapTx) Commit() error { return wtx.tx.Commit(wtx.ctx) } func (wtx wrapTx) Rollback() error { return wtx.tx.Rollback(wtx.ctx) } pgx-5.8.0/stdlib/sql_test.go000066400000000000000000001111341512357711200157750ustar00rootroot00000000000000package stdlib_test import ( "bytes" "context" "database/sql" "encoding/json" "errors" "fmt" "math" "os" "reflect" "regexp" "strconv" "sync" "testing" "time" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgtype" "github.com/jackc/pgx/v5/pgxpool" "github.com/jackc/pgx/v5/stdlib" "github.com/jackc/pgx/v5/tracelog" ) func openDB(t testing.TB, opts ...stdlib.OptionOpenDB) *sql.DB { t.Helper() config, err := pgx.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) return stdlib.OpenDB(*config, opts...) } func closeDB(t testing.TB, db *sql.DB) { err := db.Close() require.NoError(t, err) } func skipCockroachDB(t testing.TB, db *sql.DB, msg string) { conn, err := db.Conn(context.Background()) require.NoError(t, err) defer conn.Close() err = conn.Raw(func(driverConn any) error { conn := driverConn.(*stdlib.Conn).Conn() if conn.PgConn().ParameterStatus("crdb_version") != "" { t.Skip(msg) } return nil }) require.NoError(t, err) } func skipPostgreSQLVersionLessThan(t testing.TB, db *sql.DB, minVersion int64) { conn, err := db.Conn(context.Background()) require.NoError(t, err) defer conn.Close() err = conn.Raw(func(driverConn any) error { conn := driverConn.(*stdlib.Conn).Conn() serverVersionStr := conn.PgConn().ParameterStatus("server_version") serverVersionStr = regexp.MustCompile(`^[0-9]+`).FindString(serverVersionStr) // if not PostgreSQL do nothing if serverVersionStr == "" { return nil } serverVersion, err := strconv.ParseInt(serverVersionStr, 10, 64) if err != nil { return err } if serverVersion < minVersion { t.Skipf("Test requires PostgreSQL v%d+", minVersion) } return nil }) require.NoError(t, err) } func testWithAllQueryExecModes(t *testing.T, f func(t *testing.T, db *sql.DB)) { for _, mode := range []pgx.QueryExecMode{ pgx.QueryExecModeCacheStatement, pgx.QueryExecModeCacheDescribe, pgx.QueryExecModeDescribeExec, pgx.QueryExecModeExec, pgx.QueryExecModeSimpleProtocol, } { t.Run(mode.String(), func(t *testing.T) { config, err := pgx.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.DefaultQueryExecMode = mode db := stdlib.OpenDB(*config) defer func() { err := db.Close() require.NoError(t, err) }() f(t, db) ensureDBValid(t, db) }, ) } } // Do a simple query to ensure the DB is still usable. This is of less use in stdlib as the connection pool should // cover broken connections. func ensureDBValid(t testing.TB, db *sql.DB) { var sum, rowCount int32 rows, err := db.Query("select generate_series(1,$1)", 10) require.NoError(t, err) defer rows.Close() for rows.Next() { var n int32 rows.Scan(&n) sum += n rowCount++ } require.NoError(t, rows.Err()) if rowCount != 10 { t.Error("Select called onDataRow wrong number of times") } if sum != 55 { t.Error("Wrong values returned") } } type preparer interface { Prepare(query string) (*sql.Stmt, error) } func prepareStmt(t *testing.T, p preparer, sql string) *sql.Stmt { stmt, err := p.Prepare(sql) require.NoError(t, err) return stmt } func closeStmt(t *testing.T, stmt *sql.Stmt) { err := stmt.Close() require.NoError(t, err) } func TestSQLOpen(t *testing.T) { tests := []struct { driverName string }{ {driverName: "pgx"}, {driverName: "pgx/v5"}, } for _, tt := range tests { t.Run(tt.driverName, func(t *testing.T) { db, err := sql.Open(tt.driverName, os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) closeDB(t, db) }) } } func TestSQLOpenFromPool(t *testing.T) { pool, err := pgxpool.New(context.Background(), os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) t.Cleanup(pool.Close) db := stdlib.OpenDBFromPool(pool) ensureDBValid(t, db) db.Close() } func TestNormalLifeCycle(t *testing.T) { db := openDB(t) defer closeDB(t, db) skipCockroachDB(t, db, "Server issues incorrect ParameterDescription (https://github.com/cockroachdb/cockroach/issues/60907)") stmt := prepareStmt(t, db, "select 'foo', n from generate_series($1::int, $2::int) n") defer closeStmt(t, stmt) rows, err := stmt.Query(int32(1), int32(10)) require.NoError(t, err) rowCount := int64(0) for rows.Next() { rowCount++ var s string var n int64 err := rows.Scan(&s, &n) require.NoError(t, err) if s != "foo" { t.Errorf(`Expected "foo", received "%v"`, s) } if n != rowCount { t.Errorf("Expected %d, received %d", rowCount, n) } } require.NoError(t, rows.Err()) require.EqualValues(t, 10, rowCount) err = rows.Close() require.NoError(t, err) ensureDBValid(t, db) } func TestStmtExec(t *testing.T) { db := openDB(t) defer closeDB(t, db) tx, err := db.Begin() require.NoError(t, err) createStmt := prepareStmt(t, tx, "create temporary table t(a varchar not null)") _, err = createStmt.Exec() require.NoError(t, err) closeStmt(t, createStmt) insertStmt := prepareStmt(t, tx, "insert into t values($1::text)") result, err := insertStmt.Exec("foo") require.NoError(t, err) n, err := result.RowsAffected() require.NoError(t, err) require.EqualValues(t, 1, n) closeStmt(t, insertStmt) ensureDBValid(t, db) } func TestQueryCloseRowsEarly(t *testing.T) { db := openDB(t) defer closeDB(t, db) skipCockroachDB(t, db, "Server issues incorrect ParameterDescription (https://github.com/cockroachdb/cockroach/issues/60907)") stmt := prepareStmt(t, db, "select 'foo', n from generate_series($1::int, $2::int) n") defer closeStmt(t, stmt) rows, err := stmt.Query(int32(1), int32(10)) require.NoError(t, err) // Close rows immediately without having read them err = rows.Close() require.NoError(t, err) // Run the query again to ensure the connection and statement are still ok rows, err = stmt.Query(int32(1), int32(10)) require.NoError(t, err) rowCount := int64(0) for rows.Next() { rowCount++ var s string var n int64 err := rows.Scan(&s, &n) require.NoError(t, err) if s != "foo" { t.Errorf(`Expected "foo", received "%v"`, s) } if n != rowCount { t.Errorf("Expected %d, received %d", rowCount, n) } } require.NoError(t, rows.Err()) require.EqualValues(t, 10, rowCount) err = rows.Close() require.NoError(t, err) ensureDBValid(t, db) } func TestConnExec(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { _, err := db.Exec("create temporary table t(a varchar not null)") require.NoError(t, err) result, err := db.Exec("insert into t values('hey')") require.NoError(t, err) n, err := result.RowsAffected() require.NoError(t, err) require.EqualValues(t, 1, n) }) } func TestConnQuery(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { skipCockroachDB(t, db, "Server issues incorrect ParameterDescription (https://github.com/cockroachdb/cockroach/issues/60907)") rows, err := db.Query("select 'foo', n from generate_series($1::int, $2::int) n", int32(1), int32(10)) require.NoError(t, err) rowCount := int64(0) for rows.Next() { rowCount++ var s string var n int64 err := rows.Scan(&s, &n) require.NoError(t, err) if s != "foo" { t.Errorf(`Expected "foo", received "%v"`, s) } if n != rowCount { t.Errorf("Expected %d, received %d", rowCount, n) } } require.NoError(t, rows.Err()) require.EqualValues(t, 10, rowCount) err = rows.Close() require.NoError(t, err) }) } func TestConnConcurrency(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { _, err := db.Exec("create table t (id integer primary key, str text, dur_str interval)") require.NoError(t, err) defer func() { _, err := db.Exec("drop table t") require.NoError(t, err) }() var wg sync.WaitGroup concurrency := 50 errChan := make(chan error, concurrency) for i := 1; i <= concurrency; i++ { wg.Add(1) go func(idx int) { defer wg.Done() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() str := strconv.Itoa(idx) duration := time.Duration(idx) * time.Second _, err := db.ExecContext(ctx, "insert into t values($1)", idx) if err != nil { errChan <- fmt.Errorf("insert failed: %d %w", idx, err) return } _, err = db.ExecContext(ctx, "update t set str = $1 where id = $2", str, idx) if err != nil { errChan <- fmt.Errorf("update 1 failed: %d %w", idx, err) return } _, err = db.ExecContext(ctx, "update t set dur_str = $1 where id = $2", duration, idx) if err != nil { errChan <- fmt.Errorf("update 2 failed: %d %w", idx, err) return } errChan <- nil }(i) } wg.Wait() for i := 1; i <= concurrency; i++ { err := <-errChan require.NoError(t, err) } for i := 1; i <= concurrency; i++ { wg.Add(1) go func(idx int) { defer wg.Done() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() var id int var str string var duration pgtype.Interval err := db.QueryRowContext(ctx, "select id,str,dur_str from t where id = $1", idx).Scan(&id, &str, &duration) if err != nil { errChan <- fmt.Errorf("select failed: %d %w", idx, err) return } if id != idx { errChan <- fmt.Errorf("id mismatch: %d %d", idx, id) return } if str != strconv.Itoa(idx) { errChan <- fmt.Errorf("str mismatch: %d %s", idx, str) return } expectedDuration := pgtype.Interval{ Microseconds: int64(idx) * time.Second.Microseconds(), Valid: true, } if duration != expectedDuration { errChan <- fmt.Errorf("duration mismatch: %d %v", idx, duration) return } errChan <- nil }(i) } wg.Wait() for i := 1; i <= concurrency; i++ { err := <-errChan require.NoError(t, err) } }) } // https://github.com/jackc/pgx/issues/781 func TestConnQueryDifferentScanPlansIssue781(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { var s string var b bool rows, err := db.Query("select true, 'foo'") require.NoError(t, err) require.True(t, rows.Next()) require.NoError(t, rows.Scan(&b, &s)) assert.Equal(t, true, b) assert.Equal(t, "foo", s) }) } func TestConnQueryNull(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { rows, err := db.Query("select $1::int", nil) require.NoError(t, err) rowCount := int64(0) for rows.Next() { rowCount++ var n sql.NullInt64 err := rows.Scan(&n) require.NoError(t, err) if n.Valid != false { t.Errorf("Expected n to be null, but it was %v", n) } } require.NoError(t, rows.Err()) require.EqualValues(t, 1, rowCount) err = rows.Close() require.NoError(t, err) }) } func TestConnQueryRowByteSlice(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { expected := []byte{222, 173, 190, 239} var actual []byte err := db.QueryRow(`select E'\\xdeadbeef'::bytea`).Scan(&actual) require.NoError(t, err) require.EqualValues(t, expected, actual) }) } func TestConnQueryFailure(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { _, err := db.Query("select 'foo") require.Error(t, err) require.ErrorAs(t, err, new(*pgconn.PgError)) }) } func TestConnSimpleSlicePassThrough(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { skipCockroachDB(t, db, "Server does not support cardinality function") var n int64 err := db.QueryRow("select cardinality($1::text[])", []string{"a", "b", "c"}).Scan(&n) require.NoError(t, err) assert.EqualValues(t, 3, n) }) } func TestConnQueryScanGoArray(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { m := pgtype.NewMap() var a []int64 err := db.QueryRow("select '{1,2,3}'::bigint[]").Scan(m.SQLScanner(&a)) require.NoError(t, err) assert.Equal(t, []int64{1, 2, 3}, a) }) } func TestConnQueryScanArray(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { m := pgtype.NewMap() var a pgtype.Array[int64] err := db.QueryRow("select '{1,2,3}'::bigint[]").Scan(m.SQLScanner(&a)) require.NoError(t, err) assert.Equal(t, pgtype.Array[int64]{Elements: []int64{1, 2, 3}, Dims: []pgtype.ArrayDimension{{Length: 3, LowerBound: 1}}, Valid: true}, a) err = db.QueryRow("select null::bigint[]").Scan(m.SQLScanner(&a)) require.NoError(t, err) assert.Equal(t, pgtype.Array[int64]{Elements: nil, Dims: nil, Valid: false}, a) }) } func TestConnQueryScanRange(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { skipCockroachDB(t, db, "Server does not support int4range") m := pgtype.NewMap() var r pgtype.Range[pgtype.Int4] err := db.QueryRow("select int4range(1, 5)").Scan(m.SQLScanner(&r)) require.NoError(t, err) assert.Equal( t, pgtype.Range[pgtype.Int4]{ Lower: pgtype.Int4{Int32: 1, Valid: true}, Upper: pgtype.Int4{Int32: 5, Valid: true}, LowerType: pgtype.Inclusive, UpperType: pgtype.Exclusive, Valid: true, }, r) }) } // Test type that pgx would handle natively in binary, but since it is not a // database/sql native type should be passed through as a string func TestConnQueryRowPgxBinary(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { sql := "select $1::int4[]" expected := "{1,2,3}" var actual string err := db.QueryRow(sql, expected).Scan(&actual) require.NoError(t, err) require.EqualValues(t, expected, actual) }) } func TestConnQueryRowUnknownType(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { skipCockroachDB(t, db, "Server does not support point type") sql := "select $1::point" expected := "(1,2)" var actual string err := db.QueryRow(sql, expected).Scan(&actual) require.NoError(t, err) require.EqualValues(t, expected, actual) }) } func TestConnQueryJSONIntoByteSlice(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { _, err := db.Exec(` create temporary table docs( body json not null ); insert into docs(body) values('{"foo": "bar"}'); `) require.NoError(t, err) sql := `select * from docs` expected := []byte(`{"foo": "bar"}`) var actual []byte err = db.QueryRow(sql).Scan(&actual) if err != nil { t.Errorf("Unexpected failure: %v (sql -> %v)", err, sql) } if !bytes.Equal(actual, expected) { t.Errorf(`Expected "%v", got "%v" (sql -> %v)`, string(expected), string(actual), sql) } _, err = db.Exec(`drop table docs`) require.NoError(t, err) }) } func TestConnExecInsertByteSliceIntoJSON(t *testing.T) { // Not testing with simple protocol because there is no way for that to work. A []byte will be considered binary data // that needs to escape. No way to know whether the destination is really a text compatible or a bytea. db := openDB(t) defer closeDB(t, db) _, err := db.Exec(` create temporary table docs( body json not null ); `) require.NoError(t, err) expected := []byte(`{"foo": "bar"}`) _, err = db.Exec(`insert into docs(body) values($1)`, expected) require.NoError(t, err) var actual []byte err = db.QueryRow(`select body from docs`).Scan(&actual) require.NoError(t, err) if !bytes.Equal(actual, expected) { t.Errorf(`Expected "%v", got "%v"`, string(expected), string(actual)) } _, err = db.Exec(`drop table docs`) require.NoError(t, err) } func TestTransactionLifeCycle(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { _, err := db.Exec("create temporary table t(a varchar not null)") require.NoError(t, err) tx, err := db.Begin() require.NoError(t, err) _, err = tx.Exec("insert into t values('hi')") require.NoError(t, err) err = tx.Rollback() require.NoError(t, err) var n int64 err = db.QueryRow("select count(*) from t").Scan(&n) require.NoError(t, err) require.EqualValues(t, 0, n) tx, err = db.Begin() require.NoError(t, err) _, err = tx.Exec("insert into t values('hi')") require.NoError(t, err) err = tx.Commit() require.NoError(t, err) err = db.QueryRow("select count(*) from t").Scan(&n) require.NoError(t, err) require.EqualValues(t, 1, n) }) } func TestConnBeginTxIsolation(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { skipCockroachDB(t, db, "Server always uses serializable isolation level") var defaultIsoLevel string err := db.QueryRow("show transaction_isolation").Scan(&defaultIsoLevel) require.NoError(t, err) supportedTests := []struct { sqlIso sql.IsolationLevel pgIso string }{ {sqlIso: sql.LevelDefault, pgIso: defaultIsoLevel}, {sqlIso: sql.LevelReadUncommitted, pgIso: "read uncommitted"}, {sqlIso: sql.LevelReadCommitted, pgIso: "read committed"}, {sqlIso: sql.LevelRepeatableRead, pgIso: "repeatable read"}, {sqlIso: sql.LevelSnapshot, pgIso: "repeatable read"}, {sqlIso: sql.LevelSerializable, pgIso: "serializable"}, } for i, tt := range supportedTests { func() { tx, err := db.BeginTx(context.Background(), &sql.TxOptions{Isolation: tt.sqlIso}) if err != nil { t.Errorf("%d. BeginTx failed: %v", i, err) return } defer tx.Rollback() var pgIso string err = tx.QueryRow("show transaction_isolation").Scan(&pgIso) if err != nil { t.Errorf("%d. QueryRow failed: %v", i, err) } if pgIso != tt.pgIso { t.Errorf("%d. pgIso => %s, want %s", i, pgIso, tt.pgIso) } }() } unsupportedTests := []struct { sqlIso sql.IsolationLevel }{ {sqlIso: sql.LevelWriteCommitted}, {sqlIso: sql.LevelLinearizable}, } for i, tt := range unsupportedTests { tx, err := db.BeginTx(context.Background(), &sql.TxOptions{Isolation: tt.sqlIso}) if err == nil { t.Errorf("%d. BeginTx should have failed", i) tx.Rollback() } } }) } func TestConnBeginTxReadOnly(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { tx, err := db.BeginTx(context.Background(), &sql.TxOptions{ReadOnly: true}) require.NoError(t, err) defer tx.Rollback() var pgReadOnly string err = tx.QueryRow("show transaction_read_only").Scan(&pgReadOnly) if err != nil { t.Errorf("QueryRow failed: %v", err) } if pgReadOnly != "on" { t.Errorf("pgReadOnly => %s, want %s", pgReadOnly, "on") } }) } func TestBeginTxContextCancel(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { _, err := db.Exec("drop table if exists t") require.NoError(t, err) ctx, cancelFn := context.WithCancel(context.Background()) tx, err := db.BeginTx(ctx, nil) require.NoError(t, err) _, err = tx.Exec("create table t(id serial)") require.NoError(t, err) cancelFn() err = tx.Commit() if err != context.Canceled && err != sql.ErrTxDone { t.Fatalf("err => %v, want %v or %v", err, context.Canceled, sql.ErrTxDone) } var n int err = db.QueryRow("select count(*) from t").Scan(&n) var pgErr *pgconn.PgError if !errors.As(err, &pgErr) || pgErr.Code != "42P01" { t.Fatalf(`err => %v, want PgError{Code: "42P01"}`, err) } }) } func TestConnRaw(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { conn, err := db.Conn(context.Background()) require.NoError(t, err) var n int err = conn.Raw(func(driverConn any) error { conn := driverConn.(*stdlib.Conn).Conn() return conn.QueryRow(context.Background(), "select 42").Scan(&n) }) require.NoError(t, err) assert.EqualValues(t, 42, n) }) } func TestConnPingContextSuccess(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { err := db.PingContext(context.Background()) require.NoError(t, err) }) } func TestConnPrepareContextSuccess(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { stmt, err := db.PrepareContext(context.Background(), "select now()") require.NoError(t, err) err = stmt.Close() require.NoError(t, err) }) } // https://github.com/jackc/pgx/issues/1753#issuecomment-1746033281 // https://github.com/jackc/pgx/issues/1754#issuecomment-1752004634 func TestConnMultiplePrepareAndDeallocate(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { skipCockroachDB(t, db, "Server does not support pg_prepared_statements") sql := "select 42" stmt1, err := db.PrepareContext(context.Background(), sql) require.NoError(t, err) stmt2, err := db.PrepareContext(context.Background(), sql) require.NoError(t, err) err = stmt1.Close() require.NoError(t, err) var preparedStmtCount int64 err = db.QueryRowContext(context.Background(), "select count(*) from pg_prepared_statements where statement = $1", sql).Scan(&preparedStmtCount) require.NoError(t, err) require.EqualValues(t, 1, preparedStmtCount) err = stmt2.Close() // err isn't as useful as it should be as database/sql will ignore errors from Deallocate. require.NoError(t, err) err = db.QueryRowContext(context.Background(), "select count(*) from pg_prepared_statements where statement = $1", sql).Scan(&preparedStmtCount) require.NoError(t, err) require.EqualValues(t, 0, preparedStmtCount) }) } func TestConnExecContextSuccess(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { _, err := db.ExecContext(context.Background(), "create temporary table exec_context_test(id serial primary key)") require.NoError(t, err) }) } func TestConnQueryContextSuccess(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { rows, err := db.QueryContext(context.Background(), "select * from generate_series(1,10) n") require.NoError(t, err) for rows.Next() { var n int64 err := rows.Scan(&n) require.NoError(t, err) } require.NoError(t, rows.Err()) }) } func TestRowsColumnTypeDatabaseTypeName(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { rows, err := db.Query("select 42::bigint") require.NoError(t, err) columnTypes, err := rows.ColumnTypes() require.NoError(t, err) require.Len(t, columnTypes, 1) if columnTypes[0].DatabaseTypeName() != "INT8" { t.Errorf("columnTypes[0].DatabaseTypeName() => %v, want %v", columnTypes[0].DatabaseTypeName(), "INT8") } err = rows.Close() require.NoError(t, err) }) } func TestStmtExecContextSuccess(t *testing.T) { db := openDB(t) defer closeDB(t, db) _, err := db.Exec("create temporary table t(id int primary key)") require.NoError(t, err) stmt, err := db.Prepare("insert into t(id) values ($1::int4)") require.NoError(t, err) defer stmt.Close() _, err = stmt.ExecContext(context.Background(), 42) require.NoError(t, err) ensureDBValid(t, db) } func TestStmtExecContextCancel(t *testing.T) { db := openDB(t) defer closeDB(t, db) _, err := db.Exec("create temporary table t(id int primary key)") require.NoError(t, err) stmt, err := db.Prepare("insert into t(id) select $1::int4 from pg_sleep(5)") require.NoError(t, err) defer stmt.Close() ctx, cancel := context.WithTimeout(context.Background(), 100*time.Millisecond) defer cancel() _, err = stmt.ExecContext(ctx, 42) if !pgconn.Timeout(err) { t.Errorf("expected timeout error, got %v", err) } ensureDBValid(t, db) } func TestStmtQueryContextSuccess(t *testing.T) { db := openDB(t) defer closeDB(t, db) skipCockroachDB(t, db, "Server issues incorrect ParameterDescription (https://github.com/cockroachdb/cockroach/issues/60907)") stmt, err := db.Prepare("select * from generate_series(1,$1::int4) n") require.NoError(t, err) defer stmt.Close() rows, err := stmt.QueryContext(context.Background(), 5) require.NoError(t, err) for rows.Next() { var n int64 if err := rows.Scan(&n); err != nil { t.Error(err) } } if rows.Err() != nil { t.Error(rows.Err()) } ensureDBValid(t, db) } func TestRowsColumnTypes(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { columnTypesTests := []struct { Name string TypeName string Length struct { Len int64 OK bool } DecimalSize struct { Precision int64 Scale int64 OK bool } ScanType reflect.Type }{ { Name: "a", TypeName: "INT8", Length: struct { Len int64 OK bool }{ Len: 0, OK: false, }, DecimalSize: struct { Precision int64 Scale int64 OK bool }{ Precision: 0, Scale: 0, OK: false, }, ScanType: reflect.TypeOf(int64(0)), }, { Name: "bar", TypeName: "TEXT", Length: struct { Len int64 OK bool }{ Len: math.MaxInt64, OK: true, }, DecimalSize: struct { Precision int64 Scale int64 OK bool }{ Precision: 0, Scale: 0, OK: false, }, ScanType: reflect.TypeOf(""), }, { Name: "dec", TypeName: "NUMERIC", Length: struct { Len int64 OK bool }{ Len: 0, OK: false, }, DecimalSize: struct { Precision int64 Scale int64 OK bool }{ Precision: 9, Scale: 2, OK: true, }, ScanType: reflect.TypeOf(float64(0)), }, { Name: "d", TypeName: "1266", Length: struct { Len int64 OK bool }{ Len: 0, OK: false, }, DecimalSize: struct { Precision int64 Scale int64 OK bool }{ Precision: 0, Scale: 0, OK: false, }, ScanType: reflect.TypeOf(""), }, } rows, err := db.Query("SELECT 1::bigint AS a, text 'bar' AS bar, 1.28::numeric(9, 2) AS dec, '12:00:00'::timetz as d") require.NoError(t, err) columns, err := rows.ColumnTypes() require.NoError(t, err) assert.Len(t, columns, 4) for i, tt := range columnTypesTests { c := columns[i] if c.Name() != tt.Name { t.Errorf("(%d) got: %s, want: %s", i, c.Name(), tt.Name) } if c.DatabaseTypeName() != tt.TypeName { t.Errorf("(%d) got: %s, want: %s", i, c.DatabaseTypeName(), tt.TypeName) } l, ok := c.Length() if l != tt.Length.Len { t.Errorf("(%d) got: %d, want: %d", i, l, tt.Length.Len) } if ok != tt.Length.OK { t.Errorf("(%d) got: %t, want: %t", i, ok, tt.Length.OK) } p, s, ok := c.DecimalSize() if p != tt.DecimalSize.Precision { t.Errorf("(%d) got: %d, want: %d", i, p, tt.DecimalSize.Precision) } if s != tt.DecimalSize.Scale { t.Errorf("(%d) got: %d, want: %d", i, s, tt.DecimalSize.Scale) } if ok != tt.DecimalSize.OK { t.Errorf("(%d) got: %t, want: %t", i, ok, tt.DecimalSize.OK) } if c.ScanType() != tt.ScanType { t.Errorf("(%d) got: %v, want: %v", i, c.ScanType(), tt.ScanType) } } }) } func TestQueryLifeCycle(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { skipCockroachDB(t, db, "Server issues incorrect ParameterDescription (https://github.com/cockroachdb/cockroach/issues/60907)") rows, err := db.Query("SELECT 'foo', n FROM generate_series($1::int, $2::int) n WHERE 3 = $3", 1, 10, 3) require.NoError(t, err) rowCount := int64(0) for rows.Next() { rowCount++ var ( s string n int64 ) err := rows.Scan(&s, &n) require.NoError(t, err) if s != "foo" { t.Errorf(`Expected "foo", received "%v"`, s) } if n != rowCount { t.Errorf("Expected %d, received %d", rowCount, n) } } require.NoError(t, rows.Err()) err = rows.Close() require.NoError(t, err) rows, err = db.Query("select 1 where false") require.NoError(t, err) rowCount = int64(0) for rows.Next() { rowCount++ } require.NoError(t, rows.Err()) require.EqualValues(t, 0, rowCount) err = rows.Close() require.NoError(t, err) }) } // https://github.com/jackc/pgx/issues/409 func TestScanJSONIntoJSONRawMessage(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { var msg json.RawMessage err := db.QueryRow("select '{}'::json").Scan(&msg) require.NoError(t, err) require.EqualValues(t, []byte("{}"), []byte(msg)) }) } type testLog struct { lvl tracelog.LogLevel msg string data map[string]any } type testLogger struct { logs []testLog } func (l *testLogger) Log(ctx context.Context, lvl tracelog.LogLevel, msg string, data map[string]any) { l.logs = append(l.logs, testLog{lvl: lvl, msg: msg, data: data}) } func TestRegisterConnConfig(t *testing.T) { connConfig, err := pgx.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) logger := &testLogger{} connConfig.Tracer = &tracelog.TraceLog{Logger: logger, LogLevel: tracelog.LogLevelInfo} // Issue 947: Register and unregister a ConnConfig and ensure that the // returned connection string is not reused. connStr := stdlib.RegisterConnConfig(connConfig) require.Equal(t, "registeredConnConfig0", connStr) stdlib.UnregisterConnConfig(connStr) connStr = stdlib.RegisterConnConfig(connConfig) defer stdlib.UnregisterConnConfig(connStr) require.Equal(t, "registeredConnConfig1", connStr) db, err := sql.Open("pgx", connStr) require.NoError(t, err) defer closeDB(t, db) var n int64 err = db.QueryRow("select 1").Scan(&n) require.NoError(t, err) l := logger.logs[len(logger.logs)-1] assert.Equal(t, "Query", l.msg) assert.Equal(t, "select 1", l.data["sql"]) } // https://github.com/jackc/pgx/issues/958 func TestConnQueryRowConstraintErrors(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { skipPostgreSQLVersionLessThan(t, db, 11) skipCockroachDB(t, db, "Server does not support deferred constraint (https://github.com/cockroachdb/cockroach/issues/31632)") _, err := db.Exec(`create temporary table defer_test ( id text primary key, n int not null, unique (n), unique (n) deferrable initially deferred )`) require.NoError(t, err) _, err = db.Exec(`drop function if exists test_trigger cascade`) require.NoError(t, err) _, err = db.Exec(`create function test_trigger() returns trigger language plpgsql as $$ begin if new.n = 4 then raise exception 'n cant be 4!'; end if; return new; end$$`) require.NoError(t, err) _, err = db.Exec(`create constraint trigger test after insert or update on defer_test deferrable initially deferred for each row execute function test_trigger()`) require.NoError(t, err) _, err = db.Exec(`insert into defer_test (id, n) values ('a', 1), ('b', 2), ('c', 3)`) require.NoError(t, err) var id string err = db.QueryRow(`insert into defer_test (id, n) values ('e', 4) returning id`).Scan(&id) assert.Error(t, err) }) } func TestOptionBeforeAfterConnect(t *testing.T) { config, err := pgx.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) var beforeConnConfigs []*pgx.ConnConfig var afterConns []*pgx.Conn db := stdlib.OpenDB(*config, stdlib.OptionBeforeConnect(func(ctx context.Context, connConfig *pgx.ConnConfig) error { beforeConnConfigs = append(beforeConnConfigs, connConfig) return nil }), stdlib.OptionAfterConnect(func(ctx context.Context, conn *pgx.Conn) error { afterConns = append(afterConns, conn) return nil })) defer closeDB(t, db) // Force it to close and reopen a new connection after each query db.SetMaxIdleConns(0) _, err = db.Exec("select 1") require.NoError(t, err) _, err = db.Exec("select 1") require.NoError(t, err) require.Len(t, beforeConnConfigs, 2) require.Len(t, afterConns, 2) // Note: BeforeConnect creates a shallow copy, so the config contents will be the same but we wean to ensure they // are different objects, so can't use require.NotEqual require.False(t, config == beforeConnConfigs[0]) require.False(t, beforeConnConfigs[0] == beforeConnConfigs[1]) } func TestRandomizeHostOrderFunc(t *testing.T) { config, err := pgx.ParseConfig("postgres://host1,host2,host3") require.NoError(t, err) // Test that at some point we connect to all 3 hosts hostsNotSeenYet := map[string]struct{}{ "host1": {}, "host2": {}, "host3": {}, } // If we don't succeed within this many iterations, something is certainly wrong for range 100_000 { connCopy := *config stdlib.RandomizeHostOrderFunc(context.Background(), &connCopy) delete(hostsNotSeenYet, connCopy.Host) if len(hostsNotSeenYet) == 0 { return } hostCheckLoop: for _, h := range []string{"host1", "host2", "host3"} { if connCopy.Host == h { continue } for _, f := range connCopy.Fallbacks { if f.Host == h { continue hostCheckLoop } } require.Failf(t, "got configuration from RandomizeHostOrderFunc that did not have all the hosts", "%+v", connCopy) } } require.Fail(t, "did not get all hosts as primaries after many randomizations") } func TestResetSessionHookCalled(t *testing.T) { var mockCalled bool connConfig, err := pgx.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) db := stdlib.OpenDB(*connConfig, stdlib.OptionResetSession(func(ctx context.Context, conn *pgx.Conn) error { mockCalled = true return nil })) defer closeDB(t, db) err = db.Ping() require.NoError(t, err) err = db.Ping() require.NoError(t, err) require.True(t, mockCalled) } func TestCheckIdleConn(t *testing.T) { controllerConn, err := sql.Open("pgx", os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeDB(t, controllerConn) skipCockroachDB(t, controllerConn, "Server does not support pg_terminate_backend() (https://github.com/cockroachdb/cockroach/issues/35897)") db, err := sql.Open("pgx", os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) defer closeDB(t, db) var conns []*sql.Conn for range 3 { c, err := db.Conn(context.Background()) require.NoError(t, err) conns = append(conns, c) } require.EqualValues(t, 3, db.Stats().OpenConnections) var pids []uint32 for _, c := range conns { err := c.Raw(func(driverConn any) error { pids = append(pids, driverConn.(*stdlib.Conn).Conn().PgConn().PID()) return nil }) require.NoError(t, err) err = c.Close() require.NoError(t, err) } // The database/sql connection pool seems to automatically close idle connections to only keep 2 alive. // require.EqualValues(t, 3, db.Stats().OpenConnections) _, err = controllerConn.ExecContext(context.Background(), `select pg_terminate_backend(n) from unnest($1::int[]) n`, pids) require.NoError(t, err) // All conns are dead they don't know it and neither does the pool. But because of database/sql automatically closing // idle connections we can't be sure how many we should have. require.EqualValues(t, 3, db.Stats().OpenConnections) // Wait long enough so the pool will realize it needs to check the connections. time.Sleep(time.Second) // Pool should try all existing connections and find them dead, then create a new connection which should successfully ping. err = db.PingContext(context.Background()) require.NoError(t, err) // The original 3 conns should have been terminated and the a new conn established for the ping. require.EqualValues(t, 1, db.Stats().OpenConnections) c, err := db.Conn(context.Background()) require.NoError(t, err) var cPID uint32 err = c.Raw(func(driverConn any) error { cPID = driverConn.(*stdlib.Conn).Conn().PgConn().PID() return nil }) require.NoError(t, err) err = c.Close() require.NoError(t, err) require.NotContains(t, pids, cPID) } func TestOptionShouldPing_HookCalledOnReuse(t *testing.T) { hookCalled := false db := openDB(t, stdlib.OptionShouldPing(func(context.Context, stdlib.ShouldPingParams) bool { hookCalled = true // Return false to avoid relying on actual ping behavior. return false }), ) defer closeDB(t, db) // Ensure reuse (so ResetSession runs) db.SetMaxOpenConns(1) db.SetMaxIdleConns(1) // Establish the connection require.NoError(t, db.Ping()) // Reuse the connection -> should trigger ResetSession -> ShouldPing _, err := db.Exec("select 1") require.NoError(t, err) require.True(t, hookCalled, "hook should be called on reuse") } func TestRowsColumnTypeLength(t *testing.T) { testWithAllQueryExecModes(t, func(t *testing.T, db *sql.DB) { skipCockroachDB(t, db, "Server does not support type") columnTypeLengthTests := []struct { Len int64 OK bool }{ { math.MaxInt64, true, }, { math.MaxInt64, true, }, { 255, true, }, { 10, true, }, { 50, true, }, { 0, false, }, } _, err := db.Exec(`CREATE TEMPORARY TABLE temp_column_type_length ( text_column TEXT, bytea_column BYTEA, varchar_column VARCHAR(255), bpcharA_column BPCHAR(10)[], varbit_column VARBIT(50), int_column INT );`) require.NoError(t, err) rows, err := db.Query("SELECT * FROM temp_column_type_length") require.NoError(t, err) columns, err := rows.ColumnTypes() require.NoError(t, err) assert.Len(t, columns, 6) for i, tt := range columnTypeLengthTests { c := columns[i] l, ok := c.Length() if l != tt.Len { t.Errorf("(%d) got: %d, want: %d", i, l, tt.Len) } if ok != tt.OK { t.Errorf("(%d) got: %t, want: %t", i, ok, tt.OK) } } }) } pgx-5.8.0/testsetup/000077500000000000000000000000001512357711200143665ustar00rootroot00000000000000pgx-5.8.0/testsetup/README.md000066400000000000000000000001311512357711200156400ustar00rootroot00000000000000# Test Setup This directory contains miscellaneous files used to setup a test database. pgx-5.8.0/testsetup/generate_certs.go000066400000000000000000000103661512357711200177150ustar00rootroot00000000000000// Generates a CA, server certificate, and encrypted client certificate for testing pgx. package main import ( "crypto/rand" "crypto/rsa" "crypto/x509" "crypto/x509/pkix" "encoding/pem" "fmt" "math/big" "net" "os" "time" ) func main() { // Create the CA ca := &x509.Certificate{ SerialNumber: big.NewInt(1), Subject: pkix.Name{ CommonName: "pgx-root-ca", }, NotBefore: time.Now(), NotAfter: time.Now().AddDate(20, 0, 0), IsCA: true, ExtKeyUsage: []x509.ExtKeyUsage{x509.ExtKeyUsageClientAuth, x509.ExtKeyUsageServerAuth}, KeyUsage: x509.KeyUsageDigitalSignature | x509.KeyUsageCertSign, BasicConstraintsValid: true, } caKey, err := rsa.GenerateKey(rand.Reader, 4096) if err != nil { panic(err) } caBytes, err := x509.CreateCertificate(rand.Reader, ca, ca, &caKey.PublicKey, caKey) if err != nil { panic(err) } err = writePrivateKey("ca.key", caKey) if err != nil { panic(err) } err = writeCertificate("ca.pem", caBytes) if err != nil { panic(err) } // Create a server certificate signed by the CA for localhost. serverCert := &x509.Certificate{ SerialNumber: big.NewInt(2), Subject: pkix.Name{ CommonName: "localhost", }, DNSNames: []string{"localhost"}, IPAddresses: []net.IP{net.IPv4(127, 0, 0, 1), net.IPv6loopback}, NotBefore: time.Now(), NotAfter: time.Now().AddDate(20, 0, 0), ExtKeyUsage: []x509.ExtKeyUsage{x509.ExtKeyUsageClientAuth, x509.ExtKeyUsageServerAuth}, KeyUsage: x509.KeyUsageDigitalSignature, } serverCertPrivKey, err := rsa.GenerateKey(rand.Reader, 2048) if err != nil { panic(err) } serverBytes, err := x509.CreateCertificate(rand.Reader, serverCert, ca, &serverCertPrivKey.PublicKey, caKey) if err != nil { panic(err) } err = writePrivateKey("localhost.key", serverCertPrivKey) if err != nil { panic(err) } err = writeCertificate("localhost.crt", serverBytes) if err != nil { panic(err) } // Create a client certificate signed by the CA and encrypted. clientCert := &x509.Certificate{ SerialNumber: big.NewInt(3), Subject: pkix.Name{ CommonName: "pgx_sslcert", }, NotBefore: time.Now(), NotAfter: time.Now().AddDate(20, 0, 0), ExtKeyUsage: []x509.ExtKeyUsage{x509.ExtKeyUsageClientAuth}, KeyUsage: x509.KeyUsageDigitalSignature, } clientCertPrivKey, err := rsa.GenerateKey(rand.Reader, 2048) if err != nil { panic(err) } clientBytes, err := x509.CreateCertificate(rand.Reader, clientCert, ca, &clientCertPrivKey.PublicKey, caKey) if err != nil { panic(err) } err = writeEncryptedPrivateKey("pgx_sslcert.key", clientCertPrivKey, "certpw") if err != nil { panic(err) } err = writeCertificate("pgx_sslcert.crt", clientBytes) if err != nil { panic(err) } } func writePrivateKey(path string, privateKey *rsa.PrivateKey) error { file, err := os.Create(path) if err != nil { return fmt.Errorf("writePrivateKey: %w", err) } err = pem.Encode(file, &pem.Block{ Type: "RSA PRIVATE KEY", Bytes: x509.MarshalPKCS1PrivateKey(privateKey), }) if err != nil { return fmt.Errorf("writePrivateKey: %w", err) } err = file.Close() if err != nil { return fmt.Errorf("writePrivateKey: %w", err) } return nil } func writeEncryptedPrivateKey(path string, privateKey *rsa.PrivateKey, password string) error { file, err := os.Create(path) if err != nil { return fmt.Errorf("writeEncryptedPrivateKey: %w", err) } block, err := x509.EncryptPEMBlock(rand.Reader, "CERTIFICATE", x509.MarshalPKCS1PrivateKey(privateKey), []byte(password), x509.PEMCipher3DES) if err != nil { return fmt.Errorf("writeEncryptedPrivateKey: %w", err) } err = pem.Encode(file, block) if err != nil { return fmt.Errorf("writeEncryptedPrivateKey: %w", err) } err = file.Close() if err != nil { return fmt.Errorf("writeEncryptedPrivateKey: %w", err) } return nil } func writeCertificate(path string, certBytes []byte) error { file, err := os.Create(path) if err != nil { return fmt.Errorf("writeCertificate: %w", err) } err = pem.Encode(file, &pem.Block{ Type: "CERTIFICATE", Bytes: certBytes, }) if err != nil { return fmt.Errorf("writeCertificate: %w", err) } err = file.Close() if err != nil { return fmt.Errorf("writeCertificate: %w", err) } return nil } pgx-5.8.0/testsetup/pg_hba.conf000066400000000000000000000007021512357711200164540ustar00rootroot00000000000000local all postgres trust local all all trust host all pgx_md5 127.0.0.1/32 md5 host all pgx_scram 127.0.0.1/32 scram-sha-256 host all pgx_pw 127.0.0.1/32 password hostssl all pgx_ssl 127.0.0.1/32 scram-sha-256 hostssl all pgx_sslcert 127.0.0.1/32 cert pgx-5.8.0/testsetup/postgresql_setup.sql000066400000000000000000000015541512357711200205370ustar00rootroot00000000000000-- Create extensions and types. create extension hstore; create extension ltree; create domain uint64 as numeric(20,0); -- Create users for different types of connections and authentication. create user pgx_ssl with superuser PASSWORD 'secret'; create user pgx_sslcert with superuser PASSWORD 'secret'; set password_encryption = md5; create user pgx_md5 with superuser PASSWORD 'secret'; set password_encryption = 'scram-sha-256'; create user pgx_pw with superuser PASSWORD 'secret'; create user pgx_scram with superuser PASSWORD 'secret'; \set whoami `whoami` create user :whoami with superuser; -- unix domain socket user -- The tricky test user, below, has to actually exist so that it can be used in a test -- of aclitem formatting. It turns out aclitems cannot contain non-existing users/roles. create user " tricky, ' } "" \\ test user " superuser password 'secret'; pgx-5.8.0/testsetup/postgresql_ssl.conf000066400000000000000000000001331512357711200203160ustar00rootroot00000000000000ssl = on ssl_cert_file = 'server.crt' ssl_key_file = 'server.key' ssl_ca_file = 'root.crt' pgx-5.8.0/tracelog/000077500000000000000000000000001512357711200141265ustar00rootroot00000000000000pgx-5.8.0/tracelog/tracelog.go000066400000000000000000000260231512357711200162600ustar00rootroot00000000000000// Package tracelog provides a tracer that acts as a traditional logger. package tracelog import ( "context" "encoding/hex" "errors" "fmt" "sync" "time" "unicode/utf8" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgxpool" ) // LogLevel represents the pgx logging level. See LogLevel* constants for // possible values. type LogLevel int // The values for log levels are chosen such that the zero value means that no // log level was specified. const ( LogLevelTrace = LogLevel(6) LogLevelDebug = LogLevel(5) LogLevelInfo = LogLevel(4) LogLevelWarn = LogLevel(3) LogLevelError = LogLevel(2) LogLevelNone = LogLevel(1) ) func (ll LogLevel) String() string { switch ll { case LogLevelTrace: return "trace" case LogLevelDebug: return "debug" case LogLevelInfo: return "info" case LogLevelWarn: return "warn" case LogLevelError: return "error" case LogLevelNone: return "none" default: return fmt.Sprintf("invalid level %d", ll) } } // Logger is the interface used to get log output from pgx. type Logger interface { // Log a message at the given level with data key/value pairs. data may be nil. Log(ctx context.Context, level LogLevel, msg string, data map[string]any) } // LoggerFunc is a wrapper around a function to satisfy the pgx.Logger interface type LoggerFunc func(ctx context.Context, level LogLevel, msg string, data map[string]any) // Log delegates the logging request to the wrapped function func (f LoggerFunc) Log(ctx context.Context, level LogLevel, msg string, data map[string]any) { f(ctx, level, msg, data) } // LogLevelFromString converts log level string to constant // // Valid levels: // // trace // debug // info // warn // error // none func LogLevelFromString(s string) (LogLevel, error) { switch s { case "trace": return LogLevelTrace, nil case "debug": return LogLevelDebug, nil case "info": return LogLevelInfo, nil case "warn": return LogLevelWarn, nil case "error": return LogLevelError, nil case "none": return LogLevelNone, nil default: return 0, errors.New("invalid log level") } } func logQueryArgs(args []any) []any { logArgs := make([]any, 0, len(args)) for _, a := range args { switch v := a.(type) { case []byte: if len(v) < 64 { a = hex.EncodeToString(v) } else { a = fmt.Sprintf("%x (truncated %d bytes)", v[:64], len(v)-64) } case string: if len(v) > 64 { l := 0 for w := 0; l < 64; l += w { _, w = utf8.DecodeRuneInString(v[l:]) } if len(v) > l { a = fmt.Sprintf("%s (truncated %d bytes)", v[:l], len(v)-l) } } } logArgs = append(logArgs, a) } return logArgs } // TraceLogConfig holds the configuration for key names type TraceLogConfig struct { TimeKey string } // DefaultTraceLogConfig returns the default configuration for TraceLog func DefaultTraceLogConfig() *TraceLogConfig { return &TraceLogConfig{ TimeKey: "time", } } // TraceLog implements pgx.QueryTracer, pgx.BatchTracer, pgx.ConnectTracer, pgx.CopyFromTracer, pgxpool.AcquireTracer, // and pgxpool.ReleaseTracer. Logger and LogLevel are required. Config will be automatically initialized on the // first use if nil. type TraceLog struct { Logger Logger LogLevel LogLevel Config *TraceLogConfig ensureConfigOnce sync.Once } // ensureConfig initializes the Config field with default values if it is nil. func (tl *TraceLog) ensureConfig() { tl.ensureConfigOnce.Do( func() { if tl.Config == nil { tl.Config = DefaultTraceLogConfig() } }, ) } type ctxKey int const ( _ ctxKey = iota tracelogQueryCtxKey tracelogBatchCtxKey tracelogCopyFromCtxKey tracelogConnectCtxKey tracelogPrepareCtxKey tracelogAcquireCtxKey ) type traceQueryData struct { startTime time.Time sql string args []any } func (tl *TraceLog) TraceQueryStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryStartData) context.Context { return context.WithValue(ctx, tracelogQueryCtxKey, &traceQueryData{ startTime: time.Now(), sql: data.SQL, args: data.Args, }) } func (tl *TraceLog) TraceQueryEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryEndData) { tl.ensureConfig() queryData := ctx.Value(tracelogQueryCtxKey).(*traceQueryData) endTime := time.Now() interval := endTime.Sub(queryData.startTime) if data.Err != nil { if tl.shouldLog(LogLevelError) { tl.log(ctx, conn, LogLevelError, "Query", map[string]any{"sql": queryData.sql, "args": logQueryArgs(queryData.args), "err": data.Err, tl.Config.TimeKey: interval}) } return } if tl.shouldLog(LogLevelInfo) { tl.log(ctx, conn, LogLevelInfo, "Query", map[string]any{"sql": queryData.sql, "args": logQueryArgs(queryData.args), tl.Config.TimeKey: interval, "commandTag": data.CommandTag.String()}) } } type traceBatchData struct { startTime time.Time } func (tl *TraceLog) TraceBatchStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchStartData) context.Context { return context.WithValue(ctx, tracelogBatchCtxKey, &traceBatchData{ startTime: time.Now(), }) } func (tl *TraceLog) TraceBatchQuery(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchQueryData) { if data.Err != nil { if tl.shouldLog(LogLevelError) { tl.log(ctx, conn, LogLevelError, "BatchQuery", map[string]any{"sql": data.SQL, "args": logQueryArgs(data.Args), "err": data.Err}) } return } if tl.shouldLog(LogLevelInfo) { tl.log(ctx, conn, LogLevelInfo, "BatchQuery", map[string]any{"sql": data.SQL, "args": logQueryArgs(data.Args), "commandTag": data.CommandTag.String()}) } } func (tl *TraceLog) TraceBatchEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchEndData) { tl.ensureConfig() queryData := ctx.Value(tracelogBatchCtxKey).(*traceBatchData) endTime := time.Now() interval := endTime.Sub(queryData.startTime) if data.Err != nil { if tl.shouldLog(LogLevelError) { tl.log(ctx, conn, LogLevelError, "BatchClose", map[string]any{"err": data.Err, tl.Config.TimeKey: interval}) } return } if tl.shouldLog(LogLevelInfo) { tl.log(ctx, conn, LogLevelInfo, "BatchClose", map[string]any{tl.Config.TimeKey: interval}) } } type traceCopyFromData struct { startTime time.Time TableName pgx.Identifier ColumnNames []string } func (tl *TraceLog) TraceCopyFromStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceCopyFromStartData) context.Context { return context.WithValue(ctx, tracelogCopyFromCtxKey, &traceCopyFromData{ startTime: time.Now(), TableName: data.TableName, ColumnNames: data.ColumnNames, }) } func (tl *TraceLog) TraceCopyFromEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceCopyFromEndData) { tl.ensureConfig() copyFromData := ctx.Value(tracelogCopyFromCtxKey).(*traceCopyFromData) endTime := time.Now() interval := endTime.Sub(copyFromData.startTime) if data.Err != nil { if tl.shouldLog(LogLevelError) { tl.log(ctx, conn, LogLevelError, "CopyFrom", map[string]any{"tableName": copyFromData.TableName, "columnNames": copyFromData.ColumnNames, "err": data.Err, tl.Config.TimeKey: interval}) } return } if tl.shouldLog(LogLevelInfo) { tl.log(ctx, conn, LogLevelInfo, "CopyFrom", map[string]any{"tableName": copyFromData.TableName, "columnNames": copyFromData.ColumnNames, "err": data.Err, tl.Config.TimeKey: interval, "rowCount": data.CommandTag.RowsAffected()}) } } type traceConnectData struct { startTime time.Time connConfig *pgx.ConnConfig } func (tl *TraceLog) TraceConnectStart(ctx context.Context, data pgx.TraceConnectStartData) context.Context { return context.WithValue(ctx, tracelogConnectCtxKey, &traceConnectData{ startTime: time.Now(), connConfig: data.ConnConfig, }) } func (tl *TraceLog) TraceConnectEnd(ctx context.Context, data pgx.TraceConnectEndData) { tl.ensureConfig() connectData := ctx.Value(tracelogConnectCtxKey).(*traceConnectData) endTime := time.Now() interval := endTime.Sub(connectData.startTime) if data.Err != nil { if tl.shouldLog(LogLevelError) { tl.Logger.Log(ctx, LogLevelError, "Connect", map[string]any{ "host": connectData.connConfig.Host, "port": connectData.connConfig.Port, "database": connectData.connConfig.Database, tl.Config.TimeKey: interval, "err": data.Err, }) } return } if data.Conn != nil { if tl.shouldLog(LogLevelInfo) { tl.log(ctx, data.Conn, LogLevelInfo, "Connect", map[string]any{ "host": connectData.connConfig.Host, "port": connectData.connConfig.Port, "database": connectData.connConfig.Database, tl.Config.TimeKey: interval, }) } } } type tracePrepareData struct { startTime time.Time name string sql string } func (tl *TraceLog) TracePrepareStart(ctx context.Context, _ *pgx.Conn, data pgx.TracePrepareStartData) context.Context { return context.WithValue(ctx, tracelogPrepareCtxKey, &tracePrepareData{ startTime: time.Now(), name: data.Name, sql: data.SQL, }) } func (tl *TraceLog) TracePrepareEnd(ctx context.Context, conn *pgx.Conn, data pgx.TracePrepareEndData) { tl.ensureConfig() prepareData := ctx.Value(tracelogPrepareCtxKey).(*tracePrepareData) endTime := time.Now() interval := endTime.Sub(prepareData.startTime) if data.Err != nil { if tl.shouldLog(LogLevelError) { tl.log(ctx, conn, LogLevelError, "Prepare", map[string]any{"name": prepareData.name, "sql": prepareData.sql, "err": data.Err, tl.Config.TimeKey: interval}) } return } if tl.shouldLog(LogLevelInfo) { tl.log(ctx, conn, LogLevelInfo, "Prepare", map[string]any{"name": prepareData.name, "sql": prepareData.sql, tl.Config.TimeKey: interval, "alreadyPrepared": data.AlreadyPrepared}) } } type traceAcquireData struct { startTime time.Time } func (tl *TraceLog) TraceAcquireStart(ctx context.Context, _ *pgxpool.Pool, _ pgxpool.TraceAcquireStartData) context.Context { return context.WithValue(ctx, tracelogAcquireCtxKey, &traceAcquireData{ startTime: time.Now(), }) } func (tl *TraceLog) TraceAcquireEnd(ctx context.Context, _ *pgxpool.Pool, data pgxpool.TraceAcquireEndData) { tl.ensureConfig() acquireData := ctx.Value(tracelogAcquireCtxKey).(*traceAcquireData) endTime := time.Now() interval := endTime.Sub(acquireData.startTime) if data.Err != nil { if tl.shouldLog(LogLevelError) { tl.Logger.Log(ctx, LogLevelError, "Acquire", map[string]any{"err": data.Err, tl.Config.TimeKey: interval}) } return } if data.Conn != nil { if tl.shouldLog(LogLevelDebug) { tl.log(ctx, data.Conn, LogLevelDebug, "Acquire", map[string]any{tl.Config.TimeKey: interval}) } } } func (tl *TraceLog) TraceRelease(_ *pgxpool.Pool, data pgxpool.TraceReleaseData) { if tl.shouldLog(LogLevelDebug) { // there is no context on the TraceRelease callback tl.log(context.Background(), data.Conn, LogLevelDebug, "Release", map[string]any{}) } } func (tl *TraceLog) shouldLog(lvl LogLevel) bool { return tl.LogLevel >= lvl } func (tl *TraceLog) log(ctx context.Context, conn *pgx.Conn, lvl LogLevel, msg string, data map[string]any) { if data == nil { data = map[string]any{} } pgConn := conn.PgConn() if pgConn != nil { pid := pgConn.PID() if pid != 0 { data["pid"] = pid } } tl.Logger.Log(ctx, lvl, msg, data) } pgx-5.8.0/tracelog/tracelog_test.go000066400000000000000000000357461512357711200173330ustar00rootroot00000000000000package tracelog_test import ( "bytes" "context" "log" "os" "strings" "sync" "testing" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgxpool" "github.com/jackc/pgx/v5/pgxtest" "github.com/jackc/pgx/v5/tracelog" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" "golang.org/x/sync/errgroup" ) var defaultConnTestRunner pgxtest.ConnTestRunner func init() { defaultConnTestRunner = pgxtest.DefaultConnTestRunner() defaultConnTestRunner.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config, err := pgx.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) return config } } type testLog struct { lvl tracelog.LogLevel msg string data map[string]any } type testLogger struct { logs []testLog mux sync.Mutex } func (l *testLogger) Log(ctx context.Context, level tracelog.LogLevel, msg string, data map[string]any) { l.mux.Lock() defer l.mux.Unlock() data["ctxdata"] = ctx.Value("ctxdata") l.logs = append(l.logs, testLog{lvl: level, msg: msg, data: data}) } func (l *testLogger) Clear() { l.mux.Lock() defer l.mux.Unlock() l.logs = l.logs[0:0] } func (l *testLogger) FilterByMsg(msg string) (res []testLog) { l.mux.Lock() defer l.mux.Unlock() for _, log := range l.logs { if log.msg == msg { res = append(res, log) } } return res } func TestContextGetsPassedToLogMethod(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() logger := &testLogger{} tracer := &tracelog.TraceLog{ Logger: logger, LogLevel: tracelog.LogLevelTrace, } ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } pgxtest.RunWithQueryExecModes(ctx, t, ctr, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { logger.Clear() // Clear any logs written when establishing connection ctx = context.WithValue(ctx, "ctxdata", "foo") _, err := conn.Exec(ctx, `;`) require.NoError(t, err) require.Len(t, logger.logs, 1) require.Equal(t, "foo", logger.logs[0].data["ctxdata"]) }) } func TestLoggerFunc(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() const testMsg = "foo" buf := bytes.Buffer{} logger := log.New(&buf, "", 0) createAdapterFn := func(logger *log.Logger) tracelog.LoggerFunc { return func(ctx context.Context, level tracelog.LogLevel, msg string, data map[string]any) { logger.Printf("%s", testMsg) } } config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = &tracelog.TraceLog{ Logger: createAdapterFn(logger), LogLevel: tracelog.LogLevelTrace, } conn, err := pgx.ConnectConfig(ctx, config) require.NoError(t, err) defer conn.Close(ctx) buf.Reset() // Clear logs written when establishing connection if _, err := conn.Exec(context.TODO(), ";"); err != nil { t.Fatal(err) } if strings.TrimSpace(buf.String()) != testMsg { t.Errorf("Expected logger function to return '%s', but it was '%s'", testMsg, buf.String()) } } func TestLogQuery(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() logger := &testLogger{} tracer := &tracelog.TraceLog{ Logger: logger, LogLevel: tracelog.LogLevelTrace, } ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } pgxtest.RunWithQueryExecModes(ctx, t, ctr, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { logger.Clear() // Clear any logs written when establishing connection _, err := conn.Exec(ctx, `select $1::text`, "testing") require.NoError(t, err) logs := logger.FilterByMsg("Query") require.Len(t, logs, 1) require.Equal(t, tracelog.LogLevelInfo, logs[0].lvl) logger.Clear() _, err = conn.Exec(ctx, `foo`, "testing") require.Error(t, err) logs = logger.FilterByMsg("Query") require.Len(t, logs, 1) require.Equal(t, tracelog.LogLevelError, logs[0].lvl) require.Equal(t, err, logs[0].data["err"]) }) } // https://github.com/jackc/pgx/issues/1365 func TestLogQueryArgsHandlesUTF8(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() logger := &testLogger{} tracer := &tracelog.TraceLog{ Logger: logger, LogLevel: tracelog.LogLevelTrace, } ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } pgxtest.RunWithQueryExecModes(ctx, t, ctr, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { logger.Clear() // Clear any logs written when establishing connection var s string for range 63 { s += "0" } s += "😊" _, err := conn.Exec(ctx, `select $1::text`, s) require.NoError(t, err) logs := logger.FilterByMsg("Query") require.Len(t, logs, 1) require.Equal(t, tracelog.LogLevelInfo, logs[0].lvl) require.Equal(t, s, logs[0].data["args"].([]any)[0]) logger.Clear() _, err = conn.Exec(ctx, `select $1::text`, s+"000") require.NoError(t, err) logs = logger.FilterByMsg("Query") require.Len(t, logs, 1) require.Equal(t, tracelog.LogLevelInfo, logs[0].lvl) require.Equal(t, s+" (truncated 3 bytes)", logs[0].data["args"].([]any)[0]) }) } func TestLogCopyFrom(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() logger := &testLogger{} tracer := &tracelog.TraceLog{ Logger: logger, LogLevel: tracelog.LogLevelTrace, } ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } pgxtest.RunWithQueryExecModes(ctx, t, ctr, pgxtest.KnownOIDQueryExecModes, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { _, err := conn.Exec(ctx, `create temporary table foo(a int4)`) require.NoError(t, err) logger.Clear() inputRows := [][]any{ {int32(1)}, {nil}, } copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a"}, pgx.CopyFromRows(inputRows)) require.NoError(t, err) require.EqualValues(t, len(inputRows), copyCount) logs := logger.FilterByMsg("CopyFrom") require.Len(t, logs, 1) require.Equal(t, tracelog.LogLevelInfo, logs[0].lvl) logger.Clear() inputRows = [][]any{ {"not an integer"}, {nil}, } copyCount, err = conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a"}, pgx.CopyFromRows(inputRows)) require.Error(t, err) require.EqualValues(t, 0, copyCount) logs = logger.FilterByMsg("CopyFrom") require.Len(t, logs, 1) require.Equal(t, tracelog.LogLevelError, logs[0].lvl) }) } func TestLogConnect(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() logger := &testLogger{} tracer := &tracelog.TraceLog{ Logger: logger, LogLevel: tracelog.LogLevelTrace, } config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer conn1, err := pgx.ConnectConfig(ctx, config) require.NoError(t, err) defer conn1.Close(ctx) require.Len(t, logger.logs, 1) require.Equal(t, "Connect", logger.logs[0].msg) require.Equal(t, tracelog.LogLevelInfo, logger.logs[0].lvl) logger.Clear() config, err = pgx.ParseConfig("host=/invalid") require.NoError(t, err) config.Tracer = tracer conn2, err := pgx.ConnectConfig(ctx, config) require.Nil(t, conn2) require.Error(t, err) require.Len(t, logger.logs, 1) require.Equal(t, "Connect", logger.logs[0].msg) require.Equal(t, tracelog.LogLevelError, logger.logs[0].lvl) } func TestLogBatchStatementsOnExec(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() logger := &testLogger{} tracer := &tracelog.TraceLog{ Logger: logger, LogLevel: tracelog.LogLevelTrace, } ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } pgxtest.RunWithQueryExecModes(ctx, t, ctr, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { logger.Clear() // Clear any logs written when establishing connection batch := &pgx.Batch{} batch.Queue("create table foo (id bigint)") batch.Queue("drop table foo") br := conn.SendBatch(ctx, batch) _, err := br.Exec() require.NoError(t, err) _, err = br.Exec() require.NoError(t, err) err = br.Close() require.NoError(t, err) require.Len(t, logger.logs, 3) assert.Equal(t, "BatchQuery", logger.logs[0].msg) assert.Equal(t, "create table foo (id bigint)", logger.logs[0].data["sql"]) assert.Equal(t, "BatchQuery", logger.logs[1].msg) assert.Equal(t, "drop table foo", logger.logs[1].data["sql"]) assert.Equal(t, "BatchClose", logger.logs[2].msg) }) } func TestLogBatchStatementsOnBatchResultClose(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() logger := &testLogger{} tracer := &tracelog.TraceLog{ Logger: logger, LogLevel: tracelog.LogLevelTrace, } ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } pgxtest.RunWithQueryExecModes(ctx, t, ctr, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { logger.Clear() // Clear any logs written when establishing connection batch := &pgx.Batch{} batch.Queue("select generate_series(1,$1)", 100) batch.Queue("select 1 = 1;") br := conn.SendBatch(ctx, batch) err := br.Close() require.NoError(t, err) require.Len(t, logger.logs, 3) assert.Equal(t, "BatchQuery", logger.logs[0].msg) assert.Equal(t, "select generate_series(1,$1)", logger.logs[0].data["sql"]) assert.Equal(t, "BatchQuery", logger.logs[1].msg) assert.Equal(t, "select 1 = 1;", logger.logs[1].data["sql"]) assert.Equal(t, "BatchClose", logger.logs[2].msg) }) } func TestLogAcquire(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() logger := &testLogger{} tracer := &tracelog.TraceLog{ Logger: logger, LogLevel: tracelog.LogLevelTrace, } config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer poolConfig, err := pgxpool.ParseConfig(config.ConnString()) require.NoError(t, err) poolConfig.ConnConfig = config pool1, err := pgxpool.NewWithConfig(ctx, poolConfig) require.NoError(t, err) defer pool1.Close() conn1, err := pool1.Acquire(ctx) require.NoError(t, err) defer conn1.Release() require.Len(t, logger.logs, 2) // Has both the Connect and Acquire logs require.Equal(t, "Acquire", logger.logs[1].msg) require.Equal(t, tracelog.LogLevelDebug, logger.logs[1].lvl) logger.Clear() // create a 2nd pool with a bad host to verify the error handling poolConfig, err = pgxpool.ParseConfig("host=/invalid") require.NoError(t, err) poolConfig.ConnConfig.Tracer = tracer pool2, err := pgxpool.NewWithConfig(ctx, poolConfig) require.NoError(t, err) defer pool2.Close() conn2, err := pool2.Acquire(ctx) require.Error(t, err) require.Nil(t, conn2) require.Len(t, logger.logs, 2) require.Equal(t, "Acquire", logger.logs[1].msg) require.Equal(t, tracelog.LogLevelError, logger.logs[1].lvl) } func TestLogRelease(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() logger := &testLogger{} tracer := &tracelog.TraceLog{ Logger: logger, LogLevel: tracelog.LogLevelTrace, } config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer poolConfig, err := pgxpool.ParseConfig(config.ConnString()) require.NoError(t, err) poolConfig.ConnConfig = config pool1, err := pgxpool.NewWithConfig(ctx, poolConfig) require.NoError(t, err) defer pool1.Close() conn1, err := pool1.Acquire(ctx) require.NoError(t, err) logger.Clear() conn1.Release() require.Len(t, logger.logs, 1) require.Equal(t, "Release", logger.logs[0].msg) require.Equal(t, tracelog.LogLevelDebug, logger.logs[0].lvl) } func TestLogPrepare(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() logger := &testLogger{} tracer := &tracelog.TraceLog{ Logger: logger, LogLevel: tracelog.LogLevelTrace, } ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } pgxtest.RunWithQueryExecModes(ctx, t, ctr, []pgx.QueryExecMode{ pgx.QueryExecModeCacheStatement, pgx.QueryExecModeCacheDescribe, pgx.QueryExecModeDescribeExec, }, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { logger.Clear() // Clear any logs written when establishing connection _, err := conn.Exec(ctx, `select $1::text`, "testing") require.NoError(t, err) logs := logger.FilterByMsg("Prepare") require.Len(t, logs, 1) require.Equal(t, tracelog.LogLevelInfo, logs[0].lvl) logger.Clear() _, err = conn.Exec(ctx, `foo aaaa`, "testing") require.Error(t, err) logs = logger.FilterByMsg("Prepare") require.Len(t, logs, 1) require.Equal(t, err, logs[0].data["err"]) }) ctx, cancel = context.WithTimeout(ctx, 30*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, ctr, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { logger.Clear() // Clear any logs written when establishing connection _, err := conn.Prepare(ctx, "test_query_1", `select $1::int`) require.NoError(t, err) require.Len(t, logger.logs, 1) require.Equal(t, "Prepare", logger.logs[0].msg) require.Equal(t, tracelog.LogLevelInfo, logger.logs[0].lvl) logger.Clear() _, err = conn.Prepare(ctx, `test_query_2`, "foo aaaa") require.Error(t, err) require.Len(t, logger.logs, 1) require.Equal(t, "Prepare", logger.logs[0].msg) require.Equal(t, err, logger.logs[0].data["err"]) }) } // https://github.com/jackc/pgx/pull/2120 func TestConcurrentUsage(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() logger := &testLogger{} tracer := &tracelog.TraceLog{ Logger: logger, LogLevel: tracelog.LogLevelTrace, } config, err := pgxpool.ParseConfig(os.Getenv("PGX_TEST_DATABASE")) require.NoError(t, err) config.ConnConfig.Tracer = tracer for range 50 { func() { pool, err := pgxpool.NewWithConfig(ctx, config) require.NoError(t, err) defer pool.Close() eg := errgroup.Group{} for range 5 { eg.Go(func() error { _, err := pool.Exec(ctx, `select 1`) return err }) } err = eg.Wait() require.NoError(t, err) }() } } pgx-5.8.0/tracer.go000066400000000000000000000057171512357711200141470ustar00rootroot00000000000000package pgx import ( "context" "github.com/jackc/pgx/v5/pgconn" ) // QueryTracer traces Query, QueryRow, and Exec. type QueryTracer interface { // TraceQueryStart is called at the beginning of Query, QueryRow, and Exec calls. The returned context is used for the // rest of the call and will be passed to TraceQueryEnd. TraceQueryStart(ctx context.Context, conn *Conn, data TraceQueryStartData) context.Context TraceQueryEnd(ctx context.Context, conn *Conn, data TraceQueryEndData) } type TraceQueryStartData struct { SQL string Args []any } type TraceQueryEndData struct { CommandTag pgconn.CommandTag Err error } // BatchTracer traces SendBatch. type BatchTracer interface { // TraceBatchStart is called at the beginning of SendBatch calls. The returned context is used for the // rest of the call and will be passed to TraceBatchQuery and TraceBatchEnd. TraceBatchStart(ctx context.Context, conn *Conn, data TraceBatchStartData) context.Context TraceBatchQuery(ctx context.Context, conn *Conn, data TraceBatchQueryData) TraceBatchEnd(ctx context.Context, conn *Conn, data TraceBatchEndData) } type TraceBatchStartData struct { Batch *Batch } type TraceBatchQueryData struct { SQL string Args []any CommandTag pgconn.CommandTag Err error } type TraceBatchEndData struct { Err error } // CopyFromTracer traces CopyFrom. type CopyFromTracer interface { // TraceCopyFromStart is called at the beginning of CopyFrom calls. The returned context is used for the // rest of the call and will be passed to TraceCopyFromEnd. TraceCopyFromStart(ctx context.Context, conn *Conn, data TraceCopyFromStartData) context.Context TraceCopyFromEnd(ctx context.Context, conn *Conn, data TraceCopyFromEndData) } type TraceCopyFromStartData struct { TableName Identifier ColumnNames []string } type TraceCopyFromEndData struct { CommandTag pgconn.CommandTag Err error } // PrepareTracer traces Prepare. type PrepareTracer interface { // TracePrepareStart is called at the beginning of Prepare calls. The returned context is used for the // rest of the call and will be passed to TracePrepareEnd. TracePrepareStart(ctx context.Context, conn *Conn, data TracePrepareStartData) context.Context TracePrepareEnd(ctx context.Context, conn *Conn, data TracePrepareEndData) } type TracePrepareStartData struct { Name string SQL string } type TracePrepareEndData struct { AlreadyPrepared bool Err error } // ConnectTracer traces Connect and ConnectConfig. type ConnectTracer interface { // TraceConnectStart is called at the beginning of Connect and ConnectConfig calls. The returned context is used for // the rest of the call and will be passed to TraceConnectEnd. TraceConnectStart(ctx context.Context, data TraceConnectStartData) context.Context TraceConnectEnd(ctx context.Context, data TraceConnectEndData) } type TraceConnectStartData struct { ConnConfig *ConnConfig } type TraceConnectEndData struct { Conn *Conn Err error } pgx-5.8.0/tracer_test.go000066400000000000000000000466731512357711200152140ustar00rootroot00000000000000package pgx_test import ( "context" "testing" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/require" ) type testTracer struct { traceQueryStart func(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryStartData) context.Context traceQueryEnd func(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryEndData) traceBatchStart func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchStartData) context.Context traceBatchQuery func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchQueryData) traceBatchEnd func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchEndData) traceCopyFromStart func(ctx context.Context, conn *pgx.Conn, data pgx.TraceCopyFromStartData) context.Context traceCopyFromEnd func(ctx context.Context, conn *pgx.Conn, data pgx.TraceCopyFromEndData) tracePrepareStart func(ctx context.Context, conn *pgx.Conn, data pgx.TracePrepareStartData) context.Context tracePrepareEnd func(ctx context.Context, conn *pgx.Conn, data pgx.TracePrepareEndData) traceConnectStart func(ctx context.Context, data pgx.TraceConnectStartData) context.Context traceConnectEnd func(ctx context.Context, data pgx.TraceConnectEndData) } type ctxKey string func (tt *testTracer) TraceQueryStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryStartData) context.Context { if tt.traceQueryStart != nil { return tt.traceQueryStart(ctx, conn, data) } return ctx } func (tt *testTracer) TraceQueryEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryEndData) { if tt.traceQueryEnd != nil { tt.traceQueryEnd(ctx, conn, data) } } func (tt *testTracer) TraceBatchStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchStartData) context.Context { if tt.traceBatchStart != nil { return tt.traceBatchStart(ctx, conn, data) } return ctx } func (tt *testTracer) TraceBatchQuery(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchQueryData) { if tt.traceBatchQuery != nil { tt.traceBatchQuery(ctx, conn, data) } } func (tt *testTracer) TraceBatchEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchEndData) { if tt.traceBatchEnd != nil { tt.traceBatchEnd(ctx, conn, data) } } func (tt *testTracer) TraceCopyFromStart(ctx context.Context, conn *pgx.Conn, data pgx.TraceCopyFromStartData) context.Context { if tt.traceCopyFromStart != nil { return tt.traceCopyFromStart(ctx, conn, data) } return ctx } func (tt *testTracer) TraceCopyFromEnd(ctx context.Context, conn *pgx.Conn, data pgx.TraceCopyFromEndData) { if tt.traceCopyFromEnd != nil { tt.traceCopyFromEnd(ctx, conn, data) } } func (tt *testTracer) TracePrepareStart(ctx context.Context, conn *pgx.Conn, data pgx.TracePrepareStartData) context.Context { if tt.tracePrepareStart != nil { return tt.tracePrepareStart(ctx, conn, data) } return ctx } func (tt *testTracer) TracePrepareEnd(ctx context.Context, conn *pgx.Conn, data pgx.TracePrepareEndData) { if tt.tracePrepareEnd != nil { tt.tracePrepareEnd(ctx, conn, data) } } func (tt *testTracer) TraceConnectStart(ctx context.Context, data pgx.TraceConnectStartData) context.Context { if tt.traceConnectStart != nil { return tt.traceConnectStart(ctx, data) } return ctx } func (tt *testTracer) TraceConnectEnd(ctx context.Context, data pgx.TraceConnectEndData) { if tt.traceConnectEnd != nil { tt.traceConnectEnd(ctx, data) } } func TestTraceExec(t *testing.T) { t.Parallel() tracer := &testTracer{} ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, ctr, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { traceQueryStartCalled := false tracer.traceQueryStart = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryStartData) context.Context { traceQueryStartCalled = true require.Equal(t, `select $1::text`, data.SQL) require.Len(t, data.Args, 1) require.Equal(t, `testing`, data.Args[0]) return context.WithValue(ctx, ctxKey(ctxKey("fromTraceQueryStart")), "foo") } traceQueryEndCalled := false tracer.traceQueryEnd = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryEndData) { traceQueryEndCalled = true require.Equal(t, "foo", ctx.Value(ctxKey(ctxKey("fromTraceQueryStart")))) require.Equal(t, `SELECT 1`, data.CommandTag.String()) require.NoError(t, data.Err) } _, err := conn.Exec(ctx, `select $1::text`, "testing") require.NoError(t, err) require.True(t, traceQueryStartCalled) require.True(t, traceQueryEndCalled) }) } func TestTraceQuery(t *testing.T) { t.Parallel() tracer := &testTracer{} ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, ctr, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { traceQueryStartCalled := false tracer.traceQueryStart = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryStartData) context.Context { traceQueryStartCalled = true require.Equal(t, `select $1::text`, data.SQL) require.Len(t, data.Args, 1) require.Equal(t, `testing`, data.Args[0]) return context.WithValue(ctx, ctxKey("fromTraceQueryStart"), "foo") } traceQueryEndCalled := false tracer.traceQueryEnd = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryEndData) { traceQueryEndCalled = true require.Equal(t, "foo", ctx.Value(ctxKey("fromTraceQueryStart"))) require.Equal(t, `SELECT 1`, data.CommandTag.String()) require.NoError(t, data.Err) } var s string err := conn.QueryRow(ctx, `select $1::text`, "testing").Scan(&s) require.NoError(t, err) require.Equal(t, "testing", s) require.True(t, traceQueryStartCalled) require.True(t, traceQueryEndCalled) }) } func TestTraceBatchNormal(t *testing.T) { t.Parallel() tracer := &testTracer{} ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, ctr, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { traceBatchStartCalled := false tracer.traceBatchStart = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchStartData) context.Context { traceBatchStartCalled = true require.NotNil(t, data.Batch) require.Equal(t, 2, data.Batch.Len()) return context.WithValue(ctx, ctxKey("fromTraceBatchStart"), "foo") } traceBatchQueryCalledCount := 0 tracer.traceBatchQuery = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchQueryData) { traceBatchQueryCalledCount++ require.Equal(t, "foo", ctx.Value(ctxKey("fromTraceBatchStart"))) require.NoError(t, data.Err) } traceBatchEndCalled := false tracer.traceBatchEnd = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchEndData) { traceBatchEndCalled = true require.Equal(t, "foo", ctx.Value(ctxKey("fromTraceBatchStart"))) require.NoError(t, data.Err) } batch := &pgx.Batch{} batch.Queue(`select 1`) batch.Queue(`select 2`) br := conn.SendBatch(context.Background(), batch) require.True(t, traceBatchStartCalled) var n int32 err := br.QueryRow().Scan(&n) require.NoError(t, err) require.EqualValues(t, 1, n) require.EqualValues(t, 1, traceBatchQueryCalledCount) err = br.QueryRow().Scan(&n) require.NoError(t, err) require.EqualValues(t, 2, n) require.EqualValues(t, 2, traceBatchQueryCalledCount) err = br.Close() require.NoError(t, err) require.True(t, traceBatchEndCalled) }) } func TestTraceBatchClose(t *testing.T) { t.Parallel() tracer := &testTracer{} ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, ctr, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { traceBatchStartCalled := false tracer.traceBatchStart = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchStartData) context.Context { traceBatchStartCalled = true require.NotNil(t, data.Batch) require.Equal(t, 2, data.Batch.Len()) return context.WithValue(ctx, ctxKey("fromTraceBatchStart"), "foo") } traceBatchQueryCalledCount := 0 tracer.traceBatchQuery = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchQueryData) { traceBatchQueryCalledCount++ require.Equal(t, "foo", ctx.Value(ctxKey("fromTraceBatchStart"))) require.NoError(t, data.Err) } traceBatchEndCalled := false tracer.traceBatchEnd = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchEndData) { traceBatchEndCalled = true require.Equal(t, "foo", ctx.Value(ctxKey("fromTraceBatchStart"))) require.NoError(t, data.Err) } batch := &pgx.Batch{} batch.Queue(`select 1`) batch.Queue(`select 2`) br := conn.SendBatch(context.Background(), batch) require.True(t, traceBatchStartCalled) err := br.Close() require.NoError(t, err) require.EqualValues(t, 2, traceBatchQueryCalledCount) require.True(t, traceBatchEndCalled) }) } func TestTraceBatchErrorWhileReadingResults(t *testing.T) { t.Parallel() tracer := &testTracer{} ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, ctr, []pgx.QueryExecMode{pgx.QueryExecModeSimpleProtocol}, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { traceBatchStartCalled := false tracer.traceBatchStart = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchStartData) context.Context { traceBatchStartCalled = true require.NotNil(t, data.Batch) require.Equal(t, 3, data.Batch.Len()) return context.WithValue(ctx, ctxKey("fromTraceBatchStart"), "foo") } traceBatchQueryCalledCount := 0 tracer.traceBatchQuery = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchQueryData) { traceBatchQueryCalledCount++ require.Equal(t, "foo", ctx.Value(ctxKey("fromTraceBatchStart"))) if traceBatchQueryCalledCount == 2 { require.Error(t, data.Err) } else { require.NoError(t, data.Err) } } traceBatchEndCalled := false tracer.traceBatchEnd = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchEndData) { traceBatchEndCalled = true require.Equal(t, "foo", ctx.Value(ctxKey("fromTraceBatchStart"))) require.Error(t, data.Err) } batch := &pgx.Batch{} batch.Queue(`select 1`) batch.Queue(`select 2/n-2 from generate_series(0,10) n`) batch.Queue(`select 3`) br := conn.SendBatch(context.Background(), batch) require.True(t, traceBatchStartCalled) commandTag, err := br.Exec() require.NoError(t, err) require.Equal(t, "SELECT 1", commandTag.String()) commandTag, err = br.Exec() require.Error(t, err) require.Equal(t, "", commandTag.String()) commandTag, err = br.Exec() require.Error(t, err) require.Equal(t, "", commandTag.String()) err = br.Close() require.Error(t, err) require.EqualValues(t, 2, traceBatchQueryCalledCount) require.True(t, traceBatchEndCalled) }) } func TestTraceBatchErrorWhileReadingResultsWhileClosing(t *testing.T) { t.Parallel() tracer := &testTracer{} ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, ctr, []pgx.QueryExecMode{pgx.QueryExecModeSimpleProtocol}, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { traceBatchStartCalled := false tracer.traceBatchStart = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchStartData) context.Context { traceBatchStartCalled = true require.NotNil(t, data.Batch) require.Equal(t, 3, data.Batch.Len()) return context.WithValue(ctx, ctxKey("fromTraceBatchStart"), "foo") } traceBatchQueryCalledCount := 0 tracer.traceBatchQuery = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchQueryData) { traceBatchQueryCalledCount++ require.Equal(t, "foo", ctx.Value(ctxKey("fromTraceBatchStart"))) if traceBatchQueryCalledCount == 2 { require.Error(t, data.Err) } else { require.NoError(t, data.Err) } } traceBatchEndCalled := false tracer.traceBatchEnd = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceBatchEndData) { traceBatchEndCalled = true require.Equal(t, "foo", ctx.Value(ctxKey("fromTraceBatchStart"))) require.Error(t, data.Err) } batch := &pgx.Batch{} batch.Queue(`select 1`) batch.Queue(`select 2/n-2 from generate_series(0,10) n`) batch.Queue(`select 3`) br := conn.SendBatch(context.Background(), batch) require.True(t, traceBatchStartCalled) err := br.Close() require.Error(t, err) require.EqualValues(t, 2, traceBatchQueryCalledCount) require.True(t, traceBatchEndCalled) }) } func TestTraceCopyFrom(t *testing.T) { t.Parallel() tracer := &testTracer{} ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, ctr, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { ctx, cancel := context.WithTimeout(ctx, 30*time.Second) defer cancel() traceCopyFromStartCalled := false tracer.traceCopyFromStart = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceCopyFromStartData) context.Context { traceCopyFromStartCalled = true require.Equal(t, pgx.Identifier{"foo"}, data.TableName) require.Equal(t, []string{"a"}, data.ColumnNames) return context.WithValue(ctx, ctxKey("fromTraceCopyFromStart"), "foo") } traceCopyFromEndCalled := false tracer.traceCopyFromEnd = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceCopyFromEndData) { traceCopyFromEndCalled = true require.Equal(t, "foo", ctx.Value(ctxKey("fromTraceCopyFromStart"))) require.Equal(t, `COPY 2`, data.CommandTag.String()) require.NoError(t, data.Err) } _, err := conn.Exec(ctx, `create temporary table foo(a int4)`) require.NoError(t, err) inputRows := [][]any{ {int32(1)}, {nil}, } copyCount, err := conn.CopyFrom(ctx, pgx.Identifier{"foo"}, []string{"a"}, pgx.CopyFromRows(inputRows)) require.NoError(t, err) require.EqualValues(t, len(inputRows), copyCount) require.True(t, traceCopyFromStartCalled) require.True(t, traceCopyFromEndCalled) }) } func TestTracePrepare(t *testing.T) { t.Parallel() tracer := &testTracer{} ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, ctr, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { tracePrepareStartCalled := false tracer.tracePrepareStart = func(ctx context.Context, conn *pgx.Conn, data pgx.TracePrepareStartData) context.Context { tracePrepareStartCalled = true require.Equal(t, `ps`, data.Name) require.Equal(t, `select $1::text`, data.SQL) return context.WithValue(ctx, ctxKey("fromTracePrepareStart"), "foo") } tracePrepareEndCalled := false tracer.tracePrepareEnd = func(ctx context.Context, conn *pgx.Conn, data pgx.TracePrepareEndData) { tracePrepareEndCalled = true require.False(t, data.AlreadyPrepared) require.NoError(t, data.Err) } _, err := conn.Prepare(ctx, "ps", `select $1::text`) require.NoError(t, err) require.True(t, tracePrepareStartCalled) require.True(t, tracePrepareEndCalled) tracePrepareStartCalled = false tracePrepareEndCalled = false tracer.tracePrepareEnd = func(ctx context.Context, conn *pgx.Conn, data pgx.TracePrepareEndData) { tracePrepareEndCalled = true require.True(t, data.AlreadyPrepared) require.NoError(t, data.Err) } _, err = conn.Prepare(ctx, "ps", `select $1::text`) require.NoError(t, err) require.True(t, tracePrepareStartCalled) require.True(t, tracePrepareEndCalled) }) } func TestTraceConnect(t *testing.T) { t.Parallel() tracer := &testTracer{} config := defaultConnTestRunner.CreateConfig(context.Background(), t) config.Tracer = tracer traceConnectStartCalled := false tracer.traceConnectStart = func(ctx context.Context, data pgx.TraceConnectStartData) context.Context { traceConnectStartCalled = true require.NotNil(t, data.ConnConfig) return context.WithValue(ctx, ctxKey("fromTraceConnectStart"), "foo") } traceConnectEndCalled := false tracer.traceConnectEnd = func(ctx context.Context, data pgx.TraceConnectEndData) { traceConnectEndCalled = true require.NotNil(t, data.Conn) require.NoError(t, data.Err) } conn1, err := pgx.ConnectConfig(context.Background(), config) require.NoError(t, err) defer conn1.Close(context.Background()) require.True(t, traceConnectStartCalled) require.True(t, traceConnectEndCalled) config, err = pgx.ParseConfig("host=/invalid") require.NoError(t, err) config.Tracer = tracer traceConnectStartCalled = false traceConnectEndCalled = false tracer.traceConnectEnd = func(ctx context.Context, data pgx.TraceConnectEndData) { traceConnectEndCalled = true require.Nil(t, data.Conn) require.Error(t, data.Err) } conn2, err := pgx.ConnectConfig(context.Background(), config) require.Nil(t, conn2) require.Error(t, err) require.True(t, traceConnectStartCalled) require.True(t, traceConnectEndCalled) } // Ensure tracer runs within a transaction. // // https://github.com/jackc/pgx/issues/2304 func TestTraceWithinTx(t *testing.T) { t.Parallel() tracer := &testTracer{} ctr := defaultConnTestRunner ctr.CreateConfig = func(ctx context.Context, t testing.TB) *pgx.ConnConfig { config := defaultConnTestRunner.CreateConfig(ctx, t) config.Tracer = tracer return config } ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, ctr, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var queries []string tracer.traceQueryStart = func(ctx context.Context, conn *pgx.Conn, data pgx.TraceQueryStartData) context.Context { queries = append(queries, data.SQL) return ctx } tx, err := conn.Begin(ctx) require.NoError(t, err) defer tx.Rollback(ctx) _, err = tx.Exec(ctx, `select $1::text`, "testing") require.NoError(t, err) err = tx.Commit(ctx) require.NoError(t, err) require.Len(t, queries, 3) require.Equal(t, `begin`, queries[0]) require.Equal(t, `select $1::text`, queries[1]) require.Equal(t, `commit`, queries[2]) }) } pgx-5.8.0/tx.go000066400000000000000000000326731512357711200133230ustar00rootroot00000000000000package pgx import ( "context" "errors" "strconv" "strings" "github.com/jackc/pgx/v5/pgconn" ) // TxIsoLevel is the transaction isolation level (serializable, repeatable read, read committed or read uncommitted) type TxIsoLevel string // Transaction isolation levels const ( Serializable TxIsoLevel = "serializable" RepeatableRead TxIsoLevel = "repeatable read" ReadCommitted TxIsoLevel = "read committed" ReadUncommitted TxIsoLevel = "read uncommitted" ) // TxAccessMode is the transaction access mode (read write or read only) type TxAccessMode string // Transaction access modes const ( ReadWrite TxAccessMode = "read write" ReadOnly TxAccessMode = "read only" ) // TxDeferrableMode is the transaction deferrable mode (deferrable or not deferrable) type TxDeferrableMode string // Transaction deferrable modes const ( Deferrable TxDeferrableMode = "deferrable" NotDeferrable TxDeferrableMode = "not deferrable" ) // TxOptions are transaction modes within a transaction block type TxOptions struct { IsoLevel TxIsoLevel AccessMode TxAccessMode DeferrableMode TxDeferrableMode // BeginQuery is the SQL query that will be executed to begin the transaction. This allows using non-standard syntax // such as BEGIN PRIORITY HIGH with CockroachDB. If set this will override the other settings. BeginQuery string // CommitQuery is the SQL query that will be executed to commit the transaction. CommitQuery string } var emptyTxOptions TxOptions func (txOptions TxOptions) beginSQL() string { if txOptions == emptyTxOptions { return "begin" } if txOptions.BeginQuery != "" { return txOptions.BeginQuery } var buf strings.Builder buf.Grow(64) // 64 - maximum length of string with available options buf.WriteString("begin") if txOptions.IsoLevel != "" { buf.WriteString(" isolation level ") buf.WriteString(string(txOptions.IsoLevel)) } if txOptions.AccessMode != "" { buf.WriteByte(' ') buf.WriteString(string(txOptions.AccessMode)) } if txOptions.DeferrableMode != "" { buf.WriteByte(' ') buf.WriteString(string(txOptions.DeferrableMode)) } return buf.String() } var ErrTxClosed = errors.New("tx is closed") // ErrTxCommitRollback occurs when an error has occurred in a transaction and // Commit() is called. PostgreSQL accepts COMMIT on aborted transactions, but // it is treated as ROLLBACK. var ErrTxCommitRollback = errors.New("commit unexpectedly resulted in rollback") // Begin starts a transaction. Unlike database/sql, the context only affects the begin command. i.e. there is no // auto-rollback on context cancellation. func (c *Conn) Begin(ctx context.Context) (Tx, error) { return c.BeginTx(ctx, TxOptions{}) } // BeginTx starts a transaction with txOptions determining the transaction mode. Unlike database/sql, the context only // affects the begin command. i.e. there is no auto-rollback on context cancellation. func (c *Conn) BeginTx(ctx context.Context, txOptions TxOptions) (Tx, error) { _, err := c.Exec(ctx, txOptions.beginSQL()) if err != nil { // begin should never fail unless there is an underlying connection issue or // a context timeout. In either case, the connection is possibly broken. c.die() return nil, err } return &dbTx{ conn: c, commitQuery: txOptions.CommitQuery, }, nil } // Tx represents a database transaction. // // Tx is an interface instead of a struct to enable connection pools to be implemented without relying on internal pgx // state, to support pseudo-nested transactions with savepoints, and to allow tests to mock transactions. However, // adding a method to an interface is technically a breaking change. If new methods are added to Conn it may be // desirable to add them to Tx as well. Because of this the Tx interface is partially excluded from semantic version // requirements. Methods will not be removed or changed, but new methods may be added. type Tx interface { // Begin starts a pseudo nested transaction. Begin(ctx context.Context) (Tx, error) // Commit commits the transaction if this is a real transaction or releases the savepoint if this is a pseudo nested // transaction. Commit will return an error where errors.Is(ErrTxClosed) is true if the Tx is already closed, but is // otherwise safe to call multiple times. If the commit fails with a rollback status (e.g. the transaction was already // in a broken state) then an error where errors.Is(ErrTxCommitRollback) is true will be returned. Commit(ctx context.Context) error // Rollback rolls back the transaction if this is a real transaction or rolls back to the savepoint if this is a // pseudo nested transaction. Rollback will return an error where errors.Is(ErrTxClosed) is true if the Tx is already // closed, but is otherwise safe to call multiple times. Hence, a defer tx.Rollback() is safe even if tx.Commit() will // be called first in a non-error condition. Any other failure of a real transaction will result in the connection // being closed. Rollback(ctx context.Context) error CopyFrom(ctx context.Context, tableName Identifier, columnNames []string, rowSrc CopyFromSource) (int64, error) SendBatch(ctx context.Context, b *Batch) BatchResults LargeObjects() LargeObjects Prepare(ctx context.Context, name, sql string) (*pgconn.StatementDescription, error) Exec(ctx context.Context, sql string, arguments ...any) (commandTag pgconn.CommandTag, err error) Query(ctx context.Context, sql string, args ...any) (Rows, error) QueryRow(ctx context.Context, sql string, args ...any) Row // Conn returns the underlying *Conn that on which this transaction is executing. Conn() *Conn } // dbTx represents a database transaction. // // All dbTx methods return ErrTxClosed if Commit or Rollback has already been // called on the dbTx. type dbTx struct { conn *Conn savepointNum int64 closed bool commitQuery string } // Begin starts a pseudo nested transaction implemented with a savepoint. func (tx *dbTx) Begin(ctx context.Context) (Tx, error) { if tx.closed { return nil, ErrTxClosed } tx.savepointNum++ _, err := tx.conn.Exec(ctx, "savepoint sp_"+strconv.FormatInt(tx.savepointNum, 10)) if err != nil { return nil, err } return &dbSimulatedNestedTx{tx: tx, savepointNum: tx.savepointNum}, nil } // Commit commits the transaction. func (tx *dbTx) Commit(ctx context.Context) error { if tx.closed { return ErrTxClosed } commandSQL := "commit" if tx.commitQuery != "" { commandSQL = tx.commitQuery } commandTag, err := tx.conn.Exec(ctx, commandSQL) tx.closed = true if err != nil { if tx.conn.PgConn().TxStatus() != 'I' { _ = tx.conn.Close(ctx) // already have error to return } return err } if commandTag.String() == "ROLLBACK" { return ErrTxCommitRollback } return nil } // Rollback rolls back the transaction. Rollback will return ErrTxClosed if the // Tx is already closed, but is otherwise safe to call multiple times. Hence, a // defer tx.Rollback() is safe even if tx.Commit() will be called first in a // non-error condition. func (tx *dbTx) Rollback(ctx context.Context) error { if tx.closed { return ErrTxClosed } _, err := tx.conn.Exec(ctx, "rollback") tx.closed = true if err != nil { // A rollback failure leaves the connection in an undefined state tx.conn.die() return err } return nil } // Exec delegates to the underlying *Conn func (tx *dbTx) Exec(ctx context.Context, sql string, arguments ...any) (commandTag pgconn.CommandTag, err error) { if tx.closed { return pgconn.CommandTag{}, ErrTxClosed } return tx.conn.Exec(ctx, sql, arguments...) } // Prepare delegates to the underlying *Conn func (tx *dbTx) Prepare(ctx context.Context, name, sql string) (*pgconn.StatementDescription, error) { if tx.closed { return nil, ErrTxClosed } return tx.conn.Prepare(ctx, name, sql) } // Query delegates to the underlying *Conn func (tx *dbTx) Query(ctx context.Context, sql string, args ...any) (Rows, error) { if tx.closed { // Because checking for errors can be deferred to the *Rows, build one with the error err := ErrTxClosed return &baseRows{closed: true, err: err}, err } return tx.conn.Query(ctx, sql, args...) } // QueryRow delegates to the underlying *Conn func (tx *dbTx) QueryRow(ctx context.Context, sql string, args ...any) Row { rows, _ := tx.Query(ctx, sql, args...) return (*connRow)(rows.(*baseRows)) } // CopyFrom delegates to the underlying *Conn func (tx *dbTx) CopyFrom(ctx context.Context, tableName Identifier, columnNames []string, rowSrc CopyFromSource) (int64, error) { if tx.closed { return 0, ErrTxClosed } return tx.conn.CopyFrom(ctx, tableName, columnNames, rowSrc) } // SendBatch delegates to the underlying *Conn func (tx *dbTx) SendBatch(ctx context.Context, b *Batch) BatchResults { if tx.closed { return &batchResults{err: ErrTxClosed} } return tx.conn.SendBatch(ctx, b) } // LargeObjects returns a LargeObjects instance for the transaction. func (tx *dbTx) LargeObjects() LargeObjects { return LargeObjects{tx: tx} } func (tx *dbTx) Conn() *Conn { return tx.conn } // dbSimulatedNestedTx represents a simulated nested transaction implemented by a savepoint. type dbSimulatedNestedTx struct { tx Tx savepointNum int64 closed bool } // Begin starts a pseudo nested transaction implemented with a savepoint. func (sp *dbSimulatedNestedTx) Begin(ctx context.Context) (Tx, error) { if sp.closed { return nil, ErrTxClosed } return sp.tx.Begin(ctx) } // Commit releases the savepoint essentially committing the pseudo nested transaction. func (sp *dbSimulatedNestedTx) Commit(ctx context.Context) error { if sp.closed { return ErrTxClosed } _, err := sp.Exec(ctx, "release savepoint sp_"+strconv.FormatInt(sp.savepointNum, 10)) sp.closed = true return err } // Rollback rolls back to the savepoint essentially rolling back the pseudo nested transaction. Rollback will return // ErrTxClosed if the dbSavepoint is already closed, but is otherwise safe to call multiple times. Hence, a defer sp.Rollback() // is safe even if sp.Commit() will be called first in a non-error condition. func (sp *dbSimulatedNestedTx) Rollback(ctx context.Context) error { if sp.closed { return ErrTxClosed } _, err := sp.Exec(ctx, "rollback to savepoint sp_"+strconv.FormatInt(sp.savepointNum, 10)) sp.closed = true return err } // Exec delegates to the underlying Tx func (sp *dbSimulatedNestedTx) Exec(ctx context.Context, sql string, arguments ...any) (commandTag pgconn.CommandTag, err error) { if sp.closed { return pgconn.CommandTag{}, ErrTxClosed } return sp.tx.Exec(ctx, sql, arguments...) } // Prepare delegates to the underlying Tx func (sp *dbSimulatedNestedTx) Prepare(ctx context.Context, name, sql string) (*pgconn.StatementDescription, error) { if sp.closed { return nil, ErrTxClosed } return sp.tx.Prepare(ctx, name, sql) } // Query delegates to the underlying Tx func (sp *dbSimulatedNestedTx) Query(ctx context.Context, sql string, args ...any) (Rows, error) { if sp.closed { // Because checking for errors can be deferred to the *Rows, build one with the error err := ErrTxClosed return &baseRows{closed: true, err: err}, err } return sp.tx.Query(ctx, sql, args...) } // QueryRow delegates to the underlying Tx func (sp *dbSimulatedNestedTx) QueryRow(ctx context.Context, sql string, args ...any) Row { rows, _ := sp.Query(ctx, sql, args...) return (*connRow)(rows.(*baseRows)) } // CopyFrom delegates to the underlying *Conn func (sp *dbSimulatedNestedTx) CopyFrom(ctx context.Context, tableName Identifier, columnNames []string, rowSrc CopyFromSource) (int64, error) { if sp.closed { return 0, ErrTxClosed } return sp.tx.CopyFrom(ctx, tableName, columnNames, rowSrc) } // SendBatch delegates to the underlying *Conn func (sp *dbSimulatedNestedTx) SendBatch(ctx context.Context, b *Batch) BatchResults { if sp.closed { return &batchResults{err: ErrTxClosed} } return sp.tx.SendBatch(ctx, b) } func (sp *dbSimulatedNestedTx) LargeObjects() LargeObjects { return LargeObjects{tx: sp} } func (sp *dbSimulatedNestedTx) Conn() *Conn { return sp.tx.Conn() } // BeginFunc calls Begin on db and then calls fn. If fn does not return an error then it calls Commit on db. If fn // returns an error it calls Rollback on db. The context will be used when executing the transaction control statements // (BEGIN, ROLLBACK, and COMMIT) but does not otherwise affect the execution of fn. func BeginFunc( ctx context.Context, db interface { Begin(ctx context.Context) (Tx, error) }, fn func(Tx) error, ) (err error) { var tx Tx tx, err = db.Begin(ctx) if err != nil { return err } return beginFuncExec(ctx, tx, fn) } // BeginTxFunc calls BeginTx on db and then calls fn. If fn does not return an error then it calls Commit on db. If fn // returns an error it calls Rollback on db. The context will be used when executing the transaction control statements // (BEGIN, ROLLBACK, and COMMIT) but does not otherwise affect the execution of fn. func BeginTxFunc( ctx context.Context, db interface { BeginTx(ctx context.Context, txOptions TxOptions) (Tx, error) }, txOptions TxOptions, fn func(Tx) error, ) (err error) { var tx Tx tx, err = db.BeginTx(ctx, txOptions) if err != nil { return err } return beginFuncExec(ctx, tx, fn) } func beginFuncExec(ctx context.Context, tx Tx, fn func(Tx) error) (err error) { defer func() { rollbackErr := tx.Rollback(ctx) if rollbackErr != nil && !errors.Is(rollbackErr, ErrTxClosed) { err = rollbackErr } }() fErr := fn(tx) if fErr != nil { _ = tx.Rollback(ctx) // ignore rollback error as there is already an error to return return fErr } return tx.Commit(ctx) } pgx-5.8.0/tx_test.go000066400000000000000000000373121512357711200143550ustar00rootroot00000000000000package pgx_test import ( "context" "errors" "os" "testing" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgconn" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/require" ) func TestTransactionSuccessfulCommit(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) createSql := ` create temporary table foo( id integer, unique (id) ); ` if _, err := conn.Exec(context.Background(), createSql); err != nil { t.Fatalf("Failed to create table: %v", err) } tx, err := conn.Begin(context.Background()) if err != nil { t.Fatalf("conn.Begin failed: %v", err) } _, err = tx.Exec(context.Background(), "insert into foo(id) values (1)") if err != nil { t.Fatalf("tx.Exec failed: %v", err) } err = tx.Commit(context.Background()) if err != nil { t.Fatalf("tx.Commit failed: %v", err) } var n int64 err = conn.QueryRow(context.Background(), "select count(*) from foo").Scan(&n) if err != nil { t.Fatalf("QueryRow Scan failed: %v", err) } if n != 1 { t.Fatalf("Did not receive correct number of rows: %v", n) } } func TestTxCommitWhenTxBroken(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) createSql := ` create temporary table foo( id integer, unique (id) ); ` if _, err := conn.Exec(context.Background(), createSql); err != nil { t.Fatalf("Failed to create table: %v", err) } tx, err := conn.Begin(context.Background()) if err != nil { t.Fatalf("conn.Begin failed: %v", err) } if _, err := tx.Exec(context.Background(), "insert into foo(id) values (1)"); err != nil { t.Fatalf("tx.Exec failed: %v", err) } // Purposely break transaction if _, err := tx.Exec(context.Background(), "syntax error"); err == nil { t.Fatal("Unexpected success") } err = tx.Commit(context.Background()) if err != pgx.ErrTxCommitRollback { t.Fatalf("Expected error %v, got %v", pgx.ErrTxCommitRollback, err) } var n int64 err = conn.QueryRow(context.Background(), "select count(*) from foo").Scan(&n) if err != nil { t.Fatalf("QueryRow Scan failed: %v", err) } if n != 0 { t.Fatalf("Did not receive correct number of rows: %v", n) } } func TestTxCommitWhenDeferredConstraintFailure(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server does not support deferred constraint (https://github.com/cockroachdb/cockroach/issues/31632)") createSql := ` create temporary table foo( id integer, unique (id) initially deferred ); ` if _, err := conn.Exec(context.Background(), createSql); err != nil { t.Fatalf("Failed to create table: %v", err) } tx, err := conn.Begin(context.Background()) if err != nil { t.Fatalf("conn.Begin failed: %v", err) } if _, err := tx.Exec(context.Background(), "insert into foo(id) values (1)"); err != nil { t.Fatalf("tx.Exec failed: %v", err) } if _, err := tx.Exec(context.Background(), "insert into foo(id) values (1)"); err != nil { t.Fatalf("tx.Exec failed: %v", err) } err = tx.Commit(context.Background()) if pgErr, ok := err.(*pgconn.PgError); !ok || pgErr.Code != "23505" { t.Fatalf("Expected unique constraint violation 23505, got %#v", err) } var n int64 err = conn.QueryRow(context.Background(), "select count(*) from foo").Scan(&n) if err != nil { t.Fatalf("QueryRow Scan failed: %v", err) } if n != 0 { t.Fatalf("Did not receive correct number of rows: %v", n) } } func TestTxCommitSerializationFailure(t *testing.T) { t.Parallel() c1 := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, c1) if c1.PgConn().ParameterStatus("crdb_version") != "" { t.Skip("Skipping due to known server issue: (https://github.com/cockroachdb/cockroach/issues/60754)") } c2 := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, c2) ctx, cancel := context.WithTimeout(context.Background(), 30*time.Second) defer cancel() c1.Exec(ctx, `drop table if exists tx_serializable_sums`) _, err := c1.Exec(ctx, `create table tx_serializable_sums(num integer);`) if err != nil { t.Fatalf("Unable to create temporary table: %v", err) } defer c1.Exec(ctx, `drop table tx_serializable_sums`) tx1, err := c1.BeginTx(ctx, pgx.TxOptions{IsoLevel: pgx.Serializable}) if err != nil { t.Fatalf("Begin failed: %v", err) } defer tx1.Rollback(ctx) tx2, err := c2.BeginTx(ctx, pgx.TxOptions{IsoLevel: pgx.Serializable}) if err != nil { t.Fatalf("Begin failed: %v", err) } defer tx2.Rollback(ctx) _, err = tx1.Exec(ctx, `insert into tx_serializable_sums(num) select sum(num)::int from tx_serializable_sums`) if err != nil { t.Fatalf("Exec failed: %v", err) } _, err = tx2.Exec(ctx, `insert into tx_serializable_sums(num) select sum(num)::int from tx_serializable_sums`) if err != nil { t.Fatalf("Exec failed: %v", err) } err = tx1.Commit(ctx) if err != nil { t.Fatalf("Commit failed: %v", err) } err = tx2.Commit(ctx) if pgErr, ok := err.(*pgconn.PgError); !ok || pgErr.Code != "40001" { t.Fatalf("Expected serialization error 40001, got %#v", err) } ensureConnValid(t, c1) ensureConnValid(t, c2) } func TestTransactionSuccessfulRollback(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) createSql := ` create temporary table foo( id integer, unique (id) ); ` if _, err := conn.Exec(context.Background(), createSql); err != nil { t.Fatalf("Failed to create table: %v", err) } tx, err := conn.Begin(context.Background()) if err != nil { t.Fatalf("conn.Begin failed: %v", err) } _, err = tx.Exec(context.Background(), "insert into foo(id) values (1)") if err != nil { t.Fatalf("tx.Exec failed: %v", err) } err = tx.Rollback(context.Background()) if err != nil { t.Fatalf("tx.Rollback failed: %v", err) } var n int64 err = conn.QueryRow(context.Background(), "select count(*) from foo").Scan(&n) if err != nil { t.Fatalf("QueryRow Scan failed: %v", err) } if n != 0 { t.Fatalf("Did not receive correct number of rows: %v", n) } } func TestTransactionRollbackFailsClosesConnection(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) ctx, cancel := context.WithCancel(context.Background()) tx, err := conn.Begin(ctx) require.NoError(t, err) cancel() err = tx.Rollback(ctx) require.Error(t, err) require.True(t, conn.IsClosed()) } func TestBeginIsoLevels(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) pgxtest.SkipCockroachDB(t, conn, "Server always uses SERIALIZABLE isolation (https://www.cockroachlabs.com/docs/stable/demo-serializable.html)") isoLevels := []pgx.TxIsoLevel{pgx.Serializable, pgx.RepeatableRead, pgx.ReadCommitted, pgx.ReadUncommitted} for _, iso := range isoLevels { tx, err := conn.BeginTx(context.Background(), pgx.TxOptions{IsoLevel: iso}) if err != nil { t.Fatalf("conn.Begin failed: %v", err) } var level pgx.TxIsoLevel conn.QueryRow(context.Background(), "select current_setting('transaction_isolation')").Scan(&level) if level != iso { t.Errorf("Expected to be in isolation level %v but was %v", iso, level) } err = tx.Rollback(context.Background()) if err != nil { t.Fatalf("tx.Rollback failed: %v", err) } } } func TestBeginFunc(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) createSql := ` create temporary table foo( id integer, unique (id) ); ` _, err := conn.Exec(context.Background(), createSql) require.NoError(t, err) err = pgx.BeginFunc(context.Background(), conn, func(tx pgx.Tx) error { _, err := tx.Exec(context.Background(), "insert into foo(id) values (1)") require.NoError(t, err) return nil }) require.NoError(t, err) var n int64 err = conn.QueryRow(context.Background(), "select count(*) from foo").Scan(&n) require.NoError(t, err) require.EqualValues(t, 1, n) } func TestBeginFuncRollbackOnError(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) createSql := ` create temporary table foo( id integer, unique (id) ); ` _, err := conn.Exec(context.Background(), createSql) require.NoError(t, err) err = pgx.BeginFunc(context.Background(), conn, func(tx pgx.Tx) error { _, err := tx.Exec(context.Background(), "insert into foo(id) values (1)") require.NoError(t, err) return errors.New("some error") }) require.EqualError(t, err, "some error") var n int64 err = conn.QueryRow(context.Background(), "select count(*) from foo").Scan(&n) require.NoError(t, err) require.EqualValues(t, 0, n) } func TestBeginReadOnly(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) tx, err := conn.BeginTx(context.Background(), pgx.TxOptions{AccessMode: pgx.ReadOnly}) if err != nil { t.Fatalf("conn.Begin failed: %v", err) } defer tx.Rollback(context.Background()) _, err = conn.Exec(context.Background(), "create table foo(id serial primary key)") if pgErr, ok := err.(*pgconn.PgError); !ok || pgErr.Code != "25006" { t.Errorf("Expected error SQLSTATE 25006, but got %#v", err) } } func TestBeginTxBeginQuery(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { tx, err := conn.BeginTx(ctx, pgx.TxOptions{BeginQuery: "begin read only"}) require.NoError(t, err) defer tx.Rollback(ctx) var readOnly bool conn.QueryRow(ctx, "select current_setting('transaction_read_only')::bool").Scan(&readOnly) require.True(t, readOnly) err = tx.Rollback(ctx) require.NoError(t, err) }) } func TestTxNestedTransactionCommit(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) createSql := ` create temporary table foo( id integer, unique (id) ); ` if _, err := conn.Exec(context.Background(), createSql); err != nil { t.Fatalf("Failed to create table: %v", err) } tx, err := conn.Begin(context.Background()) if err != nil { t.Fatal(err) } _, err = tx.Exec(context.Background(), "insert into foo(id) values (1)") if err != nil { t.Fatalf("tx.Exec failed: %v", err) } nestedTx, err := tx.Begin(context.Background()) if err != nil { t.Fatal(err) } _, err = nestedTx.Exec(context.Background(), "insert into foo(id) values (2)") if err != nil { t.Fatalf("nestedTx.Exec failed: %v", err) } doubleNestedTx, err := nestedTx.Begin(context.Background()) if err != nil { t.Fatal(err) } _, err = doubleNestedTx.Exec(context.Background(), "insert into foo(id) values (3)") if err != nil { t.Fatalf("doubleNestedTx.Exec failed: %v", err) } err = doubleNestedTx.Commit(context.Background()) if err != nil { t.Fatalf("doubleNestedTx.Commit failed: %v", err) } err = nestedTx.Commit(context.Background()) if err != nil { t.Fatalf("nestedTx.Commit failed: %v", err) } err = tx.Commit(context.Background()) if err != nil { t.Fatalf("tx.Commit failed: %v", err) } var n int64 err = conn.QueryRow(context.Background(), "select count(*) from foo").Scan(&n) if err != nil { t.Fatalf("QueryRow Scan failed: %v", err) } if n != 3 { t.Fatalf("Did not receive correct number of rows: %v", n) } } func TestTxNestedTransactionRollback(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) createSql := ` create temporary table foo( id integer, unique (id) ); ` if _, err := conn.Exec(context.Background(), createSql); err != nil { t.Fatalf("Failed to create table: %v", err) } tx, err := conn.Begin(context.Background()) if err != nil { t.Fatal(err) } _, err = tx.Exec(context.Background(), "insert into foo(id) values (1)") if err != nil { t.Fatalf("tx.Exec failed: %v", err) } nestedTx, err := tx.Begin(context.Background()) if err != nil { t.Fatal(err) } _, err = nestedTx.Exec(context.Background(), "insert into foo(id) values (2)") if err != nil { t.Fatalf("nestedTx.Exec failed: %v", err) } err = nestedTx.Rollback(context.Background()) if err != nil { t.Fatalf("nestedTx.Rollback failed: %v", err) } _, err = tx.Exec(context.Background(), "insert into foo(id) values (3)") if err != nil { t.Fatalf("tx.Exec failed: %v", err) } err = tx.Commit(context.Background()) if err != nil { t.Fatalf("tx.Commit failed: %v", err) } var n int64 err = conn.QueryRow(context.Background(), "select count(*) from foo").Scan(&n) if err != nil { t.Fatalf("QueryRow Scan failed: %v", err) } if n != 2 { t.Fatalf("Did not receive correct number of rows: %v", n) } } func TestTxBeginFuncNestedTransactionCommit(t *testing.T) { t.Parallel() db := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, db) createSql := ` create temporary table foo( id integer, unique (id) ); ` _, err := db.Exec(context.Background(), createSql) require.NoError(t, err) err = pgx.BeginFunc(context.Background(), db, func(db pgx.Tx) error { _, err := db.Exec(context.Background(), "insert into foo(id) values (1)") require.NoError(t, err) err = pgx.BeginFunc(context.Background(), db, func(db pgx.Tx) error { _, err := db.Exec(context.Background(), "insert into foo(id) values (2)") require.NoError(t, err) err = pgx.BeginFunc(context.Background(), db, func(db pgx.Tx) error { _, err := db.Exec(context.Background(), "insert into foo(id) values (3)") require.NoError(t, err) return nil }) require.NoError(t, err) return nil }) require.NoError(t, err) return nil }) require.NoError(t, err) var n int64 err = db.QueryRow(context.Background(), "select count(*) from foo").Scan(&n) require.NoError(t, err) require.EqualValues(t, 3, n) } func TestTxBeginFuncNestedTransactionRollback(t *testing.T) { t.Parallel() db := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, db) createSql := ` create temporary table foo( id integer, unique (id) ); ` _, err := db.Exec(context.Background(), createSql) require.NoError(t, err) err = pgx.BeginFunc(context.Background(), db, func(db pgx.Tx) error { _, err := db.Exec(context.Background(), "insert into foo(id) values (1)") require.NoError(t, err) err = pgx.BeginFunc(context.Background(), db, func(db pgx.Tx) error { _, err := db.Exec(context.Background(), "insert into foo(id) values (2)") require.NoError(t, err) return errors.New("do a rollback") }) require.EqualError(t, err, "do a rollback") _, err = db.Exec(context.Background(), "insert into foo(id) values (3)") require.NoError(t, err) return nil }) require.NoError(t, err) var n int64 err = db.QueryRow(context.Background(), "select count(*) from foo").Scan(&n) require.NoError(t, err) require.EqualValues(t, 2, n) } func TestTxSendBatchClosed(t *testing.T) { t.Parallel() db := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, db) tx, err := db.Begin(context.Background()) require.NoError(t, err) defer tx.Rollback(context.Background()) err = tx.Commit(context.Background()) require.NoError(t, err) batch := &pgx.Batch{} batch.Queue("select 1") batch.Queue("select 2") batch.Queue("select 3") br := tx.SendBatch(context.Background(), batch) defer br.Close() var n int _, err = br.Exec() require.Error(t, err) err = br.QueryRow().Scan(&n) require.Error(t, err) _, err = br.Query() require.Error(t, err) } pgx-5.8.0/values.go000066400000000000000000000025061512357711200141570ustar00rootroot00000000000000package pgx import ( "errors" "github.com/jackc/pgx/v5/internal/pgio" "github.com/jackc/pgx/v5/pgtype" ) // PostgreSQL format codes const ( TextFormatCode = 0 BinaryFormatCode = 1 ) func convertSimpleArgument(m *pgtype.Map, arg any) (any, error) { buf, err := m.Encode(0, TextFormatCode, arg, []byte{}) if err != nil { return nil, err } if buf == nil { return nil, nil } return string(buf), nil } func encodeCopyValue(m *pgtype.Map, buf []byte, oid uint32, arg any) ([]byte, error) { sp := len(buf) buf = pgio.AppendInt32(buf, -1) argBuf, err := m.Encode(oid, BinaryFormatCode, arg, buf) if err != nil { if argBuf2, err2 := tryScanStringCopyValueThenEncode(m, buf, oid, arg); err2 == nil { argBuf = argBuf2 } else { return nil, err } } if argBuf != nil { buf = argBuf pgio.SetInt32(buf[sp:], int32(len(buf[sp:])-4)) } return buf, nil } func tryScanStringCopyValueThenEncode(m *pgtype.Map, buf []byte, oid uint32, arg any) ([]byte, error) { s, ok := arg.(string) if !ok { textBuf, err := m.Encode(oid, TextFormatCode, arg, nil) if err != nil { return nil, errors.New("not a string and cannot be encoded as text") } s = string(textBuf) } var v any err := m.Scan(oid, TextFormatCode, []byte(s), &v) if err != nil { return nil, err } return m.Encode(oid, BinaryFormatCode, v, buf) } pgx-5.8.0/values_test.go000066400000000000000000001003251512357711200152140ustar00rootroot00000000000000package pgx_test import ( "bytes" "context" "fmt" "net" "os" "reflect" "strings" "testing" "time" "github.com/jackc/pgx/v5" "github.com/jackc/pgx/v5/pgxtest" "github.com/stretchr/testify/assert" "github.com/stretchr/testify/require" ) func TestDateTranscode(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { dates := []time.Time{ time.Date(1, 1, 1, 0, 0, 0, 0, time.UTC), time.Date(1000, 1, 1, 0, 0, 0, 0, time.UTC), time.Date(1600, 1, 1, 0, 0, 0, 0, time.UTC), time.Date(1700, 1, 1, 0, 0, 0, 0, time.UTC), time.Date(1800, 1, 1, 0, 0, 0, 0, time.UTC), time.Date(1900, 1, 1, 0, 0, 0, 0, time.UTC), time.Date(1990, 1, 1, 0, 0, 0, 0, time.UTC), time.Date(1999, 12, 31, 0, 0, 0, 0, time.UTC), time.Date(2000, 1, 1, 0, 0, 0, 0, time.UTC), time.Date(2001, 1, 2, 0, 0, 0, 0, time.UTC), time.Date(2004, 2, 29, 0, 0, 0, 0, time.UTC), time.Date(2013, 7, 4, 0, 0, 0, 0, time.UTC), time.Date(2013, 12, 25, 0, 0, 0, 0, time.UTC), time.Date(2029, 1, 1, 0, 0, 0, 0, time.UTC), time.Date(2081, 1, 1, 0, 0, 0, 0, time.UTC), time.Date(2096, 2, 29, 0, 0, 0, 0, time.UTC), time.Date(2550, 1, 1, 0, 0, 0, 0, time.UTC), time.Date(9999, 12, 31, 0, 0, 0, 0, time.UTC), } for _, actualDate := range dates { var d time.Time err := conn.QueryRow(context.Background(), "select $1::date", actualDate).Scan(&d) if err != nil { t.Fatalf("Unexpected failure on QueryRow Scan: %v", err) } if !actualDate.Equal(d) { t.Errorf("Did not transcode date successfully: %v is not %v", d, actualDate) } } }) } func TestTimestampTzTranscode(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { inputTime := time.Date(2013, 1, 2, 3, 4, 5, 6000, time.Local) var outputTime time.Time err := conn.QueryRow(context.Background(), "select $1::timestamptz", inputTime).Scan(&outputTime) if err != nil { t.Fatalf("QueryRow Scan failed: %v", err) } if !inputTime.Equal(outputTime) { t.Errorf("Did not transcode time successfully: %v is not %v", outputTime, inputTime) } }) } // TODO - move these tests to pgtype func TestJSONAndJSONBTranscode(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { for _, typename := range []string{"json", "jsonb"} { if _, ok := conn.TypeMap().TypeForName(typename); !ok { continue // No JSON/JSONB type -- must be running against old PostgreSQL } testJSONString(t, conn, typename) testJSONStringPointer(t, conn, typename) } }) } func TestJSONAndJSONBTranscodeExtendedOnly(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) for _, typename := range []string{"json", "jsonb"} { if _, ok := conn.TypeMap().TypeForName(typename); !ok { continue // No JSON/JSONB type -- must be running against old PostgreSQL } testJSONSingleLevelStringMap(t, conn, typename) testJSONNestedMap(t, conn, typename) testJSONStringArray(t, conn, typename) testJSONInt64Array(t, conn, typename) testJSONInt16ArrayFailureDueToOverflow(t, conn, typename) testJSONStruct(t, conn, typename) } } func testJSONString(t testing.TB, conn *pgx.Conn, typename string) { input := `{"key": "value"}` expectedOutput := map[string]string{"key": "value"} var output map[string]string err := conn.QueryRow(context.Background(), "select $1::"+typename, input).Scan(&output) if err != nil { t.Errorf("%s: QueryRow Scan failed: %v", typename, err) return } if !reflect.DeepEqual(expectedOutput, output) { t.Errorf("%s: Did not transcode map[string]string successfully: %v is not %v", typename, expectedOutput, output) return } } func testJSONStringPointer(t testing.TB, conn *pgx.Conn, typename string) { input := `{"key": "value"}` expectedOutput := map[string]string{"key": "value"} var output map[string]string err := conn.QueryRow(context.Background(), "select $1::"+typename, &input).Scan(&output) if err != nil { t.Errorf("%s: QueryRow Scan failed: %v", typename, err) return } if !reflect.DeepEqual(expectedOutput, output) { t.Errorf("%s: Did not transcode map[string]string successfully: %v is not %v", typename, expectedOutput, output) return } } func testJSONSingleLevelStringMap(t *testing.T, conn *pgx.Conn, typename string) { input := map[string]string{"key": "value"} var output map[string]string err := conn.QueryRow(context.Background(), "select $1::"+typename, input).Scan(&output) if err != nil { t.Errorf("%s: QueryRow Scan failed: %v", typename, err) return } if !reflect.DeepEqual(input, output) { t.Errorf("%s: Did not transcode map[string]string successfully: %v is not %v", typename, input, output) return } } func testJSONNestedMap(t *testing.T, conn *pgx.Conn, typename string) { input := map[string]any{ "name": "Uncanny", "stats": map[string]any{"hp": float64(107), "maxhp": float64(150)}, "inventory": []any{"phone", "key"}, } var output map[string]any err := conn.QueryRow(context.Background(), "select $1::"+typename, input).Scan(&output) if err != nil { t.Errorf("%s: QueryRow Scan failed: %v", typename, err) return } if !reflect.DeepEqual(input, output) { t.Errorf("%s: Did not transcode map[string]any successfully: %v is not %v", typename, input, output) return } } func testJSONStringArray(t *testing.T, conn *pgx.Conn, typename string) { input := []string{"foo", "bar", "baz"} var output []string err := conn.QueryRow(context.Background(), "select $1::"+typename, input).Scan(&output) if err != nil { t.Errorf("%s: QueryRow Scan failed: %v", typename, err) } if !reflect.DeepEqual(input, output) { t.Errorf("%s: Did not transcode []string successfully: %v is not %v", typename, input, output) } } func testJSONInt64Array(t *testing.T, conn *pgx.Conn, typename string) { input := []int64{1, 2, 234432} var output []int64 err := conn.QueryRow(context.Background(), "select $1::"+typename, input).Scan(&output) if err != nil { t.Errorf("%s: QueryRow Scan failed: %v", typename, err) } if !reflect.DeepEqual(input, output) { t.Errorf("%s: Did not transcode []int64 successfully: %v is not %v", typename, input, output) } } func testJSONInt16ArrayFailureDueToOverflow(t *testing.T, conn *pgx.Conn, typename string) { input := []int{1, 2, 234432} var output []int16 err := conn.QueryRow(context.Background(), "select $1::"+typename, input).Scan(&output) fieldName := typename if conn.PgConn().ParameterStatus("crdb_version") != "" && typename == "json" { fieldName = "jsonb" // Seems like CockroachDB treats json as jsonb. } expectedMessage := fmt.Sprintf("can't scan into dest[0] (col: %s): json: cannot unmarshal number 234432 into Go value of type int16", fieldName) if err == nil || err.Error() != expectedMessage { t.Errorf("%s: Expected *json.UnmarshalTypeError, but got %v", typename, err) } } func testJSONStruct(t *testing.T, conn *pgx.Conn, typename string) { type person struct { Name string `json:"name"` Age int `json:"age"` } input := person{ Name: "John", Age: 42, } var output person err := conn.QueryRow(context.Background(), "select $1::"+typename, input).Scan(&output) if err != nil { t.Errorf("%s: QueryRow Scan failed: %v", typename, err) } if !reflect.DeepEqual(input, output) { t.Errorf("%s: Did not transcode struct successfully: %v is not %v", typename, input, output) } } func mustParseCIDR(t testing.TB, s string) *net.IPNet { _, ipnet, err := net.ParseCIDR(s) if err != nil { t.Fatal(err) } return ipnet } func TestInetCIDRTranscodeIPNet(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { tests := []struct { sql string value *net.IPNet }{ {"select $1::inet", mustParseCIDR(t, "0.0.0.0/32")}, {"select $1::inet", mustParseCIDR(t, "127.0.0.1/32")}, {"select $1::inet", mustParseCIDR(t, "12.34.56.0/32")}, {"select $1::inet", mustParseCIDR(t, "192.168.1.0/24")}, {"select $1::inet", mustParseCIDR(t, "255.0.0.0/8")}, {"select $1::inet", mustParseCIDR(t, "255.255.255.255/32")}, {"select $1::inet", mustParseCIDR(t, "::/128")}, {"select $1::inet", mustParseCIDR(t, "::/0")}, {"select $1::inet", mustParseCIDR(t, "::1/128")}, {"select $1::inet", mustParseCIDR(t, "2607:f8b0:4009:80b::200e/128")}, {"select $1::cidr", mustParseCIDR(t, "0.0.0.0/32")}, {"select $1::cidr", mustParseCIDR(t, "127.0.0.1/32")}, {"select $1::cidr", mustParseCIDR(t, "12.34.56.0/32")}, {"select $1::cidr", mustParseCIDR(t, "192.168.1.0/24")}, {"select $1::cidr", mustParseCIDR(t, "255.0.0.0/8")}, {"select $1::cidr", mustParseCIDR(t, "255.255.255.255/32")}, {"select $1::cidr", mustParseCIDR(t, "::/128")}, {"select $1::cidr", mustParseCIDR(t, "::/0")}, {"select $1::cidr", mustParseCIDR(t, "::1/128")}, {"select $1::cidr", mustParseCIDR(t, "2607:f8b0:4009:80b::200e/128")}, } for i, tt := range tests { if conn.PgConn().ParameterStatus("crdb_version") != "" && strings.Contains(tt.sql, "cidr") { t.Log("Server does not support cidr type (https://github.com/cockroachdb/cockroach/issues/18846)") continue } var actual net.IPNet err := conn.QueryRow(context.Background(), tt.sql, tt.value).Scan(&actual) if err != nil { t.Errorf("%d. Unexpected failure: %v (sql -> %v, value -> %v)", i, err, tt.sql, tt.value) continue } if actual.String() != tt.value.String() { t.Errorf("%d. Expected %v, got %v (sql -> %v)", i, tt.value, actual, tt.sql) } } }) } func TestInetCIDRTranscodeIP(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { tests := []struct { sql string value net.IP }{ {"select $1::inet", net.ParseIP("0.0.0.0")}, {"select $1::inet", net.ParseIP("127.0.0.1")}, {"select $1::inet", net.ParseIP("12.34.56.0")}, {"select $1::inet", net.ParseIP("255.255.255.255")}, {"select $1::inet", net.ParseIP("::1")}, {"select $1::inet", net.ParseIP("2607:f8b0:4009:80b::200e")}, {"select $1::cidr", net.ParseIP("0.0.0.0")}, {"select $1::cidr", net.ParseIP("127.0.0.1")}, {"select $1::cidr", net.ParseIP("12.34.56.0")}, {"select $1::cidr", net.ParseIP("255.255.255.255")}, {"select $1::cidr", net.ParseIP("::1")}, {"select $1::cidr", net.ParseIP("2607:f8b0:4009:80b::200e")}, } for i, tt := range tests { if conn.PgConn().ParameterStatus("crdb_version") != "" && strings.Contains(tt.sql, "cidr") { t.Log("Server does not support cidr type (https://github.com/cockroachdb/cockroach/issues/18846)") continue } var actual net.IP err := conn.QueryRow(context.Background(), tt.sql, tt.value).Scan(&actual) if err != nil { t.Errorf("%d. Unexpected failure: %v (sql -> %v, value -> %v)", i, err, tt.sql, tt.value) continue } if !actual.Equal(tt.value) { t.Errorf("%d. Expected %v, got %v (sql -> %v)", i, tt.value, actual, tt.sql) } ensureConnValid(t, conn) } failTests := []struct { sql string value *net.IPNet }{ {"select $1::inet", mustParseCIDR(t, "192.168.1.0/24")}, {"select $1::cidr", mustParseCIDR(t, "192.168.1.0/24")}, } for i, tt := range failTests { var actual net.IP err := conn.QueryRow(context.Background(), tt.sql, tt.value).Scan(&actual) if err == nil { t.Errorf("%d. Expected failure but got none", i) continue } ensureConnValid(t, conn) } }) } func TestInetCIDRArrayTranscodeIPNet(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { tests := []struct { sql string value []*net.IPNet }{ { "select $1::inet[]", []*net.IPNet{ mustParseCIDR(t, "0.0.0.0/32"), mustParseCIDR(t, "127.0.0.1/32"), mustParseCIDR(t, "12.34.56.0/32"), mustParseCIDR(t, "192.168.1.0/24"), mustParseCIDR(t, "255.0.0.0/8"), mustParseCIDR(t, "255.255.255.255/32"), mustParseCIDR(t, "::/128"), mustParseCIDR(t, "::/0"), mustParseCIDR(t, "::1/128"), mustParseCIDR(t, "2607:f8b0:4009:80b::200e/128"), }, }, { "select $1::cidr[]", []*net.IPNet{ mustParseCIDR(t, "0.0.0.0/32"), mustParseCIDR(t, "127.0.0.1/32"), mustParseCIDR(t, "12.34.56.0/32"), mustParseCIDR(t, "192.168.1.0/24"), mustParseCIDR(t, "255.0.0.0/8"), mustParseCIDR(t, "255.255.255.255/32"), mustParseCIDR(t, "::/128"), mustParseCIDR(t, "::/0"), mustParseCIDR(t, "::1/128"), mustParseCIDR(t, "2607:f8b0:4009:80b::200e/128"), }, }, } for i, tt := range tests { if conn.PgConn().ParameterStatus("crdb_version") != "" && strings.Contains(tt.sql, "cidr") { t.Log("Server does not support cidr type (https://github.com/cockroachdb/cockroach/issues/18846)") continue } var actual []*net.IPNet err := conn.QueryRow(context.Background(), tt.sql, tt.value).Scan(&actual) if err != nil { t.Errorf("%d. Unexpected failure: %v (sql -> %v, value -> %v)", i, err, tt.sql, tt.value) continue } if !reflect.DeepEqual(actual, tt.value) { t.Errorf("%d. Expected %v, got %v (sql -> %v)", i, tt.value, actual, tt.sql) } ensureConnValid(t, conn) } }) } func TestInetCIDRArrayTranscodeIP(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { tests := []struct { sql string value []net.IP }{ { "select $1::inet[]", []net.IP{ net.ParseIP("0.0.0.0"), net.ParseIP("127.0.0.1"), net.ParseIP("12.34.56.0"), net.ParseIP("255.255.255.255"), net.ParseIP("2607:f8b0:4009:80b::200e"), }, }, { "select $1::cidr[]", []net.IP{ net.ParseIP("0.0.0.0"), net.ParseIP("127.0.0.1"), net.ParseIP("12.34.56.0"), net.ParseIP("255.255.255.255"), net.ParseIP("2607:f8b0:4009:80b::200e"), }, }, } for i, tt := range tests { if conn.PgConn().ParameterStatus("crdb_version") != "" && strings.Contains(tt.sql, "cidr") { t.Log("Server does not support cidr type (https://github.com/cockroachdb/cockroach/issues/18846)") continue } var actual []net.IP err := conn.QueryRow(context.Background(), tt.sql, tt.value).Scan(&actual) if err != nil { t.Errorf("%d. Unexpected failure: %v (sql -> %v, value -> %v)", i, err, tt.sql, tt.value) continue } assert.Equal(t, len(tt.value), len(actual), "%d", i) for j := range actual { assert.True(t, actual[j].Equal(tt.value[j]), "%d", i) } ensureConnValid(t, conn) } failTests := []struct { sql string value []*net.IPNet }{ { "select $1::inet[]", []*net.IPNet{ mustParseCIDR(t, "12.34.56.0/32"), mustParseCIDR(t, "192.168.1.0/24"), }, }, { "select $1::cidr[]", []*net.IPNet{ mustParseCIDR(t, "12.34.56.0/32"), mustParseCIDR(t, "192.168.1.0/24"), }, }, } for i, tt := range failTests { var actual []net.IP err := conn.QueryRow(context.Background(), tt.sql, tt.value).Scan(&actual) if err == nil { t.Errorf("%d. Expected failure but got none", i) continue } ensureConnValid(t, conn) } }) } func TestInetCIDRTranscodeWithJustIP(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { tests := []struct { sql string value string }{ {"select $1::inet", "0.0.0.0/32"}, {"select $1::inet", "127.0.0.1/32"}, {"select $1::inet", "12.34.56.0/32"}, {"select $1::inet", "255.255.255.255/32"}, {"select $1::inet", "::/128"}, {"select $1::inet", "2607:f8b0:4009:80b::200e/128"}, {"select $1::cidr", "0.0.0.0/32"}, {"select $1::cidr", "127.0.0.1/32"}, {"select $1::cidr", "12.34.56.0/32"}, {"select $1::cidr", "255.255.255.255/32"}, {"select $1::cidr", "::/128"}, {"select $1::cidr", "2607:f8b0:4009:80b::200e/128"}, } for i, tt := range tests { if conn.PgConn().ParameterStatus("crdb_version") != "" && strings.Contains(tt.sql, "cidr") { t.Log("Server does not support cidr type (https://github.com/cockroachdb/cockroach/issues/18846)") continue } expected := mustParseCIDR(t, tt.value) var actual net.IPNet err := conn.QueryRow(context.Background(), tt.sql, expected.IP).Scan(&actual) if err != nil { t.Errorf("%d. Unexpected failure: %v (sql -> %v, value -> %v)", i, err, tt.sql, tt.value) continue } if actual.String() != expected.String() { t.Errorf("%d. Expected %v, got %v (sql -> %v)", i, tt.value, actual, tt.sql) } ensureConnValid(t, conn) } }) } func TestArrayDecoding(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { tests := []struct { sql string query any scan any assert func(testing.TB, any, any) }{ { "select $1::bool[]", []bool{true, false, true}, &[]bool{}, func(t testing.TB, query, scan any) { if !reflect.DeepEqual(query, *(scan.(*[]bool))) { t.Errorf("failed to encode bool[]") } }, }, { "select $1::smallint[]", []int16{2, 4, 484, 32767}, &[]int16{}, func(t testing.TB, query, scan any) { if !reflect.DeepEqual(query, *(scan.(*[]int16))) { t.Errorf("failed to encode smallint[]") } }, }, { "select $1::smallint[]", []uint16{2, 4, 484, 32767}, &[]uint16{}, func(t testing.TB, query, scan any) { if !reflect.DeepEqual(query, *(scan.(*[]uint16))) { t.Errorf("failed to encode smallint[]") } }, }, { "select $1::int[]", []int32{2, 4, 484}, &[]int32{}, func(t testing.TB, query, scan any) { if !reflect.DeepEqual(query, *(scan.(*[]int32))) { t.Errorf("failed to encode int[]") } }, }, { "select $1::int[]", []uint32{2, 4, 484, 2147483647}, &[]uint32{}, func(t testing.TB, query, scan any) { if !reflect.DeepEqual(query, *(scan.(*[]uint32))) { t.Errorf("failed to encode int[]") } }, }, { "select $1::bigint[]", []int64{2, 4, 484, 9223372036854775807}, &[]int64{}, func(t testing.TB, query, scan any) { if !reflect.DeepEqual(query, *(scan.(*[]int64))) { t.Errorf("failed to encode bigint[]") } }, }, { "select $1::bigint[]", []uint64{2, 4, 484, 9223372036854775807}, &[]uint64{}, func(t testing.TB, query, scan any) { if !reflect.DeepEqual(query, *(scan.(*[]uint64))) { t.Errorf("failed to encode bigint[]") } }, }, { "select $1::text[]", []string{"it's", "over", "9000!"}, &[]string{}, func(t testing.TB, query, scan any) { if !reflect.DeepEqual(query, *(scan.(*[]string))) { t.Errorf("failed to encode text[]") } }, }, { "select $1::timestamptz[]", []time.Time{time.Unix(323232, 0), time.Unix(3239949334, 0o0)}, &[]time.Time{}, func(t testing.TB, query, scan any) { queryTimeSlice := query.([]time.Time) scanTimeSlice := *(scan.(*[]time.Time)) require.Equal(t, len(queryTimeSlice), len(scanTimeSlice)) for i := range queryTimeSlice { assert.Truef(t, queryTimeSlice[i].Equal(scanTimeSlice[i]), "%d", i) } }, }, { "select $1::bytea[]", [][]byte{{0, 1, 2, 3}, {4, 5, 6, 7}}, &[][]byte{}, func(t testing.TB, query, scan any) { queryBytesSliceSlice := query.([][]byte) scanBytesSliceSlice := *(scan.(*[][]byte)) if len(queryBytesSliceSlice) != len(scanBytesSliceSlice) { t.Errorf("failed to encode byte[][] to bytea[]: expected %d to equal %d", len(queryBytesSliceSlice), len(scanBytesSliceSlice)) } for i := range queryBytesSliceSlice { qb := queryBytesSliceSlice[i] sb := scanBytesSliceSlice[i] if !bytes.Equal(qb, sb) { t.Errorf("failed to encode byte[][] to bytea[]: expected %v to equal %v", qb, sb) } } }, }, } for i, tt := range tests { err := conn.QueryRow(context.Background(), tt.sql, tt.query).Scan(tt.scan) if err != nil { t.Errorf(`%d. error reading array: %v`, i, err) continue } tt.assert(t, tt.query, tt.scan) ensureConnValid(t, conn) } }) } func TestEmptyArrayDecoding(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { var val []string err := conn.QueryRow(context.Background(), "select array[]::text[]").Scan(&val) if err != nil { t.Errorf(`error reading array: %v`, err) } if len(val) != 0 { t.Errorf("Expected 0 values, got %d", len(val)) } var n, m int32 err = conn.QueryRow(context.Background(), "select 1::integer, array[]::text[], 42::integer").Scan(&n, &val, &m) if err != nil { t.Errorf(`error reading array: %v`, err) } if len(val) != 0 { t.Errorf("Expected 0 values, got %d", len(val)) } if n != 1 { t.Errorf("Expected n to be 1, but it was %d", n) } if m != 42 { t.Errorf("Expected n to be 42, but it was %d", n) } rows, err := conn.Query(context.Background(), "select 1::integer, array['test']::text[] union select 2::integer, array[]::text[] union select 3::integer, array['test']::text[]") if err != nil { t.Errorf(`error retrieving rows with array: %v`, err) } defer rows.Close() for rows.Next() { err = rows.Scan(&n, &val) if err != nil { t.Errorf(`error reading array: %v`, err) } } }) } func TestPointerPointer(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { pgxtest.SkipCockroachDB(t, conn, "Server auto converts ints to bigint and test relies on exact types") type allTypes struct { s *string i16 *int16 i32 *int32 i64 *int64 f32 *float32 f64 *float64 b *bool t *time.Time } var actual, zero, expected allTypes { s := "foo" expected.s = &s i16 := int16(1) expected.i16 = &i16 i32 := int32(1) expected.i32 = &i32 i64 := int64(1) expected.i64 = &i64 f32 := float32(1.23) expected.f32 = &f32 f64 := float64(1.23) expected.f64 = &f64 b := true expected.b = &b t := time.Unix(123, 5000) expected.t = &t } tests := []struct { sql string queryArgs []any scanArgs []any expected allTypes }{ {"select $1::text", []any{expected.s}, []any{&actual.s}, allTypes{s: expected.s}}, {"select $1::text", []any{zero.s}, []any{&actual.s}, allTypes{}}, {"select $1::int2", []any{expected.i16}, []any{&actual.i16}, allTypes{i16: expected.i16}}, {"select $1::int2", []any{zero.i16}, []any{&actual.i16}, allTypes{}}, {"select $1::int4", []any{expected.i32}, []any{&actual.i32}, allTypes{i32: expected.i32}}, {"select $1::int4", []any{zero.i32}, []any{&actual.i32}, allTypes{}}, {"select $1::int8", []any{expected.i64}, []any{&actual.i64}, allTypes{i64: expected.i64}}, {"select $1::int8", []any{zero.i64}, []any{&actual.i64}, allTypes{}}, {"select $1::float4", []any{expected.f32}, []any{&actual.f32}, allTypes{f32: expected.f32}}, {"select $1::float4", []any{zero.f32}, []any{&actual.f32}, allTypes{}}, {"select $1::float8", []any{expected.f64}, []any{&actual.f64}, allTypes{f64: expected.f64}}, {"select $1::float8", []any{zero.f64}, []any{&actual.f64}, allTypes{}}, {"select $1::bool", []any{expected.b}, []any{&actual.b}, allTypes{b: expected.b}}, {"select $1::bool", []any{zero.b}, []any{&actual.b}, allTypes{}}, {"select $1::timestamptz", []any{expected.t}, []any{&actual.t}, allTypes{t: expected.t}}, {"select $1::timestamptz", []any{zero.t}, []any{&actual.t}, allTypes{}}, } for i, tt := range tests { actual = zero err := conn.QueryRow(context.Background(), tt.sql, tt.queryArgs...).Scan(tt.scanArgs...) if err != nil { t.Errorf("%d. Unexpected failure: %v (sql -> %v, queryArgs -> %v)", i, err, tt.sql, tt.queryArgs) } assert.Equal(t, tt.expected.s, actual.s) assert.Equal(t, tt.expected.i16, actual.i16) assert.Equal(t, tt.expected.i32, actual.i32) assert.Equal(t, tt.expected.i64, actual.i64) assert.Equal(t, tt.expected.f32, actual.f32) assert.Equal(t, tt.expected.f64, actual.f64) assert.Equal(t, tt.expected.b, actual.b) if tt.expected.t != nil || actual.t != nil { assert.True(t, tt.expected.t.Equal(*actual.t)) } ensureConnValid(t, conn) } }) } func TestPointerPointerNonZero(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { f := "foo" dest := &f err := conn.QueryRow(context.Background(), "select $1::text", nil).Scan(&dest) if err != nil { t.Errorf("Unexpected failure scanning: %v", err) } if dest != nil { t.Errorf("Expected dest to be nil, got %#v", dest) } }) } func TestEncodeTypeRename(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { type _int int inInt := _int(1) var outInt _int type _int8 int8 inInt8 := _int8(2) var outInt8 _int8 type _int16 int16 inInt16 := _int16(3) var outInt16 _int16 type _int32 int32 inInt32 := _int32(4) var outInt32 _int32 type _int64 int64 inInt64 := _int64(5) var outInt64 _int64 type _uint uint inUint := _uint(6) var outUint _uint type _uint8 uint8 inUint8 := _uint8(7) var outUint8 _uint8 type _uint16 uint16 inUint16 := _uint16(8) var outUint16 _uint16 type _uint32 uint32 inUint32 := _uint32(9) var outUint32 _uint32 type _uint64 uint64 inUint64 := _uint64(10) var outUint64 _uint64 type _string string inString := _string("foo") var outString _string type _bool bool inBool := _bool(true) var outBool _bool // pgx.QueryExecModeExec requires all types to be registered. conn.TypeMap().RegisterDefaultPgType(inInt, "int8") conn.TypeMap().RegisterDefaultPgType(inInt8, "int8") conn.TypeMap().RegisterDefaultPgType(inInt16, "int8") conn.TypeMap().RegisterDefaultPgType(inInt32, "int8") conn.TypeMap().RegisterDefaultPgType(inInt64, "int8") conn.TypeMap().RegisterDefaultPgType(inUint, "int8") conn.TypeMap().RegisterDefaultPgType(inUint8, "int8") conn.TypeMap().RegisterDefaultPgType(inUint16, "int8") conn.TypeMap().RegisterDefaultPgType(inUint32, "int8") conn.TypeMap().RegisterDefaultPgType(inUint64, "int8") conn.TypeMap().RegisterDefaultPgType(inString, "text") conn.TypeMap().RegisterDefaultPgType(inBool, "bool") err := conn.QueryRow(context.Background(), "select $1::int, $2::int, $3::int2, $4::int4, $5::int8, $6::int, $7::int, $8::int, $9::int, $10::int, $11::text, $12::bool", inInt, inInt8, inInt16, inInt32, inInt64, inUint, inUint8, inUint16, inUint32, inUint64, inString, inBool, ).Scan(&outInt, &outInt8, &outInt16, &outInt32, &outInt64, &outUint, &outUint8, &outUint16, &outUint32, &outUint64, &outString, &outBool) if err != nil { t.Fatalf("Failed with type rename: %v", err) } if inInt != outInt { t.Errorf("int rename: expected %v, got %v", inInt, outInt) } if inInt8 != outInt8 { t.Errorf("int8 rename: expected %v, got %v", inInt8, outInt8) } if inInt16 != outInt16 { t.Errorf("int16 rename: expected %v, got %v", inInt16, outInt16) } if inInt32 != outInt32 { t.Errorf("int32 rename: expected %v, got %v", inInt32, outInt32) } if inInt64 != outInt64 { t.Errorf("int64 rename: expected %v, got %v", inInt64, outInt64) } if inUint != outUint { t.Errorf("uint rename: expected %v, got %v", inUint, outUint) } if inUint8 != outUint8 { t.Errorf("uint8 rename: expected %v, got %v", inUint8, outUint8) } if inUint16 != outUint16 { t.Errorf("uint16 rename: expected %v, got %v", inUint16, outUint16) } if inUint32 != outUint32 { t.Errorf("uint32 rename: expected %v, got %v", inUint32, outUint32) } if inUint64 != outUint64 { t.Errorf("uint64 rename: expected %v, got %v", inUint64, outUint64) } if inString != outString { t.Errorf("string rename: expected %v, got %v", inString, outString) } if inBool != outBool { t.Errorf("bool rename: expected %v, got %v", inBool, outBool) } }) } // func TestRowDecodeBinary(t *testing.T) { // t.Parallel() // conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) // defer closeConn(t, conn) // tests := []struct { // sql string // expected []any // }{ // { // "select row(1, 'cat', '2015-01-01 08:12:42-00'::timestamptz)", // []any{ // int32(1), // "cat", // time.Date(2015, 1, 1, 8, 12, 42, 0, time.UTC).Local(), // }, // }, // { // "select row(100.0::float, 1.09::float)", // []any{ // float64(100), // float64(1.09), // }, // }, // } // for i, tt := range tests { // var actual []any // err := conn.QueryRow(context.Background(), tt.sql).Scan(&actual) // if err != nil { // t.Errorf("%d. Unexpected failure: %v (sql -> %v)", i, err, tt.sql) // continue // } // for j := range tt.expected { // assert.EqualValuesf(t, tt.expected[j], actual[j], "%d. [%d]", i, j) // } // ensureConnValid(t, conn) // } // } // https://github.com/jackc/pgx/issues/810 func TestRowsScanNilThenScanValue(t *testing.T) { t.Parallel() ctx, cancel := context.WithTimeout(context.Background(), 120*time.Second) defer cancel() pgxtest.RunWithQueryExecModes(ctx, t, defaultConnTestRunner, nil, func(ctx context.Context, t testing.TB, conn *pgx.Conn) { sql := `select null as a, null as b union select 1, 2 order by a nulls first ` rows, err := conn.Query(context.Background(), sql) require.NoError(t, err) require.True(t, rows.Next()) err = rows.Scan(nil, nil) require.NoError(t, err) require.True(t, rows.Next()) var a int var b int err = rows.Scan(&a, &b) require.NoError(t, err) require.EqualValues(t, 1, a) require.EqualValues(t, 2, b) rows.Close() require.NoError(t, rows.Err()) }) } func TestScanIntoByteSlice(t *testing.T) { t.Parallel() conn := mustConnectString(t, os.Getenv("PGX_TEST_DATABASE")) defer closeConn(t, conn) // Success cases for _, tt := range []struct { name string sql string resultFormatCode int16 output []byte }{ {"int - text", "select 42", pgx.TextFormatCode, []byte("42")}, {"int - binary", "select 42", pgx.BinaryFormatCode, []byte("42")}, {"text - text", "select 'hi'", pgx.TextFormatCode, []byte("hi")}, {"text - binary", "select 'hi'", pgx.BinaryFormatCode, []byte("hi")}, {"json - text", "select '{}'::json", pgx.TextFormatCode, []byte("{}")}, {"json - binary", "select '{}'::json", pgx.BinaryFormatCode, []byte("{}")}, {"jsonb - text", "select '{}'::jsonb", pgx.TextFormatCode, []byte("{}")}, {"jsonb - binary", "select '{}'::jsonb", pgx.BinaryFormatCode, []byte("{}")}, } { t.Run(tt.name, func(t *testing.T) { var buf []byte err := conn.QueryRow(context.Background(), tt.sql, pgx.QueryResultFormats{tt.resultFormatCode}).Scan(&buf) require.NoError(t, err) require.Equal(t, tt.output, buf) }) } }